Nomenclature Strain ID Strain/Stock Repository State Synonyms Type Allele ID Allele Symbol Allele Name Gene ID Gene Symbol Gene Name URL ? EM:11902 ZranG11Del EMMA sperm mutant strain MGI:106441 Zranb1 zinc finger, RAN-binding domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11902 ? EM:13084 Zic1Gln389* EMMA sperm mutant strain Zic1 Zic1 MGI:106683 Zic1 zinc finger protein of the cerebellum 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13084 ? EM:08917 Zfp507V26AMhda EMMA sperm mutant strain 77T->C 77T->C MGI:1916378 Zfp507 zinc finger protein 507 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8917 ? EM:13226 Wistar Kyoto rat NOX4KO EMMA embryo mutant strain Deletion in the NOX4 gene Deletion in the NOX4 gene MGI:1354184 Nox4 NADPH oxidase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13226 - EM:13250 Vps34-kinase dead EMMA embryo mutant strain MGI:6115471 Pik3c3 targeted mutation 1.1, TaconicArtemis MGI:2445019 Pik3c3 phosphatidylinositol 3-kinase catalytic subunit type 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13250 ? EM:13067 Trp73fl/fl (Trp73 flox/flox) EMMA sperm mutant strain Trp73-floxed Trp73-floxed MGI:1336991 Trp73 transformation related protein 73 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13067 ? EM:13068 Trp73D13/D13 (Trp73delta13) EMMA sperm mutant strain Trp73-delE13 Trp73-delE13 MGI:1336991 Trp73 transformation related protein 73 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13068 ? EM:14792 TREX1 T303P EMMA sperm mutant strain D18N D18N MGI:1328317 Trex1 three prime repair exonuclease 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14792 ? EM:11920 tidflox/KD-UMCM line 5 EMMA sperm unclassified Dnaja3 Dnaja3 MGI:1933786 Dnaja3 DnaJ heat shock protein family (Hsp40) member A3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11920 ? EM:11922 tidflox-neo/KD-UMCM/tid+ line 7 EMMA sperm unclassified Dnaja3 Dnaja3 MGI:1933786 Dnaja3 DnaJ heat shock protein family (Hsp40) member A3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11922 - EM:13465 TgVegfr3 EMMA embryo mutant strain Tg(Vegfr3) Tg(Vegfr3) Tg(Vegfr3) Tg(Vegfr3) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13465 - EM:13465 TgVegfr3 EMMA sperm mutant strain Tg(Vegfr3) Tg(Vegfr3) Tg(Vegfr3) Tg(Vegfr3) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13465 ? EM:13463 TgSHANK2A(R462X) EMMA sperm mutant strain Tg(tet0nlacZ-SHANK2A(R462X))Rsp Tg(tet0nlacZ-SHANK2A(R462X))Rsp Tg(tet0nlacZ-SHANK2A(R462X))Rsp Tg(tet0nlacZ-SHANK2A(R462X))Rsp https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13463 ? EM:13462 TgSHANK2A EMMA sperm mutant strain Tg(tet0nlacZ-SHANK2A_WT)Rsp Tg(tet0nlacZ-SHANK2A_WT)Rsp Tg(tet0nlacZ-SHANK2A_WT)Rsp Tg(tet0nlacZ-SHANK2A_WT)Rsp https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13462 - EM:14973 Tg(Zp3-creERT2)76.12.Ics EMMA embryo unclassified Tg(Zp3-creERT2)76.12.Ics Tg(Zp3-creERT2)76.12.Ics Tg(Zp3-creERT2)76.12.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14973 - EM:14972 Tg(UCP1-creERT2)56.11.Ics EMMA embryo unclassified Tg(UCP1-creERT2)56.11.Ics Tg(UCP1-creERT2)56.11.Ics Tg(UCP1-creERT2)56.11.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14972 - EM:14971 Tg(Tnni2-creERT2)42.16.Ics EMMA embryo unclassified Tg(Tnni2-creERT2)42.16.Ics Tg(Tnni2-creERT2)42.16.Ics Tg(Tnni2-creERT2)42.16.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14971 ? EM:12397 Tg(T-cre)1Gos/Biat EMMA sperm mutant strain MGI:3811072 Tg(T-cre)1Gos transgene insertion 1, Achim Gossler MGI:3811067 Tg(T-cre)1Gos transgene insertion 1, Achim Gossler https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12397 - EM:14970 Tg(Sox2-CreERT2)194.34.Ics EMMA embryo unclassified Tg(Sox2-CreERT2)194.34.Ics Tg(Sox2-CreERT2)194.34.Ics Tg(Sox2-CreERT2)194.34.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14970 - EM:14969 Tg(Slc6a3-creERT2)69.41.Ics EMMA embryo unclassified Tg(Slc6a3-creERT2)69.41.Ics Tg(Slc6a3-creERT2)69.41.Ics Tg(Slc6a3-creERT2)69.41.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14969 - EM:14968 Tg(Ppm1a CreERT2)43.3.Ics EMMA embryo unclassified Tg(Ppm1a CreERT2)43.3.Ics Tg(Ppm1a CreERT2)43.3.Ics Tg(Ppm1a CreERT2)43.3.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14968 - EM:14967 Tg(Pgk2-creERT2)35.12.Ics EMMA embryo unclassified Tg(Pgk2-creERT2)35.12.Ics Tg(Pgk2-creERT2)35.12.Ics Tg(Pgk2-creERT2)35.12.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14967 - EM:14966 Tg(Pf4-creERT2)3.21.Ics EMMA embryo unclassified Tg(Pf4-creERT2)3.21.Ics Tg(Pf4-creERT2)3.21.Ics Tg(Pf4-creERT2)3.21.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14966 - EM:14965 Tg(Pet1-creERT2)21.4.Ics EMMA embryo unclassified Tg(Pet1-creERT2)21.4.Ics Tg(Pet1-creERT2)21.4.Ics Tg(Pet1-creERT2)21.4.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14965 - EM:14964 Tg(Pcp2-creERT2)17.8.Ics EMMA embryo unclassified Tg(Pcp2-creERT2)17.8.Ics Tg(Pcp2-creERT2)17.8.Ics Tg(Pcp2-creERT2)17.8.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14964 - EM:14963 Tg(Nes-creERT2)62.33.Ics EMMA embryo unclassified Tg(Nes-creERT2)62.33.Ics Tg(Nes-creERT2)62.33.Ics Tg(Nes-creERT2)62.33.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14963 - EM:14962 Tg(Nefl-creERT2)45.3.Ics EMMA embryo unclassified Tg(Nefl-creERT2)45.3.Ics Tg(Nefl-creERT2)45.3.Ics Tg(Nefl-creERT2)45.3.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14962 - EM:14961 Tg(Myh6-creERT2)12.8.Ics EMMA embryo unclassified Tg(Myh6-creERT2)12.8.Ics Tg(Myh6-creERT2)12.8.Ics Tg(Myh6-creERT2)12.8.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14961 - EM:14960 Tg(Lyzs-creERT2)26.19.Ics EMMA embryo unclassified Tg(Lyzs-creERT2)26.19.Ics Tg(Lyzs-creERT2)26.19.Ics Tg(Lyzs-creERT2)26.19.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14960 - EM:14959 Tg(Lck-creERT2)51.17.Ics EMMA embryo unclassified Tg(Lck-creERT2)51.17.Ics Tg(Lck-creERT2)51.17.Ics Tg(Lck-creERT2)51.17.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14959 - EM:14958 Tg(KRT5-creERT2)43.10.Ics EMMA embryo unclassified Tg(KRT5-creERT2)43.10.Ics Tg(KRT5-creERT2)43.10.Ics Tg(KRT5-creERT2)43.10.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14958 - EM:14957 Tg(Krt14-creERT2)2.11.Ics EMMA embryo unclassified Tg(Krt14-creERT2)2.11.Ics Tg(Krt14-creERT2)2.11.Ics Tg(Krt14-creERT2)2.11.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14957 - EM:14956 Tg(Krt10-creERT2)39.28.Ics EMMA embryo unclassified Tg(Krt10-creERT2)39.28.Ics Tg(Krt10-creERT2)39.28.Ics Tg(Krt10-creERT2)39.28.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14956 - EM:14955 Tg(Kap-CreERT2)64.9.Ics EMMA embryo unclassified Tg(Kap-CreERT2)64.9.Ics Tg(Kap-CreERT2)64.9.Ics Tg(Kap-CreERT2)64.9.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14955 - EM:14954 Tg(Ins1-CreERT2)16.7.Ics EMMA embryo unclassified Tg(Ins1-CreERT2)16.7.Ics Tg(Ins1-CreERT2)16.7.Ics Tg(Ins1-CreERT2)16.7.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14954 - EM:14953 Tg(Gp1ba-creERT2)28.21.Ics EMMA embryo unclassified Tg(Gp1ba-creERT2)28.21.Ics Tg(Gp1ba-creERT2)28.21.Ics Tg(Gp1ba-creERT2)28.21.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14953 - EM:14952 Tg(Ghrl-creERT2)107.2.Ics EMMA embryo unclassified Tg(Ghrl-creERT2)107.2.Ics Tg(Ghrl-creERT2)107.2.Ics Tg(Ghrl-creERT2)107.2.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14952 - EM:14951 Tg(Gcg-creERT2)151.3.Ics EMMA embryo unclassified Tg(Gcg-creERT2)151.3.Ics Tg(Gcg-creERT2)151.3.Ics Tg(Gcg-creERT2)151.3.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14951 - EM:14950 Tg(FABP4-creERT2)24.12/13.Ics EMMA embryo unclassified Tg(FABP4-creERT2)24.12/13.Ics Tg(FABP4-creERT2)24.12/13.Ics Tg(FABP4-creERT2)24.12/13.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14950 - EM:14949 Tg(Eno2-creERT2)122.19.Ics EMMA embryo unclassified Tg(Eno2-creERT2)122.19.Ics Tg(Eno2-creERT2)122.19.Ics Tg(Eno2-creERT2)122.19.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14949 - EM:14948 Tg(Dlk1-creERT2)26.10.Ics EMMA embryo unclassified Tg(Dlk1-creERT2)26.10.Ics Tg(Dlk1-creERT2)26.10.Ics Tg(Dlk1-creERT2)26.10.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14948 - EM:14947 Tg(Col1a1-creERT2)6.1.Ics EMMA embryo unclassified Tg(Col1a1-creERT2)6.1.Ics Tg(Col1a1-creERT2)6.1.Ics Tg(Col1a1-creERT2)6.1.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14947 - EM:14946 Tg(Cela1-creERT2)28.3.Ics EMMA embryo unclassified Tg(Cela1-creERT2)28.3.Ics Tg(Cela1-creERT2)28.3.Ics Tg(Cela1-creERT2)28.3.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14946 - EM:14945 Tg(Cd68-creERT2)31.11.Ics EMMA embryo unclassified Tg(Cd68-creERT2)31.11.Ics Tg(Cd68-creERT2)31.11.Ics Tg(Cd68-creERT2)31.11.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14945 - EM:14944 Tg(Cd4-creERT2)6.3/5.Ics EMMA embryo unclassified Tg(Cd4-creERT2)6.3/5.Ics Tg(Cd4-creERT2)6.3/5.Ics Tg(Cd4-creERT2)6.3/5.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14944 - EM:14943 Tg(CD19-creERT2)61.2.Ics EMMA embryo unclassified Tg(CD19-creERT2)61.2.Ics Tg(CD19-creERT2)61.2.Ics Tg(CD19-creERT2)61.2.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14943 - EM:14942 TG(CAMKIIa-creERT2)130.38.Ics EMMA embryo unclassified TG(CAMKIIa-creERT2)130.38.Ics TG(CAMKIIa-creERT2)130.38.Ics TG(CAMKIIa-creERT2)130.38.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14942 - EM:14941 Tg(CamkIIa-creERT2)127.29.Ics EMMA embryo unclassified Tg(CamkIIa-creERT2)127.29.Ics Tg(CamkIIa-creERT2)127.29.Ics Tg(CamkIIa-creERT2)127.29.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14941 - EM:14940 Tg(Bglap1-creERT2)26.3.Ics EMMA embryo unclassified Tg(Bglap1-creERT2)26.3.Ics Tg(Bglap1-creERT2)26.3.Ics Tg(Bglap1-creERT2)26.3.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14940 - EM:14939 Tg(ADIPOQ-creERT2)5.1.Ics EMMA embryo unclassified Tg(ADIPOQ-creERT2)5.1.Ics Tg(ADIPOQ-creERT2)5.1.Ics Tg(ADIPOQ-creERT2)5.1.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14939 - EM:14938 Tg(Acp5-creERT2)11.40.Ics EMMA embryo unclassified Tg(Acp5-creERT2)11.40.Ics Tg(Acp5-creERT2)11.40.Ics Tg(Acp5-creERT2)11.40.Ics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14938 + EM:02207 TFH/H EMMA embryo mutant strain MGI:1856184 T brachyury MGI:98472 T brachyury, T-box transcription factor T https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2207 + EM:02207 TFH/H EMMA embryo mutant strain MGI:1857070 Itpr3 tufted MGI:96624 Itpr3 inositol 1,4,5-triphosphate receptor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2207 ? EM:11139 TetohBCL-2 in FVB/N EMMA sperm mutant strain Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11139 ? EM:11140 TetohBCL-2 in C57BL/6 EMMA sperm mutant strain Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11140 ? EM:13736 Tbx5 K339R cKI EMMA archived mutant strain TBX5 K339R (AAG to AGG) TBX5 K339R (AAG to AGG) MGI:102541 Tbx5 T-box 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13736 ? EM:12616 Tardbp RRM2mut (F210I) DBA EMMA sperm mutant strain MGI:6355454 Tardbp Riken Genomic Sciences Center 2268 MGI:2387629 Tardbp TAR DNA binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12616 ? EM:12614 Tardbp LCDmut (M323K) DBA EMMA sperm mutant strain MGI:6355456 Tardbp Riken Genomic Sciences Center 2223 MGI:2387629 Tardbp TAR DNA binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12614 - EM:12613 Tardbp LCDmut (M323K) B6 EMMA sperm B6J(D2)-Tardbp/RgscH mutant strain MGI:6355456 Tardbp Riken Genomic Sciences Center 2223 MGI:2387629 Tardbp TAR DNA binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12613 ? EM:13074 Talin1 C-mutant EMMA embryo mutant strain Talin1 Talin1 MGI:1099832 Tln1 talin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13074 + EM:01332 SY/HgIeg EMMA embryo Hertwig's syndactylism mutant strain MGI:1856182 sy shaker with syndactylism MGI:98457 sy shaker-with-syndactylism deletion region https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1332 - EM:05790 STOCK Zkscan14/WtsiOrl EMMA sperm mutant strain MGI:4432778 Zkscan14 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914485 Zkscan14 zinc finger with KRAB and SCAN domains 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5790 + EM:14065 STOCK Zfp382/WtsiOulu EMMA embryo mutant strain MGI:4362785 Zfp382 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3588204 Zfp382 zinc finger protein 382 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14065 + EM:14065 STOCK Zfp382/WtsiOulu EMMA sperm mutant strain MGI:4362785 Zfp382 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3588204 Zfp382 zinc finger protein 382 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14065 + EM:11112 STOCK Yod1/H EMMA sperm mutant strain MGI:6473480 Yod1 targeted mutation 1a, National Laboratory Animal Center MGI:2442596 Yod1 YOD1 deubiquitinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11112 + EM:02468 STOCK Xpo4/H EMMA sperm 3E, Xpo4 mutant strain MGI:5490885 Xpo4 gene trap mutation 3E, Katherine A Vallis MGI:1888526 Xpo4 exportin 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2468 + EM:01296 STOCK Whrn/H EMMA embryo wi mutant strain MGI:1857090 Whrn whirler MGI:2682003 Whrn whirlin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1296 + EM:01296 STOCK Whrn/H EMMA sperm wi mutant strain MGI:1857090 Whrn whirler MGI:2682003 Whrn whirlin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1296 + EM:11995 STOCK Vkorc1/H EMMA sperm STOCK Vkorc1/sup>/H, HM_Y139C mutant strain MGI:3605985 Vkorc1 Tyr139Cys MGI:106442 Vkorc1 vitamin K epoxide reductase complex, subunit 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11995 + EM:04326 STOCK Vezt/Vezt/Orl EMMA embryo bi-loxP/null, Vezatin flox5/null mutant strain MGI:5749802 Vezt targeted mutation 1.2, Marie C Simmler MGI:2143698 Vezt vezatin, adherens junctions transmembrane protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4326 + EM:04326 STOCK Vezt/Vezt/Orl EMMA embryo bi-loxP/null, Vezatin flox5/null mutant strain MGI:3618234 Vezt targeted mutation 1.1, Marie C Simmler MGI:2143698 Vezt vezatin, adherens junctions transmembrane protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4326 + EM:10734 STOCK Vegfc/Oulu EMMA embryo CD1.Cg-Vegfc/Oulu mutant strain MGI:3026650 Vegfc targeted mutation 1, Kari Alitalo MGI:109124 Vegfc vascular endothelial growth factor C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10734 + EM:10734 STOCK Vegfc/Oulu EMMA sperm CD1.Cg-Vegfc/Oulu mutant strain MGI:3026650 Vegfc targeted mutation 1, Kari Alitalo MGI:109124 Vegfc vascular endothelial growth factor C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10734 + EM:08030 STOCK Vav2 Vav1/Cnbc EMMA embryo CD1;129-Vav2 Vav1/Cnbc mutant strain MGI:2387822 Vav2 targeted mutation 1, Klaus-Dieter Fischer MGI:102718 Vav2 vav 2 oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8030 + EM:08030 STOCK Vav2 Vav1/Cnbc EMMA embryo CD1;129-Vav2 Vav1/Cnbc mutant strain MGI:2387840 Vav1 targeted mutation 2, Mariano Barbacid MGI:98923 Vav1 vav 1 oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8030 + EM:00392 STOCK Utrn Dmd Tg(Ckm-Dmd*)11956Chmb/H EMMA sperm CVBA 3'/Utrophin+/-/mdx, CVBA mutant stock MGI:2148589 Utrn targeted mutation 1, Kay E Davies MGI:104631 Utrn utrophin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=392 + EM:00392 STOCK Utrn Dmd Tg(Ckm-Dmd*)11956Chmb/H EMMA sperm CVBA 3'/Utrophin+/-/mdx, CVBA mutant stock MGI:5140820 Tg(Ckm-Dmd*)11956Chmb transgene insertion 11956, Jeffrey S Chamberlain MGI:5140819 Tg(Ckm-Dmd*)11956Chmb transgene insertion 11956, Jeffrey S Chamberlain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=392 + EM:00392 STOCK Utrn Dmd Tg(Ckm-Dmd*)11956Chmb/H EMMA sperm CVBA 3'/Utrophin+/-/mdx, CVBA mutant stock MGI:1856328 Dmd X linked muscular dystrophy MGI:94909 Dmd dystrophin, muscular dystrophy https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=392 + EM:13683 STOCK Ulk1/H EMMA live mutant strain MGI:5006775 Ulk1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1270126 Ulk1 unc-51 like kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13683 + EM:04767 STOCK Tyr/Tyr/Cnbc EMMA embryo albino Tyr NMR/Hsd mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4767 + EM:04767 STOCK Tyr/Tyr/Cnbc EMMA embryo albino Tyr NMR/Hsd mutant strain MGI:2153771 Tyr albino deletion 32DSD, Oak Ridge MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4767 + EM:04767 STOCK Tyr/Tyr/Cnbc EMMA sperm albino Tyr NMR/Hsd mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4767 + EM:04767 STOCK Tyr/Tyr/Cnbc EMMA sperm albino Tyr NMR/Hsd mutant strain MGI:2153771 Tyr albino deletion 32DSD, Oak Ridge MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4767 + EM:06054 STOCK Tyr Tg(Tyr)YRT3Lmon/Cnbc EMMA embryo Stock HsdWin:NMRI;B6CBA-Tg(Tyr)YRT3/Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6054 + EM:06054 STOCK Tyr Tg(Tyr)YRT3Lmon/Cnbc EMMA embryo Stock HsdWin:NMRI;B6CBA-Tg(Tyr)YRT3/Lmon mutant strain MGI:6202731 Tg(Tyr)YRT3Lmon transgene insertion YRT3, Lluis Montoliu MGI:6202729 Tg(Tyr)YRT3Lmon transgene insertion YRT3, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6054 + EM:06085 STOCK Tyr Gpr143/Cnbc EMMA embryo HsdWin:NMRI;B6N.129-Gpr143/Cnbc mutant strain MGI:1931862 Gpr143 targeted mutation 1, Barbara Incerti MGI:107193 Gpr143 G protein-coupled receptor 143 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6085 + EM:06085 STOCK Tyr Gpr143/Cnbc EMMA embryo HsdWin:NMRI;B6N.129-Gpr143/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6085 + EM:06085 STOCK Tyr Gpr143/Cnbc EMMA sperm HsdWin:NMRI;B6N.129-Gpr143/Cnbc mutant strain MGI:1931862 Gpr143 targeted mutation 1, Barbara Incerti MGI:107193 Gpr143 G protein-coupled receptor 143 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6085 + EM:06085 STOCK Tyr Gpr143/Cnbc EMMA sperm HsdWin:NMRI;B6N.129-Gpr143/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6085 + EM:04764 STOCK Tyr/Cnbc EMMA embryo Tyr "chinchilla mottled":NMRI/Hsd mutant strain MGI:1855980 Tyr chinchilla mottled MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4764 + EM:04764 STOCK Tyr/Cnbc EMMA embryo Tyr "chinchilla mottled":NMRI/Hsd mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4764 + EM:04769 STOCK Tyr/Cnbc EMMA embryo Tyr "extreme dilution mottled":NMRI/Hsd mutant strain MGI:2683485 Tyr extreme dilution mottled MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4769 + EM:04769 STOCK Tyr/Cnbc EMMA embryo Tyr "extreme dilution mottled":NMRI/Hsd mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4769 - EM:10879 STOCK Tubb6/H EMMA sperm mutant strain MGI:4458679 Tubb6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915201 Tubb6 tubulin, beta 6 class V https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10879 + EM:10543 STOCK Tubb5/Biat EMMA sperm STOCK Tubb5/Biat mutant strain MGI:6119464 Tubb5 targeted mutation 2.1, David A Keays MGI:107812 Tubb5 tubulin, beta 5 class I https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10543 + EM:10542 STOCK Tubb5/Biat EMMA sperm STOCK Tubb5/Biat mutant strain MGI:6119463 Tubb5 targeted mutation 1.1, David A Keays MGI:107812 Tubb5 tubulin, beta 5 class I https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10542 + EM:07317 STOCK Trpm1/H EMMA sperm mutant strain MGI:5287780 Trpm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1330305 Trpm1 transient receptor potential cation channel, subfamily M, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7317 + EM:01788 STOCK Trp53 Tg(Wap-HBx)1Gmn/Kctt EMMA embryo mutant stock MGI:1857590 Trp53 targeted mutation 1, Allan Bradley MGI:98834 Trp53 transformation related protein 53 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1788 + EM:01788 STOCK Trp53 Tg(Wap-HBx)1Gmn/Kctt EMMA embryo mutant stock MGI:5312872 Tg(Wap-HBx)1Gmn transgene insertion 1, Marianne Bruggemann MGI:5312861 Tg(Wap-HBx)1Gmn transgene insertion 1, Marianne Bruggemann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1788 + EM:10456 STOCK Trmt1/Ics EMMA sperm HEPD0743_6_A06, G4648 mutant strain MGI:5085360 Trmt1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1289155 Trmt1 tRNA methyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10456 + EM:10456 STOCK Trmt1/Ics EMMA live HEPD0743_6_A06, G4648 mutant strain MGI:5085360 Trmt1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1289155 Trmt1 tRNA methyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10456 + EM:05824 STOCK Tpm1/WtsiH EMMA embryo EPD0001_3_G07, 129S/SvEvBrd-Tpm1/WtsiH, 129-Tpm1/WtsiH mutant strain MGI:4842867 Tpm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98809 Tpm1 tropomyosin 1, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5824 + EM:07457 STOCK Tox3/Orl EMMA sperm B6N.Cg-Tox3/Orl mutant strain MGI:6119413 Tox3 targeted mutation 1d, Mouse Biology Program, UCDavis MGI:3039593 Tox3 TOX high mobility group box family member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7457 + EM:11023 STOCK Tnfrsf1a Tg(Tnf)6074Gkl/Flmg EMMA embryo mutant strain MGI:1861040 Tnfrsf1a targeted mutation 1, Horst Bluethmann MGI:1314884 Tnfrsf1a tumor necrosis factor receptor superfamily, member 1a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11023 + EM:11023 STOCK Tnfrsf1a Tg(Tnf)6074Gkl/Flmg EMMA embryo mutant strain MGI:3766101 Tg(Tnf)6074Gkl transgene insertion 6074, George Kollias MGI:3766128 Tg(Tnf)6074Gkl transgene insertion 6074, George Kollias https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11023 + EM:08444 STOCK Tnfrsf1a Tg(Gfap-TNF*)K21Gkl/Flmg EMMA embryo CBA;B6-Tnfrsf1a Tg(Gfap-TNF*)K21Gkl/Flmg, TgK21 mutant strain MGI:1861040 Tnfrsf1a targeted mutation 1, Horst Bluethmann MGI:1314884 Tnfrsf1a tumor necrosis factor receptor superfamily, member 1a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8444 + EM:08444 STOCK Tnfrsf1a Tg(Gfap-TNF*)K21Gkl/Flmg EMMA embryo CBA;B6-Tnfrsf1a Tg(Gfap-TNF*)K21Gkl/Flmg, TgK21 mutant strain MGI:3766134 Tg(Gfap-TNF*)K21Gkl transgene insertion K21, George Kollias MGI:3766211 Tg(Gfap-TNF*)K21Gkl transgene insertion K21, George Kollias https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8444 + EM:08448 STOCK Tnfrsf1a Tg(CD2/HBB-TNF*)5453Gkl/Flmg EMMA embryo Tg5453, CBA;B6-Tnfrsf1atm1Blt Tg(CD2/HBB-TNF*)5453Gkl /Flmg] mutant strain MGI:4818268 Tg(CD2/HBB-TNF*)5453Gkl transgene insertion 5453, George Kollias MGI:4818262 Tg(CD2/HBB-TNF*)5453Gkl transgene insertion 5453, George Kollias https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8448 + EM:08448 STOCK Tnfrsf1a Tg(CD2/HBB-TNF*)5453Gkl/Flmg EMMA embryo Tg5453, CBA;B6-Tnfrsf1atm1Blt Tg(CD2/HBB-TNF*)5453Gkl /Flmg] mutant strain MGI:1861040 Tnfrsf1a targeted mutation 1, Horst Bluethmann MGI:1314884 Tnfrsf1a tumor necrosis factor receptor superfamily, member 1a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8448 ? EM:13831 STOCK Tnfrsf19/Ieg EMMA sperm mutant strain MGI:5613002 Tnfrsf19 targeted mutation 1.1, Hans Clevers MGI:1352474 Tnfrsf19 tumor necrosis factor receptor superfamily, member 19 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13831 + EM:13001 STOCK Tmx1/RgH EMMA sperm Tmx1/H mutant strain MGI:6751621 Tmx1 targeted mutation 1, University of Reading MGI:1919986 Tmx1 thioredoxin-related transmembrane protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13001 + EM:09860 STOCK Tmprss4/Ph EMMA sperm mutant strain MGI:5806229 Tmprss4 targeted mutation 1.1, Edith Hummler MGI:2384877 Tmprss4 transmembrane protease, serine 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9860 + EM:01908 STOCK Tmem98/H EMMA embryo GENA246, Retinal White Spots, STOCK Rwhs/H, C3H;C-Rwhs/H mutant stock MGI:2178433 Tmem98 retinal white spots MGI:1923457 Tmem98 transmembrane protein 98 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1908 + EM:00386 STOCK Tmc1/WtsiH EMMA sperm Dn mutant strain MGI:1856845 Tmc1 deafness MGI:2151016 Tmc1 transmembrane channel-like gene family 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=386 + EM:01894 STOCK Tm26/H EMMA sperm TM/26 mutant strain MGI:5752830 Tm26 mutant Tm26 MGI:5752827 Tm26 mutant Tm26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1894 + EM:13685 STOCK Tll1/H EMMA live mutant strain MGI:4842415 Tll1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106923 Tll1 tolloid-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13685 + EM:10790 STOCK Tie1/Oulu EMMA embryo Crl:CD1-Tie1/Oulu, Tie1/LacZ (CD1/ICR) mutant strain MGI:2159370 Tie1 targeted mutation 1, Juha Partanen MGI:99906 Tie1 tyrosine kinase with immunoglobulin-like and EGF-like domains 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10790 + EM:10790 STOCK Tie1/Oulu EMMA sperm Crl:CD1-Tie1/Oulu, Tie1/LacZ (CD1/ICR) mutant strain MGI:2159370 Tie1 targeted mutation 1, Juha Partanen MGI:99906 Tie1 tyrosine kinase with immunoglobulin-like and EGF-like domains 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10790 + EM:04369 STOCK Thra/Kctt EMMA embryo TRa1-GFP(ven), B6NCrl;129P2-Thra/Kctt mutant strain MGI:4847930 Thra targeted mutation 4.1, Bjorn Vennstrom MGI:98742 Thra thyroid hormone receptor alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4369 - EM:07517 STOCK Tgfb1i1/WtsiOrl EMMA sperm B6NTac;B6N-A Tgfb1i1/WtsiOrl mutant strain MGI:5050851 Tgfb1i1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102784 Tgfb1i1 transforming growth factor beta 1 induced transcript 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7517 ? EM:10544 STOCK Tg(Tubb5-EGFP)1Dak/Biat EMMA sperm mutant strain MGI:6330725 Tg(Tubb5-EGFP)1Dak transgene insertion 1, David A Keays MGI:6330724 Tg(Tubb5-EGFP)1Dak transgene insertion 1, David A Keays https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10544 + EM:09494 STOCK Tg(Ttr-SMYD3)1Ital/Flmg EMMA embryo B6.CBA-Tg(Ttr-SMYD3)1Ital/Flmg mutant strain MGI:5749481 Tg(Ttr-SMYD3)1Ital transgene insertion 1, Iannis Talianidis MGI:5749480 Tg(Ttr-SMYD3)1Ital transgene insertion 1, Iannis Talianidis https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9494 ? EM:09469 STOCK Tg(Ttr-SETD7*H297A)1Ital/Flmg EMMA embryo mutant strain Tg(Ttr-SETD7*H297A)1Ital Tg(Ttr-SETD7*H297A)1Ital Tg(Ttr-SETD7*H297A)1Ital Tg(Ttr-SETD7*H297A)1Ital https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9469 ? EM:09468 STOCK Tg(Ttr-SETD7)1Ital/Flmg EMMA embryo mutant strain Tg(Ttr-SETD7)1Ital Tg(Ttr-SETD7)1Ital Tg(Ttr-SETD7)1Ital Tg(Ttr-SETD7)1Ital https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9468 + EM:09491 STOCK Tg(Ttr-NR0B2)1Ital/Flmg EMMA embryo B6.CBA-Tg(Ttr-NR0B2)1Ital/Flmg mutant strain MGI:5645742 Tg(Ttr-NR0B2)1Ital transgene insertion 1, Iannis Talianidis MGI:5645741 Tg(Ttr-NR0B2)1Ital transgene insertion 1, Iannis Talianidis https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9491 + EM:08377 STOCK Tg(TNFRSF1B)1334Gkl/Flmg EMMA sperm CBA.B6-Tg(TNFRSF1B)1334Gkl mutant strain MGI:5645560 Tg(TNFRSF1B)1334Gkl transgene insertion 1334, George Kollias MGI:5645558 Tg(TNFRSF1B)1334Gkl transgene insertion 1334, George Kollias https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8377 + EM:08366 STOCK Tg(Tnf*)A86Gkl/Flmg EMMA sperm CBA.B6-Tg(Tnf*)A86Gkl/Flmg mutant strain MGI:3766228 Tg(Tnf*)A86Gkl transgene insertion A86, George Kollias MGI:3766240 Tg(Tnf*)A86Gkl transgene insertion A86, George Kollias https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8366 + EM:10595 STOCK Tg(tetO-Pax4,-DsRed)/Cnbc EMMA embryo mutant strain Tg(tetO-Pax4,-DsRed) Tg(tetO-Pax4,-DsRed) Tg(tetO-Pax4,-DsRed) Tg(tetO-Pax4,-DsRed) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10595 + EM:10595 STOCK Tg(tetO-Pax4,-DsRed)/Cnbc EMMA sperm mutant strain Tg(tetO-Pax4,-DsRed) Tg(tetO-Pax4,-DsRed) Tg(tetO-Pax4,-DsRed) Tg(tetO-Pax4,-DsRed) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10595 ? EM:10596 STOCK Tg(tetO-Pax4*,-DsRed)/Cnbc EMMA sperm mutant strain Tg(tetO-Pax4*,-DsRed) Tg(tetO-Pax4*,-DsRed) Tg(tetO-Pax4*,-DsRed) Tg(tetO-Pax4*,-DsRed) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10596 + EM:04643 STOCK Tg(tetO-AGTR1,-lacZ)1Aco/Cnbc EMMA sperm ZhAT1Rwt1 mutant strain MGI:5648216 Tg(tetO-AGTR1,-lacZ)1Aco transgene insertion 1, Justin Ainscough MGI:5648215 Tg(tetO-AGTR1,-lacZ)1Aco transgene insertion 1, Justin Ainscough https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4643 + EM:04761 STOCK Tg(tetO-AGTR1*N111G,-lacZ)1Aco/Cnbc EMMA embryo ZhAT1Rmut2 mutant strain MGI:5648211 Tg(tetO-AGTR1*N111G,-lacZ)1Aco transgene insertion 1, Justin Ainscough MGI:5648210 Tg(tetO-AGTR1*N111G,-lacZ)1Aco transgene insertion 1, Justin Ainscough https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4761 + EM:04761 STOCK Tg(tetO-AGTR1*N111G,-lacZ)1Aco/Cnbc EMMA sperm ZhAT1Rmut2 mutant strain MGI:5648211 Tg(tetO-AGTR1*N111G,-lacZ)1Aco transgene insertion 1, Justin Ainscough MGI:5648210 Tg(tetO-AGTR1*N111G,-lacZ)1Aco transgene insertion 1, Justin Ainscough https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4761 + EM:10853 STOCK Tg(Sox2-cre/ERT2)1Skn/Cnrm EMMA embryo mutant strain MGI:4397776 Tg(Sox2-cre/ERT2)1Skn transgene insertion 1, Silvia K Nicolis MGI:4397777 Tg(Sox2-cre/ERT2)1Skn transgene insertion 1, Silvia K Nicolis https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10853 + EM:10853 STOCK Tg(Sox2-cre/ERT2)1Skn/Cnrm EMMA sperm mutant strain MGI:4397776 Tg(Sox2-cre/ERT2)1Skn transgene insertion 1, Silvia K Nicolis MGI:4397777 Tg(Sox2-cre/ERT2)1Skn transgene insertion 1, Silvia K Nicolis https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10853 + EM:07154 STOCK Tg(Sox2-Bgeo)1Skn/Cnrm EMMA embryo Sox2 beta-geo telencephalic transgen mutant strain MGI:5700640 Tg(Sox2-Bgeo)1Skn transgene insertion 1, Silvia K Nicolis MGI:5700566 Tg(Sox2-Bgeo)1Skn transgene insertion 1, Silvia K Nicolis https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7154 + EM:07154 STOCK Tg(Sox2-Bgeo)1Skn/Cnrm EMMA sperm Sox2 beta-geo telencephalic transgen mutant strain MGI:5700640 Tg(Sox2-Bgeo)1Skn transgene insertion 1, Silvia K Nicolis MGI:5700566 Tg(Sox2-Bgeo)1Skn transgene insertion 1, Silvia K Nicolis https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7154 + EM:02604 STOCK Tg(Prnp/PRNP*ARR)FM18Pcg/H EMMA sperm Tg(OvPrP)FM18, STOCK Prnp Tg(Prnp/PRNP*ARR)FM18Pcg/H mutant strain MGI:5779521 Tg(Prnp/PRNP*ARR)FM18Pcg trangene insertion FM18, Peter Griffiths MGI:5779520 Tg(Prnp/PRNP*ARR)FM18Pcg trangene insertion FM18, Peter Griffiths https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2604 - EM:04337 STOCK Tg(Prnp/PRNP*ARR)FF8Pcg/H EMMA embryo mutant strain MGI:5779525 Tg(Prnp/PRNP*ARR)FF8Pcg transgene insertion FF8, Peter Griffiths MGI:5779524 Tg(Prnp/PRNP*ARR)FF8Pcg transgene insertion FF8, Peter Griffiths https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4337 - EM:02615 STOCK Tg(Prnp/PRNP*AHQ)EM52Pcg/H EMMA embryo mutant strain MGI:5776255 Tg(Prnp/PRNP*AHQ)EM52Pcg transgene insertion EM52, Peter Griffiths MGI:5776254 Tg(Prnp/PRNP*AHQ)EM52Pcg transgene insertion EM52, Peter Griffiths https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2615 - EM:04339 STOCK Tg(Prnp/PRNP*AHQ)EM16Pcg/H EMMA embryo mutant strain MGI:5776247 Tg(Prnp/PRNP*AHQ)EM16Pcg transgene insertion EM16, Peter Griffiths MGI:5776244 Tg(Prnp/PRNP*AHQ)EM16Pcg transgene insertion EM16, Peter Griffiths https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4339 - EM:04554 STOCK Tg(Prnp/PRNP*AHQ)EF50Pcg/H EMMA embryo mutant strain MGI:5776258 Tg(Prnp/PRNP*AHQ)EF50Pcg transgene insertion EM50, Peter Griffiths MGI:5776257 Tg(Prnp/PRNP*AHQ)EF50Pcg transgene insertion EM50, Peter Griffiths https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4554 + EM:02501 STOCK Tg(Prnp-SMN)92Ahmb/H EMMA sperm PrP : fl-SMN mutant strain MGI:3774945 Tg(Prnp-SMN)92Ahmb transgene insertion 92, Arthur H M Burghes MGI:3774942 Tg(Prnp-SMN)92Ahmb transgene insertion 92, Arthur H M Burghes https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2501 + EM:02538 STOCK Tg(Prnp-PRNP*6OR)K6M6Pcg/H EMMA embryo STOCK Tg(PRNP*)K6M6Pcg/Pcg, Tg(KuPrP)K6M6 mutant strain MGI:5775412 Tg(Prnp-PRNP*6OR)K6M6Pcg transgene insertion K6M6, Peter Griffiths MGI:5775410 Tg(Prnp-PRNP*6OR)K6M6Pcg transgene insertion K6M6, Peter Griffiths https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2538 + EM:02504 STOCK Tg(Prnp-HSPB1)PPks/H EMMA archived HSP27 WT PrP Promoter line, PRP-HSP27-WT mutant strain MGI:5775105 Tg(Prnp-HSPB1)PPks transgene insertion P, Nick Parkinson MGI:5775104 Tg(Prnp-HSPB1)PPks transgene insertion P, Nick Parkinson https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2504 - EM:02600 STOCK Tg(PRNP)2019Pcg/H EMMA embryo mutant strain MGI:5775986 Tg(PRNP)2019Pcg transgene insertion 2019, Peter Griffiths MGI:5775985 Tg(PRNP)2019Pcg transgene insertion 2019, Peter Griffiths https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2600 - EM:02588 STOCK Tg(PRNP)2010Pcg/H EMMA embryo mutant strain MGI:5775933 Tg(PRNP)2010Pcg transgene insertion 2010, Peter Griffiths MGI:5775932 Tg(PRNP)2010Pcg transgene insertion 2010, Peter Griffiths https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2588 - EM:02537 STOCK Tg(PRNP)1896Pcg/H EMMA embryo mutant strain MGI:5775352 Tg(PRNP)1896Pcg transgene insertion 1896, Peter Griffiths MGI:5775349 Tg(PRNP)1896Pcg transgene insertion 1896, Peter Griffiths https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2537 + EM:02517 STOCK Tg(Prm-cre)58Og/H EMMA embryo Pro Cre, STOCK Tg(Prm-cre)58Og, Pro-Cre mutant strain MGI:2176182 Tg(Prm-cre)58Og transgene insertion 58, Stephen O'Gorman MGI:2176181 Tg(Prm-cre)58Og transgene insertion 58, Stephen O'Gorman https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2517 + EM:01344 STOCK Tg(PDGFRA-lacZ)2.2-07Nist/Kctt EMMA archived PDGFRAprom-2.2-lacZ-0.7, MNI-3 mutant strain MGI:5305726 Tg(PDGFRA-lacZ)2.2-07Nist transgene insertion 2.2-07, Monica Nister MGI:5305724 Tg(PDGFRA-lacZ)2.2-07Nist transgene insertion 2.2-07, Monica Nister https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1344 + EM:04365 STOCK Tg(Myh6-tTA)6Smbf/Cnrm EMMA embryo alphaMHC-tTA, STOCK Tg(Myh6-tTA)6Smbf/Ibcm, FVB;B6CBF1-Tg(Myh6-tTA)6Smbf/Ibcm mutant strain MGI:2665551 Tg(Myh6-tTA)6Smbf transgene insertion 6, Section of Myocardial Biology - Fishman Lab MGI:2665552 Tg(Myh6-tTA)6Smbf transgene insertion 6, Section of Myocardial Biology - Fishman Lab https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4365 + EM:04989 STOCK Tg(Myh6-tTA)6Smbf Tg(tetO-Hgf,-EGFP)24Tcre/Cnrm EMMA embryo Hgf-TetO-GFP x alphaMHC-tTA mutant strain MGI:2665551 Tg(Myh6-tTA)6Smbf transgene insertion 6, Section of Myocardial Biology - Fishman Lab MGI:2665552 Tg(Myh6-tTA)6Smbf transgene insertion 6, Section of Myocardial Biology - Fishman Lab https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4989 + EM:04989 STOCK Tg(Myh6-tTA)6Smbf Tg(tetO-Hgf,-EGFP)24Tcre/Cnrm EMMA embryo Hgf-TetO-GFP x alphaMHC-tTA mutant strain MGI:5648118 Tg(tetO-Hgf,-EGFP)24Tcre transgene insertion 24, Tiziana Crepaldi MGI:5648117 Tg(tetO-Hgf,-EGFP)24Tcre transgene insertion 24, Tiziana Crepaldi https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4989 + EM:02188 STOCK Tg(MSR1)3Winth/Cnrm EMMA embryo MSR1 mutant strain MGI:5648236 Tg(MSR1)3Winth transgene insertion 3, Menno de Winther MGI:5648235 Tg(MSR1)3Winth transgene insertion 3, Menno de Winther https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2188 ? EM:11142 STOCK Tg(MMTVtTA)1Mam/Orl EMMA sperm mutant strain MGI:3053958 Tg(MMTVtTA)1Mam transgene insertion 1, Lothar Hennighausen MGI:3053971 Tg(MMTVtTA)1Mam transgene insertion 1, Lothar Hennighausen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11142 + EM:01362 STOCK Tg(MMTV-Prlr)3Eder/Orl EMMA embryo MMTV-F3 mutant strain MGI:5304928 Tg(MMTV-Prlr)3Eder transgene insertion 3, Marc Edery MGI:5304921 Tg(MMTV-Prlr)3Eder transgene insertion 3, Marc Edery https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1362 + EM:00134 STOCK Tg(Mbp-PDGFB)90Ubc/Kieg EMMA embryo MBP-PDGF B, KFN-1, STOCK Tg(Mbp-PDGFB)90Ubc/Ubc mutant stock MGI:3044166 Tg(Mbp-PDGFB)90Ubc transgene insertion 90, Uppsala University MGI:3044165 Tg(Mbp-PDGFB)90Ubc transgene insertion 90, Uppsala University https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=134 + EM:04971 STOCK Tg(LYZ-rtTA2S*M2,tetO-ELAVL1)632Dkon/Flmg EMMA embryo STOCK Tg(LYS2-rtTA2S*M2;tetO-ELAVL1)632Dkon/Flmg, TgLrT-HAHuRL.632 mutant strain MGI:5429340 Tg(LYZ-rtTA2S*M2,tetO-ELAVL1)632Dkon transgene insertion 632, Dimitris Kontoyiannis MGI:5429341 Tg(LYZ-rtTA2S*M2,tetO-ELAVL1)632Dkon transgene insertion 632, Dimitris Kontoyiannis https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4971 + EM:04971 STOCK Tg(LYZ-rtTA2S*M2,tetO-ELAVL1)632Dkon/Flmg EMMA sperm STOCK Tg(LYS2-rtTA2S*M2;tetO-ELAVL1)632Dkon/Flmg, TgLrT-HAHuRL.632 mutant strain MGI:5429340 Tg(LYZ-rtTA2S*M2,tetO-ELAVL1)632Dkon transgene insertion 632, Dimitris Kontoyiannis MGI:5429341 Tg(LYZ-rtTA2S*M2,tetO-ELAVL1)632Dkon transgene insertion 632, Dimitris Kontoyiannis https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4971 + EM:01916 STOCK Tg(Lck-AVEN)1Zrng/Ieg EMMA embryo Tg(Lck-Aven), lck Aven mutant stock MGI:5317419 Tg(Lck-AVEN)1Zrng transgene insertion 1, Martin Zoernig MGI:5317418 Tg(Lck-AVEN)1Zrng transgene insertion 1, Martin Zoernig https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1916 + EM:02189 STOCK Tg(ITGAM-PLA2G2A)1Winth/Cnrm EMMA embryo sPLA2 mutant strain MGI:5648230 Tg(ITGAM-PLA2G2A)1Winth transgene insertion 1, Menno de Winther MGI:5648228 Tg(ITGAM-PLA2G2A)1Winth transgene insertion 1, Menno de Winther https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2189 + EM:02113 STOCK Tg(HSE-EYFP)1Mklv/Kieg EMMA embryo HiShoMice mutant strain MGI:5573168 Tg(HSE-EYFP)1Mklv transgene insertion 1, Andrey Mikhailov MGI:5573167 Tg(HSE-EYFP)1Mklv transgene insertion 1, Andrey Mikhailov https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2113 - EM:05282 STOCK Tg(H2K-lacZ)1Cba/Orl EMMA embryo B6CBA-Tg(H2K-lacZ)1Cba/Orl, H-2Z1 mutant strain MGI:5645898 Tg(H2K-lacZ)1Cba transgene insertion 1, Charles Babinet MGI:5645897 Tg(H2K-lacZ)1Cba transgene insertion 1, Charles Babinet https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5282 + EM:07149 STOCK Tg(H2-K1-Ifnb1)10Seif Ifnar1/Orl EMMA embryo STOCK Ifnar1 Tg(H2-K1-Ifnb1)10Seif/Orl, Ifnar1tm1Agt/Ifnar1tm1Agt Tg(H2-K1-Ifnb1)10Seif/Tg(H2- K1-Ifnb1)10Seif mutant strain MGI:1930950 Ifnar1 targeted mutation 1, Michel Aguet MGI:107658 Ifnar1 interferon (alpha and beta) receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7149 + EM:07149 STOCK Tg(H2-K1-Ifnb1)10Seif Ifnar1/Orl EMMA embryo STOCK Ifnar1 Tg(H2-K1-Ifnb1)10Seif/Orl, Ifnar1tm1Agt/Ifnar1tm1Agt Tg(H2-K1-Ifnb1)10Seif/Tg(H2- K1-Ifnb1)10Seif mutant strain MGI:5141611 Tg(H2-K1-Ifnb1)10Seif transgene insertion 10, Isabelle Seif MGI:5141625 Tg(H2-K1-Ifnb1)10Seif transgene insertion 10, Isabelle Seif https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7149 + EM:05237 STOCK Tg(Gfap-Pten*)6Rpm/Cnbc EMMA embryo GL1 GFAP-Pten qma mutant strain MGI:5795663 Tg(Gfap-PTEN*)6Rpm transgene insertion 6, Rafael Pulido MGI:5795659 Tg(Gfap-PTEN*)6Rpm transgene insertion 6, Rafael Pulido https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5237 + EM:05237 STOCK Tg(Gfap-Pten*)6Rpm/Cnbc EMMA sperm GL1 GFAP-Pten qma mutant strain MGI:5795663 Tg(Gfap-PTEN*)6Rpm transgene insertion 6, Rafael Pulido MGI:5795659 Tg(Gfap-PTEN*)6Rpm transgene insertion 6, Rafael Pulido https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5237 + EM:01347 STOCK Tg(GFAP-lacZ)9Nist/Kctt EMMA embryo hGFAPprom-LacZ line9, MNI-4 mutant strain MGI:5305741 Tg(GFAP-lacZ)9Nist transgene insertion 9, Monica Nister MGI:5305740 Tg(GFAP-lacZ)9Nist transgene insertion 9, Monica Nister https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1347 + EM:01347 STOCK Tg(GFAP-lacZ)9Nist/Kctt EMMA live hGFAPprom-LacZ line9, MNI-4 mutant strain MGI:5305741 Tg(GFAP-lacZ)9Nist transgene insertion 9, Monica Nister MGI:5305740 Tg(GFAP-lacZ)9Nist transgene insertion 9, Monica Nister https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1347 + EM:05989 STOCK Tg(Frzb-cre)1Tylz/Orl EMMA embryo Tg(Frzb-cre)1Tylz mutant strain MGI:3527940 Tg(Frzb-cre)1Tylz transgene insertion 1, Przemko Tylzanowski MGI:3527938 Tg(Frzb-cre)1Tylz transgene insertion 1, Przemko Tylzanowski https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5989 + EM:01133 STOCK Tg(Fabp1-cre)1Jig/JigCnrm EMMA embryo Fabp1-Cre, STOCK Tg(Fabp1-cre)1Jig, STOCK Tg(Fabp1-cre)1Jig/JigIbcm, Fabpl-Cre mutant stock MGI:2447212 Tg(Fabp1-cre)1Jig transgene insertion 1, Jeffrey I Gordon MGI:2447210 Tg(Fabp1-cre)1Jig transgene insertion 1, Jeffrey I Gordon https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1133 + EM:11833 STOCK Tg(Egr2-cre)1Pch/Orl EMMA archived STOCK MSE-cre/Orl unclassified MGI:6756343 Tg(Egr2-cre)1Pch transgene insertion 1, Patrick Charnay MGI:6756342 Tg(Egr2-cre)1Pch transgene insertion 1, Patrick Charnay https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11833 ? EM:13164 STOCK Tg(Dct-lacZ)A12Jkn/H EMMA sperm mutant strain MGI:3783632 Tg(Dct-lacZ)A12Jkn transgene insertion A12, Ian Jackson MGI:3783630 Tg(Dct-lacZ)A12Jkn transgene insertion A12, Ian Jackson https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13164 + EM:09527 STOCK Tg(CYP19A1-icre)3Fcrt/Biat EMMA embryo Aromatase-iCre mutant strain MGI:5807485 Tg(CYP19A1-icre)3Fcrt transgene insertion 3, Sophie Fouchecourt MGI:5807484 Tg(CYP19A1-icre)3Fcrt transgene insertion 3, Sophie Fouchecourt https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9527 + EM:09527 STOCK Tg(CYP19A1-icre)3Fcrt/Biat EMMA sperm Aromatase-iCre mutant strain MGI:5807485 Tg(CYP19A1-icre)3Fcrt transgene insertion 3, Sophie Fouchecourt MGI:5807484 Tg(CYP19A1-icre)3Fcrt transgene insertion 3, Sophie Fouchecourt https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9527 + EM:02518 STOCK Tg(Col2a1-cre)1Bhr/H EMMA embryo Col2-Cre, STOCK Tg(Col2a1-cre)1Bhr mutant strain MGI:2176070 Tg(Col2a1-cre)1Bhr transgene insertion 1, Richard R Behringer MGI:2176069 Tg(Col2a1-cre)1Bhr transgene insertion 1, Richard R Behringer https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2518 + EM:09617 STOCK Tg(CMV-rtTA)4Bjd Tg(tetO-LINE1*,-lacZ)#Ggs/Ieg EMMA sperm STOCK Tg(CMV-rtTA)4Bjd Tg(TRE-ORFeus,-lacZ)/Ieg, ORFeus lacZ_CMVrtTA mutant strain MGI:6220704 Tg(tetO-LINE1*,-lacZ)#Ggs transgene insertion, Gerald G Schumann MGI:6220703 Tg(tetO-LINE1*,-lacZ)#Ggs transgene insertion, Gerald G Schumann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9617 + EM:09617 STOCK Tg(CMV-rtTA)4Bjd Tg(tetO-LINE1*,-lacZ)#Ggs/Ieg EMMA sperm STOCK Tg(CMV-rtTA)4Bjd Tg(TRE-ORFeus,-lacZ)/Ieg, ORFeus lacZ_CMVrtTA mutant strain MGI:3056891 Tg(CMV-rtTA)4Bjd transgene insertion 4, Hermann Bujard MGI:3056892 Tg(CMV-rtTA)4Bjd transgene insertion 4, Hermann Bujard https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9617 - EM:02157 STOCK Tg(CMV-EYFP/DsRed2)1Mklv/Kieg EMMA embryo mutant strain MGI:5573173 Tg(CMV-EYFP/DsRed2)1Mklv transgene insertion 1, Andrey Mikhailov MGI:5573171 Tg(CMV-EYFP/DsRed2)1Mklv transgene insertion 1, Andrey Mikhailov https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2157 + EM:06004 STOCK Tg(CAMK2A-KCNIP3*,-lacZ)1Cnbc/Cnbc EMMA sperm B6CBA-Tg(hCaMKIIalpha-hEFmDREAM-IRES-lacZ)JN1Cnbc mutant strain MGI:5646261 Tg(CAMK2A-KCNIP3*,-lacZ)1Cnbc transgene insertion 1, Centro Nacional de Biotecnologia MGI:5646259 Tg(CAMK2A-KCNIP3*,-lacZ)1Cnbc transgene insertion 1, Centro Nacional de Biotecnologia https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6004 + EM:09256 STOCK Tg(Camk2a-Grin2c/itTA)12Rsp Tg(tetO-cre)LC1Bjd/Kctt EMMA sperm TgCN12+LC1 (lab name CN12) mutant strain MGI:5432029 Tg(Camk2a-Grin2c/itTA)12Rsp transgene insertion 12, Rolf Sprengel MGI:5432028 Tg(Camk2a-Grin2c/itTA)12Rsp transgene insertion 12, Rolf Sprengel https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9256 + EM:09256 STOCK Tg(Camk2a-Grin2c/itTA)12Rsp Tg(tetO-cre)LC1Bjd/Kctt EMMA sperm TgCN12+LC1 (lab name CN12) mutant strain MGI:2448952 Tg(tetO-cre)LC1Bjd transgene insertion LC1, Hermann Bujard MGI:2671943 Tg(tetO-cre)LC1Bjd transgene insertion LC1, Hermann Bujard https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9256 + EM:09255 STOCK Tg(Camk2a-Grin2c/itTA)10Rsp/Kctt EMMA sperm NMRI.Cg-Tg(Camk2a-Grin2c/itTA)10Rsp/Kctt, TgCN10 mutant strain MGI:5708649 Tg(Camk2a-Grin2c/itTA)10Rsp transgene insertion 10, Rolf Sprengel MGI:5708646 Tg(Camk2a-Grin2c/itTA)10Rsp transgene insertion 10, Rolf Sprengel https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9255 + EM:05635 STOCK Tg(CAG-Otx2,-GFP)21Asim/Cnrm EMMA embryo CMV-bOtx2 mutant strain MGI:4887448 Tg(CAG-Otx2,-GFP)21Asim transgene insertion 21, Antonio Simeone MGI:4887463 Tg(CAG-Otx2,-GFP)21Asim transgene insertion 21, Antonio Simeone https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5635 + EM:05635 STOCK Tg(CAG-Otx2,-GFP)21Asim/Cnrm EMMA sperm CMV-bOtx2 mutant strain MGI:4887448 Tg(CAG-Otx2,-GFP)21Asim transgene insertion 21, Antonio Simeone MGI:4887463 Tg(CAG-Otx2,-GFP)21Asim transgene insertion 21, Antonio Simeone https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5635 ? EM:06790 STOCK Tg(CAG-Katushka)3Sgo/Cnbc EMMA embryo mutant strain Tg(CAG-KFP)3Sgo Tg(CAG-KFP)3Sgo Tg(CAG-KFP)3Sgo Tg(CAG-KFP)3Sgo https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6790 ? EM:06790 STOCK Tg(CAG-Katushka)3Sgo/Cnbc EMMA sperm mutant strain Tg(CAG-KFP)3Sgo Tg(CAG-KFP)3Sgo Tg(CAG-KFP)3Sgo Tg(CAG-KFP)3Sgo https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6790 + EM:01917 STOCK Tg(CAG-AVEN)1Zrng/Ieg EMMA embryo beta-actin-Aven, B6;CD1-Tg(ACTB-Aven)/Ieg mutant stock MGI:5317427 Tg(CAG-AVEN)1Zrng transgene insertion 1, Martin Zoernig MGI:5317426 Tg(CAG-AVEN)1Zrng transgene insertion 1, Martin Zoernig https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1917 + EM:00026 STOCK Tg(APOA4)8022Feb/Cnrm EMMA embryo B6.(C57BL/6 x CBA)-Tg(APOA4)8022Feb/Ibcm, B6.Cg-Tg(APOA4)8022Feb/Ibcm, APOA4-Tg#8022, B6;CD1-Tg(APOA4)8022Feb/Ibcm mutant strain MGI:2652475 Tg(APOA4)8022Feb transgene insertion 8022, Francisco E Baralle MGI:2652470 Tg(APOA4)8022Feb transgene insertion 8022, Francisco E Baralle https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=26 + EM:00025 STOCK Tg(APOA4)8021Feb/Cnrm EMMA embryo B6;CD1-Tg(APOA4)8021Feb, B6;CD1-Tg(APOA4)8021Feb/Ibcm, B6.Cg-Tg(APOA4)8021Feb/Ibcm, STOCK Tg(APOA4)8021Feb/Ibcm, B6.(C57BL/6 x CBA)-Tg(APOA4)8021Feb/Ibcm, APOA4-Tg#8021 mutant strain MGI:2652472 Tg(APOA4)8021Feb transgene insertion 8021, Francisco E Baralle MGI:2652467 Tg(APOA4)8021Feb transgene insertion 8021, Francisco E Baralle https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=25 + EM:00603 STOCK Tg(Alb1-cre)7Gsc/Cnrm EMMA embryo tg alfpCre, STOCK Tg(Alb1-cre)7Gsc/Ibcm mutant strain MGI:2177602 Tg(Alb1-cre)7Gsc transgene insertion 7, Gunther Schutz MGI:2177601 Tg(Alb1-cre)7Gsc transgene insertion 7, Gunther Schutz https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=603 + EM:00603 STOCK Tg(Alb1-cre)7Gsc/Cnrm EMMA sperm tg alfpCre, STOCK Tg(Alb1-cre)7Gsc/Ibcm mutant strain MGI:2177602 Tg(Alb1-cre)7Gsc transgene insertion 7, Gunther Schutz MGI:2177601 Tg(Alb1-cre)7Gsc transgene insertion 7, Gunther Schutz https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=603 ? EM:11067 STOCK Tg(Alb1-cre) Tg(Alb1-HCVN)35Sml/Orl EMMA archived mutant strain MGI:3513779 Tg(Alb1-HCVN)35Sml transgene insertion 35, Stanley M Lemon MGI:3625827 Tg(Alb1-HCVN)35Sml transgene insertion 35, Stanley M Lemon https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11067 ? EM:11067 STOCK Tg(Alb1-cre) Tg(Alb1-HCVN)35Sml/Orl EMMA archived mutant strain Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11067 ? EM:06347 STOCK Tg(Alb-luc/EGFP)7007Ciem/Cnbc EMMA sperm mutant strain Tg(Alb-luc/EGFP)7007Ciem Tg(Alb-luc/EGFP)7007Ciem Tg(Alb-luc/EGFP)7007Ciem Tg(Alb-luc/EGFP)7007Ciem https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6347 ? EM:06345 STOCK Tg(Alb-luc/EGFP)5190Ciem/Cnbc EMMA sperm mutant strain Tg(Alb-luc/EGFP)5190Ciem Tg(Alb-luc/EGFP)5190Ciem Tg(Alb-luc/EGFP)5190Ciem Tg(Alb-luc/EGFP)5190Ciem https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6345 ? EM:06344 STOCK Tg(Alb-luc/EGFP)5189Ciem/Cnbc EMMA embryo mutant strain Tg(Alb-luc/EGFP)5189Ciem Tg(Alb-luc/EGFP)5189Ciem Tg(Alb-luc/EGFP)5189Ciem Tg(Alb-luc/EGFP)5189Ciem https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6344 ? EM:06344 STOCK Tg(Alb-luc/EGFP)5189Ciem/Cnbc EMMA sperm mutant strain Tg(Alb-luc/EGFP)5189Ciem Tg(Alb-luc/EGFP)5189Ciem Tg(Alb-luc/EGFP)5189Ciem Tg(Alb-luc/EGFP)5189Ciem https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6344 ? EM:06346 STOCK Tg(Alb-luc/EGFP)5187Ciem/Cnbc EMMA embryo mutant strain Tg(Alb-luc/EGFP)5187Ciem Tg(Alb-luc/EGFP)5187Ciem Tg(Alb-luc/EGFP)5187Ciem Tg(Alb-luc/EGFP)5187Ciem https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6346 ? EM:06346 STOCK Tg(Alb-luc/EGFP)5187Ciem/Cnbc EMMA sperm mutant strain Tg(Alb-luc/EGFP)5187Ciem Tg(Alb-luc/EGFP)5187Ciem Tg(Alb-luc/EGFP)5187Ciem Tg(Alb-luc/EGFP)5187Ciem https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6346 + EM:01100 STOCK Tg(ACTB-Neurog3)1Bzal/Orl EMMA embryo B6;D2-Tg(ACTB-Ngn3)Bzal/Orl, beta-actin-floxed-ngn3, STOCK Tg(ACTB-Ngn3)1Bzal/Orl mutant strain MGI:5750091 Tg(ACTB-Neurog3)1Bzal transgene insertion 1, Bernard Zalc MGI:5750088 Tg(ACTB-Neurog3)1Bzal transgene insertion 1, Bernard Zalc https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1100 + EM:01164 STOCK Tbce +/+ Gli3/PasOrl EMMA embryo XtP-Pasteur mutant strain MGI:1856275 Gli3 extra toes MGI:95729 Gli3 GLI-Kruppel family member GLI3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1164 + EM:01164 STOCK Tbce +/+ Gli3/PasOrl EMMA embryo XtP-Pasteur mutant strain MGI:1856997 Tbce progressive motor neuronopathy MGI:1917680 Tbce tubulin-specific chaperone E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1164 + EM:01717 STOCK Tas6/H EMMA embryo TAS6 mutant strain MGI:5646497 Tas6 mutant Tas6 MGI:5646398 Tas6 mutant Tas6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1717 + EM:01717 STOCK Tas6/H EMMA sperm TAS6 mutant strain MGI:5646497 Tas6 mutant Tas6 MGI:5646398 Tas6 mutant Tas6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1717 + EM:02206 STOCK T<21H>/H EMMA embryo T<21H> mutant strain MGI:1859667 T<21H> brachyury 21 Harwell MGI:98472 T brachyury, T-box transcription factor T https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2206 + EM:01845 STOCK T(7;19)145H/H EMMA embryo STOCK T(7;19)145H, T(7;19)145H, T145H mutant stock MGI:5316040 T(7;19)145H reciprocal translocation, Chr 7 and 19, Harwell 145 MGI:103979 T(7;19)145H reciprocal translocation, Chr 7 and 19, Harwell 145 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1845 + EM:02584 STOCK T(2;8)2Wa/H EMMA embryo T2Wa mutant strain T(2;8)2Wa reciprocal translocation, Chr 2 and 8, Wageningen 2 MGI:103706 T(2;8)2Wa reciprocal translocation, Chr 2 and 8, Wageningen 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2584 - EM:05521 STOCK Synj2/WtsiOulu EMMA embryo mutant strain MGI:4432435 Synj2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1201671 Synj2 synaptojanin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5521 ? EM:13078 STOCK Svbp/Flmg EMMA embryo mutant strain Svbp Svbp MGI:1916466 Svbp small vasohibin binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13078 ? EM:13078 STOCK Svbp/Flmg EMMA sperm mutant strain Svbp Svbp MGI:1916466 Svbp small vasohibin binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13078 + EM:05570 STOCK Stmn4/Orl EMMA embryo STOCK Stmn4/Orl mutant strain MGI:6468487 Stmn4 targeted mutation 1.1, Mouse Clinical Institute MGI:1931224 Stmn4 stathmin-like 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5570 + EM:05571 STOCK Stmn3/Orl EMMA embryo STOCK Stmn3/Orl mutant strain MGI:6468488 Stmn3 targeted mutation 1.1, Mouse Clinical Institute MGI:1277137 Stmn3 stathmin-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5571 + EM:05571 STOCK Stmn3/Orl EMMA sperm STOCK Stmn3/Orl mutant strain MGI:6468488 Stmn3 targeted mutation 1.1, Mouse Clinical Institute MGI:1277137 Stmn3 stathmin-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5571 + EM:05572 STOCK Stmn2/Orl EMMA embryo STOCK Stmn2/Orl mutant strain MGI:6468489 Stmn2 targeted mutation 1.1, Mouse Clinical Institute MGI:98241 Stmn2 stathmin-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5572 - EM:11176 STOCK Stambp/H EMMA sperm mutant strain MGI:5521854 Stambp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917777 Stambp STAM binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11176 + EM:01315 STOCK Srrm4/WtsiH EMMA embryo bv, bv (Bronx Waltzer), STOCK bv/H, STOCK bv/WtsiH, Bronx Waltzer mutant stock MGI:1856676 Srrm4 Bronx waltzer MGI:1916205 Srrm4 serine/arginine repetitive matrix 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1315 + EM:01315 STOCK Srrm4/WtsiH EMMA sperm bv, bv (Bronx Waltzer), STOCK bv/H, STOCK bv/WtsiH, Bronx Waltzer mutant stock MGI:1856676 Srrm4 Bronx waltzer MGI:1916205 Srrm4 serine/arginine repetitive matrix 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1315 + EM:01859 STOCK Sox4 Foxq1/+ +/H EMMA embryo STOCK Sox4 Foxq1/+ +/H, M91B mutant stock MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1859 + EM:01859 STOCK Sox4 Foxq1/+ +/H EMMA embryo STOCK Sox4 Foxq1/+ +/H, M91B mutant stock MGI:3819793 Sox4 mutation 91, Ruth M Arkell MGI:98366 Sox4 SRY (sex determining region Y)-box 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1859 + EM:05015 STOCK Sox2/WtsiCnbc[cc] EMMA embryo Yellow submarine mutant strain MGI:2447996 Sox2 yellow submarine MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5015 + EM:07995 STOCK Sox2/Cnrm EMMA embryo Sox2flox mutant strain MGI:4397705 Sox2 targeted mutation 4.1, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7995 + EM:07995 STOCK Sox2/Cnrm EMMA sperm Sox2flox mutant strain MGI:4397705 Sox2 targeted mutation 4.1, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7995 + EM:07114 STOCK Sox2/Cnrm EMMA embryo Sox2 deltaENH mutant strain MGI:3052123 Sox2 targeted mutation 3, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7114 + EM:07114 STOCK Sox2/Cnrm EMMA sperm Sox2 deltaENH mutant strain MGI:3052123 Sox2 targeted mutation 3, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7114 + EM:07153 STOCK Sox2/Cnrm EMMA embryo Sox2 beta-geo knock-in mutant strain MGI:2181440 Sox2 targeted mutation 2, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7153 + EM:07153 STOCK Sox2/Cnrm EMMA sperm Sox2 beta-geo knock-in mutant strain MGI:2181440 Sox2 targeted mutation 2, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7153 + EM:10000 STOCK Snx29/IcsOrl EMMA sperm E254-HEPD0532_2_B10, HEPD0532_2_B10 mutant strain MGI:4434822 Snx29 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921728 Snx29 sorting nexin 29 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10000 + EM:10367 STOCK Smyd3/Flmg EMMA embryo mutant strain MGI:4346714 Smyd3 gene trap AS0527, Wellcome Trust Sanger Institute MGI:1916976 Smyd3 SET and MYND domain containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10367 + EM:02416 STOCK Smg6/H EMMA embryo FVB.Cg-Tg(SMN1*delta5-Smg6)1Pks, SMNDelta5 mutant strain MGI:5493450 Smg6 transgene insertion 1, Nick Parkinson MGI:2144117 Smg6 SMG6 nonsense mediated mRNA decay factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2416 + EM:02524 STOCK Smad9/H EMMA sperm Smad8 conditional mutant strain MGI:5514164 Smad9 targeted mutation 2, Elizabeth J Robertson MGI:1859993 Smad9 SMAD family member 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2524 + EM:02507 STOCK Smad9/H EMMA embryo Smad8 LacZ mutant strain MGI:3701868 Smad9 targeted mutation 1, Elizabeth J Robertson MGI:1859993 Smad9 SMAD family member 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2507 + EM:02511 STOCK Smad2/H EMMA embryo Smad2 SF, Smad 2 SF mutant strain MGI:5775212 Smad2 targeted mutation 6, Elizabeth Robertson MGI:108051 Smad2 SMAD family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2511 + EM:02512 STOCK Smad2/H EMMA embryo Smad2 FL, Smad 2 FL mutant strain MGI:5775197 Smad2 targeted mutation 5, Elizabeth Robertson MGI:108051 Smad2 SMAD family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2512 + EM:02508 STOCK Smad2/H EMMA embryo Smad 2 T3, Smad2 T3 mutant strain MGI:3527156 Smad2 targeted mutation 4, Elizabeth J Robertson MGI:108051 Smad2 SMAD family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2508 + EM:02509 STOCK Smad2/H EMMA embryo Smad 2 D2, 129-Smad2/H, Smad2 D2 mutant strain MGI:3527155 Smad2 targeted mutation 3, Elizabeth J Robertson MGI:108051 Smad2 SMAD family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2509 ? EM:13218 STOCK Slc7a11/IcsOrl EMMA sperm mutant strain MGI:6390578 Slc7a11 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1347355 Slc7a11 solute carrier family 7 (cationic amino acid transporter, y+ system), member 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13218 + EM:10001 STOCK Slc7a11/IcsOrl EMMA sperm EPD0508_3_E02, E252-EPD0508_3_E02 mutant strain MGI:4441748 Slc7a11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1347355 Slc7a11 solute carrier family 7 (cationic amino acid transporter, y+ system), member 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10001 ? EM:13042 STOCK Slc25a17/Orl EMMA sperm mutant strain MGI:4124412 Slc25a17 gene trap XB686, BayGenomics MGI:1342248 Slc25a17 solute carrier family 25 (mitochondrial carrier, peroxisomal membrane protein), member 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13042 + EM:12807 STOCK Slamf1 Ifnar1/Biat EMMA embryo mutant strain MGI:1930950 Ifnar1 targeted mutation 1, Michel Aguet MGI:107658 Ifnar1 interferon (alpha and beta) receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12807 + EM:12807 STOCK Slamf1 Ifnar1/Biat EMMA embryo mutant strain MGI:3776761 Slamf1 targeted mutation 1, Shinji Ohno MGI:1351314 Slamf1 signaling lymphocytic activation molecule family member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12807 + EM:06779 STOCK Sirt3/WtsiH EMMA sperm B6NTac;B6N-A Sirt3/WtsiH mutant strain MGI:4441628 Sirt3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927665 Sirt3 sirtuin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6779 + EM:09786 STOCK Shb/Oulu EMMA embryo HEPD0613_4_G08 mutant strain MGI:4451783 Shb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98294 Shb src homology 2 domain-containing transforming protein B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9786 + EM:09786 STOCK Shb/Oulu EMMA sperm HEPD0613_4_G08 mutant strain MGI:4451783 Shb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98294 Shb src homology 2 domain-containing transforming protein B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9786 + EM:09467 STOCK Setd7/Flmg EMMA embryo mutant strain MGI:5828599 Setd7 targeted mutation 1.1, Iannis Talianidis MGI:1920501 Setd7 SET domain containing (lysine methyltransferase) 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9467 + EM:09993 STOCK Setbp1/IcsOrl EMMA sperm EPD0445_3_E05, G6-EPD0445_3_E05 mutant strain MGI:4442011 Setbp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933199 Setbp1 SET binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9993 + EM:02138 STOCK Selenon/Orl EMMA sperm SEPN1 -/- (K51-326 L-), STOCK Sepn1/Orl mutant strain MGI:4946396 Selenon targeted mutation 1.2, Mathieu Rederstorff MGI:2151208 Selenon selenoprotein N https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2138 + EM:11938 STOCK Selenon Gulo/Cnrm EMMA embryo mutant strain MGI:4946396 Selenon targeted mutation 1.2, Mathieu Rederstorff MGI:2151208 Selenon selenoprotein N https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11938 + EM:11938 STOCK Selenon Gulo/Cnrm EMMA embryo mutant strain MGI:2158350 Gulo targeted mutation 1, Nobuyo Maeda MGI:1353434 Gulo gulonolactone (L-) oxidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11938 + EM:11938 STOCK Selenon Gulo/Cnrm EMMA sperm mutant strain MGI:4946396 Selenon targeted mutation 1.2, Mathieu Rederstorff MGI:2151208 Selenon selenoprotein N https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11938 + EM:11938 STOCK Selenon Gulo/Cnrm EMMA sperm mutant strain MGI:2158350 Gulo targeted mutation 1, Nobuyo Maeda MGI:1353434 Gulo gulonolactone (L-) oxidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11938 + EM:04400 STOCK Scnn1g/Orl EMMA embryo B6N;129-Scnn1g/Orl, Scnn1g lox/lox mutant strain MGI:3832674 Scnn1g targeted mutation 1.1, Edith Hummer MGI:104695 Scnn1g sodium channel, nonvoltage-gated 1 gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4400 + EM:04397 STOCK Scnn1b/Orl EMMA embryo Liddle, B6;129P2-Scnn1b/Orl mutant strain MGI:2448620 Scnn1b targeted mutation 1.1, Edith Hummler MGI:104696 Scnn1b sodium channel, nonvoltage-gated 1 beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4397 + EM:04397 STOCK Scnn1b/Orl EMMA sperm Liddle, B6;129P2-Scnn1b/Orl mutant strain MGI:2448620 Scnn1b targeted mutation 1.1, Edith Hummler MGI:104696 Scnn1b sodium channel, nonvoltage-gated 1 beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4397 + EM:04399 STOCK Scnn1b/Orl EMMA embryo B6;129P2-Scnn1b/Orl, Scnn1b lox/lox mutant strain MGI:3832670 Scnn1b targeted mutation 1.1, Edith Hummler MGI:104696 Scnn1b sodium channel, nonvoltage-gated 1 beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4399 + EM:10603 STOCK Scaper/Ics EMMA sperm HEPD0654_7_D07, G4647 mutant strain MGI:4455688 Scaper targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1925976 Scaper S phase cyclin A-associated protein in the ER https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10603 + EM:10603 STOCK Scaper/Ics EMMA live HEPD0654_7_D07, G4647 mutant strain MGI:4455688 Scaper targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1925976 Scaper S phase cyclin A-associated protein in the ER https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10603 + EM:01876 STOCK sau Foxq1/sau<+> Foxq1<+>/H EMMA embryo M1239B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1876 + EM:01876 STOCK sau Foxq1/sau<+> Foxq1<+>/H EMMA embryo M1239B mutant strain MGI:3607721 sau sauron MGI:3607718 sau sauron https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1876 + EM:01876 STOCK sau Foxq1/sau<+> Foxq1<+>/H EMMA sperm M1239B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1876 + EM:01876 STOCK sau Foxq1/sau<+> Foxq1<+>/H EMMA sperm M1239B mutant strain MGI:3607721 sau sauron MGI:3607718 sau sauron https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1876 + EM:09173 STOCK Samd8/Cnrm EMMA embryo B6N;129P2-Samd8/Cnrm mutant strain MGI:5707963 Samd8 targeted mutation 2.1, Klaus Willecke MGI:1914880 Samd8 sterile alpha motif domain containing 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9173 + EM:09173 STOCK Samd8/Cnrm EMMA sperm B6N;129P2-Samd8/Cnrm mutant strain MGI:5707963 Samd8 targeted mutation 2.1, Klaus Willecke MGI:1914880 Samd8 sterile alpha motif domain containing 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9173 + EM:09172 STOCK Samd8/Cnrm EMMA embryo B6N;129P2-SMSr/Cnrm mutant strain MGI:5707954 Samd8 targeted mutation 1.1, Klaus Willecke MGI:1914880 Samd8 sterile alpha motif domain containing 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9172 + EM:09172 STOCK Samd8/Cnrm EMMA sperm B6N;129P2-SMSr/Cnrm mutant strain MGI:5707954 Samd8 targeted mutation 1.1, Klaus Willecke MGI:1914880 Samd8 sterile alpha motif domain containing 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9172 + EM:01691 STOCK Rvm/H EMMA embryo GENA333, C3H;C-Rvm/H mutant stock MGI:1934625 Rvm retinal vascular mass MGI:1934624 Rvm retinal vascular mass https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1691 ? EM:13253 STOCK Rora/Cnrm EMMA archived mutant strain MGI:5000017 Rora targeted mutation 1, Dennis D M O'Leary MGI:104661 Rora RAR-related orphan receptor alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13253 - EM:05802 STOCK Ripply3/WtsiCnbc EMMA embryo mutant strain MGI:4433779 Ripply3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2181192 Ripply3 ripply transcriptional repressor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5802 - EM:05802 STOCK Ripply3/WtsiCnbc EMMA sperm mutant strain MGI:4433779 Ripply3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2181192 Ripply3 ripply transcriptional repressor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5802 + EM:01388 STOCK Rgs4/Orl EMMA embryo B6;129P2-Rgs4/Orl, Rgs4lacZ mutant strain MGI:3580388 Rgs4 targeted mutation 1, Jean-Francois Brunet MGI:108409 Rgs4 regulator of G-protein signaling 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1388 + EM:05207 STOCK Rffl/Orl EMMA embryo Rffltbetageo mutant strain MGI:3846097 Rffl targeted mutation 1, Michel Cohen-Tannoudji MGI:1914588 Rffl ring finger and FYVE like domain containing protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5207 + EM:11959 STOCK Ret/H EMMA sperm mutant strain MGI:3662623 Ret targeted mutation 1, Rudiger Klein MGI:97902 Ret ret proto-oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11959 + EM:02081 STOCK Ret/Kctt EMMA embryo Ret KO, Cg-Ret/Kctt mutant strain MGI:2136894 Ret targeted mutation 1, Frank Costantini MGI:97902 Ret ret proto-oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2081 + EM:02080 STOCK Ret/Kctt EMMA embryo B6;129P2-Ret/Kctt, Ret flox mutant strain MGI:4440475 Ret targeted mutation 1.1, Patrik Ernfors MGI:97902 Ret ret proto-oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2080 + EM:09839 STOCK Rasal3/CipheOrl EMMA sperm HEPD0529_2_H07 mutant strain MGI:4436426 Rasal3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444128 Rasal3 RAS protein activator like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9839 + EM:10003 STOCK Ralb/H EMMA sperm B6.Cg-Ralb/H mutant strain MGI:5505280 Ralb targeted mutation 1.2, Christopher J Marshall MGI:1927244 Ralb v-ral simian leukemia viral oncogene B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10003 + EM:10002 STOCK Rala/H EMMA sperm RalA, B6.Cg-Rala/H, C57BL/6-Rala/CjmH mutant strain MGI:5505279 Rala targeted mutation 1.2, Christopher J Marshall MGI:1927243 Rala v-ral simian leukemia viral oncogene A (ras related) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10002 + EM:00161 STOCK Rag2/Orl EMMA embryo STOCK Rag2/Ciml, STOCK Rag2, Rag2<0> mutant stock MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=161 + EM:00161 STOCK Rag2/Orl EMMA sperm STOCK Rag2/Ciml, STOCK Rag2, Rag2<0> mutant stock MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=161 + EM:07459 STOCK Rag2 Thy1 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA embryo Rag2-/- Tg HY +/+ Thy1.1 mutant strain MGI:3579311 Thy1 a variant MGI:98747 Thy1 thymus cell antigen 1, theta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7459 + EM:07459 STOCK Rag2 Thy1 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA embryo Rag2-/- Tg HY +/+ Thy1.1 mutant strain MGI:3044562 Tg(TcraH-Y,TcrbH-Y)71Vbo transgene insertion 71, Harald von Boehmer MGI:3044559 Tg(TcraH-Y,TcrbH-Y)71Vbo transgene insertion 71, Harald von Boehmer https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7459 + EM:07459 STOCK Rag2 Thy1 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA embryo Rag2-/- Tg HY +/+ Thy1.1 mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7459 - EM:07003 STOCK Rag2 Ifnar1 Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain Ifnar1 Ifnar1 MGI:107658 Ifnar1 interferon (alpha and beta) receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7003 - EM:07003 STOCK Rag2 Ifnar1 Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain MGI:2665105 Tg(TcrLCMV)327Sdz transgene insertion 327, Birgit Ledermann MGI:2665109 Tg(TcrLCMV)327Sdz transgene insertion 327, Birgit Ledermann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7003 - EM:07003 STOCK Rag2 Ifnar1 Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7003 + EM:07463 STOCK Rag2 Cd40 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA archived mutant strain MGI:1857457 Cd40 targeted mutation 1, Hitoshi Kikutani MGI:88336 Cd40 CD40 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7463 + EM:07463 STOCK Rag2 Cd40 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA archived mutant strain MGI:3044562 Tg(TcraH-Y,TcrbH-Y)71Vbo transgene insertion 71, Harald von Boehmer MGI:3044559 Tg(TcraH-Y,TcrbH-Y)71Vbo transgene insertion 71, Harald von Boehmer https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7463 + EM:07463 STOCK Rag2 Cd40 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA archived mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7463 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6943 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6943 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1857235 Prf1 targeted mutation 1, Sandoz Pharmaceuticals MGI:97551 Prf1 perforin 1 (pore forming protein) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6943 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6943 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6943 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6943 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/°, HUMAMICE mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/°, HUMAMICE mutant strain MGI:1857235 Prf1 targeted mutation 1, Sandoz Pharmaceuticals MGI:97551 Prf1 perforin 1 (pore forming protein) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/°, HUMAMICE mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/°, HUMAMICE mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/°, HUMAMICE mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/°, HUMAMICE mutant strain MGI:2429736 Il2rg targeted mutation 1, Kazuo Sugamura MGI:96551 Il2rg interleukin 2 receptor, gamma chain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/°, HUMAMICE mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6327 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6326 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6326 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6326 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6326 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:2429736 Il2rg targeted mutation 1, Kazuo Sugamura MGI:96551 Il2rg interleukin 2 receptor, gamma chain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6326 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6326 - EM:05517 STOCK Rab29/WtsiOulu EMMA embryo mutant strain MGI:4432353 Rab29 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385107 Rab29 RAB29, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5517 + EM:07825 STOCK Rab27b/SeabH EMMA sperm B6;129-Rab27b/SeabH, Rab27B knock-out mutant strain MGI:3706986 Rab27b targeted mutation 1.2, Miguel C Seabra MGI:1931295 Rab27b RAB27B, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7825 + EM:09994 STOCK Rab19/IcsOrl EMMA sperm HEPD0535_2_C06, E255-HEPD0535_2_C06 mutant strain MGI:4434870 Rab19 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103292 Rab19 RAB19, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9994 - EM:11491 STOCK Ptprc Rag2 Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11491 - EM:11491 STOCK Ptprc Rag2 Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain MGI:2665105 Tg(TcrLCMV)327Sdz transgene insertion 327, Birgit Ledermann MGI:2665109 Tg(TcrLCMV)327Sdz transgene insertion 327, Birgit Ledermann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11491 - EM:11491 STOCK Ptprc Rag2 Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain MGI:4819849 Ptprc a variant MGI:97810 Ptprc protein tyrosine phosphatase, receptor type, C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11491 + EM:09841 STOCK Ptpra/CipheOrl EMMA sperm HEPD0511_4_G01 mutant strain MGI:4434690 Ptpra targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97808 Ptpra protein tyrosine phosphatase, receptor type, A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9841 - EM:05723 STOCK Ptpn2/WtsiBiat EMMA sperm mutant strain MGI:4441737 Ptpn2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97806 Ptpn2 protein tyrosine phosphatase, non-receptor type 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5723 ? EM:12902 STOCK Ptk2b/Orl EMMA sperm mutant strain MGI:6164156 Ptk2b targeted mutation 1.2, Genoway MGI:104908 Ptk2b PTK2 protein tyrosine kinase 2 beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12902 - EM:05527 STOCK Ptges2/WtsiOulu EMMA embryo mutant strain MGI:4432215 Ptges2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917592 Ptges2 prostaglandin E synthase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5527 + EM:10358 STOCK Ptgdr2/Biat EMMA sperm mutant strain MGI:4843032 Ptgdr2 targeted mutation 1, Velocigene MGI:1330275 Ptgdr2 prostaglandin D2 receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10358 ? EM:11052 STOCK Pten Tg(Alb1-cre) Tg(Alb1-HCVN)35Sml/Orl EMMA archived mutant strain Pten Pten MGI:109583 Pten phosphatase and tensin homolog https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11052 ? EM:11052 STOCK Pten Tg(Alb1-cre) Tg(Alb1-HCVN)35Sml/Orl EMMA archived mutant strain Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11052 ? EM:11052 STOCK Pten Tg(Alb1-cre) Tg(Alb1-HCVN)35Sml/Orl EMMA archived mutant strain MGI:3513779 Tg(Alb1-HCVN)35Sml transgene insertion 35, Stanley M Lemon MGI:3625827 Tg(Alb1-HCVN)35Sml transgene insertion 35, Stanley M Lemon https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11052 + EM:09646 STOCK Prnp Tg(Prnp-PRNP)361Jmto/Cnbc EMMA embryo Prpn tm2Edin tg(moPrpn 129Val-HuPrP-361) Jmtorres, tgVal129/tg361 mutant strain MGI:5803836 Tg(Prnp-PRNP)361Jmto transgene insertion 361, Juan Maria Torres MGI:5803835 Tg(Prnp-PRNP)361Jmto transgene insertion 361, Juan Maria Torres https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9646 + EM:09646 STOCK Prnp Tg(Prnp-PRNP)361Jmto/Cnbc EMMA embryo Prpn tm2Edin tg(moPrpn 129Val-HuPrP-361) Jmtorres, tgVal129/tg361 mutant strain MGI:2387688 Prnp targeted mutation 2, Edinburgh University MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9646 + EM:09644 STOCK Prnp Tg(Prnp-PRNP)340Jmto/Cnbc EMMA embryo Prpn tm2Edin tg(moPrpn 129Met-HuPrP-340) Jmtorres mutant strain MGI:2387688 Prnp targeted mutation 2, Edinburgh University MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9644 + EM:09644 STOCK Prnp Tg(Prnp-PRNP)340Jmto/Cnbc EMMA embryo Prpn tm2Edin tg(moPrpn 129Met-HuPrP-340) Jmtorres mutant strain MGI:5803821 Tg(Prnp-PRNP)340Jmto transgene insertion 340, Juan Maria Torres MGI:5803814 Tg(Prnp-PRNP)340Jmto transgene insertion 340, Juan Maria Torres https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9644 + EM:05415 STOCK Prnp Tg(Prnp-PRNP)110Jmto/Cnbc EMMA embryo STOCK Prnp Tg(moPrpn BoPrP)110Jmto/Cnbc, Prpn tm2Edin tg(moPrpn BoPrP)110 Jmto mutant strain MGI:2387688 Prnp targeted mutation 2, Edinburgh University MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5415 + EM:05415 STOCK Prnp Tg(Prnp-PRNP)110Jmto/Cnbc EMMA embryo STOCK Prnp Tg(moPrpn BoPrP)110Jmto/Cnbc, Prpn tm2Edin tg(moPrpn BoPrP)110 Jmto mutant strain MGI:5476799 Tg(Prnp-PRNP)110Jmto transgene insertion 110, Juan Maria Torres MGI:5476796 Tg(Prnp-PRNP)110Jmto transgene insertion 110, Juan Maria Torres https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5415 + EM:05415 STOCK Prnp Tg(Prnp-PRNP)110Jmto/Cnbc EMMA sperm STOCK Prnp Tg(moPrpn BoPrP)110Jmto/Cnbc, Prpn tm2Edin tg(moPrpn BoPrP)110 Jmto mutant strain MGI:2387688 Prnp targeted mutation 2, Edinburgh University MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5415 + EM:05415 STOCK Prnp Tg(Prnp-PRNP)110Jmto/Cnbc EMMA sperm STOCK Prnp Tg(moPrpn BoPrP)110Jmto/Cnbc, Prpn tm2Edin tg(moPrpn BoPrP)110 Jmto mutant strain MGI:5476799 Tg(Prnp-PRNP)110Jmto transgene insertion 110, Juan Maria Torres MGI:5476796 Tg(Prnp-PRNP)110Jmto transgene insertion 110, Juan Maria Torres https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5415 + EM:05416 STOCK Prnp Tg(Prnp-PRNP)001Jmto/Cnbc EMMA embryo tg(moPrpn PoPrP)001 Jmto, STOCK Prnp Tg(moPrpn PoPrP)001Jmto/Cnb mutant strain MGI:5476823 Tg(Prnp-PRNP)001Jmto transgene insertion 001, Juan Maria Torres MGI:5476816 Tg(Prnp-PRNP)001Jmto transgene insertion 001, Juan Maria Torres https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5416 + EM:05416 STOCK Prnp Tg(Prnp-PRNP)001Jmto/Cnbc EMMA embryo tg(moPrpn PoPrP)001 Jmto, STOCK Prnp Tg(moPrpn PoPrP)001Jmto/Cnb mutant strain MGI:2387688 Prnp targeted mutation 2, Edinburgh University MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5416 + EM:05416 STOCK Prnp Tg(Prnp-PRNP)001Jmto/Cnbc EMMA sperm tg(moPrpn PoPrP)001 Jmto, STOCK Prnp Tg(moPrpn PoPrP)001Jmto/Cnb mutant strain MGI:5476823 Tg(Prnp-PRNP)001Jmto transgene insertion 001, Juan Maria Torres MGI:5476816 Tg(Prnp-PRNP)001Jmto transgene insertion 001, Juan Maria Torres https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5416 + EM:05416 STOCK Prnp Tg(Prnp-PRNP)001Jmto/Cnbc EMMA sperm tg(moPrpn PoPrP)001 Jmto, STOCK Prnp Tg(moPrpn PoPrP)001Jmto/Cnb mutant strain MGI:2387688 Prnp targeted mutation 2, Edinburgh University MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5416 + EM:04338 STOCK Prnp Tg(Prnp/PRNP*ARR)FM16Pcg/H EMMA embryo mutant strain MGI:5779528 Tg(Prnp/PRNP*ARR)FM16Pcg transgene insertion FM16, Peter Griffiths MGI:5779527 Tg(Prnp/PRNP*ARR)FM16Pcg transgene insertion FM16, Peter Griffiths https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4338 + EM:04338 STOCK Prnp Tg(Prnp/PRNP*ARR)FM16Pcg/H EMMA embryo mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4338 + EM:02421 STOCK Prnp Tg(Prnp/PRNP)1Drb/H EMMA embryo mutant strain MGI:5762584 Tg(Prnp/PRNP)1Drb transgene insertion 1, David R Brown MGI:5762582 Tg(Prnp/PRNP)1Drb transgene insertion 1, David R Brown https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2421 + EM:02421 STOCK Prnp Tg(Prnp/PRNP)1Drb/H EMMA embryo mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2421 + EM:02539 STOCK Prnp Tg(Prnp-PRNP*6OR)K6M16Pcg/H EMMA embryo mutant strain MGI:5775417 Tg(Prnp-PRNP*6OR)K6M16Pcg transgene insertion K6M16, Peter Griffiths MGI:5775416 Tg(Prnp-PRNP*6OR)K6M16Pcg transgene insertion K6M16, Peter Griffiths https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2539 + EM:02539 STOCK Prnp Tg(Prnp-PRNP*6OR)K6M16Pcg/H EMMA embryo mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2539 + EM:06144 STOCK Prnp Tg(Prnp*D177N*M128V)G1Rchi/Cnrm EMMA embryo Tg(CJD-G1)/Prnp0/0 mutant strain MGI:5614760 Tg(Prnp*D177N*M128V)G1Rchi transgene insertion G1, Roberto Chiesa MGI:5614759 Tg(Prnp*D177N*M128V)G1Rchi transgene insertion G1, Roberto Chiesa https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6144 + EM:06144 STOCK Prnp Tg(Prnp*D177N*M128V)G1Rchi/Cnrm EMMA embryo Tg(CJD-G1)/Prnp0/0 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6144 + EM:06144 STOCK Prnp Tg(Prnp*D177N*M128V)G1Rchi/Cnrm EMMA sperm Tg(CJD-G1)/Prnp0/0 mutant strain MGI:5614760 Tg(Prnp*D177N*M128V)G1Rchi transgene insertion G1, Roberto Chiesa MGI:5614759 Tg(Prnp*D177N*M128V)G1Rchi transgene insertion G1, Roberto Chiesa https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6144 + EM:06144 STOCK Prnp Tg(Prnp*D177N*M128V)G1Rchi/Cnrm EMMA sperm Tg(CJD-G1)/Prnp0/0 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6144 + EM:06142 STOCK Prnp Tg(Prnp*)CDah/Cnrm EMMA embryo STOCK Prnp Tg(Prnp-PG14)1Dah/Cnrm, Tg(PG14-C)/Prnp0/0, STOCK Prnp Tg(Prnp-PG14)CDah/Cnrm mutant strain MGI:5563233 Tg(Prnp*)CDah transgene insertion C, David A Harris MGI:5563232 Tg(Prnp*)CDah transgene insertion C, David A Harris https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6142 + EM:06142 STOCK Prnp Tg(Prnp*)CDah/Cnrm EMMA embryo STOCK Prnp Tg(Prnp-PG14)1Dah/Cnrm, Tg(PG14-C)/Prnp0/0, STOCK Prnp Tg(Prnp-PG14)CDah/Cnrm mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6142 + EM:06141 STOCK Prnp Tg(Prnp)E1Rchi/Cnrm EMMA embryo Tg(WT-E1)/Prnp0/0 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6141 + EM:06141 STOCK Prnp Tg(Prnp)E1Rchi/Cnrm EMMA embryo Tg(WT-E1)/Prnp0/0 mutant strain MGI:5563239 Tg(Prnp)E1Rchi transgene insertion E1, Roberto Chiesa MGI:5563236 Tg(Prnp)E1Rchi transgene insertion E1, Roberto Chiesa https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6141 + EM:06141 STOCK Prnp Tg(Prnp)E1Rchi/Cnrm EMMA sperm Tg(WT-E1)/Prnp0/0 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6141 + EM:06141 STOCK Prnp Tg(Prnp)E1Rchi/Cnrm EMMA sperm Tg(WT-E1)/Prnp0/0 mutant strain MGI:5563239 Tg(Prnp)E1Rchi transgene insertion E1, Roberto Chiesa MGI:5563236 Tg(Prnp)E1Rchi transgene insertion E1, Roberto Chiesa https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6141 + EM:02028 STOCK Prnp Tg(Prnp)941Zbz/Cnrm EMMA embryo PrPmyc, B6,129Sv-Tg941(myc),PrnpZH1/zH1, B6;129/Sv-Tg941(myc),PrnpZH1/zH1, Tg941 PrPmyc mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2028 + EM:02028 STOCK Prnp Tg(Prnp)941Zbz/Cnrm EMMA embryo PrPmyc, B6,129Sv-Tg941(myc),PrnpZH1/zH1, B6;129/Sv-Tg941(myc),PrnpZH1/zH1, Tg941 PrPmyc mutant strain MGI:5318499 Tg(Prnp)941Zbz transgene insertion 941, University Hospital Zurich MGI:5318498 Tg(Prnp)941Zbz transgene insertion 941, University Hospital Zurich https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2028 + EM:02027 STOCK Prnp Tg(Prnp)940Zbz/Cnrm EMMA embryo PrPmyc, B6,129Sv-Tg940(myc),PrnpZH1/zH1, Tg940 PrPmyc mutant strain MGI:5318492 Tg(Prnp)940Zbz transgene insertion 940, University Hospital Zurich MGI:5318491 Tg(Prnp)940Zbz transgene insertion 940, University Hospital Zurich https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2027 + EM:02027 STOCK Prnp Tg(Prnp)940Zbz/Cnrm EMMA embryo PrPmyc, B6,129Sv-Tg940(myc),PrnpZH1/zH1, Tg940 PrPmyc mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2027 + EM:01828 STOCK Prnp Tg(Pcp2-Prnp)F332Zbz/Cnrm EMMA embryo Prnp-Tg(PrPdelta134)332Zbz, B6.Cg-Prnp Tg(L7-Prnp)F332/Cnrm, F332 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1828 + EM:01828 STOCK Prnp Tg(Pcp2-Prnp)F332Zbz/Cnrm EMMA embryo Prnp-Tg(PrPdelta134)332Zbz, B6.Cg-Prnp Tg(L7-Prnp)F332/Cnrm, F332 mutant strain MGI:5014403 Tg(Pcp2-Prnp)F332Zbz transgene insertion F332, Zurich MGI:5014394 Tg(Pcp2-Prnp)F332Zbz transgene insertion F332, Zurich https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1828 + EM:01836 STOCK Prnp Tg(Pcp2-Prnp)F13Zbz/Cnrm EMMA embryo TgF13/Prnp, F13, B6.Cg-Prnp Tg(L7-Prnp)F13/Cnrm mutant strain MGI:5014380 Tg(Pcp2-Prnp)F13Zbz transgene insertion F13, Zurich MGI:5014378 Tg(Pcp2-Prnp)F13Zbz transgene insertion F13, Zurich https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1836 + EM:01836 STOCK Prnp Tg(Pcp2-Prnp)F13Zbz/Cnrm EMMA embryo TgF13/Prnp, F13, B6.Cg-Prnp Tg(L7-Prnp)F13/Cnrm mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1836 + EM:01824 STOCK Prnp Tg(Pcp2-Prnp)E330Zbz/Cnrm EMMA embryo B6.Cg-Prnp Tg(L7-Prnp)E330, E330 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1824 + EM:01824 STOCK Prnp Tg(Pcp2-Prnp)E330Zbz/Cnrm EMMA embryo B6.Cg-Prnp Tg(L7-Prnp)E330, E330 mutant strain MGI:5014494 Tg(Pcp2-Prnp)E330Zbz transgene insertion E330, Zurich MGI:5014493 Tg(Pcp2-Prnp)E330Zbz transgene insertion E330, Zurich https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1824 + EM:01837 STOCK Prnp Tg(Eno2-Prnp)#Aag/Cnrm EMMA embryo NSE-PrP, STOCK-Prnp Tg(Eno-Prnp)/Cnrm, NSE-PrP Prnp, B6,129-TgN[NSE]Prnp ZH1/ZH1 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1837 + EM:01837 STOCK Prnp Tg(Eno2-Prnp)#Aag/Cnrm EMMA embryo NSE-PrP, STOCK-Prnp Tg(Eno-Prnp)/Cnrm, NSE-PrP Prnp, B6,129-TgN[NSE]Prnp ZH1/ZH1 mutant strain MGI:5013941 Tg(Eno2-Prnp)#Aag transgene insertion, Adriano Aguzzi MGI:5013940 Tg(Eno2-Prnp)#Aag transgene insertion, Adriano Aguzzi https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1837 + EM:08437 STOCK Prdm6/Biat EMMA sperm B6.129Ola-Prdm6 tm1Gew mutant strain MGI:5576799 Prdm6 targeted mutation 1.1, Jurgen Ruland MGI:2684938 Prdm6 PR domain containing 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8437 + EM:06222 STOCK Pmel/Kctt EMMA embryo Pmel KO, B6;129-Pmel/Kctt mutant strain MGI:5294792 Pmel targeted mutation 1.1, Leif Andersson MGI:98301 Pmel premelanosome protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6222 + EM:09990 STOCK Plekhg3/IcsOrl EMMA sperm E238-HEPD0530_4_D07, HEPD0530_4_D07 mutant strain MGI:4435115 Plekhg3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2388284 Plekhg3 pleckstrin homology domain containing, family G (with RhoGef domain) member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9990 + EM:13679 STOCK Plcg2/H EMMA live mutant strain MGI:4455703 Plcg2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97616 Plcg2 phospholipase C, gamma 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13679 - EM:10360 STOCK Plau/H EMMA sperm mutant strain MGI:4944525 Plau targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97611 Plau plasminogen activator, urokinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10360 + EM:01947 STOCK Pk27053/Ieg EMMA sperm PK27506 mutant strain MGI:5752521 Pk27053 pyruvate kinase activity mutant 27053 MGI:5752518 Pk27053 pyruvate kinase activity mutant 27053 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1947 + EM:05454 STOCK Piwil4/Cnrm EMMA embryo Miwi2 null mutant strain MGI:5320638 Piwil4 targeted mutation 2.1, Donal O'Carroll MGI:3041167 Piwil4 piwi-like RNA-mediated gene silencing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5454 - EM:05884 STOCK Pitpnm1/WtsiIeg EMMA sperm mutant strain MGI:4431584 Pitpnm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1197524 Pitpnm1 phosphatidylinositol transfer protein, membrane-associated 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5884 - EM:05431 STOCK Pik3cg/WtsiOulu EMMA embryo mutant strain MGI:4432229 Pik3cg targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353576 Pik3cg phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5431 - EM:05431 STOCK Pik3cg/WtsiOulu EMMA sperm mutant strain MGI:4432229 Pik3cg targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353576 Pik3cg phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5431 + EM:09618 STOCK Pik3ap1/CipheOrl EMMA sperm EPD0393_2_G04 mutant strain MGI:4419954 Pik3ap1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933177 Pik3ap1 phosphoinositide-3-kinase adaptor protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9618 + EM:07453 STOCK Phox2b/Orl EMMA sperm Phox2b27Alacki mutant strain MGI:4418298 Phox2b targeted mutation 4, Jean-Francois Brunet MGI:1100882 Phox2b paired-like homeobox 2b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7453 - EM:11098 STOCK Phox2b/H EMMA sperm mutant strain MGI:4418265 Phox2b targeted mutation 3.1, Jean-Francois Brunet MGI:1100882 Phox2b paired-like homeobox 2b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11098 + EM:04758 STOCK Phox2a/Orl EMMA embryo Phox2alox, B6D2.129S2-Phox2a/Orl mutant strain MGI:4438118 Phox2a targeted mutation 2.1, Jean-Francois Brunet MGI:106633 Phox2a paired-like homeobox 2a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4758 + EM:11939 STOCK Phf10/Ieg EMMA sperm mutant strain MGI:5497157 Phf10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1919307 Phf10 PHD finger protein 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11939 ? EM:14683 STOCK Pgd/IcsOrl EMMA archived mutant strain Pgd Pgd MGI:97553 Pgd phosphogluconate dehydrogenase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14683 + EM:09987 STOCK Pgd/IcsOrl EMMA sperm EPD0117_4_C03, ICS-EPD0117_4_C03-1 mutant strain MGI:4431737 Pgd targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97553 Pgd phosphogluconate dehydrogenase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9987 + EM:00142 STOCK Pde6b/H EMMA embryo GENA309, Pde6b, C3H.B6(Cg)-Pde6b/H, C3.Cg-Pde6b/H, C3H.C-Pde6b/H, C3H;C-Pde6b/H mutant strain MGI:2178315 Pde6b atypical retinal degeneration 2 MGI:97525 Pde6b phosphodiesterase 6B, cGMP, rod receptor, beta polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=142 + EM:00142 STOCK Pde6b/H EMMA sperm GENA309, Pde6b, C3H.B6(Cg)-Pde6b/H, C3.Cg-Pde6b/H, C3H.C-Pde6b/H, C3H;C-Pde6b/H mutant strain MGI:2178315 Pde6b atypical retinal degeneration 2 MGI:97525 Pde6b phosphodiesterase 6B, cGMP, rod receptor, beta polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=142 + EM:09998 STOCK Pcsk1/IcsOrl EMMA sperm EPD0508_1_C08, E253-EPD0508_1_C08 mutant strain MGI:4441678 Pcsk1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97511 Pcsk1 proprotein convertase subtilisin/kexin type 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9998 + EM:11110 STOCK Pcdh10/H EMMA sperm mutant strain MGI:6473471 Pcdh10 targeted mutation 1a, National Laboratory Animal Center MGI:1338042 Pcdh10 protocadherin 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11110 + EM:09446 STOCK Pax7 Mapk14/JpellH EMMA sperm STOCK Mapk14 Pax7/JpellH mutant strain MGI:3715522 Mapk14 targeted mutation 14, Angel R Nebreda MGI:1346865 Mapk14 mitogen-activated protein kinase 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9446 + EM:09446 STOCK Pax7 Mapk14/JpellH EMMA sperm STOCK Mapk14 Pax7/JpellH mutant strain MGI:3497712 Pax7 targeted mutation 1, Mario R Capecchi MGI:97491 Pax7 paired box 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9446 + EM:00998 STOCK Pax6/Cnrm EMMA embryo B6;Cg-Pax6/Ibcm, RLA (Retinal enhancer-LAcZ), STOCK Pax6/Ibcm mutant strain MGI:1934347 Pax6 targeted mutation 1, Peter Gruss MGI:97490 Pax6 paired box 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=998 + EM:09958 STOCK Pax4/IcsOrl EMMA sperm HEPD0670_7_A04 mutant strain MGI:4841624 Pax4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97488 Pax4 paired box 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9958 + EM:01942 STOCK Pax2/H EMMA embryo GENA380, C3H;C-Pax2/H, Opdc(GENA380), C3H;C-Opdc/H, STOCK Opdc/H mutant stock MGI:1934620 Pax2 optic disc coloboma MGI:97486 Pax2 paired box 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1942 + EM:06218 STOCK Pawr/Cnbc EMMA embryo CD1;129-Pawr/Cnbc mutant strain MGI:2678021 Pawr targeted mutation 1, Jorge Moscat MGI:2149961 Pawr PRKC, apoptosis, WT1, regulator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6218 + EM:10037 STOCK Parp1/IcsOrl EMMA sperm G4786, HEPD0555_6_C04 mutant strain MGI:4435467 Parp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1340806 Parp1 poly (ADP-ribose) polymerase family, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10037 + EM:11256 STOCK Pafah1b1/Ics EMMA sperm G4878b, HEPD0602_6_E12 mutant strain MGI:6117756 Pafah1b1 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:109520 Pafah1b1 platelet-activating factor acetylhydrolase, isoform 1b, subunit 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11256 + EM:05628 STOCK Otx2/Cnrm EMMA embryo Otx2delta3SS mutant strain MGI:4365828 Otx2 targeted mutation 9, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5628 + EM:05626 STOCK Otx2/Cnrm EMMA embryo Otx2-Flox mutant strain MGI:2661065 Otx2 targeted mutation 6, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5626 + EM:05642 STOCK Otx2/Cnrm EMMA embryo STOCK Otx2/Cnrm mutant strain MGI:6468491 Otx1 targeted mutation 5.1, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5642 + EM:05633 STOCK Otx2/Cnrm EMMA embryo Otx2FL-Otd mutant strain MGI:2157779 Otx2 targeted mutation 4, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5633 + EM:05632 STOCK Otx2/Cnrm EMMA embryo Otx2-Otd mutant strain MGI:2157778 Otx2 targeted mutation 3, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5632 + EM:05630 STOCK Otx2/Cnrm EMMA embryo Otx2-lambda mutant strain MGI:2150146 Otx2 targeted mutation 2, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5630 + EM:05623 STOCK Otx2/Cnrm EMMA embryo Otx2-Lacz mutant strain MGI:1857510 Otx2 targeted mutation 1, Institut Pasteur MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5623 + EM:05645 STOCK Otx2/Cnrm EMMA embryo STOCK Otx2/Cnrm mutant strain MGI:6468506 Otx2 targeted mutation 17, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5645 + EM:05644 STOCK Otx2/2Cnrm EMMA embryo STOCK Otx2/Cnrm mutant strain MGI:6468499 Otx2 targeted mutation 16, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5644 + EM:05643 STOCK Otx2/Cnrm EMMA embryo STOCK Otx2/Cnrm mutant strain MGI:6468505 Otx2 targeted mutation 15, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5643 + EM:05647 STOCK Otx2/Cnrm EMMA embryo mutant strain MGI:6468504 Otx2 targeted mutation 14, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5647 + EM:05647 STOCK Otx2/Cnrm EMMA sperm mutant strain MGI:6468504 Otx2 targeted mutation 14, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5647 + EM:05646 STOCK Otx2/Cnrm EMMA embryo mutant strain MGI:6468502 Otx2 targeted mutation 13, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5646 + EM:05646 STOCK Otx2/Cnrm EMMA sperm mutant strain MGI:6468502 Otx2 targeted mutation 13, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5646 + EM:05641 STOCK Otx2/Cnrm EMMA embryo STOCK Otx2/Cnrm, Otx2 RK-AA mutant strain MGI:5573195 Otx2 targeted mutation 12.1, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5641 + EM:05624 STOCK Otx2/Cnrm EMMA embryo Otx2-GFP mutant strain MGI:4365830 Otx2 targeted mutation 11, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5624 + EM:05629 STOCK Otx2/Cnrm EMMA embryo Otx2-deltaCD mutant strain MGI:4365829 Otx2 targeted mutation 10, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5629 + EM:05640 STOCK Otx2/Cnrm EMMA embryo Otx2-CreER mutant strain MGI:5473314 Otx2 targeted mutation 1.1, Magdalena Goetz MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5640 + EM:05640 STOCK Otx2/Cnrm EMMA sperm Otx2-CreER mutant strain MGI:5473314 Otx2 targeted mutation 1.1, Magdalena Goetz MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5640 + EM:05631 STOCK Otx2/Cnrm EMMA embryo Otx2-hOtx1 mutant strain MGI:2153202 Otx2 targeted mutation 1, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5631 + EM:05639 STOCK Otx1/Cnrm EMMA embryo mutant strain MGI:6468494 Otx1 targeted mutation 6, Antonio Simeone MGI:97450 Otx1 orthodenticle homeobox 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5639 + EM:05638 STOCK Otx1/Cnrm EMMA embryo mutant strain MGI:6468490 Otx1 targeted mutation 5, Antonio Simeone MGI:97450 Otx1 orthodenticle homeobox 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5638 + EM:05622 STOCK Otx1/Cnrm EMMA embryo Otx1-Cre mutant strain MGI:2661060 Otx1 targeted mutation 4, Antonio Simeone MGI:97450 Otx1 orthodenticle homeobox 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5622 + EM:05621 STOCK Otx1/Cnrm EMMA embryo mutant strain MGI:2153199 Otx1 targeted mutation 2, Antonio Simeone MGI:97450 Otx1 orthodenticle homeobox 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5621 + EM:05620 STOCK Otx1/Cnrm EMMA embryo Otx1-LacZ mutant strain MGI:2136272 Otx1 targeted mutation 1, Antonio Simeone MGI:97450 Otx1 orthodenticle homeobox 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5620 + EM:05636 STOCK Otp/Cnrm EMMA embryo Otp-LacZ mutant strain MGI:2180541 Otp targeted mutation 1, Antonio Simeone MGI:99835 Otp orthopedia homeobox https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5636 + EM:00187 STOCK Ostes/H EMMA embryo Ost, T667, trembly, C3H101H-Ostes/H mutant strain MGI:3689329 Ostes ostes MGI:3688249 Ostes ostes https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=187 + EM:00187 STOCK Ostes/H EMMA sperm Ost, T667, trembly, C3H101H-Ostes/H mutant strain MGI:3689329 Ostes ostes MGI:3688249 Ostes ostes https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=187 + EM:09373 STOCK Nub1/Ph EMMA archived HEPD0664_6_C08 mutant strain MGI:4841553 Nub1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1889001 Nub1 negative regulator of ubiquitin-like proteins 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9373 - EM:07818 STOCK Ntf5/IcsOrl EMMA sperm mutant strain MGI:4436129 Ntf5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97381 Ntf5 neurotrophin 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7818 - EM:11552 STOCK Nox4 Tg(Tek-cre)1Ywa/Orl EMMA embryo mutant strain MGI:5896730 Nox4 targeted mutation 1.2, Harald H H W Schmidt MGI:1354184 Nox4 NADPH oxidase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11552 - EM:11552 STOCK Nox4 Tg(Tek-cre)1Ywa/Orl EMMA embryo mutant strain MGI:2450311 Tg(Tek-cre)1Ywa transgene insertion 1, Masashi Yanagisawa MGI:2450309 Tg(Tek-cre)1Ywa transgene insertion 1, Masashi Yanagisawa https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11552 - EM:11553 STOCK Nox4 Tg(Myh11-icre/ERT2)1Soff/Orl EMMA embryo mutant strain MGI:5896730 Nox4 targeted mutation 1.2, Harald H H W Schmidt MGI:1354184 Nox4 NADPH oxidase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11553 - EM:11553 STOCK Nox4 Tg(Myh11-icre/ERT2)1Soff/Orl EMMA embryo mutant strain MGI:3819270 Tg(Myh11-icre/ERT2)1Soff transgene insertion 1, Stefan Offermanns Tg(Myh11-cre/ERT2)1Soff transgene insertion 1, Stefan Offermanns https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11553 - EM:11554 STOCK Nox4 Tg(Camk2a-cre)2Gsc/Orl EMMA embryo mutant strain MGI:2181426 Tg(Camk2a-cre)2Gsc transgene insertion 2, Gunther Schutz MGI:2181425 Tg(Camk2a-cre)2Gsc transgene insertion 2, Gunther Schutz https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11554 - EM:11554 STOCK Nox4 Tg(Camk2a-cre)2Gsc/Orl EMMA embryo mutant strain MGI:5896730 Nox4 targeted mutation 1.2, Harald H H W Schmidt MGI:1354184 Nox4 NADPH oxidase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11554 + EM:10414 STOCK Noto/Kctt EMMA sperm mutant strain MGI:5317920 Noto targeted mutation 2.1, Achim Gossler MGI:3053002 Noto notochord homeobox https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10414 + EM:10371 STOCK Noto/Kctt EMMA sperm mutant strain MGI:3053092 Noto targeted mutation 1, Achim Gossler MGI:3053002 Noto notochord homeobox https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10371 + EM:06271 STOCK Nfkbia Tg(KRT14-cre)1Cgn/Ieg EMMA embryo K14cre Ikba mutant strain MGI:3577709 Nfkbia targeted mutation 1, Klaus Pfeffer MGI:104741 Nfkbia nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6271 + EM:06271 STOCK Nfkbia Tg(KRT14-cre)1Cgn/Ieg EMMA embryo K14cre Ikba mutant strain MGI:2652655 Tg(KRT14-cre)1Cgn transgene insertion 1, University of Cologne MGI:2652653 Tg(KRT14-cre)1Cgn transgene insertion 1, University of Cologne https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6271 + EM:07146 STOCK Nebl/Cnrm EMMA embryo Nebulette knockout mouse mutant strain MGI:7277813 Nebl targeted mutation 1, Ju Chen MGI:1921353 Nebl nebulette https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7146 + EM:07146 STOCK Nebl/Cnrm EMMA sperm Nebulette knockout mouse mutant strain MGI:7277813 Nebl targeted mutation 1, Ju Chen MGI:1921353 Nebl nebulette https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7146 + EM:07147 STOCK Neb/Cnrm EMMA embryo mutant strain MGI:5618471 Neb targeted mutation 2.1, Ju Chen MGI:97292 Neb nebulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7147 + EM:07147 STOCK Neb/Cnrm EMMA sperm mutant strain MGI:5618471 Neb targeted mutation 2.1, Ju Chen MGI:97292 Neb nebulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7147 ? EM:07145 STOCK Neb/Cnrm EMMA archived mutant strain MGI:3664092 Neb targeted mutation 1, Ju Chen MGI:97292 Neb nebulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7145 + EM:06115 STOCK Nbr1/H EMMA sperm Nbr1D50R mutant strain MGI:6750916 Nbr1 targeted mutation 2, Caroline A Whitehouse MGI:108498 Nbr1 NBR1, autophagy cargo receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6115 + EM:11120 STOCK Nanog/Cnrm EMMA embryo mutant strain MGI:6468554 Nanog targeted mutation 1.1, Antonio Simeone MGI:1919200 Nanog Nanog homeobox https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11120 + EM:11120 STOCK Nanog/Cnrm EMMA sperm mutant strain MGI:6468554 Nanog targeted mutation 1.1, Antonio Simeone MGI:1919200 Nanog Nanog homeobox https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11120 + EM:05011 STOCK Myo7a/WtsiCnbc EMMA embryo Shaker1 mutant strain MGI:1856716 Myo7a shaker 1 MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5011 + EM:05020 STOCK Myo7a/WtsiH EMMA embryo Moonwalker, Sanger Moonwalker mutant strain MGI:1860092 Myo7a shaker 1, 6 Jackson MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5020 + EM:00428 STOCK Myo7a<816SB>/NihrH EMMA sperm Myo7a, Myo7a, CBBS-Myo7a<816SB>/NihrH mutant strain MGI:2155423 Myo7a<816SB> shaker 816SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=428 + EM:04897 STOCK Myo7a<4626SB>/WtsiCnbc EMMA embryo Myo7a<4626SB> mutant strain MGI:2155422 Myo7a<4626SB> shaker 4626SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4897 + EM:00442 STOCK Myo7a<4626SB>/NihrH EMMA embryo CBBS-Myo7a<4626SB>/NihrH, Myo7a, Myo7a mutant strain MGI:2155422 Myo7a<4626SB> shaker 4626SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=442 + EM:00442 STOCK Myo7a<4626SB>/NihrH EMMA sperm CBBS-Myo7a<4626SB>/NihrH, Myo7a, Myo7a mutant strain MGI:2155422 Myo7a<4626SB> shaker 4626SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=442 + EM:00436 STOCK Myo7a<4494SB>/NihrH EMMA sperm CBBS-Myo7a<4494SB>/NihrH, Myo7a, Myo7a mutant strain MGI:2155421 Myo7a<4494SB> shaker 4494SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=436 + EM:00427 STOCK Myo7a<3336SB>/NihrH EMMA sperm CBBS-Myo7a<3336SB>/H, Myo7a, Myo7a<3336SB>/NihrH mutant strain MGI:2155420 Myo7a<3336SB> shaker 3336SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=427 + EM:00441 STOCK Myo7a<26SB>/NihrH EMMA sperm Myo7a, Myo7a, CBBS-Myo7a<26SB>/NihrH mutant strain MGI:2155417 Myo7a<26SB> shaker 26SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=441 - EM:10988 STOCK Myh7b/WtsiPh EMMA sperm mutant strain MGI:5013737 Myh7b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3710243 Myh7b myosin, heavy chain 7B, cardiac muscle, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10988 - EM:05672 STOCK Mx1/WtsiH EMMA sperm mutant strain MGI:4431734 Mx1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97243 Mx1 MX dynamin-like GTPase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5672 + EM:01952 STOCK Mut921/H EMMA embryo MUT/921, MUT921 mutant strain MGI:5430732 Mut921 Mut921 MGI:5430735 Mut921 Mut921 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1952 + EM:01951 STOCK Mut1602/H EMMA embryo MUT1602, MUT/1602 mutant strain MGI:5470123 Mut1602 Mut1602 MGI:5470121 Mut1602 Mut1602 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1951 + EM:01954 STOCK Mut1544/H EMMA embryo MUT1544, MUT/1544 mutant strain MGI:5442354 Mut1544 Mut1544 MGI:5442350 Mut1544 Mut1544 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1954 + EM:01977 STOCK Mut1488/H EMMA embryo MUT/1488, MUT1488 mutant strain MGI:5470112 Mut1488 Mut1488 MGI:5470110 Mut1488 Mut1488 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1977 + EM:01976 STOCK Mut1397/H EMMA embryo MUT/1397, MUT1397 mutant strain MGI:5428963 Mut1397 Mut1397 MGI:5428961 Mut1397 Mut1397 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1976 + EM:01948 STOCK Mut1305/H EMMA embryo MUT1305, MUT/1305 mutant strain MGI:5429756 Mut1305 Mut1305 MGI:5429751 Mut1305 Mut1305 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1948 + EM:01950 STOCK Mut1293/H EMMA embryo MUT1293, MUT/1293 mutant strain MGI:5427423 Mut1293 Mut1293 MGI:5427421 Mut1293 Mut1293 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1950 + EM:01949 STOCK Mut1264/H EMMA embryo MUT/1264, MUT1264 mutant strain MGI:5427414 Mut1264 Mut1264 MGI:5427412 Mut1264 Mut1264 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1949 + EM:01953 STOCK Mut1154/H EMMA embryo MUT/1154, MUT1154 mutant strain MGI:5427409 Mut1154 Mut1154 MGI:5427407 Mut1154 Mut1154 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1953 + EM:14012 STOCK Mta3/WtsiOulu EMMA embryo mutant strain MGI:4419906 Mta3 targeted mutation 3a, Wellcome Trust Sanger Institute MGI:2151172 Mta3 metastasis associated 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14012 + EM:08236 STOCK Msh5/Cnrm EMMA embryo Msh5 mutant strain MGI:1858057 Msh5 targeted mutation 1, Raju Kucherlapati MGI:1329021 Msh5 mutS homolog 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8236 + EM:08236 STOCK Msh5/Cnrm EMMA sperm Msh5 mutant strain MGI:1858057 Msh5 targeted mutation 1, Raju Kucherlapati MGI:1329021 Msh5 mutS homolog 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8236 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:5829575 Tg(Tcra-V19-J33)#Lantz transgene insertion, Olivier Lantz MGI:5829571 Tg(Tcra-V19-J33)#Lantz transgene insertion, Olivier Lantz https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4509 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:5829578 Tg(Tcrb-V6)#Lantz transgene insertion, Olivier Lantz MGI:5829577 Tg(Tcrb-V6)#Lantz transgene insertion, Olivier Lantz https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4509 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:1857253 Tap1 targeted mutation 1, Philip Ashton-Rickardt MGI:98483 Tap1 transporter 1, ATP-binding cassette, sub-family B (MDR/TAP) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4509 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:3664578 Mr1 targeted mutation 1, Susan Gilfillan MGI:1195463 Mr1 major histocompatibility complex, class I-related https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4509 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:2180883 Tcra targeted mutation 1, Michael J Owen MGI:98553 Tcra T cell receptor alpha chain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4509 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:1927205 Cd74 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:96534 Cd74 CD74 antigen (invariant polypeptide of major histocompatibility complex, class II antigen-associated) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4509 + EM:09986 STOCK Mok/IcsOrl EMMA sperm HEPD0530_7_A11 mutant strain MGI:4841489 Mok targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1336881 Mok MOK protein kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9986 + EM:08367 STOCK Mog/Flmg EMMA sperm B6-Mog/Flmg mutant strain MGI:3689957 Mog targeted mutation 1, George Kollias MGI:97435 Mog myelin oligodendrocyte glycoprotein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8367 + EM:09960 STOCK Mmp9/IcsOrl EMMA sperm mutant strain MGI:5286404 Mmp9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97011 Mmp9 matrix metallopeptidase 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9960 + EM:05667 STOCK Mlana/Cnbc EMMA sperm Mlana mutant strain MGI:5476663 Mlana targeted mutation 1.2, Friedrich Beermann MGI:108454 Mlana melan-A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5667 + EM:05333 STOCK Mlana/Cnbc EMMA sperm Mlana, B6;129-Mlana/Cnbc mutant strain MGI:5476658 Mlana targeted mutation 1.1, Friedrich Beermann MGI:108454 Mlana melan-A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5333 + EM:10361 STOCK Mkrn1/Biat EMMA sperm mutant strain MGI:5430125 Mkrn1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1859353 Mkrn1 makorin, ring finger protein, 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10361 + EM:00439 STOCK Mitf/H EMMA embryo Mitf, GENA336, C3H;C-Mitf/H, Rorp mutant strain MGI:2178357 Mitf retinal orange patches MGI:104554 Mitf melanogenesis associated transcription factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=439 + EM:00439 STOCK Mitf/H EMMA sperm Mitf, GENA336, C3H;C-Mitf/H, Rorp mutant strain MGI:2178357 Mitf retinal orange patches MGI:104554 Mitf melanogenesis associated transcription factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=439 ? EM:12387 STOCK Mirc35/Kctt EMMA sperm mutant strain Mirc35 Mirc35 MGI:5475136 Mirc35 microRNA cluster 35, including Mir182 through Mir183 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12387 + EM:05330 STOCK Mir451a/Cnrm EMMA embryo STOCK Mir451/Cnrm mutant strain MGI:4829620 Mir451a targeted mutation 1.2, Donal O'Carroll MGI:3619412 Mir451a microRNA 451a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5330 + EM:05330 STOCK Mir451a/Cnrm EMMA sperm STOCK Mir451/Cnrm mutant strain MGI:4829620 Mir451a targeted mutation 1.2, Donal O'Carroll MGI:3619412 Mir451a microRNA 451a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5330 + EM:05328 STOCK Mir144/Mir451a/Cnrm EMMA embryo STOCK Mir144/Mir451/Cnrm mutant strain MGI:4829618 Mir144/Mir451a targeted mutation 1.2, Donal O'Carroll MGI:2676829 Mir144 microRNA 144 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5328 ? EM:11109 STOCK Micu1/H EMMA sperm mutant strain MGI:6473466 Micu1 targeted mutation 1a, National Laboratory Animal Center MGI:2384909 Micu1 mitochondrial calcium uptake 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11109 + EM:00262 STOCK Mgmt Tg(CRP-cre)1Iz/Cnrm EMMA embryo STOCK Tg(CRP-cre)1Iz Mgmt/Cnrm, STOCK Tg(CRP-cre)1Iz Agat, STOCK Tg(CRP-cre)1Iz Mgmt/Ibcm, floxed(mgmt)-Tg/hCRP-Cre mutant stock MGI:2652465 Tg(CRP-cre)1Iz transgene insertion 1, Manfred F Rajewsky MGI:2652463 Tg(CRP-cre)1Iz transgene insertion 1, Manfred F Rajewsky https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=262 + EM:00262 STOCK Mgmt Tg(CRP-cre)1Iz/Cnrm EMMA embryo STOCK Tg(CRP-cre)1Iz Mgmt/Cnrm, STOCK Tg(CRP-cre)1Iz Agat, STOCK Tg(CRP-cre)1Iz Mgmt/Ibcm, floxed(mgmt)-Tg/hCRP-Cre mutant stock MGI:2652462 Mgmt targeted mutation 1, Manfred F Rajewsky MGI:96977 Mgmt O-6-methylguanine-DNA methyltransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=262 + EM:09502 STOCK Men1/Flmg EMMA embryo Men1floxed/floxed mutant strain MGI:2675250 Men1 targeted mutation 1, Zhao-Qi Wang MGI:1316736 Men1 multiple endocrine neoplasia 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9502 + EM:09755 STOCK Meis3/Cnrm EMMA sperm STOCK Meis3/Cnrm mutant strain MGI:5660020 Meis3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:108519 Meis3 Meis homeobox 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9755 + EM:10029 STOCK Mbd5/Ics EMMA sperm EPD0056_1_E03 mutant strain MGI:4434485 Mbd5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2138934 Mbd5 methyl-CpG binding domain protein 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10029 ? EM:08375 STOCK Mapkapk2/Flmg EMMA sperm mutant strain MGI:6357679 Mapkapk2 targeted mutation 1.2, George Kollias MGI:109298 Mapkapk2 MAP kinase-activated protein kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8375 ? EM:08374 STOCK Mapkapk2/Flmg EMMA sperm mutant strain MGI:6357678 Mapkapk2 targeted mutation 1.1, George Kollias MGI:109298 Mapkapk2 MAP kinase-activated protein kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8374 + EM:08371 STOCK Map3k8/Flmg EMMA sperm B6-Map3k8tm1.2Gkl/Flmg mutant strain MGI:5476711 Map3k8 targeted mutation 1.2, George Kollias MGI:1346878 Map3k8 mitogen-activated protein kinase kinase kinase 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8371 + EM:08428 STOCK Map3k7/Flmg EMMA sperm TAK1delta/+ [B6-Map3k7tm1.2Gkl/Flmg] mutant strain MGI:5576980 Map3k7 targeted mutation 1.2, George Kollias MGI:1346877 Map3k7 mitogen-activated protein kinase kinase kinase 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8428 + EM:08404 STOCK Map3k7/Flmg EMMA sperm TAK1FL/FL mutant strain MGI:5576979 Map3k7 targeted mutation 1.1, George Kollias MGI:1346877 Map3k7 mitogen-activated protein kinase kinase kinase 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8404 + EM:00423 STOCK Maf/H EMMA embryo OFL, C3H101H-Maf/H mutant strain MGI:2654153 Maf opaque flecks in lens MGI:96909 Maf avian musculoaponeurotic fibrosarcoma oncogene homolog https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=423 + EM:00423 STOCK Maf/H EMMA sperm OFL, C3H101H-Maf/H mutant strain MGI:2654153 Maf opaque flecks in lens MGI:96909 Maf avian musculoaponeurotic fibrosarcoma oncogene homolog https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=423 + EM:01877 STOCK M241b Foxq1/M241b<+> Foxq1<+>/H EMMA embryo M241B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1877 + EM:01877 STOCK M241b Foxq1/M241b<+> Foxq1<+>/H EMMA embryo M241B mutant strain MGI:5515441 M241b mutant 241b MGI:5515439 M241b mutant 241b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1877 + EM:01877 STOCK M241b Foxq1/M241b<+> Foxq1<+>/H EMMA sperm M241B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1877 + EM:01877 STOCK M241b Foxq1/M241b<+> Foxq1<+>/H EMMA sperm M241B mutant strain MGI:5515441 M241b mutant 241b MGI:5515439 M241b mutant 241b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1877 + EM:09826 STOCK Lsm14b/WtsiPh EMMA sperm DEPD00559_1_C05 mutant strain MGI:4950120 Lsm14b targeted mutation 1a, Mouse Biology Program, UCDavis MGI:3040677 Lsm14b LSM family member 14B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9826 + EM:02514 STOCK Lrig3/RobH EMMA embryo mutant strain MGI:6468484 Lrig3 targeted mutation 1, Elizabeth Robertson MGI:2443955 Lrig3 leucine-rich repeats and immunoglobulin-like domains 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2514 ? EM:13124 STOCK Loxl3/Cnbc EMMA sperm mutant strain MGI:4431542 Loxl3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1337004 Loxl3 lysyl oxidase-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13124 + EM:12882 STOCK Loxl2/Cnbc EMMA embryo mutant strain MGI:5750228 Loxl2 targeted mutation 1.2, Amparo Cano MGI:2137913 Loxl2 lysyl oxidase-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12882 + EM:12916 STOCK Loxl2/2AcanCnbc EMMA embryo mutant strain MGI:5750228 Loxl2 targeted mutation 1.2, Amparo Cano MGI:2137913 Loxl2 lysyl oxidase-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12916 + EM:13005 STOCK Loxl2/Cnbc EMMA embryo mutant strain MGI:5750226 Loxl2 targeted mutation 1.1, Amparo Cano MGI:2137913 Loxl2 lysyl oxidase-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13005 + EM:04898 STOCK Lmx1a/Cnbc EMMA embryo Mutanlallemande mutant strain MGI:5423987 Lmx1a mutanlallemand MGI:1888519 Lmx1a LIM homeobox transcription factor 1 alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4898 + EM:10357 STOCK Lipa/Biat EMMA sperm INFRA-HEPD0960_2_H11-1 mutant strain MGI:5428633 Lipa targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96789 Lipa lysosomal acid lipase A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10357 + EM:11119 STOCK Lin28b/Cnrm EMMA embryo Lin28bdeltaOBS mutant strain MGI:6468553 Lin28b targeted mutation 1, Antonio Simeone MGI:3584032 Lin28b lin-28 homolog B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11119 + EM:11119 STOCK Lin28b/Cnrm EMMA sperm Lin28bdeltaOBS mutant strain MGI:6468553 Lin28b targeted mutation 1, Antonio Simeone MGI:3584032 Lin28b lin-28 homolog B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11119 + EM:01706 STOCK Lim2/H EMMA embryo C3H101H-Lim2/H, To3 mutant strain MGI:1862040 Lim2 total opacity 3 MGI:104698 Lim2 lens intrinsic membrane protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1706 + EM:02183 STOCK Lig4/ApbH EMMA sperm C57BL/6JSfdAnu-Lig4/ApbH, C57BL/6Apb-Lig4/ApbH, Tiny, Lig4Y288C, C57BL/6JApb-Lig4/ApbH, C57BL/6Apb-Lig4/Apb, C57BL/6Apb-Lig4/Apb mutant strain MGI:3714783 Lig4 tiny MGI:1335098 Lig4 ligase IV, DNA, ATP-dependent https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2183 + EM:02519 STOCK Lhx1/H EMMA embryo Lim-1 (Lhx-1) mutant strain MGI:1857848 Lhx1 targeted mutation 1, Richard R Behringer MGI:99783 Lhx1 LIM homeobox protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2519 + EM:07422 STOCK Lgals3/H EMMA sperm SJL;Cg-Lgals3/H, SJL/J Lgals3 mutant strain MGI:2183057 Lgals3 targeted mutation 1, Francoise Poirier MGI:96778 Lgals3 lectin, galactose binding, soluble 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7422 + EM:00129 STOCK Lcl/H EMMA embryo C3;CAnN-Lcl/H, C3.Cg-Lcl/H, C3H.C-Lcl/H, Lcl, C3N;CAnN-Lcl/H mutant strain MGI:2178627 Lcl lens cloudy MGI:2149028 Lcl lens cloudy https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=129 + EM:00129 STOCK Lcl/H EMMA sperm C3;CAnN-Lcl/H, C3.Cg-Lcl/H, C3H.C-Lcl/H, Lcl, C3N;CAnN-Lcl/H mutant strain MGI:2178627 Lcl lens cloudy MGI:2149028 Lcl lens cloudy https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=129 + EM:12384 STOCK Lama3/Ieg EMMA sperm mutant strain MGI:6121104 Lama3 targeted mutation 1, TaconicArtemis MGI:99909 Lama3 laminin, alpha 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12384 + EM:09157 STOCK L3mbtl2/WtsiPh EMMA sperm EPD0960_5_A06 mutant strain MGI:5472695 L3mbtl2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2443584 L3mbtl2 L3MBTL2 polycomb repressive complex 1 subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9157 + EM:10723 STOCK Klhl4/Oulu EMMA embryo mutant strain MGI:6317340 Klhl4 targeted mutation 1, Kari Alitalo MGI:2442829 Klhl4 kelch-like 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10723 + EM:02205 STOCK Kit/H EMMA embryo C3H101H-Kit/H mutant strain MGI:1856258 Kit banded MGI:96677 Kit KIT proto-oncogene receptor tyrosine kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2205 ? EM:11386 STOCK Kdm6b/Wtsi EMMA archived mutant strain MGI:6317387 Kdm6b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2448492 Kdm6b KDM1 lysine (K)-specific demethylase 6B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11386 + EM:10166 STOCK Kcnip3/Orl EMMA sperm P5370-HEPD0546_1_G09, HEPD0546_1_G09 mutant strain MGI:4436314 Kcnip3 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1929258 Kcnip3 Kv channel interacting protein 3, calsenilin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10166 + EM:02515 STOCK Invs/H EMMA embryo INV mutant strain MGI:1856915 Invs inversion of embryonic turning MGI:1335082 Invs inversin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2515 + EM:08502 STOCK Il10/Cnbc EMMA sperm EPD0158_4_D06 mutant strain MGI:4432290 Il10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96537 Il10 interleukin 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8502 + EM:02108 STOCK Ighm/Orl EMMA embryo pAp-mu mutant strain MGI:4950361 Ighm targeted mutation 1.1, Ahmed Khamlichi MGI:96448 Ighm immunoglobulin heavy constant mu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2108 + EM:02111 STOCK Ighg3/Orl EMMA embryo A150 mutant strain MGI:6241553 Ighg3 targeted mutation 1, Ahmed Khamlichi MGI:2144790 Ighg3 Immunoglobulin heavy constant gamma 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2111 + EM:11091 STOCK Igh/Orl EMMA sperm mutant strain MGI:6317346 Igh targeted mutation 9.1 Michel Cogne MGI:96442 Igh immunoglobulin heavy chain complex https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11091 + EM:05659 STOCK Igh/Orl EMMA embryo IgH 3'RR-deficient mice mutant strain MGI:4836663 Igh targeted mutation 5.1, Michel Cogne MGI:96442 Igh immunoglobulin heavy chain complex https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5659 + EM:11092 STOCK Igh/Orl EMMA sperm mutant strain MGI:6317347 Igh targeted mutation 10.1, Michel Cogne MGI:96442 Igh immunoglobulin heavy chain complex https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11092 + EM:02109 STOCK Igh-8/Orl EMMA embryo pAp-gamma3 mutant strain MGI:4950363 Igh-8 targeted mutation 2.1, Ahmed Khamlichi MGI:96450 Igh-8 immunoglobulin heavy chain 8 (heavy chain of IgG3) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2109 + EM:02110 STOCK Igh-8/Orl EMMA embryo B6;129S2-Igh-8/Orl, Ig1/Ig3 mutant strain MGI:3774279 Igh-8 targeted mutation 2, Ahmed Amine Khamlichi MGI:96450 Igh-8 immunoglobulin heavy chain 8 (heavy chain of IgG3) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2110 + EM:01732 STOCK Igf2/H EMMA embryo S1.2Neo mutant stock MGI:5309176 Igf2 targeted mutation 4, Wolf Reik MGI:96434 Igf2 insulin-like growth factor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1732 - EM:10974 STOCK Hspg2/Oulu EMMA embryo C57BL/6-Hspg2/Oulu mutant strain MGI:6468552 Hspg2 targeted mutation 3.1, Raija Soininen MGI:96257 Hspg2 perlecan (heparan sulfate proteoglycan 2) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10974 - EM:10974 STOCK Hspg2/Oulu EMMA sperm C57BL/6-Hspg2/Oulu mutant strain MGI:6468552 Hspg2 targeted mutation 3.1, Raija Soininen MGI:96257 Hspg2 perlecan (heparan sulfate proteoglycan 2) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10974 ? EM:13784 STOCK Hsd17b4/Orl EMMA sperm mutant strain MGI:5523923 Hsd17b4 targeted mutation 2, Myriam Baes MGI:105089 Hsd17b4 hydroxysteroid (17-beta) dehydrogenase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13784 + EM:12344 STOCK Hsd17b4/Ph EMMA archived mutant strain MGI:2385822 Hsd17b4 targeted mutation 1, Myriam Baes MGI:105089 Hsd17b4 hydroxysteroid (17-beta) dehydrogenase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12344 + EM:02506 STOCK Hnf4a/H EMMA embryo Is Cre, Hnf4 cre mutant strain MGI:3052820 Hnf4a targeted mutation 1, Stephane D Vincent MGI:109128 Hnf4a hepatic nuclear factor 4, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2506 ? EM:13787 STOCK Hmx3/H[cc] EMMA archived mutant strain MGI:1857493 Hmx3 targeted mutation 1, Eva Bober MGI:107160 Hmx3 H6 homeobox 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13787 + EM:08992 STOCK Hmox1/Flmg EMMA embryo B6.129-Hmox1/Flmg mutant strain MGI:3846093 Hmox1 targeted mutation 1.2, George Kollias MGI:96163 Hmox1 heme oxygenase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8992 ? EM:13167 STOCK Hint2 Hint1/Orl EMMA archived mutant strain MGI:2674018 Hint1 targeted mutation 1, I Bernard Weinstein MGI:1321133 Hint1 histidine triad nucleotide binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13167 ? EM:13167 STOCK Hint2 Hint1/Orl EMMA archived mutant strain MGI:5812015 Hint2 targeted mutation 1.1, Genoway MGI:1916167 Hint2 histidine triad nucleotide binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13167 + EM:01766 STOCK Hgd/Orl EMMA archived alkaptonuria mutant strain MGI:1856664 Hgd alkaptonuria MGI:96078 Hgd homogentisate 1, 2-dioxygenase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1766 + EM:05325 STOCK Hal/H EMMA embryo Histidinaemic mutant strain MGI:1856300 Hal histidinemia MGI:96010 Hal histidine ammonia lyase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5325 + EM:02252 STOCK H2 H2-T18 Anta/H EMMA sperm Antonia mutant strain MGI:5758945 Anta antonia MGI:5758943 Anta antonia https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2252 - EM:12135 STOCK H2-M5/Wtsi EMMA embryo mutant strain MGI:4420089 H2-M5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95917 H2-M5 histocompatibility 2, M region locus 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12135 + EM:02617 STOCK Gtf2i/Cnbc EMMA archived CD1;129-Gtf2i/Cnbc, GTF2I-2loxP mutant strain MGI:5532204 Gtf2i targeted mutation 1, Victoria Campuzano MGI:1202722 Gtf2i general transcription factor II I https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2617 + EM:09667 STOCK Gt(ROSA)26Sor/H EMMA sperm mutant strain MGI:2449039 Gt(ROSA)26Sor targeted mutation 2, Frank Costantini MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9667 + EM:00410 STOCK Gt(ROSA)26Sor/Cnrm EMMA embryo RCM2, STOCK Gt(ROSA)26Sor/Ibmc mutant strain MGI:3764519 Gt(ROSA)26Sor targeted mutation 2, Anton Berns MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=410 ? EM:11487 STOCK Gt(ROSA)26Sor/Kctt EMMA sperm mutant strain Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11487 ? EM:14725 STOCK Gt(ROSA)26Sor/Orl EMMA sperm mutant strain Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14725 + EM:10455 STOCK Gt(ROSA)26Sor Tg(Siglech-cre,-mCherry)#Spar/Ph EMMA sperm B6.Cg-Gt(ROSA)26Sor Tg(Siglech-cre,-mCherry)#Spar/Ph, pDCre x RFP reporter mutant strain MGI:3696099 Gt(ROSA)26Sor targeted mutation 1, Hans Jorg Fehling MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10455 + EM:10455 STOCK Gt(ROSA)26Sor Tg(Siglech-cre,-mCherry)#Spar/Ph EMMA sperm B6.Cg-Gt(ROSA)26Sor Tg(Siglech-cre,-mCherry)#Spar/Ph, pDCre x RFP reporter mutant strain MGI:5615447 Tg(Siglech-cre,-mCherry)#Spar transgene insertion, Tim Sparwasser MGI:5615458 Tg(Siglech-cre,-mCherry)#Spar transgene insertion, Tim Sparwasser https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10455 + EM:08181 STOCK Gt(ROSA)26Sor Tg(Ltf-icre)14Mmul/Biat EMMA sperm B6;129-R26tdRFPfl-Tg(Ltf-Cre)14 mutant strain MGI:5571915 Tg(Ltf-icre)14Mmul transgene insertion 14, Mathias Muller MGI:5571911 Tg(Ltf-icre)14Mmul transgene insertion 14, Mathias Muller https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8181 + EM:08181 STOCK Gt(ROSA)26Sor Tg(Ltf-icre)14Mmul/Biat EMMA sperm B6;129-R26tdRFPfl-Tg(Ltf-Cre)14 mutant strain MGI:3696099 Gt(ROSA)26Sor targeted mutation 1, Hans Jorg Fehling MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8181 + EM:12917 STOCK Gt(ROSA)26Sor/Cncb EMMA embryo mutant strain MGI:5750303 Gt(ROSA)26Sor targeted mutation 1.1, Amparo Cano MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12917 + EM:12186 STOCK Gt(ROSA)26Sor/H EMMA sperm mutant strain MGI:6193734 Gt(ROSA)26Sor targeted mutation 1.1, Richard Mort MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12186 + EM:05648 STOCK Gt(ROSA)26Sor/Cnrm EMMA embryo mutant strain MGI:6468507 Gt(ROSA)26Sor targeted mutation 1, Antonio Simeone MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5648 + EM:13006 STOCK Gt(ROSA)26Sor/Cnbc EMMA embryo mutant strain MGI:5750301 Gt(ROSA)26Sor targeted mutation 1, Amparo Cano MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13006 ? EM:14723 STOCK Gt(ROSA)26Sor/Orl EMMA sperm mutant strain Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14723 + EM:13120 STOCK Gt(ROSA)26Sor/H EMMA sperm mutant strain MGI:6150825 Gt(ROSA)26Sor targeted mutation 1, Erwin Pauws MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13120 + EM:09668 STOCK Gt(ROSA)26Sor/H EMMA sperm STOCK Gt(ROSA)26Sor mutant strain MGI:2449038 Gt(ROSA)26Sor targeted mutation 1, Frank Costantini MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9668 + EM:11361 STOCK Gt(ROSA)26Sor Tg(Col1a2-cre/ERT,-ALPP)7Cpd/H EMMA sperm Col1a2-Cre-ER(T);Rosa26-floxed stop eYFP mutant strain MGI:3785760 Tg(Col1a2-cre/ERT,-ALPP)7Cpd transgene insertion 7, Christopher P Denton MGI:3785759 Tg(Col1a2-cre/ERT,-ALPP)7Cpd transgene insertion 7, Christopher P Denton https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11361 + EM:11361 STOCK Gt(ROSA)26Sor Tg(Col1a2-cre/ERT,-ALPP)7Cpd/H EMMA sperm Col1a2-Cre-ER(T);Rosa26-floxed stop eYFP mutant strain MGI:2449038 Gt(ROSA)26Sor targeted mutation 1, Frank Costantini MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11361 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA embryo mutant strain MGI:2183509 Gjb2 targeted mutation 1, Unite de Genetique des Deficits Sensoriels MGI:95720 Gjb2 gap junction protein, beta 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11488 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA embryo mutant strain MGI:2445311 Gt(ROSA)26Sor targeted mutation 1, Anton Berns MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11488 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA sperm mutant strain MGI:2183509 Gjb2 targeted mutation 1, Unite de Genetique des Deficits Sensoriels MGI:95720 Gjb2 gap junction protein, beta 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11488 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA sperm mutant strain MGI:2445311 Gt(ROSA)26Sor targeted mutation 1, Anton Berns MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11488 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA live mutant strain MGI:2183509 Gjb2 targeted mutation 1, Unite de Genetique des Deficits Sensoriels MGI:95720 Gjb2 gap junction protein, beta 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11488 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA live mutant strain MGI:2445311 Gt(ROSA)26Sor targeted mutation 1, Anton Berns MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11488 + EM:07451 STOCK Gt(ROSA)26Sor/Kctt EMMA embryo Gt(ROSA)26Sor-mCherry-Rpl10a, mCherryTRAP mutant strain MGI:5569759 Gt(ROSA)26Sor targeted mutation 1, Jan M Stenman MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7451 + EM:12659 STOCK Gt(ROSA)26Sor/H EMMA sperm STOCK Tg(ROSA26-LSL-SyGCaMP-WPRE)L4, B6(CB);129S6-Gt(ROSA)26Sor/H mutant strain MGI:6414618 Gt(ROSA)26Sor targeted mutation 1, Kate Hampden-Smith MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12659 ? EM:11486 STOCK Gt(ROSA)26Sor/Kctt EMMA sperm mutant strain Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11486 + EM:12809 STOCK Gsk3a Gsk3b/H EMMA sperm mutant strain MGI:3578226 Gsk3b targeted mutation 1, Dario R Alessi MGI:1861437 Gsk3b glycogen synthase kinase 3 beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12809 + EM:12809 STOCK Gsk3a Gsk3b/H EMMA sperm mutant strain MGI:3578225 Gsk3a targeted mutation 1, Dario R Alessi MGI:2152453 Gsk3a glycogen synthase kinase 3 alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12809 + EM:04895 STOCK Grxcr1/Cnbc EMMA embryo Tasmanian devil, Grxcr1, STOCK Grxcr1/WtsiCnbc[cc] mutant strain MGI:2681910 Grxcr1 tasmanian devil MGI:3577767 Grxcr1 glutaredoxin, cysteine rich 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4895 + EM:02397 STOCK Grm7 Smn1 Tg(SMN1*E134K)1Tlbt/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN*E134K)1Pks/H, STOCK Tg(SMN2)89Ahmb Smn1 Tg(SMN1*E134K)1Tlbt/H, SMN2 low/SMN E134K, STOCK Smn1 Tg(SMN1*E134K)1Tlbt Tg(SMN2)89Ahmb/H mutant strain MGI:2448989 Grm7 transgene insertion 89, Arthur H M Burghes MGI:1351344 Grm7 glutamate receptor, metabotropic 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2397 + EM:02397 STOCK Grm7 Smn1 Tg(SMN1*E134K)1Tlbt/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN*E134K)1Pks/H, STOCK Tg(SMN2)89Ahmb Smn1 Tg(SMN1*E134K)1Tlbt/H, SMN2 low/SMN E134K, STOCK Smn1 Tg(SMN1*E134K)1Tlbt Tg(SMN2)89Ahmb/H mutant strain MGI:5493441 Tg(SMN1*E134K)1Tlbt transgene insertion 1, Kevin Talbot MGI:5493438 Tg(SMN1*E134K)1Tlbt transgene insertion 1, Kevin Talbot https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2397 + EM:02397 STOCK Grm7 Smn1 Tg(SMN1*E134K)1Tlbt/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN*E134K)1Pks/H, STOCK Tg(SMN2)89Ahmb Smn1 Tg(SMN1*E134K)1Tlbt/H, SMN2 low/SMN E134K, STOCK Smn1 Tg(SMN1*E134K)1Tlbt Tg(SMN2)89Ahmb/H mutant strain MGI:2183946 Smn1 targeted mutation 1, Michael Sendtner MGI:109257 Smn1 survival motor neuron 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2397 + EM:02500 STOCK Grm7 Smg6 Smn1/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN1*delta5-Smg6)1Pks/H, SMN Delta 5 /SMN2 low, STOCK Tg(SMN2)89Ahmb Smg6 Smn1/H, STOCK Smg6 Smn1 Tg(SMN2)89Ahmb/H mutant strain MGI:2448989 Grm7 transgene insertion 89, Arthur H M Burghes MGI:1351344 Grm7 glutamate receptor, metabotropic 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2500 + EM:02500 STOCK Grm7 Smg6 Smn1/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN1*delta5-Smg6)1Pks/H, SMN Delta 5 /SMN2 low, STOCK Tg(SMN2)89Ahmb Smg6 Smn1/H, STOCK Smg6 Smn1 Tg(SMN2)89Ahmb/H mutant strain MGI:5493450 Smg6 transgene insertion 1, Nick Parkinson MGI:2144117 Smg6 SMG6 nonsense mediated mRNA decay factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2500 + EM:02500 STOCK Grm7 Smg6 Smn1/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN1*delta5-Smg6)1Pks/H, SMN Delta 5 /SMN2 low, STOCK Tg(SMN2)89Ahmb Smg6 Smn1/H, STOCK Smg6 Smn1 Tg(SMN2)89Ahmb/H mutant strain MGI:2183946 Smn1 targeted mutation 1, Michael Sendtner MGI:109257 Smn1 survival motor neuron 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2500 - EM:05794 STOCK Grin1/WtsiOrl EMMA sperm mutant strain MGI:4432313 Grin1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95819 Grin1 glutamate receptor, ionotropic, NMDA1 (zeta 1) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5794 + EM:05216 STOCK Gjd4/Cnrm EMMA embryo Cx39KO mutant strain MGI:5009133 Gjd4 targeted mutation 1.1, Julia von Maltzahn MGI:2444990 Gjd4 gap junction protein, delta 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5216 + EM:01913 STOCK Gjc3/Cnrm EMMA embryo B6NCrl;129P2-Gjc3/Ibcm, STOCK Gjc3/Ibcm, Cx29 LacZ mutant strain MGI:4420945 Gjc3 targeted mutation 1.1, Klaus Willecke MGI:2153041 Gjc3 gap junction protein, gamma 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1913 + EM:07626 STOCK Gjb6/Cnrm EMMA embryo Cx30A88V, CD1;129P2-Gjb6/Cnrm mutant strain MGI:5607781 Gjb6 targeted mutation 2.2, Klaus Willecke MGI:107588 Gjb6 gap junction protein, beta 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7626 + EM:07626 STOCK Gjb6/Cnrm EMMA sperm Cx30A88V, CD1;129P2-Gjb6/Cnrm mutant strain MGI:5607781 Gjb6 targeted mutation 2.2, Klaus Willecke MGI:107588 Gjb6 gap junction protein, beta 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7626 - EM:02193 STOCK Gja8/H EMMA embryo mutant strain MGI:1857499 Gja8 nuclear opacity 2 MGI:99953 Gja8 gap junction protein, alpha 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2193 + EM:06035 STOCK Gja5/Cnrm EMMA embryo Cx40A96S mutant strain MGI:5544269 Gja5 targeted mutation 2.1, Klaus Willecke MGI:95716 Gja5 gap junction protein, alpha 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6035 + EM:01914 STOCK Gja1/Cnrm EMMA embryo Cx43KICx43floxCx31, B6NCrl;129P2-Gja1/Cnrm, B6NCrl;129P2-Gja1/Cnrm mutant strain MGI:5004864 Gja1 targeted mutation 6.2, Klaus Willecke MGI:95713 Gja1 gap junction protein, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1914 + EM:09091 STOCK Gja1/Cnrm EMMA embryo B6N;129P2-Gja1tm79Kwi/Cnrm mutant strain MGI:5707851 Gja1 targeted mutation 11.1, Klaus Willecke MGI:95713 Gja1 gap junction protein, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9091 + EM:09091 STOCK Gja1/Cnrm EMMA sperm B6N;129P2-Gja1tm79Kwi/Cnrm mutant strain MGI:5707851 Gja1 targeted mutation 11.1, Klaus Willecke MGI:95713 Gja1 gap junction protein, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9091 + EM:08390 STOCK Gatad2b/Ics EMMA sperm HEPD0554_7_E03 mutant strain MGI:4434913 Gatad2b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443225 Gatad2b GATA zinc finger domain containing 2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8390 + EM:00073 STOCK G6pdx/H EMMA embryo G6pd, glucose-6-phosphate, G6pdx, C3H.101H-G6pdx/H, C3H.Cg-G6pdx/H mutant strain MGI:2182739 G6pdx mutation 1, Neuherberg MGI:105979 G6pdx glucose-6-phosphate dehydrogenase X-linked https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=73 + EM:06108 STOCK Fzr1/Cnbc EMMA embryo mutant strain MGI:3800718 Fzr1 targeted mutation 1, Marcos Malumbres MGI:1926790 Fzr1 fizzy and cell division cycle 20 related 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6108 + EM:06108 STOCK Fzr1/Cnbc EMMA sperm mutant strain MGI:3800718 Fzr1 targeted mutation 1, Marcos Malumbres MGI:1926790 Fzr1 fizzy and cell division cycle 20 related 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6108 + EM:14602 STOCK Fzd9/Cnbc EMMA embryo mutant strain MGI:3586504 Fzd9 targeted mutation 1, Samuel J Pleasure MGI:1313278 Fzd9 frizzled class receptor 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14602 + EM:14602 STOCK Fzd9/Cnbc EMMA sperm mutant strain MGI:3586504 Fzd9 targeted mutation 1, Samuel J Pleasure MGI:1313278 Fzd9 frizzled class receptor 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14602 + EM:00072 STOCK Fras1/PgrKieg EMMA embryo Fras-1, STOCK Fras1/Pgr, PGr-4, STOCK Fras1/PgrIeg mutant strain MGI:2667194 Fras1 targeted mutation 1, George Chalepakis MGI:2385368 Fras1 Fraser extracellular matrix complex subunit 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=72 + EM:06767 STOCK Fras1/H EMMA sperm B6;SJL-Fras1/H, Fras1 Conditional, Fras1, B6(SJL)-Fras1/H, Fras1 mutant strain MGI:5449386 Fras1 targeted mutation 1.1, Peter J Scambler MGI:2385368 Fras1 Fraser extracellular matrix complex subunit 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6767 + EM:01878 STOCK Foxq1 M876b/Foxq1<+> M876b<+>/H EMMA embryo M876B mutant strain MGI:5515453 M876b mutant 876b MGI:5515451 M876b mutant 876b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1878 + EM:01878 STOCK Foxq1 M876b/Foxq1<+> M876b<+>/H EMMA embryo M876B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1878 + EM:01868 STOCK Foxq1 M624b/Foxq1<+> M624b<+>/H EMMA embryo M624B mutant strain MGI:5515450 M624b mutant 624b MGI:5515448 M624b mutant 624b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1868 + EM:01868 STOCK Foxq1 M624b/Foxq1<+> M624b<+>/H EMMA embryo M624B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1868 + EM:01849 STOCK Foxq1 M54b/Foxq1<+> M54b<+>/H EMMA embryo M54B, STOCK M54B/H mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1849 + EM:01849 STOCK Foxq1 M54b/Foxq1<+> M54b<+>/H EMMA embryo M54B, STOCK M54B/H mutant strain MGI:5515438 M54b mutant 54b MGI:5515436 M54b mutant 54b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1849 + EM:01849 STOCK Foxq1 M54b/Foxq1<+> M54b<+>/H EMMA sperm M54B, STOCK M54B/H mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1849 + EM:01849 STOCK Foxq1 M54b/Foxq1<+> M54b<+>/H EMMA sperm M54B, STOCK M54B/H mutant strain MGI:5515438 M54b mutant 54b MGI:5515436 M54b mutant 54b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1849 + EM:01850 STOCK Foxq1 M412b/Foxq1<+> M412b<+>/H EMMA embryo M412B mutant strain MGI:5515447 M412b mutant 412b MGI:5515445 M412b mutant 412b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1850 + EM:01850 STOCK Foxq1 M412b/Foxq1<+> M412b<+>/H EMMA embryo M412B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1850 + EM:01850 STOCK Foxq1 M412b/Foxq1<+> M412b<+>/H EMMA sperm M412B mutant strain MGI:5515447 M412b mutant 412b MGI:5515445 M412b mutant 412b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1850 + EM:01850 STOCK Foxq1 M412b/Foxq1<+> M412b<+>/H EMMA sperm M412B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1850 + EM:01853 STOCK Foxq1 M369b/Foxq1<+> M369b<+>/H EMMA embryo M369B mutant strain MGI:5515444 M369b mutant 369b MGI:5515442 M369b mutant 369b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1853 + EM:01853 STOCK Foxq1 M369b/Foxq1<+> M369b<+>/H EMMA embryo M369B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1853 + EM:01853 STOCK Foxq1 M369b/Foxq1<+> M369b<+>/H EMMA sperm M369B mutant strain MGI:5515444 M369b mutant 369b MGI:5515442 M369b mutant 369b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1853 + EM:01853 STOCK Foxq1 M369b/Foxq1<+> M369b<+>/H EMMA sperm M369B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1853 + EM:01852 STOCK Foxq1 M1645b/Foxq1<+> M1645b<+>/H EMMA embryo M1645B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1852 + EM:01852 STOCK Foxq1 M1645b/Foxq1<+> M1645b<+>/H EMMA embryo M1645B mutant strain MGI:5515465 M1645b mutant 1645b MGI:5515463 M1645b mutant 1645b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1852 + EM:01852 STOCK Foxq1 M1645b/Foxq1<+> M1645b<+>/H EMMA sperm M1645B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1852 + EM:01852 STOCK Foxq1 M1645b/Foxq1<+> M1645b<+>/H EMMA sperm M1645B mutant strain MGI:5515465 M1645b mutant 1645b MGI:5515463 M1645b mutant 1645b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1852 + EM:01851 STOCK Foxq1 M1616b/ Foxq1<+> M1616b<+>/H EMMA embryo M1616B mutant strain MGI:5515462 M1616b mutant 1616b MGI:5515460 M1616b mutant 1616b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1851 + EM:01851 STOCK Foxq1 M1616b/ Foxq1<+> M1616b<+>/H EMMA embryo M1616B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1851 + EM:01858 STOCK Foxq1 M1185b/Foxq1<+> M1185b<+>/H EMMA embryo M1185B mutant strain MGI:5515459 M1185b mutant 1185b MGI:5515457 M1185b mutant 1185b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1858 + EM:01858 STOCK Foxq1 M1185b/Foxq1<+> M1185b<+>/H EMMA embryo M1185B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1858 + EM:01858 STOCK Foxq1 M1185b/Foxq1<+> M1185b<+>/H EMMA sperm M1185B mutant strain MGI:5515459 M1185b mutant 1185b MGI:5515457 M1185b mutant 1185b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1858 + EM:01858 STOCK Foxq1 M1185b/Foxq1<+> M1185b<+>/H EMMA sperm M1185B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1858 + EM:01857 STOCK Foxq1 M1073b/Foxq1<+> M1073b<+>/H EMMA embryo M1073B mutant strain MGI:5515456 M1073b mutant 1073b MGI:5515454 M1073b mutant 1073b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1857 + EM:01857 STOCK Foxq1 M1073b/Foxq1<+> M1073b<+>/H EMMA embryo M1073B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1857 + EM:01857 STOCK Foxq1 M1073b/Foxq1<+> M1073b<+>/H EMMA sperm M1073B mutant strain MGI:5515456 M1073b mutant 1073b MGI:5515454 M1073b mutant 1073b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1857 + EM:01857 STOCK Foxq1 M1073b/Foxq1<+> M1073b<+>/H EMMA sperm M1073B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1857 + EM:00038 STOCK Foxn1/Orl EMMA archived B6;albino-Foxn1/Orl, C57BL/6 - nu congenic strain MGI:1856108 Foxn1 nude MGI:102949 Foxn1 forkhead box N1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=38 + EM:05943 STOCK Fntb/Cnbc EMMA sperm mutant strain MGI:3581447 Fntb targeted mutation 1, Mariano Barbacid MGI:1861305 Fntb farnesyltransferase, CAAX box, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5943 + EM:01286 STOCK Fnos2/H EMMA sperm FNOS2 mutant strain MGI:6241419 Fnos2 FNOS2 MGI:6241416 Fnos2 FNOS2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1286 + EM:09463 STOCK Flt4/Oulu EMMA embryo Vegfr3flox/flox mutant strain MGI:3805195 Flt4 targeted mutation 2.1, Kari Alitalo MGI:95561 Flt4 FMS-like tyrosine kinase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9463 + EM:05992 STOCK Fli1/Orl EMMA sperm mutant strain MGI:4878922 Fli1 targeted mutation 1.1, Francois Morle MGI:95554 Fli1 Friend leukemia integration 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5992 ? EM:10692 STOCK Fkrp/ScbrH EMMA sperm mutant strain MGI:4835411 Fkrp targeted mutation 1, S C Brown MGI:2447586 Fkrp fukutin related protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10692 + EM:08500 STOCK Fkrp/H EMMA sperm C57BL/6;129-FKRP Tyr307Asn mutant strain MGI:4835412 Fkrp targeted mutation 1.1, S C Brown MGI:2447586 Fkrp fukutin related protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8500 - EM:07684 STOCK Fgl1/IcsOrl EMMA archived mutant strain MGI:4436664 Fgl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:102795 Fgl1 fibrinogen-like protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7684 + EM:06912 STOCK Fgf7/H EMMA sperm mutant strain MGI:4455930 Fgf7 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:95521 Fgf7 fibroblast growth factor 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6912 + EM:02540 STOCK Fcgr1/Cnrm EMMA embryo STOCK Fcgr1/Cnrm, STOCK Fcgr1/Ibcm, CD64 KO on C57Bl6 mutant strain MGI:2664927 Fcgr1 targeted mutation 1, J Sjef Verbeek MGI:95498 Fcgr1 Fc receptor, IgG, high affinity I https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2540 + EM:02540 STOCK Fcgr1/Cnrm EMMA sperm STOCK Fcgr1/Cnrm, STOCK Fcgr1/Ibcm, CD64 KO on C57Bl6 mutant strain MGI:2664927 Fcgr1 targeted mutation 1, J Sjef Verbeek MGI:95498 Fcgr1 Fc receptor, IgG, high affinity I https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2540 + EM:04667 STOCK Fcamr/Cnbc EMMA embryo FcamR (4D6)- Null, STOCK Fcamr/Cnbc, FcamR-null mutant strain MGI:5882398 Fcamr targeted mutation 1.2, J Sjef Verbeek MGI:1927803 Fcamr Fc receptor, IgA, IgM, high affinity https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4667 + EM:04667 STOCK Fcamr/Cnbc EMMA sperm FcamR (4D6)- Null, STOCK Fcamr/Cnbc, FcamR-null mutant strain MGI:5882398 Fcamr targeted mutation 1.2, J Sjef Verbeek MGI:1927803 Fcamr Fc receptor, IgA, IgM, high affinity https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4667 + EM:04668 STOCK Fcamr/Cnbc EMMA embryo FcamR (4D6)- Floxed, STOCK Fcamr/Cnbc mutant strain MGI:5882402 Fcamr targeted mutation 1.1, J Sjef Verbeek MGI:1927803 Fcamr Fc receptor, IgA, IgM, high affinity https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4668 + EM:12632 STOCK Fbxw7/H EMMA sperm mutant strain MGI:4867641 Fbxw7 targeted mutation 1.1, Axel Behrens MGI:1354695 Fbxw7 F-box and WD-40 domain protein 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12632 + EM:01885 STOCK Fasl/Ieg EMMA embryo B6;129-Fasl/Ieg, FasL delta intra k.o./k.i. mutant stock MGI:4888490 Fasl targeted mutation 1.1, Geert Michel MGI:99255 Fasl Fas ligand (TNF superfamily, member 6) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1885 + EM:09945 STOCK Exd1/CipheOrl EMMA sperm HEPD0647_4_B07 mutant strain MGI:4457525 Exd1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3045306 Exd1 exonuclease 3'-5' domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9945 + EM:13686 STOCK Erfe/H EMMA live mutant strain MGI:5050886 Erfe targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:3606476 Erfe erythroferrone https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13686 + EM:02595 STOCK Epo/H EMMA embryo Epo, TgH(eposvT)1Pjr, STOCK Epo/H, Epo-Tag mutant strain MGI:3767166 Epo transgene insertion 134.3 LC, Peter J Ratcliffe MGI:95407 Epo erythropoietin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2595 + EM:07840 STOCK Eif6/Cnrm EMMA embryo eIF6 knockout mice mutant strain MGI:3817934 Eif6 targeted mutation 1, Stefano Biffo MGI:1196288 Eif6 eukaryotic translation initiation factor 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7840 + EM:07840 STOCK Eif6/Cnrm EMMA sperm eIF6 knockout mice mutant strain MGI:3817934 Eif6 targeted mutation 1, Stefano Biffo MGI:1196288 Eif6 eukaryotic translation initiation factor 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7840 + EM:09406 STOCK Eif2ak4/Cnbc EMMA embryo mutant strain MGI:3582154 Eif2ak4 targeted mutation 1.2, David Ron MGI:1353427 Eif2ak4 eukaryotic translation initiation factor 2 alpha kinase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9406 + EM:09408 STOCK Eif2ak4 Eif2ak2/Cnbc EMMA embryo GCN2KO.PKRKO.DKO_PKR_GCN2 Mixed Background mutant strain MGI:3582154 Eif2ak4 targeted mutation 1.2, David Ron MGI:1353427 Eif2ak4 eukaryotic translation initiation factor 2 alpha kinase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9408 + EM:09408 STOCK Eif2ak4 Eif2ak2/Cnbc EMMA embryo GCN2KO.PKRKO.DKO_PKR_GCN2 Mixed Background mutant strain MGI:2182590 Eif2ak2 targeted mutation 1, John C Bell MGI:1353449 Eif2ak2 eukaryotic translation initiation factor 2-alpha kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9408 + EM:11834 STOCK Egr2/Orl EMMA archived unclassified MGI:3798483 Egr2 targeted mutation 4, Patrick Charney MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11834 + EM:11828 STOCK Egr2/Orl EMMA archived unclassified MGI:2183227 Egr2 targeted mutation 3, Patrick Charnay MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11828 + EM:04482 STOCK Egr2 Tg(CD2-icre)4Kio/H EMMA sperm STOCK Egr2 Tg(CD2-cre)4Kio/H, Egr-2-cKO mutant strain MGI:2183227 Egr2 targeted mutation 3, Patrick Charnay MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4482 + EM:04482 STOCK Egr2 Tg(CD2-icre)4Kio/H EMMA sperm STOCK Egr2 Tg(CD2-cre)4Kio/H, Egr-2-cKO mutant strain MGI:2449947 Tg(CD2-icre)4Kio transgene insertion 4, Dimitris Kioussis MGI:2449946 Tg(CD2-icre)4Kio transgene insertion 4, Dimitris Kioussis https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4482 + EM:11389 STOCK Egr2 Egr3 Tg(CD2-icre)4Kio/H EMMA sperm mutant strain MGI:2180063 Egr3 targeted mutation 1, Jeffrey Milbrandt MGI:1306780 Egr3 early growth response 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11389 + EM:11389 STOCK Egr2 Egr3 Tg(CD2-icre)4Kio/H EMMA sperm mutant strain MGI:2183227 Egr2 targeted mutation 3, Patrick Charnay MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11389 + EM:11389 STOCK Egr2 Egr3 Tg(CD2-icre)4Kio/H EMMA sperm mutant strain MGI:2449947 Tg(CD2-icre)4Kio transgene insertion 4, Dimitris Kioussis MGI:2449946 Tg(CD2-icre)4Kio transgene insertion 4, Dimitris Kioussis https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11389 + EM:11829 STOCK Egr2/Orl EMMA archived unclassified MGI:1931056 Egr2 targeted mutation 2, Patrick Charnay MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11829 + EM:00438 STOCK Eda/H x C3H101HF1 EMMA sperm Tabby<43H> mutant strain MGI:5509473 Eda tabby 43 Harwell MGI:1195272 Eda ectodysplasin-A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=438 + EM:01847 STOCK Dync1h1/H EMMA embryo C3H101H-Dync1h1/H, C3H101H-Dnchc1/H, C3H;101H-Dync1h1/H, Legs at odd angles, Loa mutant strain MGI:2447991 Dync1h1 legs at odd angles MGI:103147 Dync1h1 dynein cytoplasmic 1 heavy chain 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1847 - EM:12065 STOCK Dusp1/Wtsi EMMA embryo mutant strain MGI:4364283 Dusp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:105120 Dusp1 dual specificity phosphatase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12065 + EM:09991 STOCK Dusp11/IcsOrl EMMA sperm EPD0209_1_C08 mutant strain MGI:4434394 Dusp11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919352 Dusp11 dual specificity phosphatase 11 (RNA/RNP complex 1-interacting) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9991 + EM:01169 STOCK Dsg4/Orl EMMA embryo lanceolate hair mutant strain MGI:1856929 Dsg4 lanceolate hair MGI:2661061 Dsg4 desmoglein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1169 + EM:01235 STOCK Dp(2Hoxd11)6Ddu/Orl EMMA embryo B6/129-HoxD, P11 Dup mutant strain MGI:5289967 Dp(2Hoxd11)6Ddu duplication, Chr 2, Denis Duboule 6 MGI:5288507 Dp(2Hoxd11)6Ddu duplication, Chr 2, Denis Duboule 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1235 + EM:05778 STOCK Dp(16App-Runx1)5Yah/Orl EMMA embryo Dp(16App-Runx1)5Yah mutant strain MGI:5789045 Dp(16App-Runx1)5Yah duplication, Chr 16, Yann Herault 5 MGI:5789044 Dp(16App-Runx1)5Yah duplication, Chr 16, Yann Herault 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5778 + EM:05778 STOCK Dp(16App-Runx1)5Yah/Orl EMMA sperm Dp(16App-Runx1)5Yah mutant strain MGI:5789045 Dp(16App-Runx1)5Yah duplication, Chr 16, Yann Herault 5 MGI:5789044 Dp(16App-Runx1)5Yah duplication, Chr 16, Yann Herault 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5778 + EM:09996 STOCK Dnajc5b/IcsOrl EMMA sperm HEPD0532_4_C06, E256-HEPD0532_4_C06 mutant strain MGI:4434677 Dnajc5b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913576 Dnajc5b DnaJ heat shock protein family (Hsp40) member C5 beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9996 + EM:05255 STOCK Dnah5/Cnbc EMMA embryo SI-Dnahc5-spontaneous mutant mutant strain MGI:5904965 Dnah5 hydrocephalus with situs inversus or heterotaxy MGI:107718 Dnah5 dynein, axonemal, heavy chain 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5255 + EM:05255 STOCK Dnah5/Cnbc EMMA sperm SI-Dnahc5-spontaneous mutant mutant strain MGI:5904965 Dnah5 hydrocephalus with situs inversus or heterotaxy MGI:107718 Dnah5 dynein, axonemal, heavy chain 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5255 + EM:02531 STOCK Dnah11/H EMMA embryo iv, STOCK Dnahc11/H mutant strain MGI:1856917 Dnah11 situs inversus viscerum MGI:1100864 Dnah11 dynein, axonemal, heavy chain 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2531 + EM:00390 STOCK Dmd Tg(tetO-Utrn)1Ked/H EMMA sperm Tg(UTR-TET)Ked, UTR, UTR/mdx (TEX) mutant stock MGI:1856328 Dmd X linked muscular dystrophy MGI:94909 Dmd dystrophin, muscular dystrophy https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=390 + EM:00390 STOCK Dmd Tg(tetO-Utrn)1Ked/H EMMA sperm Tg(UTR-TET)Ked, UTR, UTR/mdx (TEX) mutant stock MGI:2448084 Tg(tetO-Utrn)1Ked transgene insertion 1, Kay E Davies MGI:5140309 Tg(tetO-Utrn)1Ked transgene insertion 1, Kay E Davies https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=390 + EM:00391 STOCK Dmd Tg(Ckm-Dmd_iDp71)MCA-1Chmb/H EMMA sperm MCA/mdx, MCA, Tg(MCA)Ked mutant stock MGI:1856328 Dmd X linked muscular dystrophy MGI:94909 Dmd dystrophin, muscular dystrophy https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=391 + EM:00391 STOCK Dmd Tg(Ckm-Dmd_iDp71)MCA-1Chmb/H EMMA sperm MCA/mdx, MCA, Tg(MCA)Ked mutant stock MGI:5140740 Tg(Ckm-Dmd_iDp71)MCA-1Chmb transgene insertion MCA-1, Jeffrey S Chamberlain MGI:5140736 Tg(Ckm-Dmd_iDp71)MCA-1Chmb transgene insertion MCA-1, Jeffrey S Chamberlain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=391 + EM:02219 STOCK Dmd Tg(ACTA1-Utrn)3Ked/H EMMA sperm TgN(FLU)Ox, Tg(ACTA1-Utrn)3Ked, TgN(FLU)Ox(Freddie), Fre line, Freddie mutant strain MGI:5566891 Tg(ACTA1-Utrn)3Ked transgene insertion 3, Kay E Davies MGI:5566890 Tg(ACTA1-Utrn)3Ked transgene insertion 3, Kay E Davies https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2219 + EM:02219 STOCK Dmd Tg(ACTA1-Utrn)3Ked/H EMMA sperm TgN(FLU)Ox, Tg(ACTA1-Utrn)3Ked, TgN(FLU)Ox(Freddie), Fre line, Freddie mutant strain MGI:1856328 Dmd X linked muscular dystrophy MGI:94909 Dmd dystrophin, muscular dystrophy https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2219 + EM:05637 STOCK Dlx5/Cnrm EMMA embryo Dlx5-LacZ mutant strain MGI:2180474 Dlx5 targeted mutation 1, Giovanni Levi MGI:101926 Dlx5 distal-less homeobox 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5637 + EM:10388 STOCK Dll1/Biat EMMA sperm Dll1EGF1m, CD1;129-Dll1tm1(Dll1*)Gos/Biat mutant strain MGI:5805253 Dll1 targeted mutation 9.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10388 + EM:10370 STOCK Dll1/Kctt EMMA sperm Dll1EGF8m, CD1;129-Dll1/Kctt mutant strain MGI:5805246 Dll1 targeted mutation 8.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10370 - EM:12225 STOCK Dll1/Biat EMMA sperm mutant strain MGI:5790945 Dll1 targeted mutation 7.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12225 - EM:12224 STOCK Dll1/Biat EMMA sperm mutant strain MGI:5779556 Dll1 targeted mutation 4.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12224 + EM:10394 STOCK Dll1/Kctt EMMA sperm Dll1EGF7m, CD1;129-Dll1/Kctt mutant strain MGI:5805295 Dll1 targeted mutation 15.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10394 + EM:10393 STOCK Dll1/Kctt EMMA sperm Dll1EGF6m, CD1;129-Dll1/Kctt mutant strain MGI:5805291 Dll1 targeted mutation 14.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10393 + EM:10392 STOCK Dll1/Biat EMMA sperm Dll1EGF5m, CD1;129-Dll1/Biat mutant strain MGI:5805267 Dll1 targeted mutation 13.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10392 + EM:10391 STOCK Dll1/Biat EMMA sperm CD1;129-Dll1/Biat, Dll1EGF4m mutant strain MGI:5805265 Dll1 targeted mutation 12.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10391 + EM:10390 STOCK Dll1/Biat EMMA sperm Dll1EGF3m, CD1;129-Dll1/Biat mutant strain MGI:5805263 Dll1 targeted mutation 11.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10390 + EM:10389 STOCK Dll1/Biat EMMA sperm CD1;129-Dll1/Biat, Dll1EGF2m mutant strain MGI:5805257 Dll1 targeted mutation 10.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10389 + EM:02489 STOCK Dbp Hlf Tef/Cnrm EMMA embryo STOCK Dbp Hlf Tef/Ibmc, HLF-KO/DBP-KO/TEF-heterozygous mutant strain MGI:3045494 Tef targeted mutation 1, Ueli Schibler MGI:98663 Tef thyrotroph embryonic factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2489 + EM:02489 STOCK Dbp Hlf Tef/Cnrm EMMA embryo STOCK Dbp Hlf Tef/Ibmc, HLF-KO/DBP-KO/TEF-heterozygous mutant strain MGI:2183196 Dbp targeted mutation 1, Ueli Schibler MGI:94866 Dbp D site albumin promoter binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2489 + EM:02489 STOCK Dbp Hlf Tef/Cnrm EMMA embryo STOCK Dbp Hlf Tef/Ibmc, HLF-KO/DBP-KO/TEF-heterozygous mutant strain MGI:3045480 Hlf targeted mutation 1, Ueli Schibler MGI:96108 Hlf hepatic leukemia factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2489 + EM:09624 STOCK Dbnl/CipheOrl EMMA sperm EPD0504_4_A04 mutant strain MGI:4451400 Dbnl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:700006 Dbnl drebrin-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9624 + EM:02115 STOCK Dach1/Kctt EMMA embryo CBB6-Dach1/Kctt, CBB6;129P2-Dach1/Kctt, Dach1 KO mutant strain MGI:2448366 Dach1 targeted mutation 1, Stefan Krauss MGI:1277991 Dach1 dachshund family transcription factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2115 + EM:07405 STOCK Cyld/Flmg EMMA embryo Cyldtm1.1Gmos, Cylddelta9 mutant strain MGI:4819959 Cyld targeted mutation 1.1, George Mosialos MGI:1921506 Cyld CYLD lysine 63 deubiquitinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7405 + EM:07405 STOCK Cyld/Flmg EMMA sperm Cyldtm1.1Gmos, Cylddelta9 mutant strain MGI:4819959 Cyld targeted mutation 1.1, George Mosialos MGI:1921506 Cyld CYLD lysine 63 deubiquitinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7405 + EM:00136 STOCK Ctsl/Ieg EMMA embryo (house mouse)-Ctsl/Ieg, Nkt mutant strain MGI:1889860 Ctsl nackt MGI:88564 Ctsl cathepsin L https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=136 + EM:12388 STOCK Csn1s1/H EMMA sperm mutant strain MGI:6715302 Csn1s1 targeted mutation 2, Andreas F Kolb MGI:88540 Csn1s1 casein alpha s1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12388 + EM:09118 STOCK Csf2rb/CipheOrl EMMA sperm HEPD0596_1_D09 mutant strain MGI:4460364 Csf2rb targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1339759 Csf2rb colony stimulating factor 2 receptor, beta, low-affinity (granulocyte-macrophage) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9118 + EM:00612 STOCK Col4a1/H EMMA embryo Svc, C3H;C-Svc/H, GENA291, C3H;C-Col4a1/H mutant strain MGI:2178448 Col4a1 small with vacuolar cataract MGI:88454 Col4a1 collagen, type IV, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=612 + EM:00612 STOCK Col4a1/H EMMA sperm Svc, C3H;C-Svc/H, GENA291, C3H;C-Col4a1/H mutant strain MGI:2178448 Col4a1 small with vacuolar cataract MGI:88454 Col4a1 collagen, type IV, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=612 + EM:00379 STOCK Col4a1/H EMMA embryo GENA257, C3H;C-Raw/H, C3H;C-Col4a1/H mutant strain MGI:2178446 Col4a1 retinal arteriolar wiring MGI:88454 Col4a1 collagen, type IV, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=379 + EM:00379 STOCK Col4a1/H EMMA sperm GENA257, C3H;C-Raw/H, C3H;C-Col4a1/H mutant strain MGI:2178446 Col4a1 retinal arteriolar wiring MGI:88454 Col4a1 collagen, type IV, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=379 ? EM:13305 STOCK Cnn3/Ieg EMMA sperm mutant strain MGI:5825453 Cnn3 targeted mutation 1.1, Hassan Jumaa MGI:1919244 Cnn3 calponin 3, acidic https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13305 ? EM:13945 STOCK Chia1/WtsiPh EMMA sperm mutant strain MGI:4363305 Chia1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1932052 Chia1 chitinase, acidic 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13945 ? EM:12825 STOCK Cfap43/Biat EMMA sperm mutant strain Cfap43 Cfap43 MGI:1289258 Cfap43 cilia and flagella associated protein 43 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12825 ? EM:12824 STOCK Cfap206/Biat EMMA sperm mutant strain MGI:6466698 Cfap206 targeted mutation 1.2, Achim Gossler MGI:1916579 Cfap206 cilia and flagella associated protein 206 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12824 ? EM:12822 STOCK Cfap206/Biat EMMA sperm mutant strain MGI:6466697 Cfap206 targeted mutation 1.1, Achim Gossler MGI:1916579 Cfap206 cilia and flagella associated protein 206 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12822 ? EM:12396 STOCK Cfap157/Biat EMMA sperm mutant strain MGI:5907283 Cfap157 targeted mutation 1d, Helmholtz Zentrum Muenchen GmbH MGI:2447809 Cfap157 cilia and flagella associated protein 157 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12396 + EM:07170 STOCK Cers6/Cnrm EMMA embryo CerS6KILacZ mutant strain MGI:5523623 Cers6 targeted mutation 1.1, Klaus Willecke MGI:2442564 Cers6 ceramide synthase 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7170 + EM:07170 STOCK Cers6/Cnrm EMMA sperm CerS6KILacZ mutant strain MGI:5523623 Cers6 targeted mutation 1.1, Klaus Willecke MGI:2442564 Cers6 ceramide synthase 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7170 + EM:07171 STOCK Cers4/Cnrm EMMA embryo CerS4KILacZ mutant strain MGI:5638668 Cers4 targeted mutation 1.1, Klaus Willecke MGI:1914510 Cers4 ceramide synthase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7171 + EM:07171 STOCK Cers4/Cnrm EMMA sperm CerS4KILacZ mutant strain MGI:5638668 Cers4 targeted mutation 1.1, Klaus Willecke MGI:1914510 Cers4 ceramide synthase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7171 + EM:07163 STOCK Cers1/Cnrm EMMA embryo CerS1KO mutant strain MGI:5475110 Cers1 targeted mutation 1.1, Klaus Willecke MGI:2136690 Cers1 ceramide synthase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7163 + EM:07163 STOCK Cers1/Cnrm EMMA sperm CerS1KO mutant strain MGI:5475110 Cers1 targeted mutation 1.1, Klaus Willecke MGI:2136690 Cers1 ceramide synthase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7163 + EM:04677 STOCK Cebpb/Kctt EMMA embryo Cebpbfl (ICER/129Sv/C57BL6), STOCK Cebpb/Kctt mutant strain MGI:6260173 Cebpb targeted mutation 1.1, Magnus Nord MGI:88373 Cebpb CCAAT/enhancer binding protein (C/EBP), beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4677 + EM:04995 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a INK4a-/- mutant strain MGI:5648077 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University MGI:5648074 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4995 + EM:04995 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a INK4a-/- mutant strain MGI:2384177 Cdkn2a targeted mutation 2.1, Ronald DePinho MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4995 + EM:04997 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a Ink4a-Arf-/- mutant strain MGI:5648077 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University MGI:5648074 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4997 + EM:04997 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a Ink4a-Arf-/- mutant strain MGI:1857942 Cdkn2a targeted mutation 1, Ronald DePinho MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4997 + EM:04996 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a Arf-/- mutant strain MGI:1926877 Cdkn2a targeted mutation 1, Charles J Scherr MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4996 + EM:04996 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a Arf-/- mutant strain MGI:5648077 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University MGI:5648074 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4996 - EM:05879 STOCK Cdkn2a/WtsiIeg EMMA sperm mutant strain MGI:4460436 Cdkn2a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5879 - EM:07633 STOCK Cdk8/IcsOrl EMMA sperm mutant strain MGI:4842014 Cdk8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1196224 Cdk8 cyclin-dependent kinase 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7633 + EM:06841 STOCK Cdk7/Cnbc EMMA sperm Cdk7lox mutant strain MGI:5429213 Cdk7 gene trap D032B11, 1.1, German Gene Trap Consortium MGI:102956 Cdk7 cyclin-dependent kinase 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6841 + EM:06842 STOCK Cdk6 Cdk4/Cnbc EMMA sperm Cdk4tm1Bbd; Cdk6R31C, Cdk4R24C; Cdk6R31C mutant strain MGI:2154520 Cdk4 targeted mutation 1, Mariano Barbacid MGI:88357 Cdk4 cyclin-dependent kinase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6842 + EM:06842 STOCK Cdk6 Cdk4/Cnbc EMMA sperm Cdk4tm1Bbd; Cdk6R31C, Cdk4R24C; Cdk6R31C mutant strain MGI:5141514 Cdk6 targeted mutation 2.1, Philip Hinds MGI:1277162 Cdk6 cyclin-dependent kinase 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6842 - EM:05702 STOCK Cdk5rap2/WtsiIeg EMMA sperm mutant strain MGI:4433427 Cdk5rap2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384875 Cdk5rap2 CDK5 regulatory subunit associated protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5702 + EM:00197 STOCK Cdk5rap2/Ieg EMMA embryo STOCK an/Ieg, (house mouse)-an/Ieg, an mutant strain MGI:1856646 Cdk5rap2 Hertwig's anemia MGI:2384875 Cdk5rap2 CDK5 regulatory subunit associated protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=197 + EM:08029 STOCK Cdk4/Cnbc EMMA embryo Cdk4, Cd4<->, Cdk4 KO mutant strain MGI:3759558 Cdk4 targeted mutation 2.1, Mariano Barbacid MGI:88357 Cdk4 cyclin-dependent kinase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8029 + EM:08029 STOCK Cdk4/Cnbc EMMA sperm Cdk4, Cd4<->, Cdk4 KO mutant strain MGI:3759558 Cdk4 targeted mutation 2.1, Mariano Barbacid MGI:88357 Cdk4 cyclin-dependent kinase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8029 + EM:05931 STOCK Cdk2/Cnbc EMMA sperm mutant strain MGI:3759555 Cdk2 targeted mutation 2, Sagrario Ortega MGI:104772 Cdk2 cyclin-dependent kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5931 + EM:05941 STOCK Cdk2/Cnbc EMMA sperm mutant strain MGI:2675585 Cdk2 targeted mutation 1, Sagrario Ortega MGI:104772 Cdk2 cyclin-dependent kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5941 + EM:04896 STOCK Cdh23/WtsiCnbc EMMA embryo Waltzer mutant strain MGI:1856228 Cdh23 waltzer MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4896 + EM:01316 STOCK Cdh23/WtsiH EMMA sperm v, v(ALB) mutant stock MGI:1857310 Cdh23 Albany waltzer MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1316 + EM:06117 STOCK Cdc20/Cnbc EMMA sperm mutant strain MGI:4887480 Cdc20 targeted mutation 1.1, Marcos Malumbres MGI:1859866 Cdc20 cell division cycle 20 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6117 - EM:09989 STOCK Ccdc189/IcsOrl EMMA sperm STOCK Gm166/IcsOrl, HEPD0530_3_B05, STOCK Cfap119/IcsOrl mutant strain Ccdc189 EUCOMM targeted mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:7413980 Ccdc189 withdrawn, = Cfap119 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9989 + EM:08421 STOCK Cacna2d1/AschwAdlpnH EMMA sperm mutant strain MGI:4353680 Cacna2d1 targeted mutation 1, Arnold Schwartz MGI:88295 Cacna2d1 calcium channel, voltage-dependent, alpha2/delta subunit 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8421 + EM:05944 STOCK Braf/Cnbc EMMA sperm mutant strain MGI:4946645 Braf targeted mutation 1, Mariano Barbacid MGI:88190 Braf Braf transforming gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5944 + EM:02513 STOCK Bmp7/H EMMA embryo Bmp7 LacZ mutant strain MGI:2136986 Bmp7 targeted mutation 2, Elizabeth J Robertson MGI:103302 Bmp7 bone morphogenetic protein 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2513 + EM:02198 STOCK Bmp7/H EMMA embryo BMP7 neo mutant strain MGI:1857654 Bmp7 targeted mutation 1, Elizabeth J Robertson MGI:103302 Bmp7 bone morphogenetic protein 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2198 + EM:02505 STOCK Bmp6/H EMMA embryo CD1;129-Bmp6/H mutant strain MGI:2136985 Bmp6 targeted mutation 1, Elizabeth J Robertson MGI:88182 Bmp6 bone morphogenetic protein 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2505 - EM:07660 STOCK Bloc1s1/IcsOrl EMMA embryo mutant strain MGI:4434990 Bloc1s1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1195276 Bloc1s1 biogenesis of lysosomal organelles complex-1, subunit 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7660 - EM:07660 STOCK Bloc1s1/IcsOrl EMMA sperm mutant strain MGI:4434990 Bloc1s1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1195276 Bloc1s1 biogenesis of lysosomal organelles complex-1, subunit 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7660 + EM:00381 STOCK Bhv26/H EMMA sperm BHV26 mutant strain MGI:5646243 Bhv26 behavioral mutation 26 MGI:5646241 Bhv26 behavioral mutation 26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=381 + EM:01690 STOCK Bhv11/H EMMA embryo Wombat mouse, BHV11 mutant strain MGI:5646491 Bhv11 behavioral mutant Bhv11 MGI:5646394 Bhv11 behavioral mutant 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1690 + EM:09988 STOCK Bag1/IcsOrl EMMA sperm HEPD0505_2_B06, ICS-HEPD0505_2_B06-1 mutant strain MGI:4434714 Bag1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108047 Bag1 BCL2-associated athanogene 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9988 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA live STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA live STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA live STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA live STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1783 - EM:05922 STOCK B2m H2-Ab1 Tg(Cd4-EGFP)1Lt Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5922 - EM:05922 STOCK B2m H2-Ab1 Tg(Cd4-EGFP)1Lt Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5922 - EM:05922 STOCK B2m H2-Ab1 Tg(Cd4-EGFP)1Lt Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5922 - EM:05922 STOCK B2m H2-Ab1 Tg(Cd4-EGFP)1Lt Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5922 - EM:05922 STOCK B2m H2-Ab1 Tg(Cd4-EGFP)1Lt Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived mutant strain MGI:3720219 Tg(Cd4-EGFP)1Lt transgene insertion 1, Edward Leiter MGI:3720218 Tg(Cd4-EGFP)1Lt transgene insertion 1, Edward Leiter https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5922 ? EM:10977 STOCK B2m H2-Ab1 Foxp3 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain Foxp3 Foxp3 MGI:1891436 Foxp3 forkhead box P3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10977 ? EM:10977 STOCK B2m H2-Ab1 Foxp3 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10977 ? EM:10977 STOCK B2m H2-Ab1 Foxp3 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10977 ? EM:10977 STOCK B2m H2-Ab1 Foxp3 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10977 ? EM:10977 STOCK B2m H2-Ab1 Foxp3 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10977 - EM:06321 STOCK B2m Cd4 H2-Ab1 Tg(Cd4-CD4)2362Litt Tg(Cd4-EGFP) Tg(H2-Aa-HLA-DPA1)1Lone Tg(H2-Ab1-HLA-DPB1)1Lone Tg(HLA-A/H2-D/B2M)1Bpe/Orl EMMA archived mutant strain MGI:3720219 Tg(Cd4-EGFP)1Lt transgene insertion 1, Edward Leiter MGI:3720218 Tg(Cd4-EGFP)1Lt transgene insertion 1, Edward Leiter https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6321 - EM:06321 STOCK B2m Cd4 H2-Ab1 Tg(Cd4-CD4)2362Litt Tg(Cd4-EGFP) Tg(H2-Aa-HLA-DPA1)1Lone Tg(H2-Ab1-HLA-DPB1)1Lone Tg(HLA-A/H2-D/B2M)1Bpe/Orl EMMA archived mutant strain MGI:5494677 Tg(H2-Ab1-HLA-DPB1)1Lone transgene insertion 1, Yu Chun Lone MGI:5494676 Tg(H2-Ab1-HLA-DPB1)1Lone transgene insertion 1, Yu Chun Lone https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6321 - EM:06321 STOCK B2m Cd4 H2-Ab1 Tg(Cd4-CD4)2362Litt Tg(Cd4-EGFP) Tg(H2-Aa-HLA-DPA1)1Lone Tg(H2-Ab1-HLA-DPB1)1Lone Tg(HLA-A/H2-D/B2M)1Bpe/Orl EMMA archived mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6321 - EM:06321 STOCK B2m Cd4 H2-Ab1 Tg(Cd4-CD4)2362Litt Tg(Cd4-EGFP) Tg(H2-Aa-HLA-DPA1)1Lone Tg(H2-Ab1-HLA-DPB1)1Lone Tg(HLA-A/H2-D/B2M)1Bpe/Orl EMMA archived mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6321 - EM:06321 STOCK B2m Cd4 H2-Ab1 Tg(Cd4-CD4)2362Litt Tg(Cd4-EGFP) Tg(H2-Aa-HLA-DPA1)1Lone Tg(H2-Ab1-HLA-DPB1)1Lone Tg(HLA-A/H2-D/B2M)1Bpe/Orl EMMA archived mutant strain MGI:3702083 Tg(Cd4-CD4)2362Litt transgene insertion 2362, Dan R Littman MGI:2673105 Tg(Cd4-CD4)2362Litt transgene insertion 2362, Dan R Littman https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6321 - EM:06321 STOCK B2m Cd4 H2-Ab1 Tg(Cd4-CD4)2362Litt Tg(Cd4-EGFP) Tg(H2-Aa-HLA-DPA1)1Lone Tg(H2-Ab1-HLA-DPB1)1Lone Tg(HLA-A/H2-D/B2M)1Bpe/Orl EMMA archived mutant strain MGI:5494673 Tg(H2-Aa-HLA-DPA1)1Lone transgene insertion 1, Yu Chun Lone MGI:5494672 Tg(H2-Aa-HLA-DPA1)1Lone transgene insertion 1, Yu Chun Lone https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6321 - EM:06321 STOCK B2m Cd4 H2-Ab1 Tg(Cd4-CD4)2362Litt Tg(Cd4-EGFP) Tg(H2-Aa-HLA-DPA1)1Lone Tg(H2-Ab1-HLA-DPB1)1Lone Tg(HLA-A/H2-D/B2M)1Bpe/Orl EMMA archived mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6321 - EM:06321 STOCK B2m Cd4 H2-Ab1 Tg(Cd4-CD4)2362Litt Tg(Cd4-EGFP) Tg(H2-Aa-HLA-DPA1)1Lone Tg(H2-Ab1-HLA-DPB1)1Lone Tg(HLA-A/H2-D/B2M)1Bpe/Orl EMMA archived mutant strain MGI:1857281 Cd4 targeted mutation 1, Dan R Littman MGI:88335 Cd4 CD4 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6321 + EM:01789 STOCK Axin2/Ieg EMMA embryo CG;129P2-Axin2/Ieg, B6.129P2-Axin2/Ieg, Conductin (Axin2)-lacZ mutant strain MGI:3579503 Axin2 targeted mutation 1, Walter Birchmeier MGI:1270862 Axin2 axin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1789 + EM:02424 STOCK Axd/Cnrm EMMA embryo C.Cg-Axd/Ibcm, BALB/c - Axial defects, C.Cg-Axd/Cnrm mutant strain MGI:1856670 Axd axial defects MGI:88125 Axd axial defects https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2424 + EM:10409 STOCK Avil/Cnrm EMMA embryo Avil-iDTR, STOCK Avil/Cnrm mutant strain MGI:5805490 Avil targeted mutation 1, Paul A Heppenstall MGI:1333798 Avil advillin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10409 + EM:10409 STOCK Avil/Cnrm EMMA sperm Avil-iDTR, STOCK Avil/Cnrm mutant strain MGI:5805490 Avil targeted mutation 1, Paul A Heppenstall MGI:1333798 Avil advillin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10409 + EM:01886 STOCK Aven/Ieg EMMA embryo B6;129-Aven/Ieg, Aven knockout mutant stock MGI:5317759 Aven targeted mutation 1.1, Martin Zoernig MGI:1921518 Aven apoptosis, caspase activation inhibitor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1886 + EM:06109 STOCK Aurkb/Cnbc EMMA embryo mutant strain MGI:5056426 Aurkb targeted mutation 1.1, Marcos Malumbres MGI:107168 Aurkb aurora kinase B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6109 + EM:06109 STOCK Aurkb/Cnbc EMMA sperm mutant strain MGI:5056426 Aurkb targeted mutation 1.1, Marcos Malumbres MGI:107168 Aurkb aurora kinase B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6109 + EM:06220 STOCK Atr/Cnbc EMMA sperm mutant strain MGI:4355009 Atr targeted mutation 2, Oscar Fernandez-Capetillo MGI:108028 Atr ataxia telangiectasia and Rad3 related https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6220 + EM:06221 STOCK Atr/Cnbc EMMA embryo mutant strain MGI:4355008 Atr targeted mutation 1, Oscar Fernandez-Capetillo MGI:108028 Atr ataxia telangiectasia and Rad3 related https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6221 + EM:06221 STOCK Atr/Cnbc EMMA sperm mutant strain MGI:4355008 Atr targeted mutation 1, Oscar Fernandez-Capetillo MGI:108028 Atr ataxia telangiectasia and Rad3 related https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6221 + EM:07148 STOCK Atat1/Cnrm EMMA embryo Atat1 Flx mutant strain MGI:5549959 Atat1 targeted mutation 1.1, Paul A Heppenstall MGI:1913869 Atat1 alpha tubulin acetyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7148 + EM:07148 STOCK Atat1/Cnrm EMMA sperm Atat1 Flx mutant strain MGI:5549959 Atat1 targeted mutation 1.1, Paul A Heppenstall MGI:1913869 Atat1 alpha tubulin acetyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7148 + EM:10742 STOCK Arpc2/WtsiBiat EMMA sperm B6Dnk;B6Brd;B6N-Tyr Arpc2/WtsiBiat mutant strain MGI:5819114 Arpc2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1923959 Arpc2 actin related protein 2/3 complex, subunit 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10742 + EM:02443 STOCK Arap2/H EMMA sperm PARX, A9 mutant strain MGI:5514159 Arap2 gene trap mutation 9A, Katherine A Vallis MGI:2684416 Arap2 ArfGAP with RhoGAP domain, ankyrin repeat and PH domain 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2443 + EM:05566 STOCK Apc/Orl EMMA embryo B6;129P2-Apc/Orl, Apc-lox-exon14 mutant strain MGI:3521822 Apc targeted mutation 2, Christine Perret MGI:88039 Apc APC, WNT signaling pathway regulator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5566 + EM:05566 STOCK Apc/Orl EMMA sperm B6;129P2-Apc/Orl, Apc-lox-exon14 mutant strain MGI:3521822 Apc targeted mutation 2, Christine Perret MGI:88039 Apc APC, WNT signaling pathway regulator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5566 - EM:07651 STOCK Ankrd11/IcsOrl EMMA archived mutant strain MGI:4842657 Ankrd11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924337 Ankrd11 ankyrin repeat domain 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7651 + EM:02255 STOCK andra/H EMMA sperm Andromeda mutant strain MGI:5568106 andra andromeda MGI:5568104 andra andromeda https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2255 + EM:02254 STOCK anaya/H EMMA sperm Anaya mutant strain MGI:5568096 anaya anaya MGI:5568094 anaya anaya https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2254 + EM:02253 STOCK anan/H EMMA sperm Ananisi mutant strain MGI:5568076 anan ananisi MGI:5568074 anan ananisi https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2253 + EM:09992 STOCK Ahsa2/IcsOrl EMMA sperm EPD0209_2_C03 mutant strain MGI:4434221 Ahsa2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916133 Ahsa2 AHA1, activator of heat shock protein ATPase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9992 + EM:05690 STOCK Actr3/Ieg EMMA archived Actr3 (ARP3 actin-related protein 3 homolog (yeast)) mutant strain MGI:3765916 Actr3 gene trap mutation A009F03, Franz Vauti MGI:1921367 Actr3 ARP3 actin-related protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5690 - EM:02102 STOCK Aby/Orl EMMA embryo mutant strain MGI:5752853 Aby mutant Aby MGI:5752851 Aby mutant Aby https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2102 - EM:10718 STOCK A4galt/H EMMA sperm mutant strain MGI:4847810 A4galt targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3512453 A4galt alpha 1,4-galactosyltransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10718 + EM:05448 STOCK 2700049A03Rik/H EMMA sperm Talpid3 Floxed Mutant, 2700049A03Rik mutant strain MGI:5287574 2700049A03Rik targeted mutation 1.1, TaconicArtemis MGI:1924217 2700049A03Rik RIKEN cDNA 2700049A03 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5448 - EM:12096 STOCK 2210016L21Rik/Wtsi EMMA embryo mutant strain MGI:4419127 2210016L21Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919607 2210016L21Rik RIKEN cDNA 2210016L21 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12096 ? EM:09784 StarD10-F10 EMMA sperm mutant strain mouse StarD10 mouse StarD10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9784 ? EM:13090 Sox6GFPCreERT EMMA archived mutant strain Sox6 Sox6 MGI:98368 Sox6 SRY (sex determining region Y)-box 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13090 ? EM:11118 Sox2deltaOBS EMMA embryo mutant strain MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11118 ? EM:11118 Sox2deltaOBS EMMA sperm mutant strain MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11118 ? EM:12462 SKH1.Cg-Alox12b Krt14/H EMMA archived mutant strain MGI:3795934 Alox12b targeted mutation 1, Peter Krieg MGI:1274782 Alox12b arachidonate 12-lipoxygenase, 12R type https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12462 ? EM:12462 SKH1.Cg-Alox12b Krt14/H EMMA archived mutant strain MGI:5908393 Krt14 targeted mutation 1.1, Hermann-Josef Grone MGI:96688 Krt14 keratin 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12462 - EM:07421 SJLJ.129S-Lgals1/H EMMA sperm mutant strain MGI:2181809 Lgals1 targeted mutation 1, Elizabeth J Robertson MGI:96777 Lgals1 lectin, galactose binding, soluble 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7421 + EM:04546 SJL.129(B6)-Nr1i2/H EMMA sperm SJL/PXR-/-, SJL.Cg-Nr1i2/H mutant strain MGI:3609633 Nr1i2 targeted mutation 1, Steven A Kliewer MGI:1337040 Nr1i2 nuclear receptor subfamily 1, group I, member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4546 ? EM:12765 Siglec-1 (CD169) KO mouse EMMA sperm mutant strain MGI:3617694 Siglec1 targeted mutation 1, Paul R Crocker MGI:99668 Siglec1 sialic acid binding Ig-like lectin 1, sialoadhesin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12765 ? EM:11929 Rosa26-tidSind-naked/KD-UMCM/Rosa26+ line 14 EMMA sperm unclassified Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11929 ? EM:11918 Rosa26-tidSCKD-UMCM line 3 EMMA sperm unclassified Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11918 ? EM:11926 Rosa26-tidSC; tidflox/KD-UMCMline 11 EMMA embryo unclassified Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11926 ? EM:11926 Rosa26-tidSC; tidflox/KD-UMCMline 11 EMMA embryo unclassified Dnaja3 Dnaja3 MGI:1933786 Dnaja3 DnaJ heat shock protein family (Hsp40) member A3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11926 ? EM:11916 Rosa26-tidLCKD-UMCM line 1 EMMA sperm unclassified Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11916 ? EM:11924 Rosa26-tidLC; tidflox/KD-UMCM line 9 EMMA embryo unclassified Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11924 ? EM:11924 Rosa26-tidLC; tidflox/KD-UMCM line 9 EMMA embryo unclassified Dnaja3 Dnaja3 MGI:1933786 Dnaja3 DnaJ heat shock protein family (Hsp40) member A3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11924 ? EM:11917 Rosa26-tidICKD-UMCM line 2 EMMA sperm unclassified Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11917 ? EM:11925 Rosa26-tidIC; tidflox/KD-UMCM line 10 EMMA embryo unclassified Dnaja3 Dnaja3 MGI:1933786 Dnaja3 DnaJ heat shock protein family (Hsp40) member A3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11925 ? EM:11925 Rosa26-tidIC; tidflox/KD-UMCM line 10 EMMA embryo unclassified Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11925 ? EM:14764 RjHan:SD rat Fmr1 EMMA archived mutant strain Zygote electroporation of gene-specific gRNA and Cas9 was used to ablate specific sequence corresponding to the exon3. Zygote electroporation of gene-specific gRNA and Cas9 was used to ablate specific sequence corresponding to the exon3. MGI:95564 Fmr1 fragile X messenger ribonucleoprotein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14764 ? EM:14765 RjHan:SD rat Dicer EMMA archived mutant strain Zygote electroporation of gene-specific gRNA and Cas9 was used to ablate regulatory region located within intron 10-11 Zygote electroporation of gene-specific gRNA and Cas9 was used to ablate regulatory region located within intron 10-11 MGI:2177178 Dicer1 dicer 1, ribonuclease type III https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14765 ? EM:14763 RjHan:SD rat CST3 EMMA archived mutant strain Zygote electroporation of gene-specific gRNA, Cas9 and ssODN template was used to introduce M88Q point mutation. Zygote electroporation of gene-specific gRNA, Cas9 and ssODN template was used to introduce M88Q point mutation. MGI:102519 Cst3 cystatin C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14763 + EM:06764 RIII/H EMMA embryo Variant RIIIHpa/H mutant strain RIII RIII RIII RIII https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6764 + EM:06764 RIII/H EMMA sperm Variant RIIIHpa/H mutant strain RIII RIII RIII RIII https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6764 ? EM:11359 Rb(8.12)5Bnr_BALB/c EMMA sperm mutant strain Rb(8.12)5Bnr Robertsonian translocation, Chr 8 and 12, Universitat Bonn/Rhein 5 MGI:103992 Rb(8.12)5Bnr Robertsonian translocation, Chr 8 and 12, Universitat Bonn/Rhein 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11359 ? EM:11358 Rb(8.12)5Bnr EMMA sperm mutant strain Rb(8.12)5Bnr Robertsonian translocation, Chr 8 and 12, Universitat Bonn/Rhein 5 MGI:103992 Rb(8.12)5Bnr Robertsonian translocation, Chr 8 and 12, Universitat Bonn/Rhein 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11358 ? EM:11357 Rb(6.12)3Sic EMMA sperm mutant strain Rb(6.12)3Sic Robertsonian translocation, Chr 6 and 12, Sicily 3 MGI:103896 Rb(6.12)3Sic Robertsonian translocation, Chr 6 and 12, Sicily 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11357 ? EM:11356 Rb(4.12)9Bnr EMMA sperm mutant strain Rb(4.12)9Bnr Robertsonian translocation, Chr 4 MGI:103796 Rb(4.12)9Bnr Robertsonian translocation, Chr 4 and 12, Universitat Bonn/Rhein 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11356 ? EM:13349 R26-rtTAtg/0:tetO-Cpt1atg/0 (R26rtTA-CPT1A) EMMA sperm mutant strain R26-rtTA R26-rtTA R26-rtTA R26-rtTA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13349 ? EM:13349 R26-rtTAtg/0:tetO-Cpt1atg/0 (R26rtTA-CPT1A) EMMA sperm mutant strain TRE-CPT1A TRE-CPT1A Tg(tetO-Cpt1a,-EGFP) Tg(tetO-Cpt1a,-EGFP) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13349 - EM:13247 PI3K-C2a-kinase dead EMMA embryo mutant strain MGI:5779550 Pik3c2a targeted mutation 1, Bart Vanhaesebroeck MGI:1203729 Pik3c2a phosphatidylinositol-4-phosphate 3-kinase catalytic subunit type 2 alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13247 - EM:13245 PI3K-C2a-flox EMMA embryo mutant strain Pik3c2a-flox Pik3c2a-flox MGI:1203729 Pik3c2a phosphatidylinositol-4-phosphate 3-kinase catalytic subunit type 2 alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13245 + EM:01165 PDT/Pas EMMA embryo polydactyly mutant strain MGI:2684436 Twist1 Pasteur MGI:98872 Twist1 twist basic helix-loop-helix transcription factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1165 ? EM:07263 pCAGGS-Arl13bGFP EMMA embryo mutant strain Tg(CAGGS-Arl13b-GFP) Tg(CAGGS-Arl13b-GFP) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7263 ? EM:11122 pCAG-Otx2ER EMMA embryo mutant strain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11122 ? EM:11122 pCAG-Otx2ER EMMA sperm mutant strain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11122 ? EM:13523 P62-2 EMMA archived mutant strain SQSTM1 (p62) SQSTM1 (p62) SQSTM1 (p62) SQSTM1 (p62) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13523 ? EM:11633 p110beta DEL (Sv129/J background) EMMA embryo unclassified MGI:3795850 Pik3cb targeted mutation 1.1, Bart Vanhaesebroeck MGI:1922019 Pik3cb phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11633 ? EM:11633 p110beta DEL (Sv129/J background) EMMA sperm unclassified MGI:3795850 Pik3cb targeted mutation 1.1, Bart Vanhaesebroeck MGI:1922019 Pik3cb phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11633 ? EM:11121 Otp-CreER EMMA embryo mutant strain Otp-creER Otp-creER MGI:99835 Otp orthopedia homeobox https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11121 ? EM:11121 Otp-CreER EMMA sperm mutant strain Otp-creER Otp-creER MGI:99835 Otp orthopedia homeobox https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11121 + EM:04931 NOD/NckOrl EMMA embryo mutant strain NOD NOD NOD NOD https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4931 + EM:05139 NOD.FVB-Tg(Rip-RASA1*)1Wid/Orl EMMA embryo NOD-Tg(RIP::N)1Wid mutant strain MGI:5648069 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann MGI:5648068 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5139 + EM:05139 NOD.FVB-Tg(Rip-RASA1*)1Wid/Orl EMMA sperm NOD-Tg(RIP::N)1Wid mutant strain MGI:5648069 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann MGI:5648068 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5139 + EM:00726 NOD.Cg-Tg(TcraDN32D3)86Alhn Tg(Ins2-NP)25-3Olds/Orl EMMA embryo A14-86 RIP-NP NOD mutant strain MGI:3505887 Tg(TcraDN32D3)86Alhn transgene insertion 86, Agnes Lehuen MGI:3505886 Tg(TcraDN32D3)86Alhn transgene insertion 86, Agnes Lehuen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=726 + EM:00726 NOD.Cg-Tg(TcraDN32D3)86Alhn Tg(Ins2-NP)25-3Olds/Orl EMMA embryo A14-86 RIP-NP NOD mutant strain MGI:3573697 Tg(Ins2-NP)25-3Olds transgene insertion 25-3, Michael BA Oldstone, MD MGI:3531505 Tg(Ins2-NP)25-3Olds transgene insertion 25-3, Michael BA Oldstone, MD https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=726 + EM:00215 NOD.Cg-Tcra Tg(TcraCDC35)1Alhn/Orl EMMA embryo A8 Ca-/- NOD, A8, NOD.Cg-Tcra Tg(TcraCDC35)1Alhn, Valpha8 Tg Calpha<-/-> NOD mutant strain MGI:2180883 Tcra targeted mutation 1, Michael J Owen MGI:98553 Tcra T cell receptor alpha chain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=215 + EM:00215 NOD.Cg-Tcra Tg(TcraCDC35)1Alhn/Orl EMMA embryo A8 Ca-/- NOD, A8, NOD.Cg-Tcra Tg(TcraCDC35)1Alhn, Valpha8 Tg Calpha<-/-> NOD mutant strain MGI:3528229 Tg(TcraCDC35)1Alhn transgene insertion 1, Agnes Lehuen MGI:3528227 Tg(TcraCDC35)1Alhn transgene insertion 1, Agnes Lehuen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=215 + EM:01648 NOD.Cg-(D1Mit15-D1Mit359) Cd1d1/Orl EMMA embryo NOD CD1d KO, NOD.B6-L2.Cd1d-/- mutant strain MGI:2154342 Stia1 C57BL/6J MGI:2151739 Stia1 serum transfer induced arthritis 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1648 + EM:01648 NOD.Cg-(D1Mit15-D1Mit359) Cd1d1/Orl EMMA embryo NOD CD1d KO, NOD.B6-L2.Cd1d-/- mutant strain MGI:2681149 Nktcn1 C57BL/6J MGI:2681136 Nktcn1 natural killer T cell numbers 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1648 + EM:01648 NOD.Cg-(D1Mit15-D1Mit359) Cd1d1/Orl EMMA embryo NOD CD1d KO, NOD.B6-L2.Cd1d-/- mutant strain MGI:2180711 Cd1d1 targeted mutation 1, Luc Van Kaer MGI:107674 Cd1d1 CD1d1 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1648 + EM:01637 NOD.B6-Ptprc/Orl EMMA embryo NOD.CD45.2 mutant strain MGI:4819850 Ptprc b variant MGI:97810 Ptprc protein tyrosine phosphatase, receptor type, C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1637 + EM:00143 NOD.B6-Prf1/Cnrm EMMA embryo Pfp-KO, Prf-1(perforin)-KO, NOD-Prf1, B6.Cg-Prf1/Ibcm, B6.Cg-Prf1, NOD.B6-Prf1/Ibcm mutant strain MGI:1857235 Prf1 targeted mutation 1, Sandoz Pharmaceuticals MGI:97551 Prf1 perforin 1 (pore forming protein) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=143 + EM:01413 NOD.B6-Idd5(R33)/GhjOrl EMMA archived NOD.B6-Idd5-R33 mutant strain MGI:3037292 Idd5 C57BL/6 MGI:96407 Idd5 insulin dependent diabetes susceptibility 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1413 + EM:01413 NOD.B6-Idd5(R33)/GhjOrl EMMA archived NOD.B6-Idd5-R33 mutant strain Ctla4 Ctla4 MGI:88556 Ctla4 cytotoxic T-lymphocyte-associated protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1413 + EM:01414 NOD.B6-Idd5(R32)/GhjOrl EMMA archived NOD.B6-Idd5-R32 mutant strain MGI:3037292 Idd5 C57BL/6 MGI:96407 Idd5 insulin dependent diabetes susceptibility 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1414 + EM:01412 NOD.B6-Idd5(R198)/GhjOrl EMMA archived NOD.B6-Idd5-R198 mutant strain MGI:3037292 Idd5 C57BL/6 MGI:96407 Idd5 insulin dependent diabetes susceptibility 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1412 + EM:01390 NOD.B6-Hc<1>/Cnrm EMMA embryo NOD.B6-Hc, NOD.B6-Hc<1>/Ibcm mutant strain MGI:3044820 Hc<1> sufficient MGI:96031 Hc hemolytic complement https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1390 + EM:01404 NOD.B6-(H2-Q4-D17Mit36)/GhjOrl EMMA archived R89, NOD.B6-C17(R289) mutant strain MGI:3525333 Idd16 C57BL/6J MGI:107544 Idd16 insulin dependent diabetes susceptibility 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1404 + EM:01404 NOD.B6-(H2-Q4-D17Mit36)/GhjOrl EMMA archived R89, NOD.B6-C17(R289) mutant strain H2-Q4 histocompatibility 2, Q region locus 4 MGI:95933 H2-Q4 histocompatibility 2, Q region locus 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1404 + EM:01711 NOD.B6-(D6Mit254-D6Mit14)/Orl EMMA embryo NOD.B6-Idd6 Klrb1c/CarOrl, NOD.B6-NK1.1 mutant strain MGI:2384434 Klrb1c antigen Nk-1.1 allele MGI:107538 Klrb1c killer cell lectin-like receptor subfamily B member 1C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1711 + EM:01711 NOD.B6-(D6Mit254-D6Mit14)/Orl EMMA embryo NOD.B6-Idd6 Klrb1c/CarOrl, NOD.B6-NK1.1 mutant strain MGI:3036668 Idd6 C57BL/6 MGI:96408 Idd6 insulin dependent diabetes susceptibility 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1711 + EM:01394 NOD.B6-(D1Mit359-D1Mit155)/GhjCnrm EMMA embryo NOD.B6-C1D(3), L3 mutant strain D1Mit155 DNA segment, Chr 1, Massachusetts Institute of Technology 155 MGI:91529 D1Mit155 DNA segment, Chr 1, Massachusetts Institute of Technology 155 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1394 + EM:01392 NOD.B6-(D1Mit302-D1Mit178)/GhjCnrm EMMA embryo R39, NOD.B6-Idd5-R39 congenic strain MGI:2158432 Idd5.1 C57BL/6J MGI:2158421 Idd5.1 insulin dependent diabetes susceptibility 5.1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1392 + EM:01791 NOD.B6-(D1Mit19-D1Mit14)/GhjCnrm EMMA embryo NOD.B6-C1M mutant strain MGI:2385541 Ssial1 C57BL/6 MGI:2385531 Ssial1 susceptibility to sialadenitis 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1791 + EM:01396 NOD.B6-(D1Mit15-D1Mit359)/GhjCnrm EMMA embryo L2, NOD.C57BL/6-Nkt1(L2), NOD.B6-C1D(L2) mutant strain MGI:2430510 Fcgr2b<+> wild type MGI:95499 Fcgr2b Fc receptor, IgG, low affinity IIb https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1396 + EM:01396 NOD.B6-(D1Mit15-D1Mit359)/GhjCnrm EMMA embryo L2, NOD.C57BL/6-Nkt1(L2), NOD.B6-C1D(L2) mutant strain MGI:2681149 Nktcn1 C57BL/6J MGI:2681136 Nktcn1 natural killer T cell numbers 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1396 + EM:01397 NOD.B6-(D1Mit113-D1Mit359)/GhjOrl EMMA archived NOD.B6-C1D(L6), L6 mutant strain MGI:2681149 Nktcn1 C57BL/6J MGI:2681136 Nktcn1 natural killer T cell numbers 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1397 + EM:01401 NOD.B6-(D17Mit260-D17Mit199)/GhjOrl EMMA archived R76, NOD.B6-C17(R76) mutant strain Idd16.1 C57BL/6J MGI:3579885 Idd16.1 insulin dependent diabetes susceptibility 16.1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1401 + EM:01401 NOD.B6-(D17Mit260-D17Mit199)/GhjOrl EMMA archived R76, NOD.B6-C17(R76) mutant strain MGI:3525335 Idd23 C57BL/6J MGI:3525329 Idd23 insulin dependent diabetes susceptibility 23 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1401 + EM:01400 NOD.B6-(D17Mit248-D17Mit199)/GhjOrl EMMA archived R115, NOD.B6-C17(R115) mutant strain Idd16.1 C57BL/6J MGI:3579885 Idd16.1 insulin dependent diabetes susceptibility 16.1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1400 + EM:01398 NOD.B6-(D17Mit16-D17Mit36)/GhjCnrm EMMA embryo R2, NOD.B6-C17(R2) mutant strain MGI:3579319 H2 b variant MGI:95894 H2 histocompatibility-2, MHC https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1398 + EM:01398 NOD.B6-(D17Mit16-D17Mit36)/GhjCnrm EMMA embryo R2, NOD.B6-C17(R2) mutant strain MGI:3037294 Idd1 C57BL/6 MGI:96400 Idd1 insulin dependent diabetes susceptibility 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1398 + EM:01402 NOD.B6-(D17Mit114-D17Mit101)/Orl EMMA archived NOD.B6-C17(R76.22), NOD.B6-Idd16.1(R76.22)/Orl mutant strain Ceat1 chronic experimental autoimmune thyroiditis 1 MGI:3526118 Ceat1 chronic experimental autoimmune thyroiditis 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1402 + EM:01402 NOD.B6-(D17Mit114-D17Mit101)/Orl EMMA archived NOD.B6-C17(R76.22), NOD.B6-Idd16.1(R76.22)/Orl mutant strain Idd16.1 insulin dependent diabetes susceptibility 16.1 MGI:3579885 Idd16.1 insulin dependent diabetes susceptibility 16.1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1402 + EM:01403 NOD.B6-(D17Mit113-D17Mit260)/GhjOrl EMMA archived R156, NOD.B6-C17(R156) mutant strain Idd16.2 insulin dependent diabetes susceptibility 16.2 MGI:3579886 Idd16.2 insulin dependent diabetes susceptibility 16.2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1403 + EM:01403 NOD.B6-(D17Mit113-D17Mit260)/GhjOrl EMMA archived R156, NOD.B6-C17(R156) mutant strain MGI:3525335 Idd23 C57BL/6J MGI:3525329 Idd23 insulin dependent diabetes susceptibility 23 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1403 + EM:01403 NOD.B6-(D17Mit113-D17Mit260)/GhjOrl EMMA archived R156, NOD.B6-C17(R156) mutant strain Ceat1 chronic experimental autoimmune thyroiditis 1 MGI:3526118 Ceat1 chronic experimental autoimmune thyroiditis 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1403 + EM:01399 NOD.B6-(D17Mit113-D17Mit199)/GhjOrl EMMA archived R114, NOD.B6-C17(R114) mutant strain MGI:3525335 Idd23 C57BL/6J MGI:3525329 Idd23 insulin dependent diabetes susceptibility 23 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1399 + EM:01399 NOD.B6-(D17Mit113-D17Mit199)/GhjOrl EMMA archived R114, NOD.B6-C17(R114) mutant strain Ceat1 C57BL/6J MGI:3526118 Ceat1 chronic experimental autoimmune thyroiditis 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1399 + EM:01399 NOD.B6-(D17Mit113-D17Mit199)/GhjOrl EMMA archived R114, NOD.B6-C17(R114) mutant strain MGI:3525333 Idd16 C57BL/6J MGI:107544 Idd16 insulin dependent diabetes susceptibility 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1399 + EM:01803 NOD.129S6-Cd1d1/Orl EMMA embryo NOD CD1d KO mutant strain MGI:2180711 Cd1d1 targeted mutation 1, Luc Van Kaer MGI:107674 Cd1d1 CD1d1 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1803 + EM:06909 NOD.129S2-Parp1/Ieg EMMA sperm NOD-Parp1tm1Zqw mutant strain MGI:1857862 Parp1 targeted mutation 1, Zhao-Qi Wang MGI:1340806 Parp1 poly (ADP-ribose) polymerase family, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6909 + EM:09914 NOD.129P2(B6)-Nos2/Ieg EMMA sperm NOD.B6;129P2-Nos2tm1Lau mutant strain MGI:1857228 Nos2 targeted mutation 1, Victor E Laubach MGI:97361 Nos2 nitric oxide synthase 2, inducible https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9914 + EM:01638 NOD.129-Rag1 B2m H2-Ab1/Orl EMMA embryo NOD-IAbeta-beta2m-RAG1-/- mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1638 + EM:01638 NOD.129-Rag1 B2m H2-Ab1/Orl EMMA embryo NOD-IAbeta-beta2m-RAG1-/- mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1638 + EM:01638 NOD.129-Rag1 B2m H2-Ab1/Orl EMMA embryo NOD-IAbeta-beta2m-RAG1-/- mutant strain MGI:2448994 Rag1 targeted mutation 1, David Baltimore MGI:97848 Rag1 recombination activating 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1638 + EM:01422 NOD.129-Fasl/Orl EMMA embryo FasLfl/fl mutant strain MGI:3032852 Fasl targeted mutation 1, Matthieu Levi-Strauss MGI:99255 Fasl Fas ligand (TNF superfamily, member 6) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1422 + EM:00213 NOD.129(B6)-B2m H2-Ab1/DoiLpfOrl EMMA embryo NOD.129(B6)-B2m H2-Ab1/DimLpfOrl, Nod-beta2M-IAbeta, NOD.129(B6)-B2m H2-Ab1, NOD.129(B6)-B2m H2-Ab1/DimLpfCiml mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=213 + EM:00213 NOD.129(B6)-B2m H2-Ab1/DoiLpfOrl EMMA embryo NOD.129(B6)-B2m H2-Ab1/DimLpfOrl, Nod-beta2M-IAbeta, NOD.129(B6)-B2m H2-Ab1, NOD.129(B6)-B2m H2-Ab1/DimLpfCiml mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=213 + EM:00204 NOD-Tg(TcraDN32D3)78Alhn/Orl EMMA embryo NOD-Tg(TcraDN32D3)78Alhn/Ciml, NOD-Tg(TcraCD1d1)78Alhn, A14-78 NOD, NOD-Tg(TcraDN32D3)78Alhn mutant strain MGI:3526073 Tg(TcraDN32D3)78Alhn transgene insertion 78, Agnes Lehuen MGI:3526031 Tg(TcraDN32D3)78Alhn transgene insertion 78, Agnes Lehuen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=204 + EM:00214 NOD-Tg(TcraDN32D3)10Alhn/Orl EMMA embryo A14-10 NOD, NOD-Tg(TcraCD1d1)10Alhn, NOD-Tg(TcraDN32D3)10Alhn mutant strain MGI:3505746 Tg(TcraDN32D3)10Alhn transgene insertion 10, Agnes Lehuen MGI:3505713 Tg(TcraDN32D3)10Alhn transgene insertion 10, Agnes Lehuen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=214 + EM:01409 NOD-Chr 17/GhjCnrm EMMA embryo NOD-Chr 17/GhjCnrs, NOD.CBA-C17S mutant strain Chr 17 Chr 17 Chr 17 Chr 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1409 + EM:01408 NOD-Chr 17/GhjCnrm EMMA embryo NOD.B6-C17S consomic or chromosome substitution strain Chr 17 Chr 17 Chr 17 Chr 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1408 + EM:04372 NMRI.Cg-Tg(CMV-cre)1Nagy/Cnbc EMMA embryo CMV-cre mutant strain MGI:2178227 Tg(CMV-cre)1Nagy transgene insertion 1, Andras Nagy MGI:2178226 Tg(CMV-cre)1Nagy transgene insertion 1, Andras Nagy https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4372 + EM:04372 NMRI.Cg-Tg(CMV-cre)1Nagy/Cnbc EMMA sperm CMV-cre mutant strain MGI:2178227 Tg(CMV-cre)1Nagy transgene insertion 1, Andras Nagy MGI:2178226 Tg(CMV-cre)1Nagy transgene insertion 1, Andras Nagy https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4372 + EM:04371 NMRI.Cg-Tg(CAG-cre)1Nagy/Cnbc EMMA embryo pCX-NLS-cre mutant strain MGI:3586452 Tg(CAG-cre)1Nagy transgene insertion 1, Andras Nagy MGI:3586450 Tg(CAG-cre)1Nagy transgene insertion 1, Andras Nagy https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4371 + EM:04371 NMRI.Cg-Tg(CAG-cre)1Nagy/Cnbc EMMA sperm pCX-NLS-cre mutant strain MGI:3586452 Tg(CAG-cre)1Nagy transgene insertion 1, Andras Nagy MGI:3586450 Tg(CAG-cre)1Nagy transgene insertion 1, Andras Nagy https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4371 + EM:01017 NMRI.129-Apaf1/Cnrm EMMA embryo Apaf-1/XIX-18, NMRI.129-Apaf1/Ibcm mutant strain MGI:1857868 Apaf1 gene trap XIX18, Peter Gruss MGI:1306796 Apaf1 apoptotic peptidase activating factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1017 + EM:01785 NMRI-Tg(Wap-Tag)8Gmn/Kctt EMMA embryo WAP-SVT/t mutant strain MGI:3621350 Tg(Wap-Tag)8Gmn transgene insertion 8, A Graessmann MGI:3784787 Tg(Wap-Tag)8Gmn transgene insertion 8, A Graessmann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1785 + EM:01787 NMRI-Tg(WAP-tAg)1Gmn/Kctt EMMA embryo WAP-SVt/1, WAP-SVt mutant strain MGI:5313806 Tg(Wap-tAg)1Gmn transgene insertion 1, A Graessmann MGI:5313805 Tg(Wap-tAg)1Gmn transgene insertion 1, A Graessmann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1787 + EM:01786 NMRI-Tg(WAP-TAg)12Gmn/Kctt EMMA embryo WAP-SVT/12, WAP-SVT mutant strain MGI:5312328 Tg(Wap-TAg)12Gmn transgene insertion 12, A Graessmann MGI:5312327 Tg(Wap-TAg)12Gmn transgene insertion 12, A Graessmann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1786 + EM:02484 NMRI-Tg(Agt)123Uhg/Cnrm EMMA embryo TGM(rAOGEN)102, NMRI-Tg(Agt)123Uhg/Ibcm mutant strain MGI:4453970 Tg(Agt)123Uhg transgene insertion 123, University of Heidelberg MGI:4453973 Tg(Agt)123Uhg transgene insertion 123, University of Heidelberg https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2484 ? EM:09080 Myo18aD850GMhda EMMA sperm mutant strain Myo18a<2549A-G> Myo18a<2549A-G> MGI:2667185 Myo18a myosin XVIIIA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9080 + EM:04845 MSOSLOW/Orl EMMA archived MSO "resistant", MSOS/CloixOrl, MSO-Slow, STOCK MSO-Slow mutant strain MSO-Slow MSO-Slow MSO-Slow MSO-Slow https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4845 + EM:04844 MSOFAST/Orl EMMA archived STOCK MSO-Fast, MSO-Fast mutant strain MSO-Fast MSO-Fast MSO-Fast MSO-Fast https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4844 ? EM:11135 MRP8NRASD12 EMMA sperm mutant strain Tg(MRP8-Nras*)1 Tg(MRP8-Nras*)1 Tg(MRP8-Nras*)1 Tg(MRP8-Nras*)1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11135 + EM:08424 MRL.Cg-Ccr5 Fas/Cnbc EMMA sperm 5-LM mutant strain MGI:1856334 Fas lymphoproliferation MGI:95484 Fas Fas (TNF receptor superfamily member 6) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8424 + EM:08424 MRL.Cg-Ccr5 Fas/Cnbc EMMA sperm 5-LM mutant strain MGI:3613371 Ccr5 targeted mutation 1, Bruno Luckow MGI:107182 Ccr5 chemokine (C-C motif) receptor 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8424 + EM:08423 MRL.Cg-Ccr2 Fas/Cnbc EMMA sperm 2L-M mutant strain MGI:1856334 Fas lymphoproliferation MGI:95484 Fas Fas (TNF receptor superfamily member 6) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8423 + EM:08423 MRL.Cg-Ccr2 Fas/Cnbc EMMA sperm 2L-M mutant strain MGI:3613374 Ccr2 targeted mutation 1, Bruno Luckow MGI:106185 Ccr2 chemokine (C-C motif) receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8423 + EM:08422 MRL.Cg-Ccr1 Fas/Cnbc EMMA sperm `, MRL.129S4(B6)-Ccr1tm1Gao Faslpr/Cnbc, 1L-M mutant strain MGI:1931850 Ccr1 targeted mutation 1, Ji-Liang Gao MGI:104618 Ccr1 chemokine (C-C motif) receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8422 + EM:08422 MRL.Cg-Ccr1 Fas/Cnbc EMMA sperm `, MRL.129S4(B6)-Ccr1tm1Gao Faslpr/Cnbc, 1L-M mutant strain MGI:1856334 Fas lymphoproliferation MGI:95484 Fas Fas (TNF receptor superfamily member 6) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8422 + EM:08425 MRL.Cg-Ccr1 Ccr5 Fas/Cnbc EMMA sperm 15L-M mutant strain MGI:1931850 Ccr1 targeted mutation 1, Ji-Liang Gao MGI:104618 Ccr1 chemokine (C-C motif) receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8425 + EM:08425 MRL.Cg-Ccr1 Ccr5 Fas/Cnbc EMMA sperm 15L-M mutant strain MGI:3613371 Ccr5 targeted mutation 1, Bruno Luckow MGI:107182 Ccr5 chemokine (C-C motif) receptor 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8425 + EM:08425 MRL.Cg-Ccr1 Ccr5 Fas/Cnbc EMMA sperm 15L-M mutant strain MGI:1856334 Fas lymphoproliferation MGI:95484 Fas Fas (TNF receptor superfamily member 6) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8425 ? EM:08925 mPhl p 5 IRES GFP BALB/c EMMA sperm mutant strain allergen Phl p 5 allergen Phl p 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8925 + EM:00135 MP1/BiozOrl EMMA archived MP, L1 inbred strain Bioz:MP1 Bioz:MP1 Bioz:MP1 Bioz:MP1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=135 + EM:00124 MP1.BP1-Im7/DnmOrl EMMA archived LcH18, MP1.BP1-Im7/DnmOrl congenic strain MGI:3033084 Im7 Bioz:BP1 MGI:3032863 Im7 immunoregulatory 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=124 + EM:00123 MP1.BP1-Im5/DnmOrl EMMA archived MP1.BP1-Im5/DnmOrl, LcH10 congenic strain MGI:3033076 Im5 Bioz:BP1 MGI:3032858 Im5 immunoregulatory 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=123 + EM:00126 MP1.BP1-Im4/DnmOrl EMMA archived LcH6, MP1.BP1-Im4/DnmOrl congenic strain MGI:3033074 Im4 Bioz:BP1 MGI:3032855 Im4 immunoregulatory 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=126 + EM:00127 MP1.BP1-Im3/DnmOrl EMMA archived LcH8-30, MP1.BP1-Im3/DnmOrl congenic strain MGI:3033072 Im3 Bioz:BP1 MGI:3032849 Im3 immunoregulatory 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=127 + EM:00125 MP1.BP1-Im2/DnmOrl EMMA archived LcH4, MP1.BP1-Im2/DnmOrl congenic strain MGI:2157092 Im2 Bioz:BP1 MGI:2149679 Im2 immunoregulatory 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=125 + EM:00128 MP1.BP1-Im1/DnmOrl EMMA archived LcH8-60, MP1.BP1-Im1/DnmOrl congenic strain MGI:2157088 Im1 Bioz:BP1 MGI:2148963 Im1 Immunoregulatory 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=128 + EM:00198 MI/HgDstIeg EMMA embryo Hertwig's microphthalmia, MI/HgDst, STOCK Mitf/Hg, MI/HgDstNeu mutant strain MGI:1856085 Mitf microphthalmia MGI:104554 Mitf melanogenesis associated transcription factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=198 + EM:12460 MF1;129X1-Ralgds/H EMMA sperm RalGDS KO Mouse mutant strain MGI:3574574 Ralgds targeted mutation 1, Christopher J Marshall MGI:107485 Ralgds ral guanine nucleotide dissociation stimulator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12460 ? EM:13142 Marco knockout mice EMMA sperm mutant strain MGI:3690644 Marco targeted mutation 1, Karl Tryggvason MGI:1309998 Marco macrophage receptor with collagenous structure https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13142 ? EM:13351 LnB5 TCR Tg EMMA sperm mutant strain Tg(TcraLnB5,TcrbLnB5) Tg(TcraLnB5,TcrbLnB5) Tg(TcraLnB5,TcrbLnB5) Tg(TcraLnB5,TcrbLnB5) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13351 ? EM:11835 Krox20 NA*A EMMA archived unclassified Egr2 Egr2 MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11835 ? EM:11836 Krox20 C flox EMMA archived unclassified Egr2 Egr2 MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11836 + EM:01320 KREIS/HgIeg EMMA embryo kreisler mutant strain MGI:1856419 Mafb kreisler MGI:104555 Mafb v-maf musculoaponeurotic fibrosarcoma oncogene family, protein B (avian) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1320 ? EM:11997 K5-CXCL13-F3 EMMA sperm mutant strain MGI:6331225 Tg(KRT5-Cxcl13)F3Rlep transgene insertion F3, Rozen Le Panse MGI:6331222 Tg(KRT5-Cxcl13)F3Rlep transgene insertion F3, Rozen Le Panse https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11997 ? EM:11996 K5-CXCL13-F12 EMMA sperm mutant strain MGI:6331227 Tg(KRT5-Cxcl13)F12Rlep transgene insertion F12, Rozen Le Panse MGI:6331226 Tg(KRT5-Cxcl13)F12Rlep transgene insertion F12, Rozen Le Panse https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11996 + EM:12213 ICR/H[cc] EMMA live mutant strain ICR/H[cc] ICR/H[cc] ICR/H[cc] ICR/H[cc] https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12213 + EM:01166 HR2/PasOrl EMMA archived mutant strain MGI:5289957 Hr hairless 2 Institut Pasteur MGI:96223 Hr lysine demethylase and nuclear receptor corepressor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1166 ? EM:12228 HprtDll1ECD_Dll4ICD EMMA sperm mutant strain HprtDll1ECD_Dll4ICD HprtDll1ECD_Dll4ICD MGI:96217 Hprt hypoxanthine guanine phosphoribosyl transferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12228 ? EM:12229 Hprt-Dll4ECD_Dll1ICD EMMA sperm mutant strain HprtDll4ECD_Dll1ICD HprtDll4ECD_Dll1ICD MGI:96217 Hprt hypoxanthine guanine phosphoribosyl transferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12229 ? EM:11383 Hprt-CAG-LSL-ROCK2:ER EMMA sperm mutant strain MGI:96217 Hprt hypoxanthine guanine phosphoribosyl transferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11383 ? EM:11065 HLE-2/w x AlbCRE EMMA archived mutant strain Tg(Act-HCV-NS5AWeakTrans) Tg(Act-HCV-NS5AWeakTrans) Tg(Act-HCV-NS5AWeakTrans) Tg(Act-HCV-NS5AWeakTrans) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11065 ? EM:11065 HLE-2/w x AlbCRE EMMA archived mutant strain Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11065 ? EM:11064 HLE-1/S x AlbCRE EMMA archived mutant strain Tg(Act-HCV-NS5AHighTrans) Tg(Act-HCV-NS5AHighTrans) Tg(Act-HCV-NS5AHighTrans) Tg(Act-HCV-NS5AHighTrans) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11064 ? EM:11064 HLE-1/S x AlbCRE EMMA archived mutant strain Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11064 ? EM:13166 Hint3 conditional KO EMMA archived mutant strain Hint3 Hint3 MGI:1914097 Hint3 histidine triad nucleotide binding protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13166 ? EM:13168 Hint1xHint2 wild-type EMMA archived mutant strain MGI:2437191 Hint1<+> wild type MGI:1321133 Hint1 histidine triad nucleotide binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13168 ? EM:13168 Hint1xHint2 wild-type EMMA archived mutant strain MGI:3048642 Hint2<+> wild type MGI:1916167 Hint2 histidine triad nucleotide binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13168 - EM:13222 Hint1 KO C57BL/6J EMMA embryo mutant strain MGI:2674018 Hint1 targeted mutation 1, I Bernard Weinstein MGI:1321133 Hint1 histidine triad nucleotide binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13222 ? EM:13786 Headbobber, hb EMMA archived mutant strain MGI:2447989 hb head bobber MGI:107756 hb head bobber https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13786 ? EM:12761 hDMD/mdx mouse EMMA sperm mutant strain human DMD gene human DMD gene human DMD gene human DMD gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12761 ? EM:13660 H2afjDel7 (NRj) EMMA sperm mutant strain H2afj-delta7 H2afj-delta7 MGI:6358818 H2afj withdrawn, = H2aj https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13660 ? EM:13661 H2afjDel7 (JRj) EMMA sperm mutant strain H2afj-delta7 H2afj-delta7 MGI:6358818 H2afj withdrawn, = H2aj https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13661 + EM:01368 GRS/ADkcsKieg EMMA embryo GRS/A, IFLa-3 mutant strain MGI:3579297 Mtv2 mammary tumor virus locus 2, present MGI:97188 Mtv2 mammary tumor virus locus 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1368 + EM:00397 GRS.Cg-Tg(MMTV-S100a4)463Oku/Kctt EMMA embryo GR.CBB6-Tg(MMTV-S100a4)463/Kctt, tg463 mutant strain MGI:3620787 Tg(MMTV-S100a4)463Oku transgene insertion 463, Olle Karlstrom MGI:5141468 Tg(MMTV-S100a4)463Oku transgene insertion 463, Olle Karlstrom https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=397 + EM:00397 GRS.Cg-Tg(MMTV-S100a4)463Oku/Kctt EMMA live GR.CBB6-Tg(MMTV-S100a4)463/Kctt, tg463 mutant strain MGI:3620787 Tg(MMTV-S100a4)463Oku transgene insertion 463, Olle Karlstrom MGI:5141468 Tg(MMTV-S100a4)463Oku transgene insertion 463, Olle Karlstrom https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=397 - EM:09367 Gnptab EMMA sperm mutant strain MGI:5616922 Gnptab Nymphe MGI:3643902 Gnptab N-acetylglucosamine-1-phosphate transferase, alpha and beta subunits https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9367 + EM:00432 FVB;129P2-Trp53/Cnrm EMMA embryo P53F, FVB;129P2-Trp53/Ibcm mutant strain MGI:1931011 Trp53 targeted mutation 1, Anton Berns MGI:98834 Trp53 transformation related protein 53 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=432 + EM:00433 FVB;129P2-Rb1/Cnrm EMMA embryo RbF, FVB;129P2-Rb1/Ibcm mutant strain MGI:1931018 Rb1 targeted mutation 2, Anton Berns MGI:97874 Rb1 RB transcriptional corepressor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=433 + EM:00434 FVB;129P2-Rb1/Cnrm EMMA embryo FVB;129P2-Rb1/Ibcm, RbFR mutant strain MGI:1931015 Rb1 targeted mutation 1, Anton Berns MGI:97874 Rb1 RB transcriptional corepressor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=434 + EM:00406 FVB;129P2-Pten/Cnrm EMMA embryo FVB;129P2-Pten/Ibcm, PtnF mutant strain MGI:2183284 Pten targeted mutation 1, Silvia Marino MGI:109583 Pten phosphatase and tensin homolog https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=406 + EM:00408 FVB;129P2-Nf2/Cnrm EMMA embryo FVB;129P2-Nf2/Ibcm, Nf2F mutant strain MGI:1926955 Nf2 targeted mutation 2, Gilles Thomas MGI:97307 Nf2 neurofibromin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=408 + EM:00407 FVB;129P2-Cdkn2a/Cnrm EMMA sperm I4aF, FVB;129P2-Cdkn2a/Ibcm mutant strain MGI:2384163 Cdkn2a targeted mutation 2, Anton Berns MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=407 + EM:00435 FVB;129P2-Cdkn2a/Cnrm EMMA embryo FVB;129P2-Cdkn2a/Ibcm, P16B or Cdkn2a, FVB;129P2-Cdkn2a/Ibcm mutant strain MGI:2384165 Cdkn2a targeted mutation 1.1, Anton Berns MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=435 + EM:01642 FVB;129P2-Brca2/Cnrm EMMA embryo FVB;129P2-Brca2/Ibcm, Br2F mutant strain MGI:2156556 Brca2 targeted mutation 1, Anton Berns MGI:109337 Brca2 breast cancer 2, early onset https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1642 + EM:01631 FVB/NPas-Tg(H2-D)2Bujf/Orl EMMA sperm FVB H2-Db2 mutant strain MGI:5306998 Tg(H2-D)2Bujf transgene insertion 2, Jean-Francois Bureau MGI:5306997 Tg(H2-D)2Bujf transgene insertion 2, Jean-Francois Bureau https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1631 + EM:00120 FVB/NIco-Tg(Pcp2/Jun)18Dcrl/Cnrm EMMA embryo FVB/NIco-Tg(Pcp2/Jun)18Dcrl/Ibcm, L7-c-jun-Tg mutant strain MGI:3573864 Tg(Pcp2/Jun)18Dcrl transgene insertion 18, Daniella Carulli MGI:3573861 Tg(Pcp2/Jun)18Dcrl transgene insertion 18, Daniella Carulli https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=120 + EM:01722 FVB/N-Tg(Wap-cre)1Gsc/Ieg EMMA sperm WAPiCre mutant strain MGI:3527260 Tg(Wap-cre)1Gsc transgene insertion 1, Gunther Schutz MGI:3527253 Tg(Wap-cre)1Gsc transgene insertion 1, Gunther Schutz https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1722 + EM:02472 FVB/N-Tg(Tagln-Nppc)1Wlthr/Ieg EMMA embryo FVB/N SM22 CNP mutant strain MGI:5762679 Tg(Tagln-Nppc)1Wlthr transgene insertion 1, Thomas Walther MGI:5762675 Tg(Tagln-Nppc)1Wlthr transgene insertion 1, Thomas Walther https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2472 + EM:01710 FVB/N-Tg(Slc6a3-icre)1Fto/Orl EMMA sperm FVB/N-Tg(Slc6a3-cre)1Fto/Orl, FVB/N-BAC-DATCre, FVB/N-Tg(Slc6a3-cre)1Fto mutant strain MGI:3852083 Tg(Slc6a3-icre)1Fto transgene insertion 1, Francois Tronche MGI:3852082 Tg(Slc6a3-icre)1Fto transgene insertion 1, Francois Tronche https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1710 + EM:02376 FVB/N-Tg(SAA2)1Woo/H EMMA sperm SAA2 mutant strain MGI:5759854 Tg(SAA2)1Woo transgene insertion 1, Patricia Woo MGI:5759851 Tg(SAA2)1Woo transgene insertion 1, Patricia Woo https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2376 ? EM:12211 FVB/N-Tg(S100A8-BCL2)1Lgs/Orl EMMA sperm mutant strain MGI:2448741 Tg(S100A8-BCL2)1Lgs transgene insertion 1, Eric Lagasse MGI:2676367 Tg(S100A8-BCL2)1Lgs transgene insertion 1, Eric Lagasse https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12211 + EM:05367 FVB/N-Tg(Rnu6-RNAi:IE-PRV)SH30Gjo/Orl EMMA embryo SH30 mutant strain MGI:5645894 Tg(Rnu6-RNAi:IE-PRV)SH30Gjo transgene insertion SH30, Genevieve Jolivet MGI:5645891 Tg(Rnu6-RNAi:IE-PRV)SH30Gjo transgene insertion SH30, Genevieve Jolivet https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5367 + EM:05365 FVB/N-Tg(Rnu6-RNAi:IE-PRV)SH05Gjo/Orl EMMA embryo SH05 mutant strain MGI:5645892 Tg(Rnu6-RNAi:IE-PRV)SH05Gjo transgene insertion SH05, Genevieve Jolivet MGI:5645889 Tg(Rnu6-RNAi:IE-PRV)SH05Gjo transgene insertion SH05, Genevieve Jolivet https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5365 + EM:05366 FVB/N-Tg(Rnu6-RNAi:IE-PRV)SH03Gjo/Orl EMMA sperm SH03 mutant strain MGI:5645893 Tg(Rnu6-RNAi:IE-PRV)SH03Gjo transgene insertion SH03, Genevieve Jolivet MGI:5645890 Tg(Rnu6-RNAi:IE-PRV)SH03Gjo transgene insertion SH03, Genevieve Jolivet https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5366 + EM:04569 FVB/N-Tg(Rip-RASA1*)1Wid/Orl EMMA archived FVB/N-Tg(RIP::N)1Wid mutant strain MGI:5648069 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann MGI:5648068 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4569 + EM:00250 FVB/N-Tg(Prm1-Tfam)4Lrsn/Kieg EMMA embryo FVB/N-Tg(Prm1-Tfam)4Lrsn, NGLa-1, Prm1-TFAM mutant strain MGI:3525701 Tg(Prm1-Tfam)4Lrsn transgene insertion 4, Nils-Goran Larsson MGI:3525692 Tg(Prm1-Tfam)4Lrsn transgene insertion 4, Nils-Goran Larsson https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=250 + EM:01183 FVB/N-Tg(Nes-rtTA)306Rvs/Cnrm EMMA embryo FVB/N-Tg(Nes-rtTA)306Rvs/Ibcm, Nes-rtTA mutant strain MGI:3505574 Tg(Nes-rtTA)306Rvs transgene insertion 306, Steven A Reeves MGI:2136292 Tg(Nes-rtTA)306Rvs transgene insertion 306, Steven A Reeves https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1183 + EM:01183 FVB/N-Tg(Nes-rtTA)306Rvs/Cnrm EMMA live FVB/N-Tg(Nes-rtTA)306Rvs/Ibcm, Nes-rtTA mutant strain MGI:3505574 Tg(Nes-rtTA)306Rvs transgene insertion 306, Steven A Reeves MGI:2136292 Tg(Nes-rtTA)306Rvs transgene insertion 306, Steven A Reeves https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1183 + EM:07462 FVB/N-Tg(Krt14-Col18a1)J4Pih/Oulu EMMA embryo K14-endostatin (J4) FVB/N mutant strain MGI:5645734 Tg(Krt14-Col18a1)J4Pih transgene insertion J4, Taina Pihlajaniemi MGI:5645733 Tg(Krt14-Col18a1)J4Pih transgene insertion J4, Taina Pihlajaniemi https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7462 + EM:07462 FVB/N-Tg(Krt14-Col18a1)J4Pih/Oulu EMMA sperm K14-endostatin (J4) FVB/N mutant strain MGI:5645734 Tg(Krt14-Col18a1)J4Pih transgene insertion J4, Taina Pihlajaniemi MGI:5645733 Tg(Krt14-Col18a1)J4Pih transgene insertion J4, Taina Pihlajaniemi https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7462 + EM:00411 FVB/N-Tg(Gfap-cre)2Brn/Cnrm EMMA embryo FVB/N-Tg(Gfap-cre)2Brn/Ibcm mutant strain MGI:2663939 Tg(Gfap-cre)2Brn transgene insertion 2, Anton Berns MGI:2671944 Tg(Gfap-cre)2Brn transgene insertion 2, Anton Berns https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=411 + EM:05364 FVB/N-Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo/Orl EMMA embryo mutant strain MGI:5645887 Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo transgene insertion miL15, Genevieve Jolivet MGI:5645819 Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo transgene insertion miL15, Genevieve Jolivet https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5364 + EM:05364 FVB/N-Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo/Orl EMMA sperm mutant strain MGI:5645887 Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo transgene insertion miL15, Genevieve Jolivet MGI:5645819 Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo transgene insertion miL15, Genevieve Jolivet https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5364 + EM:04994 FVB/N-Tg(E2F1-luc)1Ech/Kctt EMMA embryo Ef-luc mutant strain MGI:5648123 Tg(E2F1-luc)1Ech transgene insertion 1, Eric C Holland MGI:5648121 Tg(E2F1-luc)1Ech transgene insertion 1, Eric C Holland https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4994 + EM:00195 FVB/N-Tg(Cryaa-Six3)53Pgr/Ieg EMMA sperm FVB/N-Tg(Cryaa-Six3)53Pgr/Neu, FVB/N-Tg(Cryaa-Six3)53Pgr/PgrNeu, alphaASix3, FVB/N-Tg(Cryaa-Six3)53Pgr/Pgr, FVB-Tg(aAcryst-Six3)F53 mutant strain MGI:3057335 Tg(Cryaa-Six3)53Pgr transgene insertion 53, Peter Gruss MGI:3057330 Tg(Cryaa-Six3)53Pgr transgene insertion 53, Peter Gruss https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=195 + EM:04993 FVB/N-Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a wild type mutant strain MGI:5648077 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University MGI:5648074 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4993 ? EM:10886 FVB/N-Tg(CAG-Itga11)1Dgul/Kctt EMMA sperm mutant strain Tg(CAG-Itga11)1Dgul Tg(CAG-Itga11)1Dgul Tg(CAG-Itga11)1Dgul Tg(CAG-Itga11)1Dgul https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10886 + EM:07013 FVB.Cg-Tg(Wap-Shh)119Mig/Cnbc EMMA embryo Tg(WAP-Shh)119Mig-FVB mutant strain MGI:5645728 Tg(Wap-Shh)119Mig transgene insertion 119, Marta I Gallego MGI:5645727 Tg(Wap-Shh)119Mig transgene insertion 119, Marta I Gallego https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7013 + EM:01804 FVB.Cg-Tg(Nfh/lacZ)44AApt/Orl EMMA sperm FVB.B6C3F2-Tg(Nfh/lacZ)44AApt/Orl, NFH-LacZ/FVB mutant strain MGI:2182128 Tg(Nfh/lacZ)44AApt transgene insertion 44A, Alan Peterson MGI:2388168 Tg(Nfh/lacZ)44AApt transgene insertion 44A, Alan Peterson https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1804 + EM:06074 FVB.Cg-Tg(Kap)L49Msgr/Cnbc EMMA embryo KAP L49 (FVB background), FVB.Cg-Tg(Kap)L49/Cnbc mutant strain MGI:5792809 Tg(Kap)L49Msgr transgene insertion L49, Anna Meseguer MGI:5792808 Tg(Kap)L49Msgr transgene insertion L49, Anna Meseguer https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6074 + EM:00412 FVB.Cg-Tg(IghMyc)186Brn/Cnrm EMMA sperm Emyc, FVB.Cg-Tg(IghMyc)186Brn/Ibcm mutant strain MGI:3039690 Tg(IghMyc)186Brn transgene insertion 186, Anton Berns MGI:3039691 Tg(IghMyc)186Brn transgene insertion 186, Anton Berns https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=412 + EM:09628 FVB.Cg-Tg(Col13a1)2Pih/Oulu EMMA embryo FVB/NHanHsd-Tg(Col13a1)2Pih mutant strain MGI:5645740 Tg(Col13a1)2Pih transgene insertion 2, Taina Pihlajaniemi MGI:5645739 Tg(Col13a1)2Pih transgene insertion 2, Taina Pihlajaniemi https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9628 + EM:09628 FVB.Cg-Tg(Col13a1)2Pih/Oulu EMMA sperm FVB/NHanHsd-Tg(Col13a1)2Pih mutant strain MGI:5645740 Tg(Col13a1)2Pih transgene insertion 2, Taina Pihlajaniemi MGI:5645739 Tg(Col13a1)2Pih transgene insertion 2, Taina Pihlajaniemi https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9628 + EM:05565 FVB.Cg-Tg(Camk2a-Grik2)28Cmul/Orl EMMA embryo GluK2 -6 Myc FVB mutant strain MGI:5645814 Tg(Camk2a-Grik2)28Cmul transgene insertion 28, Christophe Mulle MGI:5645813 Tg(Camk2a-Grik2)28Cmul transgene insertion 28, Christophe Mulle https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5565 + EM:02503 FVB.Cg-Tg(CAG-HSPB1)LPks/H EMMA sperm PCAGGS-HSP27-WT-LOW-COPY, HSP27 WT Low copy line mutant strain MGI:5775102 Tg(CAG-HSPB1)LPks transgene insertion L, Nick Parkinson MGI:5775101 Tg(CAG-HSPB1)LPks transgene insertion L, Nick Parkinson https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2503 + EM:02502 FVB.Cg-Tg(CAG-HSPB1)HPks/H EMMA sperm PCAGGS-HSP27-WT-HIGH-COPY, HSP27 WT High copy line mutant strain MGI:5775094 Tg(CAG-HSPB1)HPks transgene insertion H, Nick Parkinson MGI:5775092 Tg(CAG-HSPB1)HPks transgene insertion H, Nick Parkinson https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2502 ? EM:11431 FVB.Cg-Dnajc5 Tg(Thy1-GFP*)1Rfc/Cnbc EMMA embryo mutant strain MGI:3050763 Dnajc5 targeted mutation 1, Thomas C Sudhof MGI:892995 Dnajc5 DnaJ heat shock protein family (Hsp40) member C5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11431 ? EM:11431 FVB.Cg-Dnajc5 Tg(Thy1-GFP*)1Rfc/Cnbc EMMA embryo mutant strain MGI:6343356 Tg(Thy1-GFP*)1Rfc transgene insertion 1, Rafael Fernandez-Chacon MGI:6343363 Tg(Thy1-GFP*)1Rfc transgene insertion 1, Rafael Fernandez-Chacon https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11431 + EM:09898 FVB.AK(Cg)-Del(17)T/Biat EMMA sperm FVB.AK-Del(17)T/Biat mutant strain MGI:1856187 Del(17)T deletion, Chr 17, T, hairpin tail MGI:5427967 Del(17)T deletion, Chr 17, T, hairpin tail https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9898 + EM:12461 FVB.129X1(Cg)-Ralgds/H EMMA sperm RalGDS Floxed Mouse, FVB;129X1(Cg)-Ralgds/H mutant strain MGI:6317416 Ralgds targeted mutation 2, Christopher J Marshall MGI:107485 Ralgds ral guanine nucleotide dissociation stimulator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12461 + EM:09913 FVB.129S6(B6)-Col13a1/Oulu EMMA embryo mutant strain MGI:6116692 Col13a1 targeted mutation 4.1, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9913 + EM:09913 FVB.129S6(B6)-Col13a1/Oulu EMMA sperm mutant strain MGI:6116692 Col13a1 targeted mutation 4.1, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9913 + EM:10425 FVB.129S6(B6)-Col13a1/Oulu EMMA embryo mutant strain MGI:4838408 Col13a1 targeted mutation 2, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10425 + EM:10425 FVB.129S6(B6)-Col13a1/Oulu EMMA sperm mutant strain MGI:4838408 Col13a1 targeted mutation 2, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10425 - EM:11029 FVB.129S4-Col18a1/Oulu EMMA embryo mutant strain MGI:2179134 Col18a1 targeted mutation 1, Harvard Medical School MGI:88451 Col18a1 collagen, type XVIII, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11029 - EM:11029 FVB.129S4-Col18a1/Oulu EMMA sperm mutant strain MGI:2179134 Col18a1 targeted mutation 1, Harvard Medical School MGI:88451 Col18a1 collagen, type XVIII, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11029 + EM:05562 FVB.129P2-Tiam1/Cnbc EMMA sperm FVB-Tiam1 KO mutant strain MGI:2183309 Tiam1 targeted mutation 1, John G Collard MGI:103306 Tiam1 T cell lymphoma invasion and metastasis 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5562 + EM:02142 FVB.129P2-Peg12/Cnrm EMMA embryo FVB.129P2-Peg12/Ibcm, F3H mutant strain MGI:3530465 Peg12 targeted mutation 1, Anton Berns MGI:1351637 Peg12 paternally expressed 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2142 - EM:09897 FVB.129P2-Igf2r/Biat EMMA sperm mutant strain MGI:2445841 Igf2r targeted mutation 2, Erwin F Wagner MGI:96435 Igf2r insulin-like growth factor 2 receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9897 ? EM:09896 FVB.129P2-Igf2r/Biat EMMA sperm mutant strain MGI:6317421 Igf2r targeted mutation 1, Denise P Barlow MGI:96435 Igf2r insulin-like growth factor 2 receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9896 + EM:02141 FVB.129P2-Frat2/Cnrm EMMA embryo FVB.129P2-Frat2/Ibcm, F2H mutant strain MGI:3530460 Frat2 targeted mutation 1, Anton Berns MGI:2673967 Frat2 frequently rearranged in advanced T cell lymphomas 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2141 + EM:02140 FVB.129P2-Frat1/Cnrm EMMA embryo FVB.129P2-Frat1/Ibcm, F1H mutant strain MGI:2384128 Frat1 targeted mutation 1, Anton Berns MGI:109450 Frat1 frequently rearranged in advanced T cell lymphomas https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2140 + EM:02143 FVB.129P2-Frat1 Frat2/Cnrm EMMA embryo F1F2, FVB.129P2-Frat1 Frat2/Ibcm mutant strain MGI:3530463 Frat2 targeted mutation 2, Anton Berns MGI:2673967 Frat2 frequently rearranged in advanced T cell lymphomas 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2143 + EM:02143 FVB.129P2-Frat1 Frat2/Cnrm EMMA embryo F1F2, FVB.129P2-Frat1 Frat2/Ibcm mutant strain MGI:2384128 Frat1 targeted mutation 1, Anton Berns MGI:109450 Frat1 frequently rearranged in advanced T cell lymphomas https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2143 + EM:00054 FVB.129P2-Csf3r/Cnrm EMMA embryo FVB.129P2-Csf3r/Ibcm, FVB.129P2-Csf3r, Csfgr-KO mutant strain MGI:2655452 Csf3r targeted mutation 2, Erasmus University Rotterdam MGI:1339755 Csf3r colony stimulating factor 3 receptor (granulocyte) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=54 + EM:00053 FVB.129P2-Csf3r/Cnrm EMMA embryo FVB.129P2-Csf3r/Ibcm, FVB.129P2-Csf3r, Csfgr-delta715 mutant strain MGI:2156882 Csf3r targeted mutation 1, Erasmus University Rotterdam MGI:1339755 Csf3r colony stimulating factor 3 receptor (granulocyte) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=53 + EM:01645 FVB.129P2-Brca1/Cnrm EMMA embryo FVB.Cg-Brca1/Ibcm, Br1F, FVB.129P2-Brca1/Ibcm mutant strain MGI:3696057 Brca1 targeted mutation 1, Anton Berns MGI:104537 Brca1 breast cancer 1, early onset https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1645 - EM:09895 FVB.129P2-Airn/Biat EMMA sperm FVB.129P2(B6)-Airn/Biat mutant strain MGI:2677157 Airn targeted mutation 1, Denise P Barlow MGI:1353471 Airn antisense Igf2r RNA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9895 ? EM:09900 FVB.129P2-AIDup EMMA sperm mutant strain Airn to Igf2r Airn to Igf2r https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9900 ? EM:09899 FVB.129P2-AIDel EMMA sperm mutant strain Airn and Igf2r Airn and Igf2r https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9899 + EM:04424 FVB.129P2(B6)-Mfge8/Orl EMMA embryo MFGE8/TMbetageo FVB mutant strain MGI:3578644 Mfge8 gene trap KST227, BayGenomics MGI:102768 Mfge8 milk fat globule EGF and factor V/VIII domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4424 + EM:09263 FVB.129-Col15a1/Oulu EMMA embryo Collagen XV knock-out mouse in FVB background mutant strain MGI:2386162 Col15a1 targeted mutation 1, Taina Pihlajaniemi MGI:88449 Col15a1 collagen, type XV, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9263 + EM:09263 FVB.129-Col15a1/Oulu EMMA sperm Collagen XV knock-out mouse in FVB background mutant strain MGI:2386162 Col15a1 targeted mutation 1, Taina Pihlajaniemi MGI:88449 Col15a1 collagen, type XV, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9263 + EM:09799 FVB.129(Cg)-Bmx/Oulu EMMA embryo Bmx KO, FVB.Cg-Bmx/Oulu mutant strain MGI:2660714 Bmx targeted mutation 1, Kari Alitalo MGI:1101778 Bmx BMX non-receptor tyrosine kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9799 + EM:09799 FVB.129(Cg)-Bmx/Oulu EMMA sperm Bmx KO, FVB.Cg-Bmx/Oulu mutant strain MGI:2660714 Bmx targeted mutation 1, Kari Alitalo MGI:1101778 Bmx BMX non-receptor tyrosine kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9799 + EM:10424 FVB.129(B6)-Col13a1/Oulu EMMA embryo mutant strain MGI:4838409 Col13a1 targeted mutation 3.1, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10424 + EM:10424 FVB.129(B6)-Col13a1/Oulu EMMA sperm mutant strain MGI:4838409 Col13a1 targeted mutation 3.1, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10424 + EM:04774 FVB-Tg(Wap-Hgf)402Mig/Cnbc EMMA embryo mutant strain MGI:3036575 Tg(Wap-Hgf)402Mig transgene insertion 402, Marta I Gallego MGI:3037894 Tg(Wap-Hgf)402Mig transgene insertion 402, Marta I Gallego https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4774 + EM:04774 FVB-Tg(Wap-Hgf)402Mig/Cnbc EMMA sperm mutant strain MGI:3036575 Tg(Wap-Hgf)402Mig transgene insertion 402, Marta I Gallego MGI:3037894 Tg(Wap-Hgf)402Mig transgene insertion 402, Marta I Gallego https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4774 ? EM:11430 FVB-Tg(Thy1-GFP*)1Rfc/Cnbc EMMA embryo mutant strain MGI:6343356 Tg(Thy1-GFP*)1Rfc transgene insertion 1, Rafael Fernandez-Chacon MGI:6343363 Tg(Thy1-GFP*)1Rfc transgene insertion 1, Rafael Fernandez-Chacon https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11430 + EM:04778 FVB-Tg(tetO-TPR/MET,-EGFP)12Tcre/Cnrm EMMA embryo Tpr-Met-TetO-GFP, FVB-Tg(TPRMET-tetO-GFP)Tcre/Ibcm, FVB-Tg(tetO-TPR/MET,-EGFP)12Tcre/Ibcm mutant strain MGI:4949465 Tg(tetO-TPR/MET,-EGFP)12Tcre transgene insertion 12, Tiziana Crepaldi MGI:4949460 Tg(tetO-TPR/MET,-EGFP)12Tcre transgene insertion 12, Tiziana Crepaldi https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4778 + EM:04364 FVB-Tg(tetO-Hgf,-EGFP)24Tcre/Cnrm EMMA embryo Hgf-TetO-GFP mutant strain MGI:5648118 Tg(tetO-Hgf,-EGFP)24Tcre transgene insertion 24, Tiziana Crepaldi MGI:5648117 Tg(tetO-Hgf,-EGFP)24Tcre transgene insertion 24, Tiziana Crepaldi https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4364 + EM:04322 FVB-Tg(tetO-Chrnb2*V287L)H5Gica/Cnrm EMMA embryo Tg(TRE-Chrnb2VL)/H5 mutant strain MGI:5014761 Tg(tetO-Chrnb2*V287L)H5Gica transgene insertion H5, Giorgio Casari MGI:5014756 Tg(tetO-Chrnb2*V287L)H5Gica transgene insertion H5, Giorgio Casari https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4322 + EM:04321 FVB-Tg(tetO-Chrnb2*V287L)H3Gica/Cnrm EMMA embryo Tg(TRE-Chrnb2VL)/H3, FVB-Tg(tetO-Chrnb2*V287L)H3Gica/Ibcm mutant strain MGI:3843695 Tg(tetO-Chrnb2*V287L)H3Gica transgene insertion H3, Giorgio Casari MGI:3843694 Tg(tetO-Chrnb2*V287L)H3Gica transgene insertion H3, Giorgio Casari https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4321 + EM:00121 FVB-Tg(Pcp2-Gap43)L1657Fro/Cnrm EMMA embryo FVB-Tg(Pcp2-Gap43)L1657Fro/Ibcm, FVB-Tg(Pcp2-Gap43)L1657Fro, L7promoter/GAP43-ORF mutant strain MGI:2652499 Tg(Pcp2-Gap43)L1657Fro transgene insertion L1657, Ferdinando Rossi MGI:2652497 Tg(Pcp2-Gap43)L1657Fro transgene insertion L1657, Ferdinando Rossi https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=121 + EM:00756 FVB-Tg(Pax6-cre,GFP)2Pgr/PgrCnrm EMMA embryo FVB-Tg(Pax6-cre,GFP)2Pgr/PgrIbcm, ECG mutant strain MGI:3052661 Tg(Pax6-cre,GFP)2Pgr transgene insertion 2, Peter Gruss MGI:3052668 Tg(Pax6-cre,GFP)2Pgr transgene insertion 2, Peter Gruss https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=756 + EM:00755 FVB-Tg(Pax6-cre,GFP)1Pgr/PgrCnrm EMMA embryo FVB-Tg(Pax6-cre,GFP)1Pgr/PgrIbcm, Lens-Cre, FVB-Tg(Pax6-cre,-GFP)1Pgr/PgrIbcm mutant strain MGI:3045749 Tg(Pax6-cre,GFP)1Pgr transgene insertion 1, Peter Gruss MGI:3045750 Tg(Pax6-cre,GFP)1Pgr transgene insertion 1, Peter Gruss https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=755 + EM:00205 FVB-Tg(Pax4-lacZ)2Pgr/Ieg EMMA sperm FVB-Tg(Pax4 0.5Kb-LacZ)cb11, FVB-Tg(Pax4-lacZ)2Pgr/Pgr, FVB-Tg(Pax4-lacZ)2Pgr/Neu mutant strain MGI:3057320 Tg(Pax4-lacZ)2Pgr transgene insertion 2, Peter Gruss MGI:3057319 Tg(Pax4-lacZ)2Pgr transgene insertion 2, Peter Gruss https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=205 + EM:00042 FVB-Tg(Pax4-lacZ)1Pgr/PgrIeg EMMA sperm CBII(Pax4-LacZ)Tg, CBIID, FVB-Tg(Pax4-lacZ)1Pgr/Pgr mutant strain MGI:3044158 Tg(Pax4-lacZ)1Pgr transgene insertion 1, Peter Gruss MGI:3044157 Tg(Pax4-lacZ)1Pgr transgene insertion 1, Peter Gruss https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=42 + EM:01839 FVB-Tg(Nefh/EGFP)1Eyer/Orl EMMA archived NFH-GFP, FVB-Tg(Nefh-GFP)/Orl mutant strain MGI:5315129 Tg(Nefh/EGFP)1Eyer transgene insertion 1, Joel Eyer MGI:5315128 Tg(Nefh/EGFP)1Eyer transgene insertion 1, Joel Eyer https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1839 + EM:00140 FVB-Tg(Mpz-cre)1Brn/Orl EMMA embryo P0 Cre-B mutant strain MGI:2445228 Tg(Mpz-cre)1Brn transgene insertion 1, Anton Berns MGI:2445223 Tg(Mpz-cre)1Brn transgene insertion 1, Anton Berns https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=140 + EM:00314 FVB-Tg(Mpz*L106I)3Msch/Cnrm EMMA embryo FVB-Tg(P0)sub3Msch/Cnrm, P0sub3 mutant strain MGI:5003316 Tg(Mpz*L106I)3Msch transgene insertion 3, Melitta Schachner MGI:5003308 Tg(Mpz*L106I)3Msch transgene insertion 3, Melitta Schachner https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=314 + EM:00313 FVB-Tg(Mpz*L106I)1Msch/Cnrm EMMA embryo FVB-Tg(P0)sub1Msch/Cnrm, P0sub1 mutant strain MGI:5003283 Tg(Mpz*L106I)1Msch transgene insertion 1, Melitta Schachner MGI:5003282 Tg(Mpz*L106I)1Msch transgene insertion 1, Melitta Schachner https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=313 + EM:00315 FVB-Tg(Mpz*Ala221fs)4Msch/Cnrm EMMA embryo FVB-Tg(P0)ins4Msch/Cnrm, P0ins4 mutant strain MGI:5003323 Tg(Mpz*Ala221fs)4Msch transgene insertion 4, Melitta Schachner MGI:5003322 Tg(Mpz*Ala221fs)4Msch transgene insertion 4, Melitta Schachner https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=315 ? EM:09937 FVB-Tg(MMTV-PRUNE)/Cnrm EMMA embryo mutant strain Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9937 ? EM:09937 FVB-Tg(MMTV-PRUNE)/Cnrm EMMA sperm mutant strain Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9937 + EM:05152 FVB-Tg(MMTV-ERBB2*)#Arbs/Cnbc EMMA embryo FVB-Tg(MMTV-Erbb2*)#Arbs/Cnbc, FVB HER2M687, FVB-Tg(MMTV-Erbb2)/Cnbc mutant strain MGI:5883855 Tg(MMTV-ERBB2*)#Arbs transgene insertion, Joaquin Arribas MGI:5883853 Tg(MMTV-ERBB2*)#Arbs transgene insertion, Joaquin Arribas https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5152 + EM:05152 FVB-Tg(MMTV-ERBB2*)#Arbs/Cnbc EMMA sperm FVB-Tg(MMTV-Erbb2*)#Arbs/Cnbc, FVB HER2M687, FVB-Tg(MMTV-Erbb2)/Cnbc mutant strain MGI:5883855 Tg(MMTV-ERBB2*)#Arbs transgene insertion, Joaquin Arribas MGI:5883853 Tg(MMTV-ERBB2*)#Arbs transgene insertion, Joaquin Arribas https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5152 + EM:09798 FVB-Tg(KRT14-Vegfd)1Ali/Oulu EMMA embryo FVB-Tg(KRT14-Figf)1Ali/Oulu, K14-mVEGF-D mutant strain MGI:3804466 Tg(KRT14-Vegfd)1Ali transgene insertion 1, Kari Alitalo MGI:3804465 Tg(KRT14-Vegfd)1Ali transgene insertion 1, Kari Alitalo https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9798 + EM:09798 FVB-Tg(KRT14-Vegfd)1Ali/Oulu EMMA sperm FVB-Tg(KRT14-Figf)1Ali/Oulu, K14-mVEGF-D mutant strain MGI:3804466 Tg(KRT14-Vegfd)1Ali transgene insertion 1, Kari Alitalo MGI:3804465 Tg(KRT14-Vegfd)1Ali transgene insertion 1, Kari Alitalo https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9798 ? EM:10733 FVB-Tg(KRT14-VEGFC)1Ali/Oulu EMMA embryo mutant strain MGI:6273971 Tg(KRT14-VEGFC)1Ali transgene insertion 1, Kari Alitalo MGI:6273970 Tg(KRT14-VEGFC)1Ali transgene insertion 1, Kari Alitalo https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10733 ? EM:10733 FVB-Tg(KRT14-VEGFC)1Ali/Oulu EMMA sperm mutant strain MGI:6273971 Tg(KRT14-VEGFC)1Ali transgene insertion 1, Kari Alitalo MGI:6273970 Tg(KRT14-VEGFC)1Ali transgene insertion 1, Kari Alitalo https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10733 + EM:05159 FVB-Tg(Fabp2-Arg1)1Wla/Cnbc EMMA embryo FA/2 FVB mutant strain MGI:2446302 Tg(Fabp2-Arg1)1Wla transgene insertion 1, Wouters H Lamers MGI:2652048 Tg(Fabp2-Arg1)1Wla transgene insertion 1, Wouters H Lamers https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5159 + EM:05159 FVB-Tg(Fabp2-Arg1)1Wla/Cnbc EMMA sperm FA/2 FVB mutant strain MGI:2446302 Tg(Fabp2-Arg1)1Wla transgene insertion 1, Wouters H Lamers MGI:2652048 Tg(Fabp2-Arg1)1Wla transgene insertion 1, Wouters H Lamers https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5159 + EM:01657 FVB-Tg(Dll1-Dll3)3Gos/Ieg EMMA sperm Tg(Dll3)3Gos, FVB-Tg(Dll3)3Gos/Ieg mutant strain MGI:5501066 Tg(Dll1-Dll3)3Gos transgene insertion 3, Achim Gossler MGI:5501062 Tg(Dll1-Dll3)3Gos transgene insertion 3, Achim Gossler https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1657 + EM:01237 FVB-Tg(CEPHY285E6)84Hgc/Orl EMMA embryo YAC Lg 84 mutant strain MGI:5293466 Tg(CEPHY285E6)84Hgc transgene insertion 84, Edward Rubin MGI:5293462 Tg(CEPHY285E6)84Hgc transgene insertion 84, Edward Rubin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1237 + EM:01748 FVB-Tg(CEPHY285E6)67Hgc/Orl EMMA embryo YAC Lg 67 mutant strain MGI:5293460 Tg(CEPHY285E6)67Hgc transgene insertion 67, Edward Rubin MGI:5293459 Tg(CEPHY285E6)67Hgc transgene insertion 67, Edward Rubin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1748 + EM:01245 FVB-Tg(CEPHY230E8)55Hgc/Orl EMMA embryo YAC Lg 55, FVB-Tg(YAC230E)55Hgc/Orl mutant strain MGI:5291627 Tg(CEPHY230E8)55Hgc transgene insertion 55, Edward M Rubin MGI:5291626 Tg(CEPHY230E8)55Hgc transgene insertion 55, Edward M Rubin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1245 + EM:01246 FVB-Tg(CEPHY230E8)50Hgc/Orl EMMA embryo YAC Lg 50, FVB-Tg(YAC230E)50Hgc/Orl mutant strain MGI:5291633 Tg(CEPHY230E8)50Hgc transgene insertion 50, Edward M Rubin MGI:5291632 Tg(CEPHY230E8)50Hgc transgene insertion 50, Edward M Rubin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1246 + EM:01238 FVB-Tg(CEPHY152F7)57Hgc/Orl EMMA embryo YAC Lg 57 mutant strain MGI:5293456 Tg(CEPHY152F7)57Hgc transgene insertion 57, Edward Rubin MGI:5293454 Tg(CEPHY152F7)57Hgc transgene insertion 57, Edward Rubin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1238 + EM:01238 FVB-Tg(CEPHY152F7)57Hgc/Orl EMMA sperm YAC Lg 57 mutant strain MGI:5293456 Tg(CEPHY152F7)57Hgc transgene insertion 57, Edward Rubin MGI:5293454 Tg(CEPHY152F7)57Hgc transgene insertion 57, Edward Rubin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1238 + EM:01303 FVB-Tg(CEPHY152F7)12Hgc/Orl EMMA embryo YAC Lg 12, FVB-Tg(YAC152F7)12Hgc/Orl mutant strain MGI:5293446 Tg(CEPHY152F7)12Hgc transgene insertion 12, Edward M Rubin MGI:5293445 Tg(CEPHY152F7)12Hgc transgene insertion 12, Edward M Rubin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1303 + EM:01304 FVB-Tg(CEPHY141G6)4Hgc/Orl EMMA embryo YAC Lg 4, FVB-Tg(YAC141G6)4Hgc/Orl mutant strain MGI:5293441 Tg(CEPHY141G6)4Hgc transgene insertion 4, Edward M Rubin MGI:5293440 Tg(CEPHY141G6)4Hgc transgene insertion 4, Edward M Rubin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1304 + EM:01302 FVB-Tg(CEPHY141G6)28Hgc/Orl EMMA embryo FVB-Tg(YAC141G6)28Hgc/Orl, YAC Lg 28 mutant strain MGI:5293437 Tg(CEPHY141G6)28Hgc transgene insertion 28, Edward M Rubin MGI:5293436 Tg(CEPHY141G6)28Hgc transgene insertion 28, Edward M Rubin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1302 ? EM:09109 FVB-Tg(CD19-Zap70)1Icgb/Cnrm EMMA embryo mutant strain Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9109 ? EM:09109 FVB-Tg(CD19-Zap70)1Icgb/Cnrm EMMA sperm mutant strain Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9109 + EM:00005 FVB-Tg(CAG-cat,-lacZ)1Brn/StmOrl EMMA embryo FVB-Tg(ACTB-cat-lacZ)1Brn/BrnStm, FVB-Tg(ACTB-cat-lacZ)1Brn/StmOrl, ACZL, FVB-Tg(CAG-cat-lacZ)1Brn/StmOrl mutant strain MGI:3044043 Tg(CAG-cat,-lacZ)1Brn transgene insertion 1, Anton Berns MGI:3044042 Tg(CAG-cat,-lacZ)1Brn transgene insertion 1, Anton Berns https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5 + EM:01415 FVB-Tg(ACTB-tTS)1Mllo/Cnrm EMMA embryo pAct-tTS, FVB-Tg(ACTB-tTS)1Mllo/Ibcm mutant strain MGI:3717162 Tg(ACTB-tTS)1Mllo transgene insertion 1, Moises Mallo MGI:3717161 Tg(ACTB-tTS)1Mllo transgene insertion 1, Moises Mallo https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1415 + EM:11961 FVB-Il31ra/Cnrm EMMA embryo mutant strain MGI:6342541 Il31ra endonuclease-mediated mutation 2, Paul A Heppenstall MGI:2180511 Il31ra interleukin 31 receptor A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11961 + EM:11961 FVB-Il31ra/Cnrm EMMA sperm mutant strain MGI:6342541 Il31ra endonuclease-mediated mutation 2, Paul A Heppenstall MGI:2180511 Il31ra interleukin 31 receptor A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11961 ? EM:11960 FVB-Il31ra/Cnrm EMMA archived mutant strain MGI:6342540 Il31ra endonuclease-mediated mutation 1, Paul A Heppenstall MGI:2180511 Il31ra interleukin 31 receptor A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11960 ? EM:09147 Ftl1Ate007Mhda; internal lab code ATE007 EMMA sperm mutant strain Ftl1 Ftl1 MGI:95589 Ftl1 ferritin light polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9147 ? EM:12162 flox miR-26 sponge EMMA sperm mutant strain Col1A1 Col1A1 MGI:88467 Col1a1 collagen, type I, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12162 ? EM:13083 FDUP EMMA sperm mutant strain Tandem duplication of 13.7 kb at mouse chr4 Tandem duplication of 13.7 kb at mouse chr4 Tandem duplication of 13.7 kb at mouse chr4 Tandem duplication of 13.7 kb at mouse chr4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13083 ? EM:12222 Fam183b EMMA sperm mutant strain Fam183b Fam183b MGI:1922679 Fam183b family with sequence similarity 183, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12222 ? EM:11953 erGAP3 EMMA sperm mutant strain erGAP3 erGAP3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11953 ? EM:11141 EmuTEL-AML1 EMMA sperm mutant strain Tg(Emu-TEL/AML1) Tg(Emu-TEL/AML1) Tg(Emu-TEL/AML1) Tg(Emu-TEL/AML1) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11141 ? EM:15095 Eif2b5/IcsOrl EMMA archived mutant strain Eif2b5 Eif2b5 MGI:2446176 Eif2b5 eukaryotic translation initiation factor 2B, subunit 5 epsilon https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=15095 ? EM:11831 Ebf3 EMMA archived unclassified Ebf3-KO Ebf3-KO MGI:894289 Ebf3 early B cell factor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11831 + EM:01167 DW-Lepr/Orl EMMA archived diabete-Pasteur mutant strain MGI:1856013 Lepr diabetes Institut Pasteur MGI:104993 Lepr leptin receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1167 ? EM:11372 DUSP1flox EMMA embryo mutant strain Dusp1 Dusp1 MGI:105120 Dusp1 dual specificity phosphatase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11372 ? EM:13832 Dll1SF EMMA sperm mutant strain MGI:6781221 Dll1 endonuclease-mediated mutation 1.2, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13832 ? EM:12762 del52 hDMD/mdx mouse EMMA sperm mutant strain human DMD gene carrying a deletion of exon 52 human DMD gene carrying a deletion of exon 52 human DMD gene carrying a deletion of exon 52 human DMD gene carrying a deletion of exon 52 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12762 + EM:02026 DBA/1UguOrl EMMA archived DBA/1 CD44WT mutant strain MGI:2430266 Cd44<+> wild type MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2026 + EM:11300 DBA.129S2(Cg)-Synb/Orl EMMA embryo DBA.Cg-Synb/Orl mutant strain MGI:5308859 Synb targeted mutation 1.2, Mouse Clinical Institute MGI:3045308 Synb syncytin b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11300 + EM:07011 D2.Cg-Tg(Wap-Shh)186Mig/Cnbc EMMA embryo Tg(WAP-Shh)186Mig-DBA2 mutant strain MGI:5645729 Tg(Wap-Shh)186Mig transgene insertion 186, Marta I Gallego MGI:5645725 Tg(Wap-Shh)186Mig transgene insertion 186, Marta I Gallego https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7011 + EM:07011 D2.Cg-Tg(Wap-Shh)186Mig/Cnbc EMMA sperm Tg(WAP-Shh)186Mig-DBA2 mutant strain MGI:5645729 Tg(Wap-Shh)186Mig transgene insertion 186, Marta I Gallego MGI:5645725 Tg(Wap-Shh)186Mig transgene insertion 186, Marta I Gallego https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7011 + EM:01721 D2.Cg-Tg(TG-Gnas*R201H)1Rho/Orl EMMA embryo gsp mice, gsp transgenic mice, 2211D mutant strain MGI:5308857 Tg(TG-Gnas*R201H)1Rho transgene insertion 1, Rhone-Poulenc Sante MGI:5308854 Tg(TG-Gnas*R201H)1Rho transgene insertion 1, Rhone-Poulenc Sante https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1721 + EM:12679 D1OlaHsd.Cg-Thy1/Orl EMMA sperm D1.Cg-Thy1/Orl mutant strain MGI:3579311 Thy1 a variant MGI:98747 Thy1 thymus cell antigen 1, theta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12679 + EM:11814 D1OlaHsd.Cg-Tg(Tcra172,Tcrb172)1Wcl/MmmhOrl EMMA sperm D1OlaHsd.D1LacJ-Tg(Tcra172,Tcrb172)1Wcl/MmmhOrl mutant strain MGI:3699517 Tg(Tcra172,Tcrb172)1Wcl transgene insertion 1, Warren C Ladiges MGI:3767797 Tg(Tcra172,Tcrb172)1Wcl transgene insertion 1, Warren C Ladiges https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11814 ? EM:11813 D1.B6-Tg(CAG-EGFP)1Osb/JOrl EMMA sperm mutant strain MGI:2686773 Tg(CAG-EGFP)1Osb transgene insertion 1, Research Institute for Microbial Diseases, Osaka University MGI:2686899 Tg(CAG-EGFP)1Osb transgene insertion 1, Research Institute for Microbial Diseases, Osaka University https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11813 + EM:11812 D1.129P2(B6)-Il10/JOrl EMMA sperm D1.B6(129P2)-Il10/JOrl mutant strain MGI:1857199 Il10 targeted mutation 1, University of Cologne MGI:96537 Il10 interleukin 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11812 + EM:02025 D1.129-Cd44/Orl EMMA archived mutant strain MGI:2679704 Cd44 targeted mutation 1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2025 + EM:02024 D1.129-Cd44/Orl EMMA archived DBA/1 CD44v6v7-/- mutant strain MGI:2679706 Cd44 targeted mutation 1.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2024 ? EM:14674 Csb/Adh5 double KO B6J.129P2-Ercc6 Adh5/H EMMA sperm unclassified MGI:1932102 Ercc6 targeted mutation 1, Gijsbertus van der Horst MGI:1100494 Ercc6 excision repair cross-complementing rodent repair deficiency, complementation group 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14674 ? EM:14674 Csb/Adh5 double KO B6J.129P2-Ercc6 Adh5/H EMMA sperm unclassified MGI:3033711 Adh5 targeted mutation 1, Jonathan S Stamler MGI:87929 Adh5 alcohol dehydrogenase 5 (class III), chi polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14674 - EM:08317 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon Gnat2<+> EMMA embryo mutant strain MGI:4443331 Tg(Tyr-rtTA)4111Lmon transgene insertion 4111, Lluis Montoliu MGI:4443327 Tg(Tyr-rtTA)4111Lmon transgene insertion 4111, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8317 - EM:08317 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon Gnat2<+> EMMA embryo mutant strain MGI:4443329 Tg(tetO-Tyr)1335Lmon transgene insertion 1335, Lluis Montoliu MGI:4443325 Tg(tetO-Tyr)1335Lmon transgene insertion 1335, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8317 - EM:08317 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon Gnat2<+> EMMA embryo mutant strain MGI:2430747 Gnat2<+> wild type MGI:95779 Gnat2 G protein subunit alpha transducin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8317 - EM:08317 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon Gnat2<+> EMMA embryo mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8317 + EM:02611 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon EMMA embryo TRETyBS/HSTyrTET, HsdWin:NMRI.FVB/HanHsd-Tg(TRETyr,Tyr-rtTA)1335-4111Lmon/Cnbc mutant strain MGI:4443331 Tg(Tyr-rtTA)4111Lmon transgene insertion 4111, Lluis Montoliu MGI:4443327 Tg(Tyr-rtTA)4111Lmon transgene insertion 4111, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2611 + EM:02611 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon EMMA embryo TRETyBS/HSTyrTET, HsdWin:NMRI.FVB/HanHsd-Tg(TRETyr,Tyr-rtTA)1335-4111Lmon/Cnbc mutant strain MGI:4443329 Tg(tetO-Tyr)1335Lmon transgene insertion 1335, Lluis Montoliu MGI:4443325 Tg(tetO-Tyr)1335Lmon transgene insertion 1335, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2611 + EM:02611 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon EMMA embryo TRETyBS/HSTyrTET, HsdWin:NMRI.FVB/HanHsd-Tg(TRETyr,Tyr-rtTA)1335-4111Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2611 - EM:02610 CnbcHsdWin:NMRI-Tg(Tyr-Th,-Gch1)6775Lmon EMMA embryo mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2610 - EM:02610 CnbcHsdWin:NMRI-Tg(Tyr-Th,-Gch1)6775Lmon EMMA embryo mutant strain MGI:4443311 Tg(Tyr-Th,-Gch1)6775Lmon transgene insertion 6775, Lluis Montoliu MGI:4443324 Tg(Tyr-Th,-Gch1)6775Lmon transgene insertion 6775, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2610 + EM:06056 Cnbc:NMRI-Tg(Wap-ALPP*)p1938Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)p1938Lmon mutant strain MGI:6202757 Tg(Wap-ALPP*)p1938Lmon transgene insertion p1938, Lluis Montoliu MGI:6202755 Tg(Wap-ALPP*)p1938Lmon transgene insertion p1938, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6056 + EM:06056 Cnbc:NMRI-Tg(Wap-ALPP*)p1938Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)p1938Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6056 + EM:06055 Cnbc:NMRI-Tg(Wap-ALPP*)p1435Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)p1435Lmon mutant strain MGI:6202751 Tg(Wap-ALPP*)p1435Lmon transgene insertion p1435, Lluis Montoliu MGI:6202750 Tg(Wap-ALPP*)p1435Lmon transgene insertion p1435, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6055 + EM:06055 Cnbc:NMRI-Tg(Wap-ALPP*)p1435Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)p1435Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6055 + EM:06059 Cnbc:NMRI-Tg(Wap-ALPP*)b6733Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6733Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6059 + EM:06059 Cnbc:NMRI-Tg(Wap-ALPP*)b6733Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6733Lmon mutant strain MGI:6202771 Tg(Wap-ALPP*)b6733Lmon transgene insertion b6733, Lluis Montoliu MGI:6202770 Tg(Wap-ALPP*)b6733Lmon transgene insertion b6733, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6059 + EM:06058 Cnbc:NMRI-Tg(Wap-ALPP*)b6727Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6727Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6058 + EM:06058 Cnbc:NMRI-Tg(Wap-ALPP*)b6727Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6727Lmon mutant strain MGI:6202768 Tg(Wap-ALPP*)b6727Lmon transgene insertion b6727, Lluis Montoliu MGI:6202767 Tg(Wap-ALPP*)b6727Lmon transgene insertion b6727, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6058 + EM:06057 Cnbc:NMRI-Tg(Wap-ALPP*)b6725Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6725Lmon mutant strain MGI:6202764 Tg(Wap-ALPP*)b6725Lmon transgene insertion b6725, Lluis Montoliu MGI:6202763 Tg(Wap-ALPP*)b6725Lmon transgene insertion b6725, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6057 + EM:06057 Cnbc:NMRI-Tg(Wap-ALPP*)b6725Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6725Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6057 + EM:05261 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2017Lmon EMMA embryo Hsd:NMRI-Tg(Tyr,aEHS1.4)2017Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2017Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5261 + EM:05261 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2017Lmon EMMA embryo Hsd:NMRI-Tg(Tyr,aEHS1.4)2017Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2017Lmon mutant strain MGI:5645903 Tg(Tyr,aEHS1.4)2017Lmon transgene insertion 2017, Lluis Montoliu MGI:5645900 Tg(Tyr,aEHS1.4)2017Lmon transgene insertion 2017, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5261 + EM:05261 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2017Lmon EMMA sperm Hsd:NMRI-Tg(Tyr,aEHS1.4)2017Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2017Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5261 + EM:05261 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2017Lmon EMMA sperm Hsd:NMRI-Tg(Tyr,aEHS1.4)2017Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2017Lmon mutant strain MGI:5645903 Tg(Tyr,aEHS1.4)2017Lmon transgene insertion 2017, Lluis Montoliu MGI:5645900 Tg(Tyr,aEHS1.4)2017Lmon transgene insertion 2017, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5261 + EM:05262 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2005Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2005Lmon, Hsd:NMRI-Tg(Tyr,aEHS1.4)2005Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5262 + EM:05262 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2005Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2005Lmon, Hsd:NMRI-Tg(Tyr,aEHS1.4)2005Lmon/Cnbc mutant strain MGI:5645904 Tg(Tyr,aEHS1.4)2005Lmon transgene insertion 2005, Lluis Montoliu MGI:5645901 Tg(Tyr,aEHS1.4)2005Lmon transgene insertion 2005, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5262 + EM:05262 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2005Lmon EMMA sperm Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2005Lmon, Hsd:NMRI-Tg(Tyr,aEHS1.4)2005Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5262 + EM:05262 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2005Lmon EMMA sperm Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2005Lmon, Hsd:NMRI-Tg(Tyr,aEHS1.4)2005Lmon/Cnbc mutant strain MGI:5645904 Tg(Tyr,aEHS1.4)2005Lmon transgene insertion 2005, Lluis Montoliu MGI:5645901 Tg(Tyr,aEHS1.4)2005Lmon transgene insertion 2005, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5262 + EM:03109 Cnbc:NMRI-Tg(Tyr*)8749Lmon EMMA embryo YRT2deltaAB line 8749, YRT2deltaAB, NMRI-Tg(Tyr*)8749Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3109 + EM:03109 Cnbc:NMRI-Tg(Tyr*)8749Lmon EMMA embryo YRT2deltaAB line 8749, YRT2deltaAB, NMRI-Tg(Tyr*)8749Lmon/Cnbc mutant strain MGI:5788264 Tg(Tyr*)8749Lmon transgene insertion 8749, Lluis Montoliu MGI:5788263 Tg(Tyr*)8749Lmon transgene insertion 8749, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3109 + EM:03109 Cnbc:NMRI-Tg(Tyr*)8749Lmon EMMA sperm YRT2deltaAB line 8749, YRT2deltaAB, NMRI-Tg(Tyr*)8749Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3109 + EM:03109 Cnbc:NMRI-Tg(Tyr*)8749Lmon EMMA sperm YRT2deltaAB line 8749, YRT2deltaAB, NMRI-Tg(Tyr*)8749Lmon/Cnbc mutant strain MGI:5788264 Tg(Tyr*)8749Lmon transgene insertion 8749, Lluis Montoliu MGI:5788263 Tg(Tyr*)8749Lmon transgene insertion 8749, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3109 + EM:03104 Cnbc:NMRI-Tg(Tyr*)8748Lmon EMMA embryo YRT2deltaAB line 8748, NMRI-Tg(Tyr*)8748Lmon/Cnbc, YRT2deltaAB mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3104 + EM:03104 Cnbc:NMRI-Tg(Tyr*)8748Lmon EMMA embryo YRT2deltaAB line 8748, NMRI-Tg(Tyr*)8748Lmon/Cnbc, YRT2deltaAB mutant strain MGI:5787964 Tg(Tyr*)8748Lmon transgene insertion 8748, Lluis Montoliu MGI:5787963 Tg(Tyr*)8748Lmon transgene insertion 8748, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3104 + EM:03103 Cnbc:NMRI-Tg(Tyr*)6968Lmon EMMA embryo YRT2deltaA, YRT2deltaA line 6968, NMRI-Tg(Tyr*)6968Lmon/Cnbc mutant strain MGI:5787961 Tg(Tyr*)6968Lmon transgene insertion 6968, Lluis Montoliu MGI:5787960 Tg(Tyr*)6968Lmon transgene insertion 6968, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3103 + EM:03103 Cnbc:NMRI-Tg(Tyr*)6968Lmon EMMA embryo YRT2deltaA, YRT2deltaA line 6968, NMRI-Tg(Tyr*)6968Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3103 - EM:03105 Cnbc:NMRI-Tg(Tyr*)4794Lmon EMMA embryo mutant strain MGI:5787978 Tg(Tyr*)4794Lmon transgene insertion 4794, Lluis Montoliu MGI:5787970 Tg(Tyr*)4794Lmon transgene insertion 4794, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3105 - EM:03105 Cnbc:NMRI-Tg(Tyr*)4794Lmon EMMA embryo mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3105 - EM:03105 Cnbc:NMRI-Tg(Tyr*)4794Lmon EMMA sperm mutant strain MGI:5787978 Tg(Tyr*)4794Lmon transgene insertion 4794, Lluis Montoliu MGI:5787970 Tg(Tyr*)4794Lmon transgene insertion 4794, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3105 - EM:03105 Cnbc:NMRI-Tg(Tyr*)4794Lmon EMMA sperm mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3105 + EM:03102 Cnbc:NMRI-Tg(Tyr*)2138Lmon EMMA embryo YRT4 mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3102 + EM:03102 Cnbc:NMRI-Tg(Tyr*)2138Lmon EMMA embryo YRT4 mutant strain MGI:5787956 Tg(Tyr*)2138Lmon transgene insertion 2138, Lluis Montoliu MGI:5787955 Tg(Tyr*)2138Lmon transgene insertion 2138, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3102 + EM:03102 Cnbc:NMRI-Tg(Tyr*)2138Lmon EMMA sperm YRT4 mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3102 + EM:03102 Cnbc:NMRI-Tg(Tyr*)2138Lmon EMMA sperm YRT4 mutant strain MGI:5787956 Tg(Tyr*)2138Lmon transgene insertion 2138, Lluis Montoliu MGI:5787955 Tg(Tyr*)2138Lmon transgene insertion 2138, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3102 + EM:05257 Cnbc:NMRI-Tg(Tyr)2331Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr)2331Lmon, Hsd:NMRI-Tg(Tyr)2331Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5257 + EM:05257 Cnbc:NMRI-Tg(Tyr)2331Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr)2331Lmon, Hsd:NMRI-Tg(Tyr)2331Lmon/Cnbc mutant strain MGI:5645916 Tg(Tyr)2331Lmon transgene insertion 2331, Lluis Montoliu MGI:5645909 Tg(Tyr)2331Lmon transgene insertion 2331, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5257 + EM:05257 Cnbc:NMRI-Tg(Tyr)2331Lmon EMMA sperm Hsd:NMRI-Tg(Tyr-Tyr)2331Lmon, Hsd:NMRI-Tg(Tyr)2331Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5257 + EM:05257 Cnbc:NMRI-Tg(Tyr)2331Lmon EMMA sperm Hsd:NMRI-Tg(Tyr-Tyr)2331Lmon, Hsd:NMRI-Tg(Tyr)2331Lmon/Cnbc mutant strain MGI:5645916 Tg(Tyr)2331Lmon transgene insertion 2331, Lluis Montoliu MGI:5645909 Tg(Tyr)2331Lmon transgene insertion 2331, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5257 + EM:05259 Cnbc:NMRI-Tg(Tyr)2231Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2231Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2231Lmon mutant strain MGI:5645920 Tg(Tyr)2231Lmon transgene insertion 2231, Lluis Montoliu MGI:5645912 Tg(Tyr)2231Lmon transgene insertion 2231, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5259 + EM:05259 Cnbc:NMRI-Tg(Tyr)2231Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2231Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2231Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5259 + EM:05259 Cnbc:NMRI-Tg(Tyr)2231Lmon EMMA sperm Hsd:NMRI-Tg(Tyr)2231Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2231Lmon mutant strain MGI:5645920 Tg(Tyr)2231Lmon transgene insertion 2231, Lluis Montoliu MGI:5645912 Tg(Tyr)2231Lmon transgene insertion 2231, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5259 + EM:05259 Cnbc:NMRI-Tg(Tyr)2231Lmon EMMA sperm Hsd:NMRI-Tg(Tyr)2231Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2231Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5259 + EM:05256 Cnbc:NMRI-Tg(Tyr)2222Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr)2222Lmon/Cnbc, Hsd:NMRI-Tg(Tyr)2222Lmon/Cnbc mutant strain MGI:5645915 Tg(Tyr)2222Lmon transgene insertion 2222, Lluis Montoliu MGI:5645908 Tg(Tyr)2222Lmon transgene insertion 2222, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5256 + EM:05256 Cnbc:NMRI-Tg(Tyr)2222Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr)2222Lmon/Cnbc, Hsd:NMRI-Tg(Tyr)2222Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5256 + EM:05256 Cnbc:NMRI-Tg(Tyr)2222Lmon EMMA sperm Hsd:NMRI-Tg(Tyr-Tyr)2222Lmon/Cnbc, Hsd:NMRI-Tg(Tyr)2222Lmon/Cnbc mutant strain MGI:5645915 Tg(Tyr)2222Lmon transgene insertion 2222, Lluis Montoliu MGI:5645908 Tg(Tyr)2222Lmon transgene insertion 2222, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5256 + EM:05256 Cnbc:NMRI-Tg(Tyr)2222Lmon EMMA sperm Hsd:NMRI-Tg(Tyr-Tyr)2222Lmon/Cnbc, Hsd:NMRI-Tg(Tyr)2222Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5256 + EM:05260 Cnbc:NMRI-Tg(Tyr)2131Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2131Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2131Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5260 + EM:05260 Cnbc:NMRI-Tg(Tyr)2131Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2131Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2131Lmon mutant strain MGI:5645925 Tg(Tyr)2131Lmon transgene insertion 2131, Lluis Montoliu MGI:5645913 Tg(Tyr)2131Lmon transgene insertion 2131, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5260 + EM:05260 Cnbc:NMRI-Tg(Tyr)2131Lmon EMMA sperm Hsd:NMRI-Tg(Tyr)2131Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2131Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5260 + EM:05260 Cnbc:NMRI-Tg(Tyr)2131Lmon EMMA sperm Hsd:NMRI-Tg(Tyr)2131Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2131Lmon mutant strain MGI:5645925 Tg(Tyr)2131Lmon transgene insertion 2131, Lluis Montoliu MGI:5645913 Tg(Tyr)2131Lmon transgene insertion 2131, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5260 + EM:05258 Cnbc:NMRI-Tg(Tyr)2028Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2028Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2028Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5258 + EM:05258 Cnbc:NMRI-Tg(Tyr)2028Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2028Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2028Lmon mutant strain MGI:5645918 Tg(Tyr)2028Lmon transgene insertion 2028, Lluis Montoliu MGI:5645911 Tg(Tyr)2028Lmon transgene insertion 2028, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5258 + EM:03096 Cnbc:NMRI-Tg(Tyr)1999Lmon EMMA embryo NMRI-Tg(Tyr)1999Lmon/Cnbc, YRT2 mutant strain MGI:5787939 Tg(Tyr)1999Lmon transgene insertion 1999, Lluis Montoliu MGI:5787936 Tg(Tyr)1999Lmon transgene insertion 1999, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3096 + EM:03096 Cnbc:NMRI-Tg(Tyr)1999Lmon EMMA embryo NMRI-Tg(Tyr)1999Lmon/Cnbc, YRT2 mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3096 + EM:03096 Cnbc:NMRI-Tg(Tyr)1999Lmon EMMA sperm NMRI-Tg(Tyr)1999Lmon/Cnbc, YRT2 mutant strain MGI:5787939 Tg(Tyr)1999Lmon transgene insertion 1999, Lluis Montoliu MGI:5787936 Tg(Tyr)1999Lmon transgene insertion 1999, Lluis Montoliu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3096 + EM:03096 Cnbc:NMRI-Tg(Tyr)1999Lmon EMMA sperm NMRI-Tg(Tyr)1999Lmon/Cnbc, YRT2 mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3096 + EM:06053 Cnbc:NMRI-conls<+> EMMA embryo stock Hsd:NMRI-coneless+/Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6053 + EM:06053 Cnbc:NMRI-conls<+> EMMA embryo stock Hsd:NMRI-coneless+/Lmon mutant strain MGI:6198563 conls<+> wild type MGI:6198564 conls coneless https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6053 + EM:06052 Cnbc:NMRI-conls EMMA embryo stock HsdWin:NMRI-coneless/Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6052 + EM:06052 Cnbc:NMRI-conls EMMA embryo stock HsdWin:NMRI-coneless/Lmon mutant strain MGI:6198566 conls coneless MGI:6198564 conls coneless https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6052 ? EM:14676 Chd8tm1.2Mabn B6(Cg)-Chd8/H EMMA sperm unclassified MGI:6115344 Chd8 targeted mutaiton 1.2, Michiel A Bassoon MGI:1915022 Chd8 chromodomain helicase DNA binding protein 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14676 + EM:12506 CFW-Em/JG EMMA sperm mutant strain MGI:1861119 Em Emory cataract MGI:95319 Em Emory cataract https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12506 + EM:00220 CD2-Tg(HK2-luc)279Uku/Orl EMMA embryo Uku279, CD2-Tg(HK2-luc)279Uku/Ciml, CD2-Tg(HK2-luc)279Uku mutant strain MGI:3522710 Tg(HK2-luc)279Uku transgene insertion 279, University of Kuopio MGI:3522709 Tg(HK2-luc)279Uku transgene insertion 279, University of Kuopio https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=220 + EM:00219 CD2-Tg(HK2-luc)253Uku/Orl EMMA embryo CD2-Tg(HK2-luc)253Uku, CD2-Tg(HK2-luc)253Uku/Ciml mutant strain MGI:3522707 Tg(HK2-luc)253Uku transgene insertion 253, University of Kuopio MGI:3522705 Tg(HK2-luc)253Uku transgene insertion 253, University of Kuopio https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=219 + EM:00218 CD2-Tg(HK2-luc)242Uku/Orl EMMA embryo CD2-Tg(HK2-luc)242Uku, CD2-Tg(HK2-luc)242Uku/Ciml mutant strain MGI:3522703 Tg(HK2-luc)242Uku transgene insertion 242, University of Kuopio MGI:3522701 Tg(HK2-luc)242Uku transgene insertion 242, University of Kuopio https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=218 + EM:00217 CD2-Tg(HK2-luc)231Uku/Orl EMMA embryo CD2-Tg(HK2-luc)231Uku/Ciml, CD2-Tg(HK2-luc)231Uku mutant strain MGI:3522676 Tg(HK2-luc)231Uku transgene insertion 231, University of Kuopio MGI:3522674 Tg(HK2-luc)231Uku transgene insertion 231, University of Kuopio https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=217 + EM:02073 CD2-Hk2/Kctt EMMA embryo Ukko1; Hk2+/-, CD2.129P2-Hk2/Kctt mutant strain MGI:3624862 Hk2 targeted mutation 1, Markku Laakso MGI:1315197 Hk2 hexokinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2073 ? EM:11390 CD2-Egr2 transgenic (Tg) mouse EMMA sperm mutant strain CD2-Egr2-Tg CD2-Egr2-Tg https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11390 ? EM:14701 CD1;B6N-MADM-TG; Igs32; MADM-9-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14701 ? EM:14699 CD1;B6N-MADM-TG; Igs31; MADM-8-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14699 ? EM:14697 CD1;B6N-MADM-TG; Igs5; MADM-7-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat MGI:5470322 Igs5 intergenic site 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14697 ? EM:14695 CD1;B6N-MADM-TG; Igs30; MADM-6-TG EMMA archived unclassified MGI:6715987 Igs30 targeted mutation 2, Biomodels Austria MGI:6715918 Igs30 intergenic site 30 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14695 ? EM:14693 CD1;B6N-MADM-TG; Igs29; MADM-5-TG EMMA archived unclassified MGI:6715985 Igs29 targeted mutation 2, Biomodels Austria MGI:6715917 Igs29 intergenic site 29 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14693 ? EM:14691 CD1;B6N-MADM-TG; Igs28; MADM-4-TG EMMA archived unclassified MGI:6715982 Igs28 targeted mutation 2, Biomodels Austria MGI:6715914 Igs28 intergenic site 28 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14691 ? EM:14687 CD1;B6N-MADM-TG; Igs26; MADM-2-TG EMMA archived unclassified MGI:6715934 Igs26 targeted mutation 2, Biomodels Austria MGI:6715912 Igs26 intergenic site 26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14687 ? EM:14721 CD1;B6N-MADM-TG; Igs40; MADM-19-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14721 ? EM:14719 CD1;B6N-MADM-TG; Igs39; MADM-18-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14719 ? EM:14717 CD1;B6N-MADM-TG; Igs38; MADM-17-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14717 ? EM:14715 CD1;B6N-MADM-TG; Igs37; MADM-16-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14715 ? EM:14713 CD1;B6N-MADM-TG; Igs36; MADM-15-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14713 ? EM:14711 CD1;B6N-MADM-TG; Igs35; MADM-14-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14711 ? EM:14709 CD1;B6N-MADM-TG; Igs34; MADM-13-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14709 ? EM:14707 CD1;B6N-MADM-TG; Igs6; MADM-12-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14707 ? EM:14705 CD1;B6N-MADM-TG; Igs2; MADM-11-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14705 ? EM:14703 CD1;B6N-MADM-TG; Igs33; MADM-10-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14703 ? EM:14700 CD1;B6N-MADM-GT; Igs32; MADM-9-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14700 ? EM:14698 CD1;B6N-MADM-GT; Igs31; MADM-8-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14698 ? EM:14696 CD1;B6N-MADM-GT; Igs5; MADM-7-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat MGI:5470322 Igs5 intergenic site 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14696 ? EM:14694 CD1;B6N-MADM-GT; Igs30; MADM-6-GT EMMA archived unclassified MGI:6715986 Igs30 targeted mutation 1, Biomodels Austria MGI:6715918 Igs30 intergenic site 30 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14694 ? EM:14692 CD1;B6N-MADM-GT; Igs29; MADM-5-GT EMMA archived unclassified MGI:6715984 Igs29 targeted mutation 1, Biomodels Austria MGI:6715917 Igs29 intergenic site 29 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14692 ? EM:14690 CD1;B6N-MADM-GT; Igs28; MADM-4-GT EMMA archived unclassified MGI:6715981 Igs28 targeted mutation 1, Biomodels Austria MGI:6715914 Igs28 intergenic site 28 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14690 ? EM:14688 CD1;B6N-MADM-GT; Igs27; MADM-3-GT EMMA archived unclassified MGI:6715935 Igs27 targeted mutation 1, Biomodels Austria MGI:6715913 Igs27 intergenic site 27 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14688 ? EM:14686 CD1;B6N-MADM-GT; Igs26; MADM-2-GT EMMA archived unclassified MGI:6715933 Igs26 targeted mutation 1, Biomodels Austria MGI:6715912 Igs26 intergenic site 26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14686 ? EM:14720 CD1;B6N-MADM-GT; Igs40; MADM-19-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14720 ? EM:14718 CD1;B6N-MADM-GT; Igs39; MADM-18-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14718 ? EM:14716 CD1;B6N-MADM-GT; Igs38; MADM-17-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14716 ? EM:14714 CD1;B6N-MADM-GT; Igs37; MADM-16-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14714 ? EM:14712 CD1;B6N-MADM-GT; Igs36; MADM-15-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14712 ? EM:14710 CD1;B6N-MADM-GT; Igs35; MADM-14-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14710 ? EM:14708 CD1;B6N-MADM-GT; Igs34; MADM-13-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14708 ? EM:14706 CD1;B6N-MADM-GT; Igs6; MADM-12-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14706 ? EM:14704 CD1;B6N-MADM-GT; Igs2; MADM-11-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14704 ? EM:14702 CD1;B6N-MADM-GT; Igs33; MADM-10-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14702 ? EM:14689 CD1;B6N-Igs27/Biat EMMA archived unclassified MGI:6715936 Igs27 targeted mutation 2, Biomodels Austria MGI:6715913 Igs27 intergenic site 27 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14689 ? EM:14685 CD1;B6N-Igs25/Biat EMMA archived unclassified MGI:6715932 Igs25 targeted mutation 2, Biomodels Austria MGI:6715911 Igs25 intergenic site 25 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14685 ? EM:14684 CD1;B6N-Igs25/Biat EMMA archived unclassified MGI:6715931 Igs25 targeted mutation 1, Biomodels Austria MGI:6715911 Igs25 intergenic site 25 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14684 ? EM:12226 CD1;129-Dll1/Biat EMMA sperm mutant strain Dll1 Dll1 MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12226 ? EM:12227 CD1;129-Dll1/Biat EMMA sperm mutant strain Dll1 Dll1 MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12227 ? EM:12821 CD1;129-Cfap43/Biat EMMA sperm mutant strain MGI:6431400 Cfap43 endonuclease-mediated mutation 1.1, Achim Gossler MGI:1289258 Cfap43 cilia and flagella associated protein 43 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12821 - EM:12662 CD1; B6D2-Tg(Prm1EGFP, CAG-mRFP1, HS4i-TyrC)85Ltku EMMA embryo mutant strain Tg(Prm1-EGFP)85Ltku transgene insertion 85, Pawel Pelczar Tg(Prm1-EGFP)85Ltku transgene insertion 85, Pawel Pelczar https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12662 - EM:12662 CD1; B6D2-Tg(Prm1EGFP, CAG-mRFP1, HS4i-TyrC)85Ltku EMMA live mutant strain Tg(Prm1-EGFP)85Ltku transgene insertion 85, Pawel Pelczar Tg(Prm1-EGFP)85Ltku transgene insertion 85, Pawel Pelczar https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12662 + EM:06065 CD1.Cg-Stat1/Cnbc EMMA embryo CD1.129-Stat1/Dlv-Tg(APN)270<-/->/Cnbc mutant strain MGI:1930947 Stat1 targeted mutation 1, David E Levy MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6065 + EM:06061 CD1.Cg-Stat1 Tg(ANPEP)861Mmul/Cnbc EMMA embryo CD1.129-Stat1 Tg(ANPEP)861Mmul/Cnbc, CD1.129-Stat1/Dlv-Tg(APN)861<+/+>/Cnbc mutant strain MGI:1930947 Stat1 targeted mutation 1, David E Levy MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6061 + EM:06061 CD1.Cg-Stat1 Tg(ANPEP)861Mmul/Cnbc EMMA embryo CD1.129-Stat1 Tg(ANPEP)861Mmul/Cnbc, CD1.129-Stat1/Dlv-Tg(APN)861<+/+>/Cnbc mutant strain MGI:5645779 Tg(ANPEP)861Mmul transgene insertion 861, Mathias Muller MGI:5645777 Tg(ANPEP)861Mmul transgene insertion 861, Mathias Muller https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6061 + EM:06060 CD1.Cg-Stat1 Tg(ANPEP)270Mmul/Cnbc EMMA embryo mutant strain MGI:1930947 Stat1 targeted mutation 1, David E Levy MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6060 + EM:06060 CD1.Cg-Stat1 Tg(ANPEP)270Mmul/Cnbc EMMA embryo mutant strain MGI:5645778 Tg(ANPEP)270Mmul transgene insertion 270, Mathias Muller MGI:5645776 Tg(ANPEP)270Mmul transgene insertion 270, Mathias Muller https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6060 + EM:02488 CD1.Cg-Fgfr2/H EMMA sperm CD1-FGFR2c342y, CD1.Cg-Fgfr2 mutant strain MGI:3053095 Fgfr2 targeted mutation 4, Peter Lonai MGI:95523 Fgfr2 fibroblast growth factor receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2488 + EM:05990 CD1.A-Gdf5/Orl EMMA embryo Gdf5bp-J mutant strain MGI:1855974 Gdf5 brachypodism Jackson MGI:95688 Gdf5 growth differentiation factor 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5990 + EM:04663 CD1.192P2-Zfp647/H EMMA sperm CD1.192P2-Zfp647/H, Zfp647Gt(betageo)1Hgs CD1 mutant strain MGI:4353070 Zfp647 gene trap ES492, Heidi Sutherland MGI:3052806 Zfp647 zinc finger protein 647 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4663 + EM:05397 CD1.129X1-Kat2b/Orl EMMA embryo PCAF -/- CD1 mutant strain MGI:2386307 Kat2b targeted mutation 1, Yoshihiro Nakatani MGI:1343094 Kat2b K(lysine) acetyltransferase 2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5397 + EM:06064 CD1.129S-Stat1<+>/Cnbc EMMA embryo CD1.129-Stat1<+/+>-Tg(APN)270<-/->/Cnbc mutant strain MGI:2433148 Stat1<+> wild type MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6064 + EM:02389 CD1.129P2-Afp/Cnrm EMMA embryo CD1.129P2-Afp/Ibcm, CD1-Afptm1Ibmm (AFP KO1) mutant strain MGI:2388722 Afp targeted mutation 1, Claude Szpirer MGI:87951 Afp alpha fetoprotein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2389 + EM:02450 CD1.129P2(Cg)-Sp6/Cnrm EMMA embryo STOCK Sp6/Ibcm, CD1.129P2(Cg)-Sp6/Ibcm, CD1-Sp6 tm1Ibmm, CD1.129P2-Sp6/Ibcm mutant strain MGI:3778294 Sp6 targeted mutation 1.1, Claude Szpirer MGI:1932575 Sp6 trans-acting transcription factor 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2450 + EM:02450 CD1.129P2(Cg)-Sp6/Cnrm EMMA sperm STOCK Sp6/Ibcm, CD1.129P2(Cg)-Sp6/Ibcm, CD1-Sp6 tm1Ibmm, CD1.129P2-Sp6/Ibcm mutant strain MGI:3778294 Sp6 targeted mutation 1.1, Claude Szpirer MGI:1932575 Sp6 trans-acting transcription factor 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2450 + EM:05335 CD1.129P2(B6)-Sox9/H EMMA sperm Sox9-neo mutant strain MGI:3817218 Sox9 targeted mutation 2, Gerd Scherer MGI:98371 Sox9 SRY (sex determining region Y)-box 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5335 + EM:02449 CD1.129-Sp6/Cnrm EMMA embryo CD1.129P2-Sp6/Ibcm, CD1.129-Sp6/Ibcm, Sp6.loxp-tm1Ibmm/CD1 mutant strain MGI:3778292 Sp6 targeted mutation 1, Claude Szpirer MGI:1932575 Sp6 trans-acting transcription factor 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2449 + EM:07742 CD1.129-Sigmar1/Cnbc EMMA embryo STOCK CD1 Sigmar1 mutant strain MGI:3044771 Sigmar1 targeted mutation 1, Lluis Montoliu MGI:1195268 Sigmar1 sigma non-opioid intracellular receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7742 + EM:00160 CD1.129-Ptch1/Cnrm EMMA embryo CD1-Ptc-KO, CD1.129-Ptch, CD1.129-Ptch1/Ibcm, CD-1.129-Ptch, Ptc-CD1 KO mutant strain MGI:1857935 Ptch1 targeted mutation 1, Andreas Zimmer MGI:105373 Ptch1 patched 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=160 + EM:05988 CD1.129-Nog/Orl EMMA archived Nogtm1Amc mutant strain MGI:1862000 Nog targeted mutation 1, Andrew P McMahon MGI:104327 Nog noggin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5988 + EM:04858 CD1.129-Nodal/Orl EMMA embryo 129 Nodal-LacZ (KO) mutant strain MGI:2180793 Nodal targeted mutation 1, Elizabeth J Robertson MGI:97359 Nodal nodal https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4858 + EM:10583 CD1.129-Cnr1/Cnbc EMMA embryo mutant strain MGI:1857736 Cnr1 targeted mutation 1, Marc Parmentier MGI:104615 Cnr1 cannabinoid receptor 1 (brain) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10583 + EM:10583 CD1.129-Cnr1/Cnbc EMMA sperm mutant strain MGI:1857736 Cnr1 targeted mutation 1, Marc Parmentier MGI:104615 Cnr1 cannabinoid receptor 1 (brain) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10583 + EM:06068 CD1.129-Ccr6/Cnbc EMMA embryo mutant strain MGI:2179613 Ccr6 targeted mutation 1, Gabriel Marquez MGI:1333797 Ccr6 chemokine (C-C motif) receptor 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6068 + EM:06068 CD1.129-Ccr6/Cnbc EMMA sperm mutant strain MGI:2179613 Ccr6 targeted mutation 1, Gabriel Marquez MGI:1333797 Ccr6 chemokine (C-C motif) receptor 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6068 + EM:10582 CD1.129-Adora2a/Cnbc EMMA embryo mutant strain MGI:2152583 Adora2a targeted mutation 1, Marc Parmentier MGI:99402 Adora2a adenosine A2a receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10582 + EM:10582 CD1.129-Adora2a/Cnbc EMMA sperm mutant strain MGI:2152583 Adora2a targeted mutation 1, Marc Parmentier MGI:99402 Adora2a adenosine A2a receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10582 ? EM:04678 CD1-Rce1/Cnbc EMMA embryo mutant strain MGI:1336895 Rce1 Ras converting CAAX endopeptidase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4678 ? EM:04678 CD1-Rce1/Cnbc EMMA sperm mutant strain MGI:1336895 Rce1 Ras converting CAAX endopeptidase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4678 - EM:01796 CD1(B6)-Tg(Hoxb1-cre)r4Mist/Cnrm EMMA embryo mutant strain MGI:5006714 Tg(Hoxb1-cre)r4Mist transgene insertion r4, Michele Studer MGI:5006713 Tg(Hoxb1-cre)r4Mist transgene insertion r4, Michele Studer https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1796 - EM:01796 CD1(B6)-Tg(Hoxb1-cre)r4Mist/Cnrm EMMA sperm mutant strain MGI:5006714 Tg(Hoxb1-cre)r4Mist transgene insertion r4, Michele Studer MGI:5006713 Tg(Hoxb1-cre)r4Mist transgene insertion r4, Michele Studer https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1796 + EM:06063 CD1(129S)-Tg(ANPEP)861Mmul/Cnbc EMMA embryo CD1.129-Stat1<+/+>-Tg(APN)861<+/+>/Cnbc mutant strain MGI:5645779 Tg(ANPEP)861Mmul transgene insertion 861, Mathias Muller MGI:5645777 Tg(ANPEP)861Mmul transgene insertion 861, Mathias Muller https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6063 + EM:06063 CD1(129S)-Tg(ANPEP)861Mmul/Cnbc EMMA embryo CD1.129-Stat1<+/+>-Tg(APN)861<+/+>/Cnbc mutant strain MGI:2433148 Stat1<+> wild type MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6063 + EM:06062 CD1(129S)-Tg(ANPEP)270Mmul/Cnbc EMMA embryo CD1.129-Stat1<+/+>-Tg(APN)270<+/+>/Cnbc mutant strain MGI:2433148 Stat1<+> wild type MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6062 + EM:06062 CD1(129S)-Tg(ANPEP)270Mmul/Cnbc EMMA embryo CD1.129-Stat1<+/+>-Tg(APN)270<+/+>/Cnbc mutant strain MGI:5645778 Tg(ANPEP)270Mmul transgene insertion 270, Mathias Muller MGI:5645776 Tg(ANPEP)270Mmul transgene insertion 270, Mathias Muller https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6062 + EM:01382 CD-1 x B6.129S1-Pax1/Ieg EMMA sperm Pax1 mutant strain MGI:1857741 Pax1 targeted mutation 2, Neuherberg MGI:97485 Pax1 paired box 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1382 + EM:02105 CByIco.Cg-Tg(DO11.10)10Dlo/Cnrm EMMA embryo BALB/cByJIco DO11.10, CBy.Cg-Tg(DO11.10)10Dlo/Ibcm, CByIco.Cg-Tg(DO11.10)10Dlo/Ibcm mutant strain MGI:2664398 Tg(DO11.10)10Dlo transgene insertion 10, Dennis Y Loh MGI:2664401 Tg(DO11.10)10Dlo transgene insertion 10, Dennis Y Loh https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2105 + EM:02106 CByIco.129S7-Ifng/Cnrm EMMA embryo BALB/cByJIco IFNg-/-, CByIco.129S7-Ifng/Ibcm, CBy.129S7-Ifng/Ibcm mutant strain MGI:1857184 Ifng targeted mutation 1, Timothy Stewart MGI:107656 Ifng interferon gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2106 + EM:02106 CByIco.129S7-Ifng/Cnrm EMMA sperm BALB/cByJIco IFNg-/-, CByIco.129S7-Ifng/Ibcm, CBy.129S7-Ifng/Ibcm mutant strain MGI:1857184 Ifng targeted mutation 1, Timothy Stewart MGI:107656 Ifng interferon gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2106 + EM:02017 CByIco.129S-Rag2/H EMMA embryo Rag2-/- CD44WT, CBy.129-Rag2/H, BALB/cByJIco Rag2-/- CD44WT mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2017 + EM:02021 CByIco.129-Rag2 Cd44/H EMMA embryo CBy.129-Cd44 Rag2/H, BALB/cByJIco Rag2-/- CD44v10-/- mutant strain MGI:4835490 Cd44 targeted mutation 2.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2021 + EM:02021 CByIco.129-Rag2 Cd44/H EMMA embryo CBy.129-Cd44 Rag2/H, BALB/cByJIco Rag2-/- CD44v10-/- mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2021 + EM:02020 CByIco.129-Rag2 Cd44/H EMMA embryo BALB/cByJIco Rag2-/- CD44v7-/-, Rag2-/-CD44v7-/-, CBy.129-Rag2 Cd44/H mutant strain MGI:2679704 Cd44 targeted mutation 1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2020 + EM:02020 CByIco.129-Rag2 Cd44/H EMMA embryo BALB/cByJIco Rag2-/- CD44v7-/-, Rag2-/-CD44v7-/-, CBy.129-Rag2 Cd44/H mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2020 + EM:02022 CByIco.129-Rag2 Cd44/H EMMA embryo CBy.129-Cd44 Rag2/H, CBy.129-Rag2 Cd44/H, BALB/cByJIco Rag2-/- CD44v6v7-/- mutant strain MGI:2679706 Cd44 targeted mutation 1.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2022 + EM:02022 CByIco.129-Rag2 Cd44/H EMMA embryo CBy.129-Cd44 Rag2/H, CBy.129-Rag2 Cd44/H, BALB/cByJIco Rag2-/- CD44v6v7-/- mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2022 + EM:02018 CByIco.129-Cd44/Ieg EMMA archived CBy.129-Cd44/Ieg, BALB/cByJIco CD44v7-/- mutant strain MGI:2679704 Cd44 targeted mutation 1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2018 + EM:02019 CByIco.129-Cd44/Ieg EMMA archived BALB/cByJIco CD44v6v7-/- mutant strain MGI:2679706 Cd44 targeted mutation 1.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2019 + EM:02079 CByIco.129(Cg)-Cd44/Ieg EMMA archived BALB/cByJIco CD44v10-/-, CBy.129X1-Cd44/Ieg mutant strain MGI:4835490 Cd44 targeted mutation 2.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2079 + EM:02427 CBy.Cg-Cd44 Tg(DO11.10)10Dlo/Cnrm EMMA embryo CBy.Cg-Cd44 Tg(DO11.10)10Dlo/Ibcm, BALB/cByJIco DO11.10 CD44v6v7-/-, CBy.129X1-Tg(DO11.10)10Dlo Cd44/Ibcm mutant strain MGI:2664398 Tg(DO11.10)10Dlo transgene insertion 10, Dennis Y Loh MGI:2664401 Tg(DO11.10)10Dlo transgene insertion 10, Dennis Y Loh https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2427 + EM:02427 CBy.Cg-Cd44 Tg(DO11.10)10Dlo/Cnrm EMMA embryo CBy.Cg-Cd44 Tg(DO11.10)10Dlo/Ibcm, BALB/cByJIco DO11.10 CD44v6v7-/-, CBy.129X1-Tg(DO11.10)10Dlo Cd44/Ibcm mutant strain MGI:2679706 Cd44 targeted mutation 1.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2427 + EM:06070 CBy.129-Ccr8/Cnbc EMMA embryo C.129-Ccr8/Cnbc, C.129-Ccr8 mutant strain MGI:2450726 Ccr8 targeted mutation 1, Gabriel Marquez MGI:1201402 Ccr8 chemokine (C-C motif) receptor 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6070 + EM:04575 CBB10-Tg(myl2-cre)1118Tmhn/H EMMA sperm XMLC2.CRE, CBB10F1-Tg(myl2-cre)1118Tmhn/H mutant strain MGI:3712342 Tg(myl2-cre)1118Tmhn transgene insertion 1118, Tim Mohun MGI:3712335 Tg(myl2-cre)1118Tmhn transgene insertion 1118, Tim Mohun https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4575 + EM:04922 CBACa;129P2-Ube3b/WtsiCnbc EMMA embryo CBA;129P2-Ube3b/WtsiCnbc, Ube3b genetrap mutant strain MGI:4129255 Ube3b gene trap RRJ142, BayGenomics MGI:1891295 Ube3b ubiquitin protein ligase E3B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4922 + EM:05013 CBACa;129P2-Prkab1/WtsiCnbc EMMA embryo Prkab1 genetrap, CBA;129P2-Prkab1/WtsiCnbc mutant strain MGI:3838355 Prkab1 gene trap RRR454, BayGenomics MGI:1336167 Prkab1 protein kinase, AMP-activated, beta 1 non-catalytic subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5013 + EM:05012 CBACa;129P2-Kctd10/WtsiCnbc EMMA embryo CBA;129P2-Kctd10/WtsiCnbc, Kctd10 genetrap, CBA;129P2-Kctd10/WtsiCnbc mutant strain MGI:4128950 Kctd10 gene trap RRG305, BayGenomics MGI:2141207 Kctd10 potassium channel tetramerisation domain containing 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5012 + EM:05019 CBACa;129P2-Git2/WtsiCnbc EMMA embryo Git2 genetrap, CBA;129P2-Git2/WtsiCnbc mutant strain MGI:3762635 Git2 gene trap XG510, BayGenomics MGI:1347053 Git2 GIT ArfGAP 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5019 + EM:05014 CBACa;129P2-Ankrd13a/WtsiCnbc EMMA embryo Ankrd13a genetrap, CBA;129P2-Ankrd13a/WtsiCnbc mutant strain MGI:4128768 Ankrd13a gene trap RRH308, BayGenomics MGI:1915670 Ankrd13a ankyrin repeat domain 13a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5014 + EM:08993 CBAB6-Tg(tetO-HMOX1)57Gkl/Flmg EMMA embryo STOCK Tg(tetO-Hmox1)57Gkl/Flmg, B6.CBA-Tg(tetO-Hmox1)57Gkl/Flmg mutant strain MGI:5707757 Tg(tetO-HMOX1)57Gkl transgene insertion 57, George Kollias MGI:5707755 Tg(tetO-HMOX1)57Gkl transgene insertion 57, George Kollias https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8993 + EM:07265 CBAB6-Tg(Tek-Nfkbia*S32A*S36A)1Gkl/Flmg EMMA sperm Tie2DNIkappaBalpha transgenic mice, CBA.B6-Tg(Tie2-IkB)1Gkl/Flmg, B6CBA-Tg(Tek-Nfkbia*S32A*S36A)1Gkl/Flmg mutant strain MGI:5575645 Tg(Tek-Nfkbia*S32A*S36A)1Gkl transgene insertion 1, George Kollias MGI:5575644 Tg(Tek-Nfkbia*S32A*S36A)1Gkl transgene insertion 1, George Kollias https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7265 ? EM:14680 CBA;B6-Mtm1/Flmg EMMA archived mutant strain Mtm1 Mtm1 MGI:1099452 Mtm1 X-linked myotubular myopathy gene 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14680 + EM:01406 CBA/J-Chr 17/GhjCnrm EMMA embryo CBA.NOD-C17S consomic or chromosome substitution strain Chr 17 Chr 17 Chr 17 Chr 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1406 + EM:04614 CBA/Ca-Tg(TcraBM3.3,TcrbBM3.3)1Alm/Orl EMMA embryo BM3.3 TCR Tg mutant strain MGI:3793487 Tg(TcraBM3.3,TcrbBM3.3)1Alm transgene insertion 1, Andrew L Mellor MGI:3793488 Tg(TcraBM3.3,TcrbBM3.3)1Alm transgene insertion 1, Andrew L Mellor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4614 ? EM:13763 CBA/Ca-H2-Eb2/WtsiIeg EMMA sperm mutant strain MGI:6336054 H2-Eb2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95902 H2-Eb2 histocompatibility 2, class II antigen E beta2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13763 + EM:00248 CBA.Cg-Tg(Ins1-Frk-Y504F)1Ubc/Kieg EMMA embryo CBA-Tg(Ins1-Frk-Y504F)1Ubc, RIP-GTK mutant strain MGI:3487260 Tg(Ins1-Frk-Y504F)1Ubc transgene insertion 1, Uppsala University MGI:3487259 Tg(Ins1-Frk-Y504F)1Ubc transgene insertion 1, Uppsala University https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=248 + EM:05123 CBA.Cg-Bnc2/Orl EMMA embryo CBA(B6)-Bnc2/Orl, CBA.Ayu21-18 mutant strain MGI:3639337 Bnc2 gene trap 18, Institute of Molecular Embryology and Genetics MGI:2443805 Bnc2 basonuclin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5123 ? EM:11021 CBA.B6-Tnfrsf1a Tg(CD2-TNF/HBB)211Gkl/Flmg EMMA embryo mutant strain MGI:1861040 Tnfrsf1a targeted mutation 1, Horst Bluethmann MGI:1314884 Tnfrsf1a tumor necrosis factor receptor superfamily, member 1a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11021 ? EM:11021 CBA.B6-Tnfrsf1a Tg(CD2-TNF/HBB)211Gkl/Flmg EMMA embryo mutant strain Tg(CD2-TNF/HBB)211Gkl Tg(CD2-TNF/HBB)211Gkl Tg(CD2-TNF/HBB)211Gkl Tg(CD2-TNF/HBB)211Gkl https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11021 ? EM:11020 CBA.B6-Tg(CD2-TNF)7Gkl/Flmg EMMA sperm mutant strain Tg(CD2-TNF)7Gkl Tg(CD2-TNF)7Gkl Tg(CD2-TNF)7Gkl Tg(CD2-TNF)7Gkl https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11020 + EM:11299 CBA.129S2(Cg)-Synb/Orl EMMA sperm mutant strain MGI:5308859 Synb targeted mutation 1.2, Mouse Clinical Institute MGI:3045308 Synb syncytin b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11299 + EM:11297 CBA.129S2(B6)-Synb/Orl EMMA sperm mutant strain MGI:6406921 Synb targeted mutation 2.1, Mouse Clinical Institute MGI:3045308 Synb syncytin b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11297 + EM:05541 CBA.129S(B6)-Tectb/H EMMA sperm CBA/Tectbtm1Gpr mutant strain MGI:3711698 Tectb targeted mutation 1, Guy P Richardson MGI:109574 Tectb tectorin beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5541 + EM:05544 CBA.129S(B6)-Tecta/H EMMA sperm CBA/Tectatm2Gpr mutant strain MGI:3605485 Tecta targeted mutation 2, Guy P Richardson MGI:109575 Tecta tectorin alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5544 + EM:05539 CBA.129S(B6)-Tecta/H EMMA sperm CBA/Tectatm1Gpr mutant strain MGI:2183148 Tecta targeted mutation 1, Guy P Richardson MGI:109575 Tecta tectorin alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5539 + EM:05546 CBA.129S(B6)-Otoa/H EMMA sperm CBA/OtoaEGFP mutant strain MGI:5469411 Otoa targeted mutation 1, Guy P Richardson MGI:2149209 Otoa otoancorin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5546 + EM:05097 CBA.129P2(B6)-Efnb1/RhaH EMMA sperm CBA.129P2-Efnb1/Rha, Efnb1LoxP mutant strain MGI:3653699 Efnb1 targeted mutation 1, Ralf H Adams MGI:102708 Efnb1 ephrin B1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5097 ? EM:10943 CB;B6-Tg(Ttr-USP22)1Ital/Flmg EMMA sperm mutant strain Tg(Ttr-USP22)1Ital Tg(Ttr-USP22)1Ital Tg(Ttr-USP22)1Ital Tg(Ttr-USP22)1Ital https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10943 ? EM:13038 CaV2.2_HA Knockin EMMA sperm mutant strain MGI:2388140 Cacna1b targeted mutation 1, Hee-Sup Shin MGI:88296 Cacna1b calcium channel, voltage-dependent, N type, alpha 1B subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13038 ? EM:12547 Cat3vl EMMA sperm unclassified MGI:1855998 Cat3 dominant cataract 3, vacuolated lens and microphthalmia MGI:88273 Cat3 dominant cataract 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12547 ? EM:12522 Cat3vao EMMA sperm mutant strain MGI:1855997 Cat3 dominant cataract 3, vaculoes, axial opacity and microphthal MGI:88273 Cat3 dominant cataract 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12522 ? EM:12546 Cat2t EMMA sperm unclassified MGI:1857598 Cryge total opacity and microphthalmia MGI:88525 Cryge crystallin, gamma E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12546 ? EM:12545 Cat2ro EMMA sperm unclassified MGI:1855996 Crygf dominant cataract 2, radial opacity MGI:88526 Crygf crystallin, gamma F https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12545 ? EM:12544 Cat2nz EMMA sperm unclassified MGI:1855995 Cryge dominant cataract 2, nuclear and zonular opacity MGI:88525 Cryge crystallin, gamma E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12544 ? EM:12560 Cat2ns EMMA sperm unclassified MGI:1855994 Cryge dominant cataract 2, nuclear and anterior suture opacity MGI:88525 Cryge crystallin, gamma E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12560 + EM:02425 CAnNCrl.GFF(CB)-Grhl3/Cnrm EMMA embryo STOCK ct/Ibcm, STOCK Grhl3/Ibcm, CAnNCrl.GFF(CB)-Grhl3/Ibcm mutant strain MGI:1856837 Grhl3 curly tail MGI:2655333 Grhl3 grainyhead like transcription factor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2425 + EM:02496 CAnN.129S7(B6)-Il1r1/NickH EMMA sperm C.Cg-Il1r1/Nick, BALB/cAnNHsd Il1r1Tm1Imx mutant strain MGI:1861112 Il1r1 targeted mutation 1, Immunex Research and Development Corporation MGI:96545 Il1r1 interleukin 1 receptor, type I https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2496 + EM:02497 CAnN.129P2(MF1)-Il1rn/NickH EMMA sperm C.Cg-Il1rn/Nick, BALB/cAnNHsd Il1rn mutant strain MGI:3038876 Il1rn targeted mutation 1, Martin J H Nicklin MGI:96547 Il1rn interleukin 1 receptor antagonist https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2497 + EM:04560 C;129P2-Thra/Kctt EMMA embryo Thra-tm2Ven mutant strain MGI:2654864 Thra targeted mutation 2, Bjorn Vennstrom MGI:98742 Thra thyroid hormone receptor alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4560 + EM:05103 C;129P2-Pomt1/Cnbc EMMA embryo mutant strain MGI:3497739 Pomt1 targeted mutation 1, Jesus Cruces MGI:2138994 Pomt1 protein-O-mannosyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5103 + EM:05103 C;129P2-Pomt1/Cnbc EMMA sperm mutant strain MGI:3497739 Pomt1 targeted mutation 1, Jesus Cruces MGI:2138994 Pomt1 protein-O-mannosyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5103 + EM:11736 C;129P2-Pi4k2a/H EMMA sperm Pi4k2aGt(AK0094)Wtsi Balb/c mutant strain MGI:4345401 Pi4k2a gene trap AK0094, Wellcome Trust Sanger Institute MGI:1934031 Pi4k2a phosphatidylinositol 4-kinase type 2 alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11736 + EM:00122 C;129P2-Lbp/Orl EMMA embryo C;129P2-Lbp/Orl, LBP mutant strain MGI:1857976 Lbp targeted mutation 1, Robert S Jack MGI:1098776 Lbp lipopolysaccharide binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=122 + EM:01999 C57BL/6RccCnrm EMMA embryo C57BL/6RccIbcm, C57BL/6Rcc mutant strain MGI:2430266 Cd44<+> wild type MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1999 + EM:14357 C57BL/6NTac-Zscan2/WtsiOulu EMMA embryo mutant strain MGI:4363795 Zscan2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99176 Zscan2 zinc finger and SCAN domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14357 + EM:14357 C57BL/6NTac-Zscan2/WtsiOulu EMMA sperm mutant strain MGI:4363795 Zscan2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99176 Zscan2 zinc finger and SCAN domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14357 + EM:06375 C57BL/6NTac-Zscan10/WtsiCnrm EMMA sperm mutant strain MGI:4431612 Zscan10 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:3040700 Zscan10 zinc finger and SCAN domain containing 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6375 + EM:06858 C57BL/6NTac-Zkscan17/WtsiBiat EMMA sperm mutant strain MGI:4431816 Zkscan17 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2679270 Zkscan17 zinc finger with KRAB and SCAN domains 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6858 - EM:08860 C57BL/6NTac-Zfp819/WtsiH EMMA sperm mutant strain MGI:5633874 Zfp819 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1921650 Zfp819 zinc finger protein 819 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8860 + EM:04480 C57BL/6NTac-Zfp715/H EMMA sperm HEPD0520_1_F11 mutant strain MGI:4435328 Zfp715 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917180 Zfp715 zinc finger protein 715 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4480 - EM:09561 C57BL/6NTac-Zfp629/WtsiIeg EMMA sperm mutant strain MGI:5633873 Zfp629 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2444524 Zfp629 zinc finger protein 629 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9561 + EM:13680 C57BL/6NTac-Zfp57/H EMMA live mutant strain MGI:5501557 Zfp57 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99204 Zfp57 zinc finger protein 57 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13680 + EM:08383 C57BL/6NTac-Zfp365/WtsiOrl EMMA sperm mutant strain MGI:4364171 Zfp365 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2143676 Zfp365 zinc finger protein 365 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8383 + EM:11563 C57BL/6NTac-Zfp341/WtsiIeg EMMA sperm mutant strain MGI:4362726 Zfp341 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2682937 Zfp341 zinc finger protein 341 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11563 + EM:10982 C57BL/6NTac-Zfp287/WtsiIeg EMMA sperm mutant strain MGI:4433358 Zfp287 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2176561 Zfp287 zinc finger protein 287 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10982 + EM:10994 C57BL/6NTac-Zfp219/WtsiPh EMMA sperm mutant strain MGI:5514579 Zfp219 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917140 Zfp219 zinc finger protein 219 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10994 + EM:07709 C57BL/6NTac-Zfp13/IcsOrl EMMA archived mutant strain MGI:4435325 Zfp13 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99159 Zfp13 zinc finger protein 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7709 + EM:13682 C57BL/6NTac-Zdhhc16/H EMMA live mutant strain MGI:4434731 Zdhhc16 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921418 Zdhhc16 zinc finger, DHHC domain containing 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13682 + EM:07806 C57BL/6NTac-Zcchc14/WtsiOrl EMMA sperm mutant strain MGI:4362839 Zcchc14 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2159407 Zcchc14 zinc finger, CCHC domain containing 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7806 + EM:11756 C57BL/6NTac-Zc3h12a/Ieg EMMA sperm mutant strain MGI:4434879 Zc3h12a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385891 Zc3h12a zinc finger CCCH type containing 12A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11756 - EM:08958 C57BL/6NTac-Zbtb32/Cnrm EMMA sperm mutant strain MGI:5633872 Zbtb32 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1891838 Zbtb32 zinc finger and BTB domain containing 32 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8958 - EM:05170 C57BL/6NTac-Ywhab/Cnrm EMMA sperm mutant strain MGI:4435431 Ywhab targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1891917 Ywhab tyrosine 3-monooxygenase/tryptophan 5-monooxygenase activation protein, beta polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5170 + EM:07718 C57BL/6NTac-Xiap/IcsOrl EMMA sperm mutant strain MGI:4435758 Xiap targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107572 Xiap X-linked inhibitor of apoptosis https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7718 + EM:13138 C57BL/6NTac-Xbp1/IcsOrl EMMA sperm mutant strain MGI:6468279 Xbp1 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:98970 Xbp1 X-box binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13138 + EM:07516 C57BL/6NTac-Xbp1/IcsOrl EMMA archived mutant strain MGI:4432347 Xbp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98970 Xbp1 X-box binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7516 - EM:11412 C57BL/6NTac-Wwp1/H EMMA sperm mutant strain MGI:6149154 Wwp1 endonuclease mediated mutation 1, Harwell MGI:1861728 Wwp1 WW domain containing E3 ubiquitin protein ligase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11412 - EM:05171 C57BL/6NTac-Wsb2/Cnrm EMMA sperm mutant strain MGI:4434956 Wsb2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2144041 Wsb2 WD repeat and SOCS box-containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5171 - EM:03971 C57BL/6NTac-Wrnip1/Cnrm EMMA embryo B6NDen;B6N-Wrnip1/Cnrm, B6Dnk;B6N-Wrnip1/Cnrm mutant strain MGI:4432335 Wrnip1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926153 Wrnip1 Werner helicase interacting protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3971 - EM:03971 C57BL/6NTac-Wrnip1/Cnrm EMMA sperm B6NDen;B6N-Wrnip1/Cnrm, B6Dnk;B6N-Wrnip1/Cnrm mutant strain MGI:4432335 Wrnip1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926153 Wrnip1 Werner helicase interacting protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3971 - EM:09731 C57BL/6NTac-Wnt9a/WtsiH EMMA sperm mutant strain MGI:5633871 Wnt9a targeted mutation 1, Wellcome Trust Sanger Institute MGI:2446084 Wnt9a wingless-type MMTV integration site family, member 9A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9731 + EM:05873 C57BL/6NTac-Whrn/WtsiH EMMA sperm MCJH, EPD0200_4_C04 mutant strain MGI:4432119 Whrn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2682003 Whrn whirlin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5873 + EM:11407 C57BL/6NTac-Wfdc2/H EMMA live mutant strain MGI:6149155 Wfdc2 endonuclease mediated mutation 1, Harwell MGI:1914951 Wfdc2 WAP four-disulfide core domain 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11407 + EM:08232 C57BL/6NTac-Wdtc1/WtsiPh EMMA sperm mutant strain MGI:4362336 Wdtc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685541 Wdtc1 WD and tetratricopeptide repeats 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8232 ? EM:11074 C57BL/6NTac-Wdr62/Ics EMMA sperm mutant strain Wdr62 Wdr62 MGI:1923696 Wdr62 WD repeat domain 62 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11074 + EM:05860 C57BL/6NTac-Wbp2/WtsiH EMMA sperm EPD0037_2_D06, MBYF mutant strain MGI:4847848 Wbp2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:104709 Wbp2 WW domain binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5860 - EM:04409 C57BL/6NTac-Wbp2/Cnrm EMMA embryo mutant strain MGI:4847848 Wbp2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:104709 Wbp2 WW domain binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4409 - EM:04409 C57BL/6NTac-Wbp2/Cnrm EMMA sperm mutant strain MGI:4847848 Wbp2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:104709 Wbp2 WW domain binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4409 + EM:12311 C57BL/6NTac-Vwf/Ics EMMA sperm mutant strain Vwf EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:98941 Vwf Von Willebrand factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12311 + EM:09168 C57BL/6NTac-Vwa3a/WtsiPh EMMA sperm mutant strain MGI:4363306 Vwa3a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3041229 Vwa3a von Willebrand factor A domain containing 3A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9168 + EM:12409 C57BL/6NTac-Vps35/H EMMA sperm mutant strain MGI:6153830 Vps35 endonuclease-mediated mutation 1, Harwell MGI:1890467 Vps35 VPS35 retromer complex component https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12409 + EM:11409 C57BL/6NTac-Vgll3/H EMMA sperm mutant strain MGI:6149157 Vgll3 endonuclease mediated mutation 2, Harwell MGI:1920819 Vgll3 vestigial like family member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11409 + EM:11403 C57BL/6NTac-Vgll3/H EMMA live mutant strain MGI:6149156 Vgll3 endonuclease mediated mutation 1, Harwell MGI:1920819 Vgll3 vestigial like family member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11403 + EM:10784 C57BL/6NTac-Vgf/H EMMA sperm mutant strain MGI:6144255 Vgf endonuclease mediated mutation 1, Harwell MGI:1343180 Vgf VGF nerve growth factor inducible https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10784 - EM:09737 C57BL/6NTac-Vav1/WtsiH EMMA sperm mutant strain MGI:5633870 Vav1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:98923 Vav1 vav 1 oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9737 + EM:07673 C57BL/6NTac-Vat1l/IcsOrl EMMA sperm mutant strain MGI:4436304 Vat1l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2142534 Vat1l vesicle amine transport protein 1 like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7673 ? EM:14047 C57BL/6NTac-Vangl1/WtsiIeg EMMA sperm mutant strain MGI:4365105 Vangl1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2159344 Vangl1 VANGL planar cell polarity 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14047 + EM:10755 C57BL/6NTac-Usp45/H EMMA sperm mutant strain MGI:5693168 Usp45 endonuclease-mediated mutation 1, Harwell MGI:101850 Usp45 ubiquitin specific petidase 45 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10755 + EM:05826 C57BL/6NTac-Usp3/WtsiH EMMA embryo USP3(A11) mutant strain MGI:4432395 Usp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2152450 Usp3 ubiquitin specific peptidase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5826 + EM:05384 C57BL/6NTac-Usp33/WtsiCnbc EMMA embryo mutant strain MGI:4433766 Usp33 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2159711 Usp33 ubiquitin specific peptidase 33 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5384 + EM:05384 C57BL/6NTac-Usp33/WtsiCnbc EMMA sperm mutant strain MGI:4433766 Usp33 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2159711 Usp33 ubiquitin specific peptidase 33 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5384 + EM:06392 C57BL/6NTac-Usp22/WtsiH EMMA sperm mutant strain MGI:4364127 Usp22 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144157 Usp22 ubiquitin specific peptidase 22 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6392 + EM:09477 C57BL/6NTac-Usp20/WtsiPh EMMA sperm mutant strain MGI:4434938 Usp20 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921520 Usp20 ubiquitin specific peptidase 20 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9477 + EM:11883 C57BL/6NTac-Usp1/WtsiH EMMA sperm mutant strain MGI:4363583 Usp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385198 Usp1 ubiquitin specific peptidase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11883 + EM:14364 C57BL/6NTac-Ush1c/WtsiOulu EMMA embryo mutant strain MGI:4363497 Ush1c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919338 Ush1c USH1 protein network component harmonin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14364 + EM:14364 C57BL/6NTac-Ush1c/WtsiOulu EMMA sperm mutant strain MGI:4363497 Ush1c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919338 Ush1c USH1 protein network component harmonin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14364 + EM:04616 C57BL/6NTac-Uros/H EMMA sperm EPD0100_5_A01 mutant strain MGI:4433834 Uros targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98917 Uros uroporphyrinogen III synthase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4616 + EM:11346 C57BL/6NTac-Uqcrq/H EMMA live mutant strain MGI:5497330 Uqcrq targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107807 Uqcrq ubiquinol-cytochrome c reductase, complex III subunit VII https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11346 - EM:08456 C57BL/6NTac-Unc45a/Ieg EMMA sperm mutant strain MGI:4434645 Unc45a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2142246 Unc45a unc-45 myosin chaperone A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8456 + EM:12447 C57BL/6NTac-Unc13c/H EMMA sperm mutant strain MGI:6153829 Unc13c endonuclease-mediated mutation 1, Harwell MGI:2149021 Unc13c unc-13 homolog C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12447 ? EM:14370 C57BL/6NTac-Ugt2b5/WtsiOrl EMMA sperm mutant strain MGI:4362467 Ugt2b5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98900 Ugt2b5 UDP glucuronosyltransferase 2 family, polypeptide B5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14370 + EM:05791 C57BL/6NTac-Ufl1/WtsiOrl EMMA sperm mutant strain MGI:4432479 Ufl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914740 Ufl1 UFM1 specific ligase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5791 + EM:07850 C57BL/6NTac-Uevld/WtsiOulu EMMA embryo mutant strain MGI:4434449 Uevld targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1860490 Uevld UEV and lactate/malate dehyrogenase domains https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7850 + EM:07850 C57BL/6NTac-Uevld/WtsiOulu EMMA sperm mutant strain MGI:4434449 Uevld targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1860490 Uevld UEV and lactate/malate dehyrogenase domains https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7850 - EM:08947 C57BL/6NTac-Ucp1/WtsiH EMMA sperm mutant strain MGI:5633869 Ucp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:98894 Ucp1 uncoupling protein 1 (mitochondrial, proton carrier) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8947 ? EM:14058 C57BL/6NTac-Uck1/WtsiPh EMMA sperm mutant strain MGI:4362314 Uck1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:98904 Uck1 uridine-cytidine kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14058 - EM:07015 C57BL/6NTac-Ube2u/H EMMA sperm mutant strain MGI:4363149 Ube2u targeted mutation 1e, Wellcome Trust Sanger Institute MGI:3588216 Ube2u ubiquitin-conjugating enzyme E2U (putative) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7015 + EM:07693 C57BL/6NTac-Ube2b/IcsOrl EMMA sperm mutant strain MGI:4431903 Ube2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102944 Ube2b ubiquitin-conjugating enzyme E2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7693 + EM:05232 C57BL/6NTac-Twf1/WtsiCnbc EMMA embryo mutant strain MGI:4434218 Twf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1100520 Twf1 twinfilin actin binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5232 + EM:05232 C57BL/6NTac-Twf1/WtsiCnbc EMMA sperm mutant strain MGI:4434218 Twf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1100520 Twf1 twinfilin actin binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5232 + EM:06981 C57BL/6NTac-Tulp3/H EMMA sperm mutant strain MGI:4435073 Tulp3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1329045 Tulp3 tubby-like protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6981 - EM:09763 C57BL/6NTac-Ttr/WtsiH EMMA sperm mutant strain MGI:5633868 Ttr targeted mutation 1, Wellcome Trust Sanger Institute MGI:98865 Ttr transthyretin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9763 - EM:08966 C57BL/6NTac-Ttll5/Cnrm EMMA sperm mutant strain MGI:5633867 Ttll5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2443657 Ttll5 tubulin tyrosine ligase-like family, member 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8966 + EM:07712 C57BL/6NTac-Ttll1/IcsOrl EMMA archived mutant strain MGI:4432051 Ttll1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443047 Ttll1 tubulin tyrosine ligase-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7712 + EM:05838 C57BL/6NTac-Ttll12/Cnrm EMMA sperm mutant strain MGI:4433627 Ttll12 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:3039573 Ttll12 tubulin tyrosine ligase-like family, member 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5838 - EM:09546 C57BL/6NTac-Ttc21a/WtsiIeg EMMA sperm mutant strain MGI:5633866 Ttc21a targeted mutation 1, Wellcome Trust Sanger Institute MGI:1921302 Ttc21a tetratricopeptide repeat domain 21A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9546 + EM:12444 C57BL/6NTac-Tspoap1/H EMMA sperm mutant strain MGI:6153864 Tspoap1 endonuclease-mediated mutation 1, Harwell MGI:2450877 Tspoap1 TSPO associated protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12444 + EM:11473 C57BL/6NTac-Tspan17/H EMMA live mutant strain MGI:6152699 Tspan17 endonuclease mediated mutation 2, Harwell MGI:1921507 Tspan17 tetraspanin 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11473 + EM:11472 C57BL/6NTac-Tspan17/H EMMA sperm mutant strain MGI:6153828 Tspan17 endonuclease-mediated mutation 1, Harwell MGI:1921507 Tspan17 tetraspanin 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11472 + EM:11472 C57BL/6NTac-Tspan17/H EMMA live mutant strain MGI:6153828 Tspan17 endonuclease-mediated mutation 1, Harwell MGI:1921507 Tspan17 tetraspanin 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11472 + EM:11427 C57BL/6NTac-Tspan14/H EMMA live mutant strain MGI:6149216 Tspan14 endonuclease mediated mutation 1, Harwell MGI:1196325 Tspan14 tetraspanin 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11427 - EM:08950 C57BL/6NTac-Tshb/WtsiH EMMA sperm mutant strain MGI:5633865 Tshb targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:98848 Tshb thyroid stimulating hormone, beta subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8950 + EM:06260 C57BL/6NTac-Tsfm/WtsiCnbc EMMA sperm mutant strain MGI:4432572 Tsfm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913649 Tsfm Ts translation elongation factor, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6260 - EM:08859 C57BL/6NTac-Trpv1/WtsiH EMMA sperm mutant strain MGI:5633864 Trpv1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1341787 Trpv1 transient receptor potential cation channel, subfamily V, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8859 + EM:12316 C57BL/6NTac-Trpc1/Ics EMMA sperm mutant strain Trpc1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:109528 Trpc1 transient receptor potential cation channel, subfamily C, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12316 + EM:11422 C57BL/6NTac-Trp73/H EMMA sperm mutant strain MGI:6149215 Trp73 endonuclease mediated mutation 1, Harwell MGI:1336991 Trp73 transformation related protein 73 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11422 + EM:13022 C57BL/6NTac-Trmt9b/H EMMA sperm unclassified MGI:6451748 Trmt9b endonuclease-mediated mutation 2, Harwell MGI:2442328 Trmt9b tRNA methyltransferase 9B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13022 + EM:05441 C57BL/6NTac-Trmt10a/WtsiOulu EMMA embryo mutant strain MGI:4432852 Trmt10a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920421 Trmt10a tRNA methyltransferase 10A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5441 + EM:05893 C57BL/6NTac-Trim66/WtsiIeg EMMA sperm mutant strain MGI:4431799 Trim66 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2152406 Trim66 tripartite motif-containing 66 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5893 + EM:08871 C57BL/6NTac-Trim65/WtsiIeg EMMA sperm mutant strain MGI:4363168 Trim65 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442815 Trim65 tripartite motif-containing 65 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8871 + EM:07820 C57BL/6NTac-Trib3/IcsOrl EMMA sperm mutant strain MGI:4435061 Trib3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1345675 Trib3 tribbles pseudokinase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7820 + EM:10857 C57BL/6NTac-Trex1/WtsiOulu EMMA embryo mutant strain MGI:4362876 Trex1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1328317 Trex1 three prime repair exonuclease 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10857 + EM:10857 C57BL/6NTac-Trex1/WtsiOulu EMMA sperm mutant strain MGI:4362876 Trex1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1328317 Trex1 three prime repair exonuclease 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10857 + EM:10839 C57BL/6NTac-Tox2/H EMMA live C57BL/6N-Tox2/H mutant strain MGI:5749960 Tox2 endonuclease-mediated mutation 2, Harwell MGI:3611233 Tox2 TOX high mobility group box family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10839 + EM:10767 C57BL/6NTac-Tox2/H EMMA archived C57BL/6N-Tox2/H mutant strain MGI:5749959 Tox2 endonuclease-mediated mutation 1, Harwell MGI:3611233 Tox2 TOX high mobility group box family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10767 + EM:09684 C57BL/6NTac-Tor1aip1/H EMMA sperm mutant strain MGI:5514583 Tor1aip1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3582693 Tor1aip1 torsin A interacting protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9684 + EM:12445 C57BL/6NTac-Tor1a/H EMMA sperm mutant strain MGI:6153827 Tor1a endonuclease-mediated mutation 1, Harwell MGI:1353568 Tor1a torsin family 1, member A (torsin A) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12445 - EM:08848 C57BL/6NTac-Tns1/WtsiH EMMA sperm mutant strain MGI:5633856 Tns1 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:104552 Tns1 tensin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8848 + EM:11022 C57BL/6NTac-Tnip1/H EMMA sperm mutant strain MGI:4435909 Tnip1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1926194 Tnip1 TNFAIP3 interacting protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11022 + EM:13136 C57BL/6NTac-Tnfrsf9/IcsOrl EMMA archived mutant strain MGI:6363081 Tnfrsf9 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1101059 Tnfrsf9 tumor necrosis factor receptor superfamily, member 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13136 + EM:09976 C57BL/6NTac-Tnfrsf9/IcsOrl EMMA sperm mutant strain MGI:4432147 Tnfrsf9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1101059 Tnfrsf9 tumor necrosis factor receptor superfamily, member 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9976 + EM:07654 C57BL/6NTac-Tnfrsf1b/IcsOrl EMMA archived mutant strain MGI:4433096 Tnfrsf1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1314883 Tnfrsf1b tumor necrosis factor receptor superfamily, member 1b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7654 ? EM:13963 C57BL/6NTac-Tmprss15/WtsiPh EMMA sperm mutant strain MGI:4364308 Tmprss15 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1197523 Tmprss15 transmembrane protease, serine 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13963 + EM:07721 C57BL/6NTac-Tmod3/IcsOrl EMMA archived mutant strain MGI:4435232 Tmod3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1355315 Tmod3 tropomodulin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7721 + EM:05865 C57BL/6NTac-Tmem9/WtsiH EMMA sperm MCXG, EPD0144_3_A09 mutant strain MGI:4433014 Tmem9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913491 Tmem9 transmembrane protein 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5865 + EM:07679 C57BL/6NTac-Tmem94/IcsOrl EMMA archived C57BL/6NTac-2310067B10Rik/IcsOrl, EPD0215_1_D09 mutant strain MGI:4432189 Tmem94 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919197 Tmem94 transmembrane protein 94 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7679 + EM:07707 C57BL/6NTac-Tmem68/IcsOrl EMMA archived mutant strain MGI:4431978 Tmem68 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919348 Tmem68 transmembrane protein 68 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7707 + EM:07650 C57BL/6NTac-Tmem63b/IcsOrl EMMA sperm mutant strain MGI:4433726 Tmem63b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2387609 Tmem63b transmembrane protein 63b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7650 ? EM:13947 C57BL/6NTac-Tmem54/WtsiPh EMMA sperm mutant strain MGI:4362446 Tmem54 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913510 Tmem54 transmembrane protein 54 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13947 + EM:13684 C57BL/6NTac-Tmem40/H EMMA live mutant strain MGI:5430142 Tmem40 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2137870 Tmem40 transmembrane protein 40 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13684 + EM:11315 C57BL/6NTac-Tmem203/H EMMA sperm mutant strain MGI:6144257 Tmem203 endonuclease mediated mutation 2, Harwell MGI:2443597 Tmem203 transmembrane protein 203 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11315 + EM:10841 C57BL/6NTac-Tmem203/H EMMA sperm mutant strain MGI:6144256 Tmem203 endonuclease mediated mutation 1, Harwell MGI:2443597 Tmem203 transmembrane protein 203 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10841 + EM:09726 C57BL/6NTac-Tmem132a/WtsiH EMMA sperm mutant strain MGI:4362366 Tmem132a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2147810 Tmem132a transmembrane protein 132A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9726 + EM:09972 C57BL/6NTac-Tmem108/IcsOrl EMMA sperm mutant strain MGI:4441635 Tmem108 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1932411 Tmem108 transmembrane protein 108 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9972 + EM:07677 C57BL/6NTac-Tmc8/IcsOrl EMMA sperm mutant strain MGI:4432152 Tmc8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2669037 Tmc8 transmembrane channel-like gene family 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7677 + EM:05883 C57BL/6NTac-Tmc6/WtsiIeg EMMA sperm mutant strain MGI:4434247 Tmc6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098686 Tmc6 transmembrane channel-like gene family 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5883 + EM:12130 C57BL/6NTac-Tm9sf4/Wtsi EMMA embryo mutant strain MGI:4363779 Tm9sf4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2139220 Tm9sf4 transmembrane 9 superfamily member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12130 + EM:11054 C57BL/6NTac-Tm6sf2/H EMMA sperm mutant strain MGI:4362886 Tm6sf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933210 Tm6sf2 transmembrane 6 superfamily member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11054 + EM:11318 C57BL/6NTac-Tm6sf2/H EMMA sperm mutant strain MGI:6152701 Tm6sf2 endonuclease mediated mutation 4, Harwell MGI:1933210 Tm6sf2 transmembrane 6 superfamily member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11318 - EM:04555 C57BL/6NTac-Tln1/Cnrm EMMA embryo mutant strain MGI:4433023 Tln1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1099832 Tln1 talin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4555 - EM:04555 C57BL/6NTac-Tln1/Cnrm EMMA sperm mutant strain MGI:4433023 Tln1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1099832 Tln1 talin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4555 - EM:08946 C57BL/6NTac-Tle6/WtsiH EMMA sperm mutant strain MGI:5633854 Tle6 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:2149593 Tle6 transducin-like enhancer of split 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8946 + EM:10028 C57BL/6NTac-Tlcd4/WtsiIeg EMMA sperm C57BL/6NTac-Tmem56/WtsiIeg mutant strain MGI:5633855 Tlcd4 targeted mutation 1, Tmem56 MGI:1923195 Tlcd4 TLC domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10028 + EM:04437 C57BL/6NTac-Timm50/Ics EMMA sperm EPD0144_2_D04 mutant strain MGI:4433575 Timm50 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913775 Timm50 translocase of inner mitochondrial membrane 50 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4437 ? EM:14109 C57BL/6NTac-Tigit/WtsiPh EMMA sperm mutant strain Tigit undef targeted mutation , Wellcome Trust Sanger Institute MGI:3642260 Tigit T cell immunoreceptor with Ig and ITIM domains https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14109 + EM:07187 C57BL/6NTac-Tigar/WtsiH EMMA sperm EPD0192_3_E06, C57BL/6NTac-9630033F20Rik/WtsiH, MFCG mutant strain MGI:4441746 Tigar targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442752 Tigar Trp53 induced glycolysis regulatory phosphatase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7187 - EM:09740 C57BL/6NTac-Tie1/WtsiH EMMA sperm mutant strain MGI:5633853 Tie1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:99906 Tie1 tyrosine kinase with immunoglobulin-like and EGF-like domains 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9740 + EM:10533 C57BL/6NTac-Tiam1/Ics EMMA sperm mutant strain MGI:5511857 Tiam1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103306 Tiam1 T cell lymphoma invasion and metastasis 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10533 ? EM:13986 C57BL/6NTac-Tia1/WtsiOrl EMMA sperm mutant strain Tia1 KOMP targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107914 Tia1 cytotoxic granule-associated RNA binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13986 + EM:07613 C57BL/6NTac-Thra/Ics EMMA sperm mutant strain MGI:4455948 Thra targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98742 Thra thyroid hormone receptor alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7613 + EM:12361 C57BL/6NTac-Th/H EMMA sperm mutant strain MGI:6153826 Th endonuclease-mediated mutation 1, Harwell MGI:98735 Th tyrosine hydroxylase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12361 + EM:10178 C57BL/6NTac-Tgif2/IcsOrl EMMA sperm mutant strain MGI:4433717 Tgif2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915299 Tgif2 TGFB-induced factor homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10178 + EM:06107 C57BL/6NTac-Tg(ACTB-cre)3Mrt/H EMMA embryo mutant strain MGI:5316983 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin MGI:5316982 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6107 + EM:06107 C57BL/6NTac-Tg(ACTB-cre)3Mrt/H EMMA sperm mutant strain MGI:5316983 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin MGI:5316982 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6107 + EM:06107 C57BL/6NTac-Tg(ACTB-cre)3Mrt/H EMMA live mutant strain MGI:5316983 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin MGI:5316982 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6107 - EM:09773 C57BL/6NTac-Tff1/WtsiH EMMA sperm mutant strain MGI:5633852 Tff1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:88135 Tff1 trefoil factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9773 + EM:09846 C57BL/6NTac-Tex38/WtsiOrl EMMA sperm mutant strain MGI:4363110 Tex38 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922423 Tex38 testis expressed 38 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9846 + EM:10081 C57BL/6NTac-Tex101/WtsiIeg EMMA sperm mutant strain MGI:5633851 Tex101 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1930791 Tex101 testis expressed gene 101 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10081 - EM:09738 C57BL/6NTac-Tecta/WtsiH EMMA sperm mutant strain MGI:5633850 Tecta targeted mutation 1, Wellcome Trust Sanger Institute MGI:109575 Tecta tectorin alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9738 + EM:12302 C57BL/6NTac-Tcte2/Ics EMMA sperm mutant strain Tcte2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:98641 Tcte2 t-complex-associated testis expressed 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12302 + EM:07858 C57BL/6NTac-Tcf7l2/WtsiIeg EMMA sperm mutant strain MGI:4431951 Tcf7l2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202879 Tcf7l2 transcription factor 7 like 2, T cell specific, HMG box https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7858 + EM:07661 C57BL/6NTac-Tcf7/IcsOrl EMMA sperm mutant strain MGI:4441645 Tcf7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98507 Tcf7 transcription factor 7, T cell specific https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7661 + EM:06992 C57BL/6NTac-Tcf4/WtsiBiat EMMA archived mutant strain MGI:4432303 Tcf4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98506 Tcf4 transcription factor 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6992 - EM:09756 C57BL/6NTac-Tbx2/WtsiH EMMA sperm mutant strain MGI:5633849 Tbx2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:98494 Tbx2 T-box 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9756 - EM:04685 C57BL/6NTac-Tbc1d10a/Cnrm EMMA embryo mutant strain MGI:4432519 Tbc1d10a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2144164 Tbc1d10a TBC1 domain family, member 10a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4685 - EM:04685 C57BL/6NTac-Tbc1d10a/Cnrm EMMA sperm mutant strain MGI:4432519 Tbc1d10a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2144164 Tbc1d10a TBC1 domain family, member 10a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4685 + EM:14655 C57BL/6NTac-Tacr1/H EMMA sperm unclassified MGI:6741498 Tacr1 endonuclease-mediated mutation 2, Harwell MGI:98475 Tacr1 tachykinin receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14655 + EM:14654 C57BL/6NTac-Tacr1/H EMMA sperm unclassified MGI:6790648 Tacr1 endonuclease-mediated mutation 1, Harwell MGI:98475 Tacr1 tachykinin receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14654 + EM:12293 C57BL/6NTac-Tac2/Ics EMMA sperm mutant strain Tac2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:98476 Tac2 tachykinin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12293 - EM:12375 C57BL/6NTac-Syt4/H EMMA sperm C57BL/6N-Syt4/H mutant strain MGI:6153886 Syt4 endonuclease-mediated mutation 2, Harwell MGI:101759 Syt4 synaptotagmin IV https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12375 + EM:06829 C57BL/6NTac-Syt1/WtsiCnrm EMMA sperm mutant strain MGI:4433781 Syt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99667 Syt1 synaptotagmin I https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6829 + EM:07636 C57BL/6NTac-Synpo2/IcsOrl EMMA sperm mutant strain MGI:4441661 Synpo2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153070 Synpo2 synaptopodin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7636 - EM:09447 C57BL/6NTac-Syndig1l/Cnrm EMMA sperm mutant strain MGI:5633848 Syndig1l targeted mutation 1, Wellcome Trust Sanger Institute MGI:2685107 Syndig1l synapse differentiation inducing 1 like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9447 + EM:10085 C57BL/6NTac-Syce1/WtsiIeg EMMA sperm mutant strain MGI:5633847 Syce1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1921325 Syce1 synaptonemal complex central element protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10085 + EM:11459 C57BL/6NTac-Svop/H EMMA live mutant strain MGI:6152697 Svop endonuclease mediated mutation 2, Harwell MGI:1915916 Svop SV2 related protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11459 + EM:11460 C57BL/6NTac-Svop/H EMMA sperm mutant strain MGI:6153863 Svop endonuclease-mediated mutation 1, Harwell MGI:1915916 Svop SV2 related protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11460 + EM:11460 C57BL/6NTac-Svop/H EMMA live mutant strain MGI:6153863 Svop endonuclease-mediated mutation 1, Harwell MGI:1915916 Svop SV2 related protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11460 + EM:05444 C57BL/6NTac-Supt7l/WtsiOulu EMMA embryo mutant strain MGI:4432224 Supt7l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919445 Supt7l SPT7-like, STAGA complex gamma subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5444 + EM:09848 C57BL/6NTac-Supt3/WtsiPh EMMA sperm mutant strain MGI:4435781 Supt3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923723 Supt3 SPT3, SAGA and STAGA complex component https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9848 - EM:03992 C57BL/6NTac-Stx8/Cnrm EMMA sperm B6NDen;B6N-Stx8/Cnrm, B6Dnk;B6N-Stx8/Cnrm mutant strain MGI:4432376 Stx8 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1890156 Stx8 syntaxin 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3992 + EM:11421 C57BL/6NTac-Stk3/H EMMA sperm mutant strain MGI:6152695 Stk3 endonuclease mediated mutation 2, Harwell MGI:1928487 Stk3 serine/threonine kinase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11421 + EM:11411 C57BL/6NTac-Stk3/H EMMA sperm mutant strain MGI:6149213 Stk3 endonuclease mediated mutation 1, Harwell MGI:1928487 Stk3 serine/threonine kinase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11411 + EM:06040 C57BL/6NTac-Stk39/WtsiH EMMA sperm EPD0169_4_D02, MCJB mutant strain MGI:4433935 Stk39 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858416 Stk39 serine/threonine kinase 39 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6040 + EM:14652 C57BL/6NTac-Stat2/H EMMA sperm unclassified MGI:6741492 Stat2 endonuclease-mediated mutation 1, Harwell MGI:103039 Stat2 signal transducer and activator of transcription 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14652 + EM:07272 C57BL/6NTac-Stard7/WtsiOulu EMMA embryo mutant strain MGI:4433666 Stard7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2139090 Stard7 START domain containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7272 + EM:07272 C57BL/6NTac-Stard7/WtsiOulu EMMA sperm mutant strain MGI:4433666 Stard7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2139090 Stard7 START domain containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7272 + EM:11127 C57BL/6NTac-Star/WtsiH EMMA sperm mutant strain MGI:5660124 Star targeted mutation 1, Wellcome Trust Sanger Institute MGI:102760 Star steroidogenic acute regulatory protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11127 + EM:11429 C57BL/6NTac-St6gal2/H EMMA live mutant strain MGI:6152694 St6gal2 endonuclease mediated mutation 2, Harwell MGI:2445190 St6gal2 beta galactoside alpha 2,6 sialyltransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11429 + EM:11418 C57BL/6NTac-St6gal2/H EMMA sperm C57BL/6N-St6gal2/H mutant strain MGI:6149212 St6gal2 endonuclease mediated mutation 1, Harwell MGI:2445190 St6gal2 beta galactoside alpha 2,6 sialyltransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11418 + EM:07637 C57BL/6NTac-Srsf4/IcsOrl EMMA archived mutant strain MGI:4431961 Srsf4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1890577 Srsf4 serine and arginine-rich splicing factor 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7637 + EM:14651 C57BL/6NTac-Sqstm1/H EMMA sperm unclassified MGI:6741489 Sqstm1 endonuclease-mediated mutation 2, Harwell MGI:107931 Sqstm1 sequestosome 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14651 + EM:14650 C57BL/6NTac-Sqstm1/H EMMA sperm unclassified MGI:6741486 Sqstm1 endonuclease-mediated mutation 1, Harwell MGI:107931 Sqstm1 sequestosome 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14650 + EM:14649 C57BL/6NTac-Sptlc1/H EMMA sperm unclassified MGI:6741483 Sptlc1 endonuclease-mediated mutation 2, Harwell MGI:1099431 Sptlc1 serine palmitoyltransferase, long chain base subunit 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14649 + EM:14648 C57BL/6NTac-Sptlc1/H EMMA sperm unclassified MGI:6741481 Sptlc1 endonuclease-mediated mutation 1, Harwell MGI:1099431 Sptlc1 serine palmitoyltransferase, long chain base subunit 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14648 - EM:09557 C57BL/6NTac-Spp2/WtsiIeg EMMA sperm mutant strain MGI:5633846 Spp2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1922646 Spp2 secreted phosphoprotein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9557 + EM:06850 C57BL/6NTac-Spopl/WtsiCnrm EMMA embryo mutant strain MGI:4455963 Spopl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924107 Spopl speckle-type BTB/POZ protein-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6850 + EM:06850 C57BL/6NTac-Spopl/WtsiCnrm EMMA sperm mutant strain MGI:4455963 Spopl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924107 Spopl speckle-type BTB/POZ protein-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6850 + EM:12357 C57BL/6NTac-Spock1/H EMMA sperm mutant strain MGI:6153825 Spock1 endonuclease-mediated mutation 1, Harwell MGI:105371 Spock1 sparc/osteonectin, cwcv and kazal-like domains proteoglycan 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12357 + EM:07663 C57BL/6NTac-Spns1/IcsOrl EMMA archived mutant strain MGI:4434332 Spns1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1920908 Spns1 SPNS lysolipid transporter 1, lysophospholipid https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7663 - EM:09547 C57BL/6NTac-Spink8/WtsiIeg EMMA sperm mutant strain MGI:5633845 Spink8 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1925959 Spink8 serine peptidase inhibitor, Kazal type 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9547 - EM:08964 C57BL/6NTac-Spink8/Cnrm EMMA sperm mutant strain MGI:5633845 Spink8 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1925959 Spink8 serine peptidase inhibitor, Kazal type 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8964 - EM:08974 C57BL/6NTac-Spic/Cnrm EMMA sperm mutant strain MGI:5633844 Spic targeted mutation 1, Wellcome Trust Sanger Institute MGI:1341168 Spic Spi-C transcription factor (Spi-1/PU.1 related) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8974 - EM:05201 C57BL/6NTac-Spg20/Cnrm EMMA sperm mutant strain MGI:4436639 Spart targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2139806 Spart spartin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5201 + EM:09424 C57BL/6NTac-Spats1/H EMMA sperm mutant strain MGI:5436890 Spats1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918270 Spats1 spermatogenesis associated, serine-rich 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9424 + EM:12355 C57BL/6NTac-Spatc1l/H EMMA sperm mutant strain MGI:6153862 Spatc1l endonuclease-mediated mutation 1, Harwell MGI:1923823 Spatc1l spermatogenesis and centriole associated 1 like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12355 + EM:11414 C57BL/6NTac-Spata13/H EMMA sperm mutant strain MGI:6153824 Spata13 endonuclease-mediated mutation 1, Harwell MGI:104838 Spata13 spermatogenesis associated 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11414 + EM:11414 C57BL/6NTac-Spata13/H EMMA live mutant strain MGI:6153824 Spata13 endonuclease-mediated mutation 1, Harwell MGI:104838 Spata13 spermatogenesis associated 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11414 + EM:07671 C57BL/6NTac-Sox13/IcsOrl EMMA archived mutant strain MGI:4433017 Sox13 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98361 Sox13 SRY (sex determining region Y)-box 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7671 - EM:09221 C57BL/6NTac-Sost/Cnrm EMMA sperm mutant strain MGI:5633843 Sost targeted mutation 1, Wellcome Trust Sanger Institute MGI:1921749 Sost sclerostin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9221 + EM:08481 C57BL/6NTac-Snx31/WtsiFlmg EMMA sperm mutant strain MGI:5497029 Snx31 targeted mutation 1a, Mouse Biology Program, University of California, Davis MGI:1913946 Snx31 sorting nexin 31 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8481 + EM:12383 C57BL/6NTac-Snx14/H EMMA sperm C57BL/6N-Snx14/H mutant strain MGI:6153823 Snx14 endonuclease-mediated mutation 1, Harwell MGI:2155664 Snx14 sorting nexin 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12383 - EM:09542 C57BL/6NTac-Snhg11/WtsiIeg EMMA archived mutant strain MGI:5633842 Snhg11 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2441845 Snhg11 small nucleolar RNA host gene 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9542 + EM:11550 C57BL/6NTac-Snca/H EMMA live mutant strain MGI:6149211 Snca endonuclease mediated mutation 1, Harwell MGI:1277151 Snca synuclein, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11550 + EM:06013 C57BL/6NTac-Snap47/WtsiBiat EMMA sperm mutant strain MGI:4433792 Snap47 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915076 Snap47 synaptosomal-associated protein, 47 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6013 ? EM:14931 C57BL/6NTac-Snap29/Orl EMMA sperm mutant strain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14931 ? EM:14931 C57BL/6NTac-Snap29/Orl EMMA sperm mutant strain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14931 + EM:05226 C57BL/6NTac-Snap29/WtsiCnbc EMMA embryo mutant strain MGI:4433565 Snap29 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914724 Snap29 synaptosomal-associated protein 29 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5226 + EM:05226 C57BL/6NTac-Snap29/WtsiCnbc EMMA sperm mutant strain MGI:4433565 Snap29 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914724 Snap29 synaptosomal-associated protein 29 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5226 - EM:08853 C57BL/6NTac-Snap29/WtsiH EMMA sperm mutant strain MGI:5633841 Snap29 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1914724 Snap29 synaptosomal-associated protein 29 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8853 + EM:06942 C57BL/6NTac-Smyd5/WtsiCnbc EMMA embryo mutant strain MGI:4431696 Smyd5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108048 Smyd5 SET and MYND domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6942 + EM:06942 C57BL/6NTac-Smyd5/WtsiCnbc EMMA sperm mutant strain MGI:4431696 Smyd5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108048 Smyd5 SET and MYND domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6942 + EM:12334 C57BL/6NTac-Smyd3/Ics EMMA sperm mutant strain Smyd3 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1916976 Smyd3 SET and MYND domain containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12334 + EM:08345 C57BL/6NTac-Smurf1/H EMMA sperm mutant strain MGI:4433314 Smurf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923038 Smurf1 SMAD specific E3 ubiquitin protein ligase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8345 + EM:10069 C57BL/6NTac-Smim6/Ieg EMMA sperm mutant strain MGI:4362996 Smim6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915778 Smim6 small integral membrane protein 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10069 - EM:05341 C57BL/6NTac-Smco4/Cnrm EMMA sperm mutant strain MGI:4433435 Smco4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3039636 Smco4 single-pass membrane protein with coiled-coil domains 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5341 + EM:08248 C57BL/6NTac-Smc6/Ieg EMMA embryo mutant strain MGI:4435686 Smc6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914491 Smc6 structural maintenance of chromosomes 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8248 + EM:05700 C57BL/6NTac-Smarcal1/WtsiIeg EMMA sperm mutant strain MGI:4433467 Smarcal1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859183 Smarcal1 SWI/SNF related matrix associated, actin dependent regulator of chromatin, subfamily a-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5700 + EM:09702 C57BL/6NTac-Slu7/WtsiPh EMMA sperm mutant strain MGI:4363740 Slu7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385598 Slu7 SLU7 splicing factor homolog (S. cerevisiae) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9702 - EM:07309 C57BL/6NTac-Slit1/H EMMA sperm mutant strain MGI:4363887 Slit1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1315203 Slit1 slit guidance ligand 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7309 + EM:08724 C57BL/6NTac-Slc6a20a/Ieg EMMA sperm mutant strain MGI:4362653 Slc6a20a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2143217 Slc6a20a solute carrier family 6 (neurotransmitter transporter), member 20A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8724 + EM:05389 C57BL/6NTac-Slc5a6/WtsiCnbc EMMA embryo mutant strain MGI:4432225 Slc5a6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2660847 Slc5a6 solute carrier family 5 (sodium-dependent vitamin transporter), member 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5389 + EM:05389 C57BL/6NTac-Slc5a6/WtsiCnbc EMMA sperm mutant strain MGI:4432225 Slc5a6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2660847 Slc5a6 solute carrier family 5 (sodium-dependent vitamin transporter), member 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5389 + EM:13404 C57BL/6NTac-Slc44a5/WtsiCnrm EMMA live mutant strain MGI:4364041 Slc44a5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3035141 Slc44a5 solute carrier family 44, member 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13404 + EM:08703 C57BL/6NTac-Slc44a3/Ieg EMMA sperm mutant strain MGI:4434043 Slc44a3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384860 Slc44a3 solute carrier family 44, member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8703 - EM:05285 C57BL/6NTac-Slc39a8/Cnrm EMMA sperm mutant strain MGI:4432011 Slc39a8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914797 Slc39a8 solute carrier family 39 (metal ion transporter), member 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5285 + EM:05442 C57BL/6NTac-Slc35f6/WtsiOulu EMMA embryo mutant strain MGI:4432047 Slc35f6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922169 Slc35f6 solute carrier family 35, member F6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5442 + EM:13411 C57BL/6NTac-Slc35b1/WtsiCnrm EMMA live mutant strain MGI:5306495 Slc35b1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1343133 Slc35b1 solute carrier family 35, member B1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13411 - EM:08857 C57BL/6NTac-Slc32a1/WtsiH EMMA sperm mutant strain MGI:5633840 Slc32a1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1194488 Slc32a1 solute carrier family 32 (GABA vesicular transporter), member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8857 + EM:12363 C57BL/6NTac-Slc28a3/H EMMA sperm mutant strain MGI:6153822 Slc28a3 endonuclease-mediated mutation 1, Harwell MGI:2137361 Slc28a3 solute carrier family 28 (sodium-coupled nucleoside transporter), member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12363 - EM:09759 C57BL/6NTac-Slc26a5/WtsiH EMMA sperm mutant strain MGI:5633839 Slc26a5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1933154 Slc26a5 solute carrier family 26, member 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9759 - EM:09769 C57BL/6NTac-Slc26a4/WtsiH EMMA sperm mutant strain MGI:5633838 Slc26a4 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1346029 Slc26a4 solute carrier family 26, member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9769 + EM:06198 C57BL/6NTac-Slc25a43/WtsiCnrm EMMA sperm mutant strain MGI:4431833 Slc25a43 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2684854 Slc25a43 solute carrier family 25, member 43 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6198 - EM:07667 C57BL/6NTac-Slc25a38/IcsOrl EMMA sperm mutant strain MGI:4431760 Slc25a38 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384782 Slc25a38 solute carrier family 25, member 38 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7667 + EM:13330 C57BL/6NTac-Slc23a4/WtsiCnrm EMMA live mutant strain MGI:4363429 Slc23a4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917272 Slc23a4 solute carrier family 23 member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13330 + EM:10783 C57BL/6NTac-Slc22a17/H EMMA sperm C57BL/6N-Slc22a17/H mutant strain MGI:6144258 Slc22a17 endonuclease mediated mutation 2, Harwell MGI:1926225 Slc22a17 solute carrier family 22 (organic cation transporter), member 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10783 + EM:07119 C57BL/6NTac-Slc20a2/WtsiBiat EMMA sperm mutant strain MGI:4431725 Slc20a2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97851 Slc20a2 solute carrier family 20, member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7119 + EM:05549 C57BL/6NTac-Slc20a2/Ieg EMMA embryo mutant strain MGI:4431725 Slc20a2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97851 Slc20a2 solute carrier family 20, member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5549 + EM:07736 C57BL/6NTac-Slc1a7/IcsOrl EMMA sperm mutant strain MGI:4436714 Slc1a7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444087 Slc1a7 solute carrier family 1 (glutamate transporter), member 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7736 + EM:13390 C57BL/6NTac-Slc1a4/WtsiCnrm EMMA live mutant strain MGI:6256798 Slc1a4 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2135601 Slc1a4 solute carrier family 1 (glutamate/neutral amino acid transporter), member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13390 + EM:12448 C57BL/6NTac-Slc17a7/H EMMA sperm mutant strain MGI:6153821 Slc17a7 endonuclease-mediated mutation 1, Harwell MGI:1920211 Slc17a7 solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12448 + EM:07340 C57BL/6NTac-Slc17a3/H EMMA sperm C57BL/6N-Slc17a3/H mutant strain MGI:4362759 Slc17a3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2389216 Slc17a3 solute carrier family 17 (sodium phosphate), member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7340 + EM:06972 C57BL/6NTac-Slc16a6/WtsiIeg EMMA sperm mutant strain MGI:4431916 Slc16a6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144585 Slc16a6 solute carrier family 16 (monocarboxylic acid transporters), member 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6972 - EM:07873 C57BL/6NTac-Slc15a3/H EMMA sperm C57BL/6N-Slc15a3/H mutant strain MGI:4363498 Slc15a3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929691 Slc15a3 solute carrier family 15, member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7873 + EM:11047 C57BL/6NTac-Slc12a9/Ieg EMMA sperm mutant strain MGI:4433292 Slc12a9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933532 Slc12a9 solute carrier family 12 (potassium/chloride transporters), member 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11047 - EM:09549 C57BL/6NTac-Slc12a3/WtsiIeg EMMA sperm mutant strain MGI:5633837 Slc12a3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:108114 Slc12a3 solute carrier family 12, member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9549 + EM:05857 C57BL/6NTac-Sirt2/H EMMA sperm mutant strain MGI:4431586 Sirt2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927664 Sirt2 sirtuin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5857 + EM:12466 C57BL/6NTac-Shisa9/H EMMA sperm mutant strain MGI:6257819 Shisa9 endonuclease-mediated mutation 1, Harwell MGI:1919805 Shisa9 shisa family member 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12466 + EM:11647 C57BL/6NTac-Shank3/H EMMA sperm mutant strain MGI:6153882 Shank3 endonuclease-mediated mutation 2, Harwell MGI:1930016 Shank3 SH3 and multiple ankyrin repeat domains 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11647 + EM:04609 C57BL/6NTac-Sgf29/Cnrm EMMA embryo B6Dnk;B6N-Ccdc101/Cnrm, B6Dnk;B6N-Sgf29/Cnrm, B6NDen;B6N-Ccdc101/Cnrm, HEPD0527_4_B10 mutant strain MGI:4434904 Sgf29 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922815 Sgf29 SAGA complex associated factor 29 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4609 + EM:04609 C57BL/6NTac-Sgf29/Cnrm EMMA sperm B6Dnk;B6N-Ccdc101/Cnrm, B6Dnk;B6N-Sgf29/Cnrm, B6NDen;B6N-Ccdc101/Cnrm, HEPD0527_4_B10 mutant strain MGI:4434904 Sgf29 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922815 Sgf29 SAGA complex associated factor 29 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4609 - EM:08957 C57BL/6NTac-Sgca/Cnrm EMMA sperm mutant strain MGI:5633836 Sgca targeted mutation 1, Wellcome Trust Sanger Institute MGI:894698 Sgca sarcoglycan, alpha (dystrophin-associated glycoprotein) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8957 - EM:09559 C57BL/6NTac-Sfrp1/WtsiIeg EMMA sperm mutant strain MGI:5633835 Sfrp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:892014 Sfrp1 secreted frizzled-related protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9559 + EM:12390 C57BL/6NTac-Sez6/H EMMA sperm mutant strain MGI:6153819 Sez6 endonuclease-mediated mutation 1, Harwell MGI:104745 Sez6 seizure related gene 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12390 + EM:05302 C57BL/6NTac-Setmar/WtsiCnbc EMMA embryo mutant strain MGI:4432061 Setmar targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921979 Setmar SET domain without mariner transposase fusion https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5302 + EM:11199 C57BL/6NTac-Setd5/WtsiOulu EMMA embryo mutant strain MGI:4432631 Setd5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920145 Setd5 SET domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11199 + EM:11199 C57BL/6NTac-Setd5/WtsiOulu EMMA sperm mutant strain MGI:4432631 Setd5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920145 Setd5 SET domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11199 + EM:06857 C57BL/6NTac-Setd1a/WtsiCnrm EMMA sperm mutant strain MGI:4432882 Setd1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446244 Setd1a SET domain containing 1A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6857 + EM:05719 C57BL/6NTac-Sesn3/WtsiBiat EMMA embryo mutant strain MGI:4432370 Sesn3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922997 Sesn3 sestrin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5719 + EM:12301 C57BL/6NTac-Serpinc1/Ics EMMA sperm mutant strain Serpinc1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:88095 Serpinc1 serine (or cysteine) peptidase inhibitor, clade C (antithrombin), member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12301 + EM:09492 C57BL/6NTac-Serpinb12/H EMMA sperm mutant strain MGI:4362859 Serpinb12 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919119 Serpinb12 serine (or cysteine) peptidase inhibitor, clade B (ovalbumin), member 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9492 ? EM:14081 C57BL/6NTac-Serpina3c/WtsiPh EMMA sperm mutant strain MGI:4363850 Serpina3c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102848 Serpina3c serine (or cysteine) peptidase inhibitor, clade A, member 3C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14081 + EM:08482 C57BL/6NTac-Serinc3/WtsiFlmg EMMA sperm mutant strain MGI:4363849 Serinc3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1349457 Serinc3 serine incorporator 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8482 + EM:10640 C57BL/6NTac-Serf2/H EMMA sperm mutant strain MGI:5771993 Serf2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1337041 Serf2 small EDRK-rich factor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10640 - EM:07630 C57BL/6NTac-Sept8/IcsOrl EMMA archived C57BL/6NTac-Septin8/IcsOrl mutant strain MGI:4433986 Septin8 targeted mutation 1a, Wellcome Trust Sanger Institute Sep-08 Sep-08 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7630 + EM:12469 C57BL/6NTac-Senp5/H EMMA sperm mutant strain MGI:6153818 Senp5 endonuclease-mediated mutation 1, Harwell MGI:2443596 Senp5 SUMO/sentrin specific peptidase 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12469 - EM:04003 C57BL/6NTac-Sema5b/Cnrm EMMA sperm mutant strain MGI:4432860 Sema5b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107555 Sema5b sema domain, seven thrombospondin repeats (type 1 and type 1-like), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 5B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4003 + EM:07987 C57BL/6NTac-Sema4d/H EMMA sperm mutant strain MGI:4433529 Sema4d targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109244 Sema4d sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7987 - EM:09222 C57BL/6NTac-Sell/Cnrm EMMA sperm mutant strain MGI:5633834 Sell targeted mutation 2, Wellcome Trust Sanger Institute MGI:98279 Sell selectin, lymphocyte https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9222 + EM:06095 C57BL/6NTac-Selenok/WtsiCnbc EMMA sperm C57BL/6NTac-Selk/WtsiCnbc mutant strain MGI:4431818 Selenok targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1931466 Selenok selenoprotein K https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6095 ? EM:13676 C57BL/6NTac-Sec16b/WtsiOrl EMMA sperm mutant strain MGI:4365061 Sec16b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2148802 Sec16b SEC16 homolog B (S. cerevisiae) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13676 - EM:08973 C57BL/6NTac-Sds/Cnrm EMMA sperm mutant strain MGI:5633833 Sds targeted mutation 1, Wellcome Trust Sanger Institute MGI:98270 Sds serine dehydratase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8973 + EM:06193 C57BL/6NTac-Sdhc/WtsiCnrm EMMA sperm mutant strain MGI:4433079 Sdhc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913302 Sdhc succinate dehydrogenase complex, subunit C, integral membrane protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6193 + EM:06284 C57BL/6NTac-Sdc2/Ieg EMMA embryo mutant strain MGI:4364777 Sdc2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1349165 Sdc2 syndecan 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6284 + EM:14379 C57BL/6NTac-Sco1/WtsiOulu EMMA embryo mutant strain MGI:4363778 Sco1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106362 Sco1 SCO1 cytochrome c oxidase assembly protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14379 + EM:14379 C57BL/6NTac-Sco1/WtsiOulu EMMA sperm mutant strain MGI:4363778 Sco1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106362 Sco1 SCO1 cytochrome c oxidase assembly protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14379 ? EM:14383 C57BL/6NTac-Scimp/WtsiOulu EMMA embryo mutant strain MGI:4362812 Scimp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3610314 Scimp SLP adaptor and CSK interacting membrane protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14383 ? EM:14383 C57BL/6NTac-Scimp/WtsiOulu EMMA sperm mutant strain MGI:4362812 Scimp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3610314 Scimp SLP adaptor and CSK interacting membrane protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14383 + EM:09694 C57BL/6NTac-Scgb1a1/Cnrm EMMA sperm C57BL/6NTac-Scgb1a1/Cnrm mutant strain MGI:5660121 Scgb1a1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:98919 Scgb1a1 secretoglobin, family 1A, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9694 + EM:08110 C57BL/6NTac-Sarnp/Ieg EMMA embryo mutant strain MGI:4434696 Sarnp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913368 Sarnp SAP domain containing ribonucleoprotein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8110 + EM:05863 C57BL/6NTac-Sar1b/WtsiH EMMA sperm MCSS, EPD0113_3_C11 mutant strain MGI:4432515 Sar1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913647 Sar1b secretion associated Ras related GTPase 1B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5863 + EM:05978 C57BL/6NTac-Sag/WtsiBiat EMMA sperm mutant strain MGI:4433619 Sag targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98227 Sag S-antigen, retina and pineal gland (arrestin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5978 - EM:09768 C57BL/6NTac-S100a4/WtsiH EMMA sperm mutant strain MGI:5633831 S100a4 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1330282 S100a4 S100 calcium binding protein A4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9768 + EM:04941 C57BL/6NTac-Rxfp2/Ieg EMMA embryo mutant strain MGI:4433327 Rxfp2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153463 Rxfp2 relaxin/insulin-like family peptide receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4941 + EM:10535 C57BL/6NTac-Rwdd2b/Ics EMMA sperm mutant strain MGI:4433511 Rwdd2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858215 Rwdd2b RWD domain containing 2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10535 + EM:07505 C57BL/6NTac-Rwdd1/WtsiOrl EMMA sperm mutant strain MGI:4362724 Rwdd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913771 Rwdd1 RWD domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7505 + EM:07732 C57BL/6NTac-Ruvbl1/IcsOrl EMMA sperm mutant strain MGI:4432034 Ruvbl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928760 Ruvbl1 RuvB-like protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7732 + EM:07402 C57BL/6NTac-Rundc1/WtsiOulu EMMA embryo mutant strain MGI:4441618 Rundc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144506 Rundc1 RUN domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7402 + EM:07402 C57BL/6NTac-Rundc1/WtsiOulu EMMA sperm mutant strain MGI:4441618 Rundc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144506 Rundc1 RUN domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7402 + EM:06127 C57BL/6NTac-Rufy2/WtsiBiat EMMA sperm mutant strain MGI:4434385 Rufy2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917682 Rufy2 RUN and FYVE domain-containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6127 + EM:05977 C57BL/6NTac-Rtbdn/WtsiBiat EMMA sperm mutant strain MGI:4433926 Rtbdn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443686 Rtbdn retbindin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5977 + EM:09813 C57BL/6NTac-Rspo4/WtsiPh EMMA sperm mutant strain MGI:4364711 Rspo4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924467 Rspo4 R-spondin 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9813 + EM:10774 C57BL/6NTac-Rras/H EMMA sperm mutant strain MGI:6144259 Rras endonuclease mediated mutation 1, Harwell MGI:98179 Rras related RAS viral (r-ras) oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10774 + EM:09394 C57BL/6NTac-Rpia/WtsiOrl EMMA sperm mutant strain MGI:4364474 Rpia targeted mutation 1a, Wellcome Trust Sanger Institute MGI:103254 Rpia ribose 5-phosphate isomerase A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9394 + EM:06273 C57BL/6NTac-Rora/Ieg EMMA embryo mutant strain MGI:4432489 Rora targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104661 Rora RAR-related orphan receptor alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6273 + EM:07377 C57BL/6NTac-Rnf157/WtsiH EMMA sperm mutant strain MGI:4432623 Rnf157 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442484 Rnf157 ring finger protein 157 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7377 - EM:07699 C57BL/6NTac-Rnf144b/IcsOrl EMMA archived mutant strain MGI:4435770 Rnf144b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384986 Rnf144b ring finger protein 144B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7699 + EM:11644 C57BL/6NTac-Rnf115/H EMMA sperm mutant strain MGI:6152692 Rnf115 endonuclease mediated mutation 2, Harwell MGI:1915095 Rnf115 ring finger protein 115 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11644 + EM:11424 C57BL/6NTac-Rnf115/H EMMA sperm mutant strain MGI:6153813 Rnf115 endonuclease-mediated mutation 1, Harwell MGI:1915095 Rnf115 ring finger protein 115 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11424 + EM:11424 C57BL/6NTac-Rnf115/H EMMA live mutant strain MGI:6153813 Rnf115 endonuclease-mediated mutation 1, Harwell MGI:1915095 Rnf115 ring finger protein 115 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11424 + EM:08040 C57BL/6NTac-Rnd3/H EMMA sperm mutant strain MGI:4434854 Rnd3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921444 Rnd3 Rho family GTPase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8040 + EM:08943 C57BL/6NTac-Rnaset2b/H EMMA sperm mutant strain MGI:5497319 Rnaset2b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3702087 Rnaset2b ribonuclease T2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8943 + EM:07690 C57BL/6NTac-Rnase10/IcsOrl EMMA sperm mutant strain MGI:4435923 Rnase10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922269 Rnase10 ribonuclease, RNase A family, 10 (non-active) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7690 + EM:10378 C57BL/6NTac-Rlbp1/Cnrm EMMA embryo mutant strain MGI:5812261 Rlbp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:97930 Rlbp1 retinaldehyde binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10378 + EM:10378 C57BL/6NTac-Rlbp1/Cnrm EMMA sperm mutant strain MGI:5812261 Rlbp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:97930 Rlbp1 retinaldehyde binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10378 ? EM:13674 C57BL/6NTac-Rhou/WtsiOrl EMMA sperm mutant strain MGI:4363423 Rhou targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916831 Rhou ras homolog family member U https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13674 + EM:08733 C57BL/6NTac-Rhd/H EMMA sperm mutant strain MGI:4431572 Rhd targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202882 Rhd Rh blood group, D antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8733 + EM:12294 C57BL/6NTac-Rgs14/Ics EMMA sperm mutant strain Rgs14 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1859709 Rgs14 regulator of G-protein signaling 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12294 + EM:10771 C57BL/6NTac-Rgl3/H EMMA sperm C57BL/6N-Rgl3/H mutant strain MGI:6149210 Rgl3 endonuclease mediated mutation 1, Harwell MGI:1918996 Rgl3 ral guanine nucleotide dissociation stimulator-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10771 + EM:14645 C57BL/6NTac-Rfwd3/H EMMA sperm unclassified MGI:6791296 Rfwd3 targeted mutation 2, Harwell MGI:2384584 Rfwd3 ring finger and WD repeat domain 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14645 + EM:14646 C57BL/6NTac-Rfwd3/H EMMA sperm unclassified MGI:6791294 Rfwd3 targeted mutation 1, Harwell MGI:2384584 Rfwd3 ring finger and WD repeat domain 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14646 + EM:06286 C57BL/6NTac-Rftn2/WtsiBiat EMMA sperm mutant strain MGI:4433645 Rftn2 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1921263 Rftn2 raftlin family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6286 + EM:05438 C57BL/6NTac-Retreg3/WtsiOulu EMMA embryo C57BL/6NTac-Fam134c/WtsiOulu mutant strain MGI:4433416 Retreg3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1915248 Retreg3 reticulophagy regulator family member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5438 + EM:05762 C57BL/6NTac-Rest/Ieg EMMA embryo mutant strain MGI:4431796 Rest targeted mutation 2a, Wellcome Trust Sanger Institute MGI:104897 Rest RE1-silencing transcription factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5762 + EM:12299 C57BL/6NTac-Ren1/Ics EMMA sperm mutant strain Ren1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97898 Ren1 renin 1 structural https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12299 + EM:14397 C57BL/6NTac-Rdh16f2/WtsiOulu EMMA embryo mutant strain MGI:4363554 Rdh16f2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3583955 Rdh16f2 RDH16 family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14397 + EM:14397 C57BL/6NTac-Rdh16f2/WtsiOulu EMMA sperm mutant strain MGI:4363554 Rdh16f2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3583955 Rdh16f2 RDH16 family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14397 + EM:05885 C57BL/6NTac-Rcor2/WtsiIeg EMMA sperm mutant strain MGI:4431639 Rcor2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859854 Rcor2 REST corepressor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5885 + EM:05357 C57BL/6NTac-Rc3h2/Ieg EMMA embryo mutant strain MGI:4364357 Rc3h2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442789 Rc3h2 ring finger and CCCH-type zinc finger domains 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5357 + EM:07733 C57BL/6NTac-Rc3h1/IcsOrl EMMA archived mutant strain MGI:4434899 Rc3h1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2685397 Rc3h1 RING CCCH (C3H) domains 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7733 + EM:08806 C57BL/6NTac-Rbpjl/H EMMA sperm mutant strain MGI:4364029 Rbpjl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1196616 Rbpjl recombination signal binding protein for immunoglobulin kappa J region-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8806 + EM:12298 C57BL/6NTac-Rbpjl/Ics EMMA sperm mutant strain Rbpjl EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1196616 Rbpjl recombination signal binding protein for immunoglobulin kappa J region-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12298 - EM:12527 C57BL/6NTac-Rbpj/H EMMA sperm unclassified MGI:6451740 Rbpj endonuclease-mediated mutation 2, Harwell MGI:96522 Rbpj recombination signal binding protein for immunoglobulin kappa J region https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12527 + EM:07608 C57BL/6NTac-Rbmx/WtsiH EMMA sperm EPD0170_3_E04 mutant strain MGI:4363716 Rbmx targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1343044 Rbmx RNA binding motif protein, X chromosome https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7608 - EM:04571 C57BL/6NTac-Rbm4/Cnrm EMMA embryo mutant strain MGI:4435180 Rbm4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1100865 Rbm4 RNA binding motif protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4571 - EM:04571 C57BL/6NTac-Rbm4/Cnrm EMMA sperm mutant strain MGI:4435180 Rbm4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1100865 Rbm4 RNA binding motif protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4571 + EM:09370 C57BL/6NTac-Rbl1/Ieg EMMA sperm mutant strain MGI:5497361 Rbl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103300 Rbl1 RB transcriptional corepressor like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9370 + EM:12292 C57BL/6NTac-Rbfox3/Ics EMMA sperm mutant strain Rbfox3 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:106368 Rbfox3 RNA binding protein, fox-1 homolog (C. elegans) 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12292 + EM:08887 C57BL/6NTac-Rbak/WtsiIeg EMMA sperm mutant strain MGI:4364920 Rbak targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927369 Rbak RB-associated KRAB zinc finger https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8887 + EM:05886 C57BL/6NTac-Rars/WtsiIeg EMMA sperm mutant strain MGI:4432394 Rars targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914297 Rars arginyl-tRNA synthetase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5886 + EM:11400 C57BL/6NTac-Rapgef5/H EMMA sperm mutant strain MGI:6153844 Rapgef5 endonuclease mediated mutation 1, Harwell MGI:2444365 Rapgef5 Rap guanine nucleotide exchange factor (GEF) 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11400 + EM:11400 C57BL/6NTac-Rapgef5/H EMMA live mutant strain MGI:6153844 Rapgef5 endonuclease mediated mutation 1, Harwell MGI:2444365 Rapgef5 Rap guanine nucleotide exchange factor (GEF) 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11400 + EM:06643 C57BL/6NTac-Ralgapb/Wtsi EMMA archived mutant strain MGI:4363602 Ralgapb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444531 Ralgapb Ral GTPase activating protein, beta subunit (non-catalytic) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6643 + EM:06781 C57BL/6NTac-Ralb/WtsiH EMMA sperm mutant strain MGI:4433898 Ralb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927244 Ralb v-ral simian leukemia viral oncogene B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6781 + EM:07652 C57BL/6NTac-Raf1/IcsOrl EMMA archived mutant strain MGI:4433410 Raf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97847 Raf1 v-raf-leukemia viral oncogene 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7652 + EM:07127 C57BL/6NTac-Rab5c/WtsiOulu EMMA embryo mutant strain MGI:4432624 Rab5c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105306 Rab5c RAB5C, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7127 + EM:07127 C57BL/6NTac-Rab5c/WtsiOulu EMMA sperm mutant strain MGI:4432624 Rab5c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105306 Rab5c RAB5C, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7127 + EM:06276 C57BL/6NTac-Rab35/Ieg EMMA embryo mutant strain MGI:4436336 Rab35 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924657 Rab35 RAB35, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6276 + EM:06612 C57BL/6NTac-Rab15/Wtsi EMMA archived mutant strain MGI:4363640 Rab15 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916865 Rab15 RAB15, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6612 - EM:08970 C57BL/6NTac-Pyy/Cnrm EMMA sperm mutant strain MGI:5633829 Pyy targeted mutation 1, Wellcome Trust Sanger Institute MGI:99924 Pyy peptide YY https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8970 + EM:09612 C57BL/6NTac-Pus10/WtsiOulu EMMA embryo mutant strain MGI:4434872 Pus10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921717 Pus10 pseudouridylate synthase 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9612 + EM:09612 C57BL/6NTac-Pus10/WtsiOulu EMMA sperm mutant strain MGI:4434872 Pus10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921717 Pus10 pseudouridylate synthase 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9612 + EM:11426 C57BL/6NTac-Pttg1ip/H EMMA sperm mutant strain MGI:6149209 Pttg1ip endonuclease mediated mutation 1, Harwell MGI:2652132 Pttg1ip pituitary tumor-transforming 1 interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11426 - EM:08858 C57BL/6NTac-Ptprcap/WtsiH EMMA sperm mutant strain MGI:5633828 Ptprcap targeted mutation 1, Wellcome Trust Sanger Institute MGI:97811 Ptprcap protein tyrosine phosphatase, receptor type, C polypeptide-associated protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8858 - EM:06017 C57BL/6NTac-Ptpn22/Cnrm EMMA sperm mutant strain Ptpn22 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:107170 Ptpn22 protein tyrosine phosphatase, non-receptor type 22 (lymphoid) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6017 - EM:06015 C57BL/6NTac-Ptpn22/Cnrm EMMA sperm mutant strain Ptpn22 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:107170 Ptpn22 protein tyrosine phosphatase, non-receptor type 22 (lymphoid) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6015 + EM:12319 C57BL/6NTac-Pth/Ics EMMA sperm mutant strain Pth EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97799 Pth parathyroid hormone https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12319 + EM:10858 C57BL/6NTac-Ptgr1/WtsiOulu EMMA embryo mutant strain MGI:4432266 Ptgr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914353 Ptgr1 prostaglandin reductase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10858 + EM:10858 C57BL/6NTac-Ptgr1/WtsiOulu EMMA sperm mutant strain MGI:4432266 Ptgr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914353 Ptgr1 prostaglandin reductase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10858 + EM:07687 C57BL/6NTac-Ptdss1/IcsOrl EMMA sperm mutant strain MGI:4434934 Ptdss1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1276575 Ptdss1 phosphatidylserine synthase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7687 + EM:10546 C57BL/6NTac-Ptch1/IcsOrl EMMA sperm mutant strain MGI:4435107 Ptch1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:105373 Ptch1 patched 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10546 - EM:13030 C57BL/6NTac-Prune1/H EMMA sperm unclassified MGI:6451737 Prune1 endonuclease-mediated mutation 1, Harwell MGI:1925152 Prune1 prune exopolyphosphatase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13030 + EM:07638 C57BL/6NTac-Prpsap2/IcsOrl EMMA sperm mutant strain MGI:4432556 Prpsap2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384838 Prpsap2 phosphoribosyl pyrophosphate synthetase-associated protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7638 + EM:12331 C57BL/6NTac-Proc/Ics EMMA sperm mutant strain Proc EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97771 Proc protein C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12331 + EM:05699 C57BL/6NTac-Prmt2/WtsiIeg EMMA sperm mutant strain MGI:4433170 Prmt2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1316652 Prmt2 protein arginine N-methyltransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5699 + EM:05070 C57BL/6NTac-Prmt1/H EMMA sperm mutant strain MGI:4432476 Prmt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107846 Prmt1 protein arginine N-methyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5070 ? EM:13978 C57BL/6NTac-Prkab1/WtsiPh EMMA sperm mutant strain MGI:4362414 Prkab1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1336167 Prkab1 protein kinase, AMP-activated, beta 1 non-catalytic subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13978 + EM:13023 C57BL/6NTac-Prdm8/H EMMA sperm unclassified MGI:6451733 Prdm8 endonuclease-mediated mutation 1, Harwell MGI:1924880 Prdm8 PR domain containing 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13023 + EM:08951 C57BL/6NTac-Prdm16/WtsiH EMMA sperm mutant strain MGI:5633825 Prdm16 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1917923 Prdm16 PR domain containing 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8951 - EM:08850 C57BL/6NTac-Prdm16/WtsiH EMMA sperm mutant strain MGI:5633826 Prdm16 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1917923 Prdm16 PR domain containing 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8850 - EM:07644 C57BL/6NTac-Prdm10/IcsOrl EMMA sperm mutant strain MGI:4434635 Prdm10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2682952 Prdm10 PR domain containing 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7644 + EM:10164 C57BL/6NTac-Ppy/Ieg EMMA embryo mutant strain MGI:4362546 Ppy targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97753 Ppy pancreatic polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10164 - EM:07711 C57BL/6NTac-Ppp6c/IcsOrl EMMA archived mutant strain MGI:4435995 Ppp6c targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915107 Ppp6c protein phosphatase 6, catalytic subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7711 + EM:09648 C57BL/6NTac-Ppp3cc/H EMMA sperm mutant strain MGI:4434809 Ppp3cc targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107162 Ppp3cc protein phosphatase 3, catalytic subunit, gamma isoform https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9648 + EM:05704 C57BL/6NTac-Ppp3ca/WtsiBiat EMMA embryo mutant strain MGI:4432193 Ppp3ca targeted mutation 2e, Wellcome Trust Sanger Institute MGI:107164 Ppp3ca protein phosphatase 3, catalytic subunit, alpha isoform https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5704 + EM:14001 C57BL/6NTac-Ppp2r2b/WtsiOulu EMMA embryo mutant strain MGI:4364039 Ppp2r2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920180 Ppp2r2b protein phosphatase 2, regulatory subunit B, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14001 + EM:14001 C57BL/6NTac-Ppp2r2b/WtsiOulu EMMA sperm mutant strain MGI:4364039 Ppp2r2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920180 Ppp2r2b protein phosphatase 2, regulatory subunit B, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14001 + EM:12305 C57BL/6NTac-Pou2f1/Ics EMMA sperm mutant strain Pou2f1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:101898 Pou2f1 POU domain, class 2, transcription factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12305 + EM:11880 C57BL/6NTac-Polr2f/WtsiH EMMA sperm mutant strain Polr2f EUCOMM targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1349393 Polr2f polymerase (RNA) II (DNA directed) polypeptide F https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11880 - EM:08987 C57BL/6NTac-Polr2f/Cnrm EMMA sperm mutant strain MGI:5633824 Polr2f targeted mutation 1, Wellcome Trust Sanger Institute MGI:1349393 Polr2f polymerase (RNA) II (DNA directed) polypeptide F https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8987 + EM:05889 C57BL/6NTac-Polg2/WtsiIeg EMMA sperm mutant strain MGI:4432134 Polg2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354947 Polg2 polymerase (DNA directed), gamma 2, accessory subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5889 + EM:11433 C57BL/6NTac-Podxl/H EMMA sperm mutant strain MGI:6153807 Podxl endonuclease-mediated mutation 1, Harwell MGI:1351317 Podxl podocalyxin-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11433 + EM:11433 C57BL/6NTac-Podxl/H EMMA live mutant strain MGI:6153807 Podxl endonuclease-mediated mutation 1, Harwell MGI:1351317 Podxl podocalyxin-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11433 + EM:12144 C57BL/6NTac-Pnpo/Wtsi EMMA archived mutant strain MGI:4363478 Pnpo targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144151 Pnpo pyridoxine 5'-phosphate oxidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12144 + EM:05892 C57BL/6NTac-Plxnb2/WtsiIeg EMMA sperm mutant strain MGI:4433461 Plxnb2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2154239 Plxnb2 plexin B2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5892 + EM:04074 C57BL/6NTac-Plxnb2/Ieg EMMA embryo EPD0051_2_D09 mutant strain MGI:4433461 Plxnb2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2154239 Plxnb2 plexin B2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4074 + EM:08483 C57BL/6NTac-Plscr2/WtsiFlmg EMMA sperm mutant strain MGI:4363158 Plscr2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1270860 Plscr2 phospholipid scramblase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8483 + EM:07824 C57BL/6NTac-Plscr1/IcsOrl EMMA archived mutant strain MGI:4435862 Plscr1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:893575 Plscr1 phospholipid scramblase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7824 - EM:10506 C57BL/6NTac-Plpp1/IcsOrl EMMA archived C57BL/6N-Ppap2a/IcsOrl, C57BL/6NTac-Plpp1/IcsOrl, HEPD0531_4_G04 mutant strain MGI:4435089 Plpp1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:108412 Plpp1 phospholipid phosphatase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10506 + EM:05522 C57BL/6NTac-Plin2/WtsiOulu EMMA embryo mutant strain MGI:4432810 Plin2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:87920 Plin2 perilipin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5522 + EM:12313 C57BL/6NTac-Plin1/Ics EMMA sperm mutant strain Plin1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1890505 Plin1 perilipin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12313 + EM:05894 C57BL/6NTac-Plekhg1/WtsiIeg EMMA sperm mutant strain MGI:4431598 Plekhg1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2676551 Plekhg1 pleckstrin homology domain containing, family G (with RhoGef domain) member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5894 + EM:10759 C57BL/6NTac-Plcz1/H EMMA sperm mutant strain MGI:5749950 Plcz1 endonuclease-mediate mutation 1, Harwell MGI:2150308 Plcz1 phospholipase C, zeta 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10759 + EM:11642 C57BL/6NTac-Plaur/H EMMA sperm mutant strain MGI:6152691 Plaur endonuclease mediated mutation 2, Harwell MGI:97612 Plaur plasminogen activator, urokinase receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11642 + EM:11723 C57BL/6NTac-Plaur/H EMMA live mutant strain MGI:6149208 Plaur endonuclease mediated mutation 1, Harwell MGI:97612 Plaur plasminogen activator, urokinase receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11723 + EM:14640 C57BL/6NTac-Pla2g6/H EMMA sperm unclassified MGI:6741080 Pla2g6 endonuclease-mediated mutation 2, Harwell MGI:1859152 Pla2g6 phospholipase A2, group VI https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14640 + EM:14639 C57BL/6NTac-Pla2g6/H EMMA sperm unclassified MGI:6741078 Pla2g6 endonuclease-mediated mutation 1, Harwell MGI:1859152 Pla2g6 phospholipase A2, group VI https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14639 - EM:07628 C57BL/6NTac-Pla2g4f/IcsOrl EMMA archived mutant strain MGI:4435081 Pla2g4f targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2685493 Pla2g4f phospholipase A2, group IVF https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7628 + EM:07196 C57BL/6NTac-Pla2g2c/WtsiH EMMA sperm MFDP, EPD0201_1_F03 mutant strain MGI:4455976 Pla2g2c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106638 Pla2g2c phospholipase A2, group IIC https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7196 - EM:07366 C57BL/6NTac-Pkn1/H EMMA sperm C57BL/6N-Pkn1/H mutant strain MGI:4365010 Pkn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108022 Pkn1 protein kinase N1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7366 - EM:11428 C57BL/6NTac-Pkhd1l1/H EMMA sperm mutant strain MGI:6149161 Pkhd1l1 endonuclease mediated mutation 1, Harwell MGI:2183153 Pkhd1l1 polycystic kidney and hepatic disease 1-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11428 + EM:12336 C57BL/6NTac-Pkd2l1/Ics EMMA sperm mutant strain Pkd2l1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1352448 Pkd2l1 polycystic kidney disease 2-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12336 - EM:06135 C57BL/6NTac-Pkd1l2/H EMMA sperm C57BL/6N-Pkd1l2/H mutant strain MGI:4455437 Pkd1l2 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:2664668 Pkd1l2 polycystic kidney disease 1 like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6135 + EM:09774 C57BL/6NTac-Pkd1l2/WtsiH EMMA sperm C57BL/6NTac-Pkd1l2/WtsiH mutant strain MGI:5660024 Pkd1l2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2664668 Pkd1l2 polycystic kidney disease 1 like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9774 + EM:05526 C57BL/6NTac-Pik3cb/WtsiOulu EMMA embryo mutant strain MGI:4434375 Pik3cb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922019 Pik3cb phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5526 + EM:07688 C57BL/6NTac-Pik3c3/IcsOrl EMMA sperm mutant strain MGI:4433098 Pik3c3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2445019 Pik3c3 phosphatidylinositol 3-kinase catalytic subunit type 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7688 + EM:07662 C57BL/6NTac-Pigu/IcsOrl EMMA sperm mutant strain MGI:4435661 Pigu targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3039607 Pigu phosphatidylinositol glycan anchor biosynthesis, class U https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7662 + EM:09652 C57BL/6NTac-Pias3/Cnrm EMMA sperm C57BL/6NTac-Pias3/Cnrm mutant strain MGI:5660021 Pias3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1913126 Pias3 protein inhibitor of activated STAT 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9652 + EM:07722 C57BL/6NTac-Phykpl/IcsOrl EMMA embryo mutant strain MGI:4431628 Phykpl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920197 Phykpl 5-phosphohydroxy-L-lysine phospholyase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7722 + EM:07722 C57BL/6NTac-Phykpl/IcsOrl EMMA sperm mutant strain MGI:4431628 Phykpl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920197 Phykpl 5-phosphohydroxy-L-lysine phospholyase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7722 + EM:11416 C57BL/6NTac-Phldb2/H EMMA live mutant strain MGI:6149207 Phldb2 endonuclease mediated mutation 1, Harwell MGI:2444981 Phldb2 pleckstrin homology like domain, family B, member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11416 + EM:05800 C57BL/6NTac-Phf6/Ics EMMA sperm mutant strain MGI:4432234 Phf6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918248 Phf6 PHD finger protein 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5800 - EM:09732 C57BL/6NTac-Phex/WtsiH EMMA sperm mutant strain MGI:5633823 Phex targeted mutation 1, Wellcome Trust Sanger Institute MGI:107489 Phex phosphate regulating endopeptidase homolog, X-linked https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9732 + EM:09258 C57BL/6NTac-Pgam5/IcsOrl EMMA sperm mutant strain MGI:4432458 Pgam5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919792 Pgam5 phosphoglycerate mutase family member 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9258 - EM:07599 C57BL/6NTac-Pfkfb4/WtsiCnrm EMMA sperm mutant strain MGI:4362852 Pfkfb4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2687284 Pfkfb4 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7599 + EM:05793 C57BL/6NTac-Pex3/WtsiOrl EMMA sperm mutant strain MGI:4431895 Pex3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929646 Pex3 peroxisomal biogenesis factor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5793 + EM:07735 C57BL/6NTac-Pex16/IcsOrl EMMA sperm mutant strain MGI:4434961 Pex16 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1338829 Pex16 peroxisomal biogenesis factor 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7735 + EM:08734 C57BL/6NTac-Pex10/H EMMA sperm mutant strain MGI:4432787 Pex10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2684988 Pex10 peroxisomal biogenesis factor 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8734 + EM:08458 C57BL/6NTac-Pef1/Ieg EMMA sperm mutant strain MGI:4434599 Pef1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915148 Pef1 penta-EF hand domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8458 - EM:04556 C57BL/6NTac-Pebp4/Cnrm EMMA embryo mutant strain MGI:4436202 Pebp4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920773 Pebp4 phosphatidylethanolamine binding protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4556 - EM:04556 C57BL/6NTac-Pebp4/Cnrm EMMA sperm mutant strain MGI:4436202 Pebp4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920773 Pebp4 phosphatidylethanolamine binding protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4556 + EM:07386 C57BL/6NTac-Pear1/WtsiH EMMA sperm mutant strain MGI:4363617 Pear1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920432 Pear1 platelet endothelial aggregation receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7386 + EM:10187 C57BL/6NTac-Pdzk1/WtsiCnrm EMMA sperm mutant strain MGI:5497391 Pdzk1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1928901 Pdzk1 PDZ domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10187 + EM:10350 C57BL/6NTac-Pdzd8/WtsiBiat EMMA sperm mutant strain MGI:4431887 Pdzd8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2677270 Pdzd8 PDZ domain containing 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10350 + EM:06275 C57BL/6NTac-Pdia6/Ieg EMMA sperm mutant strain MGI:4435366 Pdia6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1919103 Pdia6 protein disulfide isomerase associated 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6275 + EM:09479 C57BL/6NTac-Pdhx/Ieg EMMA sperm mutant strain MGI:4435592 Pdhx targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1351627 Pdhx pyruvate dehydrogenase complex, component X https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9479 + EM:12306 C57BL/6NTac-Pdgfrb/Ics EMMA sperm mutant strain Pdgfrb EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97531 Pdgfrb platelet derived growth factor receptor, beta polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12306 + EM:12318 C57BL/6NTac-Pdgfb/Ics EMMA sperm mutant strain Pdgfb EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97528 Pdgfb platelet derived growth factor, B polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12318 + EM:12326 C57BL/6NTac-Pde6c/Ics EMMA sperm mutant strain Pde6c EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:105956 Pde6c phosphodiesterase 6C, cGMP specific, cone, alpha prime https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12326 - EM:13018 C57BL/6NTac-Pde2a/H EMMA sperm unclassified MGI:6451729 Pde2a endonuclease-mediated mutation 3, Harwell MGI:2446107 Pde2a phosphodiesterase 2A, cGMP-stimulated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13018 + EM:10090 C57BL/6NTac-Pde1b/WtsiIeg EMMA sperm mutant strain MGI:5633822 Pde1b targeted mutation 1, Wellcome Trust Sanger Institute MGI:97523 Pde1b phosphodiesterase 1B, Ca2+-calmodulin dependent https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10090 + EM:06279 C57BL/6NTac-Pcx/Ieg EMMA sperm mutant strain MGI:4432994 Pcx targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97520 Pcx pyruvate carboxylase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6279 + EM:06114 C57BL/6NTac-Pcx/Cnrm EMMA sperm mutant strain MGI:4432994 Pcx targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97520 Pcx pyruvate carboxylase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6114 - EM:09772 C57BL/6NTac-Pbx3/WtsiH EMMA sperm mutant strain MGI:5633821 Pbx3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:97496 Pbx3 pre B cell leukemia homeobox 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9772 - EM:08967 C57BL/6NTac-Pbx2/Cnrm EMMA sperm mutant strain MGI:5633820 Pbx2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1341793 Pbx2 pre B cell leukemia homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8967 + EM:08409 C57BL/6NTac-Pbrm1/Ieg EMMA embryo mutant strain MGI:4432389 Pbrm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923998 Pbrm1 polybromo 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8409 + EM:10075 C57BL/6NTac-Pax5/Ieg EMMA sperm mutant strain MGI:4433183 Pax5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97489 Pax5 paired box 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10075 + EM:13020 C57BL/6NTac-Pax2/H EMMA sperm unclassified MGI:6156350 Pax2 endonuclease mediated mutation 1, Harwell MGI:97486 Pax2 paired box 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13020 + EM:07706 C57BL/6NTac-Patl2/IcsOrl EMMA sperm mutant strain MGI:4435914 Patl2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914828 Patl2 protein associated with topoisomerase II homolog 2 (yeast) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7706 - EM:04410 C57BL/6NTac-Parvb/Cnrm EMMA embryo mutant strain MGI:4431642 Parvb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153063 Parvb parvin, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4410 - EM:04410 C57BL/6NTac-Parvb/Cnrm EMMA sperm mutant strain MGI:4431642 Parvb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153063 Parvb parvin, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4410 + EM:04692 C57BL/6NTac-Parl/H EMMA sperm HEPD0513_3_B04 mutant strain MGI:4435986 Parl targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1277152 Parl presenilin associated, rhomboid-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4692 - EM:04600 C57BL/6NTac-Palm3/Cnrm EMMA embryo mutant strain MGI:4434121 Palm3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921587 Palm3 paralemmin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4600 - EM:04600 C57BL/6NTac-Palm3/Cnrm EMMA sperm mutant strain MGI:4434121 Palm3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921587 Palm3 paralemmin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4600 + EM:07655 C57BL/6NTac-Pacs2/IcsOrl EMMA sperm mutant strain MGI:4435377 Pacs2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924399 Pacs2 phosphofurin acidic cluster sorting protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7655 + EM:12030 C57BL/6NTac-Pabpc4/Wtsi EMMA embryo mutant strain MGI:4364130 Pabpc4 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2385206 Pabpc4 poly(A) binding protein, cytoplasmic 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12030 + EM:13999 C57BL/6NTac-Pabpc4/WtsiOulu EMMA embryo mutant strain MGI:4364054 Pabpc4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385206 Pabpc4 poly(A) binding protein, cytoplasmic 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13999 + EM:13999 C57BL/6NTac-Pabpc4/WtsiOulu EMMA sperm mutant strain MGI:4364054 Pabpc4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385206 Pabpc4 poly(A) binding protein, cytoplasmic 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13999 + EM:10766 C57BL/6NTac-P2ry14/H EMMA sperm P2RY14-DEL1176-EM1-B6N, C57BL/6NTac-P2ry14/H mutant strain MGI:5749947 P2ry14 endonuclease-mediated mutation 1, Harwell MGI:2155705 P2ry14 purinergic receptor P2Y, G-protein coupled, 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10766 + EM:12304 C57BL/6NTac-P2rx7/Ics EMMA sperm mutant strain P2rx7 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1339957 P2rx7 purinergic receptor P2X, ligand-gated ion channel, 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12304 + EM:12317 C57BL/6NTac-Ovgp1/Ics EMMA sperm mutant strain Ovgp1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:106661 Ovgp1 oviductal glycoprotein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12317 + EM:07803 C57BL/6NTac-Ovgp1/H EMMA sperm C57BL/6N-Ovgp1/H mutant strain MGI:4362777 Ovgp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106661 Ovgp1 oviductal glycoprotein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7803 + EM:06780 C57BL/6NTac-Otub2/WtsiH EMMA sperm MCWA, EPD0157_3_B05 mutant strain MGI:4433067 Otub2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915399 Otub2 OTU domain, ubiquitin aldehyde binding 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6780 + EM:07674 C57BL/6NTac-Otop3/IcsOrl EMMA sperm mutant strain MGI:4431640 Otop3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916852 Otop3 otopetrin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7674 + EM:11419 C57BL/6NTac-Otop2/H EMMA sperm mutant strain MGI:6152690 Otop2 endonuclease mediated mutation 2, Harwell MGI:2388365 Otop2 otopetrin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11419 + EM:11423 C57BL/6NTac-Otop2/H EMMA live mutant strain MGI:6149206 Otop2 endonuclease mediated mutation 1, Harwell MGI:2388365 Otop2 otopetrin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11423 + EM:07634 C57BL/6NTac-Orc4/IcsOrl EMMA sperm mutant strain MGI:4433141 Orc4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1347043 Orc4 origin recognition complex, subunit 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7634 + EM:05525 C57BL/6NTac-Optn/WtsiOulu EMMA embryo mutant strain MGI:4432769 Optn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918898 Optn optineurin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5525 + EM:05346 C57BL/6NTac-Optn/Ieg EMMA embryo mutant strain MGI:4432769 Optn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918898 Optn optineurin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5346 - EM:07315 C57BL/6NTac-Oplah/Ieg EMMA embryo mutant strain MGI:4363400 Oplah targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922725 Oplah 5-oxoprolinase (ATP-hydrolysing) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7315 - EM:09777 C57BL/6NTac-Olfm1/WtsiH EMMA sperm mutant strain MGI:5633819 Olfm1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1860437 Olfm1 olfactomedin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9777 + EM:05388 C57BL/6NTac-Oasl2/WtsiCnbc EMMA embryo mutant strain MGI:4431962 Oasl2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1344390 Oasl2 2'-5' oligoadenylate synthetase-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5388 + EM:05388 C57BL/6NTac-Oasl2/WtsiCnbc EMMA sperm mutant strain MGI:4431962 Oasl2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1344390 Oasl2 2'-5' oligoadenylate synthetase-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5388 + EM:05537 C57BL/6NTac-Nxn/Ieg EMMA embryo mutant strain MGI:4432925 Nxn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109331 Nxn nucleoredoxin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5537 + EM:14043 C57BL/6NTac-Nutm1/WtsiOulu EMMA embryo mutant strain MGI:4363742 Nutm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2661384 Nutm1 NUT midline carcinoma, family member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14043 + EM:14043 C57BL/6NTac-Nutm1/WtsiOulu EMMA sperm mutant strain MGI:4363742 Nutm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2661384 Nutm1 NUT midline carcinoma, family member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14043 ? EM:14076 C57BL/6NTac-Nubpl/WtsiPh EMMA sperm mutant strain MGI:4363128 Nubpl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924076 Nubpl nucleotide binding protein-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14076 + EM:11733 C57BL/6NTac-Nrxn2/H EMMA live mutant strain MGI:6149205 Nrxn2 endonuclease mediated mutation 1, Harwell MGI:1096362 Nrxn2 neurexin II https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11733 + EM:11124 C57BL/6NTac-Nrg4/WtsiH EMMA sperm mutant strain MGI:5633817 Nrg4 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1933833 Nrg4 neuregulin 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11124 + EM:10083 C57BL/6NTac-Nr5a1/WtsiIeg EMMA sperm mutant strain MGI:5633816 Nr5a1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1346833 Nr5a1 nuclear receptor subfamily 5, group A, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10083 + EM:10788 C57BL/6NTac-Nr2f6/H EMMA sperm mutant strain MGI:6153804 Nr2f6 endonuclease-mediated mutation 1, Harwell MGI:1352453 Nr2f6 nuclear receptor subfamily 2, group F, member 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10788 + EM:10788 C57BL/6NTac-Nr2f6/H EMMA live mutant strain MGI:6153804 Nr2f6 endonuclease-mediated mutation 1, Harwell MGI:1352453 Nr2f6 nuclear receptor subfamily 2, group F, member 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10788 + EM:10065 C57BL/6NTac-Nphs2/WtsiIeg EMMA sperm mutant strain MGI:5633815 Nphs2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:2157018 Nphs2 nephrosis 2, podocin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10065 + EM:09635 C57BL/6NTac-Nolc1/Ieg EMMA sperm mutant strain MGI:4432873 Nolc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918019 Nolc1 nucleolar and coiled-body phosphoprotein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9635 - EM:07664 C57BL/6NTac-Nol8/IcsOrl EMMA sperm mutant strain MGI:4436496 Nol8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918180 Nol8 nucleolar protein 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7664 + EM:10453 C57BL/6NTac-Nodal/H EMMA sperm mutant strain MGI:4433629 Nodal targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97359 Nodal nodal https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10453 + EM:12373 C57BL/6NTac-Nnt/H EMMA sperm mutant strain MGI:6257492 Nnt endonuclease-mediated mutation 1, Harwell MGI:109279 Nnt nicotinamide nucleotide transhydrogenase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12373 + EM:09639 C57BL/6NTac-Nmt2/Ieg EMMA sperm mutant strain MGI:4436550 Nmt2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1202298 Nmt2 N-myristoyltransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9639 - EM:04346 C57BL/6NTac-Nmnat1/Cnrm EMMA embryo mutant strain MGI:4431754 Nmnat1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913704 Nmnat1 nicotinamide nucleotide adenylyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4346 - EM:04346 C57BL/6NTac-Nmnat1/Cnrm EMMA sperm mutant strain MGI:4431754 Nmnat1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913704 Nmnat1 nicotinamide nucleotide adenylyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4346 + EM:08624 C57BL/6NTac-Nme4/WtsiH EMMA sperm mutant strain MGI:4441641 Nme4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1931148 Nme4 NME/NM23 nucleoside diphosphate kinase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8624 + EM:10706 C57BL/6NTac-Nkx2-6/WtsiIeg EMMA sperm mutant strain MGI:5633814 Nkx2-6 targeted mutation 2, Wellcome Trust Sanger Institute MGI:97351 Nkx2-6 NK2 homeobox 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10706 + EM:05386 C57BL/6NTac-Nkiras2/WtsiCnbc EMMA embryo mutant strain MGI:4432279 Nkiras2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919216 Nkiras2 NFKB inhibitor interacting Ras-like protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5386 + EM:05386 C57BL/6NTac-Nkiras2/WtsiCnbc EMMA sperm mutant strain MGI:4432279 Nkiras2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919216 Nkiras2 NFKB inhibitor interacting Ras-like protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5386 + EM:08150 C57BL/6NTac-Nhp2/WtsiH EMMA sperm EPD0134_3_B06 mutant strain MGI:4362251 Nhp2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098547 Nhp2 NHP2 ribonucleoprotein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8150 + EM:07691 C57BL/6NTac-Ngfr/IcsOrl EMMA archived mutant strain MGI:4432054 Ngfr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97323 Ngfr nerve growth factor receptor (TNFR superfamily, member 16) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7691 + EM:07657 C57BL/6NTac-Nfxl1/IcsOrl EMMA sperm mutant strain MGI:4432670 Nfxl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923646 Nfxl1 nuclear transcription factor, X-box binding-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7657 - EM:03982 C57BL/6NTac-Nfkbid/Cnrm EMMA embryo B6NTac;B6N-Nfkbid/Cnrm, EPD0100_4_A03 mutant strain MGI:4432464 Nfkbid targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3041243 Nfkbid nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, delta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3982 - EM:03982 C57BL/6NTac-Nfkbid/Cnrm EMMA sperm B6NTac;B6N-Nfkbid/Cnrm, EPD0100_4_A03 mutant strain MGI:4432464 Nfkbid targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3041243 Nfkbid nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, delta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3982 + EM:07668 C57BL/6NTac-Nfasc/IcsOrl EMMA archived mutant strain MGI:4435919 Nfasc targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104753 Nfasc neurofascin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7668 ? EM:13177 C57BL/6NTac-Nek10/WtsiFlmg EMMA sperm mutant strain MGI:4363663 Nek10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685128 Nek10 NIMA (never in mitosis gene a)- related kinase 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13177 + EM:12328 C57BL/6NTac-Nefh/Ics EMMA sperm mutant strain Nefh EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97309 Nefh neurofilament, heavy polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12328 + EM:07730 C57BL/6NTac-Ndufs3/IcsOrl EMMA archived mutant strain MGI:4433795 Ndufs3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915599 Ndufs3 NADH:ubiquinone oxidoreductase core subunit S3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7730 - EM:03968 C57BL/6NTac-Ndufaf6/Cnrm EMMA sperm B6Dnk;B6N-Ndufaf6/Cnrm, B6Dnk;B6N-2310030N02Rik/Cnrm, B6NDen;B6N-2310030N02Rik/Cnrm mutant strain MGI:4433125 Ndufaf6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924197 Ndufaf6 NADH:ubiquinone oxidoreductase complex assembly factor 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3968 + EM:05197 C57BL/6NTac-Ndufa8/Ieg EMMA embryo mutant strain MGI:4436517 Ndufa8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915625 Ndufa8 NADH:ubiquinone oxidoreductase subunit A8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5197 + EM:08723 C57BL/6NTac-Ndufa10/Ieg EMMA embryo mutant strain MGI:4434585 Ndufa10 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1914523 Ndufa10 NADH:ubiquinone oxidoreductase subunit A10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8723 - EM:07789 C57BL/6NTac-Ndrg4/H EMMA sperm C57BL/6N-Ndrg4/H mutant strain MGI:4362496 Ndrg4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384590 Ndrg4 N-myc downstream regulated gene 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7789 + EM:07717 C57BL/6NTac-Ncs1/IcsOrl EMMA archived mutant strain MGI:4436379 Ncs1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109166 Ncs1 neuronal calcium sensor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7717 + EM:07176 C57BL/6NTac-Ncf2/WtsiH EMMA sperm C57BL/6N-Ncf2/WtsiH mutant strain MGI:4432766 Ncf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97284 Ncf2 neutrophil cytosolic factor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7176 + EM:07989 C57BL/6NTac-Ncbp3/H EMMA sperm EPD0046_2_C06, C57BL/6NTac-1200014J11Rik/H mutant strain MGI:4433298 Ncbp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914124 Ncbp3 nuclear cap binding subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7989 + EM:05671 C57BL/6NTac-Ncaph/WtsiH EMMA sperm MCEE, EPD0156_5_B09 mutant strain MGI:4431609 Ncaph targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444777 Ncaph non-SMC condensin I complex, subunit H https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5671 - EM:06960 C57BL/6NTac-Nbr1/H EMMA sperm C57BL/6N-Nbr1/H mutant strain MGI:4362162 Nbr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108498 Nbr1 NBR1, autophagy cargo receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6960 + EM:07021 C57BL/6NTac-Natd1/WtsiOulu EMMA embryo C57BL/6NTac-Gm16515/WtsiOulu mutant strain MGI:4432892 Natd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1344388 Natd1 N-acetyltransferase domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7021 + EM:07021 C57BL/6NTac-Natd1/WtsiOulu EMMA sperm C57BL/6NTac-Gm16515/WtsiOulu mutant strain MGI:4432892 Natd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1344388 Natd1 N-acetyltransferase domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7021 + EM:13026 C57BL/6NTac-Nars/H EMMA sperm unclassified MGI:6451612 Nars endonuclease-mediated mutation 1, Harwell MGI:1917473 Nars asparaginyl-tRNA synthetase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13026 + EM:05558 C57BL/6NTac-Napb/Cnrm EMMA sperm mutant strain MGI:4434916 Napb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104562 Napb N-ethylmaleimide sensitive fusion protein attachment protein beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5558 + EM:10080 C57BL/6NTac-Nalcn/WtsiIeg EMMA sperm mutant strain MGI:5633812 Nalcn targeted mutation 2, Wellcome Trust Sanger Institute MGI:2444306 Nalcn sodium leak channel, non-selective https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10080 + EM:10496 C57BL/6NTac-Nab2/IcsOrl EMMA archived mutant strain MGI:4435541 Nab2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107563 Nab2 Ngfi-A binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10496 + EM:06322 C57BL/6NTac-Myo9a/WtsiCnbc EMMA embryo mutant strain MGI:4433267 Myo9a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107735 Myo9a myosin IXa https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6322 + EM:06322 C57BL/6NTac-Myo9a/WtsiCnbc EMMA sperm mutant strain MGI:4433267 Myo9a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107735 Myo9a myosin IXa https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6322 - EM:09558 C57BL/6NTac-Myo1a/WtsiIeg EMMA sperm mutant strain MGI:5633811 Myo1a targeted mutation 1, Wellcome Trust Sanger Institute MGI:107732 Myo1a myosin IA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9558 + EM:04445 C57BL/6NTac-Myl4/Ieg EMMA embryo EPD0155_1_D04 mutant strain MGI:4431641 Myl4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97267 Myl4 myosin, light polypeptide 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4445 + EM:10087 C57BL/6NTac-Myh7/WtsiIeg EMMA sperm mutant strain MGI:5633809 Myh7 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2155600 Myh7 myosin, heavy polypeptide 7, cardiac muscle, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10087 - EM:09116 C57BL/6NTac-Myh4/Cnrm EMMA sperm mutant strain MGI:5633807 Myh4 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1339713 Myh4 myosin, heavy polypeptide 4, skeletal muscle https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9116 + EM:10086 C57BL/6NTac-Myh2/WtsiIeg EMMA sperm mutant strain MGI:5633801 Myh2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1339710 Myh2 myosin, heavy polypeptide 2, skeletal muscle, adult https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10086 - EM:05518 C57BL/6NTac-Myd88/WtsiOulu EMMA embryo mutant strain MGI:4434029 Myd88 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108005 Myd88 myeloid differentiation primary response gene 88 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5518 + EM:05477 C57BL/6NTac-Mxra7/H EMMA sperm EPD0059_1_G06 mutant strain MGI:4433751 Mxra7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914872 Mxra7 matrix-remodelling associated 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5477 + EM:11649 C57BL/6NTac-Mul1/H EMMA sperm mutant strain MGI:6153802 Mul1 endonuclease-mediated mutation 1, Harwell MGI:1915600 Mul1 mitochondrial ubiquitin ligase activator of NFKB 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11649 + EM:12300 C57BL/6NTac-Muc5ac/Ics EMMA sperm mutant strain Muc5ac EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:104697 Muc5ac mucin 5, subtypes A and C, tracheobronchial/gastric https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12300 + EM:07666 C57BL/6NTac-Mtrf1/IcsOrl EMMA archived mutant strain MGI:4434932 Mtrf1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384815 Mtrf1 mitochondrial translational release factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7666 + EM:05373 C57BL/6NTac-Mtor/WtsiCnbc EMMA embryo mutant strain MGI:4432158 Mtor targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928394 Mtor mechanistic target of rapamycin kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5373 + EM:05373 C57BL/6NTac-Mtor/WtsiCnbc EMMA sperm mutant strain MGI:4432158 Mtor targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928394 Mtor mechanistic target of rapamycin kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5373 + EM:07723 C57BL/6NTac-Mtmr14/IcsOrl EMMA archived mutant strain MGI:4362891 Mtmr14 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916075 Mtmr14 myotubularin related protein 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7723 - EM:04455 C57BL/6NTac-Mtch2/Cnrm EMMA embryo mutant strain MGI:4436614 Mtch2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1929260 Mtch2 mitochondrial carrier 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4455 - EM:04455 C57BL/6NTac-Mtch2/Cnrm EMMA sperm mutant strain MGI:4436614 Mtch2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1929260 Mtch2 mitochondrial carrier 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4455 - EM:07705 C57BL/6NTac-Mtarc2/IcsOrl EMMA sperm mutant strain MGI:4435988 Mtarc2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1914497 Mtarc2 mitochondrial amidoxime reducing component 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7705 - EM:09201 C57BL/6NTac-Msx2/Cnrm EMMA sperm mutant strain MGI:5633794 Msx2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:97169 Msx2 msh homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9201 + EM:06037 C57BL/6NTac-Msmo1/WtsiBiat EMMA sperm C57BL/6NTac-Sc4mol/WtsiBiat mutant strain MGI:4432850 Msmo1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913484 Msmo1 methylsterol monoxygenase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6037 + EM:12315 C57BL/6NTac-Msln/Ics EMMA sperm mutant strain Msln EUCOMM targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1888992 Msln mesothelin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12315 + EM:07698 C57BL/6NTac-Mrps35/IcsOrl EMMA archived mutant strain MGI:4433487 Mrps35 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385255 Mrps35 mitochondrial ribosomal protein S35 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7698 + EM:07738 C57BL/6NTac-Mrpl54/IcsOrl EMMA archived mutant strain MGI:4432901 Mrpl54 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913297 Mrpl54 mitochondrial ribosomal protein L54 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7738 + EM:10775 C57BL/6NTac-Mrpl23/H EMMA sperm C57BL/6NTac-Mrpl23/H mutant strain MGI:6144261 Mrpl23 endonuclease mediated mutation 1, Harwell MGI:1196612 Mrpl23 mitochondrial ribosomal protein L23 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10775 + EM:07697 C57BL/6NTac-Mrpl10/IcsOrl EMMA archived mutant strain MGI:4435617 Mrpl10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1333801 Mrpl10 mitochondrial ribosomal protein L10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7697 + EM:05870 C57BL/6NTac-Mroh7/WtsiH EMMA sperm mutant strain MGI:4434135 Mroh7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685873 Mroh7 maestro heat-like repeat family member 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5870 - EM:08847 C57BL/6NTac-Mroh7/WtsiH EMMA sperm mutant strain MGI:5633793 Mroh7 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:2685873 Mroh7 maestro heat-like repeat family member 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8847 + EM:04617 C57BL/6NTac-Mpi/H EMMA sperm EPD0227_5_D08 mutant strain MGI:4432151 Mpi targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97075 Mpi mannose phosphate isomerase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4617 - EM:04738 C57BL/6NTac-Mphosph9/Cnrm EMMA embryo mutant strain MGI:6324154 Mphosph9 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:2443138 Mphosph9 M-phase phosphoprotein 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4738 - EM:04738 C57BL/6NTac-Mphosph9/Cnrm EMMA sperm mutant strain MGI:6324154 Mphosph9 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:2443138 Mphosph9 M-phase phosphoprotein 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4738 + EM:13019 C57BL/6NTac-Mpeg1/H EMMA sperm C57BL/6NTac-Mpeg1/H unclassified MGI:6451609 Mpeg1 endonuclease-mediated mutation 1, Harwell MGI:1333743 Mpeg1 macrophage expressed gene 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13019 + EM:09161 C57BL/6NTac-Mospd1/WtsiPh EMMA sperm mutant strain MGI:4362521 Mospd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917630 Mospd1 motile sperm domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9161 - EM:09764 C57BL/6NTac-Mog/WtsiH EMMA sperm mutant strain MGI:5633791 Mog targeted mutation 1, Wellcome Trust Sanger Institute MGI:97435 Mog myelin oligodendrocyte glycoprotein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9764 + EM:10670 C57BL/6NTac-Mmp11/Ics EMMA sperm mutant strain MGI:4436340 Mmp11 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97008 Mmp11 matrix metallopeptidase 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10670 + EM:11230 C57BL/6NTac-Mlycd/H EMMA live mutant strain MGI:4362673 Mlycd targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928485 Mlycd malonyl-CoA decarboxylase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11230 - EM:04517 C57BL/6NTac-Mlh1/Cnrm EMMA embryo mutant strain MGI:4435839 Mlh1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:101938 Mlh1 mutL homolog 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4517 - EM:04517 C57BL/6NTac-Mlh1/Cnrm EMMA sperm mutant strain MGI:4435839 Mlh1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:101938 Mlh1 mutL homolog 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4517 + EM:10702 C57BL/6NTac-Mitf/WtsiIeg EMMA sperm mutant strain MGI:5633787 Mitf targeted mutation 2, Wellcome Trust Sanger Institute MGI:104554 Mitf melanogenesis associated transcription factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10702 + EM:12321 C57BL/6NTac-Mip/Ics EMMA sperm mutant strain Mip EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:96990 Mip major intrinsic protein of lens fiber https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12321 + EM:11417 C57BL/6NTac-Mindy4/H EMMA live mutant strain MGI:6149204 Mindy4 endonuclease mediated mutation 1, Harwell MGI:3583959 Mindy4 MINDY lysine 48 deubiquitinase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11417 + EM:11405 C57BL/6NTac-Mindy3/H EMMA live mutant strain MGI:6149950 Mindy3 endonuclease mediated mutation 2, Harwell MGI:1914210 Mindy3 MINDY lysine 48 deubiquitinase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11405 + EM:11415 C57BL/6NTac-Mindy3/H EMMA live mutant strain MGI:6149203 Mindy3 endonuclease mediated mutation 1, Harwell MGI:1914210 Mindy3 MINDY lysine 48 deubiquitinase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11415 + EM:11447 C57BL/6NTac-Mindy2/H EMMA live C57BL/6N-Mindy2/H mutant strain MGI:6149160 Mindy2 endonuclease mediated mutation 1, Harwell MGI:2443086 Mindy2 MINDY lysine 48 deubiquitinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11447 + EM:07670 C57BL/6NTac-Mindy1/IcsOrl EMMA sperm C57BL/6NTac-Fam63a/IcsOrl mutant strain MGI:4433829 Mindy1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922257 Mindy1 MINDY lysine 48 deubiquitinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7670 + EM:07640 C57BL/6NTac-Mib2/IcsOrl EMMA archived mutant strain MGI:4431678 Mib2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2679684 Mib2 mindbomb E3 ubiquitin protein ligase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7640 - EM:08962 C57BL/6NTac-Mia/Cnrm EMMA sperm mutant strain MGI:5633786 Mia targeted mutation 1, Wellcome Trust Sanger Institute MGI:109615 Mia MIA SH3 domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8962 + EM:08593 C57BL/6NTac-Mettl24/WtsiH EMMA sperm mutant strain MGI:4363211 Mettl24 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3045338 Mettl24 methyltransferase like 24 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8593 - EM:07966 C57BL/6NTac-Metrnl/WtsiH EMMA sperm C57BL/6N-Metrnl/WtsiH mutant strain MGI:4362702 Metrnl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384806 Metrnl meteorin, glial cell differentiation regulator-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7966 + EM:11557 C57BL/6NTac-Med19/WtsiOulu EMMA embryo mutant strain MGI:4432772 Med19 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914234 Med19 mediator complex subunit 19 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11557 + EM:11557 C57BL/6NTac-Med19/WtsiOulu EMMA sperm mutant strain MGI:4432772 Med19 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914234 Med19 mediator complex subunit 19 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11557 + EM:10828 C57BL/6NTac-Med18/H EMMA sperm mutant strain MGI:4432982 Med18 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914469 Med18 mediator complex subunit 18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10828 + EM:08720 C57BL/6NTac-Me3/Ieg EMMA embryo mutant strain MGI:4362498 Me3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916679 Me3 malic enzyme 3, NADP(+)-dependent, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8720 + EM:08646 C57BL/6NTac-Me2/Ieg EMMA sperm mutant strain MGI:4434603 Me2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2147351 Me2 malic enzyme 2, NAD(+)-dependent, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8646 - EM:04413 C57BL/6NTac-Mcf2l/Cnrm EMMA embryo mutant strain MGI:4436065 Mcf2l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103263 Mcf2l mcf.2 transforming sequence-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4413 - EM:04413 C57BL/6NTac-Mcf2l/Cnrm EMMA sperm mutant strain MGI:4436065 Mcf2l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103263 Mcf2l mcf.2 transforming sequence-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4413 + EM:10705 C57BL/6NTac-Mbp/WtsiIeg EMMA sperm mutant strain MGI:5633783 Mbp targeted mutation 2, Wellcome Trust Sanger Institute MGI:96925 Mbp myelin basic protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10705 + EM:08273 C57BL/6NTac-Mboat7/H EMMA sperm mutant strain MGI:4363399 Mboat7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924832 Mboat7 membrane bound O-acyltransferase domain containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8273 - EM:08949 C57BL/6NTac-Mb/WtsiH EMMA sperm mutant strain MGI:5633782 Mb targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:96922 Mb myoglobin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8949 + EM:07685 C57BL/6NTac-Mat2a/IcsOrl EMMA sperm mutant strain MGI:4435877 Mat2a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443731 Mat2a methionine adenosyltransferase II, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7685 - EM:05708 C57BL/6NTac-March5/WtsiBiat EMMA sperm C57BL/6NTac-Marchf5/WtsiBiat mutant strain MGI:4433802 Marchf5 targeted mutation 1a, Wellcome Trust Sanger Institute Mar-05 Mar-05 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5708 + EM:07740 C57BL/6NTac-Mapre3/IcsOrl EMMA sperm mutant strain MGI:4432919 Mapre3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2140967 Mapre3 microtubule-associated protein, RP/EB family, member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7740 + EM:04557 C57BL/6NTac-Mapkbp1/H EMMA sperm mutant strain MGI:4436014 Mapkbp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1347004 Mapkbp1 mitogen-activated protein kinase binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4557 + EM:10072 C57BL/6NTac-Mapkapk5/Ieg EMMA sperm mutant strain MGI:4432027 Mapkapk5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1333110 Mapkapk5 MAP kinase-activated protein kinase 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10072 - EM:04733 C57BL/6NTac-Mapk8ip2/Cnrm EMMA embryo mutant strain MGI:4433297 Mapk8ip2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926555 Mapk8ip2 mitogen-activated protein kinase 8 interacting protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4733 - EM:04733 C57BL/6NTac-Mapk8ip2/Cnrm EMMA sperm mutant strain MGI:4433297 Mapk8ip2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926555 Mapk8ip2 mitogen-activated protein kinase 8 interacting protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4733 ? EM:13176 C57BL/6NTac-Map3k1/WtsiFlmg EMMA sperm mutant strain MGI:4451248 Map3k1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1346872 Map3k1 mitogen-activated protein kinase kinase kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13176 ? EM:14036 C57BL/6NTac-Maneal/WtsiPh EMMA sperm mutant strain MGI:4362994 Maneal targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2684896 Maneal mannosidase, endo-alpha-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14036 + EM:14092 C57BL/6NTac-Man2b2/WtsiOulu EMMA embryo mutant strain MGI:4362174 Man2b2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1195262 Man2b2 mannosidase 2, alpha B2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14092 + EM:14092 C57BL/6NTac-Man2b2/WtsiOulu EMMA sperm mutant strain MGI:4362174 Man2b2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1195262 Man2b2 mannosidase 2, alpha B2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14092 + EM:05374 C57BL/6NTac-Mad2l2/WtsiCnbc EMMA embryo mutant strain MGI:4432091 Mad2l2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919140 Mad2l2 MAD2 mitotic arrest deficient-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5374 + EM:05374 C57BL/6NTac-Mad2l2/WtsiCnbc EMMA sperm mutant strain MGI:4432091 Mad2l2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919140 Mad2l2 MAD2 mitotic arrest deficient-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5374 ? EM:13672 C57BL/6NTac-Mab21l4/WtsiOrl EMMA sperm mutant strain MGI:4362992 Mab21l4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919124 Mab21l4 mab-21-like 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13672 + EM:06794 C57BL/6NTac-Lztr1/WtsiH EMMA sperm MDLF, EPD0140_5_E07 mutant strain MGI:4432946 Lztr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914113 Lztr1 leucine-zipper-like transcriptional regulator, 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6794 - EM:08969 C57BL/6NTac-Lztfl1/Cnrm EMMA sperm mutant strain MGI:5633781 Lztfl1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1934860 Lztfl1 leucine zipper transcription factor-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8969 + EM:08717 C57BL/6NTac-Lss/Ieg EMMA archived mutant strain MGI:4362667 Lss targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1336155 Lss lanosterol synthase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8717 + EM:12072 C57BL/6NTac-Lsm11/Wtsi EMMA embryo mutant strain MGI:4362146 Lsm11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919540 Lsm11 U7 snRNP-specific Sm-like protein LSM11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12072 + EM:11425 C57BL/6NTac-Lrr1/H EMMA sperm C57BL/6NTac-Lrr1/H mutant strain MGI:6149202 Lrr1 endonuclease mediated mutation 1, Harwell MGI:1916956 Lrr1 leucine rich repeat protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11425 + EM:12143 C57BL/6NTac-Lrpprc/Wtsi EMMA embryo mutant strain MGI:4363281 Lrpprc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919666 Lrpprc leucine-rich PPR-motif containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12143 + EM:05547 C57BL/6NTac-Lpo/Ieg EMMA embryo mutant strain MGI:4432905 Lpo targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923363 Lpo lactoperoxidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5547 + EM:07485 C57BL/6NTac-Lonrf3/WtsiOulu EMMA embryo mutant strain MGI:4363930 Lonrf3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921615 Lonrf3 LON peptidase N-terminal domain and ring finger 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7485 + EM:07485 C57BL/6NTac-Lonrf3/WtsiOulu EMMA sperm mutant strain MGI:4363930 Lonrf3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921615 Lonrf3 LON peptidase N-terminal domain and ring finger 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7485 + EM:05714 C57BL/6NTac-Lnx2/WtsiBiat EMMA embryo mutant strain MGI:4433509 Lnx2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2155959 Lnx2 ligand of numb-protein X 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5714 + EM:07701 C57BL/6NTac-Limk2/IcsOrl EMMA archived mutant strain MGI:4431692 Limk2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1197517 Limk2 LIM motif-containing protein kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7701 + EM:07692 C57BL/6NTac-Lhx1/IcsOrl EMMA archived mutant strain Lhx1 EUCOMM targeted mutation 1e, Wellcome Trust Sanger Institute MGI:99783 Lhx1 LIM homeobox protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7692 ? EM:13959 C57BL/6NTac-Leprot/WtsiPh EMMA sperm mutant strain MGI:4364337 Leprot targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2687005 Leprot leptin receptor overlapping transcript https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13959 + EM:10707 C57BL/6NTac-Lef1/WtsiIeg EMMA sperm mutant strain MGI:5633779 Lef1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:96770 Lef1 lymphoid enhancer binding factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10707 + EM:08936 C57BL/6NTac-Ldhb/WtsiOulu EMMA embryo mutant strain MGI:5299501 Ldhb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96763 Ldhb lactate dehydrogenase B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8936 + EM:08936 C57BL/6NTac-Ldhb/WtsiOulu EMMA sperm mutant strain MGI:5299501 Ldhb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96763 Ldhb lactate dehydrogenase B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8936 + EM:07865 C57BL/6NTac-Lbp/H EMMA sperm mutant strain MGI:4436125 Lbp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1098776 Lbp lipopolysaccharide binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7865 + EM:05705 C57BL/6NTac-Laptm5/WtsiBiat EMMA archived mutant strain MGI:4433224 Laptm5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108046 Laptm5 lysosomal-associated protein transmembrane 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5705 + EM:07646 C57BL/6NTac-Laptm4a/IcsOrl EMMA archived mutant strain MGI:4435176 Laptm4a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108017 Laptm4a lysosomal-associated protein transmembrane 4A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7646 + EM:06294 C57BL/6NTac-Lamb3/H EMMA sperm C57BL/6N-Lamb3/H mutant strain MGI:4364410 Lamb3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99915 Lamb3 laminin, beta 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6294 + EM:08811 C57BL/6NTac-Lama5/H EMMA sperm mutant strain MGI:4363608 Lama5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105382 Lama5 laminin, alpha 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8811 + EM:10043 C57BL/6NTac-Krt82/WtsiIeg EMMA sperm mutant strain MGI:5633778 Krt82 targeted mutation 2, Wellcome Trust Sanger Institute MGI:2149248 Krt82 keratin 82 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10043 + EM:10712 C57BL/6NTac-Krt79/WtsiIeg EMMA sperm mutant strain MGI:5297893 Krt79 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2385030 Krt79 keratin 79 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10712 - EM:08852 C57BL/6NTac-Krt17/WtsiH EMMA sperm mutant strain MGI:5633777 Krt17 targeted mutation 1, Wellcome Trust Sanger Institute MGI:96691 Krt17 keratin 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8852 - EM:07686 C57BL/6NTac-Knstrn/IcsOrl EMMA sperm mutant strain MGI:4362164 Knstrn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1289298 Knstrn kinetochore-localized astrin/SPAG5 binding https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7686 + EM:10664 C57BL/6NTac-Klrb1a/WtsiBiat EMMA sperm mutant strain MGI:4364549 Klrb1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107540 Klrb1a killer cell lectin-like receptor subfamily B member 1A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10664 + EM:11262 C57BL/6NTac-Klk5/WtsiCnrm EMMA sperm mutant strain MGI:4364033 Klk5 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1915918 Klk5 kallikrein related-peptidase 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11262 - EM:09760 C57BL/6NTac-Klk5/WtsiH EMMA sperm mutant strain MGI:5633775 Klk5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1915918 Klk5 kallikrein related-peptidase 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9760 + EM:09948 C57BL/6NTac-Klk10/Cnrm EMMA sperm mutant strain MGI:5811913 Klk10 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1916790 Klk10 kallikrein related-peptidase 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9948 + EM:07649 C57BL/6NTac-Klhl29/IcsOrl EMMA archived mutant strain MGI:4435268 Klhl29 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2683857 Klhl29 kelch-like 29 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7649 + EM:07395 C57BL/6NTac-Klhl21/WtsiH EMMA sperm EPD0122_3_B03 mutant strain MGI:4363013 Klhl21 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919288 Klhl21 kelch-like 21 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7395 + EM:08742 C57BL/6NTac-Klhl18/WtsiH EMMA sperm mutant strain MGI:4362936 Klhl18 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2143315 Klhl18 kelch-like 18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8742 + EM:04619 C57BL/6NTac-Klhdc2/H EMMA sperm HEPD0523_4_G08 mutant strain MGI:4436518 Klhdc2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916804 Klhdc2 kelch domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4619 + EM:07508 C57BL/6NTac-Klf17/WtsiOrl EMMA sperm mutant strain MGI:4362369 Klf17 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2181068 Klf17 Kruppel-like factor 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7508 + EM:11404 C57BL/6NTac-Klf14/H EMMA sperm mutant strain MGI:5749946 Klf14 endonuclease-mediated mutation 2, Harwell MGI:3577024 Klf14 Kruppel-like factor 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11404 + EM:10760 C57BL/6NTac-Klf14/H EMMA live mutant strain MGI:5749945 Klf14 endonuclease-mediated mutation 1, Harwell MGI:3577024 Klf14 Kruppel-like factor 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10760 + EM:08515 C57BL/6NTac-Klc2/WtsiOrl EMMA sperm mutant strain MGI:4434042 Klc2 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:107953 Klc2 kinesin light chain 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8515 + EM:14632 C57BL/6NTac-Khdrbs1/H EMMA sperm unclassified MGI:6719258 Khdrbs1 endonuclease-mediated mutation 3, Harwell MGI:893579 Khdrbs1 KH domain containing, RNA binding, signal transduction associated 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14632 + EM:14631 C57BL/6NTac-Khdrbs1/H EMMA sperm unclassified MGI:6719257 Khdrbs1 endonuclease-mediated mutation 2, Harwell MGI:893579 Khdrbs1 KH domain containing, RNA binding, signal transduction associated 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14631 + EM:14630 C57BL/6NTac-Khdrbs1/H EMMA sperm unclassified MGI:6719254 Khdrbs1 endonuclease-mediated mutation 1, Harwell MGI:893579 Khdrbs1 KH domain containing, RNA binding, signal transduction associated 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14630 + EM:07659 C57BL/6NTac-Kdm8/IcsOrl EMMA archived mutant strain MGI:4431607 Kdm8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924285 Kdm8 lysine (K)-specific demethylase 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7659 ? EM:13668 C57BL/6NTac-Kdm4c/WtsiOrl EMMA archived mutant strain MGI:4362199 Kdm4c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924054 Kdm4c lysine (K)-specific demethylase 4C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13668 - EM:09733 C57BL/6NTac-Kdm4c/WtsiH EMMA sperm mutant strain MGI:5633774 Kdm4c targeted mutation 1, Wellcome Trust Sanger Institute MGI:1924054 Kdm4c lysine (K)-specific demethylase 4C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9733 + EM:11316 C57BL/6NTac-Kctd17/H EMMA sperm C57BL/6N-Kctd17/H mutant strain MGI:6149895 Kctd17 endonuclease mediated mutation 2, Harwell MGI:1920094 Kctd17 potassium channel tetramerisation domain containing 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11316 + EM:10781 C57BL/6NTac-Kctd17/H EMMA sperm mutant strain MGI:6144262 Kctd17 endonuclease mediated mutation 1, Harwell MGI:1920094 Kctd17 potassium channel tetramerisation domain containing 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10781 + EM:07689 C57BL/6NTac-Kctd15/IcsOrl EMMA archived mutant strain MGI:4432583 Kctd15 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385276 Kctd15 potassium channel tetramerisation domain containing 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7689 + EM:14629 C57BL/6NTac-Kcnt1/H EMMA sperm unclassified MGI:6790579 Kcnt1 endonuclease-mediated mutation 1, Harwell MGI:1924627 Kcnt1 potassium channel, subfamily T, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14629 + EM:08514 C57BL/6NTac-Kcnn3/H EMMA sperm mutant strain MGI:4433082 Kcnn3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153183 Kcnn3 potassium intermediate/small conductance calcium-activated channel, subfamily N, member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8514 + EM:14628 C57BL/6NTac-Kcnk13/H EMMA sperm unclassified MGI:6790577 Kcnk13 endonuclease-mediated mutation 3, Harwell MGI:2384976 Kcnk13 potassium channel, subfamily K, member 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14628 + EM:10764 C57BL/6NTac-Kcnk13/H EMMA sperm mutant strain MGI:5749943 Kcnk13 endonuclease-mediated mutation 1, Harwell MGI:2384976 Kcnk13 potassium channel, subfamily K, member 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10764 + EM:12523 C57BL/6NTac-Kcnj11/H EMMA sperm unclassified MGI:6156348 Kcnj11 endonuclease-mediated mutation 1, Harwell MGI:107501 Kcnj11 potassium inwardly rectifying channel, subfamily J, member 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12523 + EM:08235 C57BL/6NTac-Kcnh4/WtsiPh EMMA sperm mutant strain MGI:4460286 Kcnh4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2156184 Kcnh4 potassium voltage-gated channel, subfamily H (eag-related), member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8235 + EM:05862 C57BL/6NTac-Kcne2/WtsiH EMMA sperm MCSJ, EPD0156_2_F10 mutant strain MGI:4431909 Kcne2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891123 Kcne2 potassium voltage-gated channel, Isk-related subfamily, gene 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5862 + EM:09508 C57BL/6NTac-Kbtbd2/H EMMA sperm mutant strain MGI:4436648 Kbtbd2 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:2384811 Kbtbd2 kelch repeat and BTB (POZ) domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9508 + EM:04584 C57BL/6NTac-Jmjd6/Ieg EMMA embryo EPD0158_3_A11 mutant strain MGI:4432550 Jmjd6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858910 Jmjd6 jumonji domain containing 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4584 - EM:09767 C57BL/6NTac-Jchain/WtsiH EMMA sperm mutant strain MGI:5633773 Jchain targeted mutation 1, Wellcome Trust Sanger Institute MGI:96493 Jchain immunoglobulin joining chain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9767 + EM:07436 C57BL/6NTac-Ivd/Ieg EMMA embryo mutant strain MGI:4436446 Ivd targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1929242 Ivd isovaleryl coenzyme A dehydrogenase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7436 - EM:09545 C57BL/6NTac-Itih1/WtsiIeg EMMA sperm mutant strain MGI:5633771 Itih1 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:96618 Itih1 inter-alpha trypsin inhibitor, heavy chain 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9545 - EM:09550 C57BL/6NTac-Itih1/WtsiIeg EMMA sperm mutant strain MGI:5633772 Itih1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:96618 Itih1 inter-alpha trypsin inhibitor, heavy chain 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9550 + EM:07739 C57BL/6NTac-Itgb5/IcsOrl EMMA archived mutant strain MGI:4433020 Itgb5 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:96614 Itgb5 integrin beta 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7739 + EM:12320 C57BL/6NTac-Itgax/Ics EMMA sperm mutant strain Itgax EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:96609 Itgax integrin alpha X https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12320 + EM:12446 C57BL/6NTac-Irx3/H EMMA sperm mutant strain MGI:6155634 Irx3 endonuclease-mediated mutation 2, Harwell MGI:1197522 Irx3 Iroquois related homeobox 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12446 + EM:06341 C57BL/6NTac-Iqce/Ics EMMA embryo mutant strain MGI:4435267 Iqce targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921489 Iqce IQ motif containing E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6341 + EM:07611 C57BL/6NTac-Ints2/WtsiH EMMA sperm EPD0205_3_C04 mutant strain MGI:4362455 Ints2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917672 Ints2 integrator complex subunit 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7611 + EM:12332 C57BL/6NTac-Insl3/Ics EMMA sperm mutant strain Insl3 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:108427 Insl3 insulin-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12332 + EM:10047 C57BL/6NTac-Ins1/WtsiIeg EMMA sperm mutant strain MGI:5633769 Ins1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:96572 Ins1 insulin I https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10047 + EM:13024 C57BL/6NTac-Inpp5k/H EMMA sperm unclassified MGI:6451583 Inpp5k endonuclease-mediated mutation 3, Harwell MGI:1194899 Inpp5k inositol polyphosphate 5-phosphatase K https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13024 + EM:10016 C57BL/6NTac-Inpp1/WtsiFlmg EMMA sperm mutant strain MGI:4363818 Inpp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104848 Inpp1 inositol polyphosphate-1-phosphatase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10016 - EM:04025 C57BL/6NTac-Ino80e/Cnrm EMMA embryo mutant strain MGI:4433084 Ino80e targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2141881 Ino80e INO80 complex subunit E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4025 - EM:04025 C57BL/6NTac-Ino80e/Cnrm EMMA sperm mutant strain MGI:4433084 Ino80e targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2141881 Ino80e INO80 complex subunit E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4025 + EM:07816 C57BL/6NTac-Ino80/IcsOrl EMMA archived mutant strain MGI:4436542 Ino80 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915392 Ino80 INO80 complex subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7816 + EM:10038 C57BL/6NTac-Il7/WtsiIeg EMMA sperm mutant strain MGI:5633768 Il7 targeted mutation 2, Wellcome Trust Sanger Institute MGI:96561 Il7 interleukin 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10038 + EM:05520 C57BL/6NTac-Il22ra1/WtsiOulu EMMA embryo mutant strain MGI:4431742 Il22ra1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2663588 Il22ra1 interleukin 22 receptor, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5520 ? EM:14353 C57BL/6NTac-Ikbke/WtsiCnbc EMMA embryo mutant strain Ikbke Sanger Institute targeted mutation 1, Wellcome Trust Sanger Institute MGI:1929612 Ikbke inhibitor of kappaB kinase epsilon https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14353 ? EM:14353 C57BL/6NTac-Ikbke/WtsiCnbc EMMA sperm mutant strain Ikbke Sanger Institute targeted mutation 1, Wellcome Trust Sanger Institute MGI:1929612 Ikbke inhibitor of kappaB kinase epsilon https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14353 - EM:06359 C57BL/6NTac-Igfbp3/H EMMA sperm mutant strain MGI:4363852 Igfbp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96438 Igfbp3 insulin-like growth factor binding protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6359 + EM:07714 C57BL/6NTac-Ift20/IcsOrl EMMA archived mutant strain MGI:4431815 Ift20 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915585 Ift20 intraflagellar transport 20 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7714 + EM:09158 C57BL/6NTac-Ift140/WtsiPh EMMA archived mutant strain MGI:4363217 Ift140 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2146906 Ift140 intraflagellar transport 140 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9158 + EM:07822 C57BL/6NTac-Ift122/IcsOrl EMMA archived mutant strain MGI:4432086 Ift122 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1932386 Ift122 intraflagellar transport 122 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7822 + EM:05803 C57BL/6NTac-Ido1/WtsiCnbc EMMA embryo mutant strain MGI:4432044 Ido1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96416 Ido1 indoleamine 2,3-dioxygenase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5803 + EM:05803 C57BL/6NTac-Ido1/WtsiCnbc EMMA sperm mutant strain MGI:4432044 Ido1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96416 Ido1 indoleamine 2,3-dioxygenase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5803 - EM:04551 C57BL/6NTac-Ibsp/Cnrm EMMA embryo mutant strain MGI:4434523 Ibsp targeted mutation 1e, Wellcome Trust Sanger Institute MGI:96389 Ibsp integrin binding sialoprotein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4551 - EM:04551 C57BL/6NTac-Ibsp/Cnrm EMMA sperm mutant strain MGI:4434523 Ibsp targeted mutation 1e, Wellcome Trust Sanger Institute MGI:96389 Ibsp integrin binding sialoprotein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4551 - EM:07642 C57BL/6NTac-Iah1/IcsOrl EMMA archived mutant strain MGI:4435023 Iah1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914982 Iah1 isoamyl acetate-hydrolyzing esterase 1 homolog https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7642 + EM:05264 C57BL/6NTac-Hsph1/Cnrm EMMA sperm mutant strain MGI:4431540 Hsph1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105053 Hsph1 heat shock 105kDa/110kDa protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5264 - EM:04414 C57BL/6NTac-Hsf2bp/Cnrm EMMA embryo mutant strain MGI:4435082 Hsf2bp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921627 Hsf2bp heat shock transcription factor 2 binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4414 - EM:04414 C57BL/6NTac-Hsf2bp/Cnrm EMMA sperm mutant strain MGI:4435082 Hsf2bp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921627 Hsf2bp heat shock transcription factor 2 binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4414 + EM:10710 C57BL/6NTac-Hrg/WtsiIeg EMMA sperm mutant strain MGI:5633767 Hrg targeted mutation 1, Wellcome Trust Sanger Institute MGI:2146636 Hrg histidine-rich glycoprotein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10710 - EM:09448 C57BL/6NTac-Hoxa3/Cnrm EMMA sperm mutant strain MGI:5633766 Hoxa3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:96175 Hoxa3 homeobox A3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9448 + EM:12333 C57BL/6NTac-Hoxa2/Ics EMMA sperm mutant strain Hoxa2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:96174 Hoxa2 homeobox A2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12333 - EM:09551 C57BL/6NTac-Hnf4a/WtsiIeg EMMA sperm mutant strain MGI:5632505 Hnf4a targeted mutation 1, Wellcome Trust Sanger Institute MGI:109128 Hnf4a hepatic nuclear factor 4, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9551 + EM:09688 C57BL/6NTac-Hmox2/H EMMA sperm mutant strain MGI:4434868 Hmox2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109373 Hmox2 heme oxygenase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9688 + EM:05901 C57BL/6NTac-Hira/WtsiIeg EMMA sperm mutant strain MGI:4431679 Hira targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99430 Hira histone cell cycle regulator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5901 - EM:05113 C57BL/6NTac-Hipk2/Cnrm EMMA sperm mutant strain MGI:4435696 Hipk2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1314872 Hipk2 homeodomain interacting protein kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5113 + EM:12335 C57BL/6NTac-Hhip/Ics EMMA sperm mutant strain Hhip EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1341847 Hhip Hedgehog-interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12335 - EM:08960 C57BL/6NTac-Hes5/Cnrm EMMA sperm mutant strain MGI:5632504 Hes5 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:104876 Hes5 hes family bHLH transcription factor 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8960 + EM:04583 C57BL/6NTac-Hells/Ieg EMMA embryo EPD0102_4_A04 mutant strain MGI:4431905 Hells targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106209 Hells helicase, lymphoid specific https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4583 + EM:14094 C57BL/6NTac-Heatr6/WtsiOulu EMMA embryo mutant strain MGI:4364452 Heatr6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919790 Heatr6 HEAT repeat containing 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14094 + EM:14094 C57BL/6NTac-Heatr6/WtsiOulu EMMA sperm mutant strain MGI:4364452 Heatr6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919790 Heatr6 HEAT repeat containing 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14094 + EM:07726 C57BL/6NTac-Heatr3/IcsOrl EMMA archived mutant strain MGI:4435825 Heatr3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444491 Heatr3 HEAT repeat containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7726 + EM:10703 C57BL/6NTac-Hdc/WtsiIeg EMMA sperm mutant strain MGI:5632502 Hdc targeted mutation 2, Wellcome Trust Sanger Institute MGI:96062 Hdc histidine decarboxylase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10703 + EM:05717 C57BL/6NTac-Hdac8/WtsiBiat EMMA sperm mutant strain MGI:4432268 Hdac8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917565 Hdac8 histone deacetylase 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5717 + EM:07737 C57BL/6NTac-Hcn4/IcsOrl EMMA sperm mutant strain MGI:4435096 Hcn4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1298209 Hcn4 hyperpolarization-activated, cyclic nucleotide-gated K+ 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7737 + EM:11725 C57BL/6NTac-Hcn1/H EMMA live mutant strain MGI:6149894 Hcn1 endonuclease mediated mutation 2, Harwell MGI:1096392 Hcn1 hyperpolarization activated cyclic nucleotide gated potassium channel 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11725 + EM:11420 C57BL/6NTac-Hcn1/H EMMA sperm mutant strain MGI:6153798 Hcn1 endonuclease-mediated mutation 1, Harwell MGI:1096392 Hcn1 hyperpolarization activated cyclic nucleotide gated potassium channel 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11420 + EM:11420 C57BL/6NTac-Hcn1/H EMMA live mutant strain MGI:6153798 Hcn1 endonuclease-mediated mutation 1, Harwell MGI:1096392 Hcn1 hyperpolarization activated cyclic nucleotide gated potassium channel 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11420 + EM:13678 C57BL/6NTac-Harbi1/H EMMA live mutant strain MGI:4435117 Harbi1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443194 Harbi1 harbinger transposase derived 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13678 + EM:13980 C57BL/6NTac-Hacl1/WtsiOulu EMMA embryo mutant strain MGI:4362181 Hacl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929657 Hacl1 2-hydroxyacyl-CoA lyase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13980 + EM:13980 C57BL/6NTac-Hacl1/WtsiOulu EMMA sperm mutant strain MGI:4362181 Hacl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929657 Hacl1 2-hydroxyacyl-CoA lyase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13980 + EM:07643 C57BL/6NTac-H6pd/IcsOrl EMMA archived mutant strain MGI:4432827 H6pd targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2140356 H6pd hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7643 ? EM:13811 C57BL/6NTac-Gzmk/IcsOrl EMMA sperm mutant strain Gzmk Gzmk MGI:1298232 Gzmk granzyme K https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13811 + EM:09981 C57BL/6NTac-Gzmk/IcsOrl EMMA sperm mutant strain MGI:4362377 Gzmk targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1298232 Gzmk granzyme K https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9981 + EM:11261 C57BL/6NTac-Gtpbp3/WtsiPh EMMA sperm mutant strain MGI:4364401 Gtpbp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917609 Gtpbp3 GTP binding protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11261 + EM:10194 C57BL/6NTac-Gtf2h2/WtsiCnrm EMMA sperm mutant strain MGI:4432932 Gtf2h2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1345669 Gtf2h2 general transcription factor II H, polypeptide 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10194 + EM:05490 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA embryo C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285396 Gt(ROSA)26Sor targeted mutation 2, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5490 + EM:05490 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA sperm C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285396 Gt(ROSA)26Sor targeted mutation 2, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5490 + EM:05490 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA live C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285396 Gt(ROSA)26Sor targeted mutation 2, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5490 + EM:11220 C57BL/6NTac-Gt(ROSA)26Sor/WtsiIeg EMMA sperm mutant strain Gt(ROSA)26Sor EUCOMM targeted mutation 1, Wellcome Trust Sanger Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11220 + EM:05488 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA embryo C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285392 Gt(ROSA)26Sor targeted mutation 1, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5488 + EM:05488 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA sperm C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285392 Gt(ROSA)26Sor targeted mutation 1, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5488 + EM:05488 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA live C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285392 Gt(ROSA)26Sor targeted mutation 1, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5488 + EM:09604 C57BL/6NTac-Gsdme/WtsiOulu EMMA embryo mutant strain MGI:4363231 Gsdme targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1889850 Gsdme gasdermin E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9604 + EM:09604 C57BL/6NTac-Gsdme/WtsiOulu EMMA sperm mutant strain MGI:4363231 Gsdme targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1889850 Gsdme gasdermin E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9604 + EM:10838 C57BL/6NTac-Grp/H EMMA live Grp-DEL483INS5-EM2-B6N Grp-DEL483INS5-EM2-B6N, C57BL/6N-Grp/H, H-Grp-DEL483INS5-EM2-B6N (IMPC) mutant strain MGI:5749871 Grp endonuclease-mediated mutation 2, Harwell MGI:95833 Grp gastrin releasing peptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10838 + EM:10765 C57BL/6NTac-Grp/H EMMA sperm C57BL/6N-Grp/H, Grp-DEL2DEL396-EM1-B6N mutant strain MGI:5749869 Grp endonuclease-mediated mutation 1, Harwell MGI:95833 Grp gastrin releasing peptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10765 + EM:11317 C57BL/6NTac-Grm7/H EMMA sperm mutant strain MGI:6149200 Grm7 endonuclease mediated mutation 1, Harwell MGI:1351344 Grm7 glutamate receptor, metabotropic 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11317 + EM:12463 C57BL/6NTac-Grm1/H EMMA sperm mutant strain MGI:6266821 Grm1 endonuclease-mediated mutation 2, Harwell MGI:1351338 Grm1 glutamate receptor, metabotropic 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12463 + EM:12530 C57BL/6NTac-Grm1/H EMMA sperm unclassified MGI:6451428 Grm1 endonuclease-mediated mutation 1, Harwell MGI:1351338 Grm1 glutamate receptor, metabotropic 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12530 - EM:09776 C57BL/6NTac-Grin2c/WtsiH EMMA sperm mutant strain MGI:5632501 Grin2c targeted mutation 1, Wellcome Trust Sanger Institute MGI:95822 Grin2c glutamate receptor, ionotropic, NMDA2C (epsilon 3) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9776 + EM:07681 C57BL/6NTac-Grhl3/IcsOrl EMMA sperm mutant strain MGI:4433681 Grhl3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2655333 Grhl3 grainyhead like transcription factor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7681 - EM:08948 C57BL/6NTac-Gpx3/WtsiH EMMA sperm mutant strain MGI:5632499 Gpx3 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:105102 Gpx3 glutathione peroxidase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8948 - EM:08854 C57BL/6NTac-Gpx3/WtsiH EMMA sperm mutant strain MGI:5632500 Gpx3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:105102 Gpx3 glutathione peroxidase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8854 + EM:12378 C57BL/6NTac-Gprin1/H EMMA sperm mutant strain MGI:6153795 Gprin1 endonuclease-mediated mutation 1, Harwell MGI:1349455 Gprin1 G protein-regulated inducer of neurite outgrowth 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12378 + EM:10175 C57BL/6NTac-Gpr88/Cnrm EMMA sperm mutant strain MGI:5811828 Gpr88 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1927653 Gpr88 G-protein coupled receptor 88 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10175 + EM:12365 C57BL/6NTac-Gpr146/H EMMA sperm C57BL/6N-Gpr146/H mutant strain MGI:6153856 Gpr146 endonuclease-mediated mutation 1, Harwell MGI:1933113 Gpr146 G protein-coupled receptor 146 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12365 ? EM:11307 C57BL/6NTac-Gnl3/WtsiOrl EMMA sperm mutant strain Gnl3 Sanger Institute targeted mutation 1, Wellcome Trust Sanger Institute MGI:1353651 Gnl3 guanine nucleotide binding protein-like 3 (nucleolar) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11307 + EM:12308 C57BL/6NTac-Gngt2/Ics EMMA sperm mutant strain Gngt2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:893584 Gngt2 guanine nucleotide binding protein (G protein), gamma transducing activity polypeptide 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12308 - EM:09778 C57BL/6NTac-Gng7/WtsiH EMMA sperm mutant strain MGI:5632498 Gng7 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95787 Gng7 guanine nucleotide binding protein (G protein), gamma 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9778 + EM:10716 C57BL/6NTac-Gng4/WtsiIeg EMMA sperm mutant strain MGI:5660016 Gng4 targeted mutation 2, Wellcome Trust Sanger Institute MGI:102703 Gng4 guanine nucleotide binding protein (G protein), gamma 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10716 + EM:12372 C57BL/6NTac-Gng11/H EMMA sperm mutant strain MGI:6153855 Gng11 endonuclease-mediated mutation 1, Harwell MGI:1913316 Gng11 guanine nucleotide binding protein (G protein), gamma 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12372 + EM:10758 C57BL/6NTac-Gnb4/H EMMA sperm C57BL/6N-Gnb4/H, GNB4-DEL617-EM1-B6N, C57BL/6N-Gnb4/H mutant strain MGI:5755155 Gnb4 endonuclease-mediated mutation 1, Harwell MGI:104581 Gnb4 guanine nucleotide binding protein (G protein), beta 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10758 - EM:08855 C57BL/6NTac-Gnai2/WtsiH EMMA sperm mutant strain MGI:5632497 Gnai2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95772 Gnai2 guanine nucleotide binding protein (G protein), alpha inhibiting 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8855 + EM:10091 C57BL/6NTac-Gnai1/WtsiIeg EMMA sperm mutant strain MGI:5632496 Gnai1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:95771 Gnai1 guanine nucleotide binding protein (G protein), alpha inhibiting 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10091 - EM:04385 C57BL/6NTac-Gna11/Cnrm EMMA embryo mutant strain MGI:4432307 Gna11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95766 Gna11 guanine nucleotide binding protein, alpha 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4385 - EM:04385 C57BL/6NTac-Gna11/Cnrm EMMA sperm mutant strain MGI:4432307 Gna11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95766 Gna11 guanine nucleotide binding protein, alpha 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4385 + EM:07710 C57BL/6NTac-Gmfg/IcsOrl EMMA sperm mutant strain MGI:4434689 Gmfg targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1927135 Gmfg glia maturation factor, gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7710 + EM:09706 C57BL/6NTac-Gmds/WtsiIeg EMMA sperm mutant strain MGI:4363597 Gmds targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891112 Gmds GDP-mannose 4, 6-dehydratase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9706 + EM:08391 C57BL/6NTac-Gm5544/WtsiOrl EMMA sperm mutant strain MGI:4364386 Gm5544 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3648209 Gm5544 predicted gene 5544 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8391 + EM:04485 C57BL/6NTac-Gm5134/H EMMA sperm mutant strain MGI:4435240 Gm5134 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3646667 Gm5134 predicted gene 5134 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4485 - EM:08143 C57BL/6NTac-Gm16379/WtsiCnrm EMMA sperm C57BL/6NTac-Mif-ps6/WtsiCnrm mutant strain MGI:4364434 Mif-ps6 targeted mutation 1a, Wellcome Trust Sanger Institute Gm16379 withdrawn, = Mif-ps6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8143 + EM:06207 C57BL/6NTac-Gm12258/Ics EMMA embryo mutant strain MGI:4436398 Gm12258 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3651534 Gm12258 predicted gene 12258 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6207 ? EM:13669 C57BL/6NTac-Glt8d2/WtsiOrl EMMA sperm mutant strain MGI:4364018 Glt8d2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922032 Glt8d2 glycosyltransferase 8 domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13669 + EM:12534 C57BL/6NTac-Gldc/H EMMA sperm unclassified MGI:6451426 Gldc endonuclease-mediated mutation 1, Harwell MGI:1341155 Gldc glycine decarboxylase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12534 + EM:08261 C57BL/6NTac-Gimap6/WtsiPh EMMA sperm mutant strain MGI:4364125 Gimap6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918876 Gimap6 GTPase, IMAP family member 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8261 + EM:04434 C57BL/6NTac-Ggt1/H EMMA sperm EPD0183_3_C02, GGT1-B6N-USA mutant strain MGI:4432621 Ggt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95706 Ggt1 gamma-glutamyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4434 + EM:07321 C57BL/6NTac-Gfpt1/H EMMA sperm mutant strain MGI:4431600 Gfpt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95698 Gfpt1 glutamine fructose-6-phosphate transaminase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7321 + EM:05706 C57BL/6NTac-Gfm1/WtsiBiat EMMA sperm mutant strain MGI:4432285 Gfm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107339 Gfm1 G elongation factor, mitochondrial 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5706 + EM:06985 C57BL/6NTac-Gfi1b/H EMMA sperm mutant strain MGI:4434882 Gfi1b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1276578 Gfi1b growth factor independent 1B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6985 + EM:12291 C57BL/6NTac-Gdf9/Ics EMMA sperm mutant strain Gdf9 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:95692 Gdf9 growth differentiation factor 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12291 + EM:10851 C57BL/6NTac-Gcsh/H EMMA sperm C57BL/6NTac-Gcsh mutant strain MGI:6153793 Gcsh endonuclease-mediated mutation 1, Harwell MGI:1915383 Gcsh glycine cleavage system protein H (aminomethyl carrier) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10851 + EM:05085 C57BL/6NTac-Gclc/WtsiCnbc EMMA embryo mutant strain MGI:4432329 Gclc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104990 Gclc glutamate-cysteine ligase, catalytic subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5085 + EM:05085 C57BL/6NTac-Gclc/WtsiCnbc EMMA sperm mutant strain MGI:4432329 Gclc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104990 Gclc glutamate-cysteine ligase, catalytic subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5085 - EM:11645 C57BL/6NTac-Gckr/H EMMA live mutant strain MGI:6149159 Gckr endonuclease mediated mutation 2, Harwell MGI:1096345 Gckr glucokinase regulatory protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11645 + EM:11406 C57BL/6NTac-Gckr/H EMMA live C57BL/6N-Gckr/H mutant strain MGI:6149158 Gckr endonuclease mediated mutation 1, Harwell MGI:1096345 Gckr glucokinase regulatory protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11406 + EM:11373 C57BL/6NTac-Gck/H EMMA sperm mutant strain MGI:6149199 Gck endonuclease mediated mutation 1, Harwell MGI:1270854 Gck glucokinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11373 + EM:10030 C57BL/6NTac-Gchfr/WtsiIeg EMMA sperm mutant strain MGI:5632495 Gchfr targeted mutation 2, Wellcome Trust Sanger Institute MGI:2443977 Gchfr GTP cyclohydrolase I feedback regulator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10030 + EM:05385 C57BL/6NTac-Gba2/WtsiCnbc EMMA embryo mutant strain MGI:4433071 Gba2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2654325 Gba2 glucosidase beta 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5385 + EM:05385 C57BL/6NTac-Gba2/WtsiCnbc EMMA sperm mutant strain MGI:4433071 Gba2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2654325 Gba2 glucosidase beta 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5385 + EM:06283 C57BL/6NTac-Gatm/Ieg EMMA embryo mutant strain MGI:4362557 Gatm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914342 Gatm glycine amidinotransferase (L-arginine:glycine amidinotransferase) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6283 + EM:10059 C57BL/6NTac-Gata2/WtsiIeg EMMA sperm mutant strain MGI:5632494 Gata2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95662 Gata2 GATA binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10059 - EM:09552 C57BL/6NTac-Gast/WtsiIeg EMMA sperm mutant strain MGI:5632493 Gast targeted mutation 1, Wellcome Trust Sanger Institute MGI:104768 Gast gastrin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9552 + EM:12329 C57BL/6NTac-Gas2/Ics EMMA sperm mutant strain Gas2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:95657 Gas2 growth arrest specific 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12329 + EM:07676 C57BL/6NTac-Gar1/IcsOrl EMMA archived mutant strain MGI:4432700 Gar1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1930948 Gar1 GAR1 ribonucleoprotein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7676 - EM:09770 C57BL/6NTac-Gap43/WtsiH EMMA sperm mutant strain MGI:5632492 Gap43 targeted mutation 2, Wellcome Trust Sanger Institute MGI:95639 Gap43 growth associated protein 43 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9770 + EM:08941 C57BL/6NTac-Galntl5/WtsiOulu EMMA embryo mutant strain MGI:4363889 Galntl5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915159 Galntl5 UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase-like 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8941 + EM:08941 C57BL/6NTac-Galntl5/WtsiOulu EMMA sperm mutant strain MGI:4363889 Galntl5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915159 Galntl5 UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase-like 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8941 + EM:08238 C57BL/6NTac-Galk2/Ieg EMMA sperm mutant strain MGI:4435970 Galk2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917226 Galk2 galactokinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8238 + EM:12467 C57BL/6NTac-Gabra2/H EMMA sperm mutant strain MGI:6149191 Gabra2 endonuclease mediated mutation 1, Harwell MGI:95614 Gabra2 gamma-aminobutyric acid (GABA) A receptor, subunit alpha 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12467 - EM:04412 C57BL/6NTac-Furin/Cnrm EMMA embryo mutant strain MGI:4434157 Furin targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97513 Furin furin (paired basic amino acid cleaving enzyme) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4412 - EM:04412 C57BL/6NTac-Furin/Cnrm EMMA sperm mutant strain MGI:4434157 Furin targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97513 Furin furin (paired basic amino acid cleaving enzyme) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4412 - EM:09765 C57BL/6NTac-Fto/WtsiH EMMA sperm mutant strain MGI:5632490 Fto targeted mutation 1, Wellcome Trust Sanger Institute MGI:1347093 Fto fat mass and obesity associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9765 + EM:10770 C57BL/6NTac-Frmd6/H EMMA archived mutant strain MGI:6149190 Frmd6 endonuclease mediated mutation 1, Harwell MGI:2442579 Frmd6 FERM domain containing 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10770 + EM:07719 C57BL/6NTac-Fpgs/IcsOrl EMMA archived mutant strain MGI:4435288 Fpgs targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:95576 Fpgs folylpolyglutamyl synthetase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7719 + EM:07713 C57BL/6NTac-Flot2/IcsOrl EMMA archived mutant strain MGI:4433811 Flot2 targeted mutation 2e, Wellcome Trust Sanger Institute MGI:103309 Flot2 flotillin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7713 - EM:07725 C57BL/6NTac-Fkbp9/IcsOrl EMMA archived mutant strain MGI:4435917 Fkbp9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1350921 Fkbp9 FK506 binding protein 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7725 + EM:07823 C57BL/6NTac-Fkbp10/IcsOrl EMMA archived mutant strain MGI:5432211 Fkbp10 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:104769 Fkbp10 FK506 binding protein 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7823 ? EM:14355 C57BL/6NTac-Filip1/WtsiCnbc EMMA sperm mutant strain Filip1 KOMP targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1917848 Filip1 filamin A interacting protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14355 - EM:07970 C57BL/6NTac-Fgf9/H EMMA sperm C57BL/6N-Fgf9/H mutant strain MGI:4364690 Fgf9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104723 Fgf9 fibroblast growth factor 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7970 - EM:08180 C57BL/6NTac-Fgf2/H EMMA sperm C57BL/6N-Fgf2/H mutant strain MGI:4433040 Fgf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95516 Fgf2 fibroblast growth factor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8180 - EM:04411 C57BL/6NTac-Fgf11/Cnrm EMMA embryo mutant strain MGI:4432799 Fgf11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109167 Fgf11 fibroblast growth factor 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4411 - EM:04411 C57BL/6NTac-Fgf11/Cnrm EMMA sperm mutant strain MGI:4432799 Fgf11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109167 Fgf11 fibroblast growth factor 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4411 - EM:09735 C57BL/6NTac-Fga/WtsiH EMMA sperm mutant strain MGI:5632489 Fga targeted mutation 2, Wellcome Trust Sanger Institute MGI:1316726 Fga fibrinogen alpha chain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9735 + EM:11125 C57BL/6NTac-Fcgr1/WtsiH EMMA sperm C57BL/6NTac-Fcgr1/Wtsi, C57BL/6NTac-Fcgr1/Wtsi mutant strain MGI:5660015 Fcgr1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95498 Fcgr1 Fc receptor, IgG, high affinity I https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11125 + EM:07208 C57BL/6NTac-Fbxo33/WtsiCnrm EMMA sperm mutant strain MGI:4432600 Fbxo33 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917861 Fbxo33 F-box protein 33 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7208 - EM:10990 C57BL/6NTac-Fam71b/WtsiPh EMMA sperm C57BL/6NTac-Garin3/WtsiPh mutant strain MGI:4364165 Garin3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3650836 Garin3 golgi associated RAB2 interactor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10990 - EM:04359 C57BL/6NTac-Fam234b/Cnrm EMMA embryo mutant strain MGI:4432729 Fam234b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921775 Fam234b family with sequence similarity 234, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4359 - EM:04359 C57BL/6NTac-Fam234b/Cnrm EMMA sperm mutant strain MGI:4432729 Fam234b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921775 Fam234b family with sequence similarity 234, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4359 - EM:04544 C57BL/6NTac-Fam110b/Cnrm EMMA embryo mutant strain MGI:4432846 Fam110b targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1916593 Fam110b family with sequence similarity 110, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4544 - EM:04544 C57BL/6NTac-Fam110b/Cnrm EMMA sperm mutant strain MGI:4432846 Fam110b targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1916593 Fam110b family with sequence similarity 110, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4544 + EM:06090 C57BL/6NTac-Fahd2a/WtsiCnbc EMMA sperm mutant strain MGI:4431777 Fahd2a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915376 Fahd2a fumarylacetoacetate hydrolase domain containing 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6090 + EM:12360 C57BL/6NTac-Fabp7/H EMMA sperm mutant strain MGI:6153790 Fabp7 endonuclease-mediated mutation 1, Harwell MGI:101916 Fabp7 fatty acid binding protein 7, brain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12360 + EM:07665 C57BL/6NTac-Fabp3/IcsOrl EMMA sperm mutant strain MGI:4431873 Fabp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95476 Fabp3 fatty acid binding protein 3, muscle and heart https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7665 + EM:09830 C57BL/6NTac-Fabp1/Cnrm EMMA sperm C57BL/6NTac-Fabp1/Cnrm mutant strain MGI:5660005 Fabp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95479 Fabp1 fatty acid binding protein 1, liver https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9830 + EM:07648 C57BL/6NTac-Fabp12/IcsOrl EMMA archived mutant strain MGI:4433784 Fabp12 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922747 Fabp12 fatty acid binding protein 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7648 + EM:05974 C57BL/6NTac-Ezr/WtsiBiat EMMA sperm mutant strain MGI:4431855 Ezr targeted mutation 2a, Wellcome Trust Sanger Institute MGI:98931 Ezr ezrin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5974 + EM:05698 C57BL/6NTac-Ezh2/WtsiIeg EMMA sperm mutant strain MGI:4432638 Ezh2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107940 Ezh2 enhancer of zeste 2 polycomb repressive complex 2 subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5698 + EM:08714 C57BL/6NTac-Ethe1/H EMMA sperm mutant strain MGI:4432299 Ethe1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913321 Ethe1 ethylmalonic encephalopathy 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8714 + EM:12259 C57BL/6NTac-Ermn/H EMMA sperm mutant strain MGI:6153851 Ermn endonuclease-mediated mutation 1, Harwell MGI:1925017 Ermn ermin, ERM-like protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12259 + EM:09757 C57BL/6NTac-Epx/WtsiH EMMA sperm C57BL/6NTac-Epx/WtsiH mutant strain MGI:5660003 Epx targeted mutation 1, Wellcome Trust Sanger Institute MGI:107569 Epx eosinophil peroxidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9757 + EM:07716 C57BL/6NTac-Ephx1/IcsOrl EMMA sperm mutant strain MGI:4434687 Ephx1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:95405 Ephx1 epoxide hydrolase 1, microsomal https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7716 - EM:05198 C57BL/6NTac-Epc2/Ieg EMMA embryo mutant strain MGI:4431957 Epc2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1278321 Epc2 enhancer of polycomb homolog 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5198 - EM:08971 C57BL/6NTac-Eomes/Cnrm EMMA sperm mutant strain MGI:5632488 Eomes targeted mutation 1, Wellcome Trust Sanger Institute MGI:1201683 Eomes eomesodermin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8971 + EM:14016 C57BL/6NTac-Entpd6/WtsiOulu EMMA embryo mutant strain MGI:4363445 Entpd6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202295 Entpd6 ectonucleoside triphosphate diphosphohydrolase 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14016 + EM:14016 C57BL/6NTac-Entpd6/WtsiOulu EMMA sperm mutant strain MGI:4363445 Entpd6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202295 Entpd6 ectonucleoside triphosphate diphosphohydrolase 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14016 - EM:08963 C57BL/6NTac-Entpd5/Cnrm EMMA sperm mutant strain MGI:5632487 Entpd5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1321385 Entpd5 ectonucleoside triphosphate diphosphohydrolase 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8963 + EM:08727 C57BL/6NTac-Enpep/Ieg EMMA sperm mutant strain MGI:4363369 Enpep targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106645 Enpep glutamyl aminopeptidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8727 - EM:04384 C57BL/6NTac-Emid1/Cnrm EMMA embryo mutant strain MGI:4433762 Emid1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2155091 Emid1 EMI domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4384 - EM:04384 C57BL/6NTac-Emid1/Cnrm EMMA sperm mutant strain MGI:4433762 Emid1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2155091 Emid1 EMI domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4384 + EM:13687 C57BL/6NTac-Elovl4/H EMMA live mutant strain MGI:5497308 Elovl4 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1933331 Elovl4 elongation of very long chain fatty acids (FEN1/Elo2, SUR4/Elo3, yeast)-like 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13687 + EM:09951 C57BL/6NTac-Elapor1/IcsOrl EMMA archived C57BL/6NTac-5330417C22Rik/IcsOrl mutant strain MGI:4436415 Elapor1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923930 Elapor1 endosome-lysosome associated apoptosis and autophagy regulator 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9951 + EM:05966 C57BL/6NTac-Elac2/WtsiBiat EMMA sperm mutant strain MGI:4456058 Elac2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1890496 Elac2 elaC ribonuclease Z 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5966 + EM:07702 C57BL/6NTac-Eif2b5/IcsOrl EMMA archived mutant strain MGI:4432328 Eif2b5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446176 Eif2b5 eukaryotic translation initiation factor 2B, subunit 5 epsilon https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7702 + EM:05712 C57BL/6NTac-Ehd1/WtsiBiat EMMA embryo mutant strain MGI:4432418 Ehd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1341878 Ehd1 EH-domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5712 + EM:05927 C57BL/6NTac-Efcab11/Cnrm EMMA sperm mutant strain MGI:4434986 Efcab11 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1926017 Efcab11 EF-hand calcium binding domain 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5927 - EM:04570 C57BL/6NTac-Eef2kmt/Cnrm EMMA embryo mutant strain MGI:4433018 Eef2kmt targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1917761 Eef2kmt eukaryotic elongation factor 2 lysine methyltransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4570 - EM:04570 C57BL/6NTac-Eef2kmt/Cnrm EMMA sperm mutant strain MGI:4433018 Eef2kmt targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1917761 Eef2kmt eukaryotic elongation factor 2 lysine methyltransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4570 + EM:07851 C57BL/6NTac-Eef1akmt1/WtsiOrl EMMA sperm C57BL/6NTac-N6amt2/WtsiOrl mutant strain MGI:4431797 Eef1akmt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915293 Eef1akmt1 EEF1A alpha lysine methyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7851 + EM:09964 C57BL/6NTac-Ect2/IcsOrl EMMA sperm mutant strain MGI:4433090 Ect2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95281 Ect2 ect2 oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9964 + EM:05789 C57BL/6NTac-Ears2/WtsiOrl EMMA sperm mutant strain MGI:4432622 Ears2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914667 Ears2 glutamyl-tRNA synthetase 2, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5789 + EM:05795 C57BL/6NTac-Dusp4/WtsiOrl EMMA sperm mutant strain MGI:4431999 Dusp4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442191 Dusp4 dual specificity phosphatase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5795 + EM:10346 C57BL/6NTac-Dusp3/WtsiBiat EMMA sperm mutant strain MGI:4820135 Dusp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919599 Dusp3 dual specificity phosphatase 3 (vaccinia virus phosphatase VH1-related) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10346 + EM:12450 C57BL/6NTac-Dtx1/H EMMA sperm mutant strain MGI:6153785 Dtx1 endonuclease-mediated mutation 1, Harwell MGI:1352744 Dtx1 deltex 1, E3 ubiquitin ligase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12450 + EM:14375 C57BL/6NTac-Dsg1b/WtsiOulu EMMA embryo mutant strain MGI:4364614 Dsg1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2664357 Dsg1b desmoglein 1 beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14375 + EM:14375 C57BL/6NTac-Dsg1b/WtsiOulu EMMA sperm mutant strain MGI:4364614 Dsg1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2664357 Dsg1b desmoglein 1 beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14375 + EM:07821 C57BL/6NTac-Drg2/IcsOrl EMMA archived mutant strain MGI:4432942 Drg2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1342307 Drg2 developmentally regulated GTP binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7821 + EM:12310 C57BL/6NTac-Drd1/Ics EMMA sperm mutant strain Drd1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:99578 Drd1 dopamine receptor D1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12310 + EM:07639 C57BL/6NTac-Dpy19l3/IcsOrl EMMA archived mutant strain MGI:4433660 Dpy19l3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443952 Dpy19l3 dpy-19-like 3 (C. elegans) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7639 + EM:09968 C57BL/6NTac-Dpp4/IcsOrl EMMA sperm mutant strain MGI:4433896 Dpp4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:94919 Dpp4 dipeptidylpeptidase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9968 + EM:04393 C57BL/6NTac-Dpm2/H EMMA sperm HEPD0510_6_G06 mutant strain MGI:4435371 Dpm2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1330238 Dpm2 dolichol-phosphate (beta-D) mannosyltransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4393 + EM:05670 C57BL/6NTac-Donson/WtsiH EMMA sperm MAVY, EPD0243_2_A05 mutant strain MGI:4433969 Donson targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1890621 Donson downstream neighbor of SON https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5670 + EM:08389 C57BL/6NTac-Dner/Ieg EMMA archived mutant strain MGI:4435871 Dner targeted mutation 3a, Helmholtz Zentrum Muenchen GmbH MGI:2152889 Dner delta/notch-like EGF repeat containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8389 + EM:09690 C57BL/6NTac-Dnase1l2/WtsiH EMMA sperm mutant strain MGI:4362265 Dnase1l2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1913955 Dnase1l2 deoxyribonuclease 1-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9690 + EM:06204 C57BL/6NTac-Dnal4/Ics EMMA embryo mutant strain MGI:4441730 Dnal4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859217 Dnal4 dynein, axonemal, light chain 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6204 + EM:04949 C57BL/6NTac-Dnajc17/Ieg EMMA embryo mutant strain MGI:4434811 Dnajc17 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916658 Dnajc17 DnaJ heat shock protein family (Hsp40) member C17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4949 + EM:04535 C57BL/6NTac-Dnajc10/H EMMA sperm HEPD0507_5_B06 mutant strain MGI:4436651 Dnajc10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914111 Dnajc10 DnaJ heat shock protein family (Hsp40) member C10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4535 + EM:12330 C57BL/6NTac-Dmrtc2/Ics EMMA sperm mutant strain Dmrtc2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1918491 Dmrtc2 doublesex and mab-3 related transcription factor like family C2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12330 - EM:09553 C57BL/6NTac-Dmbx1/WtsiIeg EMMA sperm mutant strain MGI:5632486 Dmbx1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2153518 Dmbx1 diencephalon/mesencephalon homeobox 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9553 + EM:04133 C57BL/6NTac-Dlec1/Ieg EMMA embryo EPD0183_3_F08 mutant strain MGI:4432388 Dlec1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443671 Dlec1 deleted in lung and esophageal cancer 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4133 - EM:09543 C57BL/6NTac-Dkk3/WtsiIeg EMMA sperm mutant strain MGI:5632485 Dkk3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1354952 Dkk3 dickkopf WNT signaling pathway inhibitor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9543 + EM:09710 C57BL/6NTac-Dipk1a/WtsiPh EMMA sperm C57BL/6NTac-Fam69a/WtsiPh mutant strain MGI:5548321 Dipk1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914516 Dipk1a divergent protein kinase domain 1A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9710 + EM:08729 C57BL/6NTac-Dhdds/Ieg EMMA sperm mutant strain MGI:4362250 Dhdds targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914672 Dhdds dehydrodolichyl diphosphate synthase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8729 - EM:08171 C57BL/6NTac-Denr/WtsiOrl EMMA sperm mutant strain MGI:4451332 Denr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915434 Denr density-regulated protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8171 + EM:07728 C57BL/6NTac-Ddx52/IcsOrl EMMA archived mutant strain MGI:4434081 Ddx52 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1925644 Ddx52 DExD box helicase 52 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7728 - EM:05109 C57BL/6NTac-Ddx43/Cnrm EMMA sperm mutant strain MGI:4433882 Ddx43 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3642857 Ddx43 DEAD box helicase 43 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5109 ? EM:13943 C57BL/6NTac-Ddhd1/WtsiOrl EMMA sperm mutant strain MGI:4362938 Ddhd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2150302 Ddhd1 DDHD domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13943 + EM:05962 C57BL/6NTac-Dcx/WtsiBiat EMMA sperm mutant strain MGI:4441970 Dcx targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1277171 Dcx doublecortin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5962 + EM:09711 C57BL/6NTac-Dclk1/WtsiOrl EMMA sperm mutant strain MGI:5543459 Dclk1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1330861 Dclk1 doublecortin-like kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9711 + EM:08380 C57BL/6NTac-Dcbld2/WtsiPh EMMA sperm mutant strain MGI:4363322 Dcbld2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920629 Dcbld2 discoidin, CUB and LCCL domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8380 - EM:09560 C57BL/6NTac-Dbx1/WtsiIeg EMMA sperm mutant strain MGI:5632484 Dbx1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:94867 Dbx1 developing brain homeobox 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9560 ? EM:13175 C57BL/6NTac-Dbn1/WtsiFlmg EMMA sperm mutant strain MGI:4363390 Dbn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1931838 Dbn1 drebrin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13175 + EM:12309 C57BL/6NTac-Dbi/Ics EMMA sperm mutant strain Dbi EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:94865 Dbi diazepam binding inhibitor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12309 ? EM:14032 C57BL/6NTac-Dars2/WtsiOrl EMMA sperm mutant strain MGI:4362200 Dars2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442510 Dars2 aspartyl-tRNA synthetase 2 (mitochondrial) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14032 + EM:06844 C57BL/6NTac-Dapk2/WtsiCnrm EMMA sperm mutant strain MGI:4434345 Dapk2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1341297 Dapk2 death-associated protein kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6844 + EM:06356 C57BL/6NTac-Dapk1/H EMMA sperm mutant strain MGI:4435674 Dapk1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916885 Dapk1 death associated protein kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6356 + EM:10084 C57BL/6NTac-Dagla/WtsiIeg EMMA sperm mutant strain MGI:5632483 Dagla targeted mutation 1, Wellcome Trust Sanger Institute MGI:2677061 Dagla diacylglycerol lipase, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10084 + EM:12323 C57BL/6NTac-D130043K22Rik/Ics EMMA sperm mutant strain D130043K22Rik EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:3036268 D130043K22Rik RIKEN cDNA D130043K22 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12323 + EM:08705 C57BL/6NTac-Cyp4f16/H EMMA sperm mutant strain MGI:4364137 Cyp4f16 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917351 Cyp4f16 cytochrome P450, family 4, subfamily f, polypeptide 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8705 + EM:08718 C57BL/6NTac-Cyp4b1/Ieg EMMA embryo C57BL/6NTac-Cyp4b1tm1a(KOMP)Wtsi/Ieg mutant strain MGI:4364022 Cyp4b1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:103225 Cyp4b1 cytochrome P450, family 4, subfamily b, polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8718 - EM:09537 C57BL/6NTac-Cyp1a1/Cnrm EMMA sperm mutant strain MGI:5632482 Cyp1a1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:88588 Cyp1a1 cytochrome P450, family 1, subfamily a, polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9537 + EM:13974 C57BL/6NTac-Cybc1/WtsiOulu EMMA embryo mutant strain MGI:4363837 Cybc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384959 Cybc1 cytochrome b 245 chaperone 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13974 + EM:13974 C57BL/6NTac-Cybc1/WtsiOulu EMMA sperm mutant strain MGI:4363837 Cybc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384959 Cybc1 cytochrome b 245 chaperone 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13974 + EM:09709 C57BL/6NTac-Cxcr1/WtsiPh EMMA sperm mutant strain MGI:5497392 Cxcr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2448715 Cxcr1 chemokine (C-X-C motif) receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9709 + EM:12524 C57BL/6NTac-Cx3cl1/H EMMA sperm C57BL/6NTac-Cx3cl/H unclassified MGI:6451422 Cx3cl1 endonuclease-mediated mutation 1, Harwell MGI:1097153 Cx3cl1 chemokine (C-X3-C motif) ligand 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12524 - EM:09771 C57BL/6NTac-Ctsq/WtsiH EMMA sperm mutant strain MGI:5632481 Ctsq targeted mutation 1, Wellcome Trust Sanger Institute MGI:2137385 Ctsq cathepsin Q https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9771 + EM:10223 C57BL/6NTac-Ctsq/Cnrm EMMA embryo mutant strain MGI:5632481 Ctsq targeted mutation 1, Wellcome Trust Sanger Institute MGI:2137385 Ctsq cathepsin Q https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10223 + EM:10223 C57BL/6NTac-Ctsq/Cnrm EMMA sperm mutant strain MGI:5632481 Ctsq targeted mutation 1, Wellcome Trust Sanger Institute MGI:2137385 Ctsq cathepsin Q https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10223 + EM:06216 C57BL/6NTac-Ctsd/Ics EMMA embryo mutant strain MGI:4433100 Ctsd targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88562 Ctsd cathepsin D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6216 + EM:12640 C57BL/6NTac-Ctsa/H EMMA live mutant strain MGI:4435627 Ctsa targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:97748 Ctsa cathepsin A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12640 + EM:07024 C57BL/6NTac-Ctr9/WtsiOulu EMMA embryo mutant strain MGI:4433989 Ctr9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109345 Ctr9 CTR9 homolog, Paf1/RNA polymerase II complex component https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7024 + EM:07024 C57BL/6NTac-Ctr9/WtsiOulu EMMA sperm mutant strain MGI:4433989 Ctr9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109345 Ctr9 CTR9 homolog, Paf1/RNA polymerase II complex component https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7024 + EM:08586 C57BL/6NTac-Cth/Ieg EMMA sperm mutant strain MGI:5435787 Cth targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1339968 Cth cystathionase (cystathionine gamma-lyase) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8586 - EM:09739 C57BL/6NTac-Csn1s2a/WtsiH EMMA sperm mutant strain MGI:5632480 Csn1s2a targeted mutation 1, Wellcome Trust Sanger Institute MGI:88542 Csn1s2a casein alpha s2-like A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9739 - EM:09554 C57BL/6NTac-Csk/WtsiIeg EMMA sperm mutant strain MGI:5632479 Csk targeted mutation 1, Wellcome Trust Sanger Institute MGI:88537 Csk c-src tyrosine kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9554 - EM:09766 C57BL/6NTac-Crym/WtsiH EMMA sperm mutant strain MGI:5632478 Crym targeted mutation 1, Wellcome Trust Sanger Institute MGI:102675 Crym crystallin, mu https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9766 - EM:09736 C57BL/6NTac-Crygd/WtsiH EMMA sperm mutant strain MGI:5632477 Crygd targeted mutation 2, Wellcome Trust Sanger Institute MGI:88524 Crygd crystallin, gamma D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9736 + EM:10051 C57BL/6NTac-Crygb/WtsiIeg EMMA sperm mutant strain MGI:5632476 Crygb targeted mutation 2, Wellcome Trust Sanger Institute MGI:88522 Crygb crystallin, gamma B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10051 + EM:10704 C57BL/6NTac-Cryga/WtsiIeg EMMA sperm mutant strain MGI:5632475 Cryga targeted mutation 2, Wellcome Trust Sanger Institute MGI:88521 Cryga crystallin, gamma A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10704 + EM:10763 C57BL/6NTac-Cry1/H EMMA live mutant strain MGI:5755154 Cry1 endonuclease-mediated mutation 1, Harwell MGI:1270841 Cry1 cryptochrome 1 (photolyase-like) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10763 + EM:10014 C57BL/6NTac-Crlf3/WtsiFlmg EMMA sperm mutant strain MGI:4363171 Crlf3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1860086 Crlf3 cytokine receptor-like factor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10014 + EM:10713 C57BL/6NTac-Crisp3/WtsiIeg EMMA sperm mutant strain MGI:5632474 Crisp3 targeted mutation 2, Wellcome Trust Sanger Institute MGI:102552 Crisp3 cysteine-rich secretory protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10713 - EM:08170 C57BL/6NTac-Cracdl/WtsiOrl EMMA sperm mutant strain MGI:4364312 Cracdl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919347 Cracdl capping protein inhibiting regulator of actin like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8170 + EM:08052 C57BL/6NTac-Cpt2/WtsiBiat EMMA sperm mutant strain MGI:4362863 Cpt2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109176 Cpt2 carnitine palmitoyltransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8052 + EM:10778 C57BL/6NTac-Cps1/H EMMA sperm C57BL/6N-Cps1/H mutant strain MGI:6144263 Cps1 endonuclease mediated mutation 1, Harwell MGI:891996 Cps1 carbamoyl-phosphate synthetase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10778 - EM:08849 C57BL/6NTac-Cpne6/WtsiH EMMA sperm mutant strain MGI:5632472 Cpne6 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1334445 Cpne6 copine VI https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8849 - EM:08861 C57BL/6NTac-Cpne6/WtsiH EMMA sperm mutant strain MGI:5632473 Cpne6 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1334445 Cpne6 copine VI https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8861 - EM:04002 C57BL/6NTac-Cpeb4/Cnrm EMMA sperm mutant strain MGI:4434181 Cpeb4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914829 Cpeb4 cytoplasmic polyadenylation element binding protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4002 + EM:05349 C57BL/6NTac-Cpa2/Ieg EMMA embryo mutant strain MGI:4436075 Cpa2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3617840 Cpa2 carboxypeptidase A2, pancreatic https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5349 + EM:12312 C57BL/6NTac-Corin/Ics EMMA sperm mutant strain Corin EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1349451 Corin corin, serine peptidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12312 + EM:09952 C57BL/6NTac-Coq6/IcsOrl EMMA sperm mutant strain MGI:4435820 Coq6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924408 Coq6 coenzyme Q6 monooxygenase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9952 + EM:07680 C57BL/6NTac-Cops4/IcsOrl EMMA sperm mutant strain MGI:4435445 Cops4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1349414 Cops4 COP9 signalosome subunit 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7680 + EM:06775 C57BL/6NTac-Copg1/WtsiH EMMA sperm EPD0102_1_D08, MCGY mutant strain MGI:4432009 Copg1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858696 Copg1 coatomer protein complex, subunit gamma 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6775 + EM:09482 C57BL/6NTac-Commd9/H EMMA sperm mutant strain MGI:4365175 Commd9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923751 Commd9 COMM domain containing 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9482 + EM:07703 C57BL/6NTac-Col5a1/IcsOrl EMMA archived mutant strain MGI:4435753 Col5a1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88457 Col5a1 collagen, type V, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7703 - EM:04732 C57BL/6NTac-Col4a5/Cnrm EMMA embryo mutant strain MGI:4432414 Col4a5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88456 Col4a5 collagen, type IV, alpha 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4732 - EM:04732 C57BL/6NTac-Col4a5/Cnrm EMMA sperm mutant strain MGI:4432414 Col4a5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88456 Col4a5 collagen, type IV, alpha 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4732 + EM:12376 C57BL/6NTac-Col4a4/H EMMA sperm mutant strain MGI:6153784 Col4a4 endonuclease-mediated mutation 1, Harwell MGI:104687 Col4a4 collagen, type IV, alpha 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12376 + EM:08609 C57BL/6NTac-Col24a1/WtsiH EMMA sperm mutant strain MGI:4433574 Col24a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918605 Col24a1 collagen, type XXIV, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8609 + EM:11402 C57BL/6NTac-Cntnap2/H EMMA live mutant strain MGI:6149219 Cntnap2 endonuclease mediated mutation 2, Harwell MGI:1914047 Cntnap2 contactin associated protein-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11402 + EM:11408 C57BL/6NTac-Cntnap2/H EMMA sperm mutant strain MGI:6153781 Cntnap2 endonuclease-mediated mutation 1, Harwell MGI:1914047 Cntnap2 contactin associated protein-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11408 + EM:09950 C57BL/6NTac-Cntnap1/IcsOrl EMMA sperm mutant strain MGI:4431603 Cntnap1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858201 Cntnap1 contactin associated protein-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9950 + EM:10965 C57BL/6NTac-Cnp/H EMMA sperm C57BL/6NTac-Cnptm1a(EUCOMM)Wtsi/H mutant strain MGI:4433004 Cnp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88437 Cnp 2',3'-cyclic nucleotide 3' phosphodiesterase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10965 - EM:09548 C57BL/6NTac-Cnp/WtsiIeg EMMA sperm mutant strain MGI:5632471 Cnp targeted mutation 1, Wellcome Trust Sanger Institute MGI:88437 Cnp 2',3'-cyclic nucleotide 3' phosphodiesterase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9548 + EM:05872 C57BL/6NTac-Cnot9/WtsiH EMMA sperm EPD0156_3_A07, MCWG, C57BL/6NTac-Rqcd1/WtsiH mutant strain MGI:4431867 Cnot9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928902 Cnot9 CCR4-NOT transcription complex, subunit 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5872 ? EM:14024 C57BL/6NTac-Cnot6/WtsiPh EMMA sperm mutant strain MGI:4451305 Cnot6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144529 Cnot6 CCR4-NOT transcription complex, subunit 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14024 - EM:09762 C57BL/6NTac-Cmtm5/WtsiH EMMA sperm mutant strain MGI:5632412 Cmtm5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2447164 Cmtm5 CKLF-like MARVEL transmembrane domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9762 + EM:07704 C57BL/6NTac-Clk1/IcsOrl EMMA archived mutant strain MGI:4432186 Clk1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107403 Clk1 CDC-like kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7704 - EM:08965 C57BL/6NTac-Cldn7/Cnrm EMMA sperm mutant strain MGI:5632404 Cldn7 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1859285 Cldn7 claudin 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8965 + EM:12433 C57BL/6NTac-Cldn3/H EMMA sperm mutant strain MGI:6153848 Cldn3 endonuclease-mediated mutation 1, Harwell MGI:1329044 Cldn3 claudin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12433 + EM:04395 C57BL/6NTac-Cisd2/H EMMA sperm mutant strain MGI:4434148 Cisd2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914256 Cisd2 CDGSH iron sulfur domain 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4395 + EM:04395 C57BL/6NTac-Cisd2/H EMMA live mutant strain MGI:4434148 Cisd2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914256 Cisd2 CDGSH iron sulfur domain 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4395 + EM:11497 C57BL/6NTac-Cir1/WtsiIeg EMMA sperm mutant strain MGI:5577261 Cir1 targeted mutation 3a, Wellcome Trust Sanger Institute MGI:1914185 Cir1 corepressor interacting with RBPJ, 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11497 - EM:04019 C57BL/6NTac-Cidec/Cnrm EMMA sperm mutant strain MGI:4433521 Cidec targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95585 Cidec cell death-inducing DFFA-like effector c https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4019 + EM:12307 C57BL/6NTac-Cidec/Ics EMMA sperm mutant strain Cidec EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:95585 Cidec cell death-inducing DFFA-like effector c https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12307 + EM:12362 C57BL/6NTac-Cib3/H EMMA sperm mutant strain MGI:6153778 Cib3 endonuclease-mediated mutation 1, Harwell MGI:2685953 Cib3 calcium and integrin binding family member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12362 ? EM:13187 C57BL/6NTac-Churc1/WtsiFlmg EMMA sperm mutant strain MGI:4441753 Churc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923684 Churc1 churchill domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13187 + EM:12471 C57BL/6NTac-Chrna5/H EMMA sperm mutant strain MGI:6153777 Chrna5 endonuclease-mediated mutation 1, Harwell MGI:87889 Chrna5 cholinergic receptor, nicotinic, alpha polypeptide 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12471 + EM:07658 C57BL/6NTac-Chrna1/IcsOrl EMMA sperm mutant strain MGI:4435231 Chrna1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:87885 Chrna1 cholinergic receptor, nicotinic, alpha polypeptide 1 (muscle) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7658 + EM:11314 C57BL/6NTac-Chrdl1/H EMMA live mutant strain MGI:5749866 Chrdl1 endonuclease-mediated mutation 2, Harwell MGI:1933172 Chrdl1 chordin-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11314 + EM:10757 C57BL/6NTac-Chrdl1/H EMMA sperm Chrdl1-DEL694-EM1-B6N mutant strain MGI:5749864 Chrdl1 endonuclease-mediated mutation 1, Harwell MGI:1933172 Chrdl1 chordin-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10757 + EM:10200 C57BL/6NTac-Chpf/Ieg EMMA sperm mutant strain MGI:4460343 Chpf targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:106576 Chpf chondroitin polymerizing factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10200 + EM:10840 C57BL/6NTac-Chodl/H EMMA sperm mutant strain MGI:6149218 Chodl endonuclease mediated mutation 2, Harwell MGI:2179069 Chodl chondrolectin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10840 + EM:10769 C57BL/6NTac-Chodl/H EMMA sperm H-CHODL-DEL576-EM1-B6N (IMPC), CHODL-DEL576-EM1-B6N, C57BL/6N-Chodl/H mutant strain MGI:5755153 Chodl endonuclease-mediated mutation 1, Harwell MGI:2179069 Chodl chondrolectin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10769 + EM:07874 C57BL/6NTac-Chmp4c/H EMMA sperm EPD0113_1_B10 mutant strain MGI:4431890 Chmp4c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913621 Chmp4c charged multivesicular body protein 4C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7874 + EM:10088 C57BL/6NTac-Chgb/WtsiIeg EMMA sperm mutant strain MGI:5632403 Chgb targeted mutation 1, Wellcome Trust Sanger Institute MGI:88395 Chgb chromogranin B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10088 - EM:09574 C57BL/6NTac-Chga/Cnrm EMMA sperm mutant strain MGI:5632402 Chga targeted mutation 1, Wellcome Trust Sanger Institute MGI:88394 Chga chromogranin A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9574 + EM:07632 C57BL/6NTac-Cgas/IcsOrl EMMA sperm C57BL/6NTac-Mb21d1/IcsOrl mutant strain MGI:4435548 Cgas targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2442261 Cgas cyclic GMP-AMP synthase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7632 + EM:10082 C57BL/6NTac-Cga/WtsiIeg EMMA sperm mutant strain MGI:5632399 Cga targeted mutation 1, Wellcome Trust Sanger Institute MGI:88390 Cga glycoprotein hormones, alpha subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10082 + EM:11291 C57BL/6NTac-Cfap410/WtsiOrl EMMA sperm C57BL/6NTac-1810043G02Rik/WtsiOrl mutant strain MGI:4432613 Cfap410 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915134 Cfap410 cilia and flagella associated protein 410 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11291 + EM:05669 C57BL/6NTac-Cfap36/WtsiH EMMA sperm EPD0059_1_A09, MBUU, C57BL/6NTac-Ccdc104/WtsiH mutant strain MGI:4433419 Cfap36 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913994 Cfap36 cilia and flagella associated protein 36 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5669 - EM:09562 C57BL/6NTac-Cfap126/WtsiIeg EMMA sperm mutant strain MGI:5632398 Cfap126 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1922722 Cfap126 cilia and flagella associated protein 126 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9562 + EM:05888 C57BL/6NTac-Cep41/WtsiIeg EMMA sperm mutant strain MGI:4432442 Cep41 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891414 Cep41 centrosomal protein 41 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5888 + EM:12526 C57BL/6NTac-Cep290/H EMMA sperm unclassified MGI:6450518 Cep290 endonuclease-mediated mutation 1, Harwell MGI:2384917 Cep290 centrosomal protein 290 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12526 + EM:08128 C57BL/6NTac-Cenph/Ieg EMMA embryo mutant strain MGI:4436053 Cenph targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1349448 Cenph centromere protein H https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8128 - EM:09456 C57BL/6NTac-Ceacam1/Cnrm EMMA sperm mutant strain MGI:5632397 Ceacam1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1347245 Ceacam1 CEA cell adhesion molecule 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9456 - EM:08846 C57BL/6NTac-Cdx2/WtsiH EMMA sperm mutant strain MGI:5632396 Cdx2 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:88361 Cdx2 caudal type homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8846 + EM:09369 C57BL/6NTac-Cdsn/Ieg EMMA embryo mutant strain MGI:4436163 Cdsn targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3505689 Cdsn corneodesmosin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9369 ? EM:14114 C57BL/6NTac-Cdkn2aipnl/WtsiOrl EMMA sperm mutant strain MGI:4362329 Cdkn2aipnl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1261797 Cdkn2aipnl CDKN2A interacting protein N-terminal like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14114 + EM:08637 C57BL/6NTac-Cdk5rap3/Ieg EMMA sperm mutant strain MGI:4435510 Cdk5rap3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1933126 Cdk5rap3 CDK5 regulatory subunit associated protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8637 - EM:09322 C57BL/6NTac-Cdh2/Cnrm EMMA sperm mutant strain MGI:5632395 Cdh2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:88355 Cdh2 cadherin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9322 + EM:10890 C57BL/6NTac-Cdh23/H EMMA sperm mutant strain MGI:5749861 Cdh23 endonuclease-mediated revertant 3, Harwell MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10890 + EM:14656 C57BL/6NTac-Cdh23 Ush2a/H EMMA sperm unclassified MGI:5749861 Cdh23 endonuclease-mediated revertant 3, Harwell MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14656 + EM:14656 C57BL/6NTac-Cdh23 Ush2a/H EMMA sperm unclassified MGI:6791292 Ush2a endonuclease-mediated mutation 1, Harwell MGI:1341292 Ush2a usherin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14656 + EM:14636 C57BL/6NTac-Cdh23 Nefh/H EMMA sperm unclassified MGI:5749861 Cdh23 endonuclease-mediated revertant 3, Harwell MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14636 + EM:14636 C57BL/6NTac-Cdh23 Nefh/H EMMA sperm unclassified MGI:6717160 Nefh endonuclease-mediated mutation 3, Harwell MGI:97309 Nefh neurofilament, heavy polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14636 + EM:14635 C57BL/6NTac-Cdh23 Nefh/H EMMA sperm unclassified MGI:6717159 Nefh endonuclease-mediated mutation 2, Harwell MGI:97309 Nefh neurofilament, heavy polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14635 + EM:14635 C57BL/6NTac-Cdh23 Nefh/H EMMA sperm unclassified MGI:5749861 Cdh23 endonuclease-mediated revertant 3, Harwell MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14635 + EM:14634 C57BL/6NTac-Cdh23 Nefh/H EMMA sperm unclassified MGI:6717158 Nefh endonuclease-mediated mutation 1, Harwell MGI:97309 Nefh neurofilament, heavy polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14634 + EM:14634 C57BL/6NTac-Cdh23 Nefh/H EMMA sperm unclassified MGI:5749861 Cdh23 endonuclease-mediated revertant 3, Harwell MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14634 - EM:09758 C57BL/6NTac-Cdh16/WtsiH EMMA sperm mutant strain MGI:5632394 Cdh16 targeted mutation 1, Wellcome Trust Sanger Institute MGI:106671 Cdh16 cadherin 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9758 + EM:10529 C57BL/6NTac-Cdh13/Ics EMMA live mutant strain MGI:4436162 Cdh13 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99551 Cdh13 cadherin 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10529 + EM:12055 C57BL/6NTac-Cdca8/Wtsi EMMA embryo mutant strain MGI:4362476 Cdca8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1196274 Cdca8 cell division cycle associated 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12055 + EM:06210 C57BL/6NTac-Cdc26/Ics EMMA embryo mutant strain MGI:4436708 Cdc26 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913690 Cdc26 cell division cycle 26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6210 - EM:08851 C57BL/6NTac-Cd63/WtsiH EMMA sperm mutant strain MGI:5632393 Cd63 targeted mutation 1, Wellcome Trust Sanger Institute MGI:99529 Cd63 CD63 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8851 - EM:09153 C57BL/6NTac-Cd4/Cnrm EMMA sperm mutant strain MGI:5632392 Cd4 targeted mutation 2, Wellcome Trust Sanger Institute MGI:88335 Cd4 CD4 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9153 + EM:12295 C57BL/6NTac-Cd3e/Ics EMMA sperm mutant strain Cd3e EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:88332 Cd3e CD3 antigen, epsilon polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12295 + EM:12314 C57BL/6NTac-Cd34/Ics EMMA sperm mutant strain Cd34 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:88329 Cd34 CD34 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12314 + EM:04396 C57BL/6NTac-Ccnyl1/H EMMA sperm EPD0177_5_F06 mutant strain MGI:4432945 Ccnyl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2138614 Ccnyl1 cyclin Y-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4396 - EM:08961 C57BL/6NTac-Ccl25/Cnrm EMMA sperm mutant strain MGI:5632391 Ccl25 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1099448 Ccl25 chemokine (C-C motif) ligand 25 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8961 + EM:12437 C57BL/6NTac-Cckbr/H EMMA sperm mutant strain MGI:6157678 Cckbr endonuclease-mediated mutation 1, Harwell MGI:99479 Cckbr cholecystokinin B receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12437 + EM:05967 C57BL/6NTac-Ccdc77/WtsiBiat EMMA sperm mutant strain MGI:4432801 Ccdc77 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914450 Ccdc77 coiled-coil domain containing 77 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5967 + EM:09578 C57BL/6NTac-Ccdc69/WtsiPh EMMA sperm mutant strain MGI:4364083 Ccdc69 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1196234 Ccdc69 coiled-coil domain containing 69 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9578 + EM:05869 C57BL/6NTac-Ccdc106/WtsiH EMMA sperm MDDT, EPD0177_4_C08 mutant strain MGI:4433912 Ccdc106 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385900 Ccdc106 coiled-coil domain containing 106 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5869 - EM:08047 C57BL/6NTac-Catip/WtsiBiat EMMA sperm mutant strain MGI:4362227 Catip targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685062 Catip ciliogenesis associated TTC17 interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8047 + EM:09985 C57BL/6NTac-Casq1/IcsOrl EMMA sperm mutant strain MGI:4431740 Casq1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1309468 Casq1 calsequestrin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9985 + EM:05347 C57BL/6NTac-Car4/Ieg EMMA embryo mutant strain MGI:4433993 Car4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1096574 Car4 carbonic anhydrase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5347 + EM:05381 C57BL/6NTac-Caprin2/WtsiCnbc EMMA embryo mutant strain MGI:4434168 Caprin2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2448541 Caprin2 caprin family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5381 + EM:05381 C57BL/6NTac-Caprin2/WtsiCnbc EMMA sperm mutant strain MGI:4434168 Caprin2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2448541 Caprin2 caprin family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5381 ? EM:13987 C57BL/6NTac-Capn8/WtsiIeg EMMA sperm mutant strain MGI:5632390 Capn8 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2181366 Capn8 calpain 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13987 + EM:04707 C57BL/6NTac-Capn5/H EMMA sperm HEPD0525_1_C12 mutant strain MGI:4436604 Capn5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1100859 Capn5 calpain 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4707 + EM:05552 C57BL/6NTac-Cap2/Ieg EMMA embryo mutant strain MGI:4431970 Cap2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914502 Cap2 CAP, adenylate cyclase-associated protein, 2 (yeast) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5552 + EM:06091 C57BL/6NTac-Cand2/WtsiCnbc EMMA sperm mutant strain MGI:4432020 Cand2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914338 Cand2 cullin-associated and neddylation-dissociated 2 (putative) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6091 + EM:07656 C57BL/6NTac-Cacnb4/IcsOrl EMMA sperm mutant strain MGI:4435787 Cacnb4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103301 Cacnb4 calcium channel, voltage-dependent, beta 4 subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7656 + EM:10874 C57BL/6NTac-C4b/H EMMA sperm mutant strain MGI:6144264 C4b endonuclease mediated mutation 1, Harwell MGI:88228 C4b complement component 4B (Chido blood group) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10874 + EM:11313 C57BL/6NTac-C2cd4a/H EMMA sperm mutant strain MGI:6144266 C2cd4a endonuclease mediated mutation 2, Harwell MGI:3645763 C2cd4a C2 calcium-dependent domain containing 4A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11313 + EM:10777 C57BL/6NTac-C2cd4a/H EMMA sperm C57BL/6N-C2cd4a/H mutant strain MGI:6144265 C2cd4a endonuclease mediated mutation 1, Harwell MGI:3645763 C2cd4a C2 calcium-dependent domain containing 4A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10777 + EM:06295 C57BL/6NTac-C1rl/H EMMA sperm mutant strain MGI:4435790 C1rl targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2660692 C1rl complement component 1, r subcomponent-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6295 + EM:07819 C57BL/6NTac-C1qbp/IcsOrl EMMA sperm mutant strain MGI:4432129 C1qbp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1194505 C1qbp complement component 1, q subcomponent binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7819 + EM:12364 C57BL/6NTac-Bud23/H EMMA sperm mutant strain MGI:6153866 Bud23 endonuclease-mediated mutation 2, Harwell MGI:1913388 Bud23 BUD23, rRNA methyltransferase and ribosome maturation factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12364 + EM:11730 C57BL/6NTac-Bud23/H EMMA live mutant strain MGI:6149189 Bud23 endonuclease mediated mutation 1, Harwell MGI:1913388 Bud23 BUD23, rRNA methyltransferase and ribosome maturation factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11730 ? EM:13217 C57BL/6NTac-Btk/IcsOrl EMMA sperm mutant strain MGI:6155006 Btk targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:88216 Btk Bruton agammaglobulinemia tyrosine kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13217 + EM:07682 C57BL/6NTac-Btk/IcsOrl EMMA sperm mutant strain MGI:4434935 Btk targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88216 Btk Bruton agammaglobulinemia tyrosine kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7682 + EM:07629 C57BL/6NTac-Bspry/IcsOrl EMMA archived mutant strain MGI:4432968 Bspry targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2177191 Bspry B-box and SPRY domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7629 + EM:11506 C57BL/6NTac-Bscl2/H EMMA sperm mutant strain MGI:6153776 Bscl2 endonuclease-mediated mutation 1, Harwell MGI:1298392 Bscl2 Berardinelli-Seip congenital lipodystrophy 2 (seipin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11506 + EM:11506 C57BL/6NTac-Bscl2/H EMMA live mutant strain MGI:6153776 Bscl2 endonuclease-mediated mutation 1, Harwell MGI:1298392 Bscl2 Berardinelli-Seip congenital lipodystrophy 2 (seipin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11506 + EM:10179 C57BL/6NTac-Bphl/IcsOrl EMMA sperm mutant strain MGI:4436026 Bphl targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915271 Bphl biphenyl hydrolase-like (serine hydrolase, breast epithelial mucin-associated antigen) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10179 + EM:10701 C57BL/6NTac-Bpgm/WtsiIeg EMMA sperm mutant strain MGI:4363424 Bpgm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098242 Bpgm 2,3-bisphosphoglycerate mutase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10701 + EM:06075 C57BL/6NTac-Boc/H EMMA sperm mutant strain MGI:4364249 Boc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2151153 Boc biregional cell adhesion molecule-related/down-regulated by oncogenes (Cdon) binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6075 + EM:07672 C57BL/6NTac-Bmx/IcsOrl EMMA sperm mutant strain MGI:4433142 Bmx targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1101778 Bmx BMX non-receptor tyrosine kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7672 + EM:04863 C57BL/6NTac-Bmp7/H EMMA sperm mutant strain MGI:4436150 Bmp7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103302 Bmp7 bone morphogenetic protein 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4863 + EM:08484 C57BL/6NTac-Bivm/WtsiFlmg EMMA sperm mutant strain MGI:5296109 Bivm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2179809 Bivm basic, immunoglobulin-like variable motif containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8484 + EM:09819 C57BL/6NTac-Bhlhe40/WtsiPh EMMA sperm mutant strain MGI:4362482 Bhlhe40 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1097714 Bhlhe40 basic helix-loop-helix family, member e40 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9819 + EM:05360 C57BL/6NTac-Becn1/Cnrm EMMA embryo mutant strain MGI:4362198 Becn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891828 Becn1 beclin 1, autophagy related https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5360 - EM:10772 C57BL/6NTac-Bdkrb1/H EMMA sperm B6N;B6NTac-Bdkrb1/H, C57BL/6N;C57BL/6NTac-Bdkrb1/H mutant strain MGI:6140144 Bdkrb1 endonuclease mediated mutation 1, Harwell MGI:88144 Bdkrb1 bradykinin receptor, beta 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10772 + EM:05866 C57BL/6NTac-Bdh2/WtsiH EMMA sperm EPD0143_2_E05 mutant strain MGI:4433163 Bdh2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917022 Bdh2 3-hydroxybutyrate dehydrogenase, type 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5866 + EM:09272 C57BL/6NTac-Bccip/Ieg EMMA embryo mutant strain MGI:4435867 Bccip targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913415 Bccip BRCA2 and CDKN1A interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9272 + EM:09272 C57BL/6NTac-Bccip/Ieg EMMA sperm mutant strain MGI:4435867 Bccip targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913415 Bccip BRCA2 and CDKN1A interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9272 + EM:14614 C57BL/6NTac-Bcap31/H EMMA sperm unclassified MGI:6717133 Bcap31 endonuclease-mediated mutation 2, Harwell MGI:1350933 Bcap31 B cell receptor associated protein 31 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14614 + EM:14613 C57BL/6NTac-Bcap31/H EMMA sperm unclassified MGI:6717131 Bcap31 endonuclease-mediated mutation 1, Harwell MGI:1350933 Bcap31 B cell receptor associated protein 31 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14613 + EM:06028 C57BL/6NTac-Bbs5/H EMMA sperm EPD0227_3_C06 mutant strain MGI:4433255 Bbs5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919819 Bbs5 Bardet-Biedl syndrome 5 (human) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6028 ? EM:11884 C57BL/6NTac-Batf3/WtsiH EMMA sperm mutant strain Batf3 KOMP targeted mutation 1, Wellcome Trust Sanger Institute MGI:1925491 Batf3 basic leucine zipper transcription factor, ATF-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11884 - EM:08856 C57BL/6NTac-Barhl1/WtsiH EMMA sperm mutant strain MGI:5632389 Barhl1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1859288 Barhl1 BarH like homeobox 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8856 + EM:08891 C57BL/6NTac-Bap1/WtsiIeg EMMA sperm mutant strain MGI:4436674 Bap1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1206586 Bap1 Brca1 associated protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8891 + EM:07678 C57BL/6NTac-Baiap2l2/IcsOrl EMMA archived mutant strain MGI:4435406 Baiap2l2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2652819 Baiap2l2 BAI1-associated protein 2-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7678 + EM:07720 C57BL/6NTac-B9d1/IcsOrl EMMA archived mutant strain MGI:4432284 B9d1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1351471 B9d1 B9 protein domain 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7720 + EM:07727 C57BL/6NTac-B4galnt3/IcsOrl EMMA sperm mutant strain MGI:4434237 B4galnt3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3041155 B4galnt3 beta-1,4-N-acetyl-galactosaminyl transferase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7727 + EM:08898 C57BL/6NTac-Atxn3/WtsiPh EMMA sperm mutant strain MGI:4363482 Atxn3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1099442 Atxn3 ataxin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8898 ? EM:14929 C57BL/6NTac-Atpif1/Orl EMMA sperm mutant strain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14929 + EM:05233 C57BL/6NTac-Atpif1/WtsiCnbc EMMA embryo mutant strain MGI:4433166 Atpif1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1196457 Atpif1 ATPase inhibitory factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5233 + EM:10675 C57BL/6NTac-Atp9a/Ieg EMMA sperm mutant strain MGI:4460384 Atp9a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1330826 Atp9a ATPase, class II, type 9A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10675 + EM:12296 C57BL/6NTac-Atp6v1g2/Ics EMMA sperm mutant strain Atp6v1g2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1913487 Atp6v1g2 ATPase, H+ transporting, lysosomal V1 subunit G2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12296 + EM:07641 C57BL/6NTac-Atp6v1d/IcsOrl EMMA archived mutant strain MGI:4434885 Atp6v1d targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921084 Atp6v1d ATPase, H+ transporting, lysosomal V1 subunit D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7641 + EM:10054 C57BL/6NTac-Atp4b/WtsiIeg EMMA sperm mutant strain MGI:5632388 Atp4b targeted mutation 2, Wellcome Trust Sanger Institute MGI:88114 Atp4b ATPase, H+/K+ exchanging, beta polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10054 + EM:09026 C57BL/6NTac-Atp1a3/H EMMA sperm mutant strain MGI:5438364 Atp1a3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88107 Atp1a3 ATPase, Na+/K+ transporting, alpha 3 polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9026 + EM:13034 C57BL/6NTac-Atp1a3/H EMMA sperm unclassified MGI:6450024 Atp1a3 endonuclease-mediated mutation 3, Harwell MGI:88107 Atp1a3 ATPase, Na+/K+ transporting, alpha 3 polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13034 + EM:13025 C57BL/6NTac-Atp1a3/H EMMA sperm unclassified MGI:6450018 Atp1a3 endonuclease-mediated mutation 1, Harwell MGI:88107 Atp1a3 ATPase, Na+/K+ transporting, alpha 3 polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13025 - EM:09703 C57BL/6NTac-Atp11a/WtsiIeg EMMA sperm mutant strain MGI:4363953 Atp11a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354735 Atp11a ATPase, class VI, type 11A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9703 - EM:04961 C57BL/6NTac-Atg3/Cnrm EMMA sperm mutant strain MGI:4436012 Atg3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915091 Atg3 autophagy related 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4961 + EM:05376 C57BL/6NTac-Atg16l1/WtsiCnbc EMMA embryo mutant strain MGI:4432181 Atg16l1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924290 Atg16l1 autophagy related 16-like 1 (S. cerevisiae) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5376 + EM:05376 C57BL/6NTac-Atg16l1/WtsiCnbc EMMA sperm mutant strain MGI:4432181 Atg16l1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924290 Atg16l1 autophagy related 16-like 1 (S. cerevisiae) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5376 + EM:10711 C57BL/6NTac-Atf4/WtsiIeg EMMA sperm mutant strain MGI:5659996 Atf4 targeted mutation 1, Wellcome Trust Sanger Institute MGI:88096 Atf4 activating transcription factor 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10711 + EM:09817 C57BL/6NTac-Atad3a/WtsiPh EMMA sperm mutant strain MGI:4364878 Atad3a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919214 Atad3a ATPase family, AAA domain containing 3A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9817 - EM:03996 C57BL/6NTac-Asxl1/Cnrm EMMA embryo mutant strain MGI:6272013 Asxl1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2684063 Asxl1 ASXL transcriptional regulator 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3996 - EM:03996 C57BL/6NTac-Asxl1/Cnrm EMMA sperm mutant strain MGI:6272013 Asxl1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2684063 Asxl1 ASXL transcriptional regulator 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=3996 ? EM:09271 C57BL/6NTac-Aspa/Ieg EMMA sperm mutant strain MGI:4434258 Aspa targeted mutation 1a, Wellcome Trust Sanger Institute MGI:87914 Aspa aspartoacylase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9271 + EM:07647 C57BL/6NTac-Ascc3/IcsOrl EMMA archived mutant strain MGI:4436301 Ascc3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1925237 Ascc3 activating signal cointegrator 1 complex subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7647 - EM:04548 C57BL/6NTac-Arvcf/Ieg EMMA sperm mutant strain MGI:4432634 Arvcf targeted mutation 1e, Wellcome Trust Sanger Institute MGI:109620 Arvcf armadillo repeat gene deleted in velocardiofacial syndrome https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4548 + EM:09472 C57BL/6NTac-Art4/WtsiH EMMA sperm mutant strain MGI:4363180 Art4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202710 Art4 ADP-ribosyltransferase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9472 + EM:07635 C57BL/6NTac-Armt1/IcsOrl EMMA archived C57BL/6NTac-1700052N19Rik/IcsOrl mutant strain MGI:4433265 Armt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920669 Armt1 acidic residue methyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7635 + EM:10792 C57BL/6NTac-Armh4/H EMMA archived 3632451O06RIK-DEL1869-EM2-B6N, C57BL/6NTac-3632451O06Rik/H, C57BL/6NTac-3632451O06Rik/H mutant strain MGI:5749843 Armh4 endonuclease-mediated mutation 2, Harwell MGI:1914669 Armh4 armadillo-like helical domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10792 + EM:10762 C57BL/6NTac-Armh4/H EMMA archived C57BL/6NTac-3632451O06Rik/H, 3632451O06RIK-DEL1851-EM1-B6N, C57BL/6N-3632451O06Rik/H mutant strain MGI:5749842 Armh4 endonuclease-mediated mutation 1, Harwell MGI:1914669 Armh4 armadillo-like helical domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10762 + EM:10785 C57BL/6NTac-Arl15/H EMMA live C57BL/6N-Arl15/H mutant strain MGI:6149188 Arl15 endonuclease mediated mutation 1, Harwell MGI:2442308 Arl15 ADP-ribosylation factor-like 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10785 + EM:11521 C57BL/6NTac-Arhgef9/H EMMA sperm C57BL/6NTac-Arhgef/H mutant strain MGI:6153845 Arhgef9 endonuclease mediated mutation 1, Harwell MGI:2442233 Arhgef9 CDC42 guanine nucleotide exchange factor (GEF) 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11521 + EM:11521 C57BL/6NTac-Arhgef9/H EMMA live C57BL/6NTac-Arhgef/H mutant strain MGI:6153845 Arhgef9 endonuclease mediated mutation 1, Harwell MGI:2442233 Arhgef9 CDC42 guanine nucleotide exchange factor (GEF) 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11521 + EM:12046 C57BL/6NTac-Arhgef4/Wtsi EMMA embryo mutant strain MGI:4364388 Arhgef4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442507 Arhgef4 Rho guanine nucleotide exchange factor (GEF) 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12046 + EM:09891 C57BL/6NTac-Arhgef1/WtsiPh EMMA sperm mutant strain MGI:4434048 Arhgef1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353510 Arhgef1 Rho guanine nucleotide exchange factor (GEF) 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9891 ? EM:13671 C57BL/6NTac-Arhgap25/WtsiOrl EMMA sperm mutant strain MGI:4362243 Arhgap25 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443687 Arhgap25 Rho GTPase activating protein 25 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13671 + EM:07808 C57BL/6NTac-Arhgap22/WtsiOrl EMMA sperm mutant strain MGI:4363166 Arhgap22 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443418 Arhgap22 Rho GTPase activating protein 22 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7808 + EM:07675 C57BL/6NTac-Arcn1/IcsOrl EMMA archived mutant strain MGI:4435514 Arcn1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2387591 Arcn1 archain 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7675 - EM:08972 C57BL/6NTac-Aqp3/Cnrm EMMA sperm mutant strain MGI:5632387 Aqp3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1333777 Aqp3 aquaporin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8972 + EM:09371 C57BL/6NTac-Aqp1/H EMMA sperm mutant strain MGI:4441703 Aqp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:103201 Aqp1 aquaporin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9371 + EM:14115 C57BL/6NTac-Apool/WtsiOulu EMMA embryo mutant strain MGI:4364721 Apool targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915367 Apool apolipoprotein O-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14115 + EM:14115 C57BL/6NTac-Apool/WtsiOulu EMMA sperm mutant strain MGI:4364721 Apool targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915367 Apool apolipoprotein O-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14115 + EM:07378 C57BL/6NTac-Apip/WtsiH EMMA sperm mutant strain MGI:4441695 Apip targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926788 Apip APAF1 interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7378 + EM:10756 C57BL/6NTac-Ap3m2/H EMMA live mutant strain MGI:6149217 Ap3m2 endonuclease mediated mutation 2, Harwell MGI:1929214 Ap3m2 adaptor-related protein complex 3, mu 2 subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10756 - EM:04711 C57BL/6NTac-Ap3m1/Cnrm EMMA embryo mutant strain MGI:4436527 Ap3m1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1929212 Ap3m1 adaptor-related protein complex 3, mu 1 subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4711 - EM:04711 C57BL/6NTac-Ap3m1/Cnrm EMMA sperm mutant strain MGI:4436527 Ap3m1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1929212 Ap3m1 adaptor-related protein complex 3, mu 1 subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4711 + EM:12105 C57BL/6NTac-Anp32e/Wtsi EMMA embryo mutant strain MGI:4451429 Anp32e targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1913721 Anp32e acidic (leucine-rich) nuclear phosphoprotein 32 family, member E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12105 + EM:08234 C57BL/6NTac-Anks6/WtsiPh EMMA sperm mutant strain MGI:4363754 Anks6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922941 Anks6 ankyrin repeat and sterile alpha motif domain containing 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8234 + EM:06843 C57BL/6NTac-Anapc4/WtsiCnrm EMMA sperm mutant strain MGI:4434153 Anapc4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098673 Anapc4 anaphase promoting complex subunit 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6843 + EM:05895 C57BL/6NTac-Amotl1/WtsiIeg EMMA sperm mutant strain MGI:4433551 Amotl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922973 Amotl1 angiomotin-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5895 + EM:12322 C57BL/6NTac-Amhr2/Ics EMMA sperm mutant strain Amhr2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:105062 Amhr2 anti-Mullerian hormone type 2 receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12322 + EM:07351 C57BL/6NTac-Alms1/H EMMA sperm mutant strain MGI:6324160 Alms1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1934606 Alms1 ALMS1, centrosome and basal body associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7351 + EM:09931 C57BL/6NTac-Alms1/H EMMA sperm mutant strain MGI:4434567 Alms1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1934606 Alms1 ALMS1, centrosome and basal body associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9931 + EM:12327 C57BL/6NTac-Aldoc/Ics EMMA sperm mutant strain Aldoc EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:101863 Aldoc aldolase C, fructose-bisphosphate https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12327 - EM:09506 C57BL/6NTac-Aldh8a1/Cnrm EMMA sperm mutant strain MGI:5632386 Aldh8a1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2653900 Aldh8a1 aldehyde dehydrogenase 8 family, member A1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9506 - EM:09117 C57BL/6NTac-Aldh3a2/Cnrm EMMA sperm mutant strain MGI:5632385 Aldh3a2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1353452 Aldh3a2 aldehyde dehydrogenase family 3, subfamily A2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9117 + EM:07734 C57BL/6NTac-Aldh3a2/IcsOrl EMMA sperm mutant strain MGI:4432633 Aldh3a2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353452 Aldh3a2 aldehyde dehydrogenase family 3, subfamily A2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7734 + EM:08719 C57BL/6NTac-Aldh1l1/Ieg EMMA sperm mutant strain MGI:4364886 Aldh1l1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1340024 Aldh1l1 aldehyde dehydrogenase 1 family, member L1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8719 + EM:12025 C57BL/6NTac-Aldh18a1/Wtsi EMMA embryo mutant strain MGI:4363671 Aldh18a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1888908 Aldh18a1 aldehyde dehydrogenase 18 family, member A1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12025 + EM:05864 C57BL/6NTac-Aldh16a1/WtsiH EMMA sperm EPD0091_2_D04, MBWA mutant strain MGI:4432547 Aldh16a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916998 Aldh16a1 aldehyde dehydrogenase 16 family, member A1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5864 + EM:09874 C57BL/6NTac-Alb/Cnrm EMMA sperm mutant strain MGI:5811675 Alb targeted mutation 2, Wellcome Trust Sanger Institute MGI:87991 Alb albumin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9874 + EM:07186 C57BL/6NTac-Akt1s1/WtsiH EMMA sperm MEVA, EPD0156_2_A06 mutant strain MGI:4431959 Akt1s1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914855 Akt1s1 AKT1 substrate 1 (proline-rich) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7186 + EM:12324 C57BL/6NTac-Akr1b7/Ics EMMA sperm mutant strain Akr1b7 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:101918 Akr1b7 aldo-keto reductase family 1, member B7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12324 - EM:09556 C57BL/6NTac-Aif1/WtsiIeg EMMA sperm mutant strain MGI:5632384 Aif1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1343098 Aif1 allograft inflammatory factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9556 - EM:09775 C57BL/6NTac-Afp/WtsiH EMMA sperm mutant strain MGI:5632383 Afp targeted mutation 1, Wellcome Trust Sanger Institute MGI:87951 Afp alpha fetoprotein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9775 + EM:05099 C57BL/6NTac-Afmid/H EMMA sperm EPD0155_6_A07 mutant strain MGI:4432070 Afmid targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2448704 Afmid arylformamidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5099 - EM:07631 C57BL/6NTac-Afm/IcsOrl EMMA sperm mutant strain MGI:4455621 Afm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2429409 Afm afamin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7631 + EM:05880 C57BL/6NTac-Aff3/WtsiIeg EMMA sperm mutant strain MGI:4434291 Aff3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106927 Aff3 AF4/FMR2 family, member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5880 + EM:11312 C57BL/6NTac-Adprhl1/H EMMA archived mutant strain MGI:6140150 Adprhl1 endonuclease mediated mutation 2, Harwell MGI:2442168 Adprhl1 ADP-ribosylhydrolase like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11312 + EM:10875 C57BL/6NTac-Adprhl1/H EMMA live mutant strain MGI:6140149 Adprhl1 endonuclease mediated mutation 1, Harwell MGI:2442168 Adprhl1 ADP-ribosylhydrolase like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10875 - EM:09507 C57BL/6NTac-Adora2a/Cnrm EMMA sperm mutant strain MGI:5632382 Adora2a targeted mutation 1, Wellcome Trust Sanger Institute MGI:99402 Adora2a adenosine A2a receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9507 + EM:12303 C57BL/6NTac-Adipoq/Ics EMMA sperm mutant strain Adipoq EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:106675 Adipoq adiponectin, C1Q and collagen domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12303 + EM:07190 C57BL/6NTac-Adgrd1/WtsiCnrm EMMA sperm C57BL/6NTac-Gpr133/WtsiCnrm mutant strain MGI:4432831 Adgrd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3041203 Adgrd1 adhesion G protein-coupled receptor D1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7190 + EM:09384 C57BL/6NTac-Adamtsl5/H EMMA sperm mutant strain MGI:5430118 Adamtsl5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913798 Adamtsl5 ADAMTS-like 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9384 + EM:10803 C57BL/6NTac-Adamts16/H EMMA sperm mutant strain MGI:6140145 Adamts16 endonuclease mediated mutation 2, Harwell MGI:2429637 Adamts16 a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10803 + EM:10776 C57BL/6NTac-Adamts16/H EMMA sperm C57BL/6N-Adamts16/H mutant strain MGI:6140148 Adamts16 endonuclease mediated mutation 1, Harwell MGI:2429637 Adamts16 a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10776 + EM:12297 C57BL/6NTac-Acsm4/Ics EMMA sperm mutant strain Acsm4 EUCOMM targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2681844 Acsm4 acyl-CoA synthetase medium-chain family member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12297 + EM:09875 C57BL/6NTac-Acox2/Cnrm EMMA sperm mutant strain MGI:5811647 Acox2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1934852 Acox2 acyl-Coenzyme A oxidase 2, branched chain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9875 + EM:08149 C57BL/6NTac-Acot5/WtsiCnrm EMMA sperm mutant strain MGI:4364061 Acot5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384969 Acot5 acyl-CoA thioesterase 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8149 + EM:07627 C57BL/6NTac-Acap3/IcsOrl EMMA archived mutant strain MGI:4436565 Acap3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2153589 Acap3 ArfGAP with coiled-coil, ankyrin repeat and PH domains 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7627 - EM:08959 C57BL/6NTac-Acan/Cnrm EMMA sperm mutant strain MGI:5632381 Acan targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:99602 Acan aggrecan https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8959 + EM:11311 C57BL/6NTac-Abcc5/H EMMA archived mutant strain MGI:5749846 Abcc5 endonuclease-mediated mutation 2, Harwell MGI:1351644 Abcc5 ATP-binding cassette, sub-family C (CFTR/MRP), member 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11311 + EM:10761 C57BL/6NTac-Abcc5/H EMMA sperm mutant strain MGI:5749845 Abcc5 endonuclease-mediated mutation 1, Harwell MGI:1351644 Abcc5 ATP-binding cassette, sub-family C (CFTR/MRP), member 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10761 + EM:05200 C57BL/6NTac-Abcb11/Ieg EMMA embryo mutant strain MGI:4434682 Abcb11 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1351619 Abcb11 ATP-binding cassette, sub-family B (MDR/TAP), member 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5200 - EM:09555 C57BL/6NTac-A4galt/WtsiIeg EMMA sperm mutant strain MGI:5632380 A4galt targeted mutation 1, Wellcome Trust Sanger Institute MGI:3512453 A4galt alpha 1,4-galactosyltransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9555 + EM:07653 C57BL/6NTac-4933430I17Rik/IcsOrl EMMA sperm mutant strain MGI:4432117 4933430I17Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3045314 4933430I17Rik RIKEN cDNA 4933430I17 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7653 + EM:05713 C57BL/6NTac-3110001I22Rik/WtsiBiat EMMA embryo mutant strain MGI:4434304 Bfar targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913848 Pphln1-ps1 periphilin 1, pseudogene 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5713 + EM:07724 C57BL/6NTac-2900026A02Rik/IcsOrl EMMA archived mutant strain MGI:4435426 2900026A02Rik targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920194 2900026A02Rik RIKEN cDNA 2900026A02 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7724 + EM:04559 C57BL/6NTac-2810408A11Rik/H EMMA sperm EPD0175_1_E10 mutant strain MGI:4431683 2810408A11Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917669 2810408A11Rik RIKEN cDNA 2810408A11 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4559 + EM:12136 C57BL/6NTac-2310057J18Rik/Wtsi EMMA embryo mutant strain MGI:4364593 2310057J18Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914969 2310057J18Rik RIKEN cDNA 2310057J18 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12136 + EM:08745 C57BL/6NTac-1700067K01Rik/WtsiOrl EMMA sperm mutant strain MGI:5289829 1700067K01Rik targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1920703 1700067K01Rik RIKEN cDNA 1700067K01 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8745 - EM:08478 C57BL/6NTac-1700001C02Rik/WtsiFlmg EMMA sperm C57BL/6NTac-Fam166c/WtsiFlmg mutant strain MGI:4432273 Fam166c targeted mutation 1a, Wellcome Trust Sanger Institute 1700001C02 1700001C02Rik https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8478 + EM:10873 C57BL/6NTac-1110017D15Rik/H EMMA sperm mutant strain MGI:5749859 1110017D15Rik endonuclease-mediated mutation 2, Harwell MGI:1920971 1110017D15Rik RIKEN cDNA 1110017D15 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10873 + EM:10768 C57BL/6NTac-1110017D15Rik/H EMMA live mutant strain MGI:5749856 1110017D15Rik endonuclease-mediated mutation 1, Harwell MGI:1920971 1110017D15Rik RIKEN cDNA 1110017D15 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10768 ? EM:13653 C57BL/6NJ-Acot12/Ieg EMMA sperm mutant strain MGI:6403702 Acot12 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1921406 Acot12 acyl-CoA thioesterase 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13653 ? EM:13696 C57BL/6NCrl-Zpbp2/Ieg EMMA sperm mutant strain Zpbp2 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1916626 Zpbp2 zona pellucida binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13696 ? EM:13451 C57BL/6NCrl-Zmym6/Ieg EMMA sperm mutant strain MGI:6157344 Zmym6 endonuclease mediated mutation 2, Helmholtz Zentrum Muenchen GmbH MGI:106505 Zmym6 zinc finger, MYM-type 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13451 ? EM:13509 C57BL/6NCrl-Zmat5/Ieg EMMA sperm mutant strain Zmat5 CRISPR/CAS9 targeted mutation , undef MGI:1914428 Zmat5 zinc finger, matrin type 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13509 + EM:12239 C57BL/6NCrl-Zfp644/Ph EMMA sperm mutant strain MGI:6341848 Zfp644 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1277212 Zfp644 zinc finger protein 644 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12239 + EM:11532 C57BL/6NCrl-Zfp61/Ieg EMMA sperm mutant strain MGI:6120826 Zfp61 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:99663 Zfp61 zinc finger protein 61 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11532 ? EM:13577 C57BL/6NCrl-Zfp280d/Ieg EMMA sperm mutant strain MGI:6382407 Zfp280d endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2384583 Zfp280d zinc finger protein 280D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13577 + EM:11531 C57BL/6NCrl-Zdhhc5/Ieg EMMA sperm C57BL/6N-Zdhhc5/Ieg mutant strain MGI:6317366 Zdhhc5 targeted mutation 1e.1, Helmholtz Zentrum Muenchen GmbH MGI:1923573 Zdhhc5 zinc finger, DHHC domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11531 ? EM:13496 C57BL/6NCrl-Zdhhc20/Ieg EMMA sperm mutant strain MGI:6277052 Zdhhc20 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1923215 Zdhhc20 zinc finger, DHHC domain containing 20 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13496 ? EM:13631 C57BL/6NCrl-Zcchc17/Ieg EMMA sperm mutant strain MGI:6435661 Zcchc17 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1919955 Zcchc17 zinc finger, CCHC domain containing 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13631 + EM:12543 C57BL/6NCrl-Zc3h12a/Ieg EMMA sperm mutant strain MGI:6220866 Zc3h12a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2385891 Zc3h12a zinc finger CCCH type containing 12A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12543 + EM:11787 C57BL/6NCrl-Wiz/Ph EMMA sperm mutant strain MGI:6316145 Wiz endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1332638 Wiz widely-interspaced zinc finger motifs https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11787 + EM:09053 C57BL/6NCrl-Wdsub1/Ph EMMA archived mutant strain MGI:5588281 Wdsub1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919387 Wdsub1 WD repeat, SAM and U-box domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9053 - EM:12414 C57BL/6NCrl-Wdr63/Ph EMMA live mutant strain Wdr63 CRISPR/CAS9 targeted mutation , undef MGI:3045269 Dnai3 dynein axonemal intermediate chain 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12414 + EM:11684 C57BL/6NCrl-Vgll4/Ieg EMMA sperm mutant strain MGI:6120802 Vgll4 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2652840 Vgll4 vestigial like family member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11684 ? EM:13479 C57BL/6NCrl-Vdac3/Ieg EMMA sperm mutant strain MGI:6273947 Vdac3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:106922 Vdac3 voltage-dependent anion channel 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13479 ? EM:13400 C57BL/6NCrl-Uggt2/Ieg EMMA sperm mutant strain MGI:6472606 Uggt2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913685 Uggt2 UDP-glucose glycoprotein glucosyltransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13400 + EM:11770 C57BL/6NCrl-Uchl4/Ph EMMA sperm C57BL/6NCrl-Uchl4/Ph mutant strain MGI:6152712 Uchl4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1890440 Uchl4 ubiquitin carboxyl-terminal esterase L4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11770 + EM:12280 C57BL/6NCrl-Ubl4b/Ph EMMA sperm mutant strain MGI:6341871 Ubl4b endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1914841 Ubl4b ubiquitin-like 4B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12280 ? EM:13473 C57BL/6NCrl-Ube3a/Ieg EMMA sperm mutant strain MGI:6273955 Ube3a endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:105098 Ube3a ubiquitin protein ligase E3A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13473 + EM:12283 C57BL/6NCrl-Ube2n/Ph EMMA live mutant strain MGI:6341889 Ube2n endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1934835 Ube2n ubiquitin-conjugating enzyme E2N https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12283 ? EM:12773 C57BL/6NCrl-Ube2e3/Ph EMMA sperm mutant strain MGI:6367969 Ube2e3 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:107412 Ube2e3 ubiquitin-conjugating enzyme E2E 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12773 + EM:11332 C57BL/6NCrl-Ubd/Ph EMMA sperm mutant strain MGI:6120710 Ubd targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1344410 Ubd ubiquitin D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11332 + EM:11614 C57BL/6NCrl-Ubd/Ph EMMA sperm mutant strain MGI:5810734 Ubd targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1344410 Ubd ubiquitin D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11614 + EM:12290 C57BL/6NCrl-Ubac2/Ieg EMMA sperm mutant strain Ubac2 EUCOMM targeted mutation 1e.1, Helmholtz Zentrum Muenchen GmbH MGI:1916139 Ubac2 ubiquitin associated domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12290 + EM:11687 C57BL/6NCrl-Tyk2/Ieg EMMA sperm mutant strain MGI:6120762 Tyk2 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1929470 Tyk2 tyrosine kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11687 ? EM:15102 C57BL/6NCrl-Tube1/Ieg EMMA sperm mutant strain Tube1 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1919174 Tube1 tubulin, epsilon 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=15102 ? EM:13724 C57BL/6NCrl-Ttll8/Ieg EMMA sperm mutant strain MGI:6441116 Ttll8 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1922902 Ttll8 tubulin tyrosine ligase-like family, member 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13724 + EM:11666 C57BL/6NCrl-Ttll12/Ieg EMMA sperm C57BL/6N-Ttll12/Ieg mutant strain MGI:6317367 Ttll12 targeted mutation 1e.1, Wellcome Trust Sanger Institute MGI:3039573 Ttll12 tubulin tyrosine ligase-like family, member 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11666 ? EM:13557 C57BL/6NCrl-Tspan8/Ieg EMMA sperm mutant strain MGI:6277054 Tspan8 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2384918 Tspan8 tetraspanin 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13557 ? EM:13635 C57BL/6NCrl-Tspan15/Ieg EMMA sperm mutant strain Tspan15 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1917673 Tspan15 tetraspanin 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13635 + EM:11303 C57BL/6NCrl-Trim9/Ph EMMA sperm mutant strain MGI:6147539 Trim9 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2137354 Trim9 tripartite motif-containing 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11303 + EM:09055 C57BL/6NCrl-Trim15/Ph EMMA archived mutant strain MGI:5588277 Trim15 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1916347 Trim15 tripartite motif-containing 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9055 + EM:11338 C57BL/6NCrl-Trabd2b/Ph EMMA sperm C57BL/6NCrl-Trabd2b/Ph mutant strain MGI:6152711 Trabd2b endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:3650152 Trabd2b TraB domain containing 2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11338 ? EM:15006 C57BL/6NCrl-Togaram2/Ieg EMMA sperm mutant strain Togaram2 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:2443498 Togaram2 TOG array regulator of axonemal microtubules 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=15006 ? EM:13515 C57BL/6NCrl-Tnks/Ieg EMMA sperm mutant strain MGI:6273966 Tnks endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1341087 Tnks tankyrase, TRF1-interacting ankyrin-related ADP-ribose polymerase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13515 + EM:11913 C57BL/6NCrl-Tmem62/Ph EMMA sperm mutant strain MGI:6341890 Tmem62 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2139461 Tmem62 transmembrane protein 62 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11913 + EM:11682 C57BL/6NCrl-Tmem60/Ph EMMA live C57BL/6NCrl-Tmem60/Ph mutant strain MGI:6152710 Tmem60 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2673965 Tmem60 transmembrane protein 60 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11682 + EM:11874 C57BL/6NCrl-Tmem47/Ph EMMA sperm mutant strain MGI:6341870 Tmem47 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2177570 Tmem47 transmembrane protein 47 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11874 + EM:11876 C57BL/6NCrl-Tmem273/Ph EMMA sperm mutant strain MGI:6341882 Tmem273 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1916319 Tmem273 transmembrane protein 273 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11876 + EM:12176 C57BL/6NCrl-Tmem240/Ph EMMA sperm mutant strain MGI:6341826 Tmem240 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3648074 Tmem240 transmembrane protein 240 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12176 + EM:11771 C57BL/6NCrl-Tmem150b/Ph EMMA sperm C57BL/6NCrl-Tmem150b/Ph mutant strain MGI:6152708 Tmem150b endonuclease mediated mutation 1, Institute of Molecular Genetics MGI:2679718 Tmem150b transmembrane protein 150B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11771 + EM:11772 C57BL/6NCrl-Tmem132b/Ph EMMA sperm C57BL/6NCrl-Tmem132b/Ph mutant strain MGI:6152707 Tmem132b endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3609245 Tmem132b transmembrane protein 132B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11772 ? EM:13467 C57BL/6NCrl-Tle1/Ieg EMMA sperm mutant strain MGI:6384610 Tle1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:104636 Tle1 transducin-like enhancer of split 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13467 ? EM:13488 C57BL/6NCrl-Timp2/Ieg EMMA sperm mutant strain MGI:6276911 Timp2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:98753 Timp2 tissue inhibitor of metalloproteinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13488 + EM:11538 C57BL/6NCrl-Thg1l/Ieg EMMA sperm mutant strain MGI:6120731 Thg1l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913878 Thg1l tRNA-histidine guanylyltransferase 1-like (S. cerevisiae) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11538 + EM:12476 C57BL/6NCrl-Tg(Vav1-STAT5B)731Biat/Biat EMMA sperm B6N-Tg(STAT5B)731Biat mutant strain MGI:6164041 Tg(Vav1-STAT5B)731Biat transgene insertion 731, Biomodels Austria MGI:6164040 Tg(Vav1-STAT5B)731Biat transgene insertion 731, Biomodels Austria https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12476 + EM:02120 C57BL/6NCrl-Tg(Bglap-Omd)1Kieg/Kieg EMMA embryo OSAD, C57BL/6NCrlOSAD mutant strain MGI:5516352 Tg(Bglap-Omd)1Kieg transgene insertion 1, Karolinska Institute Unit for Embryology and Genetics MGI:5516351 Tg(Bglap-Omd)1Kieg transgene insertion 1, Karolinska Institute Unit for Embryology and Genetics https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2120 + EM:11774 C57BL/6NCrl-Tent5a/Ph EMMA sperm C57BL/6NCrl-Fam46a/Ph mutant strain MGI:6152705 Tent5a endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2670964 Tent5a terminal nucleotidyltransferase 5A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11774 + EM:11700 C57BL/6NCrl-Tent4a/Ph EMMA sperm C57BL/6NCrl-Papd7/Ph mutant strain MGI:6120803 Tent4a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2682295 Tent4a terminal nucleotidyltransferase 4A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11700 ? EM:14738 C57BL/6NCrl-Ten1/Ieg EMMA sperm mutant strain MGI:6449028 Ten1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1916785 Ten1 TEN1 telomerase capping complex subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14738 ? EM:13619 C57BL/6NCrl-Tcp11x2/Ieg EMMA sperm mutant strain MGI:6449038 Tcp11x2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1919091 Tcp11x2 t-complex 11 family, X-linked 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13619 + EM:12192 C57BL/6NCrl-Tbl1xr1/Ieg EMMA sperm mutant strain MGI:6199116 Tbl1xr1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2441730 Tbl1xr1 transducin (beta)-like 1X-linked receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12192 + EM:11962 C57BL/6NCrl-Tasor/Ph EMMA sperm mutant strain MGI:6341945 Tasor endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1921694 Tasor transcription activation suppressor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11962 ? EM:13497 C57BL/6NCrl-Tanc2/Ieg EMMA sperm mutant strain MGI:6384591 Tanc2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2444121 Tanc2 tetratricopeptide repeat, ankyrin repeat and coiled-coil containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13497 ? EM:13581 C57BL/6NCrl-Sytl4/Ieg EMMA sperm mutant strain MGI:6451108 Sytl4 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1351606 Sytl4 synaptotagmin-like 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13581 + EM:11534 C57BL/6NCrl-Syncrip/Ieg EMMA sperm mutant strain MGI:6120727 Syncrip targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1891690 Syncrip synaptotagmin binding, cytoplasmic RNA interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11534 - EM:10366 C57BL/6NCrl-Syde1/Ieg EMMA sperm mutant strain MGI:5704518 Syde1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1918959 Syde1 synapse defective 1, Rho GTPase, homolog 1 (C. elegans) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10366 ? EM:13409 C57BL/6NCrl-Sycp2/Ieg EMMA sperm mutant strain MGI:6507385 Sycp2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1933281 Sycp2 synaptonemal complex protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13409 ? EM:13506 C57BL/6NCrl-Sult2a8/Ieg EMMA sperm mutant strain MGI:6314734 Sult2a8 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1924221 Sult2a8 sulfotransferase family 2A, dehydroepiandrosterone (DHEA)-preferring, member 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13506 ? EM:13104 C57BL/6NCrl-Sult1a1/Ph EMMA sperm mutant strain Sult1a1 CRISPR/CAS9 targeted mutation , undef MGI:102896 Sult1a1 sulfotransferase family 1A, phenol-preferring, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13104 + EM:11908 C57BL/6NCrl-Sulf1/Ieg EMMA sperm mutant strain MGI:6160170 Sulf1 targeted mutation 1b, Mouse Biology Program, UCDavis MGI:2138563 Sulf1 sulfatase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11908 ? EM:13494 C57BL/6NCrl-Stxbp5/Ieg EMMA sperm mutant strain MGI:6277010 Stxbp5 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1926058 Stxbp5 syntaxin binding protein 5 (tomosyn) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13494 + EM:10138 C57BL/6NCrl-Stx5a/Ieg EMMA sperm mutant strain MGI:5692753 Stx5a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1928483 Stx5a syntaxin 5A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10138 + EM:11702 C57BL/6NCrl-Strn4/Ph EMMA sperm C57BL/6N-Strn4/Ph mutant strain MGI:6317368 Strn4 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2142346 Strn4 striatin, calmodulin binding protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11702 + EM:12184 C57BL/6NCrl-Strip2/Ph EMMA sperm mutant strain MGI:6341827 Strip2 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2444363 Strip2 striatin interacting protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12184 ? EM:13603 C57BL/6NCrl-Strbp/Ieg EMMA sperm mutant strain MGI:6302759 Strbp endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:104626 Strbp spermatid perinuclear RNA binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13603 + EM:12248 C57BL/6NCrl-Stk26/Ph EMMA sperm mutant strain MGI:6159329 Stk26 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1917665 Stk26 serine/threonine kinase 26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12248 ? EM:13733 C57BL/6NCrl-Sptlc3/Ieg EMMA sperm mutant strain MGI:6441120 Sptlc3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2444678 Sptlc3 serine palmitoyltransferase, long chain base subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13733 + EM:11985 C57BL/6NCrl-Spryd4/Ph EMMA sperm mutant strain MGI:6341853 Spryd4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1913951 Spryd4 SPRY domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11985 + EM:11773 C57BL/6NCrl-Spink6/Ph EMMA sperm C57BL/6NCrl-Spink6/Ph mutant strain MGI:6152706 Spink6 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3648654 Spink6 serine peptidase inhibitor, Kazal type 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11773 ? EM:12420 C57BL/6NCrl-Spink13/Ph EMMA sperm mutant strain MGI:6341936 Spink13 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3642511 Spink13 serine peptidase inhibitor, Kazal type 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12420 ? EM:12279 C57BL/6NCrl-Sox14/Ph EMMA sperm mutant strain MGI:6341893 Sox14 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:98362 Sox14 SRY (sex determining region Y)-box 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12279 ? EM:13418 C57BL/6NCrl-Snx13/Ieg EMMA sperm mutant strain MGI:6472608 Snx13 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2661416 Snx13 sorting nexin 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13418 ? EM:13582 C57BL/6NCrl-Snrpb2/Ieg EMMA sperm mutant strain MGI:6414501 Snrpb2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:104805 Snrpb2 U2 small nuclear ribonucleoprotein B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13582 + EM:10113 C57BL/6NCrl-Smim6/Ieg EMMA sperm mutant strain MGI:5692688 Smim6 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915778 Smim6 small integral membrane protein 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10113 ? EM:13595 C57BL/6NCrl-Slc6a15/Ieg EMMA sperm mutant strain MGI:6361241 Slc6a15 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2143484 Slc6a15 solute carrier family 6 (neurotransmitter transporter), member 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13595 ? EM:13573 C57BL/6NCrl-Slc5a9/Ieg EMMA sperm mutant strain MGI:6423835 Slc5a9 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2140201 Slc5a9 solute carrier family 5 (sodium/glucose cotransporter), member 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13573 ? EM:13654 C57BL/6NCrl-Slc5a4a/Ieg EMMA sperm mutant strain MGI:6414481 Slc5a4a endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1927848 Slc5a4a solute carrier family 5, member 4a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13654 ? EM:13626 C57BL/6NCrl-Slc35f5/Ieg EMMA sperm mutant strain MGI:6414495 Slc35f5 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1921400 Slc35f5 solute carrier family 35, member F5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13626 + EM:11872 C57BL/6NCrl-Slc25a32/Orl EMMA archived mutant strain MGI:6406920 Slc25a32 endonuclease-mediated mutation 1, Orleans MGI:1917156 Slc25a32 solute carrier family 25, member 32 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11872 ? EM:13558 C57BL/6NCrl-Slc25a13/Ieg EMMA sperm mutant strain MGI:6388371 Slc25a13 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1354721 Slc25a13 solute carrier family 25 (mitochondrial carrier, adenine nucleotide translocator), member 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13558 ? EM:13561 C57BL/6NCrl-Slc25a12/Ieg EMMA sperm mutant strain MGI:6305719 Slc25a12 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1926080 Slc25a12 solute carrier family 25 (mitochondrial carrier, Aralar), member 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13561 + EM:12252 C57BL/6NCrl-Slc25a10/Ieg EMMA sperm mutant strain MGI:6120716 Slc25a10 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1353497 Slc25a10 solute carrier family 25 (mitochondrial carrier, dicarboxylate transporter), member 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12252 ? EM:13640 C57BL/6NCrl-Slc13a4/Ieg EMMA sperm mutant strain MGI:6414526 Slc13a4 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2442367 Slc13a4 solute carrier family 13 (sodium/sulfate symporters), member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13640 + EM:11535 C57BL/6NCrl-Slc12a9/Ieg EMMA sperm mutant strain MGI:6120766 Slc12a9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1933532 Slc12a9 solute carrier family 12 (potassium/chloride transporters), member 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11535 ? EM:12418 C57BL/6NCrl-Sla2/Ph EMMA sperm mutant strain MGI:6341873 Sla2 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1925049 Sla2 Src-like-adaptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12418 + EM:12170 C57BL/6NCrl-Sinhcaf/Ph EMMA sperm mutant strain MGI:6341898 Sinhcaf endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1929091 Sinhcaf SIN3-HDAC complex associated factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12170 + EM:12835 C57BL/6NCrl-Shisal2a/Ieg EMMA sperm mutant strain MGI:6279892 Shisal2a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3651644 Shisal2a shisa like 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12835 + EM:12276 C57BL/6NCrl-Shisal1/Ph EMMA sperm mutant strain MGI:6341918 Shisal1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1919551 Shisal1 shisa like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12276 ? EM:13493 C57BL/6NCrl-Sec13/Ieg EMMA sperm mutant strain MGI:6279926 Sec13 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:99832 Sec13 SEC13 homolog, nuclear pore and COPII coat complex component https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13493 + EM:10169 C57BL/6NCrl-Sec11c/Ieg EMMA sperm mutant strain MGI:5696903 Sec11c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913536 Sec11c SEC11 homolog C, signal peptidase complex subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10169 + EM:11909 C57BL/6NCrl-Scmh1/Ieg EMMA sperm mutant strain MGI:6324158 Scmh1 targeted mutation 1e.1, Helmholtz Zentrum Muenchen GmbH MGI:1352762 Scmh1 sex comb on midleg homolog 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11909 ? EM:13734 C57BL/6NCrl-Scara3/Ieg EMMA sperm mutant strain Scara3 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:2444418 Scara3 scavenger receptor class A, member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13734 + EM:11304 C57BL/6NCrl-Sbspon/Ph EMMA sperm mutant strain MGI:6147538 Sbspon endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2684952 Sbspon somatomedin B and thrombospondin, type 1 domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11304 + EM:12286 C57BL/6NCrl-Sbsn/Ph EMMA sperm mutant strain MGI:6341905 Sbsn endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2446326 Sbsn suprabasin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12286 ? EM:13645 C57BL/6NCrl-Samm50/Ieg EMMA sperm mutant strain MGI:6414489 Samm50 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1915903 Samm50 SAMM50 sorting and assembly machinery component https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13645 ? EM:13627 C57BL/6NCrl-Rtn4/Ieg EMMA sperm mutant strain MGI:6279927 Rtn4 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1915835 Rtn4 reticulon 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13627 ? EM:15100 C57BL/6NCrl-Rnps1/Ieg EMMA sperm mutant strain Rnps1 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:97960 Rnps1 RNA binding protein with serine rich domain 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=15100 + EM:11366 C57BL/6NCrl-Rnls/Ieg EMMA sperm mutant strain MGI:6120734 Rnls targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915045 Rnls renalase, FAD-dependent amine oxidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11366 + EM:12752 C57BL/6NCrl-Rnf5/Ph EMMA sperm mutant strain MGI:6361211 Rnf5 targeted mutation 1.1, Velocigene MGI:1860076 Rnf5 ring finger protein 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12752 + EM:12180 C57BL/6NCrl-Rnf4/Ph EMMA sperm mutant strain MGI:6341902 Rnf4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1201691 Rnf4 ring finger protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12180 ? EM:12277 C57BL/6NCrl-Rnf223/Ph EMMA sperm mutant strain MGI:6341957 Rnf223 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3588193 Rnf223 ring finger 223 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12277 + EM:12413 C57BL/6NCrl-Rnf19b/Ph EMMA live mutant strain MGI:6341934 Rnf19b endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1922484 Rnf19b ring finger protein 19B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12413 + EM:10161 C57BL/6NCrl-Rnf186/Ph EMMA sperm mutant strain MGI:5695912 Rnf186 targeted mutation 1.1, Velocigene MGI:1914075 Rnf186 ring finger protein 186 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10161 + EM:13197 C57BL/6NCrl-Rnf168/Ph EMMA live mutant strain MGI:6433991 Rnf168 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1917488 Rnf168 ring finger protein 168 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13197 ? EM:12419 C57BL/6NCrl-Rnf14/Ph EMMA sperm mutant strain MGI:6341897 Rnf14 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1929668 Rnf14 ring finger protein 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12419 + EM:12656 C57BL/6NCrl-Rnf121/Ph EMMA sperm mutant strain MGI:5609353 Rnf121 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1922462 Rnf121 ring finger protein 121 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12656 + EM:11339 C57BL/6NCrl-Rhobtb1/Ph EMMA sperm mutant strain MGI:6147537 Rhobtb1 endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:1916538 Rhobtb1 Rho-related BTB domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11339 ? EM:13484 C57BL/6NCrl-Rhbg/Ieg EMMA sperm mutant strain MGI:6273949 Rhbg endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1927379 Rhbg Rhesus blood group-associated B glycoprotein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13484 + EM:12589 C57BL/6NCrl-Rffl/Ph EMMA live mutant strain MGI:6341904 Rffl endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1914588 Rffl ring finger and FYVE like domain containing protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12589 + EM:11464 C57BL/6NCrl-Retreg2/Ph EMMA sperm mutant strain MGI:6147536 Retreg2 endonucleas-mediated mutation 2, Institute of Molecular Genetics MGI:2388278 Retreg2 reticulophagy regulator family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11464 ? EM:13643 C57BL/6NCrl-Rbm39/Ieg EMMA sperm mutant strain MGI:6403708 Rbm39 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2157953 Rbm39 RNA binding motif protein 39 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13643 ? EM:13618 C57BL/6NCrl-Raver1/Ieg EMMA sperm mutant strain MGI:6414545 Raver1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1919016 Raver1 ribonucleoprotein, PTB-binding 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13618 ? EM:13637 C57BL/6NCrl-Ptbp2/Ieg EMMA sperm mutant strain MGI:6388381 Ptbp2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1860489 Ptbp2 polypyrimidine tract binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13637 + EM:12284 C57BL/6NCrl-Pstpip1/Ph EMMA sperm mutant strain MGI:6341846 Pstpip1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1321396 Pstpip1 proline-serine-threonine phosphatase-interacting protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12284 ? EM:14563 C57BL/6NCrl-Psors1c2/Ieg EMMA sperm mutant strain Psors1c2 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1930025 Psors1c2 psoriasis susceptibility 1 candidate 2 (human) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14563 + EM:10140 C57BL/6NCrl-Psmc2/Ieg EMMA sperm mutant strain MGI:5692582 Psmc2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:109555 Psmc2 proteasome (prosome, macropain) 26S subunit, ATPase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10140 ? EM:12682 C57BL/6NCrl-Prss57/Ph EMMA sperm mutant strain MGI:6341906 Prss57 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1920356 Prss57 protease, serine 57 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12682 ? EM:12597 C57BL/6NCrl-Prss54/Ph EMMA sperm mutant strain MGI:6341879 Prss54 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1918243 Prss54 protease, serine 54 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12597 ? EM:12594 C57BL/6NCrl-Prss47/Ph EMMA sperm mutant strain MGI:6341895 Prss47 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2685120 Prss47 protease, serine 47 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12594 ? EM:12602 C57BL/6NCrl-Prss21/Ph EMMA sperm mutant strain MGI:6341900 Prss21 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1916698 Prss21 protease, serine 21 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12602 ? EM:13439 C57BL/6NCrl-Prox2/Ieg EMMA sperm mutant strain MGI:6257723 Prox2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1920672 Prox2 prospero homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13439 ? EM:13414 C57BL/6NCrl-Prkd3/Ieg EMMA sperm mutant strain MGI:6472607 Prkd3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922542 Prkd3 protein kinase D3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13414 ? EM:13445 C57BL/6NCrl-Prkd2/Ieg EMMA sperm mutant strain MGI:6257638 Prkd2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2141917 Prkd2 protein kinase D2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13445 ? EM:12416 C57BL/6NCrl-Prg4/Ph EMMA sperm mutant strain MGI:6341884 Prg4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1891344 Prg4 proteoglycan 4 (megakaryocyte stimulating factor, articular superficial zone protein) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12416 + EM:11370 C57BL/6NCrl-Ppp4r3b/Ieg EMMA sperm mutant strain MGI:6120774 Ppp4r3b targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2144474 Ppp4r3b protein phosphatase 4 regulatory subunit 3B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11370 ? EM:15108 C57BL/6NCrl-Ppil6/Ieg EMMA sperm mutant strain Ppil6 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1920325 Ppil6 peptidylprolyl isomerase (cyclophilin)-like 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=15108 ? EM:15005 C57BL/6NCrl-Pomk/Ieg EMMA sperm mutant strain Pomk CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1921903 Pomk protein-O-mannose kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=15005 ? EM:14678 C57BL/6NCrl-Plppr5/Ph EMMA sperm mutant strain Plppr5 CRISPR/CAS9 targeted mutation , undef MGI:1923019 Plppr5 phospholipid phosphatase related 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14678 ? EM:14579 C57BL/6NCrl-Plpp4/Ieg EMMA sperm mutant strain Plpp4 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:2685936 Plpp4 phospholipid phosphatase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14579 + EM:12539 C57BL/6NCrl-Plekha1/Ieg EMMA sperm mutant strain MGI:6256795 Plekha1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2442213 Plekha1 pleckstrin homology domain containing, family A (phosphoinositide binding specific) member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12539 ? EM:13491 C57BL/6NCrl-Plag1/Ieg EMMA sperm mutant strain MGI:6273963 Plag1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1891916 Plag1 pleiomorphic adenoma gene 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13491 + EM:11866 C57BL/6NCrl-Pknox2/Ph EMMA sperm mutant strain MGI:6341886 Pknox2 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2445415 Pknox2 Pbx/knotted 1 homeobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11866 + EM:11740 C57BL/6NCrl-Pip4p1/Ph EMMA sperm C57BL/6NCrl-Tmem55b/Ph, C57BL/6NCrl-Tmem55b/Ph mutant strain MGI:6152709 Pip4p1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2448501 Pip4p1 phosphatidylinositol-4,5-bisphosphate 4-phosphatase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11740 ? EM:13563 C57BL/6NCrl-Phf14/Ieg EMMA sperm mutant strain MGI:6277016 Phf14 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1923539 Phf14 PHD finger protein 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13563 + EM:12435 C57BL/6NCrl-Phf10/Ieg EMMA sperm mutant strain MGI:6276833 Phf10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919307 Phf10 PHD finger protein 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12435 ? EM:13430 C57BL/6NCrl-Phactr4/Ieg EMMA sperm mutant strain MGI:6324157 Phactr4 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2140327 Phactr4 phosphatase and actin regulator 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13430 ? EM:13501 C57BL/6NCrl-Phactr3/Ieg EMMA sperm mutant strain MGI:6273948 Phactr3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1921439 Phactr3 phosphatase and actin regulator 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13501 ? EM:13455 C57BL/6NCrl-Phactr2/Ieg EMMA sperm mutant strain MGI:6257524 Phactr2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2446138 Phactr2 phosphatase and actin regulator 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13455 ? EM:13727 C57BL/6NCrl-Pgm3/Ieg EMMA sperm mutant strain MGI:6388357 Pgm3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:97566 Pgm3 phosphoglucomutase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13727 ? EM:11529 C57BL/6NCrl-Pex1/Ieg EMMA sperm mutant strain Pex1 EUCOMM targeted mutation 1e.1, Helmholtz Zentrum Muenchen GmbH MGI:1918632 Pex1 peroxisomal biogenesis factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11529 ? EM:13617 C57BL/6NCrl-Pdia3/Ieg EMMA sperm mutant strain MGI:6399889 Pdia3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:95834 Pdia3 protein disulfide isomerase associated 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13617 ? EM:12499 C57BL/6NCrl-Pdgfd/Ph EMMA sperm mutant strain MGI:6341877 Pdgfd endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1919035 Pdgfd platelet-derived growth factor, D polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12499 + EM:11911 C57BL/6NCrl-Pdgfc/Ieg EMMA sperm mutant strain MGI:6160167 Pdgfc targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1859631 Pdgfc platelet-derived growth factor, C polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11911 + EM:13434 C57BL/6NCrl-Pdcd6ip/Ieg EMMA live mutant strain MGI:6257536 Pdcd6ip endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1333753 Pdcd6ip programmed cell death 6 interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13434 + EM:12341 C57BL/6NCrl-Pcp4l1/Ph EMMA sperm mutant strain MGI:6120730 Pcp4l1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913675 Pcp4l1 Purkinje cell protein 4-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12341 ? EM:13602 C57BL/6NCrl-Pcdhgc3/Ieg EMMA sperm mutant strain MGI:6336215 Pcdhgc3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1935201 Pcdhgc3 protocadherin gamma subfamily C, 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13602 ? EM:13560 C57BL/6NCrl-Pcdhgb2/Ieg EMMA sperm mutant strain MGI:6336214 Pcdhgb2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1935170 Pcdhgb2 protocadherin gamma subfamily B, 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13560 ? EM:13517 C57BL/6NCrl-Pcdhga1/Ieg EMMA sperm mutant strain MGI:6273954 Pcdhga1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1935212 Pcdhga1 protocadherin gamma subfamily A, 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13517 ? EM:13725 C57BL/6NCrl-Pcca/Ieg EMMA sperm mutant strain Pcca CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:97499 Pcca propionyl-Coenzyme A carboxylase, alpha polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13725 ? EM:13441 C57BL/6NCrl-Pacs1/Ieg EMMA sperm mutant strain MGI:6257514 Pacs1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1277113 Pacs1 phosphofurin acidic cluster sorting protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13441 + EM:12831 C57BL/6NCrl-P2rx2/Ieg EMMA sperm mutant strain MGI:6279891 P2rx2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2665170 P2rx2 purinergic receptor P2X, ligand-gated ion channel, 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12831 ? EM:14898 C57BL/6NCrl-Omd/Ieg EMMA sperm mutant strain Omd CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1350918 Omd osteomodulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14898 ? EM:13507 C57BL/6NCrl-Oma1/Ieg EMMA sperm mutant strain MGI:6314739 Oma1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1914263 Oma1 OMA1 zinc metallopeptidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13507 ? EM:13513 C57BL/6NCrl-Olfr1466/Ieg EMMA sperm mutant strain Olfr1466 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:3031300 Or5b112 olfactory receptor family 5 subfamily B member 112 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13513 ? EM:13063 C57BL/6NCrl-Nxnl2/Ph EMMA sperm mutant strain Nxnl2 CRISPR/CAS9 targeted mutation , undef MGI:1922374 Nxnl2 nucleoredoxin-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13063 + EM:12182 C57BL/6NCrl-Nwd2/Ph EMMA sperm mutant strain MGI:6341878 Nwd2 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1920464 Nwd2 NACHT and WD repeat domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12182 + EM:11907 C57BL/6NCrl-Nup35/Ieg EMMA sperm mutant strain MGI:6160168 Nup35 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916732 Nup35 nucleoporin 35 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11907 + EM:11365 C57BL/6NCrl-Nucks1/Ieg EMMA sperm mutant strain MGI:6120767 Nucks1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1934811 Nucks1 nuclear casein kinase and cyclin-dependent kinase substrate 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11365 + EM:11613 C57BL/6NCrl-Nub1/Ph EMMA sperm mutant strain MGI:5766751 Nub1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1889001 Nub1 negative regulator of ubiquitin-like proteins 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11613 ? EM:13511 C57BL/6NCrl-Nt5c2/Ieg EMMA sperm mutant strain MGI:6273967 Nt5c2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2178563 Nt5c2 5'-nucleotidase, cytosolic II https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13511 ? EM:13495 C57BL/6NCrl-Npepps/Ieg EMMA sperm mutant strain MGI:6276869 Npepps endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1101358 Npepps aminopeptidase puromycin sensitive https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13495 ? EM:13481 C57BL/6NCrl-Neurod2/Ieg EMMA sperm mutant strain MGI:6273956 Neurod2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:107755 Neurod2 neurogenic differentiation 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13481 ? EM:13499 C57BL/6NCrl-Neto2/Ieg EMMA sperm mutant strain MGI:6384608 Neto2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1921763 Neto2 neuropilin (NRP) and tolloid (TLL)-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13499 + EM:11528 C57BL/6NCrl-Napb/Ieg EMMA sperm mutant strain MGI:6120686 Napb targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:104562 Napb N-ethylmaleimide sensitive fusion protein attachment protein beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11528 ? EM:14836 C57BL/6NCrl-Napa/Ph EMMA sperm mutant strain Napa CRISPR/CAS9 targeted mutation , undef MGI:104563 Napa N-ethylmaleimide sensitive fusion protein attachment protein alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14836 ? EM:13447 C57BL/6NCrl-Nacc1/Ieg EMMA sperm mutant strain MGI:6324156 Nacc1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1914080 Nacc1 nucleus accumbens associated 1, BEN and BTB (POZ) domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13447 + EM:12175 C57BL/6NCrl-Naa38/Ph EMMA sperm mutant strain MGI:6341883 Naa38 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1925554 Naa38 N(alpha)-acetyltransferase 38, NatC auxiliary subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12175 + EM:11306 C57BL/6NCrl-Mzb1/Ph EMMA sperm mutant strain MGI:6147535 Mzb1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1917066 Mzb1 marginal zone B and B1 cell-specific protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11306 + EM:09512 C57BL/6NCrl-Myl2/Ieg EMMA sperm mutant strain MGI:5629324 Myl2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:97272 Myl2 myosin, light polypeptide 2, regulatory, cardiac, slow https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9512 ? EM:13516 C57BL/6NCrl-Mydgf/Ieg EMMA sperm mutant strain MGI:6273959 Mydgf endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2156020 Mydgf myeloid derived growth factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13516 ? EM:13604 C57BL/6NCrl-Mtmr2/Ieg EMMA sperm mutant strain MGI:6386315 Mtmr2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1924366 Mtmr2 myotubularin related protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13604 ? EM:13584 C57BL/6NCrl-Mtcp1/Ieg EMMA sperm mutant strain Mtcp1 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:102699 Mtcp1 mature T cell proliferation 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13584 ? EM:13624 C57BL/6NCrl-Mogat1/Ieg EMMA sperm mutant strain MGI:6399911 Mogat1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1915643 Mogat1 monoacylglycerol O-acyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13624 ? EM:13510 C57BL/6NCrl-Mmd/Ieg EMMA sperm mutant strain MGI:6384588 Mmd endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1914718 Mmd monocyte to macrophage differentiation-associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13510 ? EM:13646 C57BL/6NCrl-Mmab/Ieg EMMA sperm mutant strain MGI:6435666 Mmab endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1924947 Mmab methylmalonic aciduria (cobalamin deficiency) cblB type homolog (human) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13646 + EM:13480 C57BL/6NCrl-Mgll/Ieg EMMA live mutant strain MGI:6273958 Mgll endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1346042 Mgll monoglyceride lipase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13480 ? EM:13384 C57BL/6NCrl-Mfn1/Ieg EMMA sperm mutant strain MGI:6414496 Mfn1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1914664 Mfn1 mitofusin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13384 + EM:11612 C57BL/6NCrl-Mex3b/Ph EMMA sperm mutant strain MGI:5766754 Mex3b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1918252 Mex3b mex3 RNA binding family member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11612 + EM:11612 C57BL/6NCrl-Mex3b/Ph EMMA live mutant strain MGI:5766754 Mex3b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1918252 Mex3b mex3 RNA binding family member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11612 ? EM:13474 C57BL/6NCrl-Mettl5/Ieg EMMA sperm mutant strain MGI:6273953 Mettl5 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1922672 Mettl5 methyltransferase like 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13474 ? EM:13716 C57BL/6NCrl-Mettl23Hmgu/Ieg EMMA sperm mutant strain Mettl23Hmgu CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1921569 Mettl23 methyltransferase like 23 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13716 + EM:11867 C57BL/6NCrl-Mest/Ph EMMA sperm mutant strain MGI:6341841 Mest endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:96968 Mest mesoderm specific transcript https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11867 + EM:11334 C57BL/6NCrl-Marchf8/Ph EMMA sperm C57BL/6NCrl-March8/Ph mutant strain MGI:6147531 Marchf8 endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:1919029 Marchf8 membrane associated ring-CH-type finger 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11334 + EM:12830 C57BL/6NCrl-Marchf3/Ph EMMA sperm mutant strain MGI:6358620 Marchf3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2443667 Marchf3 membrane associated ring-CH-type finger 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12830 ? EM:13452 C57BL/6NCrl-Mapk13/Ieg EMMA sperm mutant strain MGI:6257497 Mapk13 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1346864 Mapk13 mitogen-activated protein kinase 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13452 ? EM:13477 C57BL/6NCrl-Man2a1/Ieg EMMA sperm mutant strain MGI:6273945 Man2a1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:104669 Man2a1 mannosidase 2, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13477 ? EM:14745 C57BL/6NCrl-Magix/Ieg EMMA sperm mutant strain MGI:6403694 Magix endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1859644 Magix MAGI family member, X-linked https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14745 ? EM:13630 C57BL/6NCrl-Macroh2a2/Ieg EMMA sperm mutant strain MGI:6441118 Macroh2a2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:3037658 Macroh2a2 macroH2A.2 histone https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13630 ? EM:13571 C57BL/6NCrl-Ly6g6f/Ieg EMMA sperm mutant strain Ly6g6f CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:3616082 Ly6g6f lymphocyte antigen 6 complex, locus G6F https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13571 + EM:11539 C57BL/6NCrl-Ly6g6d/Ieg EMMA sperm mutant strain MGI:6120778 Ly6g6d targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2148931 Ly6g6d lymphocyte antigen 6 complex, locus G6D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11539 + EM:12617 C57BL/6NCrl-Ltn1/Ph EMMA sperm mutant strain MGI:6304241 Ltn1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1926163 Ltn1 listerin E3 ubiquitin protein ligase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12617 ? EM:13468 C57BL/6NCrl-Lrp1b/Ieg EMMA sperm mutant strain MGI:6273952 Lrp1b endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2151136 Lrp1b low density lipoprotein-related protein 1B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13468 + EM:11786 C57BL/6NCrl-Lratd2/Ph EMMA sperm mutant strain MGI:6316150 Lratd2 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3026924 Lratd2 LRAT domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11786 + EM:12477 C57BL/6NCrl-Lpp/Ph EMMA sperm mutant strain MGI:6120784 Lpp targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2441849 Lpp LIM domain containing preferred translocation partner in lipoma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12477 + EM:12815 C57BL/6NCrl-Lmo1/Ieg EMMA sperm mutant strain MGI:6382778 Lmo1 targeted mutation 1b, Mouse Biology Program, UCDavis MGI:102812 Lmo1 LIM domain only 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12815 ? EM:15101 C57BL/6NCrl-Lime1/Ieg EMMA sperm mutant strain Lime1 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1919949 Lime1 Lck interacting transmembrane adaptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=15101 + EM:10118 C57BL/6NCrl-Ldlr/Ieg EMMA sperm mutant strain MGI:5695977 Ldlr targeted mutation 1b, Wellcome Trust Sanger Institute MGI:96765 Ldlr low density lipoprotein receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10118 + EM:10369 C57BL/6NCrl-Lct/Ieg EMMA sperm mutant strain MGI:5704514 Lct targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104576 Lct lactase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10369 ? EM:14521 C57BL/6NCrl-Lars/WtsiIeg EMMA sperm mutant strain MGI:5637014 Lars targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913808 Lars leucyl-tRNA synthetase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14521 + EM:11869 C57BL/6NCrl-Lamtor4/Ph EMMA sperm mutant strain MGI:6341931 Lamtor4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1913346 Lamtor4 late endosomal/lysosomal adaptor, MAPK and MTOR activator 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11869 ? EM:13621 C57BL/6NCrl-Lamtor3/Ieg EMMA sperm mutant strain MGI:6441124 Lamtor3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1929467 Lamtor3 late endosomal/lysosomal adaptor, MAPK and MTOR activator 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13621 ? EM:12486 C57BL/6NCrl-Krtap9-5/Ph EMMA sperm mutant strain MGI:6341857 Krtap9-5 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3650333 Krtap9-5 keratin associated protein 9-5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12486 ? EM:12497 C57BL/6NCrl-Krt33b/Ph EMMA sperm mutant strain MGI:6341937 Krt33b endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1309991 Krt33b keratin 33B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12497 ? EM:12491 C57BL/6NCrl-Krt28/Ph EMMA sperm mutant strain MGI:6341928 Krt28 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1918093 Krt28 keratin 28 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12491 ? EM:12483 C57BL/6NCrl-Krt27/Ph EMMA sperm mutant strain MGI:6341921 Krt27 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1339999 Krt27 keratin 27 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12483 + EM:12177 C57BL/6NCrl-Klk8/Ph EMMA sperm mutant strain MGI:6341912 Klk8 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1343327 Klk8 kallikrein related-peptidase 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12177 + EM:09056 C57BL/6NCrl-Klk5/Ph EMMA archived mutant strain MGI:5604101 Klk5 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1915918 Klk5 kallikrein related-peptidase 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9056 ? EM:12484 C57BL/6NCrl-Klk15/Ph EMMA sperm mutant strain MGI:6341840 Klk15 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2447533 Klk15 kallikrein related-peptidase 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12484 - EM:12654 C57BL/6NCrl-Klk14/Ph EMMA sperm mutant strain MGI:5571350 Klk14 targeted mutation 1.1, Velocigene MGI:2447564 Klk14 kallikrein related-peptidase 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12654 + EM:11910 C57BL/6NCrl-Klk13/Ph EMMA sperm mutant strain MGI:6341887 Klk13 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3615275 Klk13 kallikrein related-peptidase 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11910 + EM:11989 C57BL/6NCrl-Klk12/Ph EMMA sperm mutant strain MGI:6341825 Klk12 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1916761 Klk12 kallikrein related-peptidase 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11989 + EM:11611 C57BL/6NCrl-Klhl5/Ph EMMA sperm mutant strain MGI:5692709 Klhl5 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919028 Klhl5 kelch-like 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11611 ? EM:13570 C57BL/6NCrl-Kl/Ieg EMMA sperm mutant strain MGI:6276985 Kl endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1101771 Kl klotho https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13570 ? EM:13476 C57BL/6NCrl-Kif28/Ieg EMMA sperm mutant strain Kif28 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:2686151 Kif28 kinesin family member 28 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13476 ? EM:13720 C57BL/6NCrl-Kctd2/Ieg EMMA sperm mutant strain MGI:6414510 Kctd2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1917632 Kctd2 potassium channel tetramerisation domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13720 ? EM:13498 C57BL/6NCrl-Kcnh7/Ieg EMMA sperm mutant strain MGI:6273965 Kcnh7 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2159566 Kcnh7 potassium voltage-gated channel, subfamily H (eag-related), member 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13498 + EM:12810 C57BL/6NCrl-Kansl1l/Ieg EMMA sperm mutant strain MGI:6379553 Kansl1l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915941 Kansl1l KAT8 regulatory NSL complex subunit 1-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12810 ? EM:13633 C57BL/6NCrl-Islr/Ieg EMMA sperm mutant strain Islr CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1349645 Islr immunoglobulin superfamily containing leucine-rich repeat https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13633 ? EM:13505 C57BL/6NCrl-Insig2/Ieg EMMA sperm mutant strain MGI:6276878 Insig2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1920249 Insig2 insulin induced gene 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13505 + EM:11914 C57BL/6NCrl-Insig1/Ph EMMA sperm mutant strain MGI:6341860 Insig1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1916289 Insig1 insulin induced gene 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11914 + EM:11533 C57BL/6NCrl-Il4i1/Ieg EMMA sperm mutant strain MGI:6120692 Il4i1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:109552 Il4i1 interleukin 4 induced 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11533 + EM:11527 C57BL/6NCrl-Il31/Ieg EMMA sperm mutant strain MGI:6120755 Il31 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923649 Il31 interleukin 31 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11527 + EM:11369 C57BL/6NCrl-Il13ra2/Ieg EMMA sperm mutant strain MGI:6120701 Il13ra2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1277954 Il13ra2 interleukin 13 receptor, alpha 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11369 + EM:10170 C57BL/6NCrl-Idi1/Ieg EMMA sperm mutant strain MGI:5696924 Idi1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2442264 Idi1 isopentenyl-diphosphate delta isomerase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10170 + EM:11540 C57BL/6NCrl-Ica1l/Ieg EMMA sperm mutant strain MGI:6120743 Ica1l targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1917625 Ica1l islet cell autoantigen 1-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11540 ? EM:13586 C57BL/6NCrl-Ibtk/Ieg EMMA sperm mutant strain MGI:6358629 Ibtk endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1918677 Ibtk inhibitor of Bruton agammaglobulinemia tyrosine kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13586 ? EM:13600 C57BL/6NCrl-Hip1/Ieg EMMA sperm mutant strain MGI:6305724 Hip1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1099804 Hip1 huntingtin interacting protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13600 - EM:11940 C57BL/6NCrl-Hgs/Ieg EMMA sperm C57BL/6NCrl-Hgs/2Ieg mutant strain MGI:6163774 Hgs targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104681 Hgs HGF-regulated tyrosine kinase substrate https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11940 + EM:10591 C57BL/6NCrl-Hepacam2/Ph EMMA sperm mutant strain MGI:5766759 Hepacam2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2141520 Hepacam2 HEPACAM family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10591 + EM:10591 C57BL/6NCrl-Hepacam2/Ph EMMA live mutant strain MGI:5766759 Hepacam2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2141520 Hepacam2 HEPACAM family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10591 ? EM:13649 C57BL/6NCrl-Hebp1/Ieg EMMA sperm mutant strain MGI:6433993 Hebp1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1333880 Hebp1 heme binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13649 + EM:12179 C57BL/6NCrl-Hdac4/Ph EMMA sperm mutant strain MGI:6341845 Hdac4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3036234 Hdac4 histone deacetylase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12179 ? EM:14983 C57BL/6NCrl-Hapln3/Ieg EMMA sperm mutant strain Hapln3 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1914916 Hapln3 hyaluronan and proteoglycan link protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14983 + EM:11536 C57BL/6NCrl-Gstt1/Ieg EMMA sperm mutant strain MGI:5695115 Gstt1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:107379 Gstt1 glutathione S-transferase, theta 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11536 ? EM:13652 C57BL/6NCrl-Gstp2/Ieg EMMA sperm mutant strain MGI:6414521 Gstp2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:95864 Gstp2 glutathione S-transferase, pi 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13652 ? EM:13593 C57BL/6NCrl-Gstp1/Ieg EMMA sperm mutant strain MGI:6330715 Gstp1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:95865 Gstp1 glutathione S-transferase, pi 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13593 ? EM:13651 C57BL/6NCrl-Gstm3/Ieg EMMA sperm mutant strain MGI:6414476 Gstm3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:106026 Gstm3 glutathione S-transferase, mu 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13651 ? EM:13594 C57BL/6NCrl-Gstm1/Ieg EMMA sperm mutant strain MGI:6367950 Gstm1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:95860 Gstm1 glutathione S-transferase, mu 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13594 ? EM:13442 C57BL/6NCrl-Gria1/Ieg EMMA sperm mutant strain MGI:6257717 Gria1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:95808 Gria1 glutamate receptor, ionotropic, AMPA1 (alpha 1) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13442 ? EM:13449 C57BL/6NCrl-Gper1/Ieg EMMA sperm mutant strain Gper1 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1924104 Gper1 G protein-coupled estrogen receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13449 ? EM:13622 C57BL/6NCrl-Gpd1/Ieg EMMA sperm mutant strain MGI:6441117 Gpd1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:95679 Gpd1 glycerol-3-phosphate dehydrogenase 1 (soluble) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13622 ? EM:13698 C57BL/6NCrl-Gpalpp1/Ieg EMMA sperm mutant strain MGI:6433996 Gpalpp1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1914717 Gpalpp1 GPALPP motifs containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13698 ? EM:13437 C57BL/6NCrl-Gm4951/Ieg EMMA sperm mutant strain MGI:6158427 Gm4951 endonuclease mediated mutation 2, Helmholtz Zentrum Muenchen GmbH MGI:3644953 Gm4951 predicted gene 4951 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13437 ? EM:13612 C57BL/6NCrl-Glipr1/Ieg EMMA sperm mutant strain Glipr1 CRISPR/CAS9 targeted mutation , undef MGI:1920940 Glipr1 GLI pathogenesis-related 1 (glioma) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13612 ? EM:13416 C57BL/6NCrl-Gins2/Ieg EMMA sperm mutant strain MGI:6470391 Gins2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921019 Gins2 GINS complex subunit 2 (Psf2 homolog) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13416 ? EM:13574 C57BL/6NCrl-Gatb/Ieg EMMA sperm mutant strain MGI:6358623 Gatb endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2442496 Gatb glutamyl-tRNA(Gln) amidotransferase, subunit B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13574 + EM:11685 C57BL/6NCrl-Fut1/Ieg EMMA sperm mutant strain MGI:6120691 Fut1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:109375 Fut1 fucosyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11685 ? EM:13500 C57BL/6NCrl-Foxd2/Ieg EMMA sperm mutant strain MGI:6273962 Foxd2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1347471 Foxd2 forkhead box D2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13500 + EM:12410 C57BL/6NCrl-Fgf14/Ph EMMA live mutant strain MGI:6341935 Fgf14 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:109189 Fgf14 fibroblast growth factor 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12410 ? EM:13489 C57BL/6NCrl-Fezf2/Ieg EMMA sperm mutant strain MGI:6273951 Fezf2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1859823 Fezf2 Fez family zinc finger 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13489 + EM:12590 C57BL/6NCrl-Fbxw18/Ph EMMA live mutant strain MGI:6341894 Fbxw18 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3505704 Fbxw18 F-box and WD-40 domain protein 18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12590 + EM:12490 C57BL/6NCrl-Fbxw15/Ph EMMA live mutant strain MGI:6341864 Fbxw15 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3505701 Fbxw15 F-box and WD-40 domain protein 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12490 + EM:12285 C57BL/6NCrl-Fbxo25/Ph EMMA live mutant strain MGI:6341913 Fbxo25 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1914072 Fbxo25 F-box protein 25 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12285 ? EM:13625 C57BL/6NCrl-Fancd2/Ieg EMMA sperm mutant strain MGI:6302758 Fancd2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2448480 Fancd2 Fanconi anemia, complementation group D2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13625 + EM:12171 C57BL/6NCrl-Fam83h/Ph EMMA sperm mutant strain MGI:6341855 Fam83h endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2145900 Fam83h family with sequence similarity 83, member H https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12171 - EM:12282 C57BL/6NCrl-Fam71f1/Ph EMMA sperm C57BL/6NCrl-Garin1b/Ph mutant strain Fam71f1 CRISPR/CAS9 targeted mutation , undef MGI:3032524 Garin1b golgi associated RAB2 interactor 1B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12282 + EM:11336 C57BL/6NCrl-Fam172a/Ph EMMA sperm mutant strain MGI:6147534 Fam172a endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:1915925 Fam172a family with sequence similarity 172, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11336 ? EM:12601 C57BL/6NCrl-Fam161b/Ph EMMA sperm mutant strain MGI:6341852 Fam161b endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2443027 Fam161b family with sequence similarity 161, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12601 - EM:11877 C57BL/6NCrl-Fam126a/Ph EMMA sperm C57BL/6NCrl-Hycc1/Ph mutant strain Fam126a CRISPR/CAS9 targeted mutation , undef MGI:2149839 Hycc1 hyccin PI4KA lipid kinase complex subunit 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11877 ? EM:13518 C57BL/6NCrl-Fam107a/Ieg EMMA sperm mutant strain MGI:6314737 Fam107a endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:3041256 Fam107a family with sequence similarity 107, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13518 + EM:12200 C57BL/6NCrl-Fads6/Ieg EMMA sperm mutant strain MGI:6194112 Fads6 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3039592 Fads6 fatty acid desaturase domain family, member 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12200 ? EM:13556 C57BL/6NCrl-Fabp2/Ieg EMMA sperm mutant strain MGI:6336213 Fabp2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:95478 Fabp2 fatty acid binding protein 2, intestinal https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13556 + EM:11537 C57BL/6NCrl-Exph5/Ieg EMMA sperm mutant strain MGI:6120790 Exph5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443248 Exph5 exophilin 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11537 ? EM:13638 C57BL/6NCrl-Exoc6b/Ieg EMMA sperm mutant strain MGI:6414561 Exoc6b endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1923164 Exoc6b exocyst complex component 6B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13638 ? EM:15098 C57BL/6NCrl-Etnppl/Ieg EMMA sperm mutant strain Etnppl CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1919010 Etnppl ethanolamine phosphate phospholyase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=15098 ? EM:13714 C57BL/6NCrl-Etfb/Ieg EMMA sperm mutant strain Etfb CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:106098 Etfb electron transferring flavoprotein, beta polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13714 ? EM:14739 C57BL/6NCrl-Esyt1/Ieg EMMA sperm mutant strain Esyt1 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1344426 Esyt1 extended synaptotagmin-like protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14739 ? EM:13514 C57BL/6NCrl-Ergic2/Ieg EMMA sperm mutant strain MGI:6314735 Ergic2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1914706 Ergic2 ERGIC and golgi 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13514 ? EM:13614 C57BL/6NCrl-Ercc6l2/Ieg EMMA sperm mutant strain MGI:6399886 Ercc6l2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1923501 Ercc6l2 excision repair cross-complementing rodent repair deficiency, complementation group 6 like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13614 + EM:12826 C57BL/6NCrl-Erbb2/Ieg EMMA sperm mutant strain MGI:6279893 Erbb2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:95410 Erbb2 erb-b2 receptor tyrosine kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12826 + EM:12452 C57BL/6NCrl-Emsy/Ph EMMA sperm mutant strain MGI:6341933 Emsy endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1924203 Emsy EMSY, BRCA2-interacting transcriptional repressor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12452 ? EM:13721 C57BL/6NCrl-Eif4g1/Ieg EMMA sperm mutant strain MGI:6414502 Eif4g1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2384784 Eif4g1 eukaryotic translation initiation factor 4, gamma 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13721 ? EM:13616 C57BL/6NCrl-Eif3k/Ieg EMMA sperm mutant strain MGI:6399916 Eif3k endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1921080 Eif3k eukaryotic translation initiation factor 3, subunit K https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13616 ? EM:13470 C57BL/6NCrl-Eif3f/Ieg EMMA sperm mutant strain MGI:6384603 Eif3f endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1913335 Eif3f eukaryotic translation initiation factor 3, subunit F https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13470 ? EM:13475 C57BL/6NCrl-Eef1a2/Ieg EMMA sperm mutant strain MGI:6157345 Eef1a2 endonuclease mediated mutation 2, Helmholtz Zentrum Muenchen GmbH MGI:1096317 Eef1a2 eukaryotic translation elongation factor 1 alpha 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13475 + EM:11371 C57BL/6NCrl-Eea1/Ieg EMMA sperm mutant strain MGI:6120786 Eea1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2442192 Eea1 early endosome antigen 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11371 ? EM:13579 C57BL/6NCrl-Echs1/Ieg EMMA sperm mutant strain MGI:6361232 Echs1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2136460 Echs1 enoyl Coenzyme A hydratase, short chain, 1, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13579 ? EM:13629 C57BL/6NCrl-Duox1/Ieg EMMA sperm mutant strain MGI:6441115 Duox1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2139422 Duox1 dual oxidase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13629 + EM:12415 C57BL/6NCrl-Dtx4/Ph EMMA sperm mutant strain MGI:6341925 Dtx4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2672905 Dtx4 deltex 4, E3 ubiquitin ligase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12415 ? EM:13406 C57BL/6NCrl-Dpp3/Ieg EMMA sperm mutant strain MGI:6470392 Dpp3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1922471 Dpp3 dipeptidylpeptidase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13406 ? EM:13634 C57BL/6NCrl-Dock4/Ieg EMMA sperm mutant strain MGI:6449030 Dock4 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1918006 Dock4 dedicator of cytokinesis 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13634 + EM:11541 C57BL/6NCrl-Dnmt3l/Ieg EMMA sperm mutant strain MGI:6120722 Dnmt3l targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1859287 Dnmt3l DNA (cytosine-5-)-methyltransferase 3-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11541 ? EM:13564 C57BL/6NCrl-Dnajb14/Ieg EMMA sperm mutant strain MGI:6388373 Dnajb14 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1917854 Dnajb14 DnaJ heat shock protein family (Hsp40) member B14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13564 ? EM:13583 C57BL/6NCrl-Dmd/Ieg EMMA sperm mutant strain MGI:6277059 Dmd endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:94909 Dmd dystrophin, muscular dystrophy https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13583 ? EM:13492 C57BL/6NCrl-Dlst/Ieg EMMA sperm mutant strain MGI:6277023 Dlst endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1926170 Dlst dihydrolipoamide S-succinyltransferase (E2 component of 2-oxo-glutarate complex) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13492 ? EM:13512 C57BL/6NCrl-Dio1/Ieg EMMA sperm mutant strain MGI:6276908 Dio1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:94896 Dio1 deiodinase, iodothyronine, type I https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13512 + EM:07575 C57BL/6NCrl-Dicer1/Ph EMMA sperm C57BL/6-Dicer1/Ph, DcrMTdel mutant strain MGI:5566698 Dicer1 endonuclease-mediated mutation 3, Petr Svoboda MGI:2177178 Dicer1 dicer 1, ribonuclease type III https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7575 ? EM:13392 C57BL/6NCrl-Dhx9/Ieg EMMA sperm mutant strain MGI:6472605 Dhx9 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:108177 Dhx9 DEAH (Asp-Glu-Ala-His) box polypeptide 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13392 ? EM:13628 C57BL/6NCrl-Dhrs4/Ieg EMMA sperm mutant strain MGI:6378426 Dhrs4 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:90169 Dhrs4 dehydrogenase/reductase (SDR family) member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13628 ? EM:13623 C57BL/6NCrl-Dennd6b/Ieg EMMA sperm mutant strain MGI:6449025 Dennd6b endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1916690 Dennd6b DENN domain containing 6B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13623 ? EM:13285 C57BL/6NCrl-Dele1/Ph EMMA sperm mutant strain MGI:6316147 Dele1 endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:1914089 Dele1 DAP3 binding cell death enhancer 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13285 + EM:11704 C57BL/6NCrl-Ddi2/Ph EMMA sperm mutant strain MGI:6117798 Ddi2 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1917244 Ddi2 DNA-damage inducible protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11704 + EM:12340 C57BL/6NCrl-Ddi2/Ph EMMA sperm mutant strain MGI:5810736 Ddi2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1917244 Ddi2 DNA-damage inducible protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12340 ? EM:13482 C57BL/6NCrl-Ddc/Ieg EMMA sperm mutant strain MGI:6273964 Ddc endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:94876 Ddc dopa decarboxylase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13482 + EM:12183 C57BL/6NCrl-Dcaf8/Ph EMMA sperm mutant strain MGI:6341909 Dcaf8 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:91860 Dcaf8 DDB1 and CUL4 associated factor 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12183 + EM:11994 C57BL/6NCrl-Dcaf12/Ph EMMA sperm mutant strain MGI:6341838 Dcaf12 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1916220 Dcaf12 DDB1 and CUL4 associated factor 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11994 ? EM:13706 C57BL/6NCrl-Cyria/Ieg EMMA sperm mutant strain MGI:6414515 Cyria endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1261783 Cyria CYFIP related Rac1 interactor A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13706 + EM:12181 C57BL/6NCrl-Cyp39a1/Ph EMMA sperm mutant strain MGI:6341926 Cyp39a1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1927096 Cyp39a1 cytochrome P450, family 39, subfamily a, polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12181 ? EM:13596 C57BL/6NCrl-Cyp2b9/Ieg EMMA sperm mutant strain MGI:6304243 Cyp2b9 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:88600 Cyp2b9 cytochrome P450, family 2, subfamily b, polypeptide 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13596 ? EM:15097 C57BL/6NCrl-Cts3/Ieg EMMA sperm mutant strain Cts3 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:2151929 Cts3 cathepsin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=15097 + EM:11686 C57BL/6NCrl-Ctrc/Ieg EMMA sperm mutant strain MGI:6120756 Ctrc targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1923951 Ctrc chymotrypsin C (caldecrin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11686 ? EM:13597 C57BL/6NCrl-Crygn/Ieg EMMA sperm mutant strain MGI:6330718 Crygn endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2449167 Crygn crystallin, gamma N https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13597 ? EM:12278 C57BL/6NCrl-Crx/Ph EMMA sperm mutant strain MGI:6341903 Crx endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1194883 Crx cone-rod homeobox https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12278 ? EM:13254 C57BL/6NCrl-Cox7a2/Ieg EMMA sperm mutant strain MGI:6385264 Cox7a2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1316715 Cox7a2 cytochrome c oxidase subunit 7A2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13254 ? EM:13503 C57BL/6NCrl-Coq7/Ieg EMMA sperm mutant strain MGI:6273957 Coq7 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:107207 Coq7 demethyl-Q 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13503 ? EM:13060 C57BL/6NCrl-Cobl/Ph EMMA sperm mutant strain MGI:6414524 Cobl endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:105056 Cobl cordon-bleu WH2 repeat https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13060 + EM:12173 C57BL/6NCrl-Coa6/Ph EMMA sperm mutant strain MGI:6341938 Coa6 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1915142 Coa6 cytochrome c oxidase assembly factor 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12173 ? EM:13397 C57BL/6NCrl-Cnot6l/Ieg EMMA sperm mutant strain MGI:6514804 Cnot6l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443154 Cnot6l CCR4-NOT transcription complex, subunit 6-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13397 + EM:10142 C57BL/6NCrl-Cmpk1/Ieg EMMA sperm mutant strain MGI:5692662 Cmpk1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913838 Cmpk1 cytidine monophosphate (UMP-CMP) kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10142 ? EM:13567 C57BL/6NCrl-Cmas/Ieg EMMA sperm mutant strain MGI:6361234 Cmas endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1337124 Cmas cytidine monophospho-N-acetylneuraminic acid synthetase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13567 + EM:11305 C57BL/6NCrl-Cluh/Ph EMMA sperm mutant strain MGI:6147533 Cluh endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1921398 Cluh clustered mitochondria (cluA/CLU1) homolog https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11305 ? EM:13562 C57BL/6NCrl-Cisd1/Ieg EMMA sperm mutant strain MGI:6276862 Cisd1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1261855 Cisd1 CDGSH iron sulfur domain 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13562 ? EM:12243 C57BL/6NCrl-Ciao2b/Ph EMMA sperm mutant strain MGI:6341859 Ciao2b endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1915773 Ciao2b cytosolic iron-sulfur assembly component 2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12243 + EM:14534 C57BL/6NCrl-Churc1/WtsiPh EMMA live mutant strain MGI:6477909 Churc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923684 Churc1 churchill domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14534 ? EM:13636 C57BL/6NCrl-Chst10/Ieg EMMA sperm mutant strain MGI:6441122 Chst10 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2138283 Chst10 carbohydrate sulfotransferase 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13636 + EM:10452 C57BL/6NCrl-Chpf/Ieg EMMA sperm mutant strain MGI:5751153 Chpf targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:106576 Chpf chondroitin polymerizing factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10452 + EM:12828 C57BL/6NCrl-Chaf1b/Ieg EMMA sperm mutant strain MGI:6279889 Chaf1b targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1314881 Chaf1b chromatin assembly factor 1, subunit B (p60) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12828 + EM:11768 C57BL/6NCrl-Cfap161/Ph EMMA sperm C57BL/6NCrl-Cfap161/Ph mutant strain MGI:6152704 Cfap161 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1922806 Cfap161 cilia and flagella associated protein 161 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11768 ? EM:13401 C57BL/6NCrl-Cerkl/Ieg EMMA sperm mutant strain MGI:6472609 Cerkl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3037816 Cerkl ceramide kinase-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13401 ? EM:12863 C57BL/6NCrl-Cer1/Ph EMMA sperm mutant strain Cer1 CRISPR/CAS9 targeted mutation , undef MGI:1201414 Cer1 cerberus 1, DAN family BMP antagonist https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12863 ? EM:13718 C57BL/6NCrl-Cep170b/Ieg EMMA sperm mutant strain MGI:6403701 Cep170b endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2145043 Cep170b centrosomal protein 170B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13718 ? EM:13588 C57BL/6NCrl-Cenpv/Ieg EMMA sperm mutant strain Cenpv CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1920389 Cenpv centromere protein V https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13588 + EM:11688 C57BL/6NCrl-Cckar/Ieg EMMA sperm mutant strain MGI:6120823 Cckar targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:99478 Cckar cholecystokinin A receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11688 ? EM:14808 C57BL/6NCrl-Ccdc183/Ieg EMMA sperm mutant strain Ccdc183 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1924308 Ccdc183 coiled-coil domain containing 183 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14808 ? EM:14895 C57BL/6NCrl-Car3/Ieg EMMA sperm mutant strain Car3 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:88270 Car3 carbonic anhydrase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14895 + EM:11368 C57BL/6NCrl-Car14/Ieg EMMA sperm mutant strain MGI:6120708 Car14 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1344341 Car14 carbonic anhydrase 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11368 + EM:11526 C57BL/6NCrl-Camk2b/Ieg EMMA sperm mutant strain MGI:6120813 Camk2b targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:88257 Camk2b calcium/calmodulin-dependent protein kinase II, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11526 ? EM:15103 C57BL/6NCrl-C2cd4c/Ieg EMMA sperm mutant strain C2cd4c CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:2685084 C2cd4c C2 calcium-dependent domain containing 4C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=15103 ? EM:13428 C57BL/6NCrl-C1galt1/Ieg EMMA sperm mutant strain MGI:6273946 C1galt1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2151071 C1galt1 core 1 synthase, glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase, 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13428 + EM:12458 C57BL/6NCrl-Bysl/Ph EMMA sperm mutant strain MGI:6341843 Bysl endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1858419 Bysl bystin-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12458 + EM:12174 C57BL/6NCrl-Btbd8/Ph EMMA sperm mutant strain MGI:6341849 Btbd8 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3646208 Btbd8 BTB (POZ) domain containing 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12174 + EM:12342 C57BL/6NCrl-Btbd3/Ph EMMA sperm mutant strain MGI:5588286 Btbd3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2385155 Btbd3 BTB (POZ) domain containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12342 ? EM:12681 C57BL/6NCrl-Btbd18/Ph EMMA sperm mutant strain MGI:6341842 Btbd18 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3650217 Btbd18 BTB (POZ) domain containing 18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12681 ? EM:13647 C57BL/6NCrl-Btbd10/Ieg EMMA sperm mutant strain MGI:6399906 Btbd10 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1916065 Btbd10 BTB (POZ) domain containing 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13647 ? EM:13580 C57BL/6NCrl-Bsph2/Ieg EMMA sperm mutant strain MGI:6384596 Bsph2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1924934 Bsph2 binder of sperm protein homolog 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13580 ? EM:12731 C57BL/6NCrl-Bmp6/Ph EMMA sperm mutant strain MGI:6358085 Bmp6 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:88182 Bmp6 bone morphogenetic protein 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12731 + EM:11769 C57BL/6NCrl-Bmerb1/Ph EMMA sperm C57BL/6NCrl-2900011O08Rik/Ph mutant strain MGI:6152702 Bmerb1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1914504 Bmerb1 bMERB domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11769 ? EM:12236 C57BL/6NCrl-Birc6/Ph EMMA sperm mutant strain MGI:6341866 Birc6 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1276108 Birc6 baculoviral IAP repeat-containing 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12236 ? EM:13576 C57BL/6NCrl-Bcdin3d/Ieg EMMA sperm mutant strain Bcdin3d CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1922534 Bcdin3d BCDIN3 domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13576 ? EM:13615 C57BL/6NCrl-Aven/Ieg EMMA sperm mutant strain MGI:6403699 Aven endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1921518 Aven apoptosis, caspase activation inhibitor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13615 ? EM:14842 C57BL/6NCrl-Atrnl1/Ieg EMMA sperm mutant strain Atrnl1 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:2147749 Atrnl1 attractin like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14842 + EM:10365 C57BL/6NCrl-Atp9a/Ieg EMMA sperm mutant strain MGI:5704515 Atp9a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1330826 Atp9a ATPase, class II, type 9A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10365 ? EM:14830 C57BL/6NCrl-Atp8b3/Ieg EMMA sperm mutant strain Atp8b3 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1914581 Atp8b3 ATPase, class I, type 8B, member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14830 + EM:11458 C57BL/6NCrl-Atp6v0c/Ph EMMA sperm mutant strain MGI:6147532 Atp6v0c endonuclease mediated-mutation 2, Institute of Molecular Genetics MGI:88116 Atp6v0c ATPase, H+ transporting, lysosomal V0 subunit C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11458 ? EM:12172 C57BL/6NCrl-Atg7/Ph EMMA sperm mutant strain MGI:6341910 Atg7 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1921494 Atg7 autophagy related 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12172 + EM:12241 C57BL/6NCrl-Asb7/Ph EMMA sperm mutant strain MGI:6341901 Asb7 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2152835 Asb7 ankyrin repeat and SOCS box-containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12241 ? EM:12237 C57BL/6NCrl-Asb5/Ph EMMA sperm mutant strain MGI:6341940 Asb5 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1923544 Asb5 ankyrin repeat and SOCs box-containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12237 + EM:11871 C57BL/6NCrl-Asb4/Ph EMMA live mutant strain MGI:6341911 Asb4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1929751 Asb4 ankyrin repeat and SOCS box-containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11871 ? EM:12487 C57BL/6NCrl-Asb16/Ph EMMA sperm mutant strain MGI:6341953 Asb16 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2654437 Asb16 ankyrin repeat and SOCS box-containing 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12487 + EM:12193 C57BL/6NCrl-Arhgap26/Ieg EMMA sperm mutant strain MGI:6199115 Arhgap26 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1918552 Arhgap26 Rho GTPase activating protein 26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12193 ? EM:13605 C57BL/6NCrl-Arhgap15/Ieg EMMA sperm mutant strain MGI:6277012 Arhgap15 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1923367 Arhgap15 Rho GTPase activating protein 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13605 ? EM:13632 C57BL/6NCrl-Arfgef1/Ieg EMMA sperm mutant strain MGI:6423073 Arfgef1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2442988 Arfgef1 ADP-ribosylation factor guanine nucleotide-exchange factor 1(brefeldin A-inhibited) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13632 ? EM:13601 C57BL/6NCrl-Apoa4/Ieg EMMA sperm mutant strain MGI:6386312 Apoa4 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:88051 Apoa4 apolipoprotein A-IV https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13601 + EM:12256 C57BL/6NCrl-Aopep/Ph EMMA sperm mutant strain MGI:6209550 Aopep targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919311 Aopep aminopeptidase O https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12256 ? EM:13592 C57BL/6NCrl-Anpep/Ieg EMMA sperm mutant strain MGI:6367953 Anpep endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:5000466 Anpep alanyl (membrane) aminopeptidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13592 ? EM:13565 C57BL/6NCrl-Ankzf1/Ieg EMMA sperm mutant strain MGI:6382399 Ankzf1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1098746 Ankzf1 ankyrin repeat and zinc finger domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13565 + EM:11367 C57BL/6NCrl-Alkbh6/Ieg EMMA sperm mutant strain MGI:6120771 Alkbh6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2142037 Alkbh6 alkB homolog 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11367 ? EM:12693 C57BL/6NCrl-Aim2/Ph EMMA sperm mutant strain MGI:6341916 Aim2 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2686159 Aim2 absent in melanoma 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12693 ? EM:13487 C57BL/6NCrl-Ahctf1/Ieg EMMA sperm mutant strain MGI:6384598 Ahctf1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1915033 Ahctf1 AT hook containing transcription factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13487 ? EM:14730 C57BL/6NCrl-Agxt2/Ieg EMMA sperm mutant strain MGI:6450144 Agxt2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2146052 Agxt2 alanine-glyoxylate aminotransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14730 ? EM:15099 C57BL/6NCrl-Aff2/Ieg EMMA sperm mutant strain Aff2 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1202294 Aff2 AF4/FMR2 family, member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=15099 ? EM:13613 C57BL/6NCrl-Adam30/Ieg EMMA sperm mutant strain Adam30 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1918328 Adam30 a disintegrin and metallopeptidase domain 30 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13613 ? EM:12723 C57BL/6NCrl-Actr3/Ph EMMA sperm mutant strain MGI:6358065 Actr3 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1921367 Actr3 ARP3 actin-related protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12723 ? EM:13572 C57BL/6NCrl-Acsf3/Ieg EMMA sperm mutant strain Acsf3 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:2182591 Acsf3 acyl-CoA synthetase family member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13572 ? EM:13708 C57BL/6NCrl-Acp6/Ieg EMMA sperm mutant strain MGI:6449047 Acp6 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1931010 Acp6 acid phosphatase 6, lysophosphatidic https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13708 ? EM:13568 C57BL/6NCrl-Acnat2/Ieg EMMA sperm mutant strain MGI:6361231 Acnat2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2444345 Acnat2 acyl-coenzyme A amino acid N-acyltransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13568 + EM:12339 C57BL/6NCrl-Abcg8/Ph EMMA sperm mutant strain MGI:5810735 Abcg8 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914720 Abcg8 ATP binding cassette subfamily G member 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12339 ? EM:13587 C57BL/6NCrl-Abcg3/Ieg EMMA sperm mutant strain MGI:6399880 Abcg3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1351624 Abcg3 ATP binding cassette subfamily G member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13587 + EM:11335 C57BL/6NCrl-3425401B19Rik/Ph EMMA sperm mutant strain MGI:6147530 3425401B19Rik endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:3588196 3425401B19Rik RIKEN cDNA 3425401B19 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11335 + EM:11302 C57BL/6NCrl-2510009E07Rik/Ph EMMA sperm C57BL/6NCrl-2510009E07Rik/Ph mutant strain MGI:6147529 2510009E07Rik endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1919440 2510009E07Rik RIKEN cDNA 2510009E07 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11302 ? EM:13650 C57BL/6NCrl-1810055G02Rik/Ieg EMMA sperm mutant strain MGI:6388367 1810055G02Rik endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1919306 1810055G02Rik RIKEN cDNA 1810055G02 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13650 ? EM:13569 C57BL/6NCrl-1700021F07Rik/Ieg EMMA sperm mutant strain MGI:6386309 1700021F07Rik endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1919471 1700021F07Rik RIKEN cDNA 1700021F07 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13569 ? EM:13648 C57BL/6NCrl-1300017J02Rik/Ieg EMMA sperm mutant strain 1300017J02Rik CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1919025 Inhca inhibitor of carbonic anhydrase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13648 ? EM:14267 C57BL/6N;C57BL/6NTac-Zfp239/WtsiIeg EMMA sperm mutant strain MGI:5636945 Zfp239 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1306812 Zfp239 zinc finger protein 239 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14267 ? EM:14147 C57BL/6N;C57BL/6NTac-Vwa3a/WtsiIeg EMMA sperm mutant strain MGI:5637178 Vwa3a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3041229 Vwa3a von Willebrand factor A domain containing 3A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14147 ? EM:14321 C57BL/6N;C57BL/6NTac-Ssr2/WtsiCnbc EMMA archived mutant strain MGI:5637009 Ssr2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913506 Ssr2 signal sequence receptor, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14321 - EM:14142 C57BL/6N;C57BL/6NTac-Kif13b/WtsiOulu EMMA embryo mutant strain MGI:5636925 Kif13b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1098265 Kif13b kinesin family member 13B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14142 - EM:14142 C57BL/6N;C57BL/6NTac-Kif13b/WtsiOulu EMMA sperm mutant strain MGI:5636925 Kif13b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1098265 Kif13b kinesin family member 13B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14142 ? EM:14424 C57BL/6N;C57BL/6NTac-Galntl5/WtsiCnbc EMMA archived mutant strain MGI:5577268 Galntl5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915159 Galntl5 UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase-like 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14424 - EM:14190 C57BL/6N;C57BL/6NTac-Exosc9/WtsiOulu EMMA embryo mutant strain MGI:5636988 Exosc9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1355319 Exosc9 exosome component 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14190 - EM:14190 C57BL/6N;C57BL/6NTac-Exosc9/WtsiOulu EMMA sperm mutant strain MGI:5636988 Exosc9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1355319 Exosc9 exosome component 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14190 ? EM:14426 C57BL/6N;C57BL/6NTac-D6Wsu163e/WtsiIeg EMMA sperm mutant strain MGI:5636910 D6Wsu163e targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107893 D6Wsu163e DNA segment, Chr 6, Wayne State University 163, expressed https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14426 ? EM:14134 C57BL/6N;C57BL/6NTac-Cgrrf1/WtsiIeg EMMA sperm mutant strain MGI:5637038 Cgrrf1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916368 Cgrrf1 cell growth regulator with ring finger domain 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14134 ? EM:14335 C57BL/6N;C57BL/6NTac-Bivm/WtsiIeg EMMA sperm mutant strain MGI:5637122 Bivm targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2179809 Bivm basic, immunoglobulin-like variable motif containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14335 - EM:14675 C57BL/6N.B6J-Atp8/IbraH EMMA embryo unclassified MGI:4355536 mt-Atp8 mutation 1 MGI:99926 mt-Atp8 mitochondrially encoded ATP synthase 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14675 + EM:13822 C57BL/6N-Zup1/WtsiOulu EMMA embryo mutant strain MGI:6153719 Zup1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919830 Zup1 zinc finger containing ubiquitin peptidase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13822 + EM:13822 C57BL/6N-Zup1/WtsiOulu EMMA sperm mutant strain MGI:6153719 Zup1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919830 Zup1 zinc finger containing ubiquitin peptidase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13822 + EM:14597 C57BL/6N-Zswim3/WtsiOulu EMMA embryo mutant strain MGI:6336067 Zswim3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914788 Zswim3 zinc finger SWIM-type containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14597 + EM:14597 C57BL/6N-Zswim3/WtsiOulu EMMA sperm mutant strain MGI:6336067 Zswim3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914788 Zswim3 zinc finger SWIM-type containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14597 + EM:12657 C57BL/6N-Zscan29/Orl EMMA sperm mutant strain MGI:6406851 Zscan29 endonuclease-mediated mutation 1, Centre d'ImmunoPhenomique MGI:2139317 Zscan29 zinc finger SCAN domains 29 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12657 + EM:11582 C57BL/6N-Zmynd11/WtsiIeg EMMA sperm mutant strain MGI:6119402 Zmynd11 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1913755 Zmynd11 zinc finger, MYND domain containing 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11582 ? EM:14449 C57BL/6N-Zmym4/WtsiPh EMMA sperm mutant strain MGI:6153718 Zmym4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1915035 Zmym4 zinc finger, MYM-type 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14449 + EM:12827 C57BL/6N-Zmiz1/H EMMA live mutant strain MGI:6314264 Zmiz1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3040693 Zmiz1 zinc finger, MIZ-type containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12827 + EM:11504 C57BL/6N-Zmiz1/H EMMA sperm mutant strain MGI:4451804 Zmiz1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3040693 Zmiz1 zinc finger, MIZ-type containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11504 + EM:11504 C57BL/6N-Zmiz1/H EMMA live mutant strain MGI:4451804 Zmiz1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3040693 Zmiz1 zinc finger, MIZ-type containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11504 + EM:10354 C57BL/6N-Zkscan17/WtsiBiat EMMA sperm mutant strain MGI:5548856 Zkscan17 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2679270 Zkscan17 zinc finger with KRAB and SCAN domains 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10354 + EM:14319 C57BL/6N-Zfyve28/WtsiH EMMA live mutant strain MGI:5637169 Zfyve28 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2684992 Zfyve28 zinc finger, FYVE domain containing 28 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14319 ? EM:14239 C57BL/6N-Zfp879/WtsiOrl EMMA sperm mutant strain MGI:5637179 Zfp879 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:3053099 Zfp879 zinc finger protein 879 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14239 ? EM:14258 C57BL/6N-Zfp84/WtsiOrl EMMA sperm mutant strain MGI:5636909 Zfp84 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107780 Zfp84 zinc finger protein 84 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14258 + EM:11161 C57BL/6N-Zfp763/WtsiH EMMA sperm mutant strain MGI:6153715 Zfp763 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1920701 Zfp763 zinc finger protein 763 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11161 + EM:04803 C57BL/6N-Zfp760/Ieg EMMA embryo B6NTac;B6N-Zfp760/Ieg mutant strain MGI:4436640 Zfp760 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2679257 Zfp760 zinc finger protein 760 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4803 + EM:08895 C57BL/6N-Zfp719/WtsiIeg EMMA sperm mutant strain MGI:5548829 Zfp719 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2444708 Zfp719 zinc finger protein 719 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8895 + EM:09715 C57BL/6N-Zfp69/Ieg EMMA sperm mutant strain MGI:5692574 Zfp69 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:107794 Zfp69 zinc finger protein 69 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9715 + EM:08587 C57BL/6N-Zfp69/Ieg EMMA embryo mutant strain MGI:5286360 Zfp69 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107794 Zfp69 zinc finger protein 69 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8587 + EM:14241 C57BL/6N-Zfp664/WtsiH EMMA live mutant strain MGI:5708248 Zfp664 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442505 Zfp664 zinc finger protein 664 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14241 ? EM:14238 C57BL/6N-Zfp658/WtsiCnbc EMMA archived mutant strain MGI:5637160 Zfp658 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2652821 Zfp658 zinc finger protein 658 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14238 - EM:05805 C57BL/6N-Zfp61/Cnrm EMMA sperm mutant strain MGI:4436153 Zfp61 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99663 Zfp61 zinc finger protein 61 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5805 + EM:08570 C57BL/6N-Zfp616/WtsiH EMMA sperm mutant strain MGI:5548908 Zfp616 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3650906 Zfp616 zinc finger protein 616 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8570 ? EM:14549 C57BL/6N-Zfp54/WtsiPh EMMA sperm mutant strain MGI:6153708 Zfp54 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:99201 Zfp54 zinc finger protein 54 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14549 + EM:09252 C57BL/6N-Zfp445/Ieg EMMA sperm mutant strain MGI:5613658 Zfp445 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2143340 Zfp445 zinc finger protein 445 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9252 + EM:08509 C57BL/6N-Zfp445/Ieg EMMA sperm mutant strain MGI:4849402 Zfp445 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2143340 Zfp445 zinc finger protein 445 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8509 + EM:14310 C57BL/6N-Zfp408/WtsiH EMMA live mutant strain MGI:5637174 Zfp408 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2685857 Zfp408 zinc finger protein 408 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14310 + EM:14155 C57BL/6N-Zfp292/WtsiOulu EMMA embryo mutant strain MGI:6120714 Zfp292 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1353423 Zfp292 zinc finger protein 292 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14155 + EM:14155 C57BL/6N-Zfp292/WtsiOulu EMMA sperm mutant strain MGI:6120714 Zfp292 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1353423 Zfp292 zinc finger protein 292 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14155 ? EM:14344 C57BL/6N-Zfp287/WtsiIeg EMMA sperm mutant strain MGI:5548771 Zfp287 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2176561 Zfp287 zinc finger protein 287 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14344 ? EM:14296 C57BL/6N-Zfp266/WtsiIeg EMMA sperm mutant strain MGI:5637091 Zfp266 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924769 Zfp266 zinc finger protein 266 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14296 + EM:14510 C57BL/6N-Zfp219/WtsiH EMMA live mutant strain MGI:5796933 Zfp219 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1917140 Zfp219 zinc finger protein 219 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14510 + EM:06803 C57BL/6N-Zfp207/H EMMA sperm B6NTac;B6N-Zfp207/H mutant strain MGI:4847731 Zfp207 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1340045 Zfp207 zinc finger protein 207 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6803 + EM:08250 C57BL/6N-Zfp182/WtsiPh EMMA sperm mutant strain MGI:5552020 Zfp182 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442220 Zfp182 zinc finger protein 182 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8250 + EM:08472 C57BL/6N-Zfp119a/Ieg EMMA sperm mutant strain MGI:5548456 Zfp119a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1345189 Zfp119a zinc finger protein 119a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8472 + EM:08462 C57BL/6N-Zfp119a/Ieg EMMA embryo mutant strain MGI:4458716 Zfp119a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1345189 Zfp119a zinc finger protein 119a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8462 - EM:05839 C57BL/6N-Zdhhc5/Cnrm EMMA sperm mutant strain MGI:4841863 Zdhhc5 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1923573 Zdhhc5 zinc finger, DHHC domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5839 + EM:05657 C57BL/6N-Zdhhc24/H EMMA sperm B6NTac;B6N-Zdhhc24/H mutant strain MGI:4435901 Zdhhc24 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917855 Zdhhc24 zinc finger, DHHC domain containing 24 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5657 + EM:08113 C57BL/6N-Zbtb24/Ieg EMMA sperm mutant strain MGI:5548888 Zbtb24 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3039618 Zbtb24 zinc finger and BTB domain containing 24 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8113 + EM:06925 C57BL/6N-Zbtb24/Ieg EMMA sperm mutant strain MGI:4458660 Zbtb24 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3039618 Zbtb24 zinc finger and BTB domain containing 24 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6925 - EM:06000 C57BL/6N-Zbtb1/Cnrm EMMA sperm mutant strain MGI:4441870 Zbtb1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2442326 Zbtb1 zinc finger and BTB domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6000 ? EM:14194 C57BL/6N-Zbed5/WtsiIeg EMMA sperm mutant strain MGI:5637059 Zbed5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919220 Zbed5 zinc finger BED-type containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14194 + EM:08661 C57BL/6N-Yae1d1/Ieg EMMA sperm mutant strain MGI:5548529 Yae1d1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914258 Yae1d1 Yae1 domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8661 + EM:08638 C57BL/6N-Yae1d1/Ieg EMMA embryo mutant strain MGI:4888902 Yae1d1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914258 Yae1d1 Yae1 domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8638 + EM:10578 C57BL/6N-Xpr1/Ph EMMA archived mutant strain MGI:4362650 Xpr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97932 Xpr1 xenotropic and polytropic retrovirus receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10578 ? EM:14523 C57BL/6N-Xkrx/WtsiIeg EMMA sperm mutant strain MGI:5637183 Xkrx targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3584011 Xkrx X-linked Kx blood group related, X-linked https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14523 + EM:09251 C57BL/6N-Xkr5/Ieg EMMA sperm mutant strain MGI:5613662 Xkr5 targeted mutation 1b, Mouse Biology Program, UCDavis MGI:2442327 Xkr5 X-linked Kx blood group related 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9251 + EM:08726 C57BL/6N-Xkr5/Ieg EMMA embryo mutant strain MGI:4840884 Xkr5 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:2442327 Xkr5 X-linked Kx blood group related 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8726 + EM:04978 C57BL/6N-Wtap/H EMMA sperm B6NTac;B6N-Wtap/H mutant strain MGI:4434984 Wtap targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1926395 Wtap WT1 associating protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4978 + EM:08073 C57BL/6N-Wsb2/Ieg EMMA embryo mutant strain MGI:5548747 Wsb2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2144041 Wsb2 WD repeat and SOCS box-containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8073 ? EM:14329 C57BL/6N-Wrap53/WtsiCnbc EMMA archived mutant strain MGI:5637129 Wrap53 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2384933 Wrap53 WD repeat containing, antisense to Trp53 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14329 + EM:10353 C57BL/6N-Wnt16/WtsiBiat EMMA sperm mutant strain MGI:5548733 Wnt16 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2136018 Wnt16 wingless-type MMTV integration site family, member 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10353 - EM:05953 C57BL/6N-Wls/Cnrm EMMA sperm mutant strain MGI:4455675 Wls targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915401 Wls wntless WNT ligand secretion mediator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5953 ? EM:14343 C57BL/6N-Wfikkn2/WtsiIeg EMMA sperm mutant strain MGI:5637164 Wfikkn2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2669209 Wfikkn2 WAP, follistatin/kazal, immunoglobulin, kunitz and netrin domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14343 + EM:04722 C57BL/6N-Washc5/Ieg EMMA embryo B6NTac;B6N-E430025E21Rik/Ieg, C57BL/6N-E430025E21Rik/Ieg mutant strain MGI:4435153 Washc5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2146110 Washc5 WASH complex subunit 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4722 + EM:14186 C57BL/6N-Washc2/WtsiOulu EMMA embryo mutant strain MGI:5692563 Washc2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:106463 Washc2 WASH complex subunit 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14186 + EM:14186 C57BL/6N-Washc2/WtsiOulu EMMA sperm mutant strain MGI:5692563 Washc2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:106463 Washc2 WASH complex subunit 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14186 + EM:08360 C57BL/6N-Wars/Ieg EMMA sperm mutant strain MGI:5548346 Wars1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:104630 Wars1 tryptophanyl-tRNA synthetase1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8360 + EM:08109 C57BL/6N-Wars/Ieg EMMA embryo B6NTac;B6N-Wars/Ieg mutant strain MGI:4435065 Wars1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104630 Wars1 tryptophanyl-tRNA synthetase1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8109 + EM:12198 C57BL/6N-Wac/Wtsi EMMA embryo mutant strain MGI:5925355 Wac targeted mutation 2c, Wellcome Trust Sanger Institute MGI:2387357 Wac WW domain containing adaptor with coiled-coil https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12198 + EM:12198 C57BL/6N-Wac/Wtsi EMMA sperm mutant strain MGI:5925355 Wac targeted mutation 2c, Wellcome Trust Sanger Institute MGI:2387357 Wac WW domain containing adaptor with coiled-coil https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12198 ? EM:14212 C57BL/6N-Wac/WtsiCnbc EMMA archived mutant strain MGI:5637134 Wac targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2387357 Wac WW domain containing adaptor with coiled-coil https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14212 + EM:07936 C57BL/6N-Vxn/WtsiCnrm EMMA sperm C57BL/6N-3110035E14Rik/WtsiCnrm mutant strain MGI:5548679 Vxn targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924232 Vxn vexin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7936 + EM:09346 C57BL/6N-Vwa8/Ieg EMMA sperm mutant strain MGI:5614704 Vwa8 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919008 Vwa8 von Willebrand factor A domain containing 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9346 + EM:08643 C57BL/6N-Vwa8/Ieg EMMA sperm mutant strain MGI:4441772 Vwa8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919008 Vwa8 von Willebrand factor A domain containing 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8643 ? EM:13938 C57BL/6N-Vsig10/WtsiCnbc EMMA sperm mutant strain MGI:6153703 Vsig10 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2448533 Vsig10 V-set and immunoglobulin domain containing 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13938 ? EM:13922 C57BL/6N-Vrk1/WtsiCnbc EMMA sperm mutant strain MGI:6153762 Vrk1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1261847 Vrk1 vaccinia related kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13922 + EM:08097 C57BL/6N-Vps13c/Ieg EMMA sperm mutant strain MGI:5548822 Vps13c targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2444207 Vps13c vacuolar protein sorting 13C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8097 + EM:09150 C57BL/6N-Vps13c/Ieg EMMA sperm mutant strain MGI:4460376 Vps13c targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444207 Vps13c vacuolar protein sorting 13C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9150 ? EM:14508 C57BL/6N-Vps13a/WtsiIeg EMMA sperm mutant strain MGI:5637150 Vps13a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2444304 Vps13a vacuolar protein sorting 13A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14508 ? EM:13917 C57BL/6N-Vpreb3/WtsiCnbc EMMA sperm mutant strain MGI:6153702 Vpreb3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:98938 Vpreb3 V-set pre-B cell surrogate light chain 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13917 - EM:05505 C57BL/6N-Vmp1/Ieg EMMA sperm mutant strain MGI:6386775 Vmp1 targeted mutation 1.1, TaconicArtemis MGI:1923159 Vmp1 vacuole membrane protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5505 - EM:05506 C57BL/6N-Vmp1/Ieg EMMA embryo mutant strain MGI:6386774 Vmp1 targeted mutation 1.1, TaconicArtemis MGI:1923159 Vmp1 vacuole membrane protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5506 ? EM:14458 C57BL/6N-Vmn2r27/WtsiCnbc EMMA sperm mutant strain MGI:6153701 Vmn2r27 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3761517 Vmn2r27 vomeronasal 2, receptor27 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14458 + EM:14581 C57BL/6N-Vil1/WtsiOulu EMMA embryo mutant strain MGI:6153700 Vil1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:98930 Vil1 villin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14581 + EM:14581 C57BL/6N-Vil1/WtsiOulu EMMA sperm mutant strain MGI:6153700 Vil1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:98930 Vil1 villin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14581 + EM:11130 C57BL/6N-Vgll4/Ieg EMMA sperm mutant strain MGI:4841645 Vgll4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2652840 Vgll4 vestigial like family member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11130 ? EM:13862 C57BL/6N-Vgf/WtsiCnbc EMMA sperm mutant strain MGI:6153761 Vgf endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1343180 Vgf VGF nerve growth factor inducible https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13862 + EM:10235 C57BL/6N-Vdac1/Ieg EMMA sperm mutant strain MGI:5701719 Vdac1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106919 Vdac1 voltage-dependent anion channel 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10235 + EM:08577 C57BL/6N-Vdac1/Ieg EMMA sperm mutant strain MGI:4432270 Vdac1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106919 Vdac1 voltage-dependent anion channel 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8577 ? EM:14242 C57BL/6N-Vamp3/WtsiOrl EMMA sperm mutant strain MGI:5692605 Vamp3 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1321389 Vamp3 vesicle-associated membrane protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14242 + EM:08285 C57BL/6N-Usp54/H EMMA sperm mutant strain MGI:5286230 Usp54 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926037 Usp54 ubiquitin specific peptidase 54 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8285 + EM:13819 C57BL/6N-Usp51/WtsiOulu EMMA embryo mutant strain MGI:6153699 Usp51 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3588217 Usp51 ubiquitin specific protease 51 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13819 + EM:13819 C57BL/6N-Usp51/WtsiOulu EMMA sperm mutant strain MGI:6153699 Usp51 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3588217 Usp51 ubiquitin specific protease 51 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13819 + EM:14219 C57BL/6N-Usp44/WtsiPh EMMA live mutant strain MGI:5708261 Usp44 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3045318 Usp44 ubiquitin specific peptidase 44 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14219 - EM:05481 C57BL/6N-Usp38/H EMMA sperm B6NTac;B6N-Usp38/H mutant strain MGI:4455680 Usp38 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922091 Usp38 ubiquitin specific peptidase 38 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5481 + EM:11162 C57BL/6N-Usp37/WtsiH EMMA sperm mutant strain MGI:6153697 Usp37 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2442483 Usp37 ubiquitin specific peptidase 37 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11162 + EM:10743 C57BL/6N-Usp30/H EMMA sperm C57BL/6N-Usp30/WtsiH mutant strain MGI:5790643 Usp30 targeted mutation 2c, Helmholtz Zentrum Muenchen GmbH MGI:2140991 Usp30 ubiquitin specific peptidase 30 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10743 - EM:14214 C57BL/6N-Usp30/WtsiH EMMA live C57BL/6N-Usp30/Wtsi mutant strain MGI:5692776 Usp30 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2140991 Usp30 ubiquitin specific peptidase 30 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14214 + EM:08280 C57BL/6N-Usp2/H EMMA sperm mutant strain MGI:5286393 Usp2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858178 Usp2 ubiquitin specific peptidase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8280 + EM:14403 C57BL/6N-Usp19/WtsiOulu EMMA embryo mutant strain MGI:5796934 Usp19 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1918722 Usp19 ubiquitin specific peptidase 19 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14403 + EM:14403 C57BL/6N-Usp19/WtsiOulu EMMA sperm mutant strain MGI:5796934 Usp19 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1918722 Usp19 ubiquitin specific peptidase 19 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14403 ? EM:13193 C57BL/6N-Usp15/WtsiH EMMA sperm mutant strain MGI:5708164 Usp15 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:101857 Usp15 ubiquitin specific peptidase 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13193 + EM:07787 C57BL/6N-Usp14/H EMMA sperm B6NTac;B6N-Usp14/H mutant strain MGI:4460420 Usp14 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1928898 Usp14 ubiquitin specific peptidase 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7787 + EM:12707 C57BL/6N-Usp13/WtsiH EMMA live mutant strain MGI:5701723 Usp13 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919857 Usp13 ubiquitin specific peptidase 13 (isopeptidase T-3) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12707 + EM:08062 C57BL/6N-Usp12/Ieg EMMA embryo mutant strain MGI:5548414 Usp12 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1270128 Usp12 ubiquitin specific peptidase 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8062 ? EM:14195 C57BL/6N-Usf1/WtsiIeg EMMA sperm mutant strain MGI:6120824 Usf1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:99542 Usf1 upstream transcription factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14195 + EM:10141 C57BL/6N-Uqcrh/Ieg EMMA sperm mutant strain MGI:5692661 Uqcrh targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913826 Uqcrh ubiquinol-cytochrome c reductase hinge protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10141 + EM:10079 C57BL/6N-Uqcrh/Ieg EMMA sperm mutant strain MGI:4431969 Uqcrh targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913826 Uqcrh ubiquinol-cytochrome c reductase hinge protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10079 + EM:08081 C57BL/6N-Uqcrb/Ieg EMMA sperm mutant strain MGI:5548543 Uqcrb targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914780 Uqcrb ubiquinol-cytochrome c reductase binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8081 + EM:06277 C57BL/6N-Uqcrb/Ieg EMMA embryo B6NTac;B6N-Uqcrb/Ieg mutant strain MGI:5006762 Uqcrb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914780 Uqcrb ubiquinol-cytochrome c reductase binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6277 + EM:06277 C57BL/6N-Uqcrb/Ieg EMMA sperm B6NTac;B6N-Uqcrb/Ieg mutant strain MGI:5006762 Uqcrb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914780 Uqcrb ubiquinol-cytochrome c reductase binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6277 + EM:08419 C57BL/6N-Unc45a/Ieg EMMA sperm mutant strain MGI:5759982 Unc45a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2142246 Unc45a unc-45 myosin chaperone A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8419 + EM:12755 C57BL/6N-Uggt2/Ieg EMMA sperm mutant strain MGI:4451533 Uggt2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913685 Uggt2 UDP-glucose glycoprotein glucosyltransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12755 + EM:08087 C57BL/6N-Ucp1/Ieg EMMA sperm mutant strain MGI:5692920 Ucp1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:98894 Ucp1 uncoupling protein 1 (mitochondrial, proton carrier) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8087 + EM:05767 C57BL/6N-Ucp1/Ieg EMMA sperm mutant strain MGI:4841543 Ucp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98894 Ucp1 uncoupling protein 1 (mitochondrial, proton carrier) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5767 + EM:09187 C57BL/6N-Uchl1/H EMMA sperm mutant strain MGI:4451787 Uchl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103149 Uchl1 ubiquitin carboxy-terminal hydrolase L1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9187 ? EM:14427 C57BL/6N-Ubxn10/WtsiCnbc EMMA archived mutant strain MGI:5637146 Ubxn10 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443123 Ubxn10 UBX domain protein 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14427 + EM:14137 C57BL/6N-Ube2t/WtsiH EMMA live mutant strain MGI:5692669 Ube2t targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914446 Ube2t ubiquitin-conjugating enzyme E2T https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14137 + EM:09106 C57BL/6N-Ubash3a/Ieg EMMA sperm mutant strain MGI:5605803 Ubash3a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1926074 Ubash3a ubiquitin associated and SH3 domain containing, A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9106 + EM:11090 C57BL/6N-Ubac2/Ieg EMMA sperm mutant strain MGI:4453674 Ubac2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916139 Ubac2 ubiquitin associated domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11090 ? EM:12719 C57BL/6N-Tyr Styk1/Biat EMMA sperm mutant strain MGI:5428590 Styk1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2141396 Styk1 serine/threonine/tyrosine kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12719 + EM:11178 C57BL/6N-Tyk2/Ieg EMMA sperm mutant strain MGI:5511690 Tyk2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1929470 Tyk2 tyrosine kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11178 + EM:07875 C57BL/6N-Txnip/H EMMA sperm C57BL/6NTac-Txnip/H, B6NTac;B6N-Txnip/H mutant strain MGI:5008885 Txnip targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1889549 Txnip thioredoxin interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7875 + EM:10165 C57BL/6N-Txlna/H EMMA sperm mutant strain MGI:4436006 Txlna targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:105968 Txlna taxilin alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10165 ? EM:05504 C57BL/6N-Twist1/Ieg EMMA embryo mutant strain Twist1 Twist1 MGI:98872 Twist1 twist basic helix-loop-helix transcription factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5504 ? EM:14786 C57BL/6N-Tut7/WtsiCnbc EMMA sperm mutant strain MGI:6257698 Tut7 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2387179 Tut7 terminal uridylyl transferase 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14786 + EM:10971 C57BL/6N-Tulp4/Biat EMMA sperm mutant strain MGI:4365109 Tulp4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916092 Tulp4 tubby like protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10971 + EM:10464 C57BL/6N-Tulp3/H EMMA sperm C57BL/6NTac-Tulp3/H mutant strain MGI:5752546 Tulp3 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1329045 Tulp3 tubby-like protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10464 ? EM:14572 C57BL/6N-Tuba4a/WtsiCnbc EMMA sperm mutant strain MGI:6153696 Tuba4a endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1095410 Tuba4a tubulin, alpha 4A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14572 ? EM:14305 C57BL/6N-Tuba3a/WtsiCnbc EMMA archived mutant strain MGI:5636920 Tuba3a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1095406 Tuba3a tubulin, alpha 3A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14305 + EM:14429 C57BL/6N-Ttll10/WtsiPh EMMA live mutant strain MGI:5775002 Ttll10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1921855 Ttll10 tubulin tyrosine ligase-like family, member 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14429 + EM:09345 C57BL/6N-Tspo/Ieg EMMA sperm mutant strain MGI:5614711 Tspo targeted mutation 1b, Wellcome Trust Sanger Institute MGI:88222 Tspo translocator protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9345 + EM:08606 C57BL/6N-Tspo/Ieg EMMA embryo mutant strain MGI:5009653 Tspo targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88222 Tspo translocator protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8606 ? EM:14464 C57BL/6N-Tspan33/WtsiCnbc EMMA sperm mutant strain MGI:6153695 Tspan33 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919012 Tspan33 tetraspanin 33 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14464 + EM:11760 C57BL/6N-Tsks/WtsiCnrm EMMA sperm mutant strain MGI:6152743 Tsks endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1347560 Tsks testis-specific serine kinase substrate https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11760 + EM:11113 C57BL/6N-Trpm7/H EMMA live mutant strain MGI:4841295 Trpm7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929996 Trpm7 transient receptor potential cation channel, subfamily M, member 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11113 + EM:10641 C57BL/6N-Trp53bp2/H EMMA sperm mutant strain MGI:4881993 Trp53bp2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2138319 Trp53bp2 transformation related protein 53 binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10641 + EM:11741 C57BL/6N-Trp53/H EMMA live mutant strain MGI:4451930 Trp53 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98834 Trp53 transformation related protein 53 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11741 + EM:13813 C57BL/6N-Troap/WtsiOulu EMMA embryo mutant strain MGI:6153693 Troap endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1925983 Troap trophinin associated protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13813 + EM:13813 C57BL/6N-Troap/WtsiOulu EMMA sperm mutant strain MGI:6153693 Troap endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1925983 Troap trophinin associated protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13813 ? EM:14420 C57BL/6N-Trmt2a/WtsiIeg EMMA sperm mutant strain MGI:5548943 Trmt2a targeted mutation 2b, Wellcome Trust Sanger Institute MGI:96270 Trmt2a TRM2 tRNA methyltransferase 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14420 + EM:11038 C57BL/6N-Trmt2a/Ieg EMMA sperm mutant strain MGI:5811627 Trmt2a targeted mutation 1.1, Velocigene MGI:96270 Trmt2a TRM2 tRNA methyltransferase 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11038 ? EM:13719 C57BL/6N-Triqk/WtsiOrl EMMA sperm mutant strain MGI:6257646 Triqk endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:3650048 Triqk triple QxxK/R motif containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13719 ? EM:13867 C57BL/6N-Trim6/WtsiCnbc EMMA sperm mutant strain MGI:6153691 Trim6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2137352 Trim6 tripartite motif-containing 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13867 ? EM:14151 C57BL/6N-Trim65/WtsiIeg EMMA sperm mutant strain MGI:5637142 Trim65 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442815 Trim65 tripartite motif-containing 65 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14151 + EM:09687 C57BL/6N-Trim39/H EMMA sperm mutant strain MGI:4434684 Trim39 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1890659 Trim39 tripartite motif-containing 39 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9687 + EM:07620 C57BL/6N-Trim29/WtsiCnrm EMMA sperm mutant strain MGI:5548617 Trim29 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919419 Trim29 tripartite motif-containing 29 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7620 + EM:14422 C57BL/6N-Trim25/WtsiOulu EMMA embryo mutant strain MGI:5692539 Trim25 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:102749 Trim25 tripartite motif-containing 25 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14422 + EM:14422 C57BL/6N-Trim25/WtsiOulu EMMA sperm mutant strain MGI:5692539 Trim25 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:102749 Trim25 tripartite motif-containing 25 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14422 + EM:11571 C57BL/6N-Trim21/WtsiIeg EMMA sperm mutant strain MGI:6140225 Trim21 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:106657 Trim21 tripartite motif-containing 21 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11571 + EM:13827 C57BL/6N-Trerf1/WtsiOulu EMMA embryo mutant strain MGI:6153688 Trerf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2442086 Trerf1 transcriptional regulating factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13827 + EM:13827 C57BL/6N-Trerf1/WtsiOulu EMMA sperm mutant strain MGI:6153688 Trerf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2442086 Trerf1 transcriptional regulating factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13827 + EM:08667 C57BL/6N-Treml1/H EMMA sperm mutant strain MGI:4436002 Treml1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918576 Treml1 triggering receptor expressed on myeloid cells-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8667 + EM:11363 C57BL/6N-Trdmt1/H EMMA archived mutant strain MGI:5286348 Trdmt1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1274787 Trdmt1 tRNA aspartic acid methyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11363 ? EM:13923 C57BL/6N-Trbv19/WtsiPh EMMA sperm mutant strain MGI:6153687 Trbv19 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:98604 Trbv19 T cell receptor beta, variable 19 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13923 + EM:11001 C57BL/6N-Trappc9/WtsiPh EMMA sperm mutant strain MGI:5692743 Trappc9 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1923760 Trappc9 trafficking protein particle complex 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11001 + EM:10214 C57BL/6N-Trappc14/H EMMA sperm C57BL/6N-BC037034/H, C57BL/6N-Map11/H mutant strain MGI:5511727 Trappc14 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2385896 Trappc14 trafficking protein particle complex 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10214 ? EM:14299 C57BL/6N-Trappc10/WtsiOrl EMMA sperm mutant strain MGI:5636961 Trappc10 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336209 Trappc10 trafficking protein particle complex 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14299 ? EM:05502 C57BL/6N-Traf7/Ieg EMMA embryo mutant strain Traf7 Traf7 MGI:3042141 Traf7 TNF receptor-associated factor 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5502 ? EM:05503 C57BL/6N-Traf7/Ieg EMMA embryo mutant strain Traf7 Traf7 MGI:3042141 Traf7 TNF receptor-associated factor 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5503 + EM:09049 C57BL/6N-Tpcn2/H EMMA sperm mutant strain MGI:5692810 Tpcn2 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:2385297 Tpcn2 two pore segment channel 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9049 + EM:05903 C57BL/6N-Tpcn2/H EMMA sperm HEPD0665_2_C10, B6NTac;B6N-Tpcn2/H mutant strain MGI:4842149 Tpcn2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385297 Tpcn2 two pore segment channel 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5903 + EM:08142 C57BL/6N-Tomm20l/WtsiCnrm EMMA sperm mutant strain MGI:5548653 Tomm20l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922516 Tomm20l translocase of outer mitochondrial membrane 20-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8142 + EM:09414 C57BL/6N-Tnxb/H EMMA sperm mutant strain MGI:4451866 Tnxb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1932137 Tnxb tenascin XB https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9414 ? EM:14489 C57BL/6N-Tnpo1/WtsiIeg EMMA sperm mutant strain Tnpo1 KOMP targeted mutation 2e, Wellcome Trust Sanger Institute MGI:2681523 Tnpo1 transportin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14489 ? EM:13731 C57BL/6N-Tnpo1/WtsiOrl EMMA sperm mutant strain MGI:6336064 Tnpo1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2681523 Tnpo1 transportin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13731 + EM:14217 C57BL/6N-Tnfsf18/WtsiH EMMA live mutant strain MGI:5796938 Tnfsf18 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2673064 Tnfsf18 tumor necrosis factor (ligand) superfamily, member 18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14217 ? EM:05501 C57BL/6N-Tnfsf13b/Ieg EMMA embryo mutant strain Tnfsf13b Tnfsf13b MGI:1344376 Tnfsf13b tumor necrosis factor (ligand) superfamily, member 13b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5501 + EM:09866 C57BL/6N-Tnfrsf1a/H EMMA sperm mutant strain MGI:5473067 Tnfrsf1a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1314884 Tnfrsf1a tumor necrosis factor receptor superfamily, member 1a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9866 ? EM:14300 C57BL/6N-Tmprss11c/WtsiIeg EMMA sperm mutant strain MGI:5708263 Tmprss11c targeted mutation 2b, Wellcome Trust Sanger Institute MGI:3521861 Tmprss11c transmembrane protease, serine 11c https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14300 + EM:09685 C57BL/6N-Tmem51/H EMMA sperm mutant strain MGI:4951020 Tmem51 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384874 Tmem51 transmembrane protein 51 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9685 ? EM:05498 C57BL/6N-Tmem45b/Ieg EMMA embryo mutant strain Tmem45b Tmem45b MGI:2384574 Tmem45b transmembrane protein 45b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5498 ? EM:05499 C57BL/6N-Tmem45b/Ieg EMMA sperm mutant strain Tmem45b Tmem45b MGI:2384574 Tmem45b transmembrane protein 45b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5499 + EM:14169 C57BL/6N-Tmem241/WtsiPh EMMA live mutant strain MGI:5637138 Tmem241 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442435 Tmem241 transmembrane protein 241 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14169 ? EM:13712 C57BL/6N-Tmem235/WtsiOrl EMMA sperm mutant strain MGI:6257731 Tmem235 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:3651706 Tmem235 transmembrane protein 235 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13712 - EM:14281 C57BL/6N-Tmem211/WtsiOulu EMMA embryo C57BL/6N-Lhfpl7/WtsiOulu mutant strain Tmem211 KOMP targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2685700 Lhfpl7 LHFPL tetraspan subfamily member 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14281 - EM:14281 C57BL/6N-Tmem211/WtsiOulu EMMA sperm C57BL/6N-Lhfpl7/WtsiOulu mutant strain Tmem211 KOMP targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2685700 Lhfpl7 LHFPL tetraspan subfamily member 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14281 + EM:14132 C57BL/6N-Tmem18/WtsiPh EMMA live mutant strain MGI:5637133 Tmem18 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2387176 Tmem18 transmembrane protein 18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14132 + EM:10830 C57BL/6N-Tmem167/H EMMA sperm mutant strain MGI:4435969 Tmem167 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913324 Tmem167 transmembrane protein 167 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10830 ? EM:14448 C57BL/6N-Tmem14c/WtsiPh EMMA sperm mutant strain MGI:6153686 Tmem14c endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1913404 Tmem14c transmembrane protein 14C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14448 ? EM:13713 C57BL/6N-Tmem131/WtsiOrl EMMA sperm mutant strain MGI:6257725 Tmem131 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1927110 Tmem131 transmembrane protein 131 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13713 + EM:10130 C57BL/6N-Tmem116/Ieg EMMA sperm mutant strain MGI:5695121 Tmem116 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1924712 Tmem116 transmembrane protein 116 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10130 + EM:09480 C57BL/6N-Tmem116/Ieg EMMA embryo mutant strain MGI:5085387 Tmem116 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924712 Tmem116 transmembrane protein 116 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9480 + EM:08567 C57BL/6N-Tmc3/WtsiH EMMA sperm mutant strain MGI:5548850 Tmc3 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2669033 Tmc3 transmembrane channel-like gene family 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8567 ? EM:05496 C57BL/6N-Tlr9/Ieg EMMA embryo mutant strain Tlr9 Tlr9 MGI:1932389 Tlr9 toll-like receptor 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5496 ? EM:05497 C57BL/6N-Tlr9/Ieg EMMA embryo mutant strain Tlr9 Tlr9 MGI:1932389 Tlr9 toll-like receptor 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5497 ? EM:05500 C57BL/6N-Tlr7/Ieg EMMA embryo mutant strain Tlr7 Tlr7 MGI:2176882 Tlr7 toll-like receptor 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5500 + EM:10052 C57BL/6N-Tlr13/Ieg EMMA sperm mutant strain MGI:5692860 Tlr13 targeted mutation 1.1, Velocigene MGI:3045213 Tlr13 toll-like receptor 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10052 + EM:11759 C57BL/6N-Tlr12/WtsiCnrm EMMA sperm mutant strain MGI:6152742 Tlr12 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3045221 Tlr12 toll-like receptor 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11759 + EM:11889 C57BL/6N-Tlr11/WtsiH EMMA sperm mutant strain MGI:6153685 Tlr11 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3045226 Tlr11 toll-like receptor 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11889 + EM:14462 C57BL/6N-Tle5/WtsiOulu EMMA embryo mutant strain MGI:6153271 Tle5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95806 Tle5 TLE family member 5, transcriptional modulator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14462 + EM:14462 C57BL/6N-Tle5/WtsiOulu EMMA sperm mutant strain MGI:6153271 Tle5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95806 Tle5 TLE family member 5, transcriptional modulator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14462 - EM:08490 C57BL/6N-Timp1/H EMMA sperm B6NTac;B6N-A Timp1/H mutant strain MGI:4841598 Timp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98752 Timp1 tissue inhibitor of metalloproteinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8490 + EM:14262 C57BL/6N-Timmdc1/WtsiOulu EMMA embryo mutant strain MGI:5637083 Timmdc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922139 Timmdc1 translocase of inner mitochondrial membrane domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14262 + EM:14262 C57BL/6N-Timmdc1/WtsiOulu EMMA sperm mutant strain MGI:5637083 Timmdc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922139 Timmdc1 translocase of inner mitochondrial membrane domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14262 + EM:14265 C57BL/6N-Timeless/WtsiOulu EMMA embryo mutant strain MGI:5692606 Timeless targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1321393 Timeless timeless circadian clock 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14265 + EM:14265 C57BL/6N-Timeless/WtsiOulu EMMA sperm mutant strain MGI:5692606 Timeless targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1321393 Timeless timeless circadian clock 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14265 ? EM:14486 C57BL/6N-Tigit/WtsiPh EMMA sperm mutant strain MGI:6406775 Tigit targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:3642260 Tigit T cell immunoreceptor with Ig and ITIM domains https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14486 + EM:14408 C57BL/6N-Tigar/WtsiH EMMA live mutant strain MGI:5692824 Tigar targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442752 Tigar Trp53 induced glycolysis regulatory phosphatase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14408 + EM:14170 C57BL/6N-Tial1/WtsiH EMMA live mutant strain MGI:5708174 Tial1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107913 Tial1 Tia1 cytotoxic granule-associated RNA binding protein-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14170 ? EM:14255 C57BL/6N-Tia1/WtsiOrl EMMA sperm mutant strain Tia1 KOMP targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107914 Tia1 cytotoxic granule-associated RNA binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14255 + EM:11068 C57BL/6N-Thg1l/Ieg EMMA sperm mutant strain MGI:4431657 Thg1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913878 Thg1l tRNA-histidine guanylyltransferase 1-like (S. cerevisiae) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11068 + EM:14180 C57BL/6N-Thada/WtsiOulu EMMA embryo mutant strain MGI:5548889 Thada targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3039623 Thada thyroid adenoma associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14180 + EM:14180 C57BL/6N-Thada/WtsiOulu EMMA sperm mutant strain MGI:5548889 Thada targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3039623 Thada thyroid adenoma associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14180 + EM:11896 C57BL/6N-Tgm3/WtsiH EMMA sperm mutant strain MGI:6153772 Tgm3 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:98732 Tgm3 transglutaminase 3, E polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11896 + EM:12636 C57BL/6N-Tgm1/H EMMA live mutant strain MGI:4458787 Tgm1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98730 Tgm1 transglutaminase 1, K polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12636 ? EM:14256 C57BL/6N-Tgfb1i1/WtsiOrl EMMA sperm mutant strain MGI:5636887 Tgfb1i1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:102784 Tgfb1i1 transforming growth factor beta 1 induced transcript 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14256 - EM:12475 C57BL/6N-Tg(Vav1-STAT5B*N642H)726Biat/Biat EMMA archived mutant strain MGI:6164037 Tg(Vav1-STAT5B*N642H)726Biat transgene insertion 726, Biomodels Austria MGI:6164036 Tg(Vav1-STAT5B*N642H)726Biat transgene insertion 726, Biomodels Austria https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12475 ? EM:11779 C57BL/6N-Tg(Vav-BFL1)686Biat/Biat EMMA sperm mutant strain Tg(Vav-BFL1)686Biat Tg(Vav-BFL1)686Biat Tg(Vav-BFL1)686Biat Tg(Vav-BFL1)686Biat https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11779 ? EM:11778 C57BL/6N-Tg(Vav-BCLX)670Biat/Biat EMMA sperm mutant strain Tg(Vav-BCLX)670Biat Tg(Vav-BCLX)670Biat Tg(Vav-BCLX)670Biat Tg(Vav-BCLX)670Biat https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11778 + EM:07327 C57BL/6N-Tg(Tnfrsf19-cre/ERT2)1Kori/Ph EMMA sperm TROY-CreERT2, C57BL/6-Tg(Tnfrsf19-cre/ERT2)1Kori/Ph mutant strain MGI:5575757 Tg(Tnfrsf19-cre/ERT2)1Kori transgene insertion 1, Vladimir Korinek MGI:5575756 Tg(Tnfrsf19-cre/ERT2)1Kori transgene insertion 1, Vladimir Korinek https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7327 ? EM:14608 C57BL/6N-Tg(Th-SNCA*)15Ccs/Ieg EMMA sperm mutant strain MGI:3764815 Tg(Th-SNCA*)1.2Ccs transgene insertion 1.2, Christine C Stichel MGI:3764733 Tg(Th-SNCA*)1.2Ccs transgene insertion 1.2, Christine C Stichel https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14608 ? EM:14609 C57BL/6N-Tg(Prnp-SNCA*)11Ccs/Ieg EMMA sperm mutant strain Tg(Prnp-SNCA*)11Ccs Tg(Prnp-SNCA*)11Ccs Tg(Prnp-SNCA*)11Ccs Tg(Prnp-SNCA*)11Ccs https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14609 + EM:11673 C57BL/6N-Tg(Pdpn-icre)14Biat/Biat EMMA sperm Pdpn-Cre, C57BL/6N-Tg(Pdpn-Cre)408Biat mutant strain MGI:5526988 Tg(Pdpn-icre)14Biat transgene insertion 14, Biomodels Austria MGI:5526987 Tg(Pdpn-icre)14Biat transgene insertion 14, Biomodels Austria https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11673 + EM:04887 C57BL/6N-Tg(NES/TK-PDGFB,-lacZ)312Kfn/Kctt EMMA embryo UB6n-Nestin-PDGF B-LacZ, nes/tk-Pdgfb-lacZ mutant strain MGI:5648209 Tg(NES/TK-PDGFB,-lacZ)312Kfn transgene insertion 312, Karin Forsberg-Nilsson MGI:5648207 Tg(NES/TK-PDGFB,-lacZ)312Kfn transgene insertion 312, Karin Forsberg-Nilsson https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4887 ? EM:13610 C57BL/6N-Tg(Cxcl13-cre,-tdTomato)723Biat/Biat EMMA sperm mutant strain Tg(Cxcl13-cre,-tdTomato)723Biat Tg(Cxcl13-cre,-tdTomato)723Biat Tg(Cxcl13-cre,-tdTomato)723Biat Tg(Cxcl13-cre,-tdTomato)723Biat https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13610 + EM:05917 C57BL/6N-Tg(CRP-Cast)1Lbau/Orl EMMA embryo mutant strain MGI:5789386 Tg(CRP-Cast)1Lbau transgene insertion 1, Laurent Baud MGI:5789383 Tg(CRP-Cast)1Lbau transgene insertion 1, Laurent Baud https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5917 + EM:09381 C57BL/6N-Tg(Ccl19-cre)489Biat/Biat EMMA sperm mutant strain MGI:5526991 Tg(Ccl19-cre)489Biat transgene insertion 489, Biomodels Austria MGI:5526990 Tg(Ccl19-cre)489Biat transgene insertion 489, Biomodels Austria https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9381 ? EM:14607 C57BL/6N-Tg(CAG-SNCA*)17Ccs/Ieg EMMA sperm mutant strain MGI:3764813 Tg(CAG-SNCA*)1.1Ccs transgene insertion 1.1, Christine C Stichel MGI:3764732 Tg(CAG-SNCA*)1.1Ccs transgene insertion 1.1, Christine C Stichel https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14607 ? EM:09498 C57BL/6N-Tg(CAG-mCherry)690Biat/Biat EMMA sperm mutant strain Tg(CAG-mCherry)690Biat Tg(CAG-mCherry)690Biat Tg(CAG-mCherry)690Biat Tg(CAG-mCherry)690Biat https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9498 + EM:09626 C57BL/6N-Tfap2b/Ieg EMMA sperm mutant strain MGI:5635165 Tfap2b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104672 Tfap2b transcription factor AP-2 beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9626 + EM:08633 C57BL/6N-Tfap2b/Ieg EMMA embryo mutant strain MGI:4948640 Tfap2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104672 Tfap2b transcription factor AP-2 beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8633 ? EM:14145 C57BL/6N-Tex261/WtsiIeg EMMA sperm mutant strain MGI:5812916 Tex261 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1096575 Tex261 testis expressed gene 261 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14145 ? EM:14339 C57BL/6N-Tepsin/WtsiCnbc EMMA archived mutant strain MGI:5637095 Tepsin targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1926027 Tepsin TEPSIN, adaptor related protein complex 4 accessory protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14339 ? EM:14166 C57BL/6N-Tent5c/WtsiCnbc EMMA archived mutant strain MGI:5637082 Tent5c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921895 Tent5c terminal nucleotidyltransferase 5C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14166 ? EM:14138 C57BL/6N-Tcf4/WtsiH EMMA sperm mutant strain MGI:6283398 Tcf4 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:98506 Tcf4 transcription factor 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14138 + EM:13550 C57BL/6N-Tcf20/WtsiKieg EMMA live mutant strain MGI:6257777 Tcf20 endonuclease-mediated mutation 2, Wellcome Trust Sanger Institute MGI:108399 Tcf20 transcription factor 20 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13550 + EM:11890 C57BL/6N-Tcf20/WtsiH EMMA sperm mutant strain MGI:6153684 Tcf20 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:108399 Tcf20 transcription factor 20 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11890 + EM:07951 C57BL/6N-Tceal5/WtsiOulu EMMA embryo mutant strain MGI:5548883 Tceal5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3036236 Tceal5 transcription elongation factor A (SII)-like 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7951 + EM:07951 C57BL/6N-Tceal5/WtsiOulu EMMA sperm mutant strain MGI:5548883 Tceal5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3036236 Tceal5 transcription elongation factor A (SII)-like 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7951 + EM:08701 C57BL/6N-Tcaim/H EMMA sperm EPD0327_1_B11, B6NTac;B6N-Tcaim/H mutant strain MGI:4433698 Tcaim targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1196217 Tcaim T cell activation inhibitor, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8701 + EM:11330 C57BL/6N-Tbl1xr1/Ieg EMMA sperm mutant strain MGI:5085358 Tbl1xr1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2441730 Tbl1xr1 transducin (beta)-like 1X-linked receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11330 - EM:07141 C57BL/6N-Tbkbp1/H EMMA sperm B6NTac;B6N-Tbkbp1/H, B6NTac;B6N-A Tbkbp1/H mutant strain MGI:4842322 Tbkbp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920424 Tbkbp1 TBK1 binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7141 + EM:09308 C57BL/6N-Tbce/Ieg EMMA sperm mutant strain MGI:5588279 Tbce targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1917680 Tbce tubulin-specific chaperone E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9308 + EM:08306 C57BL/6N-Tbce/Ieg EMMA sperm mutant strain MGI:5297130 Tbce targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1917680 Tbce tubulin-specific chaperone E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8306 ? EM:14236 C57BL/6N-Tbc1d22a/WtsiCnbc EMMA archived mutant strain MGI:5636942 Tbc1d22a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1289265 Tbc1d22a TBC1 domain family, member 22a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14236 ? EM:13461 C57BL/6N-Tax1bp3/IegBiat EMMA sperm unclassified MGI:6508042 Tax1bp3 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1923531 Tax1bp3 Tax1 (human T cell leukemia virus type I) binding protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13461 + EM:10137 C57BL/6N-Tax1bp3/Ieg EMMA sperm mutant strain MGI:5692738 Tax1bp3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1923531 Tax1bp3 Tax1 (human T cell leukemia virus type I) binding protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10137 + EM:09585 C57BL/6N-Tax1bp3/Ieg EMMA sperm mutant strain MGI:4436221 Tax1bp3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923531 Tax1bp3 Tax1 (human T cell leukemia virus type I) binding protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9585 + EM:07861 C57BL/6N-Tatdn3/WtsiOulu EMMA embryo mutant strain MGI:5548575 Tatdn3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916222 Tatdn3 TatD DNase domain containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7861 + EM:07861 C57BL/6N-Tatdn3/WtsiOulu EMMA sperm mutant strain MGI:5548575 Tatdn3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916222 Tatdn3 TatD DNase domain containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7861 + EM:08625 C57BL/6N-Tardbp/H EMMA sperm mutant strain MGI:5140493 Tardbp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2387629 Tardbp TAR DNA binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8625 + EM:10124 C57BL/6N-Tap1/Ieg EMMA sperm mutant strain MGI:5692917 Tap1 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:98483 Tap1 transporter 1, ATP-binding cassette, sub-family B (MDR/TAP) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10124 + EM:09400 C57BL/6N-Tap1/Ieg EMMA sperm mutant strain MGI:4868062 Tap1 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:98483 Tap1 transporter 1, ATP-binding cassette, sub-family B (MDR/TAP) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9400 + EM:05344 C57BL/6N-Tango6/Cnrm EMMA sperm C57BL/6N-Tmco7/Cnrm mutant strain MGI:4455865 Tango6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2142786 Tango6 transport and golgi organization 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5344 ? EM:13747 C57BL/6N-Tafa2/WtsiOrl EMMA sperm mutant strain MGI:6257537 Tafa2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2143691 Tafa2 TAFA chemokine like family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13747 ? EM:13756 C57BL/6N-Taf4b/WtsiOrl EMMA sperm mutant strain MGI:6153682 Taf4b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2152345 Taf4b TATA-box binding protein associated factor 4b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13756 ? EM:13887 C57BL/6N-Tada2a/WtsiPh EMMA sperm mutant strain MGI:6153681 Tada2a endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2144471 Tada2a transcriptional adaptor 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13887 + EM:08402 C57BL/6N-Tacr1/Cnrm EMMA sperm mutant strain MGI:5569967 Tacr1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:98475 Tacr1 tachykinin receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8402 + EM:08399 C57BL/6N-Tacr1/Cnrm EMMA embryo mutant strain MGI:5008936 Tacr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98475 Tacr1 tachykinin receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8399 + EM:08399 C57BL/6N-Tacr1/Cnrm EMMA sperm mutant strain MGI:5008936 Tacr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98475 Tacr1 tachykinin receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8399 + EM:14465 C57BL/6N-Sytl3/WtsiOulu EMMA embryo mutant strain MGI:6153629 Sytl3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1933367 Sytl3 synaptotagmin-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14465 + EM:14465 C57BL/6N-Sytl3/WtsiOulu EMMA sperm mutant strain MGI:6153629 Sytl3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1933367 Sytl3 synaptotagmin-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14465 + EM:08690 C57BL/6N-Synj1/H EMMA sperm mutant strain MGI:4432121 Synj1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354961 Synj1 synaptojanin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8690 + EM:10362 C57BL/6N-Syncrip/Ieg EMMA sperm mutant strain MGI:4950166 Syncrip targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1891690 Syncrip synaptotagmin binding, cytoplasmic RNA interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10362 + EM:09307 C57BL/6N-Syk/Ieg EMMA sperm mutant strain MGI:5588292 Syk targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:99515 Syk spleen tyrosine kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9307 + EM:08239 C57BL/6N-Syk/Ieg EMMA embryo mutant strain MGI:4950230 Syk targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99515 Syk spleen tyrosine kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8239 + EM:10421 C57BL/6N-Syde1/Ieg EMMA sperm mutant strain MGI:4841821 Syde1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918959 Syde1 synapse defective 1, Rho GTPase, homolog 1 (C. elegans) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10421 + EM:12756 C57BL/6N-Sycp2/Ieg EMMA sperm mutant strain MGI:5516625 Sycp2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1933281 Sycp2 synaptonemal complex protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12756 + EM:14538 C57BL/6N-Sv2c/WtsiH EMMA live mutant strain MGI:6120752 Sv2c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922459 Sv2c synaptic vesicle glycoprotein 2c https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14538 + EM:13393 C57BL/6N-Sult1c1/WtsiCnrm EMMA live mutant strain MGI:5636889 Sult1c1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:102928 Sult1c1 sulfotransferase family, cytosolic, 1C, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13393 + EM:11392 C57BL/6N-Sulf1/Ieg EMMA sperm mutant strain MGI:5141826 Sulf1 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:2138563 Sulf1 sulfatase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11392 + EM:09698 C57BL/6N-Stx5a/Ieg EMMA sperm mutant strain MGI:5284918 Stx5a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1928483 Stx5a syntaxin 5A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9698 ? EM:05510 C57BL/6N-Strip2/Ieg EMMA embryo mutant strain MGI:6755525 Strip2 targeted mutation 1.2, Taconic MGI:2444363 Strip2 striatin interacting protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5510 ? EM:05511 C57BL/6N-Strip2/Ieg EMMA embryo mutant strain MGI:6755524 Strip2 targeted mutation 1.1, Taconic MGI:2444363 Strip2 striatin interacting protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5511 ? EM:14454 C57BL/6N-Stom/WtsiCnbc EMMA sperm mutant strain MGI:6153628 Stom endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95403 Stom stomatin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14454 ? EM:14280 C57BL/6N-Stimate/WtsiIeg EMMA sperm mutant strain MGI:5637076 Stimate targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1921500 Stimate STIM activating enhancer https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14280 ? EM:13695 C57BL/6N-Stat2/WtsiOrl EMMA sperm mutant strain MGI:6153759 Stat2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:103039 Stat2 signal transducer and activator of transcription 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13695 + EM:14312 C57BL/6N-Stard8/WtsiH EMMA live mutant strain MGI:5548840 Stard8 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2448556 Stard8 START domain containing 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14312 + EM:14243 C57BL/6N-Stard7/WtsiOulu EMMA embryo mutant strain MGI:6120770 Stard7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2139090 Stard7 START domain containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14243 + EM:14243 C57BL/6N-Stard7/WtsiOulu EMMA sperm mutant strain MGI:6120770 Stard7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2139090 Stard7 START domain containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14243 + EM:09048 C57BL/6N-Stard10/H EMMA sperm mutant strain MGI:5692642 Stard10 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1860093 Stard10 START domain containing 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9048 + EM:06202 C57BL/6N-Stard10/H EMMA sperm B6NTac;B6N-Stard10/H mutant strain MGI:4419294 Stard10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1860093 Stard10 START domain containing 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6202 + EM:10123 C57BL/6N-Stac2/Ieg EMMA sperm mutant strain MGI:5692781 Stac2 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2144518 Stac2 SH3 and cysteine rich domain 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10123 + EM:10071 C57BL/6N-Stac2/Ieg EMMA sperm mutant strain MGI:4942095 Stac2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2144518 Stac2 SH3 and cysteine rich domain 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10071 + EM:09250 C57BL/6N-Sspn/Ieg EMMA sperm mutant strain MGI:5613642 Sspn targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1353511 Sspn sarcospan https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9250 + EM:08732 C57BL/6N-Sspn/Ieg EMMA sperm mutant strain MGI:4436581 Sspn targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1353511 Sspn sarcospan https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8732 ? EM:13845 C57BL/6N-Ssc5d/WtsiCnbc EMMA sperm mutant strain MGI:6153627 Ssc5d endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3606211 Ssc5d scavenger receptor cysteine rich family, 5 domains https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13845 ? EM:14130 C57BL/6N-Srebf2/WtsiCnbc EMMA sperm mutant strain Srebf2 KOMP targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107585 Srebf2 sterol regulatory element binding factor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14130 + EM:13821 C57BL/6N-Srcap/WtsiOulu EMMA embryo mutant strain MGI:6153626 Srcap endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2444036 Srcap Snf2-related CREBBP activator protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13821 + EM:13821 C57BL/6N-Srcap/WtsiOulu EMMA sperm mutant strain MGI:6153626 Srcap endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2444036 Srcap Snf2-related CREBBP activator protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13821 - EM:07140 C57BL/6N-Sptbn2/H EMMA sperm B6NTac;B6N-Sptbn2/H mutant strain MGI:4841660 Sptbn2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1313261 Sptbn2 spectrin beta, non-erythrocytic 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7140 + EM:10031 C57BL/6N-Spryd3/Ieg EMMA sperm mutant strain MGI:5695128 Spryd3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2446175 Spryd3 SPRY domain containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10031 + EM:04724 C57BL/6N-Spryd3/Ieg EMMA sperm B6NTac;B6N-Spryd3/Ieg mutant strain MGI:4434532 Spryd3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2446175 Spryd3 SPRY domain containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4724 ? EM:13803 C57BL/6N-Spring1/WtsiIeg EMMA sperm mutant strain MGI:6281933 Spring1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1924042 Spring1 SREBF pathway regulator in golgi 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13803 + EM:09683 C57BL/6N-Spice1/H EMMA sperm mutant strain MGI:5286323 Spice1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1196252 Spice1 spindle and centriole associated protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9683 ? EM:13749 C57BL/6N-Spi1/WtsiIeg EMMA sperm mutant strain MGI:6281103 Spi1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:98282 Spi1 spleen focus forming virus (SFFV) proviral integration oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13749 ? EM:13755 C57BL/6N-Spg21/WtsiIeg EMMA sperm mutant strain MGI:6153624 Spg21 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:106403 Spg21 SPG21, maspardin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13755 - EM:08074 C57BL/6N-Spg20/Ieg EMMA sperm C57BL/6N-Spart/Ieg mutant strain MGI:5548741 Spart targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2139806 Spart spartin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8074 ? EM:13769 C57BL/6N-Spats2l/WtsiOrl EMMA sperm mutant strain MGI:6281943 Spats2l endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914448 Spats2l spermatogenesis associated, serine-rich 2-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13769 + EM:11570 C57BL/6N-Spaca9/WtsiIeg EMMA sperm mutant strain MGI:6140224 Spaca9 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1917237 Spaca9 sperm acrosome associated 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11570 ? EM:13814 C57BL/6N-Spaca7/WtsiIeg EMMA sperm mutant strain MGI:6257711 Spaca7 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1925884 Spaca7 sperm acrosome associated 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13814 - EM:07872 C57BL/6N-Sort1/H EMMA sperm B6NTac;B6N-Sort1/H mutant strain MGI:4842306 Sort1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1338015 Sort1 sortilin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7872 + EM:08449 C57BL/6N-Sorl1/Cnrm EMMA embryo mutant strain MGI:5569945 Sorl1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1202296 Sorl1 sortilin-related receptor, LDLR class A repeats-containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8449 + EM:08449 C57BL/6N-Sorl1/Cnrm EMMA sperm mutant strain MGI:5569945 Sorl1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1202296 Sorl1 sortilin-related receptor, LDLR class A repeats-containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8449 + EM:08401 C57BL/6N-Sorl1/Cnrm EMMA sperm mutant strain MGI:4451976 Sorl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202296 Sorl1 sortilin-related receptor, LDLR class A repeats-containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8401 + EM:13928 C57BL/6N-Son/WtsiOulu EMMA embryo mutant strain MGI:6153757 Son endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:98353 Son Son DNA binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13928 + EM:13928 C57BL/6N-Son/WtsiOulu EMMA sperm mutant strain MGI:6153757 Son endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:98353 Son Son DNA binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13928 + EM:12759 C57BL/6N-Snx13/Ieg EMMA sperm mutant strain MGI:5295603 Snx13 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2661416 Snx13 sorting nexin 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12759 + EM:07007 C57BL/6N-Snrnp200/H EMMA sperm B6NTac;B6N-Snrnp200/H mutant strain MGI:4840806 Snrnp200 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:2444401 Snrnp200 small nuclear ribonucleoprotein 200 (U5) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7007 + EM:09934 C57BL/6N-Snorc/Oulu EMMA embryo C57BL/6N-3110079O15Rik/Oulu mutant strain MGI:5637067 Snorc targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1920484 Snorc secondary ossification center associated regulator of chondrocyte maturation https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9934 + EM:09934 C57BL/6N-Snorc/Oulu EMMA sperm C57BL/6N-3110079O15Rik/Oulu mutant strain MGI:5637067 Snorc targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1920484 Snorc secondary ossification center associated regulator of chondrocyte maturation https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9934 + EM:09933 C57BL/6N-Snorc/Oulu EMMA embryo C57BL/6N-3110079O15Rik/Oulu mutant strain MGI:4436063 Snorc targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920484 Snorc secondary ossification center associated regulator of chondrocyte maturation https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9933 + EM:09933 C57BL/6N-Snorc/Oulu EMMA sperm C57BL/6N-3110079O15Rik/Oulu mutant strain MGI:4436063 Snorc targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920484 Snorc secondary ossification center associated regulator of chondrocyte maturation https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9933 + EM:08988 C57BL/6N-Sncb/H EMMA sperm mutant strain MGI:4455731 Sncb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1889011 Sncb synuclein, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8988 + EM:08403 C57BL/6N-Sncaip/Cnrm EMMA sperm mutant strain MGI:5569950 Sncaip targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915097 Sncaip synuclein, alpha interacting protein (synphilin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8403 + EM:08400 C57BL/6N-Sncaip/Cnrm EMMA sperm mutant strain MGI:4938575 Sncaip targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915097 Sncaip synuclein, alpha interacting protein (synphilin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8400 + EM:09661 C57BL/6N-Snapc1/H EMMA sperm mutant strain MGI:4867920 Snapc1 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:1922877 Snapc1 small nuclear RNA activating complex, polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9661 + EM:09868 C57BL/6N-Snap23/H EMMA sperm mutant strain MGI:4460454 Snap23 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109356 Snap23 synaptosomal-associated protein 23 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9868 + EM:07130 C57BL/6N-Smurf2/H EMMA sperm EPD0424_6_H08, B6NTac;B6N-Smurf2/H mutant strain MGI:4431726 Smurf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913563 Smurf2 SMAD specific E3 ubiquitin protein ligase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7130 + EM:07888 C57BL/6N-Smpd4/WtsiCnrm EMMA sperm mutant strain MGI:5548688 Smpd4 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1924876 Smpd4 sphingomyelin phosphodiesterase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7888 + EM:04902 C57BL/6N-Smoc1/H EMMA sperm B6NTac;B6N-Smoc1/H mutant strain MGI:4431709 Smoc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929878 Smoc1 SPARC related modular calcium binding 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4902 ? EM:13742 C57BL/6N-Smim1/WtsiOrl EMMA sperm mutant strain MGI:6153773 Smim1 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:1916109 Smim1 small integral membrane protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13742 + EM:11219 C57BL/6N-Smim1/WtsiIeg EMMA sperm mutant strain MGI:6140223 Smim1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1916109 Smim1 small integral membrane protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11219 + EM:14340 C57BL/6N-Smg9/WtsiH EMMA live mutant strain MGI:5692712 Smg9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919247 Smg9 SMG9 nonsense mediated mRNA decay factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14340 + EM:14316 C57BL/6N-Smg1/WtsiH EMMA live mutant strain MGI:5692718 Smg1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919742 Smg1 SMG1 nonsense mediated mRNA decay associated PI3K related kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14316 + EM:10413 C57BL/6N-Smcr8/Cnbc EMMA sperm mutant strain MGI:4452950 Smcr8 targeted mutation 1, Velocigene MGI:2444720 Smcr8 Smith-Magenis syndrome chromosome region, candidate 8 homolog (human) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10413 + EM:09249 C57BL/6N-Smc6/Ieg EMMA sperm mutant strain MGI:5613644 Smc6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914491 Smc6 structural maintenance of chromosomes 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9249 + EM:08174 C57BL/6N-Slitrk4/WtsiOulu EMMA embryo mutant strain MGI:5548808 Slitrk4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442509 Slitrk4 SLIT and NTRK-like family, member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8174 + EM:08174 C57BL/6N-Slitrk4/WtsiOulu EMMA sperm mutant strain MGI:5548808 Slitrk4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442509 Slitrk4 SLIT and NTRK-like family, member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8174 + EM:13405 C57BL/6N-Slfnl1/WtsiCnrm EMMA live mutant strain MGI:6149901 Slfnl1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3045330 Slfnl1 schlafen like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13405 - EM:07438 C57BL/6N-Slfn4/H EMMA sperm B6NTac;B6N-Slfn4/H mutant strain MGI:4944570 Slfn4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1329010 Slfn4 schlafen 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7438 + EM:13446 C57BL/6N-Slco1a6/WtsiCnrm EMMA live mutant strain MGI:6281935 Slco1a6 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1351906 Slco1a6 solute carrier organic anion transporter family, member 1a6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13446 + EM:07780 C57BL/6N-Slc9a4/H EMMA sperm B6NTac;B6N-Slc9a4/H mutant strain MGI:4842748 Slc9a4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105074 Slc9a4 solute carrier family 9 (sodium/hydrogen exchanger), member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7780 + EM:09028 C57BL/6N-Slc6a2/Cnrm EMMA sperm mutant strain MGI:5588269 Slc6a2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1270850 Slc6a2 solute carrier family 6 (neurotransmitter transporter, noradrenalin), member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9028 + EM:08398 C57BL/6N-Slc6a2/Cnrm EMMA sperm mutant strain MGI:4461511 Slc6a2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1270850 Slc6a2 solute carrier family 6 (neurotransmitter transporter, noradrenalin), member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8398 + EM:09248 C57BL/6N-Slc6a20a/Ieg EMMA sperm mutant strain MGI:5613657 Slc6a20a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2143217 Slc6a20a solute carrier family 6 (neurotransmitter transporter), member 20A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9248 + EM:13453 C57BL/6N-Slc5a12/WtsiCnrm EMMA live mutant strain MGI:6257445 Slc5a12 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2138890 Slc5a12 solute carrier family 5 (sodium/glucose cotransporter), member 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13453 - EM:07866 C57BL/6N-Slc4a10/H EMMA sperm mutant strain MGI:4451535 Slc4a10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2150150 Slc4a10 solute carrier family 4, sodium bicarbonate cotransporter-like, member 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7866 + EM:08091 C57BL/6N-Slc47a1/Ieg EMMA embryo mutant strain MGI:5548541 Slc47a1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914723 Slc47a1 solute carrier family 47, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8091 + EM:05536 C57BL/6N-Slc47a1/Ieg EMMA embryo B6NTac;B6N-Slc47a1/Ieg mutant strain MGI:4432174 Slc47a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914723 Slc47a1 solute carrier family 47, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5536 + EM:10112 C57BL/6N-Slc44a4/Ieg EMMA sperm mutant strain MGI:5692698 Slc44a4 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1917379 Slc44a4 solute carrier family 44, member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10112 + EM:09107 C57BL/6N-Slc44a4/Ieg EMMA sperm mutant strain MGI:4841742 Slc44a4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917379 Slc44a4 solute carrier family 44, member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9107 + EM:09247 C57BL/6N-Slc44a3/Ieg EMMA sperm mutant strain MGI:5613661 Slc44a3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2384860 Slc44a3 solute carrier family 44, member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9247 - EM:04833 C57BL/6N-Slc40a1/H EMMA sperm B6NTac;B6N-Slc40a1/H mutant strain MGI:4435780 Slc40a1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1315204 Slc40a1 solute carrier family 40 (iron-regulated transporter), member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4833 + EM:13367 C57BL/6N-Slc37a3/WtsiCnrm EMMA live mutant strain MGI:6153622 Slc37a3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919394 Slc37a3 solute carrier family 37 (glycerol-3-phosphate transporter), member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13367 + EM:09223 C57BL/6N-Slc2a5/Ieg EMMA sperm mutant strain MGI:5613655 Slc2a5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1928369 Slc2a5 solute carrier family 2 (facilitated glucose transporter), member 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9223 + EM:07602 C57BL/6N-Slc2a5/Ieg EMMA sperm B6NTac;B6N-Slc2a5/Ieg mutant strain MGI:4842480 Slc2a5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928369 Slc2a5 solute carrier family 2 (facilitated glucose transporter), member 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7602 + EM:13448 C57BL/6N-Slc29a3/WtsiCnrm EMMA live mutant strain MGI:6257459 Slc29a3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1918529 Slc29a3 solute carrier family 29 (nucleoside transporters), member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13448 + EM:13429 C57BL/6N-Slc25a37/WtsiCnrm EMMA live mutant strain MGI:6153621 Slc25a37 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914962 Slc25a37 solute carrier family 25, member 37 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13429 + EM:13396 C57BL/6N-Slc25a28/WtsiCnrm EMMA live mutant strain MGI:5637123 Slc25a28 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2180509 Slc25a28 solute carrier family 25, member 28 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13396 + EM:08415 C57BL/6N-Slc25a15/Ieg EMMA sperm mutant strain MGI:5636973 Slc25a15 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1342274 Slc25a15 solute carrier family 25 (mitochondrial carrier ornithine transporter), member 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8415 + EM:08408 C57BL/6N-Slc25a15/Ieg EMMA embryo mutant strain MGI:5085374 Slc25a15 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1342274 Slc25a15 solute carrier family 25 (mitochondrial carrier ornithine transporter), member 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8408 + EM:11107 C57BL/6N-Slc25a10/Ieg EMMA sperm mutant strain MGI:4460471 Slc25a10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353497 Slc25a10 solute carrier family 25 (mitochondrial carrier, dicarboxylate transporter), member 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11107 - EM:07801 C57BL/6N-Slc24a4/H EMMA sperm B6NTac;B6N-Slc24a4/H mutant strain MGI:4944392 Slc24a4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2447362 Slc24a4 solute carrier family 24 (sodium/potassium/calcium exchanger), member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7801 + EM:07868 C57BL/6N-Slc22a8/H EMMA sperm B6NTac;B6N-Slc22a8/H mutant strain MGI:4419220 Slc22a8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1336187 Slc22a8 solute carrier family 22 (organic anion transporter), member 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7868 + EM:08067 C57BL/6N-Slc20a2/Ieg EMMA sperm mutant strain MGI:5548966 Slc20a2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:97851 Slc20a2 solute carrier family 20, member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8067 + EM:05733 C57BL/6N-Slc17a8/Ics EMMA sperm VGluT3cKO mutant strain MGI:5645786 Slc17a8 targeted mutation 2, Salah El Mestikawy MGI:3039629 Slc17a8 solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5733 + EM:09570 C57BL/6N-Slc17a6/H EMMA sperm mutant strain MGI:4455898 Slc17a6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2156052 Slc17a6 solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9570 + EM:09352 C57BL/6N-Slc13a5/Ieg EMMA sperm mutant strain MGI:5614709 Slc13a5 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3037150 Slc13a5 solute carrier family 13 (sodium-dependent citrate transporter), member 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9352 + EM:08618 C57BL/6N-Slc13a5/Ieg EMMA sperm mutant strain MGI:4841523 Slc13a5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3037150 Slc13a5 solute carrier family 13 (sodium-dependent citrate transporter), member 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8618 + EM:14417 C57BL/6N-Slamf9/WtsiOulu EMMA embryo mutant strain MGI:5692740 Slamf9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923692 Slamf9 SLAM family member 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14417 + EM:14417 C57BL/6N-Slamf9/WtsiOulu EMMA sperm mutant strain MGI:5692740 Slamf9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923692 Slamf9 SLAM family member 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14417 ? EM:13905 C57BL/6N-Skint7/WtsiCnbc EMMA sperm mutant strain MGI:6153620 Skint7 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3041190 Skint7 selection and upkeep of intraepithelial T cells 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13905 + EM:09090 C57BL/6N-Siva1/Ieg EMMA sperm mutant strain MGI:5605765 Siva1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1353606 Siva1 SIVA1, apoptosis-inducing factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9090 + EM:08127 C57BL/6N-Siva1/Ieg EMMA embryo B6NTac;B6N-Siva1/Ieg mutant strain MGI:4455701 Siva1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1353606 Siva1 SIVA1, apoptosis-inducing factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8127 - EM:10067 C57BL/6N-Sirt6/H EMMA sperm B6NTac;B6N-Sirt6/H mutant strain MGI:5692638 Sirt6 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1354161 Sirt6 sirtuin 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10067 + EM:05219 C57BL/6N-Sirt6/H EMMA sperm Sirt6(F08), B6NTac;B6N-Sirt6/H mutant strain MGI:4432093 Sirt6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354161 Sirt6 sirtuin 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5219 + EM:10236 C57BL/6N-Sirt5/Ieg EMMA sperm mutant strain MGI:5701722 Sirt5 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1915596 Sirt5 sirtuin 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10236 + EM:08621 C57BL/6N-Sirt5/Ieg EMMA embryo mutant strain MGI:5511642 Sirt5 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1915596 Sirt5 sirtuin 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8621 + EM:06825 C57BL/6N-Sirt4/H EMMA sperm B6NTac;B6N-Sirt4/H mutant strain MGI:4457551 Sirt4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922637 Sirt4 sirtuin 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6825 + EM:10146 C57BL/6N-Sirt1/H EMMA sperm mutant strain MGI:5692765 Sirt1 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:2135607 Sirt1 sirtuin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10146 - EM:05484 C57BL/6N-Sirt1/H EMMA sperm B6NTac;B6N-Sirt1/H, EPD0428_2_B04 mutant strain MGI:4432175 Sirt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2135607 Sirt1 sirtuin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5484 ? EM:14587 C57BL/6N-Sirpb1c/WtsiPh EMMA sperm mutant strain MGI:6153619 Sirpb1c endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3807521 Sirpb1c signal-regulatory protein beta 1C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14587 ? EM:13876 C57BL/6N-Sirpb1b/WtsiPh EMMA sperm mutant strain MGI:6153618 Sirpb1b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3779828 Sirpb1b signal-regulatory protein beta 1B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13876 + EM:09622 C57BL/6N-Sipa1/H EMMA sperm mutant strain MGI:4847818 Sipa1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107576 Sipa1 signal-induced proliferation associated gene 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9622 + EM:08697 C57BL/6N-Shmt1/H EMMA sperm mutant strain MGI:4454114 Shmt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98299 Shmt1 serine hydroxymethyltransferase 1 (soluble) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8697 + EM:14592 C57BL/6N-Shld1/WtsiOulu EMMA embryo mutant strain MGI:6257464 Shld1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1920997 Shld1 shieldin complex subunit 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14592 + EM:14592 C57BL/6N-Shld1/WtsiOulu EMMA sperm mutant strain MGI:6257464 Shld1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1920997 Shld1 shieldin complex subunit 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14592 - EM:07782 C57BL/6N-Shh/H EMMA sperm B6NTac;B6N-Shh/H, EPD0339_3_A12 mutant strain MGI:4433366 Shh targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98297 Shh sonic hedgehog https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7782 ? EM:14517 C57BL/6N-Sh3pxd2a/WtsiCnbc EMMA archived mutant strain MGI:5636944 Sh3pxd2a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1298393 Sh3pxd2a SH3 and PX domains 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14517 ? EM:14228 C57BL/6N-Sh3bgrl3/WtsiCnbc EMMA archived mutant strain MGI:5637071 Sh3bgrl3 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1920973 Sh3bgrl3 SH3 domain binding glutamic acid-rich protein-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14228 + EM:07621 C57BL/6N-Sgsm1/Wtsi EMMA archived mutant strain MGI:5636905 Sgsm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107320 Sgsm1 small G protein signaling modulator 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7621 + EM:08418 C57BL/6N-Sgip1/Ieg EMMA sperm C57BL/6N-Sgip1/Hmgu mutant strain MGI:5548629 Sgip1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1920344 Sgip1 SH3-domain GRB2-like (endophilin) interacting protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8418 + EM:08411 C57BL/6N-Sgip1/Ieg EMMA sperm mutant strain MGI:4841887 Sgip1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920344 Sgip1 SH3-domain GRB2-like (endophilin) interacting protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8411 + EM:07902 C57BL/6N-Sfxn3/WtsiCnrm EMMA sperm mutant strain MGI:5548735 Sfxn3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2137679 Sfxn3 sideroflexin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7902 + EM:08318 C57BL/6N-Sez6l/H EMMA sperm mutant strain MGI:4942074 Sez6l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1935121 Sez6l seizure related 6 homolog like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8318 ? EM:14244 C57BL/6N-Setd1a/WtsiCnbc EMMA archived mutant strain MGI:6162235 Setd1a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2446244 Setd1a SET domain containing 1A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14244 ? EM:14215 C57BL/6N-Setd1a/WtsiIeg EMMA archived mutant strain Setd1a undef targeted mutation , Wellcome Trust Sanger Institute MGI:2446244 Setd1a SET domain containing 1A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14215 ? EM:14555 C57BL/6N-Serpinb9b/WtsiPh EMMA sperm mutant strain MGI:6153613 Serpinb9b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:894668 Serpinb9b serine (or cysteine) peptidase inhibitor, clade B, member 9b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14555 + EM:10739 C57BL/6N-Serf2/H EMMA live Serf2 mutant strain MGI:6317359 Serf2 targeted mutation 1d, Helmholtz Zentrum Muenchen GmbH MGI:1337041 Serf2 small EDRK-rich factor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10739 + EM:10831 C57BL/6N-Serf1/H EMMA sperm mutant strain MGI:4436313 Serf1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1337114 Serf1 small EDRK-rich factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10831 + EM:14401 C57BL/6N-Senp6/WtsiOulu EMMA embryo mutant strain MGI:6120751 Senp6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1922075 Senp6 SUMO/sentrin specific peptidase 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14401 + EM:14401 C57BL/6N-Senp6/WtsiOulu EMMA sperm mutant strain MGI:6120751 Senp6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1922075 Senp6 SUMO/sentrin specific peptidase 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14401 - EM:09031 C57BL/6N-Sema3f/H EMMA sperm B6NTac;B6N-A Sema3f/H mutant strain MGI:5692585 Sema3f targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1096347 Sema3f sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3F https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9031 + EM:06945 C57BL/6N-Sema3f/H EMMA sperm B6NTac;B6N-Sema3f/H mutant strain MGI:4435144 Sema3f targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1096347 Sema3f sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3F https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6945 + EM:08544 C57BL/6N-Sell/H EMMA sperm mutant strain MGI:4434581 Sell targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98279 Sell selectin, lymphocyte https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8544 + EM:07981 C57BL/6N-Selk/WtsiH EMMA sperm C57BL/6N-Selenok/WtsiH mutant strain MGI:5548722 Selenok targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1931466 Selenok selenoprotein K https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7981 ? EM:14512 C57BL/6N-Selenow/WtsiOrl EMMA sperm mutant strain MGI:5636930 Selenow targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1100878 Selenow selenoprotein W https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14512 + EM:09170 C57BL/6N-Selenok/WtsiH EMMA sperm C57BL/6N-Selk/WtsiH mutant strain MGI:5548722 Selenok targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1931466 Selenok selenoprotein K https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9170 + EM:13911 C57BL/6N-Selenoi/WtsiOulu EMMA embryo mutant strain MGI:6153612 Selenoi endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107898 Selenoi selenoprotein I https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13911 + EM:13911 C57BL/6N-Selenoi/WtsiOulu EMMA sperm mutant strain MGI:6153612 Selenoi endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107898 Selenoi selenoprotein I https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13911 + EM:09227 C57BL/6N-Sec14l4/Ieg EMMA sperm mutant strain MGI:5613659 Sec14l4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2144095 Sec14l4 SEC14-like lipid binding 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9227 + EM:07612 C57BL/6N-Sec14l4/Ieg EMMA embryo B6NTac;B6N-Sec14l4/Ieg mutant strain MGI:4433028 Sec14l4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144095 Sec14l4 SEC14-like lipid binding 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7612 + EM:09697 C57BL/6N-Sec11c/Ieg EMMA sperm mutant strain MGI:4456039 Sec11c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913536 Sec11c SEC11 homolog C, signal peptidase complex subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9697 + EM:08116 C57BL/6N-Sdhb/Ieg EMMA sperm C57BL/6N-Sdhb/Hmgu mutant strain MGI:5548548 Sdhb targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914930 Sdhb succinate dehydrogenase complex, subunit B, iron sulfur (Ip) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8116 + EM:07615 C57BL/6N-Sdhb/Ieg EMMA embryo B6NTac;B6N-Sdhb/Ieg mutant strain MGI:5085385 Sdhb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914930 Sdhb succinate dehydrogenase complex, subunit B, iron sulfur (Ip) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7615 + EM:09383 C57BL/6N-Sdc4/H EMMA sperm mutant strain MGI:4451381 Sdc4 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1349164 Sdc4 syndecan 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9383 + EM:13866 C57BL/6N-Sdc3/WtsiOulu EMMA embryo mutant strain MGI:6153756 Sdc3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1349163 Sdc3 syndecan 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13866 + EM:13866 C57BL/6N-Sdc3/WtsiOulu EMMA sperm mutant strain MGI:6153756 Sdc3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1349163 Sdc3 syndecan 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13866 + EM:08059 C57BL/6N-Sdc2/Ieg EMMA sperm mutant strain MGI:5548470 Sdc2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1349165 Sdc2 syndecan 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8059 + EM:07574 C57BL/6N-Scnn1g/H EMMA sperm EPD0795_5_H04, B6NTac;B6N-Scnn1g/H mutant strain MGI:5299883 Scnn1g targeted mutation 1e, Wellcome Trust Sanger Institute MGI:104695 Scnn1g sodium channel, nonvoltage-gated 1 gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7574 - EM:04742 C57BL/6N-Scnn1b/Cnrm EMMA embryo mutant strain MGI:4435286 Scnn1b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104696 Scnn1b sodium channel, nonvoltage-gated 1 beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4742 - EM:04742 C57BL/6N-Scnn1b/Cnrm EMMA sperm mutant strain MGI:4435286 Scnn1b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104696 Scnn1b sodium channel, nonvoltage-gated 1 beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4742 ? EM:13715 C57BL/6N-Scn4b/WtsiOrl EMMA sperm mutant strain MGI:6153611 Scn4b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2687406 Scn4b sodium channel, type IV, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13715 - EM:06051 C57BL/6N-Scn4a/H EMMA sperm B6NTac;B6N-Scn4a/H mutant strain MGI:5284906 Scn4a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:98250 Scn4a sodium channel, voltage-gated, type IV, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6051 + EM:11595 C57BL/6N-Scmh1/Ieg EMMA sperm mutant strain MGI:4458794 Scmh1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1352762 Scmh1 sex comb on midleg homolog 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11595 - EM:08968 C57BL/6N-Scgb3a1/Cnrm EMMA sperm mutant strain MGI:5633832 Scgb3a1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1915912 Scgb3a1 secretoglobin, family 3A, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8968 ? EM:14441 C57BL/6N-Scaf1/WtsiCnbc EMMA sperm mutant strain MGI:6153610 Scaf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2141980 Scaf1 SR-related CTD-associated factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14441 + EM:11758 C57BL/6N-Scaf11/WtsiCnrm EMMA sperm mutant strain MGI:6152741 Scaf11 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1919443 Scaf11 SR-related CTD-associated factor 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11758 + EM:09856 C57BL/6N-Sbno1/H EMMA sperm mutant strain MGI:5294216 Sbno1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384298 Sbno1 strawberry notch 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9856 + EM:09462 C57BL/6N-Sarnp/Ieg EMMA sperm mutant strain MGI:5548511 Sarnp targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1913368 Sarnp SAP domain containing ribonucleoprotein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9462 + EM:11377 C57BL/6N-Samd7/H EMMA sperm mutant strain MGI:4455714 Samd7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923203 Samd7 sterile alpha motif domain containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11377 + EM:10854 C57BL/6N-S1pr2/WtsiOulu EMMA embryo mutant strain MGI:5423977 S1pr2 stonedeaf MGI:99569 S1pr2 sphingosine-1-phosphate receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10854 ? EM:13768 C57BL/6N-S100a4/WtsiOrl EMMA sperm mutant strain MGI:6336062 S100a4 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1330282 S100a4 S100 calcium binding protein A4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13768 + EM:07322 C57BL/6N-Ryr2/H EMMA sperm mutant strain MGI:4458493 Ryr2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99685 Ryr2 ryanodine receptor 2, cardiac https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7322 + EM:09656 C57BL/6N-Ryr1/H EMMA sperm mutant strain MGI:4951021 Ryr1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99659 Ryr1 ryanodine receptor 1, skeletal muscle https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9656 + EM:07947 C57BL/6N-Rxfp2/Ieg EMMA embryo C57BL/6N-Rxfp2/Hmgu mutant strain MGI:5548762 Rxfp2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2153463 Rxfp2 relaxin/insulin-like family peptide receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7947 ? EM:14306 C57BL/6N-Rwdd1/WtsiOrl EMMA sperm mutant strain MGI:5637013 Rwdd1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913771 Rwdd1 RWD domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14306 + EM:11396 C57BL/6N-Runx1t1/H EMMA sperm mutant strain MGI:4881046 Runx1t1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104793 Runx1t1 RUNX1 translocation partner 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11396 + EM:08942 C57BL/6N-Rundc1/WtsiOulu EMMA embryo mutant strain MGI:5548750 Rundc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2144506 Rundc1 RUN domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8942 + EM:08942 C57BL/6N-Rundc1/WtsiOulu EMMA sperm mutant strain MGI:5548750 Rundc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2144506 Rundc1 RUN domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8942 + EM:09027 C57BL/6N-Rtraf/Cnrm EMMA sperm mutant strain MGI:5585725 Rtraf targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1915295 Rtraf RNA transcription, translation and transport factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9027 + EM:08397 C57BL/6N-Rtraf/Cnrm EMMA sperm mutant strain MGI:4455868 Rtraf targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915295 Rtraf RNA transcription, translation and transport factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8397 - EM:06920 C57BL/6N-Rtn1/H EMMA sperm B6NTac;B6N-Rtn1/H mutant strain MGI:4880888 Rtn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933947 Rtn1 reticulon 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6920 + EM:13818 C57BL/6N-Rsrc1/WtsiOulu EMMA embryo mutant strain MGI:6153607 Rsrc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914130 Rsrc1 arginine/serine-rich coiled-coil 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13818 + EM:13818 C57BL/6N-Rsrc1/WtsiOulu EMMA sperm mutant strain MGI:6153607 Rsrc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914130 Rsrc1 arginine/serine-rich coiled-coil 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13818 - EM:05125 C57BL/6N-Rsbn1/H EMMA sperm mutant strain MGI:4433850 Rsbn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444993 Rsbn1 rosbin, round spermatid basic protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5125 + EM:14150 C57BL/6N-Rreb1/WtsiH EMMA live mutant strain MGI:5816878 Rreb1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443664 Rreb1 ras responsive element binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14150 + EM:06932 C57BL/6N-Rptor/H EMMA sperm B6NTac;B6N-Rptor/H mutant strain MGI:4441657 Rptor targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1921620 Rptor regulatory associated protein of MTOR, complex 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6932 + EM:13884 C57BL/6N-Rptn/WtsiOulu EMMA embryo mutant strain MGI:6336061 Rptn endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1099055 Rptn repetin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13884 + EM:13884 C57BL/6N-Rptn/WtsiOulu EMMA sperm mutant strain MGI:6336061 Rptn endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1099055 Rptn repetin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13884 + EM:10136 C57BL/6N-Rps26/Ieg EMMA sperm mutant strain MGI:5692633 Rps26 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1351628 Rps26 ribosomal protein S26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10136 + EM:10073 C57BL/6N-Rps26/Ieg EMMA sperm mutant strain MGI:5511742 Rps26 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1351628 Rps26 ribosomal protein S26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10073 + EM:10062 C57BL/6N-Rps19/Ph EMMA sperm mutant strain Rps19 Rps19 MGI:1333780 Rps19 ribosomal protein S19 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10062 + EM:10062 C57BL/6N-Rps19/Ph EMMA live mutant strain Rps19 Rps19 MGI:1333780 Rps19 ribosomal protein S19 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10062 - EM:04953 C57BL/6N-Rprd1b/H EMMA sperm mutant strain MGI:4435125 Rprd1b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917720 Rprd1b regulation of nuclear pre-mRNA domain containing 1B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4953 + EM:10139 C57BL/6N-Rpl32/Ieg EMMA sperm mutant strain MGI:5692914 Rpl32 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:98038 Rpl32 ribosomal protein L32 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10139 + EM:10078 C57BL/6N-Rpl32/Ieg EMMA sperm mutant strain MGI:4842059 Rpl32 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98038 Rpl32 ribosomal protein L32 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10078 + EM:09509 C57BL/6N-Rph3a/Ieg EMMA sperm mutant strain MGI:5588265 Rph3a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:102788 Rph3a rabphilin 3A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9509 + EM:08307 C57BL/6N-Rph3a/Ieg EMMA embryo mutant strain MGI:4946758 Rph3a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:102788 Rph3a rabphilin 3A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8307 - EM:04900 C57BL/6N-Rpe65/H EMMA sperm mutant strain MGI:4436481 Rpe65 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98001 Rpe65 retinal pigment epithelium 65 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4900 + EM:08085 C57BL/6N-Rora/Ieg EMMA sperm mutant strain MGI:5548347 Rora targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104661 Rora RAR-related orphan receptor alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8085 + EM:07617 C57BL/6N-Ropn1l/WtsiCnrm EMMA sperm mutant strain MGI:5548780 Ropn1l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2182357 Ropn1l ropporin 1-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7617 + EM:08622 C57BL/6N-Rnls/Ieg EMMA sperm mutant strain MGI:4847877 Rnls targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915045 Rnls renalase, FAD-dependent amine oxidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8622 - EM:06917 C57BL/6N-Rnf183/H EMMA sperm B6NTac;B6N-Rnf183/H mutant strain MGI:4419200 Rnf183 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923322 Rnf183 ring finger protein 183 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6917 - EM:05310 C57BL/6N-Rnf169/H EMMA sperm B6NTac;B6N-Rnf169/H mutant strain MGI:4452734 Rnf169 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920257 Rnf169 ring finger protein 169 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5310 + EM:14174 C57BL/6N-Rnf157/WtsiH EMMA live mutant strain MGI:5637139 Rnf157 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442484 Rnf157 ring finger protein 157 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14174 ? EM:14580 C57BL/6N-Rnf145/WtsiPh EMMA sperm mutant strain MGI:6153606 Rnf145 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921565 Rnf145 ring finger protein 145 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14580 ? EM:14347 C57BL/6N-Rnf138/WtsiOrl EMMA sperm mutant strain MGI:5692757 Rnf138 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1929211 Rnf138 ring finger protein 138 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14347 ? EM:13858 C57BL/6N-Rnf114/WtsiPh EMMA sperm mutant strain MGI:6153605 Rnf114 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1933159 Rnf114 ring finger protein 114 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13858 ? EM:14160 C57BL/6N-Rnasek/WtsiIeg EMMA sperm mutant strain MGI:5636901 Rnasek targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106369 Rnasek ribonuclease, RNase K https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14160 + EM:09880 C57BL/6N-Rnase10/Cnrm EMMA sperm mutant strain MGI:5812264 Rnase10 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1922269 Rnase10 ribonuclease, RNase A family, 10 (non-active) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9880 + EM:06799 C57BL/6N-Rlbp1/H EMMA sperm B6NTac;B6N-Rlbp1/H mutant strain MGI:4462637 Rlbp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97930 Rlbp1 retinaldehyde binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6799 + EM:11153 C57BL/6N-Rimbp2/WtsiH EMMA sperm mutant strain MGI:6153603 Rimbp2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2443235 Rimbp2 RIMS binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11153 + EM:08417 C57BL/6N-Rilpl1/Ieg EMMA sperm mutant strain MGI:5548660 Rilpl1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1922945 Rilpl1 Rab interacting lysosomal protein-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8417 + EM:08410 C57BL/6N-Rilpl1/Ieg EMMA embryo mutant strain MGI:4946743 Rilpl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922945 Rilpl1 Rab interacting lysosomal protein-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8410 - EM:05280 C57BL/6N-Ric8b/Cnrm EMMA embryo mutant strain MGI:4434606 Ric8b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2682307 Ric8b RIC8 guanine nucleotide exchange factor B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5280 - EM:05280 C57BL/6N-Ric8b/Cnrm EMMA sperm mutant strain MGI:4434606 Ric8b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2682307 Ric8b RIC8 guanine nucleotide exchange factor B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5280 + EM:04954 C57BL/6N-Ric1/H EMMA sperm B6NTac;B6N-Rica/H, B6NTac;B6N-Ric1/H, B6NTac;B6N-C030046E11Rik/H mutant strain MGI:4435468 Ric1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924893 Ric1 RAB6A GEF complex partner 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4954 + EM:07952 C57BL/6N-Rhox13/WtsiCnrm EMMA sperm mutant strain MGI:5548634 Rhox13 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1920864 Rhox13 reproductive homeobox 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7952 - EM:05008 C57BL/6N-Rhbdl3/H EMMA sperm mutant strain MGI:4433810 Rhbdl3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2179276 Rhbdl3 rhomboid like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5008 ? EM:13925 C57BL/6N-Rhbdf2/WtsiCnbc EMMA sperm mutant strain MGI:6153755 Rhbdf2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2442473 Rhbdf2 rhomboid 5 homolog 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13925 + EM:06944 C57BL/6N-Rgs5/H EMMA sperm B6NTac;B6N-Rgs5/H mutant strain MGI:4432511 Rgs5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098434 Rgs5 regulator of G-protein signaling 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6944 ? EM:13216 C57BL/6N-Rgs1/WtsiH EMMA live mutant strain Rgs1 EUCOMM targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354694 Rgs1 regulator of G-protein signaling 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13216 + EM:10740 C57BL/6N-Rgs16/H EMMA archived mutant strain MGI:5790638 Rgs16 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:108407 Rgs16 regulator of G-protein signaling 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10740 + EM:09347 C57BL/6N-Rfxank/Ieg EMMA sperm mutant strain MGI:5614696 Rfxank targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1333865 Rfxank regulatory factor X-associated ankyrin-containing protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9347 + EM:08465 C57BL/6N-Rfxank/Ieg EMMA embryo mutant strain MGI:5008000 Rfxank targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1333865 Rfxank regulatory factor X-associated ankyrin-containing protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8465 + EM:09831 C57BL/6N-Rfx7/H EMMA sperm mutant strain MGI:5692823 Rfx7 targeted mutation 2c, Helmholtz Zentrum Muenchen GmbH MGI:2442675 Rfx7 regulatory factor X, 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9831 - EM:07804 C57BL/6N-Rfx7/H EMMA sperm mutant strain MGI:5511570 Rfx7 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2442675 Rfx7 regulatory factor X, 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7804 ? EM:13707 C57BL/6N-Rexo5/WtsiOrl EMMA sperm mutant strain MGI:6153602 Rexo5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919402 Rexo5 RNA exonuclease 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13707 - EM:07596 C57BL/6N-Rexo2/H EMMA sperm mutant strain MGI:4433994 Rexo2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1888981 Rexo2 RNA exonuclease 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7596 + EM:08072 C57BL/6N-Rest/Ieg EMMA sperm mutant strain MGI:5692555 Rest targeted mutation 2b, Wellcome Trust Sanger Institute MGI:104897 Rest RE1-silencing transcription factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8072 + EM:07990 C57BL/6N-Rel/H EMMA sperm B6NTac;B6N-Rel/H mutant strain MGI:4441649 Rel targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97897 Rel reticuloendotheliosis oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7990 + EM:13681 C57BL/6N-Reg4/H EMMA live mutant strain MGI:4887647 Reg4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914959 Reg4 regenerating islet-derived family, member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13681 + EM:14522 C57BL/6N-Reg3d/WtsiH EMMA live mutant strain MGI:5636985 Reg3d targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1353426 Reg3d regenerating islet-derived 3 delta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14522 + EM:09246 C57BL/6N-Rcn1/Ieg EMMA sperm mutant strain MGI:5613634 Rcn1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:104559 Rcn1 reticulocalbin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9246 + EM:08247 C57BL/6N-Rcn1/Ieg EMMA sperm mutant strain MGI:4841832 Rcn1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104559 Rcn1 reticulocalbin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8247 - EM:07113 C57BL/6N-Rcc2/H EMMA sperm mutant strain MGI:4453694 Rcc2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919784 Rcc2 regulator of chromosome condensation 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7113 + EM:14460 C57BL/6N-Rbms3/WtsiOulu EMMA embryo mutant strain MGI:6281925 Rbms3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2444477 Rbms3 RNA binding motif, single stranded interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14460 + EM:14460 C57BL/6N-Rbms3/WtsiOulu EMMA sperm mutant strain MGI:6281925 Rbms3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2444477 Rbms3 RNA binding motif, single stranded interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14460 - EM:07797 C57BL/6N-Rbms1/H EMMA sperm mutant strain MGI:4433622 Rbms1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1861774 Rbms1 RNA binding motif, single stranded interacting protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7797 + EM:13440 C57BL/6N-Rbm7/WtsiCnrm EMMA live mutant strain MGI:6257449 Rbm7 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914260 Rbm7 RNA binding motif protein 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13440 ? EM:14289 C57BL/6N-Rbm33/WtsiCnbc EMMA archived mutant strain MGI:5637065 Rbm33 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919670 Rbm33 RNA binding motif protein 33 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14289 + EM:14552 C57BL/6N-Rbm24/WtsiCnbc EMMA embryo mutant strain MGI:6153601 Rbm24 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3610364 Rbm24 RNA binding motif protein 24 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14552 + EM:14552 C57BL/6N-Rbm24/WtsiCnbc EMMA sperm mutant strain MGI:6153601 Rbm24 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3610364 Rbm24 RNA binding motif protein 24 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14552 ? EM:14445 C57BL/6N-Rbm17/WtsiCnbc EMMA sperm mutant strain MGI:6257515 Rbm17 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1924188 Rbm17 RNA binding motif protein 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14445 + EM:10108 C57BL/6N-Rbl1/Ieg EMMA sperm mutant strain MGI:5692547 Rbl1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:103300 Rbl1 RB transcriptional corepressor like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10108 ? EM:14224 C57BL/6N-Rbak/WtsiIeg EMMA sperm mutant strain MGI:5637097 Rbak targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1927369 Rbak RB-associated KRAB zinc finger https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14224 ? EM:13752 C57BL/6N-Rasgrp3/WtsiIeg EMMA sperm mutant strain MGI:6153600 Rasgrp3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3028579 Rasgrp3 RAS, guanyl releasing protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13752 + EM:11111 C57BL/6N-Rasgrf1/H EMMA sperm WCW_1413_003, STOCK Rasgrf1/H mutant strain MGI:6460115 Rasgrf1 targeted mutation 1a, National Laboratory Animal Center MGI:99694 Rasgrf1 RAS protein-specific guanine nucleotide-releasing factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11111 + EM:14431 C57BL/6N-Rarres1/WtsiOulu EMMA embryo mutant strain MGI:6281923 Rarres1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1924461 Rarres1 retinoic acid receptor responder (tazarotene induced) 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14431 + EM:14431 C57BL/6N-Rarres1/WtsiOulu EMMA sperm mutant strain MGI:6281923 Rarres1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1924461 Rarres1 retinoic acid receptor responder (tazarotene induced) 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14431 + EM:07839 C57BL/6N-Rapsn/H EMMA sperm B6NTac;B6N-Rapsn/H mutant strain MGI:4433819 Rapsn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99422 Rapsn receptor-associated protein of the synapse https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7839 ? EM:14282 C57BL/6N-Raph1/WtsiIeg EMMA sperm mutant strain MGI:5637089 Raph1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924550 Raph1 Ras association (RalGDS/AF-6) and pleckstrin homology domains 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14282 - EM:07401 C57BL/6N-Ramp1/H EMMA sperm B6NTac;B6N-Ramp1/H, EPD0843_4_B11 mutant strain MGI:5286381 Ramp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858418 Ramp1 receptor (calcitonin) activity modifying protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7401 + EM:09301 C57BL/6N-Raet1c/Ieg EMMA sperm mutant strain MGI:5548391 Raet1c targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:109431 Raet1c retinoic acid early transcript gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9301 + EM:08108 C57BL/6N-Raet1c/Ieg EMMA sperm B6NTac;B6N-Raet1c/Ieg mutant strain MGI:5008842 Raet1c targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109431 Raet1c retinoic acid early transcript gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8108 - EM:04743 C57BL/6N-Rabgap1/Cnrm EMMA embryo mutant strain MGI:4434702 Rabgap1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385139 Rabgap1 RAB GTPase activating protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4743 - EM:04743 C57BL/6N-Rabgap1/Cnrm EMMA sperm mutant strain MGI:4434702 Rabgap1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385139 Rabgap1 RAB GTPase activating protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4743 + EM:08094 C57BL/6N-Rab35/Ieg EMMA embryo mutant strain MGI:5548685 Rab35 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1924657 Rab35 RAB35, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8094 + EM:14561 C57BL/6N-Rab30/WtsiCnbc EMMA embryo mutant strain MGI:6153599 Rab30 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1923235 Rab30 RAB30, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14561 + EM:14561 C57BL/6N-Rab30/WtsiCnbc EMMA sperm mutant strain MGI:6153599 Rab30 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1923235 Rab30 RAB30, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14561 ? EM:13797 C57BL/6N-Rab28/WtsiOrl EMMA sperm mutant strain MGI:6315511 Rab28 endonuclease-mediated mutation 2, Wellcome Trust Sanger Institute MGI:1917285 Rab28 RAB28, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13797 + EM:08807 C57BL/6N-Rab23/H EMMA sperm mutant strain MGI:4460477 Rab23 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99833 Rab23 RAB23, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8807 + EM:14502 C57BL/6N-Rab21/WtsiOulu EMMA embryo mutant strain MGI:5638577 Rab21 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:894308 Rab21 RAB21, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14502 + EM:14502 C57BL/6N-Rab21/WtsiOulu EMMA sperm mutant strain MGI:5638577 Rab21 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:894308 Rab21 RAB21, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14502 + EM:11258 C57BL/6N-Rab1a/H EMMA sperm mutant strain MGI:4363435 Rab1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97842 Rab1a RAB1A, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11258 ? EM:13753 C57BL/6N-Rab11fip2/WtsiIeg EMMA sperm mutant strain MGI:6281928 Rab11fip2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1922248 Rab11fip2 RAB11 family interacting protein 2 (class I) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13753 ? EM:14585 C57BL/6N-Pvr/WtsiCnbc EMMA sperm mutant strain MGI:6153598 Pvr endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107741 Pvr poliovirus receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14585 + EM:14430 C57BL/6N-Pus10/WtsiOulu EMMA embryo mutant strain MGI:5701724 Pus10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1921717 Pus10 pseudouridylate synthase 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14430 + EM:14430 C57BL/6N-Pus10/WtsiOulu EMMA sperm mutant strain MGI:5701724 Pus10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1921717 Pus10 pseudouridylate synthase 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14430 + EM:10888 C57BL/6N-Pts/H EMMA sperm mutant strain MGI:4944538 Pts targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1338783 Pts 6-pyruvoyl-tetrahydropterin synthase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10888 + EM:08359 C57BL/6N-Ptpn23/Ieg EMMA sperm mutant strain MGI:5567111 Ptpn23 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2144837 Ptpn23 protein tyrosine phosphatase, non-receptor type 23 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8359 + EM:08101 C57BL/6N-Ptpn23/Ieg EMMA sperm B6NTac;B6N-Ptpn23/Ieg mutant strain MGI:4434698 Ptpn23 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2144837 Ptpn23 protein tyrosine phosphatase, non-receptor type 23 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8101 + EM:10694 C57BL/6N-Ptk7/H EMMA sperm mutant strain MGI:5319349 Ptk7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918711 Ptk7 PTK7 protein tyrosine kinase 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10694 ? EM:13766 C57BL/6N-Ptk2b/WtsiIeg EMMA sperm mutant strain MGI:6153597 Ptk2b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:104908 Ptk2b PTK2 protein tyrosine kinase 2 beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13766 + EM:09696 C57BL/6N-Psmc2/Ieg EMMA sperm mutant strain MGI:4841895 Psmc2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109555 Psmc2 proteasome (prosome, macropain) 26S subunit, ATPase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9696 + EM:13383 C57BL/6N-Psg29/WtsiCnrm EMMA live mutant strain MGI:6153596 Psg29 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891361 Psg29 pregnancy-specific beta-1-glycoprotein 29 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13383 ? EM:13921 C57BL/6N-Psg26/WtsiPh EMMA sperm mutant strain MGI:6153594 Psg26 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891358 Psg26 pregnancy-specific beta-1-glycoprotein 26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13921 ? EM:13730 C57BL/6N-Psg25/WtsiOrl EMMA sperm mutant strain MGI:6153593 Psg25 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891357 Psg25 pregnancy-specific beta-1-glycoprotein 25 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13730 ? EM:13837 C57BL/6N-Psg22/WtsiPh EMMA sperm mutant strain MGI:6153592 Psg22 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891354 Psg22 pregnancy-specific beta-1-glycoprotein 22 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13837 ? EM:13870 C57BL/6N-Psg21/WtsiPh EMMA sperm mutant strain MGI:6153591 Psg21 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891353 Psg21 pregnancy-specific beta-1-glycoprotein 21 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13870 ? EM:13850 C57BL/6N-Psg20/WtsiPh EMMA sperm mutant strain MGI:6153590 Psg20 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891352 Psg20 pregnancy-specific beta-1-glycoprotein 20 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13850 ? EM:13871 C57BL/6N-Psg19/WtsiPh EMMA sperm mutant strain MGI:6153589 Psg19 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1347252 Psg19 pregnancy specific beta-1-glycoprotein 19 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13871 ? EM:13851 C57BL/6N-Psg18/WtsiPh EMMA sperm mutant strain MGI:6153588 Psg18 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1347251 Psg18 pregnancy specific beta-1-glycoprotein 18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13851 + EM:11587 C57BL/6N-Psg17/WtsiIeg EMMA sperm mutant strain MGI:6140222 Psg17 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1347250 Psg17 pregnancy specific beta-1-glycoprotein 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11587 + EM:14418 C57BL/6N-Prxl2b/WtsiH EMMA live mutant strain MGI:5779678 Prxl2b targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1913719 Prxl2b peroxiredoxin like 2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14418 ? EM:14559 C57BL/6N-Prss53/WtsiCnbc EMMA sperm mutant strain MGI:6153264 Prss53 endonuclease mediated mutation 2, Wellcome Trust Sanger Institute MGI:2652890 Prss53 protease, serine 53 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14559 + EM:11580 C57BL/6N-Prss53/WtsiIeg EMMA sperm mutant strain MGI:6147557 Prss53 endonuclease mediated mutation 2, Wellcome Trust Sanger Institute MGI:2652890 Prss53 protease, serine 53 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11580 + EM:11762 C57BL/6N-Prss53/WtsiCnrm EMMA sperm mutant strain MGI:6140219 Prss53 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2652890 Prss53 protease, serine 53 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11762 - EM:05604 C57BL/6N-Prss50/H EMMA sperm mutant strain MGI:4455807 Prss50 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2447303 Prss50 protease, serine 50 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5604 + EM:13532 C57BL/6N-Prrg2/WtsiKieg EMMA embryo mutant strain MGI:5548709 Prrg2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1929596 Prrg2 proline-rich Gla (G-carboxyglutamic acid) polypeptide 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13532 + EM:13532 C57BL/6N-Prrg2/WtsiKieg EMMA sperm mutant strain MGI:5548709 Prrg2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1929596 Prrg2 proline-rich Gla (G-carboxyglutamic acid) polypeptide 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13532 ? EM:13873 C57BL/6N-Prr5l/WtsiCnbc EMMA sperm mutant strain MGI:6153587 Prr5l endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919696 Prr5l proline rich 5 like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13873 ? EM:13838 C57BL/6N-Prr14l/WtsiPh EMMA sperm mutant strain MGI:6153586 Prr14l endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2443658 Prr14l proline rich 14-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13838 - EM:04943 C57BL/6N-Prph2/H EMMA sperm mutant strain MGI:4435174 Prph2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:102791 Prph2 peripherin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4943 + EM:13841 C57BL/6N-Prorp/WtsiOulu EMMA embryo mutant strain MGI:6281941 Prorp endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1913382 Prorp protein only RNase P catalytic subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13841 + EM:13841 C57BL/6N-Prorp/WtsiOulu EMMA sperm mutant strain MGI:6281941 Prorp endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1913382 Prorp protein only RNase P catalytic subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13841 + EM:10735 C57BL/6N-Prmt1/H EMMA archived C57BL/6NTac-Prmt1/H mutant strain MGI:5587827 Prmt1 targeted mutation 1c, Welcome Trust Sanger Institute MGI:107846 Prmt1 protein arginine N-methyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10735 - EM:09536 C57BL/6N-Prl4a1/Cnrm EMMA sperm mutant strain MGI:5633827 Prl4a1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1206587 Prl4a1 prolactin family 4, subfamily a, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9536 + EM:08524 C57BL/6N-Prkg1/H EMMA sperm mutant strain MGI:4454120 Prkg1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108174 Prkg1 protein kinase, cGMP-dependent, type I https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8524 + EM:11965 C57BL/6N-Prkd3/Ieg EMMA sperm mutant strain MGI:4432250 Prkd3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922542 Prkd3 protein kinase D3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11965 ? EM:13709 C57BL/6N-Prkd1/WtsiOrl EMMA sperm mutant strain MGI:6153770 Prkd1 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:99879 Prkd1 protein kinase D1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13709 ? EM:13690 C57BL/6N-Prkd1/WtsiOrl EMMA sperm mutant strain MGI:6153585 Prkd1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:99879 Prkd1 protein kinase D1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13690 + EM:08365 C57BL/6N-Prkab2/H EMMA sperm mutant strain MGI:4946773 Prkab2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1336185 Prkab2 protein kinase, AMP-activated, beta 2 non-catalytic subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8365 ? EM:14536 C57BL/6N-Prkab1/WtsiPh EMMA sperm mutant strain MGI:5501071 Prkab1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336167 Prkab1 protein kinase, AMP-activated, beta 1 non-catalytic subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14536 + EM:09105 C57BL/6N-Prkab1/Ieg EMMA sperm mutant strain MGI:5501071 Prkab1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336167 Prkab1 protein kinase, AMP-activated, beta 1 non-catalytic subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9105 + EM:08673 C57BL/6N-Prkaa2/H EMMA sperm mutant strain MGI:5318770 Prkaa2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1336173 Prkaa2 protein kinase, AMP-activated, alpha 2 catalytic subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8673 - EM:05832 C57BL/6N-Primpol/H EMMA sperm mutant strain MGI:4432243 Primpol targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3603756 Primpol primase and polymerase (DNA-directed) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5832 - EM:07869 C57BL/6N-Prelid2/H EMMA sperm EPD0656_6_A01, B6NTac;B6N-Prelid2/H mutant strain MGI:4842294 Prelid2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924869 Prelid2 PRELI domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7869 ? EM:13886 C57BL/6N-Prdm8/WtsiCnbc EMMA sperm mutant strain MGI:6153584 Prdm8 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1924880 Prdm8 PR domain containing 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13886 + EM:10148 C57BL/6N-Prdm4/H EMMA sperm mutant strain MGI:5692724 Prdm4 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1920093 Prdm4 PR domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10148 + EM:06967 C57BL/6N-Prdm4/H EMMA sperm B6NTac;B6N-Prdm4/2H mutant strain MGI:4435837 Prdm4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920093 Prdm4 PR domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6967 + EM:11242 C57BL/6N-Prdm16/WtsiH EMMA sperm mutant strain MGI:5633825 Prdm16 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1917923 Prdm16 PR domain containing 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11242 + EM:09245 C57BL/6N-Prc1/Ieg EMMA sperm mutant strain MGI:5613643 Prc1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1858961 Prc1 protein regulator of cytokinesis 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9245 + EM:08513 C57BL/6N-Prc1/Ieg EMMA sperm mutant strain MGI:5294171 Prc1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1858961 Prc1 protein regulator of cytokinesis 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8513 ? EM:14210 C57BL/6N-Pramel15/WtsiIeg EMMA sperm mutant strain MGI:5637193 Pramel15 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3712553 Pramel15 PRAME like 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14210 + EM:07316 C57BL/6N-Pram1/H EMMA sperm B6NTac;B6N-Pram1/H mutant strain MGI:4461665 Pram1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3576625 Pram1 PML-RAR alpha-regulated adaptor molecule 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7316 + EM:10167 C57BL/6N-Ppy/Ieg EMMA sperm mutant strain MGI:5695979 Ppy targeted mutation 1b, Wellcome Trust Sanger Institute MGI:97753 Ppy pancreatic polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10167 - EM:07784 C57BL/6N-Ppt2/H EMMA sperm B6NTac;B6N-Ppt2/H mutant strain MGI:4841007 Ppt2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1860075 Ppt2 palmitoyl-protein thioesterase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7784 + EM:11031 C57BL/6N-Ppp4r3b/Ieg EMMA sperm mutant strain MGI:4847838 Ppp4r3b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2144474 Ppp4r3b protein phosphatase 4 regulatory subunit 3B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11031 + EM:11577 C57BL/6N-Ppp1cc/WtsiOulu EMMA embryo mutant strain MGI:6140218 Ppp1cc endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:104872 Ppp1cc protein phosphatase 1 catalytic subunit gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11577 + EM:11577 C57BL/6N-Ppp1cc/WtsiOulu EMMA sperm mutant strain MGI:6140218 Ppp1cc endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:104872 Ppp1cc protein phosphatase 1 catalytic subunit gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11577 ? EM:13940 C57BL/6N-Ppm1d/WtsiCnbc EMMA sperm mutant strain MGI:6153754 Ppm1d endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1858214 Ppm1d protein phosphatase 1D magnesium-dependent, delta isoform https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13940 - EM:06976 C57BL/6N-Ppm1a/H EMMA sperm B6NTac;B6N-Ppm1a/H mutant strain MGI:4458753 Ppm1a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99878 Ppm1a protein phosphatase 1A, magnesium dependent, alpha isoform https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6976 + EM:14297 C57BL/6N-Ppil3/WtsiH EMMA live mutant strain MGI:5637044 Ppil3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1917475 Ppil3 peptidylprolyl isomerase (cyclophilin)-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14297 + EM:09631 C57BL/6N-Ppfia2/H EMMA sperm mutant strain MGI:4458715 Ppfia2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443834 Ppfia2 protein tyrosine phosphatase, receptor type, f polypeptide (PTPRF), interacting protein (liprin), alpha 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9631 + EM:10145 C57BL/6N-Pparg/H EMMA sperm mutant strain MGI:5692913 Pparg targeted mutation 1c, Wellcome Trust Sanger Institute MGI:97747 Pparg peroxisome proliferator activated receptor gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10145 - EM:07489 C57BL/6N-Pparg/H EMMA sperm B6NTac;B6N-Pparg/H mutant strain MGI:4419888 Pparg targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97747 Pparg peroxisome proliferator activated receptor gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7489 ? EM:14787 C57BL/6N-Pou6f1/WtsiCnbc EMMA sperm mutant strain MGI:6153583 Pou6f1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:102935 Pou6f1 POU domain, class 6, transcription factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14787 + EM:09662 C57BL/6N-Pon2/H EMMA sperm mutant strain MGI:4847743 Pon2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:106687 Pon2 paraoxonase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9662 + EM:13758 C57BL/6N-Polr2m/WtsiCnrm EMMA live mutant strain MGI:6336060 Polr2m endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107282 Polr2m polymerase (RNA) II (DNA directed) polypeptide M https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13758 - EM:05202 C57BL/6N-Poln/Cnrm EMMA sperm mutant strain MGI:4435830 Poln targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2675617 Poln DNA polymerase N https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5202 ? EM:14161 C57BL/6N-Pold3/WtsiIeg EMMA sperm mutant strain MGI:5637026 Pold3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915217 Pold3 polymerase (DNA-directed), delta 3, accessory subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14161 ? EM:13847 C57BL/6N-Pogk/WtsiCnbc EMMA sperm mutant strain MGI:6153582 Pogk endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1918842 Pogk pogo transposable element with KRAB domain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13847 + EM:09640 C57BL/6N-Pmel/Ieg EMMA sperm mutant strain MGI:5637220 Pmel targeted mutation 1b, Wellcome Trust Sanger Institute MGI:98301 Pmel premelanosome protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9640 + EM:09637 C57BL/6N-Pmel/Ieg EMMA sperm mutant strain MGI:4441778 Pmel targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98301 Pmel premelanosome protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9637 ? EM:13689 C57BL/6N-Plxdc1/WtsiOrl EMMA sperm mutant strain MGI:6153581 Plxdc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919574 Plxdc1 plexin domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13689 + EM:05336 C57BL/6N-Plpp3/Cnrm EMMA sperm STOCK Plpp3/Cnrm, STOCK Ppap2b/Cnrm mutant strain MGI:4451775 Plpp3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915166 Plpp3 phospholipid phosphatase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5336 + EM:11214 C57BL/6N-Plet1/WtsiIeg EMMA sperm mutant strain MGI:6147556 Plet1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1923759 Plet1 placenta expressed transcript 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11214 ? EM:13759 C57BL/6N-Plekhf2/WtsiIeg EMMA sperm mutant strain MGI:6336059 Plekhf2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919051 Plekhf2 pleckstrin homology domain containing, family F (with FYVE domain) member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13759 + EM:13370 C57BL/6N-Plekhf1/WtsiCnrm EMMA live mutant strain MGI:6153580 Plekhf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919537 Plekhf1 pleckstrin homology domain containing, family F (with FYVE domain) member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13370 + EM:11755 C57BL/6N-Plekha1/Ieg EMMA sperm mutant strain MGI:5501548 Plekha1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2442213 Plekha1 pleckstrin homology domain containing, family A (phosphoinositide binding specific) member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11755 ? EM:14055 C57BL/6N-Plek/WtsiPh EMMA sperm mutant strain Plek EUCOMM targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1860485 Plek pleckstrin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14055 ? EM:13892 C57BL/6N-Plcg2/WtsiCnbc EMMA sperm mutant strain MGI:6153579 Plcg2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:97616 Plcg2 phospholipase C, gamma 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13892 - EM:07095 C57BL/6N-Plac9a/H EMMA sperm B6NTac;B6N-Plac9a/H, B6NTac;B6N-Plac9/H mutant strain MGI:4946775 Plac9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2663998 Plac9 placenta specific 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7095 + EM:09378 C57BL/6N-Plac8/Ieg EMMA sperm mutant strain MGI:5637155 Plac8 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2445289 Plac8 placenta-specific 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9378 + EM:09368 C57BL/6N-Plac8/Ieg EMMA sperm mutant strain MGI:4841670 Plac8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2445289 Plac8 placenta-specific 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9368 + EM:09779 C57BL/6N-Pla2g6/WtsiH EMMA sperm STOCK Pla2g6/WtsiH, Pla2g6-G04, MFZL mutant strain MGI:6209669 Pla2g6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859152 Pla2g6 phospholipase A2, group VI https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9779 + EM:08473 C57BL/6N-Pla2g2e/Ieg EMMA sperm mutant strain MGI:5636980 Pla2g2e targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1349660 Pla2g2e phospholipase A2, group IIE https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8473 + EM:08464 C57BL/6N-Pla2g2e/Ieg EMMA embryo mutant strain MGI:4432002 Pla2g2e targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1349660 Pla2g2e phospholipase A2, group IIE https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8464 + EM:14409 C57BL/6N-Pla2g2c/WtsiOulu EMMA embryo mutant strain MGI:5816875 Pla2g2c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106638 Pla2g2c phospholipase A2, group IIC https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14409 + EM:14409 C57BL/6N-Pla2g2c/WtsiOulu EMMA sperm mutant strain MGI:5816875 Pla2g2c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106638 Pla2g2c phospholipase A2, group IIC https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14409 + EM:08414 C57BL/6N-Pla2g10/Ieg EMMA embryo mutant strain MGI:5548469 Pla2g10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1347522 Pla2g10 phospholipase A2, group X https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8414 + EM:04720 C57BL/6N-Pla2g10/Ieg EMMA embryo B6NTac;B6N-Pla2g10/Ieg mutant strain MGI:4435080 Pla2g10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1347522 Pla2g10 phospholipase A2, group X https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4720 + EM:09244 C57BL/6N-Pkn2/Ieg EMMA sperm mutant strain MGI:5613636 Pkn2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:109211 Pkn2 protein kinase N2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9244 + EM:09415 C57BL/6N-Pkn2/Ieg EMMA sperm mutant strain MGI:4363870 Pkn2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109211 Pkn2 protein kinase N2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9415 + EM:08420 C57BL/6N-Pkig/Ieg EMMA sperm mutant strain MGI:5636975 Pkig targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1343086 Pkig protein kinase inhibitor, gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8420 + EM:08457 C57BL/6N-Pkig/Ieg EMMA embryo mutant strain MGI:5014672 Pkig targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1343086 Pkig protein kinase inhibitor, gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8457 - EM:07006 C57BL/6N-Pkd2l2/H EMMA sperm B6NTac;B6N-Pkd2l2/H, C57BL/6N-Pkd2l2tm1a(EUCOMM)Wtsi/H, EPD0354_1_A07 mutant strain MGI:4432894 Pkd2l2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858231 Pkd2l2 polycystic kidney disease 2-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7006 + EM:11574 C57BL/6N-Pitx1/WtsiIeg EMMA sperm mutant strain MGI:6140217 Pitx1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:107374 Pitx1 paired-like homeodomain transcription factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11574 + EM:10737 C57BL/6N-Pink1/H EMMA sperm mutant strain MGI:5637036 Pink1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916193 Pink1 PTEN induced putative kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10737 - EM:07320 C57BL/6N-Pink1/H EMMA sperm mutant strain MGI:5008020 Pink1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916193 Pink1 PTEN induced putative kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7320 ? EM:13872 C57BL/6N-Pilrb2/WtsiCnbc EMMA sperm mutant strain MGI:6153578 Pilrb2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2450535 Pilrb2 paired immunoglobin-like type 2 receptor beta 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13872 + EM:13541 C57BL/6N-Pik3cg/WtsiKieg EMMA embryo mutant strain MGI:6149897 Pik3cg targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1353576 Pik3cg phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13541 + EM:13541 C57BL/6N-Pik3cg/WtsiKieg EMMA sperm mutant strain MGI:6149897 Pik3cg targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1353576 Pik3cg phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13541 ? EM:14419 C57BL/6N-Pigl/WtsiIeg EMMA sperm mutant strain MGI:5637168 Pigl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2681271 Pigl phosphatidylinositol glycan anchor biosynthesis, class L https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14419 ? EM:13932 C57BL/6N-Phip/WtsiCnbc EMMA sperm mutant strain MGI:6153577 Phip endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1932404 Phip pleckstrin homology domain interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13932 ? EM:13924 C57BL/6N-Phgdh/WtsiCnbc EMMA sperm mutant strain MGI:6153576 Phgdh endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1355330 Phgdh 3-phosphoglycerate dehydrogenase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13924 ? EM:14446 C57BL/6N-Phf8/WtsiCnbc EMMA sperm mutant strain MGI:6153728 Phf8 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:2444341 Phf8 PHD finger protein 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14446 + EM:13378 C57BL/6N-Phf7/WtsiCnrm EMMA live mutant strain MGI:6153574 Phf7 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919088 Phf7 PHD finger protein 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13378 + EM:08412 C57BL/6N-Pgs1/Ieg EMMA sperm mutant strain MGI:5637078 Pgs1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1921701 Pgs1 phosphatidylglycerophosphate synthase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8412 + EM:08407 C57BL/6N-Pgs1/Ieg EMMA embryo mutant strain MGI:4451871 Pgs1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921701 Pgs1 phosphatidylglycerophosphate synthase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8407 + EM:14253 C57BL/6N-Pgap2/WtsiH EMMA live mutant strain MGI:5637131 Pgap2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2385286 Pgap2 post-GPI attachment to proteins 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14253 + EM:10135 C57BL/6N-Pfkfb3/Ieg EMMA sperm mutant strain MGI:5692802 Pfkfb3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2181202 Pfkfb3 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10135 + EM:09829 C57BL/6N-Pfkfb3/Ieg EMMA sperm mutant strain MGI:4441922 Pfkfb3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2181202 Pfkfb3 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9829 - EM:05837 C57BL/6N-Pex1/Cnrm EMMA sperm mutant strain MGI:4458786 Pex1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1918632 Pex1 peroxisomal biogenesis factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5837 + EM:10465 C57BL/6N-Per2/H EMMA sperm mutant strain MGI:5752545 Per2 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1195265 Per2 period circadian clock 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10465 + EM:04827 C57BL/6N-Per2/H EMMA sperm B6NTac;B6N-Per2/H mutant strain MGI:4436072 Per2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1195265 Per2 period circadian clock 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4827 + EM:08468 C57BL/6N-Pef1/Ieg EMMA sperm mutant strain MGI:5614701 Pef1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1915148 Pef1 penta-EF hand domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8468 + EM:13746 C57BL/6N-Pdzrn4/WtsiOrl EMMA live mutant strain MGI:6257816 Pdzrn4 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:3056996 Pdzrn4 PDZ domain containing RING finger 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13746 + EM:14527 C57BL/6N-Pdzk1/WtsiOulu EMMA embryo mutant strain MGI:5692756 Pdzk1 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1928901 Pdzk1 PDZ domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14527 + EM:14527 C57BL/6N-Pdzk1/WtsiOulu EMMA sperm mutant strain MGI:5692756 Pdzk1 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1928901 Pdzk1 PDZ domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14527 + EM:14234 C57BL/6N-Pdzd8/WtsiH EMMA live mutant strain MGI:5708255 Pdzd8 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2677270 Pdzd8 PDZ domain containing 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14234 + EM:09324 C57BL/6N-Pdss2/H EMMA sperm mutant strain MGI:4946711 Pdss2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918615 Pdss2 prenyl (solanesyl) diphosphate synthase, subunit 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9324 + EM:09046 C57BL/6N-Pdpn/H EMMA sperm mutant strain MGI:5692543 Pdpn targeted mutation 1c, Wellcome Trust Sanger Institute MGI:103098 Pdpn podoplanin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9046 + EM:06983 C57BL/6N-Pdpn/H EMMA sperm B6NTac;B6N-Pdpn/H mutant strain MGI:4842558 Pdpn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:103098 Pdpn podoplanin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6983 + EM:11894 C57BL/6N-Pdlim1/WtsiH EMMA sperm mutant strain MGI:6153573 Pdlim1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1860611 Pdlim1 PDZ and LIM domain 1 (elfin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11894 + EM:09298 C57BL/6N-Pdia6/Ieg EMMA sperm mutant strain MGI:5605786 Pdia6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919103 Pdia6 protein disulfide isomerase associated 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9298 + EM:13656 C57BL/6N-Pdia4/WtsiH EMMA live mutant strain MGI:5636896 Pdia4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104864 Pdia4 protein disulfide isomerase associated 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13656 + EM:09243 C57BL/6N-Pdhx/Ieg EMMA sperm mutant strain MGI:5613640 Pdhx targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1351627 Pdhx pyruvate dehydrogenase complex, component X https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9243 + EM:08382 C57BL/6N-Pdgfrb/H EMMA sperm mutant strain MGI:4841570 Pdgfrb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97531 Pdgfrb platelet derived growth factor receptor, beta polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8382 + EM:11374 C57BL/6N-Pdgfc/Ieg EMMA sperm mutant strain MGI:4435567 Pdgfc targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1859631 Pdgfc platelet-derived growth factor, C polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11374 + EM:10833 C57BL/6N-Pde8a/H EMMA sperm mutant strain MGI:4941557 Pde8a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1277116 Pde8a phosphodiesterase 8A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10833 + EM:08956 C57BL/6N-Pdcd5/Biat EMMA sperm mutant strain MGI:4951313 Pdcd5 targeted mutation 1, Velocigene MGI:1913538 Pdcd5 programmed cell death 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8956 ? EM:14165 C57BL/6N-Pdcd2/WtsiIeg EMMA sperm mutant strain MGI:5636894 Pdcd2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104643 Pdcd2 programmed cell death 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14165 + EM:08090 C57BL/6N-Pcx/Ieg EMMA embryo C57BL/6N-Pcx/Hmgu mutant strain MGI:5548959 Pcx targeted mutation 1b, Wellcome Trust Sanger Institute MGI:97520 Pcx pyruvate carboxylase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8090 + EM:09641 C57BL/6N-Pcsk9/Ieg EMMA sperm mutant strain MGI:5637110 Pcsk9 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2140260 Pcsk9 proprotein convertase subtilisin/kexin type 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9641 + EM:09064 C57BL/6N-Pcsk9/Ieg EMMA sperm mutant strain MGI:5511776 Pcsk9 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2140260 Pcsk9 proprotein convertase subtilisin/kexin type 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9064 + EM:04708 C57BL/6N-Pcnx3/Cnrm EMMA embryo B6NDen;B6N-Pcnxl3/Cnrm, C57BL/6N-Pcnxl3/Cnrm, HEPD0534_9_H10, B6Dnk;B6N-Pcnxl3/Cnrm mutant strain MGI:4434701 Pcnx3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1861733 Pcnx3 pecanex homolog 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4708 + EM:04708 C57BL/6N-Pcnx3/Cnrm EMMA sperm B6NDen;B6N-Pcnxl3/Cnrm, C57BL/6N-Pcnxl3/Cnrm, HEPD0534_9_H10, B6Dnk;B6N-Pcnxl3/Cnrm mutant strain MGI:4434701 Pcnx3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1861733 Pcnx3 pecanex homolog 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4708 + EM:09398 C57BL/6N-Pced1a/WtsiOrl EMMA sperm mutant strain MGI:5548804 Pced1a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442177 Pced1a PC-esterase domain containing 1A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9398 + EM:14550 C57BL/6N-Pcdh7/WtsiOulu EMMA embryo mutant strain MGI:6281098 Pcdh7 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1860487 Pcdh7 protocadherin 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14550 + EM:14550 C57BL/6N-Pcdh7/WtsiOulu EMMA sperm mutant strain MGI:6281098 Pcdh7 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1860487 Pcdh7 protocadherin 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14550 ? EM:13926 C57BL/6N-Pcdh1/WtsiCnbc EMMA sperm mutant strain MGI:6153572 Pcdh1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:104692 Pcdh1 protocadherin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13926 ? EM:13880 C57BL/6N-Pcdh15/WtsiCnbc EMMA sperm mutant strain MGI:6153753 Pcdh15 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891428 Pcdh15 protocadherin 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13880 - EM:08416 C57BL/6N-Pbrm1/Ieg EMMA sperm mutant strain MGI:5548674 Pbrm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923998 Pbrm1 polybromo 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8416 + EM:10134 C57BL/6N-Pax5/Ieg EMMA sperm mutant strain MGI:5692910 Pax5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:97489 Pax5 paired box 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10134 - EM:07871 C57BL/6N-Pawr/H EMMA sperm B6NTac;B6N-Pawr/H mutant strain MGI:4888921 Pawr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2149961 Pawr PRKC, apoptosis, WT1, regulator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7871 ? EM:13864 C57BL/6N-Parn/WtsiCnbc EMMA sperm mutant strain MGI:6153570 Parn endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921358 Parn poly(A)-specific ribonuclease (deadenylation nuclease) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13864 + EM:09120 C57BL/6N-Pard3b/Ieg EMMA sperm mutant strain MGI:5588280 Pard3b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919301 Pard3b par-3 family cell polarity regulator beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9120 + EM:08123 C57BL/6N-Pard3b/Ieg EMMA embryo B6NTac;B6N-Pard3b/Ieg mutant strain MGI:4441664 Pard3b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919301 Pard3b par-3 family cell polarity regulator beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8123 - EM:07836 C57BL/6N-Pard3/H EMMA sperm B6NTac;B6N-Pard3/H mutant strain MGI:4364353 Pard3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2135608 Pard3 par-3 family cell polarity regulator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7836 + EM:08752 C57BL/6N-Paox/Ieg EMMA sperm mutant strain MGI:5548591 Paox targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1916983 Paox polyamine oxidase (exo-N4-amino) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8752 + EM:07443 C57BL/6N-Paox/Ieg EMMA embryo mutant strain MGI:4363510 Paox targeted mutation 1, Wellcome Trust Sanger Institute MGI:1916983 Paox polyamine oxidase (exo-N4-amino) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7443 ? EM:14140 C57BL/6N-Pam16/WtsiCnbc EMMA archived mutant strain MGI:5637011 Pam16 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913699 Pam16 presequence translocase-asssociated motor 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14140 + EM:13380 C57BL/6N-Palm/WtsiCnrm EMMA live mutant strain MGI:6153569 Palm endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1261814 Palm paralemmin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13380 + EM:10463 C57BL/6N-Pak1/H EMMA sperm mutant strain MGI:5752547 Pak1 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1339975 Pak1 p21 (RAC1) activated kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10463 - EM:07474 C57BL/6N-Pak1/H EMMA sperm B6NTac;B6N-Pak1/H mutant strain MGI:4842016 Pak1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1339975 Pak1 p21 (RAC1) activated kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7474 + EM:07909 C57BL/6N-P2rx7/Ieg EMMA embryo C57BL/6N-P2rx7/Hmgu mutant strain MGI:5548444 P2rx7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1339957 P2rx7 purinergic receptor P2X, ligand-gated ion channel, 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7909 + EM:05116 C57BL/6N-P2rx7/Ieg EMMA sperm B6NTac;B6N-P2rx7/Ieg mutant strain MGI:4432150 P2rx7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1339957 P2rx7 purinergic receptor P2X, ligand-gated ion channel, 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5116 - EM:07066 C57BL/6N-P2rx6/H EMMA sperm B6NTac;B6N-P2rx6/H mutant strain MGI:5050912 P2rx6 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1337113 P2rx6 purinergic receptor P2X, ligand-gated ion channel, 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7066 + EM:10131 C57BL/6N-P2rx5/Ieg EMMA sperm mutant strain MGI:5692770 P2rx5 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2137026 P2rx5 purinergic receptor P2X, ligand-gated ion channel, 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10131 + EM:09185 C57BL/6N-P2rx5/Ieg EMMA embryo mutant strain MGI:4841555 P2rx5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2137026 P2rx5 purinergic receptor P2X, ligand-gated ion channel, 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9185 + EM:09045 C57BL/6N-P2rx4/H EMMA sperm mutant strain MGI:5708187 P2rx4 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1338859 P2rx4 purinergic receptor P2X, ligand-gated ion channel 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9045 + EM:07910 C57BL/6N-P2rx4/H EMMA live mutant strain MGI:5548440 P2rx4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1338859 P2rx4 purinergic receptor P2X, ligand-gated ion channel 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7910 - EM:06002 C57BL/6N-P2rx4/H EMMA sperm B6NTac;B6N-P2rx4/H mutant strain MGI:4944573 P2rx4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1338859 P2rx4 purinergic receptor P2X, ligand-gated ion channel 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6002 + EM:14286 C57BL/6N-Otud7b/WtsiH EMMA live mutant strain MGI:5637162 Otud7b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2654703 Otud7b OTU domain containing 7B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14286 + EM:11053 C57BL/6N-Otud4/H EMMA sperm mutant strain MGI:5319342 Otud4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1098801 Otud4 OTU domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11053 + EM:12646 C57BL/6N-Otp/H EMMA sperm mutant strain MGI:5008941 Otp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99835 Otp orthopedia homeobox https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12646 ? EM:14440 C57BL/6N-Otof/WtsiCnbc EMMA sperm mutant strain MGI:6257766 Otof endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1891247 Otof otoferlin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14440 ? EM:13937 C57BL/6N-Ostn/WtsiCnbc EMMA sperm mutant strain MGI:6153568 Ostn endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2677164 Ostn osteocrin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13937 + EM:11035 C57BL/6N-Ostf1/Ieg EMMA sperm mutant strain MGI:5811626 Ostf1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:700012 Ostf1 osteoclast stimulating factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11035 + EM:09636 C57BL/6N-Ostf1/Ieg EMMA sperm mutant strain MGI:5052480 Ostf1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:700012 Ostf1 osteoclast stimulating factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9636 + EM:10122 C57BL/6N-Oscp1/Ieg EMMA sperm mutant strain MGI:5692692 Oscp1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1916308 Oscp1 organic solute carrier partner 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10122 + EM:09399 C57BL/6N-Oscp1/Ieg EMMA sperm mutant strain MGI:4881057 Oscp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916308 Oscp1 organic solute carrier partner 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9399 + EM:10133 C57BL/6N-Osbpl11/Ieg EMMA sperm mutant strain MGI:5692785 Osbpl11 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2146553 Osbpl11 oxysterol binding protein-like 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10133 + EM:10074 C57BL/6N-Osbpl11/Ieg EMMA sperm mutant strain MGI:4847796 Osbpl11 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2146553 Osbpl11 oxysterol binding protein-like 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10074 + EM:08075 C57BL/6N-Oplah/Ieg EMMA sperm C57BL/6N-Oplah/Hmgu mutant strain MGI:5548658 Oplah targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922725 Oplah 5-oxoprolinase (ATP-hydrolysing) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8075 + EM:08077 C57BL/6N-Odad3/Ieg EMMA sperm C57BL/6N-Ccdc151/Ieg mutant strain MGI:5548687 Odad3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1924859 Odad3 outer dynein arm docking complex subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8077 + EM:12746 C57BL/6N-Odad3/Cnrm EMMA live C57BL/6N-Ccdc151/Cnrm mutant strain MGI:5548687 Odad3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1924859 Odad3 outer dynein arm docking complex subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12746 + EM:05473 C57BL/6N-Odad3/Cnrm EMMA sperm C57BL/6N-Ccdc151/Cnrm mutant strain MGI:4455711 Odad3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924859 Odad3 outer dynein arm docking complex subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5473 + EM:11765 C57BL/6N-Oard1/WtsiCnrm EMMA sperm mutant strain MGI:6152739 Oard1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2146818 Oard1 O-acyl-ADP-ribose deacylase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11765 + EM:05127 C57BL/6N-Nxpe5/H EMMA sperm mutant strain MGI:4433447 Nxpe5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3584036 Nxpe5 neurexophilin and PC-esterase domain family, member 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5127 + EM:08100 C57BL/6N-Nxn/Ieg EMMA sperm C57BL/6N-Nxn/Hmgu mutant strain MGI:5548389 Nxn targeted mutation 1b, Wellcome Trust Sanger Institute MGI:109331 Nxn nucleoredoxin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8100 ? EM:14308 C57BL/6N-Nutm2/WtsiIeg EMMA sperm mutant strain MGI:5637173 Nutm2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2685652 Nutm2 NUT family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14308 + EM:14528 C57BL/6N-Nutm1/WtsiOulu EMMA embryo mutant strain MGI:5812926 Nutm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2661384 Nutm1 NUT midline carcinoma, family member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14528 + EM:14528 C57BL/6N-Nutm1/WtsiOulu EMMA sperm mutant strain MGI:5812926 Nutm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2661384 Nutm1 NUT midline carcinoma, family member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14528 + EM:11375 C57BL/6N-Nup35/Ieg EMMA sperm mutant strain MGI:5008019 Nup35 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916732 Nup35 nucleoporin 35 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11375 ? EM:13836 C57BL/6N-Nudcd3/WtsiCnbc EMMA sperm mutant strain MGI:6153752 Nudcd3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2144158 Nudcd3 NudC domain containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13836 + EM:09632 C57BL/6N-Nucks1/Ieg EMMA embryo mutant strain MGI:4841942 Nucks1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1934811 Nucks1 nuclear casein kinase and cyclin-dependent kinase substrate 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9632 + EM:11226 C57BL/6N-Nubpl/WtsiIeg EMMA sperm mutant strain MGI:5775003 Nubpl targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1924076 Nubpl nucleotide binding protein-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11226 + EM:14541 C57BL/6N-Nubpl/WtsiOulu EMMA embryo mutant strain MGI:5548675 Nubpl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924076 Nubpl nucleotide binding protein-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14541 + EM:14541 C57BL/6N-Nubpl/WtsiOulu EMMA sperm mutant strain MGI:5548675 Nubpl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924076 Nubpl nucleotide binding protein-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14541 + EM:09242 C57BL/6N-Nubp2/Ieg EMMA sperm mutant strain MGI:5613638 Nubp2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1347072 Nubp2 nucleotide binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9242 + EM:08954 C57BL/6N-Nubp2/Ieg EMMA sperm mutant strain MGI:4460379 Nubp2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1347072 Nubp2 nucleotide binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8954 - EM:07446 C57BL/6N-Ntrk2/H EMMA sperm mutant strain MGI:4460486 Ntrk2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97384 Ntrk2 neurotrophic tyrosine kinase, receptor, type 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7446 + EM:10147 C57BL/6N-Ntrk1/H EMMA sperm mutant strain MGI:5692907 Ntrk1 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:97383 Ntrk1 neurotrophic tyrosine kinase, receptor, type 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10147 - EM:07342 C57BL/6N-Ntrk1/H EMMA sperm B6NTac;B6N-Ntrk1/H mutant strain MGI:4887687 Ntrk1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97383 Ntrk1 neurotrophic tyrosine kinase, receptor, type 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7342 + EM:11650 C57BL/6N-Nsun2/WtsiOulu EMMA embryo mutant strain MGI:5310947 Nsun2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:107252 Nsun2 NOL1/NOP2/Sun domain family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11650 + EM:11650 C57BL/6N-Nsun2/WtsiOulu EMMA sperm mutant strain MGI:5310947 Nsun2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:107252 Nsun2 NOL1/NOP2/Sun domain family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11650 ? EM:13751 C57BL/6N-Nsmce1/WtsiIeg EMMA sperm mutant strain MGI:6153567 Nsmce1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914961 Nsmce1 NSE1 homolog, SMC5-SMC6 complex component https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13751 + EM:09010 C57BL/6N-Nsd3/H EMMA sperm C57BL/6N-Whsc1l1/H mutant strain MGI:4434820 Nsd3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2142581 Nsd3 nuclear receptor binding SET domain protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9010 + EM:09544 C57BL/6N-Nrxn1/H EMMA sperm mutant strain MGI:5008771 Nrxn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1096391 Nrxn1 neurexin I https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9544 ? EM:14784 C57BL/6N-Nrg4/WtsiCnbc EMMA sperm mutant strain MGI:6153566 Nrg4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1933833 Nrg4 neuregulin 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14784 + EM:14213 C57BL/6N-Nrbp1/WtsiOulu EMMA embryo mutant strain MGI:5637124 Nrbp1 targeted mutation 3b, Wellcome Trust Sanger Institute MGI:2183436 Nrbp1 nuclear receptor binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14213 + EM:14213 C57BL/6N-Nrbp1/WtsiOulu EMMA sperm mutant strain MGI:5637124 Nrbp1 targeted mutation 3b, Wellcome Trust Sanger Institute MGI:2183436 Nrbp1 nuclear receptor binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14213 + EM:10426 C57BL/6N-Nras/H EMMA sperm mutant strain MGI:5002952 Nras targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97376 Nras neuroblastoma ras oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10426 + EM:09780 C57BL/6N-Nr4a1/Biat EMMA sperm mutant strain MGI:4432935 Nr4a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1352454 Nr4a1 nuclear receptor subfamily 4, group A, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9780 + EM:13691 C57BL/6N-Nr0b1/WtsiOrl EMMA embryo mutant strain MGI:6153726 Nr0b1 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:1352460 Nr0b1 nuclear receptor subfamily 0, group B, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13691 + EM:06125 C57BL/6N-Nptn/H EMMA sperm B6NTac;B6N-Nptn/H mutant strain MGI:4455733 Nptn targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108077 Nptn neuroplastin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6125 - EM:04739 C57BL/6N-Npc1/H EMMA sperm B6NTac;B6N-Npc1/H mutant strain MGI:4436617 Npc1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1097712 Npc1 NPC intracellular cholesterol transporter 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4739 ? EM:14323 C57BL/6N-Npat/WtsiIeg EMMA sperm mutant strain MGI:5636907 Npat targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107605 Npat nuclear protein in the AT region https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14323 + EM:09421 C57BL/6N-Notch1/H EMMA sperm mutant strain MGI:4455755 Notch1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97363 Notch1 notch 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9421 + EM:10111 C57BL/6N-Nolc1/Ieg EMMA sperm mutant strain MGI:5692702 Nolc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1918019 Nolc1 nucleolar and coiled-body phosphoprotein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10111 + EM:10121 C57BL/6N-Nmt2/Ieg EMMA sperm mutant strain MGI:5692594 Nmt2 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1202298 Nmt2 N-myristoyltransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10121 - EM:07781 C57BL/6N-Nlrp9b/H EMMA sperm B6NTac;B6N-Nlrp9b/H mutant strain MGI:4841142 Nlrp9b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2675377 Nlrp9b NLR family, pyrin domain containing 9B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7781 + EM:08369 C57BL/6N-Nlrc4/H EMMA sperm mutant strain MGI:4841652 Nlrc4 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:3036243 Nlrc4 NLR family, CARD domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8369 ? EM:14588 C57BL/6N-Nkain3/WtsiPh EMMA sperm mutant strain MGI:6153564 Nkain3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2444830 Nkain3 Na+/K+ transporting ATPase interacting 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14588 + EM:08808 C57BL/6N-Nisch/H EMMA sperm mutant strain MGI:5319353 Nisch targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1928323 Nisch nischarin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8808 ? EM:14162 C57BL/6N-Nipsnap3a/WtsiIeg EMMA sperm mutant strain MGI:5637068 Nipsnap3a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1920648 Nipsnap3a nipsnap homolog 3A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14162 + EM:10598 C57BL/6N-Ngfr/H EMMA archived mutant strain MGI:5637211 Ngfr targeted mutation 1b, Wellcome Trust Sanger Institute MGI:97323 Ngfr nerve growth factor receptor (TNFR superfamily, member 16) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10598 + EM:10120 C57BL/6N-Ngdn/Ieg EMMA sperm mutant strain MGI:5692691 Ngdn targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916216 Ngdn neuroguidin, EIF4E binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10120 + EM:10064 C57BL/6N-Ngdn/Ieg EMMA sperm mutant strain MGI:5052489 Ngdn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916216 Ngdn neuroguidin, EIF4E binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10064 + EM:13885 C57BL/6N-Nfkbiz/WtsiOulu EMMA embryo mutant strain MGI:6153562 Nfkbiz endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1931595 Nfkbiz nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, zeta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13885 + EM:13885 C57BL/6N-Nfkbiz/WtsiOulu EMMA sperm mutant strain MGI:6153562 Nfkbiz endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1931595 Nfkbiz nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, zeta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13885 + EM:08106 C57BL/6N-Nfatc3/Ieg EMMA sperm C57BL/6N-Nfatc3/Hmgu mutant strain MGI:5548344 Nfatc3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:103296 Nfatc3 nuclear factor of activated T cells, cytoplasmic, calcineurin dependent 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8106 + EM:08102 C57BL/6N-Nfatc3/Ieg EMMA embryo B6NTac;B6N-Nfatc3/Ieg mutant strain MGI:5000351 Nfatc3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103296 Nfatc3 nuclear factor of activated T cells, cytoplasmic, calcineurin dependent 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8102 ? EM:05494 C57BL/6N-Nexn/Ieg EMMA embryo mutant strain Nexn Nexn MGI:1916060 Nexn nexilin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5494 ? EM:05495 C57BL/6N-Nexn/Ieg EMMA embryo mutant strain Nexn Nexn MGI:1916060 Nexn nexilin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5495 ? EM:14407 C57BL/6N-Nek3/WtsiIeg EMMA sperm mutant strain MGI:5636976 Nek3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1344371 Nek3 NIMA (never in mitosis gene a)-related expressed kinase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14407 + EM:07339 C57BL/6N-Nedd4l/H EMMA sperm B6NTac;B6N-Nedd4l/H mutant strain MGI:4363447 Nedd4l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933754 Nedd4l neural precursor cell expressed, developmentally down-regulated gene 4-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7339 + EM:08459 C57BL/6N-Nedd4/H EMMA sperm mutant strain MGI:5511569 Nedd4 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:97297 Nedd4 neural precursor cell expressed, developmentally down-regulated 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8459 + EM:14271 C57BL/6N-Nebl/WtsiPh EMMA live mutant strain MGI:5692728 Nebl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921353 Nebl nebulette https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14271 + EM:08470 C57BL/6N-Ndufs1/Ieg EMMA sperm mutant strain MGI:5548814 Ndufs1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2443241 Ndufs1 NADH:ubiquinone oxidoreductase core subunit S1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8470 + EM:08460 C57BL/6N-Ndufs1/Ieg EMMA embryo mutant strain MGI:4843861 Ndufs1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443241 Ndufs1 NADH:ubiquinone oxidoreductase core subunit S1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8460 + EM:09311 C57BL/6N-Ndufb9/Ieg EMMA sperm mutant strain MGI:5637008 Ndufb9 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1913468 Ndufb9 NADH:ubiquinone oxidoreductase subunit B9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9311 + EM:09291 C57BL/6N-Ndufb9/Ieg EMMA embryo mutant strain MGI:4841556 Ndufb9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913468 Ndufb9 NADH:ubiquinone oxidoreductase subunit B9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9291 + EM:09291 C57BL/6N-Ndufb9/Ieg EMMA sperm mutant strain MGI:4841556 Ndufb9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913468 Ndufb9 NADH:ubiquinone oxidoreductase subunit B9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9291 + EM:14500 C57BL/6N-Ndufb4/WtsiOulu EMMA embryo mutant strain MGI:6149899 Ndufb4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915444 Ndufb4 NADH:ubiquinone oxidoreductase subunit B4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14500 + EM:14500 C57BL/6N-Ndufb4/WtsiOulu EMMA sperm mutant strain MGI:6149899 Ndufb4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915444 Ndufb4 NADH:ubiquinone oxidoreductase subunit B4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14500 + EM:08092 C57BL/6N-Ndufa8/Ieg EMMA embryo C57BL/6N-Ndufa8/Hmgu mutant strain MGI:5548563 Ndufa8 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1915625 Ndufa8 NADH:ubiquinone oxidoreductase subunit A8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8092 + EM:10048 C57BL/6N-Ndufa10/Ieg EMMA sperm mutant strain MGI:6317360 Ndufa10 targeted mutation 1e.1, Helmholtz Zentrum Muenchen GmbH MGI:1914523 Ndufa10 NADH:ubiquinone oxidoreductase subunit A10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10048 + EM:13385 C57BL/6N-Ndrg2/WtsiCnrm EMMA live mutant strain MGI:6153561 Ndrg2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1352498 Ndrg2 N-myc downstream regulated gene 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13385 + EM:09864 C57BL/6N-Ndnf/Oulu EMMA embryo mutant strain MGI:4880569 Ndnf targeted mutation 1, Mammalian Functional Genomics Centre MGI:1915419 Ndnf neuron-derived neurotrophic factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9864 + EM:09864 C57BL/6N-Ndnf/Oulu EMMA sperm mutant strain MGI:4880569 Ndnf targeted mutation 1, Mammalian Functional Genomics Centre MGI:1915419 Ndnf neuron-derived neurotrophic factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9864 + EM:08069 C57BL/6N-Ndfip2/Ieg EMMA embryo C57BL/6N-Ndfip2/Hmgu mutant strain MGI:5548666 Ndfip2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1923523 Ndfip2 Nedd4 family interacting protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8069 + EM:05045 C57BL/6N-Ndfip2/Ieg EMMA embryo B6NTac;B6N-Ndfip2/Ieg mutant strain MGI:4436082 Ndfip2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923523 Ndfip2 Nedd4 family interacting protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5045 ? EM:14406 C57BL/6N-Nctc1/WtsiOrl EMMA sperm mutant strain Nctc1 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:1306816 Nctc1 non-coding transcript 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14406 + EM:09372 C57BL/6N-Ncoa3/H EMMA sperm mutant strain MGI:5008021 Ncoa3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1276535 Ncoa3 nuclear receptor coactivator 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9372 - EM:08188 C57BL/6N-Ncf4/H EMMA sperm B6NTac;B6N-Ncf4/H mutant strain MGI:4841143 Ncf4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109186 Ncf4 neutrophil cytosolic factor 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8188 + EM:14211 C57BL/6N-Ncf2/WtsiH EMMA live mutant strain MGI:6149902 Ncf2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:97284 Ncf2 neutrophil cytosolic factor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14211 ? EM:13843 C57BL/6N-Ncapd3/WtsiCnbc EMMA sperm mutant strain MGI:6153560 Ncapd3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2142989 Ncapd3 non-SMC condensin II complex, subunit D3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13843 ? EM:14451 C57BL/6N-Ncapd2/WtsiCnbc EMMA sperm mutant strain MGI:6153559 Ncapd2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1915548 Ncapd2 non-SMC condensin I complex, subunit D2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14451 + EM:14279 C57BL/6N-Nbeal1/WtsiH EMMA live mutant strain MGI:5785044 Nbeal1 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2444343 Nbeal1 neurobeachin like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14279 ? EM:14919 C57BL/6N-Nbea/Ieg EMMA sperm mutant strain Nbea Nbea MGI:1347075 Nbea neurobeachin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14919 + EM:08754 C57BL/6N-Nbas/Ieg EMMA sperm mutant strain MGI:5548607 Nbas targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1918419 Nbas neuroblastoma amplified sequence https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8754 + EM:07435 C57BL/6N-Nbas/Ieg EMMA embryo B6NTac;B6N-Nbas/Ieg mutant strain MGI:4946709 Nbas targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918419 Nbas neuroblastoma amplified sequence https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7435 + EM:07859 C57BL/6N-Natd1/WtsiOulu EMMA embryo C57BL/6N-Gm16515/WtsiOulu mutant strain MGI:5548455 Natd1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1344388 Natd1 N-acetyltransferase domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7859 + EM:07859 C57BL/6N-Natd1/WtsiOulu EMMA sperm C57BL/6N-Gm16515/WtsiOulu mutant strain MGI:5548455 Natd1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1344388 Natd1 N-acetyltransferase domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7859 + EM:08809 C57BL/6N-Nat8f5/H EMMA sperm mutant strain MGI:5141838 Nat8f5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916299 Nat8f5 N-acetyltransferase 8 (GCN5-related) family member 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8809 - EM:12338 C57BL/6N-Nap1l4/Orl EMMA sperm mutant strain MGI:6357884 Nap1l4 endonuclease-mediated mutation 1, Centre d'ImmunoPhenomique MGI:1316687 Nap1l4 nucleosome assembly protein 1-like 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12338 - EM:05309 C57BL/6N-Nagk/H EMMA sperm mutant strain MGI:4455634 Nagk targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1860418 Nagk N-acetylglucosamine kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5309 + EM:14402 C57BL/6N-Nadk2/WtsiH EMMA live mutant strain MGI:5637034 Nadk2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915896 Nadk2 NAD kinase 2, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14402 + EM:14539 C57BL/6N-Nacc2/WtsiH EMMA live mutant strain MGI:5637027 Nacc2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1915241 Nacc2 nucleus accumbens associated 2, BEN and BTB (POZ) domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14539 + EM:09096 C57BL/6N-Myoz1/Ieg EMMA embryo mutant strain MGI:5548708 Myoz1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1929471 Myoz1 myozenin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9096 ? EM:14487 C57BL/6N-Myo9a/WtsiCnbc EMMA archived mutant strain MGI:5636908 Myo9a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107735 Myo9a myosin IXa https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14487 + EM:13364 C57BL/6N-Myo5b/WtsiCnrm EMMA live mutant strain MGI:6153496 Myo5b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:106598 Myo5b myosin VB https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13364 ? EM:13855 C57BL/6N-Myl3/WtsiCnbc EMMA sperm mutant strain MGI:6153495 Myl3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:97268 Myl3 myosin, light polypeptide 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13855 + EM:09487 C57BL/6N-Myl2/Ieg EMMA sperm mutant strain MGI:5425876 Myl2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97272 Myl2 myosin, light polypeptide 2, regulatory, cardiac, slow https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9487 + EM:11897 C57BL/6N-Myl10/WtsiH EMMA sperm mutant strain MGI:6153494 Myl10 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891705 Myl10 myosin, light chain 10, regulatory https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11897 + EM:14254 C57BL/6N-Myh3/WtsiH EMMA live mutant strain MGI:6120706 Myh3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1339709 Myh3 myosin, heavy polypeptide 3, skeletal muscle, embryonic https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14254 + EM:08157 C57BL/6N-Mybphl/WtsiBiat EMMA sperm mutant strain MGI:5548569 Mybphl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916003 Mybphl myosin binding protein H-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8157 + EM:09100 C57BL/6N-Mybbp1a/Ieg EMMA sperm mutant strain MGI:5548364 Mybbp1a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:106181 Mybbp1a MYB binding protein (P160) 1a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9100 + EM:06278 C57BL/6N-Mybbp1a/Ieg EMMA embryo B6NTac;B6N-Mybbp1a/Ieg mutant strain MGI:4435114 Mybbp1a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:106181 Mybbp1a MYB binding protein (P160) 1a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6278 ? EM:14275 C57BL/6N-Mtmr1/WtsiIeg EMMA sperm mutant strain MGI:5708190 Mtmr1 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1858271 Mtmr1 myotubularin related protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14275 ? EM:13458 C57BL/6N-Mtif3/IegBiat EMMA sperm unclassified Mtif3 Mtif3 MGI:1923616 Mtif3 mitochondrial translational initiation factor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13458 + EM:09253 C57BL/6N-Mtif3/Ieg EMMA sperm mutant strain MGI:5613653 Mtif3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923616 Mtif3 mitochondrial translational initiation factor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9253 + EM:08245 C57BL/6N-Mtif3/Ieg EMMA embryo mutant strain MGI:4457571 Mtif3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923616 Mtif3 mitochondrial translational initiation factor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8245 + EM:08654 C57BL/6N-Mthfsl/Ieg EMMA sperm mutant strain MGI:5548911 Mthfsl targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3780550 Mthfsl 5, 10-methenyltetrahydrofolate synthetase-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8654 + EM:08626 C57BL/6N-Mthfsl/Ieg EMMA sperm mutant strain MGI:4434563 Mthfsl targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3780550 Mthfsl 5, 10-methenyltetrahydrofolate synthetase-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8626 + EM:12648 C57BL/6N-Mthfr/H EMMA live mutant strain MGI:5521869 Mthfr targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:106639 Mthfr methylenetetrahydrofolate reductase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12648 + EM:09183 C57BL/6N-Mthfd2l/H EMMA sperm mutant strain MGI:5692689 Mthfd2l targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1915871 Mthfd2l methylenetetrahydrofolate dehydrogenase (NADP+ dependent) 2-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9183 - EM:06362 C57BL/6N-Mthfd2l/H EMMA sperm mutant strain MGI:4431820 Mthfd2l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915871 Mthfd2l methylenetetrahydrofolate dehydrogenase (NADP+ dependent) 2-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6362 + EM:14590 C57BL/6N-Msrb2/WtsiOulu EMMA embryo mutant strain MGI:6281101 Msrb2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1923717 Msrb2 methionine sulfoxide reductase B2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14590 + EM:14590 C57BL/6N-Msrb2/WtsiOulu EMMA sperm mutant strain MGI:6281101 Msrb2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1923717 Msrb2 methionine sulfoxide reductase B2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14590 ? EM:13726 C57BL/6N-Msl1/WtsiOrl EMMA sperm mutant strain MGI:6153493 Msl1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921276 Msl1 male specific lethal 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13726 + EM:09511 C57BL/6N-Msh5/Ieg EMMA sperm mutant strain MGI:5629311 Msh5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1329021 Msh5 mutS homolog 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9511 + EM:08955 C57BL/6N-Msh5/Ieg EMMA sperm mutant strain MGI:4842260 Msh5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1329021 Msh5 mutS homolog 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8955 ? EM:14302 C57BL/6N-Mrps5/WtsiIeg EMMA sperm mutant strain MGI:5548689 Mrps5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924971 Mrps5 mitochondrial ribosomal protein S5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14302 + EM:14233 C57BL/6N-Mrpl23/WtsiOulu EMMA embryo mutant strain MGI:5694166 Mrpl23 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1196612 Mrpl23 mitochondrial ribosomal protein L23 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14233 + EM:14233 C57BL/6N-Mrpl23/WtsiOulu EMMA sperm mutant strain MGI:5694166 Mrpl23 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1196612 Mrpl23 mitochondrial ribosomal protein L23 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14233 + EM:13369 C57BL/6N-Mrpl20/WtsiCnrm EMMA live mutant strain MGI:6153492 Mrpl20 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2137221 Mrpl20 mitochondrial ribosomal protein L20 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13369 ? EM:14514 C57BL/6N-Mroh4/WtsiIeg EMMA sperm mutant strain MGI:5637041 Mroh4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916689 Mroh4 maestro heat-like repeat family member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14514 + EM:10039 C57BL/6N-Mpst/Ieg EMMA sperm mutant strain MGI:5692799 Mpst targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2179733 Mpst mercaptopyruvate sulfurtransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10039 + EM:08601 C57BL/6N-Mpst/Ieg EMMA sperm mutant strain MGI:4841819 Mpst targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2179733 Mpst mercaptopyruvate sulfurtransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8601 - EM:06387 C57BL/6N-Mpo/H EMMA sperm B6NTac;B6N-Mpo/H mutant strain MGI:4362976 Mpo targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97137 Mpo myeloperoxidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6387 + EM:11581 C57BL/6N-Morc2a/WtsiOulu EMMA embryo mutant strain MGI:6140214 Morc2a endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1921772 Morc2a microrchidia 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11581 + EM:11581 C57BL/6N-Morc2a/WtsiOulu EMMA sperm mutant strain MGI:6140214 Morc2a endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1921772 Morc2a microrchidia 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11581 + EM:09099 C57BL/6N-Mocs2/Ieg EMMA embryo mutant strain MGI:5548433 Mocs2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336894 Mocs2 molybdenum cofactor synthesis 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9099 + EM:09099 C57BL/6N-Mocs2/Ieg EMMA sperm mutant strain MGI:5548433 Mocs2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336894 Mocs2 molybdenum cofactor synthesis 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9099 + EM:06280 C57BL/6N-Mocs2/Ieg EMMA embryo B6NTac;B6N-Mocs2/Ieg mutant strain MGI:4456059 Mocs2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1336894 Mocs2 molybdenum cofactor synthesis 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6280 + EM:07319 C57BL/6N-Mob2/H EMMA sperm B6NTac;B6N-Mob2/H mutant strain MGI:5286243 Mob2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919891 Mob2 MOB kinase activator 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7319 ? EM:13771 C57BL/6N-Mndal/WtsiIeg EMMA sperm mutant strain MGI:6302755 Mndal endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:3780953 Mndal myeloid nuclear differentiation antigen like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13771 - EM:05337 C57BL/6N-Mmrn1/Cnrm EMMA sperm mutant strain MGI:4451813 Mmrn1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918195 Mmrn1 multimerin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5337 - EM:06744 C57BL/6N-Mmp16/H EMMA sperm B6NTac;B6N-Mmp16/H mutant strain MGI:5014693 Mmp16 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1276107 Mmp16 matrix metallopeptidase 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6744 - EM:05321 C57BL/6N-Mmp12/H EMMA sperm mutant strain MGI:4455797 Mmp12 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97005 Mmp12 matrix metallopeptidase 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5321 ? EM:14788 C57BL/6N-Mmadhc/WtsiCnbc EMMA sperm mutant strain MGI:6281099 Mmadhc endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1923786 Mmadhc methylmalonic aciduria (cobalamin deficiency) cblD type, with homocystinuria https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14788 - EM:05287 C57BL/6N-Mllt3/Cnrm EMMA sperm mutant strain MGI:4434535 Mllt3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917372 Mllt3 myeloid/lymphoid or mixed-lineage leukemia; translocated to, 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5287 + EM:10680 C57BL/6N-Mkrn2/WtsiPh EMMA sperm mutant strain MGI:5548531 Mkrn2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914277 Mkrn2 makorin, ring finger protein, 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10680 + EM:11573 C57BL/6N-Mkrn2/WtsiOulu EMMA embryo mutant strain MGI:6140212 Mkrn2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914277 Mkrn2 makorin, ring finger protein, 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11573 + EM:11573 C57BL/6N-Mkrn2/WtsiOulu EMMA sperm mutant strain MGI:6140212 Mkrn2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914277 Mkrn2 makorin, ring finger protein, 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11573 - EM:05507 C57BL/6N-Mirc53/Ieg EMMA embryo mutant strain MGI:6863895 Mirc53 targeted mutation 1.1, Helmholtz Zentrum Muenchen GmbH MGI:6359857 Mirc53 microRNA cluster 53, including Mir221 and Mir222 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5507 + EM:11885 C57BL/6N-Mir96/WtsiH EMMA sperm mutant strain Mir96 undef targeted mutation , Wellcome Trust Sanger Institute MGI:3619440 Mir96 microRNA 96 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11885 ? EM:12223 C57BL/6N-Mir182/WtsiH EMMA sperm mutant strain Mir182 Mir182 MGI:2676846 Mir182 microRNA 182 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12223 + EM:09088 C57BL/6N-Mipol1/Ieg EMMA sperm mutant strain MGI:5605791 Mipol1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1920740 Mipol1 mirror-image polydactyly 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9088 + EM:08619 C57BL/6N-Mipol1/Ieg EMMA embryo mutant strain MGI:4843891 Mipol1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920740 Mipol1 mirror-image polydactyly 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8619 ? EM:13536 C57BL/6N-Minar2/WtsiKieg EMMA sperm mutant strain MGI:5637144 Minar2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442934 Minar2 membrane integral NOTCH2 associated receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13536 + EM:08650 C57BL/6N-Miga1/Ieg EMMA sperm C57BL/6N-Fam73a/Ieg, C57BL/6N-Mita1/Ieg mutant strain MGI:5567110 Miga1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924567 Miga1 mitoguardin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8650 - EM:08607 C57BL/6N-Miga1/Ieg EMMA sperm mutant strain MGI:4461706 Miga1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924567 Miga1 mitoguardin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8607 + EM:09241 C57BL/6N-Mgat1/Ieg EMMA sperm mutant strain MGI:5613671 Mgat1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:96973 Mgat1 mannoside acetylglucosaminyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9241 + EM:08518 C57BL/6N-Mgat1/Ieg EMMA sperm mutant strain MGI:4842039 Mgat1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96973 Mgat1 mannoside acetylglucosaminyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8518 ? EM:13931 C57BL/6N-Mga/WtsiCnbc EMMA sperm mutant strain MGI:6153491 Mga endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1352483 Mga MAX gene associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13931 - EM:05994 C57BL/6N-Mfsd8/Cnrm EMMA sperm mutant strain MGI:4456699 Mfsd8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1919425 Mfsd8 major facilitator superfamily domain containing 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5994 + EM:10115 C57BL/6N-Mfn2/Ieg EMMA sperm mutant strain MGI:5692821 Mfn2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442230 Mfn2 mitofusin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10115 + EM:09811 C57BL/6N-Mfn2/Ieg EMMA embryo mutant strain MGI:4434285 Mfn2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442230 Mfn2 mitofusin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9811 + EM:09811 C57BL/6N-Mfn2/Ieg EMMA sperm mutant strain MGI:4434285 Mfn2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442230 Mfn2 mitofusin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9811 + EM:10410 C57BL/6N-Mex3a/Cnbc EMMA sperm mutant strain MGI:5085513 Mex3a targeted mutation 1, Velocigene MGI:1919890 Mex3a mex3 RNA binding family member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10410 - EM:13663 C57BL/6N-Met/Cnrm EMMA embryo mutant strain Met Met MGI:96969 Met met proto-oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13663 - EM:13663 C57BL/6N-Met/Cnrm EMMA sperm mutant strain Met Met MGI:96969 Met met proto-oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13663 - EM:13662 C57BL/6N-Met/Cnrm EMMA embryo mutant strain Met Met MGI:96969 Met met proto-oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13662 - EM:13662 C57BL/6N-Met/Cnrm EMMA sperm mutant strain Met Met MGI:96969 Met met proto-oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13662 ? EM:14513 C57BL/6N-Medag/WtsiOrl EMMA sperm mutant strain MGI:5548602 Medag targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1917967 Medag mesenteric estrogen dependent adipogenesis https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14513 + EM:11164 C57BL/6N-Med23/WtsiH EMMA sperm mutant strain MGI:6153490 Med23 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1917458 Med23 mediator complex subunit 23 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11164 + EM:09514 C57BL/6N-Me3/Ieg EMMA sperm mutant strain MGI:5629317 Me3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916679 Me3 malic enzyme 3, NADP(+)-dependent, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9514 + EM:10107 C57BL/6N-Me2/Ieg EMMA sperm mutant strain MGI:5692786 Me2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2147351 Me2 malic enzyme 2, NAD(+)-dependent, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10107 + EM:13817 C57BL/6N-Mdfic/WtsiOulu EMMA embryo mutant strain MGI:6153489 Mdfic endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:104611 Mdfic MyoD family inhibitor domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13817 + EM:13817 C57BL/6N-Mdfic/WtsiOulu EMMA sperm mutant strain MGI:6153489 Mdfic endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:104611 Mdfic MyoD family inhibitor domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13817 + EM:10143 C57BL/6N-Mcub/H EMMA sperm C57BL/6N-Ccdc109b/H mutant strain MGI:5692665 Mcub targeted mutation 1c, Mouse Biology Program, UCDavis MGI:1914065 Mcub mitochondrial calcium uniporter dominant negative beta subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10143 + EM:07308 C57BL/6N-Mcub/H EMMA sperm C57BL/6N-Ccdc109b/H, B6NTac;B6N-Ccdc109b/H mutant strain MGI:4840771 Mcub targeted mutation 1a, Mouse Biology Program, UCDavis MGI:1914065 Mcub mitochondrial calcium uniporter dominant negative beta subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7308 - EM:10448 C57BL/6N-Mcu/H EMMA sperm B6NTac;B6N-A Mcu/H mutant strain MGI:5692853 Mcu targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:3026965 Mcu mitochondrial calcium uniporter https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10448 - EM:07445 C57BL/6N-Mcu/H EMMA sperm B6NTac;B6N-Mcu/H mutant strain MGI:5294185 Mcu targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3026965 Mcu mitochondrial calcium uniporter https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7445 + EM:10462 C57BL/6N-Mboat7/H EMMA sperm C57BL/6NTac-Mboat7/H mutant strain MGI:5752550 Mboat7 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1924832 Mboat7 membrane bound O-acyltransferase domain containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10462 + EM:11160 C57BL/6N-Mbl2/WtsiOulu EMMA embryo mutant strain MGI:6140211 Mbl2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:96924 Mbl2 mannose-binding lectin (protein C) 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11160 + EM:11160 C57BL/6N-Mbl2/WtsiOulu EMMA sperm mutant strain MGI:6140211 Mbl2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:96924 Mbl2 mannose-binding lectin (protein C) 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11160 + EM:11157 C57BL/6N-Mbd1/WtsiH EMMA sperm mutant strain MGI:6153488 Mbd1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1333811 Mbd1 methyl-CpG binding domain protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11157 + EM:13381 C57BL/6N-Matn4/WtsiCnrm EMMA live mutant strain MGI:6153487 Matn4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1328314 Matn4 matrilin 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13381 - EM:07498 C57BL/6N-Marveld2/H EMMA sperm mutant strain MGI:4461651 Marveld2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446166 Marveld2 MARVEL (membrane-associating) domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7498 + EM:10237 C57BL/6N-Marco/Ieg EMMA sperm mutant strain MGI:5701720 Marco targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1309998 Marco macrophage receptor with collagenous structure https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10237 + EM:09486 C57BL/6N-Marco/Ieg EMMA sperm mutant strain Marco EUCOMM targeted mutation 2, Helmholtz Zentrum Muenchen GmbH MGI:1309998 Marco macrophage receptor with collagenous structure https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9486 + EM:09039 C57BL/6N-Mapkbp1/H EMMA sperm mutant strain MGI:5692629 Mapkbp1 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1347004 Mapkbp1 mitogen-activated protein kinase binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9039 + EM:10132 C57BL/6N-Mapkapk5/Ieg EMMA sperm mutant strain MGI:5692611 Mapkapk5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1333110 Mapkapk5 MAP kinase-activated protein kinase 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10132 - EM:05658 C57BL/6N-Mapkapk2/H EMMA sperm B6NTac;B6N-Mapkapk2/H mutant strain MGI:4842229 Mapkapk2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109298 Mapkapk2 MAP kinase-activated protein kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5658 - EM:08187 C57BL/6N-Mapk11/H EMMA sperm B6NTac;B6N-Mapk11/H mutant strain MGI:4435746 Mapk11 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1338024 Mapk11 mitogen-activated protein kinase 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8187 + EM:06159 C57BL/6N-Map3k7/H EMMA sperm B6NTac;B6N-Map3k7/H mutant strain MGI:4947820 Map3k7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1346877 Map3k7 mitogen-activated protein kinase kinase kinase 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6159 + EM:08070 C57BL/6N-Map3k10/Ieg EMMA sperm mutant strain MGI:5548463 Map3k10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1346879 Map3k10 mitogen-activated protein kinase kinase kinase 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8070 - EM:05474 C57BL/6N-Map3k10/Cnrm EMMA sperm mutant strain MGI:4435860 Map3k10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1346879 Map3k10 mitogen-activated protein kinase kinase kinase 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5474 + EM:14226 C57BL/6N-Mansc4/WtsiOulu EMMA embryo mutant strain MGI:6120810 Mansc4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3645619 Mansc4 MANSC domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14226 + EM:14226 C57BL/6N-Mansc4/WtsiOulu EMMA sperm mutant strain MGI:6120810 Mansc4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3645619 Mansc4 MANSC domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14226 + EM:07943 C57BL/6N-Man2b2/WtsiCnrm EMMA sperm mutant strain MGI:5513801 Man2b2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1195262 Man2b2 mannosidase 2, alpha B2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7943 ? EM:14164 C57BL/6N-Mamstr/WtsiIeg EMMA sperm mutant strain MGI:5637079 Mamstr targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921740 Mamstr MEF2 activating motif and SAP domain containing transcriptional regulator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14164 + EM:13644 C57BL/6N-Malt1/H EMMA live mutant strain MGI:4455782 Malt1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2445027 Malt1 MALT1 paracaspase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13644 + EM:13824 C57BL/6N-Magee2/WtsiOulu EMMA embryo mutant strain MGI:6153485 Magee2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2148316 Magee2 MAGE family member E2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13824 + EM:13824 C57BL/6N-Magee2/WtsiOulu EMMA sperm mutant strain MGI:6153485 Magee2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2148316 Magee2 MAGE family member E2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13824 + EM:09306 C57BL/6N-Maea/Ieg EMMA sperm mutant strain MGI:5588275 Maea targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1891748 Maea macrophage erythroblast attacher https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9306 + EM:09288 C57BL/6N-Maea/Ieg EMMA sperm mutant strain MGI:4842478 Maea targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891748 Maea macrophage erythroblast attacher https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9288 + EM:11156 C57BL/6N-Macrod1/WtsiPh EMMA sperm mutant strain MGI:6140210 Macrod1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2147583 Macrod1 mono-ADP ribosylhydrolase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11156 + EM:13788 C57BL/6N-Mab21l4 Klhl18/H[cc] EMMA embryo mutant strain Mab21l4 (also known as 2310007B03Rik) Mab21l4 (also known as 2310007B03Rik) MGI:1919124 Mab21l4 mab-21-like 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13788 + EM:13788 C57BL/6N-Mab21l4 Klhl18/H[cc] EMMA embryo mutant strain MGI:6470867 Klhl18 low frequency MGI:2143315 Klhl18 kelch-like 18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13788 + EM:11764 C57BL/6N-Lzts1/WtsiCnrm EMMA sperm mutant strain MGI:6152738 Lzts1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2684762 Lzts1 leucine zipper, putative tumor suppressor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11764 + EM:08396 C57BL/6N-Lyn/H EMMA sperm mutant strain MGI:4888900 Lyn targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96892 Lyn LYN proto-oncogene, Src family tyrosine kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8396 ? EM:13732 C57BL/6N-Ly6g/WtsiOrl EMMA sperm mutant strain MGI:6257598 Ly6g endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:109440 Ly6g lymphocyte antigen 6 complex, locus G https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13732 + EM:11048 C57BL/6N-Ly6g6d/Ieg EMMA sperm mutant strain MGI:4436130 Ly6g6d targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2148931 Ly6g6d lymphocyte antigen 6 complex, locus G6D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11048 ? EM:14416 C57BL/6N-Luc7l2/WtsiOrl EMMA sperm mutant strain MGI:5816877 Luc7l2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2183260 Luc7l2 LUC7-like 2 (S. cerevisiae) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14416 + EM:09416 C57BL/6N-Lta4h/H EMMA sperm mutant strain MGI:5692898 Lta4h targeted mutation 1c, Wellcome Trust Sanger Institute MGI:96836 Lta4h leukotriene A4 hydrolase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9416 + EM:08282 C57BL/6N-Lta4h/H EMMA sperm mutant strain MGI:4820073 Lta4h targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96836 Lta4h leukotriene A4 hydrolase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8282 + EM:09269 C57BL/6N-Lss/Ieg EMMA sperm mutant strain MGI:5561557 Lss targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336155 Lss lanosterol synthase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9269 + EM:08057 C57BL/6N-Lsm1/Ieg EMMA sperm C57BL/6N-Lsm1/Hmgu mutant strain MGI:5548536 Lsm1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914457 Lsm1 LSM1 homolog, mRNA degradation associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8057 + EM:06274 C57BL/6N-Lsm1/Ieg EMMA embryo B6NTac;B6N-Lsm1/Ieg mutant strain MGI:4887646 Lsm1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914457 Lsm1 LSM1 homolog, mRNA degradation associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6274 ? EM:13893 C57BL/6N-Lrrn4cl/WtsiCnbc EMMA sperm mutant strain Lrrn4cl CRISPR/CAS9 targeted mutation , Wellcome Trust Sanger Institute MGI:1916102 Lrrn4cl LRRN4 C-terminal like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13893 + EM:13433 C57BL/6N-Lrrc3c/WtsiCnrm EMMA live mutant strain MGI:6336056 Lrrc3c endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2684858 Lrrc3c leucine rich repeat containing 3C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13433 ? EM:13728 C57BL/6N-Lrrc36/WtsiOrl EMMA sperm mutant strain MGI:6153483 Lrrc36 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2448585 Lrrc36 leucine rich repeat containing 36 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13728 - EM:14199 C57BL/6N-Lrmp/WtsiOulu EMMA embryo mutant strain Lrmp EUCOMM targeted mutation 1b, Wellcome Trust Sanger Institute MGI:108424 Irag2 inositol 1,4,5-triphosphate receptor associated 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14199 - EM:14199 C57BL/6N-Lrmp/WtsiOulu EMMA sperm mutant strain Lrmp EUCOMM targeted mutation 1b, Wellcome Trust Sanger Institute MGI:108424 Irag2 inositol 1,4,5-triphosphate receptor associated 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14199 ? EM:14568 C57BL/6N-Lrguk/WtsiCnbc EMMA sperm mutant strain MGI:6153746 Lrguk endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921604 Lrguk leucine-rich repeats and guanylate kinase domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14568 ? EM:14924 C57BL/6N-Lrba/Ieg EMMA sperm mutant strain MGI:5796558 Lrba targeted mutation 1.1, Manfred W Kilimann MGI:1933162 Lrba LPS-responsive beige-like anchor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14924 + EM:13918 C57BL/6N-Lrba/WtsiOulu EMMA embryo mutant strain MGI:6153482 Lrba endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1933162 Lrba LPS-responsive beige-like anchor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13918 + EM:13918 C57BL/6N-Lrba/WtsiOulu EMMA sperm mutant strain MGI:6153482 Lrba endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1933162 Lrba LPS-responsive beige-like anchor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13918 + EM:14248 C57BL/6N-Lpxn/WtsiOulu EMMA embryo mutant strain MGI:5692788 Lpxn targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2147677 Lpxn leupaxin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14248 + EM:14248 C57BL/6N-Lpxn/WtsiOulu EMMA sperm mutant strain MGI:5692788 Lpxn targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2147677 Lpxn leupaxin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14248 + EM:08071 C57BL/6N-Lpo/Ieg EMMA embryo mutant strain MGI:5548663 Lpo targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923363 Lpo lactoperoxidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8071 ? EM:14467 C57BL/6N-Lpcat3/WtsiCnbc EMMA sperm mutant strain MGI:6153481 Lpcat3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1315211 Lpcat3 lysophosphatidylcholine acyltransferase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14467 + EM:10447 C57BL/6N-Lpcat1/H EMMA sperm mutant strain MGI:4458720 Lpcat1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384812 Lpcat1 lysophosphatidylcholine acyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10447 + EM:14495 C57BL/6N-Lonrf3/WtsiOulu EMMA embryo mutant strain MGI:5548642 Lonrf3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921615 Lonrf3 LON peptidase N-terminal domain and ring finger 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14495 + EM:14495 C57BL/6N-Lonrf3/WtsiOulu EMMA sperm mutant strain MGI:5548642 Lonrf3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921615 Lonrf3 LON peptidase N-terminal domain and ring finger 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14495 + EM:09070 C57BL/6N-Lonp1/Ieg EMMA sperm mutant strain MGI:5521859 Lonp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921392 Lonp1 lon peptidase 1, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9070 + EM:11329 C57BL/6N-Lmo1/Ieg EMMA sperm mutant strain MGI:4843686 Lmo1 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:102812 Lmo1 LIM domain only 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11329 + EM:10615 C57BL/6N-Lmnb1/WtsiH EMMA sperm mutant strain MGI:5767330 Lmnb1 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:96795 Lmnb1 lamin B1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10615 ? EM:13754 C57BL/6N-Lman2/WtsiIeg EMMA sperm mutant strain MGI:6286369 Lman2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914140 Lman2 lectin, mannose-binding 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13754 ? EM:13760 C57BL/6N-Lingo3/WtsiIeg EMMA sperm mutant strain MGI:6287372 Lingo3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:3609246 Lingo3 leucine rich repeat and Ig domain containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13760 - EM:09032 C57BL/6N-Lifr/H EMMA sperm B6NTac;B6N-Lifr/H mutant strain MGI:5692896 Lifr targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:96788 Lifr LIF receptor alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9032 - EM:06941 C57BL/6N-Lifr/H EMMA sperm B6NTac;B6N-Lifr/H mutant strain MGI:4841519 Lifr targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96788 Lifr LIF receptor alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6941 + EM:09084 C57BL/6N-Lhfpl2/H EMMA sperm mutant strain MGI:4462597 Lhfpl2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2145236 Lhfpl2 lipoma HMGIC fusion partner-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9084 + EM:08894 C57BL/6N-Lgals7/WtsiIeg EMMA sperm mutant strain MGI:5548425 Lgals7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1316742 Lgals7 lectin, galactose binding, soluble 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8894 + EM:09044 C57BL/6N-Lgals3/H EMMA sperm mutant strain MGI:5692895 Lgals3 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:96778 Lgals3 lectin, galactose binding, soluble 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9044 - EM:06800 C57BL/6N-Lgals3/H EMMA sperm mutant strain MGI:4432481 Lgals3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96778 Lgals3 lectin, galactose binding, soluble 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6800 ? EM:14574 C57BL/6N-Lfng/WtsiCnbc EMMA sperm mutant strain MGI:6153723 Lfng endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1095413 Lfng LFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14574 - EM:07837 C57BL/6N-Leprotl1/H EMMA sperm HEPD0576_6_H12, B6NTac;B6N-Leprotl1/H mutant strain MGI:4434583 Leprotl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915442 Leprotl1 leptin receptor overlapping transcript-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7837 + EM:08158 C57BL/6N-Leprot/WtsiBiat EMMA sperm mutant strain MGI:5548880 Leprot targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2687005 Leprot leptin receptor overlapping transcript https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8158 + EM:07367 C57BL/6N-Lepr/H EMMA sperm B6NTac;B6N-Lepr/H mutant strain MGI:4453725 Lepr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104993 Lepr leptin receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7367 ? EM:14149 C57BL/6N-Ldlrad4/WtsiCnbc EMMA archived mutant strain MGI:5636938 Ldlrad4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1277150 Ldlrad4 low density lipoprotein receptor class A domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14149 + EM:10076 C57BL/6N-Ldlr/Ieg EMMA sperm mutant strain MGI:4433768 Ldlr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96765 Ldlr low density lipoprotein receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10076 ? EM:14278 C57BL/6N-Ldhb/WtsiPh EMMA sperm mutant strain MGI:5637210 Ldhb targeted mutation 1b, Wellcome Trust Sanger Institute MGI:96763 Ldhb lactate dehydrogenase B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14278 + EM:08651 C57BL/6N-Ldah/Ieg EMMA sperm mutant strain MGI:5637035 Ldah targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916082 Ldah lipid droplet associated hydrolase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8651 + EM:07442 C57BL/6N-Ldah/Ieg EMMA embryo B6NTac;B6N-Ldah/Ieg, B6NTac;B6N-1110057K04Rik/Ieg mutant strain MGI:4456805 Ldah targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916082 Ldah lipid droplet associated hydrolase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7442 + EM:08731 C57BL/6N-Lct/Ieg EMMA sperm mutant strain MGI:4841441 Lct targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104576 Lct lactase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8731 + EM:13436 C57BL/6N-Lce3e/WtsiCnrm EMMA live mutant strain MGI:6153480 Lce3e endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1916764 Lce3e late cornified envelope 3E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13436 ? EM:14171 C57BL/6N-Lce1m/WtsiCnbc EMMA archived mutant strain MGI:5637007 Lce1m targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913453 Lce1m late cornified envelope 1M https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14171 + EM:07311 C57BL/6N-Lce1f/H EMMA sperm B6NTac;B6N-Lce1f/H mutant strain MGI:4841178 Lce1f targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915078 Lce1f late cornified envelope 1F https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7311 ? EM:14556 C57BL/6N-Larp4b/WtsiPh EMMA sperm mutant strain MGI:6153479 Larp4b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:106330 Larp4b La ribonucleoprotein 4B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14556 + EM:10467 C57BL/6N-Lamb3/H EMMA sperm mutant strain MGI:5752556 Lamb3 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:99915 Lamb3 laminin, beta 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10467 + EM:10466 C57BL/6N-Lama5/H EMMA sperm C57BL/6NTac-Lama5/H mutant strain MGI:5752544 Lama5 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:105382 Lama5 laminin, alpha 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10466 + EM:09240 C57BL/6N-Lama1/Ieg EMMA sperm mutant strain MGI:5613672 Lama1 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:99892 Lama1 laminin, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9240 + EM:08512 C57BL/6N-Lama1/Ieg EMMA sperm mutant strain MGI:4436547 Lama1 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:99892 Lama1 laminin, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8512 + EM:09239 C57BL/6N-Lactb/Ieg EMMA sperm mutant strain MGI:5613656 Lactb targeted mutation 1.1, Mouse Biology Program, UCDavis MGI:1933395 Lactb lactamase, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9239 + EM:08725 C57BL/6N-Lactb/Ieg EMMA sperm mutant strain MGI:4819984 Lactb targeted mutation 1, Mouse Biology Program, UCDavis MGI:1933395 Lactb lactamase, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8725 ? EM:13750 C57BL/6N-Krt87/WtsiIeg EMMA sperm mutant strain MGI:6286373 Krt87 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:3665486 Krt87 keratin 87 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13750 ? EM:14496 C57BL/6N-Krt83/WtsiIeg EMMA sperm mutant strain MGI:5637191 Krt83 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3690448 Krt83 keratin 83 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14496 + EM:08573 C57BL/6N-Krt7/WtsiH EMMA sperm mutant strain MGI:5548947 Krt7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:96704 Krt7 keratin 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8573 ? EM:14152 C57BL/6N-Krt79/WtsiIeg EMMA sperm mutant strain MGI:5708243 Krt79 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2385030 Krt79 keratin 79 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14152 - EM:07497 C57BL/6N-Krt74/H EMMA sperm B6NTac;B6N-Krt74/H mutant strain MGI:4461649 Krt74 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3629975 Krt74 keratin 74 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7497 + EM:13823 C57BL/6N-Krt5/WtsiOulu EMMA embryo mutant strain MGI:6153745 Krt5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:96702 Krt5 keratin 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13823 + EM:13823 C57BL/6N-Krt5/WtsiOulu EMMA sperm mutant strain MGI:6153745 Krt5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:96702 Krt5 keratin 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13823 - EM:09535 C57BL/6N-Krt12/Cnrm EMMA sperm mutant strain MGI:5633776 Krt12 targeted mutation 2, Wellcome Trust Sanger Institute MGI:96687 Krt12 keratin 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9535 + EM:10106 C57BL/6N-Knl1/Ieg EMMA sperm mutant strain MGI:5692741 Knl1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1923714 Knl1 kinetochore scaffold 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10106 + EM:08578 C57BL/6N-Knl1/Ieg EMMA sperm mutant strain MGI:4841642 Knl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923714 Knl1 kinetochore scaffold 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8578 ? EM:14411 C57BL/6N-Kmt2e/WtsiOrl EMMA sperm mutant strain Kmt2e undef targeted mutation , Wellcome Trust Sanger Institute MGI:1924825 Kmt2e lysine (K)-specific methyltransferase 2E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14411 ? EM:14428 C57BL/6N-Kmt2d/WtsiCnbc EMMA archived mutant strain Kmt2d undef targeted mutation , Wellcome Trust Sanger Institute MGI:2682319 Kmt2d lysine (K)-specific methyltransferase 2D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14428 ? EM:13902 C57BL/6N-Klrc3/WtsiPh EMMA sperm mutant strain MGI:6153384 Klrc3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1929720 Klrc3 killer cell lectin-like receptor subfamily C, member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13902 ? EM:13908 C57BL/6N-Klrc2/WtsiPh EMMA sperm mutant strain MGI:6153383 Klrc2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1336162 Klrc2 killer cell lectin-like receptor subfamily C, member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13908 ? EM:13882 C57BL/6N-Klrc1/WtsiPh EMMA sperm mutant strain MGI:6153382 Klrc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1336161 Klrc1 killer cell lectin-like receptor subfamily C, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13882 + EM:09638 C57BL/6N-Klrb1/Ieg EMMA sperm mutant strain MGI:4453704 Klrb1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96877 Klrb1 killer cell lectin-like receptor subfamily B member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9638 ? EM:13741 C57BL/6N-Klra6/WtsiOrl EMMA sperm mutant strain MGI:6153381 Klra6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:101902 Klra6 killer cell lectin-like receptor, subfamily A, member 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13741 + EM:07921 C57BL/6N-Klkb1/Ieg EMMA embryo mutant strain MGI:5548334 Klkb1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:102849 Klkb1 kallikrein B, plasma 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7921 + EM:05553 C57BL/6N-Klkb1/Ieg EMMA embryo B6NTac;B6N-Klkb1/Ieg mutant strain MGI:4456034 Klkb1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102849 Klkb1 kallikrein B, plasma 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5553 + EM:11152 C57BL/6N-Klk6/WtsiH EMMA sperm mutant strain MGI:6153380 Klk6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1343166 Klk6 kallikrein related-peptidase 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11152 + EM:14423 C57BL/6N-Klhl42/WtsiH EMMA live mutant strain MGI:6120798 Klhl42 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2444786 Klhl42 kelch-like 42 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14423 - EM:07572 C57BL/6N-Klhl3/H EMMA sperm B6NTac;B6N-Klhl3/H mutant strain MGI:4946685 Klhl3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2445185 Klhl3 kelch-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7572 + EM:14488 C57BL/6N-Klhl26/WtsiOulu EMMA embryo mutant strain MGI:5796937 Klhl26 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443079 Klhl26 kelch-like 26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14488 + EM:14488 C57BL/6N-Klhl26/WtsiOulu EMMA sperm mutant strain MGI:5796937 Klhl26 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443079 Klhl26 kelch-like 26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14488 - EM:05848 C57BL/6N-Klf7/H EMMA sperm B6NTac;B6N-Klf7/H mutant strain MGI:4434914 Klf7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1935151 Klf7 Kruppel-like factor 7 (ubiquitous) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5848 ? EM:13779 C57BL/6N-Klf1/WtsiIeg EMMA sperm mutant strain MGI:6153379 Klf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1342771 Klf1 Kruppel-like factor 1 (erythroid) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13779 + EM:09397 C57BL/6N-Klf17/WtsiOrl EMMA sperm mutant strain MGI:5548777 Klf17 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2181068 Klf17 Kruppel-like factor 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9397 + EM:14245 C57BL/6N-Kif3b/WtsiH EMMA live mutant strain MGI:5548376 Kif3b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107688 Kif3b kinesin family member 3B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14245 ? EM:14188 C57BL/6N-Kif24/WtsiIeg EMMA sperm mutant strain MGI:5637052 Kif24 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1918345 Kif24 kinesin family member 24 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14188 + EM:08656 C57BL/6N-Kif20a/Ieg EMMA sperm mutant strain MGI:5636934 Kif20a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1201682 Kif20a kinesin family member 20A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8656 + EM:08632 C57BL/6N-Kif20a/Ieg EMMA embryo mutant strain MGI:4436572 Kif20a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1201682 Kif20a kinesin family member 20A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8632 ? EM:13460 C57BL/6N-Khdrbs3/IegBiat EMMA sperm unclassified Khdrbs3 Khdrbs3 MGI:1313312 Khdrbs3 KH domain containing, RNA binding, signal transduction associated 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13460 + EM:08658 C57BL/6N-Khdrbs3/Ieg EMMA sperm mutant strain MGI:5636948 Khdrbs3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1313312 Khdrbs3 KH domain containing, RNA binding, signal transduction associated 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8658 + EM:08634 C57BL/6N-Khdrbs3/Ieg EMMA sperm mutant strain MGI:4847821 Khdrbs3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1313312 Khdrbs3 KH domain containing, RNA binding, signal transduction associated 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8634 + EM:11155 C57BL/6N-Kera/WtsiPh EMMA sperm mutant strain MGI:6140208 Kera endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1202398 Kera keratocan https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11155 + EM:14205 C57BL/6N-Kdm6b/WtsiOulu EMMA embryo mutant strain MGI:6324163 Kdm6b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2448492 Kdm6b KDM1 lysine (K)-specific demethylase 6B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14205 + EM:14205 C57BL/6N-Kdm6b/WtsiOulu EMMA sperm mutant strain MGI:6324163 Kdm6b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2448492 Kdm6b KDM1 lysine (K)-specific demethylase 6B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14205 ? EM:13705 C57BL/6N-Kdm5b/WtsiOrl EMMA sperm mutant strain MGI:6153378 Kdm5b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1922855 Kdm5b lysine (K)-specific demethylase 5B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13705 + EM:09483 C57BL/6N-Kcnn1/H EMMA sperm mutant strain MGI:4419229 Kcnn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933993 Kcnn1 potassium intermediate/small conductance calcium-activated channel, subfamily N, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9483 - EM:05957 C57BL/6N-Kcnj9/H EMMA sperm B6NTac;B6N-Kcnj9/H mutant strain MGI:4436261 Kcnj9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108007 Kcnj9 potassium inwardly-rectifying channel, subfamily J, member 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5957 + EM:08990 C57BL/6N-Kcnj14/H EMMA sperm mutant strain MGI:5511630 Kcnj14 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2384820 Kcnj14 potassium inwardly-rectifying channel, subfamily J, member 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8990 + EM:10832 C57BL/6N-Kcnj12/H EMMA sperm mutant strain MGI:4432694 Kcnj12 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108495 Kcnj12 potassium inwardly-rectifying channel, subfamily J, member 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10832 - EM:10056 C57BL/6N-Kcnj11/H EMMA sperm B6NTac;B6N-A Kcnj11/H mutant strain MGI:5692571 Kcnj11 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:107501 Kcnj11 potassium inwardly rectifying channel, subfamily J, member 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10056 - EM:08845 C57BL/6N-Kcnj11/H EMMA sperm B6NTac;B6N-A Kcnj11/H mutant strain MGI:5473147 Kcnj11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107501 Kcnj11 potassium inwardly rectifying channel, subfamily J, member 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8845 + EM:09266 C57BL/6N-Kcnj10/H EMMA sperm mutant strain MGI:4451428 Kcnj10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1194504 Kcnj10 potassium inwardly-rectifying channel, subfamily J, member 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9266 ? EM:14163 C57BL/6N-Kcnh4/WtsiIeg EMMA sperm mutant strain MGI:5637120 Kcnh4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2156184 Kcnh4 potassium voltage-gated channel, subfamily H (eag-related), member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14163 + EM:08338 C57BL/6N-Kcnb1/H EMMA sperm mutant strain MGI:5002949 Kcnb1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96666 Kcnb1 potassium voltage gated channel, Shab-related subfamily, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8338 ? EM:13778 C57BL/6N-Kbtbd11/WtsiIeg EMMA sperm mutant strain MGI:6153377 Kbtbd11 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1922151 Kbtbd11 kelch repeat and BTB (POZ) domain containing 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13778 - EM:06113 C57BL/6N-Katnb1/Cnrm EMMA sperm mutant strain MGI:4436305 Katnb1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921437 Katnb1 katanin p80 (WD40-containing) subunit B 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6113 + EM:11211 C57BL/6N-Kat2b/WtsiIeg EMMA sperm mutant strain MGI:6140207 Kat2b endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1343094 Kat2b K(lysine) acetyltransferase 2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11211 + EM:12754 C57BL/6N-Kansl1l/Ieg EMMA sperm mutant strain MGI:4432674 Kansl1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915941 Kansl1l KAT8 regulatory NSL complex subunit 1-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12754 + EM:11210 C57BL/6N-Josd1/WtsiIeg EMMA sperm mutant strain MGI:6140206 Josd1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1921408 Josd1 Josephin domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11210 ? EM:13701 C57BL/6N-Jmjd7/WtsiOrl EMMA sperm mutant strain MGI:6153376 Jmjd7 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3845785 Jmjd7 jumonji domain containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13701 ? EM:13459 C57BL/6N-Jmjd6/IegBiat EMMA sperm unclassified MGI:6756397 Jmjd6 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1858910 Jmjd6 jumonji domain containing 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13459 + EM:08088 C57BL/6N-Jmjd6/Ieg EMMA sperm mutant strain MGI:5548491 Jmjd6 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1858910 Jmjd6 jumonji domain containing 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8088 ? EM:14443 C57BL/6N-Jmjd4/WtsiCnbc EMMA sperm mutant strain MGI:6153375 Jmjd4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2144404 Jmjd4 jumonji domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14443 + EM:10018 C57BL/6N-Jarid2/Cnrm EMMA embryo mutant strain MGI:5811911 Jarid2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:104813 Jarid2 jumonji, AT rich interactive domain 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10018 + EM:10018 C57BL/6N-Jarid2/Cnrm EMMA sperm mutant strain MGI:5811911 Jarid2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:104813 Jarid2 jumonji, AT rich interactive domain 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10018 + EM:07862 C57BL/6N-Jag2/H EMMA sperm B6NTac;B6N-Jag2/H mutant strain MGI:4880880 Jag2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098270 Jag2 jagged 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7862 + EM:08753 C57BL/6N-Ivd/Ieg EMMA sperm mutant strain MGI:5548705 Ivd targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1929242 Ivd isovaleryl coenzyme A dehydrogenase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8753 + EM:08117 C57BL/6N-Itm2c/Ieg EMMA sperm mutant strain MGI:5548700 Itm2c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1927594 Itm2c integral membrane protein 2C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8117 + EM:08103 C57BL/6N-Itm2c/Ieg EMMA sperm B6NTac;B6N-Itm2c/Ieg mutant strain MGI:4431661 Itm2c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927594 Itm2c integral membrane protein 2C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8103 + EM:13450 C57BL/6N-Itm2a/WtsiCnrm EMMA live mutant strain MGI:6153374 Itm2a endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107706 Itm2a integral membrane protein 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13450 + EM:11578 C57BL/6N-Itln1/WtsiIeg EMMA sperm mutant strain MGI:6140205 Itln1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1333831 Itln1 intelectin 1 (galactofuranose binding) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11578 ? EM:14583 C57BL/6N-Itgam/WtsiCnbc EMMA sperm mutant strain MGI:6153373 Itgam endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:96607 Itgam integrin alpha M https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14583 - EM:07783 C57BL/6N-Itgae/H EMMA sperm mutant strain MGI:4433992 Itgae targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1298377 Itgae integrin alpha E, epithelial-associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7783 - EM:09538 C57BL/6N-Itga2/Cnrm EMMA sperm mutant strain MGI:5633770 Itga2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:96600 Itga2 integrin alpha 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9538 + EM:05766 C57BL/6N-Itga2/H EMMA sperm B6NTac;B6N-Itga2/H mutant strain MGI:4455765 Itga2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96600 Itga2 integrin alpha 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5766 + EM:09007 C57BL/6N-Itch/H EMMA sperm mutant strain MGI:4888905 Itch targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1202301 Itch itchy, E3 ubiquitin protein ligase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9007 ? EM:14780 C57BL/6N-Irgm1/WtsiCnbc EMMA sperm mutant strain MGI:6153372 Irgm1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107567 Irgm1 immunity-related GTPase family M member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14780 ? EM:14435 C57BL/6N-Irf6/WtsiCnbc EMMA sperm mutant strain MGI:6153743 Irf6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1859211 Irf6 interferon regulatory factor 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14435 + EM:07483 C57BL/6N-Irak2/H EMMA sperm B6NTac;B6N-Irak2/H mutant strain MGI:4431835 Irak2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2429603 Irak2 interleukin-1 receptor-associated kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7483 ? EM:14504 C57BL/6N-Irak1/WtsiOrl EMMA sperm mutant strain MGI:5636906 Irak1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:107420 Irak1 interleukin-1 receptor-associated kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14504 + EM:14497 C57BL/6N-Ints9/WtsiOulu EMMA embryo mutant strain MGI:5796932 Ints9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1098533 Ints9 integrator complex subunit 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14497 + EM:14497 C57BL/6N-Ints9/WtsiOulu EMMA sperm mutant strain MGI:5796932 Ints9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1098533 Ints9 integrator complex subunit 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14497 ? EM:14156 C57BL/6N-Ints11/WtsiIeg EMMA sperm mutant strain MGI:5708213 Ints11 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1919207 Ints11 integrator complex subunit 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14156 ? EM:14434 C57BL/6N-Insyn2b/WtsiCnbc EMMA sperm mutant strain MGI:6153338 Insyn2b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3643491 Insyn2b inhibitory synaptic factor family member 2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14434 + EM:10949 C57BL/6N-Ing3/Biat EMMA sperm mutant strain MGI:4432585 Ing3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919027 Ing3 inhibitor of growth family, member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10949 + EM:14551 C57BL/6N-Il6ra/WtsiOulu EMMA embryo mutant strain MGI:7345522 Il6ra endonuclease mediated mutation 3, Wellcome Trust Sanger Insititute MGI:105304 Il6ra interleukin 6 receptor, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14551 + EM:14551 C57BL/6N-Il6ra/WtsiOulu EMMA sperm mutant strain MGI:7345522 Il6ra endonuclease mediated mutation 3, Wellcome Trust Sanger Insititute MGI:105304 Il6ra interleukin 6 receptor, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14551 + EM:13825 C57BL/6N-Il6ra/WtsiOulu EMMA embryo mutant strain MGI:6153742 Il6ra endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:105304 Il6ra interleukin 6 receptor, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13825 + EM:13825 C57BL/6N-Il6ra/WtsiOulu EMMA sperm mutant strain MGI:6153742 Il6ra endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:105304 Il6ra interleukin 6 receptor, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13825 ? EM:13775 C57BL/6N-Il4ra/WtsiIeg EMMA sperm mutant strain MGI:6153371 Il4ra endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:105367 Il4ra interleukin 4 receptor, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13775 + EM:09387 C57BL/6N-Il4i1/Ieg EMMA sperm mutant strain MGI:4432453 Il4i1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109552 Il4i1 interleukin 4 induced 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9387 - EM:05779 C57BL/6N-Il31/Cnrm EMMA sperm mutant strain MGI:4842595 Il31 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923649 Il31 interleukin 31 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5779 + EM:14345 C57BL/6N-Il27/WtsiH EMMA live mutant strain MGI:5694183 Il27 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2384409 Il27 interleukin 27 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14345 + EM:08953 C57BL/6N-Il19/H EMMA sperm mutant strain MGI:5511440 Il19 targeted mutation 2e, Helmholtz Zentrum Muenchen GmbH MGI:1890472 Il19 interleukin 19 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8953 + EM:11763 C57BL/6N-Il18rap/WtsiCnrm EMMA sperm mutant strain MGI:6152737 Il18rap endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1338888 Il18rap interleukin 18 receptor accessory protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11763 + EM:14222 C57BL/6N-Il17re/WtsiH EMMA live mutant strain MGI:7345521 Il17re targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1889371 Il17re interleukin 17 receptor E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14222 + EM:13992 C57BL/6N-Il17re/WtsiCnrm EMMA live mutant strain MGI:6157265 Il17re targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1889371 Il17re interleukin 17 receptor E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13992 + EM:10738 C57BL/6N-Il15/H EMMA archived mutant strain MGI:5790636 Il15 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:103014 Il15 interleukin 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10738 - EM:07964 C57BL/6N-Il15/H EMMA sperm B6NTac;B6N-Il15/H, HEPD0629_7_C06 mutant strain MGI:4455931 Il15 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103014 Il15 interleukin 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7964 + EM:09087 C57BL/6N-Il13ra2/Ieg EMMA sperm mutant strain MGI:4452745 Il13ra2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1277954 Il13ra2 interleukin 13 receptor, alpha 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9087 + EM:09493 C57BL/6N-Il12a/H EMMA sperm mutant strain MGI:4455775 Il12a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96539 Il12a interleukin 12a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9493 + EM:08503 C57BL/6N-Il10/Cnbc EMMA sperm mutant strain MGI:4432290 Il10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96537 Il10 interleukin 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8503 ? EM:14542 C57BL/6N-Ikbke/WtsiH EMMA live mutant strain Ikbke EUCOMM targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1929612 Ikbke inhibitor of kappaB kinase epsilon https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14542 ? EM:14184 C57BL/6N-Ikbke/WtsiCnbc EMMA archived mutant strain Ikbke EUCOMM targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1929612 Ikbke inhibitor of kappaB kinase epsilon https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14184 + EM:11218 C57BL/6N-Igsf8/WtsiIeg EMMA sperm mutant strain MGI:6140202 Igsf8 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2154090 Igsf8 immunoglobulin superfamily, member 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11218 + EM:11891 C57BL/6N-Igsf6/WtsiH EMMA sperm mutant strain MGI:6153370 Igsf6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891393 Igsf6 immunoglobulin superfamily, member 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11891 ? EM:13904 C57BL/6N-Igsf3/WtsiCnbc EMMA sperm mutant strain MGI:6257569 Igsf3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1926158 Igsf3 immunoglobulin superfamily, member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13904 + EM:08183 C57BL/6N-Igfbp3/H EMMA sperm mutant strain MGI:5548945 Igfbp3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:96438 Igfbp3 insulin-like growth factor binding protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8183 + EM:08649 C57BL/6N-Ift81/Ieg EMMA sperm mutant strain MGI:5636927 Ift81 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1098597 Ift81 intraflagellar transport 81 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8649 + EM:08602 C57BL/6N-Ift81/Ieg EMMA embryo mutant strain MGI:4433881 Ift81 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098597 Ift81 intraflagellar transport 81 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8602 + EM:14260 C57BL/6N-Ifitm6/WtsiH EMMA live mutant strain MGI:5638572 Ifitm6 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2686976 Ifitm6 interferon induced transmembrane protein 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14260 + EM:14207 C57BL/6N-Ifitm1/WtsiH EMMA live mutant strain MGI:5775001 Ifitm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915963 Ifitm1 interferon induced transmembrane protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14207 + EM:10668 C57BL/6N-Ifitm1/H EMMA sperm mutant strain MGI:4432260 Ifitm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915963 Ifitm1 interferon induced transmembrane protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10668 ? EM:13835 C57BL/6N-Ifih1/WtsiCnbc EMMA sperm mutant strain MGI:6153741 Ifih1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1918836 Ifih1 interferon induced with helicase C domain 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13835 + EM:13916 C57BL/6N-Ifi44l/WtsiOulu EMMA embryo mutant strain MGI:6257644 Ifi44l endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:95975 Ifi44l interferon-induced protein 44 like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13916 + EM:13916 C57BL/6N-Ifi44l/WtsiOulu EMMA sperm mutant strain MGI:6257644 Ifi44l endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:95975 Ifi44l interferon-induced protein 44 like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13916 + EM:10060 C57BL/6N-Ifi27l2a/Ieg EMMA sperm mutant strain MGI:5548678 Ifi27l2a targeted mutation 1.1, Velocigene MGI:1924183 Ifi27l2a interferon, alpha-inducible protein 27 like 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10060 ? EM:14311 C57BL/6N-Ifi27/WtsiCnbc EMMA archived mutant strain MGI:5636940 Ifi27 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1277180 Ifi27 interferon, alpha-inducible protein 27 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14311 ? EM:13781 C57BL/6N-Ifi207/WtsiIeg EMMA sperm mutant strain MGI:6153369 Ifi207 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2138302 Ifi207 interferon activated gene 207 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13781 + EM:09909 C57BL/6N-Idi1/Ieg EMMA sperm mutant strain MGI:4434753 Idi1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2442264 Idi1 isopentenyl-diphosphate delta isomerase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9909 + EM:14175 C57BL/6N-Id2/WtsiOulu EMMA embryo mutant strain MGI:5796939 Id2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:96397 Id2 inhibitor of DNA binding 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14175 + EM:14175 C57BL/6N-Id2/WtsiOulu EMMA sperm mutant strain MGI:5796939 Id2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:96397 Id2 inhibitor of DNA binding 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14175 + EM:11895 C57BL/6N-Icam5/WtsiH EMMA sperm mutant strain MGI:6153368 Icam5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:109430 Icam5 intercellular adhesion molecule 5, telencephalin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11895 + EM:11344 C57BL/6N-Ica1l/Ieg EMMA sperm mutant strain MGI:5294183 Ica1l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917625 Ica1l islet cell autoantigen 1-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11344 ? EM:13891 C57BL/6N-Iars/WtsiCnbc EMMA sperm mutant strain MGI:6153367 Iars endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2145219 Iars isoleucine-tRNA synthetase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13891 + EM:09238 C57BL/6N-Hunk/Ieg EMMA sperm mutant strain MGI:5613639 Hunk targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1347352 Hunk hormonally upregulated Neu-associated kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9238 + EM:08246 C57BL/6N-Hunk/Ieg EMMA embryo mutant strain MGI:5050999 Hunk targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1347352 Hunk hormonally upregulated Neu-associated kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8246 + EM:11594 C57BL/6N-Htra3/WtsiOulu EMMA embryo mutant strain MGI:6140200 Htra3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1925808 Htra3 HtrA serine peptidase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11594 + EM:11594 C57BL/6N-Htra3/WtsiOulu EMMA sperm mutant strain MGI:6140200 Htra3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1925808 Htra3 HtrA serine peptidase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11594 ? EM:13744 C57BL/6N-Hspa13/WtsiOrl EMMA sperm mutant strain MGI:6153366 Hspa13 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1309463 Hspa13 heat shock protein 70 family, member 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13744 + EM:08066 C57BL/6N-Hsf2bp/Ieg EMMA sperm mutant strain MGI:5548644 Hsf2bp targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1921627 Hsf2bp heat shock transcription factor 2 binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8066 + EM:11216 C57BL/6N-Hrnr/WtsiIeg EMMA sperm mutant strain MGI:6140199 Hrnr endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3046938 Hrnr hornerin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11216 + EM:04718 C57BL/6N-Hprt/Ieg EMMA embryo B6NTac;B6N-Hprt/Ieg mutant strain MGI:4435169 Hprt targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96217 Hprt hypoxanthine guanine phosphoribosyl transferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4718 + EM:05414 C57BL/6N-Hprt/WtsiOulu EMMA embryo HPRT CMV Cre (CRET), C57BL/6N-Hprt/WtsiOulu mutant strain MGI:5496382 Hprt targeted mutation 1, Wellcome Trust Sanger Institute MGI:96217 Hprt hypoxanthine guanine phosphoribosyl transferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5414 + EM:12647 C57BL/6N-Hpgd/H EMMA live mutant strain MGI:4946754 Hpgd targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108085 Hpgd hydroxyprostaglandin dehydrogenase 15 (NAD) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12647 + EM:11150 C57BL/6N-Hpf1/WtsiH EMMA sperm mutant strain MGI:6153365 Hpf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919862 Hpf1 histone PARylation factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11150 + EM:09237 C57BL/6N-Hoxa2/Ieg EMMA sperm mutant strain MGI:5613670 Hoxa2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:96174 Hoxa2 homeobox A2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9237 + EM:11030 C57BL/6N-Hoxa2/Ieg EMMA sperm mutant strain MGI:4455974 Hoxa2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96174 Hoxa2 homeobox A2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11030 + EM:09236 C57BL/6N-Hnf4a/Ieg EMMA sperm mutant strain MGI:5613635 Hnf4a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:109128 Hnf4a hepatic nuclear factor 4, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9236 + EM:08243 C57BL/6N-Hnf4a/Ieg EMMA embryo mutant strain MGI:4455726 Hnf4a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109128 Hnf4a hepatic nuclear factor 4, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8243 + EM:09305 C57BL/6N-Hipk3/Ieg EMMA embryo mutant strain MGI:5588270 Hipk3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1314882 Hipk3 homeodomain interacting protein kinase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9305 + EM:09305 C57BL/6N-Hipk3/Ieg EMMA sperm mutant strain MGI:5588270 Hipk3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1314882 Hipk3 homeodomain interacting protein kinase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9305 + EM:09294 C57BL/6N-Hipk3/Ieg EMMA embryo mutant strain MGI:5289889 Hipk3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1314882 Hipk3 homeodomain interacting protein kinase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9294 + EM:09294 C57BL/6N-Hipk3/Ieg EMMA sperm mutant strain MGI:5289889 Hipk3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1314882 Hipk3 homeodomain interacting protein kinase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9294 ? EM:14433 C57BL/6N-Hipk3/WtsiCnbc EMMA sperm mutant strain MGI:6153740 Hipk3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1314882 Hipk3 homeodomain interacting protein kinase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14433 - EM:05220 C57BL/6N-Hint1/H EMMA sperm mutant strain MGI:4433692 Hint1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1321133 Hint1 histidine triad nucleotide binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5220 + EM:14503 C57BL/6N-Hibadh/WtsiH EMMA live mutant strain MGI:5637002 Hibadh targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1889802 Hibadh 3-hydroxyisobutyrate dehydrogenase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14503 - EM:07493 C57BL/6N-Hhipl1/H EMMA sperm B6NTac;B6N-Hhipl1/H mutant strain MGI:4451243 Hhipl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919265 Hhipl1 hedgehog interacting protein-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7493 + EM:10642 C57BL/6N-Hexb/H EMMA sperm mutant strain MGI:5050187 Hexb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96074 Hexb hexosaminidase B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10642 + EM:10246 C57BL/6N-Herc1/Wtsi EMMA archived mutant strain MGI:6102914 Herc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2384589 Herc1 HECT and RLD domain containing E3 ubiquitin protein ligase family member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10246 ? EM:14782 C57BL/6N-Hepacam/WtsiCnbc EMMA sperm mutant strain MGI:6153364 Hepacam endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1920177 Hepacam hepatocyte cell adhesion molecule https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14782 + EM:08093 C57BL/6N-Hells/Ieg EMMA sperm mutant strain MGI:5548365 Hells targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106209 Hells helicase, lymphoid specific https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8093 + EM:10450 C57BL/6N-Hecw1/H EMMA sperm mutant strain MGI:5511718 Hecw1 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2444115 Hecw1 HECT, C2 and WW domain containing E3 ubiquitin protein ligase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10450 ? EM:13842 C57BL/6N-Heatr9/WtsiCnbc EMMA sperm mutant strain MGI:6153363 Heatr9 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3650286 Heatr9 HEAT repeat containing 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13842 + EM:10055 C57BL/6N-Hdac1/Ieg EMMA sperm mutant strain MGI:5548383 Hdac1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:108086 Hdac1 histone deacetylase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10055 - EM:07870 C57BL/6N-Hcrtr2/H EMMA sperm mutant strain MGI:4456664 Hcrtr2 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2680765 Hcrtr2 hypocretin (orexin) receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7870 + EM:13694 C57BL/6N-Hba-x/WtsiCnrm EMMA live mutant strain MGI:6153362 Hba-x endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:96019 Hba-x hemoglobin X, alpha-like embryonic chain in Hba complex https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13694 - EM:08190 C57BL/6N-Has1/H EMMA sperm B6NTac;B6N-Has1/H mutant strain MGI:4419868 Has1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106590 Has1 hyaluronan synthase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8190 ? EM:14594 C57BL/6N-Hapln4/WtsiPh EMMA sperm mutant strain MGI:6153361 Hapln4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2679531 Hapln4 hyaluronan and proteoglycan link protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14594 + EM:11163 C57BL/6N-Hao2/WtsiH EMMA sperm mutant strain MGI:6153360 Hao2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:96012 Hao2 hydroxyacid oxidase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11163 ? EM:14439 C57BL/6N-Hao1/WtsiCnbc EMMA sperm mutant strain MGI:6336055 Hao1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:96011 Hao1 hydroxyacid oxidase 1, liver https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14439 - EM:06138 C57BL/6N-Hace1/H EMMA sperm B6NTac;B6N-Hace1/H mutant strain MGI:4840984 Hace1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446110 Hace1 HECT domain and ankyrin repeat containing, E3 ubiquitin protein ligase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6138 + EM:14237 C57BL/6N-H2bl1/WtsiOulu EMMA embryo mutant strain MGI:5637040 H2bl1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916632 H2bl1 H2B.L histone variant 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14237 + EM:14237 C57BL/6N-H2bl1/WtsiOulu EMMA sperm mutant strain MGI:5637040 H2bl1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916632 H2bl1 H2B.L histone variant 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14237 + EM:11584 C57BL/6N-H2ab3/WtsiOulu EMMA embryo C57BL/6N-H2afb3/WtsiOulu mutant strain MGI:6140198 H2ab3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3644875 H2ab3 H2A.B variant histone 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11584 + EM:11584 C57BL/6N-H2ab3/WtsiOulu EMMA sperm C57BL/6N-H2afb3/WtsiOulu mutant strain MGI:6140198 H2ab3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3644875 H2ab3 H2A.B variant histone 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11584 + EM:13826 C57BL/6N-H2-T24/WtsiOulu EMMA embryo mutant strain MGI:6153358 H2-T24 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95958 H2-T24 histocompatibility 2, T region locus 24 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13826 + EM:13826 C57BL/6N-H2-T24/WtsiOulu EMMA sperm mutant strain MGI:6153358 H2-T24 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95958 H2-T24 histocompatibility 2, T region locus 24 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13826 ? EM:14789 C57BL/6N-Gzmf/WtsiCnbc EMMA sperm mutant strain MGI:6153357 Gzmf endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:109254 Gzmf granzyme F https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14789 ? EM:14453 C57BL/6N-Gzme/WtsiCnbc EMMA sperm mutant strain MGI:6153356 Gzme endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:109265 Gzme granzyme E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14453 + EM:13387 C57BL/6N-Gzmd/WtsiCnrm EMMA live mutant strain MGI:5823220 Gzmd targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:109255 Gzmd granzyme D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13387 + EM:08810 C57BL/6N-Gtf2e2/H EMMA sperm mutant strain MGI:5008024 Gtf2e2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915403 Gtf2e2 general transcription factor II E, polypeptide 2 (beta subunit) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8810 ? EM:14596 C57BL/6N-Gtdc1/WtsiCnbc EMMA sperm mutant strain MGI:6281919 Gtdc1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2444269 Gtdc1 glycosyltransferase-like domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14596 + EM:04830 C57BL/6N-Gt(ROSA)26Sor/WtsiIeg EMMA embryo ROSA26 Fki, C57BL/6N-Gt(ROSA)26Sor/WtsiIeg mutant strain MGI:5496383 Gt(ROSA)26Sor targeted mutation 1, Wellcome Trust Sanger Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4830 - EM:10234 C57BL/6N-Gstm6/Ieg EMMA sperm mutant strain MGI:6148222 Gstm6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1309467 Gstm6 glutathione S-transferase, mu 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10234 + EM:08620 C57BL/6N-Gstm6/Ieg EMMA embryo mutant strain MGI:5287849 Gstm6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1309467 Gstm6 glutathione S-transferase, mu 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8620 + EM:09516 C57BL/6N-Gsta4/Ieg EMMA sperm mutant strain MGI:5629310 Gsta4 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1309515 Gsta4 glutathione S-transferase, alpha 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9516 + EM:08599 C57BL/6N-Gsta4/Ieg EMMA embryo mutant strain MGI:5013788 Gsta4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1309515 Gsta4 glutathione S-transferase, alpha 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8599 - EM:11665 C57BL/6N-Gsk3a/Ieg EMMA sperm mutant strain MGI:5695125 Gsk3a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2152453 Gsk3a glycogen synthase kinase 3 alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11665 - EM:05306 C57BL/6N-Gse1/H EMMA sperm mutant strain MGI:4455973 Gse1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098275 Gse1 genetic suppressor element 1, coiled-coil protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5306 ? EM:14240 C57BL/6N-Grsf1/WtsiIeg EMMA sperm mutant strain MGI:5636902 Grsf1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106479 Grsf1 G-rich RNA sequence binding factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14240 + EM:11804 C57BL/6N-Grpel1/Oulu EMMA embryo mutant strain MGI:4432720 Grpel1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1334417 Grpel1 GrpE-like 1, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11804 + EM:11804 C57BL/6N-Grpel1/Oulu EMMA sperm mutant strain MGI:4432720 Grpel1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1334417 Grpel1 GrpE-like 1, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11804 - EM:10779 C57BL/6N-Grm7/H EMMA live mutant strain Grm7 CRISPR/CAS9 targeted mutation, MRC Harwell MGI:1351344 Grm7 glutamate receptor, metabotropic 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10779 - EM:05909 C57BL/6N-Grm6/H EMMA sperm mutant strain MGI:4431613 Grm6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1351343 Grm6 glutamate receptor, metabotropic 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5909 + EM:08283 C57BL/6N-Grm3/H EMMA sperm mutant strain MGI:4820049 Grm3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1351340 Grm3 glutamate receptor, metabotropic 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8283 + EM:10396 C57BL/6N-Grin3b/H EMMA sperm mutant strain MGI:4462594 Grin3b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2150393 Grin3b glutamate receptor, ionotropic, NMDA3B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10396 + EM:10461 C57BL/6N-Grin3a/H EMMA sperm mutant strain MGI:5752551 Grin3a targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1933206 Grin3a glutamate receptor ionotropic, NMDA3A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10461 + EM:09296 C57BL/6N-Grin3a/H EMMA sperm mutant strain MGI:4458762 Grin3a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1933206 Grin3a glutamate receptor ionotropic, NMDA3A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9296 + EM:12638 C57BL/6N-Grik2/H EMMA live mutant strain MGI:5052479 Grik2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:95815 Grik2 glutamate receptor, ionotropic, kainate 2 (beta 2) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12638 + EM:11259 C57BL/6N-Grik1/H EMMA sperm mutant strain MGI:4840802 Grik1 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:95814 Grik1 glutamate receptor, ionotropic, kainate 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11259 ? EM:14490 C57BL/6N-Grb7/WtsiIeg EMMA sperm mutant strain MGI:5636886 Grb7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:102683 Grb7 growth factor receptor bound protein 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14490 + EM:08713 C57BL/6N-Gpx3/H EMMA sperm mutant strain MGI:4841147 Gpx3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105102 Gpx3 glutathione peroxidase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8713 + EM:08055 C57BL/6N-Gpsm2/Ieg EMMA sperm mutant strain MGI:5548664 Gpsm2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923373 Gpsm2 G-protein signalling modulator 2 (AGS3-like, C. elegans) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8055 + EM:05535 C57BL/6N-Gpsm2/Ieg EMMA embryo B6NTac;B6N-Gpsm2/Ieg mutant strain MGI:4441912 Gpsm2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923373 Gpsm2 G-protein signalling modulator 2 (AGS3-like, C. elegans) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5535 + EM:13039 C57BL/6N-Gpr35/WtsiH EMMA live mutant strain MGI:5638567 Gpr35 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1929509 Gpr35 G protein-coupled receptor 35 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13039 - EM:06174 C57BL/6N-Gpr22/H EMMA sperm B6NTac;B6N-Gpr22/H mutant strain MGI:4362775 Gpr22 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920260 Gpr22 G protein-coupled receptor 22 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6174 - EM:04737 C57BL/6N-Gpr1/Cnrm EMMA embryo B6NDen;B6N-Gpr1/Cnrm, B6Dnk;B6N-Cmklr2/Cnrm, B6Dnk;B6N-Gpr1/Cnrm mutant strain MGI:4434954 Cmklr2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385324 Cmklr2 chemerin chemokine-like receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4737 - EM:04737 C57BL/6N-Gpr1/Cnrm EMMA sperm B6NDen;B6N-Gpr1/Cnrm, B6Dnk;B6N-Cmklr2/Cnrm, B6Dnk;B6N-Gpr1/Cnrm mutant strain MGI:4434954 Cmklr2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385324 Cmklr2 chemerin chemokine-like receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4737 + EM:09877 C57BL/6N-Gpr176/H EMMA sperm mutant strain MGI:4843901 Gpr176 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2685858 Gpr176 G protein-coupled receptor 176 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9877 + EM:13415 C57BL/6N-Gpr152/WtsiCnrm EMMA live mutant strain MGI:5548871 Gpr152 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2685519 Gpr152 G protein-coupled receptor 152 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13415 + EM:08388 C57BL/6N-Gpr137b/H EMMA sperm mutant strain MGI:4820052 Gpr137b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891463 Gpr137b G protein-coupled receptor 137B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8388 + EM:10110 C57BL/6N-Gpbp1/Ieg EMMA sperm mutant strain MGI:5692726 Gpbp1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1920524 Gpbp1 GC-rich promoter binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10110 + EM:09177 C57BL/6N-Gpbp1/Ieg EMMA sperm mutant strain MGI:5006774 Gpbp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920524 Gpbp1 GC-rich promoter binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9177 + EM:09510 C57BL/6N-Gpatch2l/Ieg EMMA sperm mutant strain MGI:5629318 Gpatch2l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1917623 Gpatch2l G patch domain containing 2 like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9510 + EM:09488 C57BL/6N-Gpatch2l/Ieg EMMA sperm mutant strain MGI:4362674 Gpatch2l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917623 Gpatch2l G patch domain containing 2 like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9488 ? EM:11284 C57BL/6N-Gpatch1/WtsiOrl EMMA archived mutant strain MGI:6153355 Gpatch1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914721 Gpatch1 G patch domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11284 + EM:10399 C57BL/6N-Got1/H EMMA sperm C57BL6/NTac-Got1/H mutant strain MGI:4950165 Got1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:95791 Got1 glutamic-oxaloacetic transaminase 1, soluble https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10399 - EM:06828 C57BL/6N-Gosr2/H EMMA sperm mutant strain MGI:4849382 Gosr2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1927204 Gosr2 golgi SNAP receptor complex member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6828 - EM:04736 C57BL/6N-Golt1b/Cnrm EMMA embryo mutant strain MGI:4432110 Golt1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914214 Golt1b golgi transport 1B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4736 - EM:04736 C57BL/6N-Golt1b/Cnrm EMMA sperm mutant strain MGI:4432110 Golt1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914214 Golt1b golgi transport 1B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4736 ? EM:14287 C57BL/6N-Golm2/WtsiIeg EMMA sperm mutant strain MGI:5637147 Golm2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2443129 Golm2 golgi membrane protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14287 - EM:08286 C57BL/6N-Golga3/H EMMA sperm B6NTac;B6N-Golga3/H mutant strain MGI:4841643 Golga3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96958 Golga3 golgi autoantigen, golgin subfamily a, 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8286 ? EM:13403 C57BL/6N-Gnl3/WtsiCnrm EMMA live mutant strain Gnl3 Sanger Institute targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1353651 Gnl3 guanine nucleotide binding protein-like 3 (nucleolar) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13403 + EM:13388 C57BL/6N-Gnb3/WtsiCnrm EMMA live mutant strain MGI:5637208 Gnb3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:95785 Gnb3 guanine nucleotide binding protein (G protein), beta 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13388 - EM:07005 C57BL/6N-Gnao1/H EMMA sperm B6NTac;B6N-Gnao1/H mutant strain MGI:4456727 Gnao1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:95775 Gnao1 guanine nucleotide binding protein, alpha O https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7005 + EM:11569 C57BL/6N-Gm5155/WtsiOulu EMMA embryo mutant strain MGI:6140197 Gm5155 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3647191 Gm5155 predicted gene 5155 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11569 + EM:11569 C57BL/6N-Gm5155/WtsiOulu EMMA sperm mutant strain MGI:6140197 Gm5155 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3647191 Gm5155 predicted gene 5155 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11569 ? EM:13740 C57BL/6N-Gm45261/WtsiOrl EMMA sperm mutant strain MGI:6286372 Gm45261 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:5791097 Gm45261 predicted gene 45261 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13740 ? EM:14298 C57BL/6N-Gm28050/WtsiOrl EMMA sperm mutant strain Gm28050 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:5547786 Gm28050 predicted gene, 28050 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14298 ? EM:13863 C57BL/6N-Gm2694/WtsiPh EMMA sperm mutant strain MGI:6153353 Gm2694 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3780864 Gm2694 predicted gene 2694 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13863 ? EM:14455 C57BL/6N-Gm20646/WtsiPh EMMA sperm mutant strain MGI:6153352 Gm20646 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:5313093 Gm20646 predicted gene 20646 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14455 ? EM:13869 C57BL/6N-Gm17750/WtsiCnbc EMMA sperm mutant strain MGI:6153351 Gm17750 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:5009828 Gm17750 predicted gene, 17750 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13869 ? EM:13776 C57BL/6N-Gm12169/WtsiIeg EMMA sperm mutant strain MGI:6153350 Gm12169 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3650838 Gm12169 predicted gene 12169 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13776 ? EM:13765 C57BL/6N-Gm1043/WtsiIeg EMMA sperm mutant strain MGI:6281929 Gm1043 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2685889 Gm1043 predicted gene 1043 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13765 ? EM:13879 C57BL/6N-Glyatl3/WtsiCnbc EMMA sperm mutant strain MGI:6153766 Glyatl3 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:3647683 Glyatl3 glycine-N-acyltransferase-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13879 + EM:11154 C57BL/6N-Glyatl3/WtsiOulu EMMA embryo mutant strain MGI:6140196 Glyatl3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3647683 Glyatl3 glycine-N-acyltransferase-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11154 + EM:11154 C57BL/6N-Glyatl3/WtsiOulu EMMA sperm mutant strain MGI:6140196 Glyatl3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3647683 Glyatl3 glycine-N-acyltransferase-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11154 + EM:08370 C57BL/6N-Glul/H EMMA sperm mutant strain MGI:4820105 Glul targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95739 Glul glutamate-ammonia ligase (glutamine synthetase) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8370 + EM:09379 C57BL/6N-Gltp/Ph EMMA archived mutant strain MGI:4434874 Gltp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1929253 Gltp glycolipid transfer protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9379 + EM:13438 C57BL/6N-Glt1d1/WtsiCnrm EMMA live mutant strain MGI:6281932 Glt1d1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2442755 Glt1d1 glycosyltransferase 1 domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13438 - EM:07478 C57BL/6N-Glra2/H EMMA sperm B6NTac;B6N-Glra2/H mutant strain MGI:4364480 Glra2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95748 Glra2 glycine receptor, alpha 2 subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7478 + EM:09030 C57BL/6N-Glp1r/H EMMA sperm mutant strain MGI:5692922 Glp1r targeted mutation 1c, Mouse Biology Program, UCDavis MGI:99571 Glp1r glucagon-like peptide 1 receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9030 + EM:06808 C57BL/6N-Glp1r/H EMMA sperm B6NTac;B6N-Glp1r/H mutant strain MGI:4840757 Glp1r targeted mutation 1a, Mouse Biology Program, UCDavis MGI:99571 Glp1r glucagon-like peptide 1 receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6808 + EM:14432 C57BL/6N-Gldn/WtsiCnbc EMMA embryo mutant strain MGI:6153349 Gldn endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2388361 Gldn gliomedin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14432 + EM:14432 C57BL/6N-Gldn/WtsiCnbc EMMA sperm mutant strain MGI:6153349 Gldn endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2388361 Gldn gliomedin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14432 + EM:14456 C57BL/6N-Glcci1/WtsiOulu EMMA embryo mutant strain MGI:6153348 Glcci1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2179717 Glcci1 glucocorticoid induced transcript 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14456 + EM:14456 C57BL/6N-Glcci1/WtsiOulu EMMA sperm mutant strain MGI:6153348 Glcci1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2179717 Glcci1 glucocorticoid induced transcript 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14456 - EM:05129 C57BL/6N-Gja8/H EMMA sperm HEPD0555_6_G06, B6NTac;B6N-Gja8/H, STOCK Gja8/H mutant strain MGI:4435449 Gja8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99953 Gja8 gap junction protein, alpha 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5129 ? EM:14573 C57BL/6N-Gimap4/WtsiCnbc EMMA sperm mutant strain MGI:6153347 Gimap4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1349656 Gimap4 GTPase, IMAP family member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14573 ? EM:13739 C57BL/6N-Ghitm/WtsiOrl EMMA sperm mutant strain MGI:6153346 Ghitm endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1913342 Ghitm growth hormone inducible transmembrane protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13739 + EM:08098 C57BL/6N-Ggps1/Ieg EMMA sperm mutant strain MGI:5548447 Ggps1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1341724 Ggps1 geranylgeranyl diphosphate synthase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8098 + EM:11806 C57BL/6N-Ggps1/Ieg EMMA sperm mutant strain MGI:5000392 Ggps1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1341724 Ggps1 geranylgeranyl diphosphate synthase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11806 + EM:08662 C57BL/6N-Gfpt2/Ieg EMMA sperm mutant strain MGI:5636966 Gfpt2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1338883 Gfpt2 glutamine fructose-6-phosphate transaminase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8662 + EM:08640 C57BL/6N-Gfpt2/Ieg EMMA embryo mutant strain MGI:4433591 Gfpt2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1338883 Gfpt2 glutamine fructose-6-phosphate transaminase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8640 + EM:09182 C57BL/6N-Gfpt1/H EMMA sperm mutant strain MGI:5692888 Gfpt1 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:95698 Gfpt1 glutamine fructose-6-phosphate transaminase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9182 - EM:05172 C57BL/6N-Gfod2/Cnrm EMMA sperm mutant strain MGI:4435083 Gfod2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917825 Gfod2 glucose-fructose oxidoreductase domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5172 + EM:09304 C57BL/6N-Gdi2/Ieg EMMA sperm mutant strain MGI:5588293 Gdi2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:99845 Gdi2 guanosine diphosphate (GDP) dissociation inhibitor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9304 + EM:08244 C57BL/6N-Gdi2/Ieg EMMA sperm mutant strain MGI:5286327 Gdi2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99845 Gdi2 guanosine diphosphate (GDP) dissociation inhibitor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8244 + EM:10460 C57BL/6N-Gdf15/H EMMA sperm mutant strain MGI:5752548 Gdf15 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1346047 Gdf15 growth differentiation factor 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10460 - EM:06354 C57BL/6N-Gdf15/H EMMA sperm B6NTac;B6N-Gdf15/H mutant strain MGI:4362649 Gdf15 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1346047 Gdf15 growth differentiation factor 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6354 + EM:09300 C57BL/6N-Gde1/Ieg EMMA sperm mutant strain MGI:5548506 Gde1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1891827 Gde1 glycerophosphodiester phosphodiesterase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9300 + EM:08126 C57BL/6N-Gde1/Ieg EMMA embryo B6NTac;B6N-Gde1/Ieg mutant strain MGI:4841688 Gde1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1891827 Gde1 glycerophosphodiester phosphodiesterase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8126 + EM:11215 C57BL/6N-Gdap2/WtsiIeg EMMA sperm mutant strain MGI:6140193 Gdap2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1338001 Gdap2 ganglioside-induced differentiation-associated-protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11215 ? EM:13868 C57BL/6N-Gcc2/WtsiCnbc EMMA sperm mutant strain MGI:6153345 Gcc2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1917547 Gcc2 GRIP and coiled-coil domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13868 - EM:06993 C57BL/6N-Gbx1/H EMMA sperm B6NTac;B6N-Gbx1/H mutant strain MGI:4944338 Gbx1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95667 Gbx1 gastrulation brain homeobox 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6993 + EM:11213 C57BL/6N-Gbp5/WtsiIeg EMMA sperm mutant strain MGI:6140192 Gbp5 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2429943 Gbp5 guanylate binding protein 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11213 ? EM:13767 C57BL/6N-Gbp4/WtsiOrl EMMA sperm mutant strain MGI:6153344 Gbp4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:97072 Gbp4 guanylate binding protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13767 + EM:08757 C57BL/6N-Gbp2/Ieg EMMA sperm mutant strain MGI:5548331 Gbp2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:102772 Gbp2 guanylate binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8757 + EM:09101 C57BL/6N-Gatm/Ieg EMMA embryo mutant strain MGI:5548533 Gatm targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914342 Gatm glycine amidinotransferase (L-arginine:glycine amidinotransferase) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9101 + EM:09101 C57BL/6N-Gatm/Ieg EMMA sperm mutant strain MGI:5548533 Gatm targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914342 Gatm glycine amidinotransferase (L-arginine:glycine amidinotransferase) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9101 + EM:09235 C57BL/6N-Galk2/Ieg EMMA sperm mutant strain MGI:5613648 Galk2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1917226 Galk2 galactokinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9235 + EM:08064 C57BL/6N-Gad2/Ieg EMMA sperm mutant strain MGI:5548938 Gad2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:95634 Gad2 glutamic acid decarboxylase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8064 + EM:05550 C57BL/6N-Gad2/Ieg EMMA embryo B6NTac;B6N-Gad2/Ieg mutant strain MGI:4433273 Gad2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95634 Gad2 glutamic acid decarboxylase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5550 + EM:07481 C57BL/6N-Gabarapl2/H EMMA sperm B6NTac;B6N-Gabarapl2/H mutant strain MGI:4434575 Gabarapl2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1890602 Gabarapl2 gamma-aminobutyric acid (GABA) A receptor-associated protein-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7481 + EM:08277 C57BL/6N-Fzd3/H EMMA sperm mutant strain MGI:4842008 Fzd3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108476 Fzd3 frizzled class receptor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8277 ? EM:05509 C57BL/6N-Fyco1/Ieg EMMA embryo mutant strain Fyco1 Fyco1 MGI:107277 Fyco1 FYVE and coiled-coil domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5509 ? EM:05508 C57BL/6N-Fyco1/Ieg EMMA embryo mutant strain Fyco1 Fyco1 MGI:107277 Fyco1 FYVE and coiled-coil domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5508 + EM:08083 C57BL/6N-Fyb/Ieg EMMA embryo mutant strain MGI:5548460 Fyb targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1346327 Fyb FYN binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8083 - EM:05210 C57BL/6N-Fyb/Cnrm EMMA sperm mutant strain MGI:4436293 Fyb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1346327 Fyb FYN binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5210 + EM:13544 C57BL/6N-Fut8/WtsiKieg EMMA embryo mutant strain MGI:6153343 Fut8 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1858901 Fut8 fucosyltransferase 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13544 + EM:13544 C57BL/6N-Fut8/WtsiKieg EMMA sperm mutant strain MGI:6153343 Fut8 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1858901 Fut8 fucosyltransferase 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13544 + EM:11217 C57BL/6N-Fut2/WtsiIeg EMMA sperm mutant strain MGI:6140191 Fut2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:109374 Fut2 fucosyltransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11217 + EM:11274 C57BL/6N-Fut1/Ieg EMMA sperm mutant strain MGI:5050841 Fut1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109375 Fut1 fucosyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11274 - EM:05961 C57BL/6N-Fstl1/Cnrm EMMA sperm mutant strain MGI:4458780 Fstl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:102793 Fstl1 follistatin-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5961 ? EM:13774 C57BL/6N-Fst/WtsiIeg EMMA sperm mutant strain MGI:6333014 Fst endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95586 Fst follistatin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13774 ? EM:14320 C57BL/6N-Fryl/WtsiIeg EMMA sperm mutant strain MGI:5692715 Fryl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919563 Fryl FRY like transcription coactivator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14320 + EM:05929 C57BL/6N-Frs2/H EMMA sperm B6NTac;B6N-Frs2/H mutant strain MGI:4433393 Frs2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1100860 Frs2 fibroblast growth factor receptor substrate 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5929 + EM:07313 C57BL/6N-Frrs1l/H EMMA sperm B6NTac;B6N-Frrs1l/H mutant strain MGI:4941526 Frrs1l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2442704 Frrs1l ferric-chelate reductase 1 like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7313 + EM:08084 C57BL/6N-Frmd5/Ieg EMMA embryo mutant strain MGI:5548809 Frmd5 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2442557 Frmd5 FERM domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8084 ? EM:10058 C57BL/6N-Folh1/Ph EMMA sperm mutant strain Folh1 Folh1 MGI:1858193 Folh1 folate hydrolase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10058 ? EM:08499 C57BL/6N-Folh1/Ph EMMA sperm mutant strain Folh1 Folh1 MGI:1858193 Folh1 folate hydrolase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8499 ? EM:14452 C57BL/6N-Fndc5/WtsiPh EMMA sperm mutant strain MGI:6153342 Fndc5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1917614 Fndc5 fibronectin type III domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14452 ? EM:13910 C57BL/6N-Fndc10/WtsiPh EMMA sperm mutant strain MGI:6153341 Fndc10 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2444790 Fndc10 fibronectin type III domain containing 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13910 - EM:07802 C57BL/6N-Flnb/H EMMA sperm B6NTac;B6N-Flnb/H mutant strain MGI:4458530 Flnb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446089 Flnb filamin, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7802 ? EM:05513 C57BL/6N-Flg Hrnr/Ieg EMMA embryo mutant strain Hrnr Hrnr MGI:3046938 Hrnr hornerin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5513 ? EM:05513 C57BL/6N-Flg Hrnr/Ieg EMMA embryo mutant strain Flg Flg MGI:95553 Flg filaggrin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5513 + EM:10114 C57BL/6N-Fis1/Ieg EMMA sperm mutant strain MGI:5692658 Fis1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1913687 Fis1 fission, mitochondrial 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10114 + EM:09485 C57BL/6N-Fis1/Ieg EMMA sperm mutant strain MGI:5497163 Fis1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913687 Fis1 fission, mitochondrial 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9485 ? EM:14410 C57BL/6N-Filip1/WtsiCnbc EMMA archived mutant strain MGI:6406759 Filip1 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1917848 Filip1 filamin A interacting protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14410 + EM:11579 C57BL/6N-Fignl1/WtsiIeg EMMA sperm mutant strain MGI:6140190 Fignl1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1890648 Fignl1 fidgetin-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11579 + EM:11683 C57BL/6N-Ficd/H EMMA live mutant strain MGI:6120693 Ficd targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1098550 Ficd FIC domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11683 + EM:11664 C57BL/6N-Ficd/H EMMA live mutant strain MGI:4942081 Ficd targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1098550 Ficd FIC domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11664 + EM:11893 C57BL/6N-Fgfbp1/WtsiH EMMA sperm mutant strain MGI:6153340 Fgfbp1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1096350 Fgfbp1 fibroblast growth factor binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11893 + EM:07495 C57BL/6N-Fgf8/H EMMA sperm B6NTac;B6N-Fgf8/H mutant strain MGI:4419458 Fgf8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99604 Fgf8 fibroblast growth factor 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7495 - EM:06822 C57BL/6N-Fgf22/H EMMA sperm B6NTac;B6N-Fgf22/H mutant strain MGI:4455942 Fgf22 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914362 Fgf22 fibroblast growth factor 22 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6822 + EM:10144 C57BL/6N-Fgf10/H EMMA sperm mutant strain MGI:5692589 Fgf10 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1099809 Fgf10 fibroblast growth factor 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10144 + EM:06353 C57BL/6N-Fgf10/H EMMA sperm B6NTac;B6N-Fgf10/H mutant strain MGI:4431585 Fgf10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1099809 Fgf10 fibroblast growth factor 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6353 + EM:14154 C57BL/6N-Fes/WtsiH EMMA live mutant strain MGI:5812934 Fes targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:95514 Fes feline sarcoma oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14154 + EM:10400 C57BL/6N-Fer1l4/H EMMA sperm mutant strain MGI:5002942 Fer1l4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921812 Fer1l4 fer-1-like 4 (C. elegans) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10400 + EM:09219 C57BL/6N-Fdx1/Ieg EMMA sperm mutant strain MGI:5588266 Fdx1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:103224 Fdx1 ferredoxin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9219 + EM:08241 C57BL/6N-Fdx1/Ieg EMMA embryo mutant strain MGI:4452014 Fdx1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:103224 Fdx1 ferredoxin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8241 + EM:08241 C57BL/6N-Fdx1/Ieg EMMA sperm mutant strain MGI:4452014 Fdx1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:103224 Fdx1 ferredoxin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8241 + EM:08042 C57BL/6N-Fcrl6/H EMMA sperm B6NTac;B6N-Fcrl6/H mutant strain MGI:5013745 Fcrl6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3618339 Fcrl6 Fc receptor-like 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8042 + EM:14177 C57BL/6N-Fcho2/WtsiOulu EMMA embryo mutant strain MGI:5775007 Fcho2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3505790 Fcho2 FCH domain only 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14177 + EM:14177 C57BL/6N-Fcho2/WtsiOulu EMMA sperm mutant strain MGI:5775007 Fcho2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3505790 Fcho2 FCH domain only 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14177 + EM:09932 C57BL/6N-Fcgr3/H EMMA archived mutant strain MGI:4842001 Fcgr3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:95500 Fcgr3 Fc receptor, IgG, low affinity III https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9932 + EM:11542 C57BL/6N-Fcgbp/Cnrm EMMA embryo mutant strain MGI:5548824 Fcgbp targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2444336 Fcgbp Fc fragment of IgG binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11542 + EM:11542 C57BL/6N-Fcgbp/Cnrm EMMA sperm mutant strain MGI:5548824 Fcgbp targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2444336 Fcgbp Fc fragment of IgG binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11542 - EM:05780 C57BL/6N-Fcgbp/Cnrm EMMA sperm mutant strain MGI:4432812 Fcgbp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444336 Fcgbp Fc fragment of IgG binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5780 + EM:08156 C57BL/6N-Fbxw26/WtsiBiat EMMA sperm mutant strain MGI:5548906 Fbxw26 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3646662 Fbxw26 F-box and WD-40 domain protein 26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8156 + EM:11752 C57BL/6N-Fbxo7/WtsiCnrm EMMA sperm mutant strain MGI:6117789 Fbxo7 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1917004 Fbxo7 F-box protein 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11752 + EM:14231 C57BL/6N-Fbxo7/WtsiCnrm EMMA live mutant strain MGI:6120740 Fbxo7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1917004 Fbxo7 F-box protein 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14231 + EM:10196 C57BL/6N-Fbxo33/WtsiCnrm EMMA sperm mutant strain MGI:5548601 Fbxo33 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1917861 Fbxo33 F-box protein 33 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10196 - EM:06999 C57BL/6N-Fbxo11/H EMMA sperm mutant strain MGI:4434283 Fbxo11 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2147134 Fbxo11 F-box protein 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6999 - EM:07779 C57BL/6N-Fbxl21/H EMMA sperm B6NTac;B6N-Fbxl21/H mutant strain MGI:5473110 Fbxl21 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2442921 Fbxl21 F-box and leucine-rich repeat protein 21 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7779 + EM:10445 C57BL/6N-Fbxl20/H EMMA sperm mutant strain MGI:4840937 Fbxl20 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919444 Fbxl20 F-box and leucine-rich repeat protein 20 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10445 + EM:08659 C57BL/6N-Fbp2/Ieg EMMA sperm mutant strain MGI:5637205 Fbp2 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:95491 Fbp2 fructose bisphosphatase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8659 + EM:08636 C57BL/6N-Fbp2/Ieg EMMA embryo mutant strain MGI:5511594 Fbp2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:95491 Fbp2 fructose bisphosphatase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8636 ? EM:12385 C57BL/6N-Fbn2/Orl EMMA sperm mutant strain Fbn2 Fbn2 MGI:95490 Fbn2 fibrillin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12385 - EM:09051 C57BL/6N-Farp1/Ph EMMA archived mutant strain MGI:5588287 Farp1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2446173 Farp1 FERM, RhoGEF (Arhgef) and pleckstrin domain protein 1 (chondrocyte-derived) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9051 ? EM:13899 C57BL/6N-Far1/WtsiCnbc EMMA sperm mutant strain MGI:6153339 Far1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914670 Far1 fatty acyl CoA reductase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13899 + EM:09098 C57BL/6N-Fam53b/Ieg EMMA embryo mutant strain MGI:5548690 Fam53b targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1925188 Fam53b family with sequence similarity 53, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9098 + EM:09098 C57BL/6N-Fam53b/Ieg EMMA sperm mutant strain MGI:5548690 Fam53b targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1925188 Fam53b family with sequence similarity 53, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9098 - EM:05447 C57BL/6N-Fam53b/Cnrm EMMA sperm mutant strain MGI:4841848 Fam53b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1925188 Fam53b family with sequence similarity 53, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5447 ? EM:14577 C57BL/6N-Fam50b/WtsiCnbc EMMA sperm mutant strain MGI:6333013 Fam50b endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1351640 Fam50b family with sequence similarity 50, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14577 ? EM:13920 C57BL/6N-Fam234a/WtsiCnbc EMMA sperm mutant strain MGI:6286374 Fam234a endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2146854 Fam234a family with sequence similarity 234, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13920 ? EM:14783 C57BL/6N-Fam219b/WtsiCnbc EMMA sperm mutant strain MGI:6257518 Fam219b endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1925573 Fam219b family with sequence similarity 219, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14783 + EM:09102 C57BL/6N-Fam216a/Ieg EMMA sperm mutant strain MGI:5548573 Fam216a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1916198 Fam216a family with sequence similarity 216, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9102 + EM:08645 C57BL/6N-Fam216a/Ieg EMMA embryo mutant strain MGI:4841879 Fam216a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916198 Fam216a family with sequence similarity 216, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8645 ? EM:14586 C57BL/6N-Fam189b/WtsiCnbc EMMA sperm mutant strain Fam189b CRISPR/CAS9 targeted mutation , Wellcome Trust Sanger Institute MGI:1915771 Entrep3 endosomal transmembrane epsin interactor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14586 ? EM:13711 C57BL/6N-Fam189a1/WtsiOrl EMMA sperm mutant strain Fam189a1 CRISPR/CAS9 targeted mutation , Wellcome Trust Sanger Institute MGI:1917888 Entrep2 endosomal transmembrane epsin interactor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13711 ? EM:14249 C57BL/6N-Fam163a/WtsiOrl EMMA sperm mutant strain MGI:5637187 Fam163a targeted mutation 2b, Wellcome Trust Sanger Institute MGI:3618859 Fam163a family with sequence similarity 163, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14249 + EM:09234 C57BL/6N-Fam162a/Ieg EMMA sperm mutant strain MGI:5613649 Fam162a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1917436 Fam162a family with sequence similarity 162, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9234 + EM:09489 C57BL/6N-Fam162a/Ieg EMMA sperm mutant strain MGI:5289875 Fam162a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917436 Fam162a family with sequence similarity 162, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9489 + EM:14198 C57BL/6N-Fam160a1/WtsiH EMMA live mutant strain MGI:5638570 Fhip1a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2444746 Fhip1a FHF complex subunit HOOK interacting protein 1A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14198 - EM:05426 C57BL/6N-Fam151b/H EMMA sperm B6NTac;B6N-Fam151b/H mutant strain MGI:4455695 Fam151b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921192 Fam151b family with sequence similarity 151, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5426 ? EM:13699 C57BL/6N-Fam13c/WtsiOrl EMMA sperm mutant strain MGI:6281926 Fam13c endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1918971 Fam13c family with sequence similarity 13, member C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13699 + EM:11583 C57BL/6N-Fam13a/WtsiOulu EMMA embryo mutant strain MGI:6140189 Fam13a endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1889842 Fam13a family with sequence similarity 13, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11583 + EM:11583 C57BL/6N-Fam13a/WtsiOulu EMMA sperm mutant strain MGI:6140189 Fam13a endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1889842 Fam13a family with sequence similarity 13, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11583 ? EM:13717 C57BL/6N-Fam133b/WtsiOrl EMMA sperm mutant strain MGI:6153337 Fam133b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1915402 Fam133b family with sequence similarity 133, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13717 ? EM:14346 C57BL/6N-Fam122c/WtsiOrl EMMA sperm mutant strain MGI:5637072 Pabir3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921116 Pabir3 PABIR family member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14346 + EM:13435 C57BL/6N-Fam114a2/WtsiCnrm EMMA live mutant strain MGI:6257503 Fam114a2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1917629 Fam114a2 family with sequence similarity 114, member A2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13435 ? EM:13874 C57BL/6N-Fam111a/WtsiCnbc EMMA sperm mutant strain MGI:6153336 Fam111a endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1915508 Fam111a family with sequence similarity 111, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13874 + EM:13365 C57BL/6N-Fam110c/WtsiCnrm EMMA live mutant strain MGI:6153335 Fam110c endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1918813 Fam110c family with sequence similarity 110, member C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13365 ? EM:13854 C57BL/6N-Fam102b/WtsiCnbc EMMA sperm mutant strain Fam102b CRISPR/CAS9 targeted mutation, Wellcome Trust Sanger Institute MGI:3036259 Eeig2 EEIG family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13854 + EM:10787 C57BL/6N-Fah/Biat EMMA sperm mutant strain MGI:4880346 Fah targeted mutation 1, Mammalian Functional Genomics Centre MGI:95482 Fah fumarylacetoacetate hydrolase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10787 + EM:14540 C57BL/6N-Fads3/WtsiH EMMA live mutant strain MGI:5692754 Fads3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1928740 Fads3 fatty acid desaturase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14540 + EM:04757 C57BL/6N-Fabp1/Cnrm EMMA sperm STOCK Fabp1/Ibcm, STOCK Fabp1/Cnrm, HEPD0538_1_A05 mutant strain MGI:4435668 Fabp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:95479 Fabp1 fatty acid binding protein 1, liver https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4757 - EM:08350 C57BL/6N-F7/H EMMA sperm B6NTac;B6N-F7/H mutant strain MGI:4451755 F7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109325 F7 coagulation factor VII https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8350 - EM:07788 C57BL/6N-F2/H EMMA sperm B6NTac;B6N-F2/H mutant strain MGI:4950199 F2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88380 F2 coagulation factor II https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7788 + EM:06365 C57BL/6N-F10/H EMMA sperm B6NTac;B6N-F10/H mutant strain MGI:4435623 F10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103107 F10 coagulation factor X https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6365 + EM:11069 C57BL/6N-Exph5/Ieg EMMA archived mutant strain MGI:4432491 Exph5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443248 Exph5 exophilin 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11069 + EM:14191 C57BL/6N-Exosc9/WtsiOulu EMMA embryo mutant strain MGI:6278508 Exosc9 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1355319 Exosc9 exosome component 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14191 + EM:14191 C57BL/6N-Exosc9/WtsiOulu EMMA sperm mutant strain MGI:6278508 Exosc9 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1355319 Exosc9 exosome component 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14191 + EM:08249 C57BL/6N-Exoc3l2/WtsiPh EMMA sperm mutant strain MGI:5548646 Exoc3l2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921713 Exoc3l2 exocyst complex component 3-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8249 + EM:14511 C57BL/6N-Exoc3/WtsiPh EMMA live mutant strain MGI:5823225 Exoc3 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2443972 Exoc3 exocyst complex component 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14511 + EM:11576 C57BL/6N-Exo5/WtsiOulu EMMA embryo mutant strain MGI:6140188 Exo5 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1920422 Exo5 exonuclease 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11576 + EM:11576 C57BL/6N-Exo5/WtsiOulu EMMA sperm mutant strain MGI:6140188 Exo5 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1920422 Exo5 exonuclease 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11576 + EM:06361 C57BL/6N-Evl/H EMMA sperm B6NTac;B6N-Evl/H mutant strain MGI:4363092 Evl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1194884 Evl Ena-vasodilator stimulated phosphoprotein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6361 ? EM:13703 C57BL/6N-Etv3/WtsiOrl EMMA sperm mutant strain MGI:6153333 Etv3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1350926 Etv3 ets variant 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13703 + EM:09069 C57BL/6N-Etfdh/Ieg EMMA sperm mutant strain MGI:4451799 Etfdh targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:106100 Etfdh electron transferring flavoprotein, dehydrogenase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9069 + EM:05958 C57BL/6N-Esyt3/H EMMA sperm B6NTac;B6N-Esyt3/H mutant strain MGI:4433605 Esyt3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098699 Esyt3 extended synaptotagmin-like protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5958 + EM:13748 C57BL/6N-Esr1/WtsiIeg EMMA live mutant strain MGI:6333012 Esr1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1352467 Esr1 estrogen receptor 1 (alpha) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13748 ? EM:12658 C57BL/6N-Ern1/Orl EMMA sperm mutant strain Ern1 Ern1 MGI:1930134 Ern1 endoplasmic reticulum (ER) to nucleus signalling 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12658 + EM:13816 C57BL/6N-Ermap/WtsiOulu EMMA embryo mutant strain MGI:6153332 Ermap endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1349816 Ermap erythroblast membrane-associated protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13816 + EM:13816 C57BL/6N-Ermap/WtsiOulu EMMA sperm mutant strain MGI:6153332 Ermap endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1349816 Ermap erythroblast membrane-associated protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13816 ? EM:13919 C57BL/6N-Ergic3/WtsiCnbc EMMA sperm mutant strain MGI:6153331 Ergic3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1913616 Ergic3 ERGIC and golgi 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13919 + EM:10398 C57BL/6N-Eps8l2/H EMMA sperm mutant strain MGI:4842782 Eps8l2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2138828 Eps8l2 EPS8-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10398 + EM:08060 C57BL/6N-Epc2/Ieg EMMA sperm mutant strain MGI:5692601 Epc2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1278321 Epc2 enhancer of polycomb homolog 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8060 - EM:06875 C57BL/6N-Epas1/H EMMA sperm mutant strain MGI:4951065 Epas1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109169 Epas1 endothelial PAS domain protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6875 + EM:14461 C57BL/6N-Epas1/WtsiOulu EMMA embryo mutant strain MGI:6257575 Epas1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:109169 Epas1 endothelial PAS domain protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14461 + EM:14461 C57BL/6N-Epas1/WtsiOulu EMMA sperm mutant strain MGI:6257575 Epas1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:109169 Epas1 endothelial PAS domain protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14461 + EM:12474 C57BL/6N-Ep400/H EMMA live mutant strain MGI:5285739 Ep400 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1276124 Ep400 E1A binding protein p400 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12474 + EM:07133 C57BL/6N-Eomes/H EMMA sperm B6NTac;B6N-Eomes/H mutant strain MGI:5014719 Eomes targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1201683 Eomes eomesodermin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7133 + EM:08058 C57BL/6N-Entpd1/Ieg EMMA sperm mutant strain MGI:5548332 Entpd1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:102805 Entpd1 ectonucleoside triphosphate diphosphohydrolase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8058 + EM:10109 C57BL/6N-Enpep/Ieg EMMA sperm mutant strain MGI:5692565 Enpep targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106645 Enpep glutamyl aminopeptidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10109 ? EM:05492 C57BL/6N-Emp3/Ieg EMMA embryo mutant strain Emp3 Emp3 MGI:1098729 Emp3 epithelial membrane protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5492 ? EM:05493 C57BL/6N-Emp3/Ieg EMMA embryo mutant strain Emp3 Emp3 MGI:1098729 Emp3 epithelial membrane protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5493 ? EM:12914 C57BL/6N-Eml1/Orl EMMA sperm mutant strain MGI:6473556 Eml1 targeted mutation 1.2, Mouse Clinical Institute MGI:1915769 Eml1 echinoderm microtubule associated protein like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12914 + EM:11887 C57BL/6N-Eml1/WtsiH EMMA sperm mutant strain MGI:6153330 Eml1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1915769 Eml1 echinoderm microtubule associated protein like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11887 + EM:11886 C57BL/6N-Emcn/WtsiH EMMA sperm mutant strain MGI:6153329 Emcn endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891716 Emcn endomucin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11886 + EM:09459 C57BL/6N-Emc8/H EMMA sperm mutant strain MGI:4942045 Emc8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1343095 Emc8 ER membrane protein complex subunit 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9459 + EM:09515 C57BL/6N-Emc3/Ieg EMMA sperm mutant strain MGI:5629314 Emc3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913337 Emc3 ER membrane protein complex subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9515 + EM:08639 C57BL/6N-Emc3/Ieg EMMA sperm mutant strain MGI:4453751 Emc3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913337 Emc3 ER membrane protein complex subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8639 - EM:05151 C57BL/6N-Emc10/H EMMA sperm EPD0370_7_E10, 2310044H10Rik, B6NTac;B6N-Emc10/H mutant strain MGI:4432030 Emc10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916933 Emc10 ER membrane protein complex subunit 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5151 + EM:08281 C57BL/6N-Elovl6/H EMMA sperm mutant strain MGI:5008866 Elovl6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2156528 Elovl6 ELOVL family member 6, elongation of long chain fatty acids (yeast) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8281 + EM:09655 C57BL/6N-Elmod2/H EMMA sperm mutant strain MGI:4436007 Elmod2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2445165 Elmod2 ELMO/CED-12 domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9655 + EM:04834 C57BL/6N-Elmod1/H EMMA sperm B6NTac;B6N-Elmod1/H mutant strain MGI:4435771 Elmod1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3583900 Elmod1 ELMO/CED-12 domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4834 + EM:10198 C57BL/6N-Ell2/WtsiCnrm EMMA sperm mutant strain MGI:5548782 Ell2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2183438 Ell2 elongation factor for RNA polymerase II 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10198 + EM:14447 C57BL/6N-Elf4/WtsiOulu EMMA embryo mutant strain MGI:6153328 Elf4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1928377 Elf4 E74-like factor 4 (ets domain transcription factor) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14447 + EM:14447 C57BL/6N-Elf4/WtsiOulu EMMA sperm mutant strain MGI:6153328 Elf4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1928377 Elf4 E74-like factor 4 (ets domain transcription factor) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14447 ? EM:13457 C57BL/6N-Elac2/WtsiBiat EMMA sperm unclassified MGI:6357902 Elac2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1890496 Elac2 elaC ribonuclease Z 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13457 + EM:14505 C57BL/6N-Elac2/WtsiH EMMA live mutant strain MGI:5637003 Elac2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1890496 Elac2 elaC ribonuclease Z 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14505 + EM:08666 C57BL/6N-Eif2b3/H EMMA sperm mutant strain MGI:4951025 Eif2b3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1313286 Eif2b3 eukaryotic translation initiation factor 2B, subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8666 + EM:14304 C57BL/6N-Ehmt1/WtsiH EMMA live mutant strain MGI:5605800 Ehmt1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1924933 Ehmt1 euchromatic histone methyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14304 + EM:13820 C57BL/6N-Ehd2/WtsiOulu EMMA embryo mutant strain MGI:6153327 Ehd2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2154274 Ehd2 EH-domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13820 + EM:13820 C57BL/6N-Ehd2/WtsiOulu EMMA sperm mutant strain MGI:6153327 Ehd2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2154274 Ehd2 EH-domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13820 ? EM:13840 C57BL/6N-Efr3a/WtsiCnbc EMMA sperm mutant strain MGI:6153326 Efr3a endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1923990 Efr3a EFR3 homolog A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13840 + EM:07920 C57BL/6N-Efna5/Ieg EMMA embryo mutant strain MGI:5548373 Efna5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107444 Efna5 ephrin A5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7920 + EM:05548 C57BL/6N-Efna5/Ieg EMMA embryo B6NTac;B6N-Efna5/Ieg mutant strain MGI:4441837 Efna5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107444 Efna5 ephrin A5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5548 ? EM:14554 C57BL/6N-Efcab3/WtsiCnbc EMMA sperm mutant strain MGI:6153325 Efcab3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1918144 Efcab3 EF-hand calcium binding domain 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14554 ? EM:13700 C57BL/6N-Efcab12/WtsiOrl EMMA sperm mutant strain MGI:6281934 Efcab12 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2681834 Efcab12 EF-hand calcium binding domain 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13700 + EM:11032 C57BL/6N-Eea1/Ieg EMMA sperm mutant strain MGI:5085379 Eea1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2442192 Eea1 early endosome antigen 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11032 + EM:11089 C57BL/6N-Edem2/H EMMA sperm mutant strain MGI:4841551 Edem2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915540 Edem2 ER degradation enhancer, mannosidase alpha-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11089 - EM:08186 C57BL/6N-Ecm1/H EMMA sperm B6NTac;B6N-Ecm1/H mutant strain MGI:4452742 Ecm1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103060 Ecm1 extracellular matrix protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8186 + EM:07625 C57BL/6N-Eci3/WtsiCnrm EMMA sperm mutant strain MGI:5548579 Eci3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916373 Eci3 enoyl-Coenzyme A delta isomerase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7625 - EM:09054 C57BL/6N-Eci2/Ph EMMA sperm mutant strain MGI:5588272 Eci2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1346064 Eci2 enoyl-Coenzyme A delta isomerase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9054 ? EM:13704 C57BL/6N-Echdc2/WtsiOrl EMMA sperm mutant strain MGI:6153720 Echdc2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1289238 Echdc2 enoyl Coenzyme A hydratase domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13704 + EM:10129 C57BL/6N-Ech1/Ieg EMMA sperm mutant strain MGI:5692640 Ech1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1858208 Ech1 enoyl coenzyme A hydratase 1, peroxisomal https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10129 + EM:09633 C57BL/6N-Ech1/Ieg EMMA archived mutant strain MGI:4433635 Ech1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858208 Ech1 enoyl coenzyme A hydratase 1, peroxisomal https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9633 + EM:05534 C57BL/6N-Eaf1/H EMMA sperm AF1(E07), B6NTac;B6N-Eaf1/H mutant strain MGI:4433402 Eaf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921677 Eaf1 ELL associated factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5534 ? EM:14796 C57BL/6N-Dyrk2/Ics EMMA sperm mutant strain MGI:6336070 Dyrk2 endonuclease-mediated mutation 1, Mouse Clinical Institute MGI:1330301 Dyrk2 dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14796 ? EM:14220 C57BL/6N-Dynlt2b/WtsiOrl EMMA sperm mutant strain MGI:5708198 Dynlt2b targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1913311 Dynlt2b dynein light chain Tctex-type 2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14220 + EM:13374 C57BL/6N-Dusp14/WtsiCnrm EMMA live mutant strain MGI:6153324 Dusp14 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1927168 Dusp14 dual specificity phosphatase 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13374 ? EM:14141 C57BL/6N-Dus2/WtsiIeg EMMA sperm mutant strain MGI:6120729 Dus2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913619 Dus2 dihydrouridine synthase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14141 + EM:13391 C57BL/6N-Duoxa2/WtsiCnrm EMMA live mutant strain MGI:5637016 Duoxa2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914061 Duoxa2 dual oxidase maturation factor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13391 + EM:13844 C57BL/6N-Dtwd2/WtsiOulu EMMA embryo mutant strain MGI:6281921 Dtwd2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1916107 Dtwd2 DTW domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13844 + EM:13844 C57BL/6N-Dtwd2/WtsiOulu EMMA sperm mutant strain MGI:6281921 Dtwd2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1916107 Dtwd2 DTW domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13844 + EM:12833 C57BL/6N-Dse/H EMMA live mutant strain MGI:6314263 Dse targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2443455 Dse dermatan sulfate epimerase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12833 + EM:12642 C57BL/6N-Dse/H EMMA live mutant strain MGI:4941523 Dse targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443455 Dse dermatan sulfate epimerase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12642 + EM:10454 C57BL/6N-Dsc3/H EMMA sperm mutant strain MGI:4461753 Dsc3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1194993 Dsc3 desmocollin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10454 + EM:09095 C57BL/6N-Dpp9/Ieg EMMA embryo mutant strain MGI:5548821 Dpp9 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2443967 Dpp9 dipeptidylpeptidase 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9095 - EM:04611 C57BL/6N-Dpp9/Cnrm EMMA embryo mutant strain MGI:4435737 Dpp9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443967 Dpp9 dipeptidylpeptidase 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4611 - EM:04611 C57BL/6N-Dpp9/Cnrm EMMA sperm mutant strain MGI:4435737 Dpp9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443967 Dpp9 dipeptidylpeptidase 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4611 ? EM:13659 C57BL/6N-Dpm1/WtsiH EMMA sperm mutant strain MGI:5636953 Dpm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1330239 Dpm1 dolichol-phosphate (beta-D) mannosyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13659 ? EM:14589 C57BL/6N-Dph7/WtsiCnbc EMMA sperm mutant strain MGI:6153323 Dph7 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914478 Dph7 diphthamine biosynethesis 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14589 + EM:13549 C57BL/6N-Dph5/WtsiKieg EMMA live mutant strain MGI:6153322 Dph5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1916990 Dph5 diphthamide biosynthesis 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13549 ? EM:13777 C57BL/6N-Dpep1/WtsiIeg EMMA sperm mutant strain MGI:6314736 Dpep1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:94917 Dpep1 dipeptidase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13777 + EM:04723 C57BL/6N-Dock10/Ieg EMMA embryo B6NTac;B6N-Dock10/Ieg mutant strain MGI:4436497 Dock10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2146320 Dock10 dedicator of cytokinesis 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4723 + EM:11328 C57BL/6N-Dnmt3l/Ieg EMMA sperm mutant strain MGI:5497107 Dnmt3l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1859287 Dnmt3l DNA (cytosine-5-)-methyltransferase 3-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11328 + EM:08394 C57BL/6N-Dner/Ieg EMMA sperm mutant strain MGI:5637119 Dner targeted mutation 3b, Helmholtz Zentrum Muenchen GmbH MGI:2152889 Dner delta/notch-like EGF repeat containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8394 - EM:04963 C57BL/6N-Dnase2b/H EMMA sperm mutant strain MGI:4435602 Dnase2b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913283 Dnase2b deoxyribonuclease II beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4963 + EM:08574 C57BL/6N-Dnase1l2/WtsiH EMMA sperm mutant strain MGI:5501065 Dnase1l2 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1913955 Dnase1l2 deoxyribonuclease 1-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8574 + EM:13407 C57BL/6N-Dnajc8/WtsiCnrm EMMA live mutant strain MGI:5637033 Dnajc8 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915848 Dnajc8 DnaJ heat shock protein family (Hsp40) member C8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13407 + EM:09349 C57BL/6N-Dnajc27/Ieg EMMA sperm mutant strain MGI:5614706 Dnajc27 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2443036 Dnajc27 DnaJ heat shock protein family (Hsp40) member C27 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9349 + EM:08627 C57BL/6N-Dnajc27/Ieg EMMA embryo mutant strain MGI:5444912 Dnajc27 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443036 Dnajc27 DnaJ heat shock protein family (Hsp40) member C27 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8627 ? EM:13903 C57BL/6N-Dnajc24/WtsiCnbc EMMA sperm mutant strain MGI:6153321 Dnajc24 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919522 Dnajc24 DnaJ heat shock protein family (Hsp40) member C24 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13903 ? EM:14545 C57BL/6N-Dnajc1/WtsiCnbc EMMA sperm mutant strain MGI:6153320 Dnajc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:103268 Dnajc1 DnaJ heat shock protein family (Hsp40) member C1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14545 + EM:04754 C57BL/6N-Dnajc19/H EMMA sperm B6NTac;B6N-Dnajc19/H mutant strain MGI:4435205 Dnajc19 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914963 Dnajc19 DnaJ heat shock protein family (Hsp40) member C19 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4754 + EM:07581 C57BL/6N-Dnajc17/Ieg EMMA embryo mutant strain MGI:5548585 Dnajc17 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1916658 Dnajc17 DnaJ heat shock protein family (Hsp40) member C17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7581 + EM:13379 C57BL/6N-Dnajb9/WtsiCnrm EMMA live mutant strain MGI:6153319 Dnajb9 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1351618 Dnajb9 DnaJ heat shock protein family (Hsp40) member B9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13379 + EM:09351 C57BL/6N-Dnajb11/Ieg EMMA sperm mutant strain MGI:5614700 Dnajb11 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915088 Dnajb11 DnaJ heat shock protein family (Hsp40) member B11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9351 + EM:09265 C57BL/6N-Dnajb11/Ieg EMMA sperm mutant strain MGI:5050997 Dnajb11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915088 Dnajb11 DnaJ heat shock protein family (Hsp40) member B11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9265 + EM:13431 C57BL/6N-Dmbt1/WtsiCnrm EMMA live mutant strain MGI:6153318 Dmbt1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:106210 Dmbt1 deleted in malignant brain tumors 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13431 + EM:09085 C57BL/6N-Dmac2l/H EMMA sperm C57BL/6N-Atp5s/H mutant strain MGI:4456684 Dmac2l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915305 Dmac2l distal membrane arm assembly complex 2 like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9085 + EM:11209 C57BL/6N-Dlk1/WtsiIeg EMMA sperm mutant strain MGI:6140187 Dlk1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:94900 Dlk1 delta like non-canonical Notch ligand 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11209 + EM:14201 C57BL/6N-Dlgap4/WtsiOulu EMMA embryo mutant strain MGI:5796936 Dlgap4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2138865 Dlgap4 DLG associated protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14201 + EM:14201 C57BL/6N-Dlgap4/WtsiOulu EMMA sperm mutant strain MGI:5796936 Dlgap4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2138865 Dlgap4 DLG associated protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14201 + EM:08056 C57BL/6N-Dlec1/Ieg EMMA embryo mutant strain MGI:5548818 Dlec1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443671 Dlec1 deleted in lung and esophageal cancer 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8056 + EM:08751 C57BL/6N-Dis3/Ieg EMMA sperm mutant strain MGI:5548623 Dis3 targeted mutation 1e.1, Helmholtz Zentrum Muenchen GmbH MGI:1919912 Dis3 DIS3 homolog, exosome endoribonuclease and 3'-5' exoribonuclease https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8751 + EM:07437 C57BL/6N-Dis3/Ieg EMMA embryo B6NTac;B6N-Dis3/Ieg mutant strain MGI:4820203 Dis3 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1919912 Dis3 DIS3 homolog, exosome endoribonuclease and 3'-5' exoribonuclease https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7437 ? EM:14342 C57BL/6N-Dip2a/WtsiIeg EMMA sperm mutant strain MGI:5548794 Dip2a targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2385920 Dip2a disco interacting protein 2 homolog A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14342 + EM:08289 C57BL/6N-Dicer1/H EMMA sperm mutant strain MGI:4461668 Dicer1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2177178 Dicer1 dicer 1, ribonuclease type III https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8289 + EM:12753 C57BL/6N-Dhx9/Ieg EMMA sperm mutant strain MGI:4434665 Dhx9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108177 Dhx9 DEAH (Asp-Glu-Ala-His) box polypeptide 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12753 + EM:14263 C57BL/6N-Dhx35/WtsiH EMMA live mutant strain MGI:5637055 Dhx35 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1918965 Dhx35 DEAH (Asp-Glu-Ala-His) box polypeptide 35 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14263 ? EM:14167 C57BL/6N-Dhx33/WtsiIeg EMMA sperm mutant strain MGI:5637153 Dhx33 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2445102 Dhx33 DEAH (Asp-Glu-Ala-His) box polypeptide 33 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14167 + EM:11589 C57BL/6N-Dhrs7c/WtsiOulu EMMA embryo mutant strain MGI:6140186 Dhrs7c endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1915710 Dhrs7c dehydrogenase/reductase (SDR family) member 7C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11589 + EM:11589 C57BL/6N-Dhrs7c/WtsiOulu EMMA sperm mutant strain MGI:6140186 Dhrs7c endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1915710 Dhrs7c dehydrogenase/reductase (SDR family) member 7C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11589 + EM:14341 C57BL/6N-Dhodh/WtsiH EMMA live mutant strain MGI:5548703 Dhodh targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1928378 Dhodh dihydroorotate dehydrogenase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14341 + EM:09233 C57BL/6N-Dhdds/Ieg EMMA sperm mutant strain MGI:5613645 Dhdds targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914672 Dhdds dehydrodolichyl diphosphate synthase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9233 + EM:13815 C57BL/6N-Dffb/WtsiOulu EMMA embryo mutant strain MGI:6153316 Dffb endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1196287 Dffb DNA fragmentation factor, beta subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13815 + EM:13815 C57BL/6N-Dffb/WtsiOulu EMMA sperm mutant strain MGI:6153316 Dffb endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1196287 Dffb DNA fragmentation factor, beta subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13815 ? EM:13664 C57BL/6N-Deptor/WtsiIeg EMMA sperm mutant strain MGI:5812922 Deptor targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2146322 Deptor DEP domain containing MTOR-interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13664 ? EM:14333 C57BL/6N-Depdc7/WtsiOrl EMMA sperm mutant strain MGI:5823223 Depdc7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2139258 Depdc7 DEP domain containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14333 + EM:10459 C57BL/6N-Depdc5/H EMMA sperm mutant strain MGI:5752552 Depdc5 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:2141101 Depdc5 DEP domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10459 + EM:08844 C57BL/6N-Depdc5/H EMMA sperm mutant strain MGI:5013779 Depdc5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2141101 Depdc5 DEP domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8844 ? EM:14499 C57BL/6N-Denr/WtsiOrl EMMA sperm mutant strain MGI:5637029 Denr targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915434 Denr density-regulated protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14499 ? EM:14227 C57BL/6N-Dennd4c/WtsiCnbc EMMA archived mutant strain MGI:5637024 Dennd4c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914769 Dennd4c DENN domain containing 4C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14227 + EM:10197 C57BL/6N-Dennd1c/WtsiCnrm EMMA sperm mutant strain MGI:5548604 Dennd1c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1918035 Dennd1c DENN domain containing 1C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10197 ? EM:14682 C57BL/6N-Del(6Tmem176b-Tmem176a)1Ced/Orl EMMA sperm mutant strain MGI:6828965 Del(6Tmem176b-Tmem176a)1Ced deletion, Chr 6, Cedric Louvet 1 MGI:6828967 Del(6Tmem176b-Tmem176a)1Ced deletion, Chr 6, Cedric Louvet 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14682 ? EM:14291 C57BL/6N-Defb30/WtsiIeg EMMA sperm mutant strain MGI:5637070 Defb30 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1920920 Defb30 defensin beta 30 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14291 ? EM:14158 C57BL/6N-Defb14/WtsiCnbc EMMA archived mutant strain MGI:5637165 Defb14 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2675345 Defb14 defensin beta 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14158 + EM:08112 C57BL/6N-Decr2/Ieg EMMA sperm mutant strain MGI:5548465 Decr2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1347059 Decr2 2-4-dienoyl-Coenzyme A reductase 2, peroxisomal https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8112 + EM:06919 C57BL/6N-Decr2/Ieg EMMA embryo mutant strain MGI:4460423 Decr2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1347059 Decr2 2-4-dienoyl-Coenzyme A reductase 2, peroxisomal https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6919 ? EM:14135 C57BL/6N-Ddx42/WtsiIeg EMMA sperm mutant strain MGI:5637061 Ddx42 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919297 Ddx42 DEAD box helicase 42 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14135 ? EM:14578 C57BL/6N-Ddx23/WtsiPh EMMA sperm mutant strain MGI:6153315 Ddx23 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921601 Ddx23 DEAD box helicase 23 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14578 + EM:08393 C57BL/6N-Ddx1/Cnrm EMMA sperm mutant strain MGI:5569068 Ddx1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2144727 Ddx1 DEAD box helicase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8393 + EM:08387 C57BL/6N-Ddx1/Cnrm EMMA sperm mutant strain MGI:4455792 Ddx1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2144727 Ddx1 DEAD box helicase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8387 + EM:11575 C57BL/6N-Dcun1d3/WtsiIeg EMMA sperm mutant strain MGI:6140185 Dcun1d3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2679003 Dcun1d3 DCN1, defective in cullin neddylation 1, domain containing 3 (S. cerevisiae) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11575 + EM:11149 C57BL/6N-Dcn/WtsiOulu EMMA embryo mutant strain MGI:6140184 Dcn endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:94872 Dcn decorin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11149 + EM:11149 C57BL/6N-Dcn/WtsiOulu EMMA sperm mutant strain MGI:6140184 Dcn endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:94872 Dcn decorin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11149 ? EM:14292 C57BL/6N-Dcdc2b/WtsiIeg EMMA sperm mutant strain MGI:5637175 Dcdc2b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2686212 Dcdc2b doublecortin domain containing 2b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14292 + EM:09623 C57BL/6N-Dbn1/WtsiOulu EMMA embryo mutant strain MGI:5501061 Dbn1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1931838 Dbn1 drebrin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9623 + EM:09623 C57BL/6N-Dbn1/WtsiOulu EMMA sperm mutant strain MGI:5501061 Dbn1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1931838 Dbn1 drebrin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9623 + EM:08114 C57BL/6N-Dbn1/Ieg EMMA embryo mutant strain MGI:5501061 Dbn1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1931838 Dbn1 drebrin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8114 + EM:13454 C57BL/6N-Dars/WtsiCnrm EMMA live mutant strain MGI:6281944 Dars endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2442544 Dars aspartyl-tRNA synthetase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13454 + EM:13389 C57BL/6N-Dapk2/WtsiCnrm EMMA live mutant strain MGI:5636971 Dapk2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1341297 Dapk2 death-associated protein kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13389 ? EM:14235 C57BL/6N-Dact3/WtsiIeg EMMA sperm mutant strain MGI:5637190 Dact3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3654828 Dact3 dishevelled-binding antagonist of beta-catenin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14235 + EM:08284 C57BL/6N-Daam1/H EMMA sperm mutant strain MGI:5000343 Daam1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914596 Daam1 dishevelled associated activator of morphogenesis 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8284 ? EM:14148 C57BL/6N-D630023F18Rik/WtsiIeg EMMA sperm mutant strain MGI:5637108 D630023F18Rik targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2138198 D630023F18Rik RIKEN cDNA D630023F18 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14148 - EM:04901 C57BL/6N-D430041D05Rik/H EMMA sperm mutant strain MGI:4435522 D430041D05Rik targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2181743 D430041D05Rik RIKEN cDNA D430041D05 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4901 + EM:09297 C57BL/6N-Cystm1/Ieg EMMA embryo mutant strain MGI:5548508 Cystm1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1913310 Cystm1 cysteine-rich transmembrane module containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9297 + EM:09297 C57BL/6N-Cystm1/Ieg EMMA sperm mutant strain MGI:5548508 Cystm1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1913310 Cystm1 cysteine-rich transmembrane module containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9297 + EM:08598 C57BL/6N-Cystm1/Ieg EMMA embryo mutant strain MGI:5299828 Cystm1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913310 Cystm1 cysteine-rich transmembrane module containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8598 + EM:08598 C57BL/6N-Cystm1/Ieg EMMA sperm mutant strain MGI:5299828 Cystm1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913310 Cystm1 cysteine-rich transmembrane module containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8598 + EM:10117 C57BL/6N-Cyp7a1/Ieg EMMA sperm mutant strain MGI:5692562 Cyp7a1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106091 Cyp7a1 cytochrome P450, family 7, subfamily a, polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10117 + EM:09086 C57BL/6N-Cyp7a1/Ieg EMMA embryo mutant strain MGI:4433062 Cyp7a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106091 Cyp7a1 cytochrome P450, family 7, subfamily a, polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9086 + EM:11757 C57BL/6N-Cyp4f18/WtsiCnrm EMMA sperm mutant strain MGI:6152734 Cyp4f18 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919304 Cyp4f18 cytochrome P450, family 4, subfamily f, polypeptide 18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11757 + EM:09226 C57BL/6N-Cyp4f14/Ieg EMMA sperm mutant strain MGI:5613654 Cyp4f14 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1927669 Cyp4f14 cytochrome P450, family 4, subfamily f, polypeptide 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9226 + EM:07997 C57BL/6N-Cyp4f14/Ieg EMMA embryo B6NTac;B6N-Cyp4f14/Ieg mutant strain MGI:5299832 Cyp4f14 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1927669 Cyp4f14 cytochrome P450, family 4, subfamily f, polypeptide 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7997 + EM:08655 C57BL/6N-Cyp4b1/Ieg EMMA sperm mutant strain MGI:5548340 Cyp4b1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:103225 Cyp4b1 cytochrome P450, family 4, subfamily b, polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8655 + EM:07622 C57BL/6N-Cyp2r1/WtsiCnrm EMMA sperm mutant strain MGI:5548842 Cyp2r1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2449771 Cyp2r1 cytochrome P450, family 2, subfamily r, polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7622 - EM:06364 C57BL/6N-Cyp2e1/H EMMA sperm B6NTac;B6N-Cyp2e1/H mutant strain MGI:4419612 Cyp2e1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88607 Cyp2e1 cytochrome P450, family 2, subfamily e, polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6364 + EM:08674 C57BL/6N-Cyp2b13/Wtsi EMMA archived mutant strain MGI:5637203 Cyp2b13 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:88599 Cyp2b13 cytochrome P450, family 2, subfamily b, polypeptide 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8674 + EM:11432 C57BL/6N-Cyp19a1/H EMMA live mutant strain MGI:4455643 Cyp19a1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88587 Cyp19a1 cytochrome P450, family 19, subfamily a, polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11432 + EM:14317 C57BL/6N-Cyp11a1/WtsiH EMMA live mutant strain MGI:5692883 Cyp11a1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:88582 Cyp11a1 cytochrome P450, family 11, subfamily a, polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14317 + EM:08379 C57BL/6N-Cybrd1/H EMMA sperm mutant strain MGI:4435546 Cybrd1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2654575 Cybrd1 cytochrome b reductase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8379 + EM:07096 C57BL/6N-Cybb/H EMMA sperm B6NTac;B6N-Cybb/H mutant strain MGI:4847712 Cybb targeted mutation 2a, Wellcome Trust Sanger Institute MGI:88574 Cybb cytochrome b-245, beta polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7096 + EM:13539 C57BL/6N-Cyba/WtsiKieg EMMA embryo mutant strain MGI:6157266 Cyba targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1316658 Cyba cytochrome b-245, alpha polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13539 + EM:13539 C57BL/6N-Cyba/WtsiKieg EMMA sperm mutant strain MGI:6157266 Cyba targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1316658 Cyba cytochrome b-245, alpha polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13539 + EM:05654 C57BL/6N-Cyb5r2/H EMMA sperm B6NTac;B6N-Cyb5r2/H mutant strain MGI:4455692 Cyb5r2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444415 Cyb5r2 cytochrome b5 reductase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5654 + EM:09303 C57BL/6N-Cyb561a3/Ieg EMMA sperm mutant strain MGI:5588290 Cyb561a3 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2686925 Cyb561a3 cytochrome b561 family, member A3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9303 + EM:08010 C57BL/6N-Cyb561a3/Ieg EMMA embryo B6NTac;B6N-Cyb561a3/Ieg mutant strain MGI:5511778 Cyb561a3 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2686925 Cyb561a3 cytochrome b561 family, member A3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8010 + EM:09810 C57BL/6N-Cyb561/Cnrm EMMA sperm C57BL/6N-Cyb561/Cnrm mutant strain MGI:5659999 Cyb561 targeted mutation 1, Wellcome Trust Sanger Institute MGI:103253 Cyb561 cytochrome b-561 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9810 - EM:07876 C57BL/6N-Cxcl9/H EMMA sperm B6NTac;B6N-Cxcl9/H mutant strain MGI:4944537 Cxcl9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1352449 Cxcl9 chemokine (C-X-C motif) ligand 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7876 ? EM:14421 C57BL/6N-Cttnbp2/WtsiIeg EMMA sperm mutant strain MGI:5636986 Cttnbp2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1353467 Cttnbp2 cortactin binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14421 - EM:05421 C57BL/6N-Cttn/H EMMA sperm B6NTac;B6N-Cttn/H mutant strain MGI:4435642 Cttn targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99695 Cttn cortactin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5421 - EM:05956 C57BL/6N-Ctso/Cnrm EMMA sperm mutant strain MGI:4841300 Ctso targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2139628 Ctso cathepsin O https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5956 + EM:11345 C57BL/6N-Ctrc/Ieg EMMA sperm mutant strain MGI:4436084 Ctrc targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923951 Ctrc chymotrypsin C (caldecrin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11345 ? EM:14246 C57BL/6N-Ctr9/WtsiIeg EMMA sperm mutant strain MGI:5548390 Ctr9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:109345 Ctr9 CTR9 homolog, Paf1/RNA polymerase II complex component https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14246 + EM:06931 C57BL/6N-Ctnnbip1/H EMMA sperm B6NTac;B6N-Ctnnbip1/H mutant strain MGI:4441623 Ctnnbip1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915756 Ctnnbip1 catenin beta interacting protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6931 + EM:09267 C57BL/6N-Cth/Ieg EMMA sperm mutant strain MGI:5614698 Cth targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1339968 Cth cystathionase (cystathionine gamma-lyase) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9267 + EM:09452 C57BL/6N-Ctdsp1/H EMMA sperm mutant strain MGI:5008023 Ctdsp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2654470 Ctdsp1 CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) small phosphatase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9452 + EM:10116 C57BL/6N-Ctc1/Ieg EMMA sperm mutant strain MGI:5692690 Ctc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916214 Ctc1 CTS telomere maintenance complex component 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10116 + EM:10068 C57BL/6N-Ctc1/Ieg EMMA sperm mutant strain MGI:4363331 Ctc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916214 Ctc1 CTS telomere maintenance complex component 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10068 + EM:13368 C57BL/6N-Ct55/WtsiCnrm EMMA live mutant strain MGI:6153265 Ct55 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1922263 Ct55 cancer/testis antigen 55 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13368 + EM:09225 C57BL/6N-Cstf3/Ieg EMMA sperm mutant strain MGI:5613641 Cstf3 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1351825 Cstf3 cleavage stimulation factor, 3' pre-RNA, subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9225 + EM:08001 C57BL/6N-Cstf3/Ieg EMMA embryo B6NTac;B6N-Cstf3/Ieg mutant strain MGI:5511779 Cstf3 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1351825 Cstf3 cleavage stimulation factor, 3' pre-RNA, subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8001 + EM:14334 C57BL/6N-Cstdc1/WtsiOulu EMMA embryo mutant strain MGI:5701725 Cstdc1 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1925859 Cstdc1 cystatin domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14334 + EM:14334 C57BL/6N-Cstdc1/WtsiOulu EMMA sperm mutant strain MGI:5701725 Cstdc1 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1925859 Cstdc1 cystatin domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14334 + EM:09224 C57BL/6N-Csnk1g2/Ieg EMMA sperm mutant strain MGI:5613652 Csnk1g2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1920014 Csnk1g2 casein kinase 1, gamma 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9224 + EM:08003 C57BL/6N-Csnk1g2/Ieg EMMA embryo B6NTac;B6N-Csnk1g2/Ieg mutant strain MGI:5014700 Csnk1g2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920014 Csnk1g2 casein kinase 1, gamma 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8003 + EM:11208 C57BL/6N-Csmd1/WtsiIeg EMMA sperm mutant strain MGI:6140182 Csmd1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2137383 Csmd1 CUB and Sushi multiple domains 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11208 ? EM:14591 C57BL/6N-Csf2ra/WtsiCnbc EMMA sperm mutant strain MGI:6153313 Csf2ra endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1339754 Csf2ra colony stimulating factor 2 receptor, alpha, low-affinity (granulocyte-macrophage) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14591 ? EM:14322 C57BL/6N-Csf2/WtsiOrl EMMA sperm mutant strain Csf2 KOMP targeted mutation 1b, Mouse Biology Program, UCDavis MGI:1339752 Csf2 colony stimulating factor 2 (granulocyte-macrophage) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14322 + EM:09268 C57BL/6N-Cs/Ieg EMMA sperm mutant strain MGI:5614712 Cs targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:88529 Cs citrate synthase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9268 + EM:08722 C57BL/6N-Cs/Ieg EMMA embryo mutant strain MGI:4843824 Cs targeted mutation 1, Wellcome Trust Sanger Institute MGI:88529 Cs citrate synthase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8722 + EM:11175 C57BL/6N-Cryge/H EMMA live mutant strain MGI:4840577 Cryge targeted mutation 2a, Wellcome Trust Sanger Institute MGI:88525 Cryge crystallin, gamma E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11175 + EM:10213 C57BL/6N-Cryba1/Cnrm EMMA sperm mutant strain MGI:5811746 Cryba1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:88518 Cryba1 crystallin, beta A1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10213 ? EM:13865 C57BL/6N-Crnn/WtsiCnbc EMMA sperm mutant strain MGI:6153312 Crnn endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2685861 Crnn cornulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13865 + EM:11159 C57BL/6N-Crlf3/WtsiH EMMA sperm mutant strain MGI:6140181 Crlf3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1860086 Crlf3 cytokine receptor-like factor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11159 + EM:13377 C57BL/6N-Crip1/WtsiCnrm EMMA live mutant strain MGI:6153311 Crip1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:88501 Crip1 cysteine-rich protein 1 (intestinal) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13377 + EM:10449 C57BL/6N-Creld2/H EMMA sperm mutant strain MGI:5751156 Creld2 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1923987 Creld2 cysteine-rich with EGF-like domains 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10449 - EM:05482 C57BL/6N-Creld2/H EMMA sperm B6NTac;B6N-Creld2/H mutant strain MGI:4435724 Creld2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923987 Creld2 cysteine-rich with EGF-like domains 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5482 + EM:09621 C57BL/6N-Crct1/Cnrm EMMA sperm C57BL/6N-Crct1/Cnrm mutant strain MGI:5659998 Crct1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1921425 Crct1 cysteine-rich C-terminal 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9621 + EM:11129 C57BL/6N-Crb2/WtsiH EMMA sperm mutant strain MGI:5775005 Crb2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:2679260 Crb2 crumbs family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11129 ? EM:14290 C57BL/6N-Cracdl/WtsiOrl EMMA sperm mutant strain MGI:5637062 Cracdl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919347 Cracdl capping protein inhibiting regulator of actin like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14290 + EM:13533 C57BL/6N-Cpt2/WtsiKieg EMMA embryo mutant strain MGI:5636913 Cpt2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:109176 Cpt2 carnitine palmitoyltransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13533 + EM:13533 C57BL/6N-Cpt2/WtsiKieg EMMA sperm mutant strain MGI:5636913 Cpt2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:109176 Cpt2 carnitine palmitoyltransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13533 ? EM:13412 C57BL/6N-Cpt1a/WtsiCnrm EMMA live mutant strain Cpt1a undef targeted mutation , Wellcome Trust Sanger Institute MGI:1098296 Cpt1a carnitine palmitoyltransferase 1a, liver https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13412 + EM:07860 C57BL/6N-Cpsf3/WtsiCnrm EMMA sperm mutant strain MGI:5548494 Cpsf3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1859328 Cpsf3 cleavage and polyadenylation specificity factor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7860 ? EM:14133 C57BL/6N-Cpgi81/WtsiIeg EMMA sperm mutant strain Cpgi81 undef targeted mutation , William C. Skarnes MGI:5665212 Cpgi81 CpG island 81 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14133 ? EM:14208 C57BL/6N-Cpgi5563/WtsiIeg EMMA sperm mutant strain MGI:6359756 Cpgi5563 targeted mutation 1.1, William C Skarnes MGI:5670665 Cpgi5563 CpG island 5563 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14208 ? EM:14332 C57BL/6N-Cpgi5176/WtsiIeg EMMA sperm mutant strain Cpgi5176 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:5670278 Cpgi5176 CpG island 5176 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14332 ? EM:14425 C57BL/6N-Cpgi399/WtsiIeg EMMA sperm mutant strain Cpgi399 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:5665530 Cpgi399 CpG island 399 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14425 ? EM:14223 C57BL/6N-Cpgi23001/WtsiIeg EMMA sperm mutant strain Cpgi23001 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:5688069 Cpgi23001 CpG island 23001 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14223 ? EM:14414 C57BL/6N-Cpgi15497/WtsiIeg EMMA sperm mutant strain Cpgi15497 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:5680577 Cpgi15497 CpG island 15497 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14414 ? EM:14315 C57BL/6N-Cpgi15344/WtsiIeg EMMA sperm mutant strain Cpgi15344 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:5680424 Cpgi15344 CpG island 15344 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14315 ? EM:14209 C57BL/6N-Cpgi15342/WtsiIeg EMMA sperm mutant strain Cpgi15342 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:5680422 Cpgi15342 CpG island 15342 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14209 ? EM:14270 C57BL/6N-Cpgi13569/WtsiIeg EMMA sperm mutant strain Cpgi13569 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:5678653 Cpgi13569 CpG island 13569 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14270 ? EM:14285 C57BL/6N-Cpgi13101/WtsiOrl EMMA sperm mutant strain Cpgi13101 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:5678185 Cpgi13101 CpG island 13101 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14285 ? EM:14157 C57BL/6N-Cpgi1230/WtsiIeg EMMA sperm mutant strain Cpgi1230 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:5666359 Cpgi1230 CpG island 1230 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14157 ? EM:14336 C57BL/6N-Cpgi11865/WtsiIeg EMMA sperm mutant strain Cpgi11865 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:5676951 Cpgi11865 CpG island 11865 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14336 + EM:10412 C57BL/6N-Cpeb3/Cnbc EMMA sperm mutant strain MGI:4841750 Cpeb3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443075 Cpeb3 cytoplasmic polyadenylation element binding protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10412 + EM:08086 C57BL/6N-Cpe/Ieg EMMA sperm mutant strain MGI:5548328 Cpe targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:101932 Cpe carboxypeptidase E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8086 + EM:05350 C57BL/6N-Cpe/Ieg EMMA embryo B6NTac;B6N-Cpe/Ieg mutant strain MGI:4451784 Cpe targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:101932 Cpe carboxypeptidase E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5350 + EM:08063 C57BL/6N-Cpa2/Ieg EMMA sperm mutant strain MGI:5548904 Cpa2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3617840 Cpa2 carboxypeptidase A2, pancreatic https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8063 + EM:09228 C57BL/6N-Cotl1/Ieg EMMA sperm mutant strain MGI:5613651 Cotl1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919292 Cotl1 coactosin-like 1 (Dictyostelium) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9228 + EM:09458 C57BL/6N-Cotl1/Ieg EMMA sperm mutant strain MGI:4841953 Cotl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1919292 Cotl1 coactosin-like 1 (Dictyostelium) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9458 + EM:10834 C57BL/6N-Coq2/H EMMA sperm mutant strain MGI:4841620 Coq2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1919133 Coq2 coenzyme Q2 4-hydroxybenzoate polyprenyltransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10834 - EM:08041 C57BL/6N-Comt/H EMMA sperm EPD0350_1_G06, B6NTac;B6N-Comt/H mutant strain MGI:4432657 Comt targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88470 Comt catechol-O-methyltransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8041 ? EM:14318 C57BL/6N-Colgalt2/WtsiIeg EMMA sperm mutant strain MGI:6120768 Colgalt2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2138232 Colgalt2 collagen beta(1-O)galactosyltransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14318 - EM:08189 C57BL/6N-Col9a2/H EMMA sperm B6NTac;B6N-Col9a2/H mutant strain MGI:4950248 Col9a2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88466 Col9a2 collagen, type IX, alpha 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8189 + EM:12667 C57BL/6N-Col4a5/CnrmH EMMA live mutant strain MGI:5548921 Col4a5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:88456 Col4a5 collagen, type IV, alpha 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12667 + EM:09043 C57BL/6N-Col4a3/H EMMA sperm mutant strain MGI:5692551 Col4a3 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:104688 Col4a3 collagen, type IV, alpha 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9043 - EM:07131 C57BL/6N-Col4a3/H EMMA sperm mutant strain MGI:4431840 Col4a3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104688 Col4a3 collagen, type IV, alpha 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7131 + EM:11598 C57BL/6N-Col4a2/WtsiOulu EMMA embryo mutant strain MGI:6140180 Col4a2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:88455 Col4a2 collagen, type IV, alpha 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11598 + EM:11598 C57BL/6N-Col4a2/WtsiOulu EMMA sperm mutant strain MGI:6140180 Col4a2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:88455 Col4a2 collagen, type IV, alpha 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11598 ? EM:14338 C57BL/6N-Col24a1/WtsiIeg EMMA sperm mutant strain MGI:5637054 Col24a1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1918605 Col24a1 collagen, type XXIV, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14338 + EM:10128 C57BL/6N-Col11a2/Ieg EMMA sperm mutant strain MGI:5692880 Col11a2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:88447 Col11a2 collagen, type XI, alpha 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10128 + EM:09208 C57BL/6N-Col11a2/Ieg EMMA archived mutant strain MGI:5305616 Col11a2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88447 Col11a2 collagen, type XI, alpha 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9208 ? EM:14562 C57BL/6N-Col11a1/WtsiCnbc EMMA sperm mutant strain MGI:6383383 Col11a1 endonuclease-mediated mutation 2, Wellcome Trust Sanger Institute MGI:88446 Col11a1 collagen, type XI, alpha 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14562 + EM:08648 C57BL/6N-Cog3/Ieg EMMA sperm mutant strain MGI:5548843 Cog3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2450151 Cog3 component of oligomeric golgi complex 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8648 + EM:08584 C57BL/6N-Cog3/Ieg EMMA sperm mutant strain MGI:5304885 Cog3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2450151 Cog3 component of oligomeric golgi complex 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8584 + EM:11165 C57BL/6N-Cntn6/WtsiH EMMA sperm mutant strain MGI:6140176 Cntn6 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1858223 Cntn6 contactin 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11165 - EM:08287 C57BL/6N-Cnr2/Ics EMMA embryo mutant strain MGI:6147781 Cnr2 targeted mutation 1, Mouse Clinical Institute MGI:104650 Cnr2 cannabinoid receptor 2 (macrophage) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8287 + EM:13606 C57BL/6N-Cnpy2/WtsiCnrm EMMA live mutant strain MGI:6153309 Cnpy2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1928477 Cnpy2 canopy FGF signaling regulator 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13606 + EM:12266 C57BL/6N-Cnot6l/Ieg EMMA sperm mutant strain MGI:5014723 Cnot6l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443154 Cnot6l CCR4-NOT transcription complex, subunit 6-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12266 ? EM:14197 C57BL/6N-Cnot4/WtsiCnbc EMMA archived mutant strain MGI:5636993 Cnot4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1859026 Cnot4 CCR4-NOT transcription complex, subunit 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14197 + EM:07624 C57BL/6N-Cnbd1/WtsiCnrm EMMA sperm mutant strain MGI:5548907 Cnbd1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3650508 Cnbd1 cyclic nucleotide binding domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7624 + EM:09011 C57BL/6N-Cmpk2/H EMMA sperm mutant strain MGI:4840944 Cmpk2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99830 Cmpk2 cytidine monophosphate (UMP-CMP) kinase 2, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9011 + EM:10077 C57BL/6N-Cmpk1/Ieg EMMA sperm mutant strain MGI:4441825 Cmpk1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913838 Cmpk1 cytidine monophosphate (UMP-CMP) kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10077 ? EM:14277 C57BL/6N-Cmbl/WtsiOrl EMMA sperm mutant strain MGI:5637042 Cmbl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916824 Cmbl carboxymethylenebutenolidase-like (Pseudomonas) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14277 + EM:06366 C57BL/6N-Clu/H EMMA sperm B6NTac;B6N-Clu/H mutant strain MGI:4951032 Clu targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88423 Clu clusterin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6366 - EM:04610 C57BL/6N-Clstn3/Cnrm EMMA embryo mutant strain MGI:4435060 Clstn3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2178323 Clstn3 calsyntenin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4610 - EM:04610 C57BL/6N-Clstn3/Cnrm EMMA sperm mutant strain MGI:4435060 Clstn3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2178323 Clstn3 calsyntenin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4610 + EM:06798 C57BL/6N-Clstn1/H EMMA sperm B6NTac;B6N-Clstn1/H mutant strain MGI:4950238 Clstn1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1929895 Clstn1 calsyntenin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6798 + EM:13376 C57BL/6N-Clic3/WtsiCnrm EMMA live mutant strain MGI:6153308 Clic3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1916704 Clic3 chloride intracellular channel 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13376 + EM:09490 C57BL/6N-Clec2i/H EMMA sperm mutant strain MGI:4946790 Clec2i targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2136650 Clec2i C-type lectin domain family 2, member i https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9490 + EM:10889 C57BL/6N-Clcnka/H EMMA sperm mutant strain MGI:4881996 Clcnka targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1329026 Clcnka chloride channel, voltage-sensitive Ka https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10889 + EM:11247 C57BL/6N-Clcn3/H EMMA live mutant strain MGI:4451789 Clcn3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103555 Clcn3 chloride channel, voltage-sensitive 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11247 ? EM:05489 C57BL/6N-Cited4/Ieg EMMA embryo mutant strain MGI:7333116 Cited4 targeted mutation 1.2, TaconicArtemis MGI:1861694 Cited4 Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5489 ? EM:05491 C57BL/6N-Cited4/Ieg EMMA embryo mutant strain MGI:7333115 Cited4 targeted mutation 1.1, TaconicArtemis MGI:1861694 Cited4 Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5491 + EM:09386 C57BL/6N-Cited1/Ieg EMMA archived mutant strain MGI:5497176 Cited1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108023 Cited1 Cbp/p300-interacting transactivator with Glu/Asp-rich carboxy-terminal domain 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9386 + EM:09042 C57BL/6N-Cisd2/H EMMA sperm C57BL/6NTac-Cisd2/H mutant strain MGI:5692667 Cisd2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1914256 Cisd2 CDGSH iron sulfur domain 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9042 + EM:09627 C57BL/6N-Cilp2/Ieg EMMA sperm mutant strain MGI:5635169 Cilp2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915959 Cilp2 cartilage intermediate layer protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9627 + EM:09289 C57BL/6N-Cilp2/Ieg EMMA sperm mutant strain MGI:4842704 Cilp2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915959 Cilp2 cartilage intermediate layer protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9289 ? EM:14247 C57BL/6N-Cibar1/WtsiOrl EMMA sperm mutant strain MGI:5637028 Cibar1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915349 Cibar1 CBY1 interacting BAR domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14247 + EM:09041 C57BL/6N-Cib2/H EMMA sperm B6NTac;B6N-Cib2/H mutant strain MGI:5659516 Cib2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1929293 Cib2 calcium and integrin binding family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9041 + EM:05417 C57BL/6N-Cib2/H EMMA sperm B6NTac;B6N-Cib2/H mutant strain MGI:4432101 Cib2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929293 Cib2 calcium and integrin binding family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5417 ? EM:14790 C57BL/6N-Chtf8/WtsiCnbc EMMA sperm mutant strain MGI:6153307 Chtf8 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2443370 Chtf8 CTF8, chromosome transmission fidelity factor 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14790 ? EM:13710 C57BL/6N-Chst9/WtsiOrl EMMA sperm mutant strain MGI:6333011 Chst9 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1918617 Chst9 carbohydrate (N-acetylgalactosamine 4-0) sulfotransferase 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13710 + EM:09310 C57BL/6N-Chst5/Ieg EMMA sperm mutant strain MGI:5637102 Chst5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1931825 Chst5 carbohydrate (N-acetylglucosamine 6-O) sulfotransferase 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9310 + EM:09295 C57BL/6N-Chst5/Ieg EMMA embryo mutant strain MGI:4432310 Chst5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1931825 Chst5 carbohydrate (N-acetylglucosamine 6-O) sulfotransferase 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9295 + EM:09295 C57BL/6N-Chst5/Ieg EMMA sperm mutant strain MGI:4432310 Chst5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1931825 Chst5 carbohydrate (N-acetylglucosamine 6-O) sulfotransferase 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9295 - EM:07867 C57BL/6N-Chrnb2/H EMMA sperm B6NTac;B6N-Chrnb2/H mutant strain MGI:5050253 Chrnb2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:87891 Chrnb2 cholinergic receptor, nicotinic, beta polypeptide 2 (neuronal) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7867 - EM:05186 C57BL/6N-Chrna9/H EMMA sperm mutant strain MGI:4432564 Chrna9 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1202403 Chrna9 cholinergic receptor, nicotinic, alpha polypeptide 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5186 - EM:07778 C57BL/6N-Chrna7/H EMMA sperm B6NTac;B6N-Chrna7/H mutant strain MGI:4434762 Chrna7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99779 Chrna7 cholinergic receptor, nicotinic, alpha polypeptide 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7778 ? EM:14225 C57BL/6N-Chmp6/WtsiIeg EMMA sperm mutant strain MGI:5637182 Chmp6 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3583942 Chmp6 charged multivesicular body protein 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14225 + EM:14259 C57BL/6N-Chil4/WtsiH EMMA live mutant strain MGI:5701721 Chil4 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1341098 Chil4 chitinase-like 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14259 - EM:07476 C57BL/6N-Chic2/H EMMA sperm mutant strain MGI:4868091 Chic2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921527 Chic2 cysteine-rich hydrophobic domain 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7476 ? EM:14544 C57BL/6N-Chd1/WtsiPh EMMA sperm mutant strain MGI:6286376 Chd1 endonuclease-mediated mutation 2, Wellcome Trust Sanger Institute MGI:88393 Chd1 chromodomain helicase DNA binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14544 ? EM:14543 C57BL/6N-Chd1/WtsiPh EMMA sperm mutant strain MGI:6281097 Chd1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:88393 Chd1 chromodomain helicase DNA binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14543 ? EM:14412 C57BL/6N-Chchd6/WtsiIeg EMMA sperm mutant strain MGI:6120728 Chchd6 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913348 Chchd6 coiled-coil-helix-coiled-coil-helix domain containing 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14412 + EM:13372 C57BL/6N-Chadl/WtsiCnrm EMMA live mutant strain MGI:6153306 Chadl endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3036284 Chadl chondroadherin-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13372 + EM:13443 C57BL/6N-Chac2/WtsiCnrm EMMA live mutant strain MGI:6333010 Chac2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1915294 Chac2 ChaC, cation transport regulator 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13443 + EM:09722 C57BL/6N-Cflar/Orl EMMA sperm mutant strain MGI:4433525 Cflar targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1336166 Cflar CASP8 and FADD-like apoptosis regulator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9722 - EM:07415 C57BL/6N-Cfi/H EMMA sperm B6NTac;B6N-Cfi/H mutant strain MGI:4820199 Cfi targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:105937 Cfi complement component factor i https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7415 + EM:11151 C57BL/6N-Cfap53/WtsiH EMMA sperm mutant strain MGI:6153305 Cfap53 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921703 Cfap53 cilia and flagella associated protein 53 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11151 ? EM:14531 C57BL/6N-Cfap410/WtsiOrl EMMA sperm mutant strain MGI:5812918 Cfap410 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915134 Cfap410 cilia and flagella associated protein 410 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14531 ? EM:13894 C57BL/6N-Cetn4/WtsiCnbc EMMA sperm mutant strain MGI:6153304 Cetn4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2677454 Cetn4 centrin 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13894 + EM:11251 C57BL/6N-Cers1/H EMMA sperm mutant strain MGI:4841520 Cers1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2136690 Cers1 ceramide synthase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11251 ? EM:14192 C57BL/6N-Cerox1/WtsiIeg EMMA sperm mutant strain Cerox1 undef targeted mutation , William C. Skarnes MGI:1920084 Cerox1 cytoplasmic endogenous regulator of oxidative phosphorylation 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14192 + EM:12757 C57BL/6N-Cerkl/Ieg EMMA sperm mutant strain MGI:4881936 Cerkl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3037816 Cerkl ceramide kinase-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12757 - EM:12612 C57BL/6N-Cep85l/Orl EMMA sperm mutant strain MGI:6406984 Cep85l endonuclease-mediated mutation 1, Centre d'ImmunoPhenomique MGI:3642684 Cep85l centrosomal protein 85-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12612 ? EM:13743 C57BL/6N-Cep72/WtsiOrl EMMA sperm mutant strain MGI:6153303 Cep72 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921720 Cep72 centrosomal protein 72 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13743 ? EM:14469 C57BL/6N-Cep44/WtsiCnbc EMMA sperm mutant strain MGI:6281105 Cep44 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:3525111 Cep44 centrosomal protein 44 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14469 + EM:08065 C57BL/6N-Cep43/Ieg EMMA sperm C57BL/6N-Fgfr1op/Ieg mutant strain MGI:5548654 Cep43 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1922546 Cep43 centrosomal protein 43 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8065 - EM:04776 C57BL/6N-Cep43/Cnrm EMMA embryo mutant strain MGI:4436456 Cep43 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922546 Cep43 centrosomal protein 43 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4776 - EM:04776 C57BL/6N-Cep43/Cnrm EMMA sperm mutant strain MGI:4436456 Cep43 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922546 Cep43 centrosomal protein 43 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4776 + EM:07338 C57BL/6N-Cep164/H EMMA sperm B6NTac;B6N-Cep164/H mutant strain MGI:4432075 Cep164 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384878 Cep164 centrosomal protein 164 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7338 + EM:14204 C57BL/6N-Cep120/WtsiH EMMA live mutant strain MGI:5812923 Cep120 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2147298 Cep120 centrosomal protein 120 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14204 ? EM:14301 C57BL/6N-Cenpl/WtsiIeg EMMA sperm mutant strain MGI:5637046 Cenpl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1917704 Cenpl centromere protein L https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14301 + EM:09207 C57BL/6N-Cenph/Ieg EMMA sperm mutant strain MGI:5588273 Cenph targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1349448 Cenph centromere protein H https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9207 + EM:08076 C57BL/6N-Cenpe/Ieg EMMA sperm mutant strain MGI:5548395 Cenpe targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1098230 Cenpe centromere protein E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8076 - EM:05121 C57BL/6N-Cenpe/Cnrm EMMA sperm mutant strain MGI:4436086 Cenpe targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1098230 Cenpe centromere protein E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5121 ? EM:14327 C57BL/6N-Celf2/WtsiPh EMMA sperm mutant strain MGI:6164777 Celf2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1338822 Celf2 CUGBP, Elav-like family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14327 + EM:14326 C57BL/6N-Celf2/WtsiPh EMMA live mutant strain MGI:5779676 Celf2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1338822 Celf2 CUGBP, Elav-like family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14326 + EM:13373 C57BL/6N-Ceacam5/WtsiCnrm EMMA live mutant strain MGI:6153302 Ceacam5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1920500 Ceacam5 CEA cell adhesion molecule 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13373 + EM:11766 C57BL/6N-Ceacam3/WtsiCnrm EMMA sperm mutant strain MGI:6152736 Ceacam3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3646296 Ceacam3 CEA cell adhesion molecule 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11766 ? EM:13888 C57BL/6N-Ceacam15/WtsiCnbc EMMA sperm mutant strain MGI:6153301 Ceacam15 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2141810 Ceacam15 CEA cell adhesion molecule 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13888 + EM:11767 C57BL/6N-Ceacam14/WtsiCnrm EMMA live mutant strain MGI:6149151 Ceacam14 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914334 Ceacam14 CEA cell adhesion molecule 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11767 ? EM:13875 C57BL/6N-Ceacam13/WtsiCnbc EMMA sperm mutant strain MGI:6153300 Ceacam13 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1917035 Ceacam13 CEA cell adhesion molecule 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13875 + EM:11586 C57BL/6N-Ceacam12/WtsiOulu EMMA embryo mutant strain MGI:6140175 Ceacam12 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914565 Ceacam12 CEA cell adhesion molecule 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11586 + EM:11586 C57BL/6N-Ceacam12/WtsiOulu EMMA sperm mutant strain MGI:6140175 Ceacam12 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914565 Ceacam12 CEA cell adhesion molecule 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11586 + EM:11588 C57BL/6N-Ceacam11/WtsiOulu EMMA embryo mutant strain MGI:6140174 Ceacam11 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914246 Ceacam11 CEA cell adhesion molecule 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11588 + EM:11588 C57BL/6N-Ceacam11/WtsiOulu EMMA sperm mutant strain MGI:6140174 Ceacam11 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914246 Ceacam11 CEA cell adhesion molecule 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11588 + EM:13547 C57BL/6N-Cdyl/WtsiKieg EMMA embryo mutant strain MGI:6153299 Cdyl endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1339956 Cdyl chromodomain protein, Y chromosome-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13547 + EM:13547 C57BL/6N-Cdyl/WtsiKieg EMMA sperm mutant strain MGI:6153299 Cdyl endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1339956 Cdyl chromodomain protein, Y chromosome-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13547 + EM:09377 C57BL/6N-Cdsn/Ieg EMMA sperm mutant strain MGI:5637180 Cdsn targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3505689 Cdsn corneodesmosin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9377 + EM:07894 C57BL/6N-Cdkn2aipnl/WtsiOulu EMMA embryo mutant strain MGI:5548411 Cdkn2aipnl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1261797 Cdkn2aipnl CDKN2A interacting protein N-terminal like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7894 + EM:07894 C57BL/6N-Cdkn2aipnl/WtsiOulu EMMA sperm mutant strain MGI:5548411 Cdkn2aipnl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1261797 Cdkn2aipnl CDKN2A interacting protein N-terminal like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7894 + EM:08061 C57BL/6N-Cdkal1/Ieg EMMA embryo mutant strain MGI:5548648 Cdkal1 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1921765 Cdkal1 CDK5 regulatory subunit associated protein 1-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8061 + EM:05555 C57BL/6N-Cdkal1/Ieg EMMA embryo B6NTac;B6N-Cdkal1/Ieg mutant strain MGI:4842388 Cdkal1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1921765 Cdkal1 CDK5 regulatory subunit associated protein 1-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5555 ? EM:13810 C57BL/6N-Cdk6/TcpBiat EMMA sperm unclassified MGI:6814677 Cdk6 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1277162 Cdk6 cyclin-dependent kinase 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13810 + EM:08660 C57BL/6N-Cdk5rap3/Ieg EMMA embryo mutant strain MGI:5548726 Cdk5rap3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1933126 Cdk5rap3 CDK5 regulatory subunit associated protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8660 ? EM:13809 C57BL/6N-Cdk4/TcpBiat EMMA sperm unclassified MGI:6316287 Cdk4 targeted mutation 1c, Mammalian Functional Genomics Centre MGI:88357 Cdk4 cyclin-dependent kinase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13809 + EM:14041 C57BL/6N-Cdk1/WtsiOulu EMMA embryo mutant strain MGI:7345514 Cdk1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:88351 Cdk1 cyclin-dependent kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14041 + EM:14041 C57BL/6N-Cdk1/WtsiOulu EMMA sperm mutant strain MGI:7345514 Cdk1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:88351 Cdk1 cyclin-dependent kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14041 + EM:09376 C57BL/6N-Cdk13/Ieg EMMA embryo mutant strain MGI:5588278 Cdk13 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1916812 Cdk13 cyclin-dependent kinase 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9376 + EM:09376 C57BL/6N-Cdk13/Ieg EMMA sperm mutant strain MGI:5588278 Cdk13 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1916812 Cdk13 cyclin-dependent kinase 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9376 + EM:08124 C57BL/6N-Cdk13/Ieg EMMA embryo B6NTac;B6N-Cdk13/Ieg mutant strain MGI:4842225 Cdk13 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916812 Cdk13 cyclin-dependent kinase 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8124 ? EM:13780 C57BL/6N-Cdhr3/WtsiIeg EMMA sperm mutant strain MGI:6333009 Cdhr3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1916014 Cdhr3 cadherin-related family member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13780 + EM:14252 C57BL/6N-Cdh23/WtsiH EMMA live mutant strain MGI:5775000 Cdh23 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14252 ? EM:13757 C57BL/6N-Cdh18/WtsiIeg EMMA sperm mutant strain MGI:6281922 Cdh18 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1344366 Cdh18 cadherin 18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13757 + EM:14598 C57BL/6N-Cdca2/WtsiCnbc EMMA embryo mutant strain MGI:6153298 Cdca2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919787 Cdca2 cell division cycle associated 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14598 + EM:14598 C57BL/6N-Cdca2/WtsiCnbc EMMA sperm mutant strain MGI:6153298 Cdca2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919787 Cdca2 cell division cycle associated 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14598 + EM:08276 C57BL/6N-Cdc42/H EMMA sperm mutant strain MGI:4951033 Cdc42 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:106211 Cdc42 cell division cycle 42 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8276 + EM:13548 C57BL/6N-Cdc20b/WtsiKieg EMMA embryo mutant strain MGI:6153297 Cdc20b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3644472 Cdc20b cell division cycle 20B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13548 + EM:13548 C57BL/6N-Cdc20b/WtsiKieg EMMA sperm mutant strain MGI:6153297 Cdc20b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3644472 Cdc20b cell division cycle 20B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13548 + EM:09299 C57BL/6N-Cdc123/Ieg EMMA sperm mutant strain MGI:5548737 Cdc123 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2138811 Cdc123 cell division cycle 123 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9299 + EM:09290 C57BL/6N-Cdc123/Ieg EMMA embryo mutant strain MGI:4940785 Cdc123 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2138811 Cdc123 cell division cycle 123 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9290 + EM:09290 C57BL/6N-Cdc123/Ieg EMMA sperm mutant strain MGI:4940785 Cdc123 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2138811 Cdc123 cell division cycle 123 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9290 + EM:13427 C57BL/6N-Cdan1/WtsiCnrm EMMA live mutant strain MGI:6257455 Cdan1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1916218 Cdan1 congenital dyserythropoietic anemia, type I (human) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13427 + EM:11593 C57BL/6N-Cd96/WtsiOulu EMMA embryo mutant strain MGI:6140170 Cd96 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1934368 Cd96 CD96 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11593 + EM:11593 C57BL/6N-Cd96/WtsiOulu EMMA sperm mutant strain MGI:6140170 Cd96 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1934368 Cd96 CD96 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11593 - EM:07777 C57BL/6N-Cd5l/H EMMA sperm B6NTac;B6N-Cd5l/H mutant strain MGI:4840877 Cd5l targeted mutation 1a, Mouse Biology Program, UCDavis MGI:1334419 Cd5l CD5 antigen-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7777 ? EM:13723 C57BL/6N-Cd53/WtsiOrl EMMA sperm mutant strain MGI:6333008 Cd53 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:88341 Cd53 CD53 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13723 + EM:11592 C57BL/6N-Cd300ld/WtsiIeg EMMA sperm mutant strain MGI:6140160 Cd300ld endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2442358 Cd300ld CD300 molecule like family member d https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11592 + EM:11892 C57BL/6N-Cd300ld2/WtsiH EMMA sperm mutant strain MGI:6153296 Cd300ld2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3649405 Cd300ld2 CD300 molecule like family member D2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11892 + EM:11591 C57BL/6N-Cd300c/WtsiOulu EMMA embryo mutant strain MGI:6140159 Cd300c endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3032626 Cd300c CD300C molecule https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11591 + EM:11591 C57BL/6N-Cd300c/WtsiOulu EMMA sperm mutant strain MGI:6140159 Cd300c endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3032626 Cd300c CD300C molecule https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11591 - EM:05072 C57BL/6N-Cd28/H EMMA sperm mutant strain MGI:4435635 Cd28 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88327 Cd28 CD28 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5072 ? EM:14515 C57BL/6N-Cd226/WtsiPh EMMA sperm mutant strain MGI:6406679 Cd226 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3039602 Cd226 CD226 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14515 ? EM:14524 C57BL/6N-Cd226/WtsiPh EMMA sperm mutant strain Cd226 KOMP targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3039602 Cd226 CD226 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14524 - EM:05361 C57BL/6N-Cd200/H EMMA sperm mutant strain MGI:4362965 Cd200 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1196990 Cd200 CD200 molecule https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5361 ? EM:13927 C57BL/6N-Cd160/WtsiCnbc EMMA sperm mutant strain MGI:6153295 Cd160 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1860383 Cd160 CD160 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13927 + EM:09302 C57BL/6N-Ccpg1/Ieg EMMA sperm mutant strain MGI:5588268 Ccpg1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1196419 Ccpg1 cell cycle progression 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9302 + EM:08242 C57BL/6N-Ccpg1/Ieg EMMA embryo mutant strain MGI:5000356 Ccpg1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1196419 Ccpg1 cell cycle progression 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8242 + EM:10566 C57BL/6N-Ccnd2/H EMMA sperm mutant strain MGI:4843631 Ccnd2 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:88314 Ccnd2 cyclin D2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10566 - EM:07838 C57BL/6N-Ccnb1/H EMMA sperm B6NTac;B6N-Ccnb1/H mutant strain MGI:4419820 Ccnb1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88302 Ccnb1 cyclin B1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7838 ? EM:13722 C57BL/6N-Ccl5/WtsiOrl EMMA sperm mutant strain MGI:6153293 Ccl5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:98262 Ccl5 chemokine (C-C motif) ligand 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13722 ? EM:13852 C57BL/6N-Ccl20/WtsiCnbc EMMA sperm mutant strain MGI:6153292 Ccl20 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1329031 Ccl20 chemokine (C-C motif) ligand 20 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13852 + EM:11108 C57BL/6N-Cckar/Ieg EMMA sperm mutant strain MGI:4841614 Cckar targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99478 Cckar cholecystokinin A receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11108 + EM:13375 C57BL/6N-Ccdc85c/WtsiCnrm EMMA live mutant strain MGI:6147794 Ccdc85c endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3644008 Ccdc85c coiled-coil domain containing 85C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13375 ? EM:13936 C57BL/6N-Ccdc6/WtsiCnbc EMMA sperm mutant strain MGI:6153244 Ccdc6 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1923801 Ccdc6 coiled-coil domain containing 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13936 ? EM:14189 C57BL/6N-Ccdc69/WtsiOrl EMMA sperm mutant strain MGI:5636931 Ccdc69 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1196234 Ccdc69 coiled-coil domain containing 69 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14189 + EM:07248 C57BL/6N-Ccdc50/H EMMA sperm B6NTac;B6N-Ccdc50/H mutant strain MGI:4841765 Ccdc50 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914751 Ccdc50 coiled-coil domain containing 50 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7248 ? EM:14537 C57BL/6N-Ccdc127/WtsiIeg EMMA sperm mutant strain MGI:5637023 Ccdc127 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914683 Ccdc127 coiled-coil domain containing 127 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14537 ? EM:13566 C57BL/6N-Ccdc125/Ieg EMMA sperm mutant strain MGI:6377203 Ccdc125 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1923291 Ccdc125 coiled-coil domain containing 125 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13566 + EM:05905 C57BL/6N-Cbx2/H EMMA sperm B6NTac;B6N-Cbx2/H mutant strain MGI:4420062 Cbx2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88289 Cbx2 chromobox 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5905 + EM:13538 C57BL/6N-Cbr2/WtsiKieg EMMA embryo mutant strain MGI:5692567 Cbr2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:107200 Cbr2 carbonyl reductase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13538 + EM:13538 C57BL/6N-Cbr2/WtsiKieg EMMA sperm mutant strain MGI:5692567 Cbr2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:107200 Cbr2 carbonyl reductase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13538 ? EM:14206 C57BL/6N-Catip/WtsiIeg EMMA sperm mutant strain MGI:5637170 Catip targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2685062 Catip ciliogenesis associated TTC17 interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14206 + EM:06911 C57BL/6N-Casz1/H EMMA sperm B6NTac;B6N-Casz1/H mutant strain MGI:4841554 Casz1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1196251 Casz1 castor zinc finger 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6911 + EM:07904 C57BL/6N-Carmil2/CipheOrl EMMA sperm C57BL/6N-Rltpr/CipheOrl mutant strain MGI:4462559 Carmil2 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:2685431 Carmil2 capping protein regulator and myosin 1 linker 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7904 + EM:07928 C57BL/6N-Car4/Ieg EMMA embryo mutant strain MGI:5548394 Car4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1096574 Car4 carbonic anhydrase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7928 + EM:09481 C57BL/6N-Car14/Ieg EMMA sperm mutant strain MGI:5050211 Car14 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1344341 Car14 carbonic anhydrase 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9481 ? EM:14261 C57BL/6N-Capza2/WtsiIeg EMMA sperm mutant strain MGI:5638561 Capza2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106222 Capza2 capping actin protein of muscle Z-line subunit alpha 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14261 + EM:11000 C57BL/6N-Caprin1/WtsiPh EMMA sperm mutant strain MGI:5692641 Caprin1 targeted mutation 3c, Wellcome Trust Sanger Institute MGI:1858234 Caprin1 cell cycle associated protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11000 + EM:09206 C57BL/6N-Capn12/Ieg EMMA sperm mutant strain MGI:5605772 Capn12 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1891369 Capn12 calpain 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9206 + EM:09293 C57BL/6N-Capn12/Ieg EMMA embryo mutant strain MGI:4881978 Capn12 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1891369 Capn12 calpain 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9293 + EM:09293 C57BL/6N-Capn12/Ieg EMMA sperm mutant strain MGI:4881978 Capn12 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1891369 Capn12 calpain 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9293 ? EM:14218 C57BL/6N-Capn11/WtsiIeg EMMA sperm mutant strain MGI:5692635 Capn11 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1352490 Capn11 calpain 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14218 + EM:08078 C57BL/6N-Cap2/Ieg EMMA embryo mutant strain MGI:5692670 Cap2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914502 Cap2 CAP, adenylate cyclase-associated protein, 2 (yeast) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8078 + EM:09205 C57BL/6N-Cant1/Ieg EMMA sperm mutant strain MGI:5612825 Cant1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1923275 Cant1 calcium activated nucleotidase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9205 + EM:08006 C57BL/6N-Cant1/Ieg EMMA embryo B6NTac;B6N-Cant1/Ieg mutant strain MGI:4455761 Cant1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923275 Cant1 calcium activated nucleotidase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8006 + EM:14303 C57BL/6N-Camkmt/WtsiH EMMA live mutant strain MGI:5637069 Camkmt targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1920832 Camkmt calmodulin-lysine N-methyltransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14303 + EM:10215 C57BL/6N-Camk2g/H EMMA sperm mutant strain MGI:4842292 Camk2g targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88259 Camk2g calcium/calmodulin-dependent protein kinase II gamma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10215 ? EM:14593 C57BL/6N-Camk2d/WtsiCnbc EMMA sperm mutant strain MGI:6153291 Camk2d endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1341265 Camk2d calcium/calmodulin-dependent protein kinase II, delta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14593 - EM:05782 C57BL/6N-Camk2b/Cnrm EMMA sperm mutant strain MGI:4841596 Camk2b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88257 Camk2b calcium/calmodulin-dependent protein kinase II, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5782 + EM:06745 C57BL/6N-Cacna1b/H EMMA sperm B6NTac;B6N-Cacna1b/H mutant strain MGI:4363249 Cacna1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88296 Cacna1b calcium channel, voltage-dependent, N type, alpha 1B subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6745 - EM:05847 C57BL/6N-Cabp1/H EMMA sperm mutant strain MGI:4441861 Cabp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1352750 Cabp1 calcium binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5847 + EM:13939 C57BL/6N-Cables2/WtsiOulu EMMA embryo mutant strain MGI:6314732 Cables2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2182335 Cables2 CDK5 and Abl enzyme substrate 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13939 + EM:13939 C57BL/6N-Cables2/WtsiOulu EMMA sperm mutant strain MGI:6314732 Cables2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2182335 Cables2 CDK5 and Abl enzyme substrate 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13939 - EM:05655 C57BL/6N-Cab39l/Cnrm EMMA sperm mutant strain MGI:4433220 Cab39l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914081 Cab39l calcium binding protein 39-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5655 ? EM:14565 C57BL/6N-C8g/WtsiPh EMMA sperm mutant strain MGI:6153290 C8g endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:88237 C8g complement component 8, gamma polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14565 + EM:07344 C57BL/6N-C8b/H EMMA sperm B6NTac;B6N-C8b/H mutant strain MGI:4458718 C8b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88236 C8b complement component 8, beta polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7344 + EM:13545 C57BL/6N-C2cd4b/WtsiKieg EMMA embryo mutant strain MGI:6153289 C2cd4b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1922947 C2cd4b C2 calcium-dependent domain containing 4B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13545 + EM:13545 C57BL/6N-C2cd4b/WtsiKieg EMMA sperm mutant strain MGI:6153289 C2cd4b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1922947 C2cd4b C2 calcium-dependent domain containing 4B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13545 + EM:12644 C57BL/6N-C1qtnf3/H EMMA sperm mutant strain MGI:5473094 C1qtnf3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1932136 C1qtnf3 C1q and tumor necrosis factor related protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12644 + EM:07065 C57BL/6N-C1qtnf2/H EMMA sperm B6NTac;B6N-C1qtnf2/H mutant strain MGI:4419335 C1qtnf2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1916433 C1qtnf2 C1q and tumor necrosis factor related protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7065 + EM:06103 C57BL/6N-Btrc/H EMMA sperm B6NTac;B6N-Btrc/H mutant strain MGI:4419962 Btrc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1338871 Btrc beta-transducin repeat containing protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6103 ? EM:13692 C57BL/6N-Btnl2/WtsiOrl EMMA sperm mutant strain MGI:6153288 Btnl2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1859549 Btnl2 butyrophilin-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13692 ? EM:13729 C57BL/6N-Btn2a2/WtsiOrl EMMA sperm mutant strain MGI:6153287 Btn2a2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3606486 Btn2a2 butyrophilin, subfamily 2, member A2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13729 + EM:08079 C57BL/6N-Btbd9/Ieg EMMA sperm mutant strain MGI:5548584 Btbd9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916625 Btbd9 BTB (POZ) domain containing 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8079 + EM:05554 C57BL/6N-Btbd9/Ieg EMMA embryo B6NTac;B6N-Btbd9/Ieg mutant strain MGI:4842263 Btbd9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916625 Btbd9 BTB (POZ) domain containing 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5554 ? EM:13432 C57BL/6N-Brox/WtsiCnrm EMMA sperm mutant strain MGI:6153286 Brox endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1918928 Brox BRO1 domain and CAAX motif containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13432 ? EM:13782 C57BL/6N-Brinp2/WtsiIeg EMMA sperm mutant strain MGI:6286377 Brinp2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2443333 Brinp2 bone morphogenic protein/retinoic acid inducible neural-specific 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13782 + EM:11572 C57BL/6N-Brd2/WtsiIeg EMMA sperm mutant strain MGI:6147548 Brd2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:99495 Brd2 bromodomain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11572 + EM:11761 C57BL/6N-Brcc3/WtsiCnrm EMMA sperm mutant strain MGI:6149150 Brcc3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2389572 Brcc3 BRCA1/BRCA2-containing complex, subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11761 + EM:04955 C57BL/6N-Bpifb3/Cnrm EMMA sperm B6NDen;B6N-Rya3/Cnrm, B6Dnk;B6N-Rya3/Cnrm, B6Dnk;B6N-Bpifb3/Cnrm mutant strain MGI:4435026 Bpifb3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2675077 Bpifb3 BPI fold containing family B, member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4955 + EM:14168 C57BL/6N-Bola3/WtsiH EMMA live mutant strain MGI:5812921 Bola3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1925903 Bola3 bolA-like 3 (E. coli) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14168 ? EM:14284 C57BL/6N-Bnip2/WtsiIeg EMMA sperm mutant strain MGI:5636917 Bnip2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:109327 Bnip2 BCL2/adenovirus E1B interacting protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14284 + EM:08252 C57BL/6N-Bms1/Ieg EMMA sperm mutant strain MGI:5548836 Bms1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2446132 Bms1 BMS1, ribosome biogenesis factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8252 + EM:08107 C57BL/6N-Bms1/Ieg EMMA sperm B6NTac;B6N-Bms1/Ieg mutant strain MGI:4435886 Bms1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2446132 Bms1 BMS1, ribosome biogenesis factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8107 ? EM:13890 C57BL/6N-Bin2/WtsiCnbc EMMA sperm mutant strain MGI:6153285 Bin2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3611448 Bin2 bridging integrator 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13890 ? EM:14413 C57BL/6N-Bhlhe40/WtsiOrl EMMA sperm mutant strain MGI:5583057 Bhlhe40 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1097714 Bhlhe40 basic helix-loop-helix family, member e40 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14413 + EM:08617 C57BL/6N-Bex2/Ieg EMMA sperm mutant strain MGI:4951053 Bex2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1338017 Bex2 brain expressed X-linked 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8617 + EM:14330 C57BL/6N-Begain/WtsiH EMMA live mutant strain MGI:5775006 Begain targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3044626 Begain brain-enriched guanylate kinase-associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14330 + EM:08080 C57BL/6N-Becn1/Ieg EMMA sperm mutant strain MGI:5548507 Becn1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1891828 Becn1 beclin 1, autophagy related https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8080 ? EM:13929 C57BL/6N-Bclaf3/WtsiCnbc EMMA sperm mutant strain MGI:6153284 Bclaf3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2685992 Bclaf3 Bclaf1 and Thrap3 family member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13929 + EM:10397 C57BL/6N-Bcl3/H EMMA sperm mutant strain MGI:4460467 Bcl3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88140 Bcl3 B cell leukemia/lymphoma 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10397 ? EM:09309 C57BL/6N-Bcl2l15/Ieg EMMA sperm mutant strain MGI:5637171 Bcl2l15 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2685412 Bcl2l15 BCLl2-like 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9309 + EM:09292 C57BL/6N-Bcl2l15/Ieg EMMA embryo mutant strain MGI:4841810 Bcl2l15 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2685412 Bcl2l15 BCLl2-like 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9292 + EM:09292 C57BL/6N-Bcl2l15/Ieg EMMA sperm mutant strain MGI:4841810 Bcl2l15 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2685412 Bcl2l15 BCLl2-like 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9292 + EM:08756 C57BL/6N-Bccip/Ieg EMMA sperm mutant strain MGI:5548513 Bccip targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1913415 Bccip BRCA2 and CDKN1A interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8756 + EM:09034 C57BL/6N-BC055324/H EMMA sperm mutant strain MGI:5692863 BC055324 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:3590554 BC055324 cDNA sequence BC055324 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9034 + EM:04950 C57BL/6N-BC055324/H EMMA sperm B6NTac;B6N-BC055324/H mutant strain MGI:4434838 BC055324 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3590554 BC055324 cDNA sequence BC055324 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4950 + EM:09155 C57BL/6N-BC053393/H EMMA sperm mutant strain MGI:4939735 BC053393 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3039605 BC053393 cDNA sequence BC053393 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9155 ? EM:14791 C57BL/6N-BC051142/WtsiCnbc EMMA sperm mutant strain BC051142 CRISPR/CAS9 targeted mutation , Wellcome Trust Sanger Institute MGI:3039565 Tsbp1 testis expressed basic protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14791 + EM:09033 C57BL/6N-Bbs5/H EMMA sperm C57BL/6NTac-Bbs5/H mutant strain MGI:5692720 Bbs5 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1919819 Bbs5 Bardet-Biedl syndrome 5 (human) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9033 ? EM:13861 C57BL/6N-Bbs2/WtsiPh EMMA sperm mutant strain MGI:6153765 Bbs2 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:2135267 Bbs2 Bardet-Biedl syndrome 2 (human) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13861 ? EM:13860 C57BL/6N-Bbs2/WtsiPh EMMA sperm mutant strain MGI:6153739 Bbs2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2135267 Bbs2 Bardet-Biedl syndrome 2 (human) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13860 ? EM:13900 C57BL/6N-Baz2b/WtsiCnbc EMMA sperm mutant strain MGI:6153283 Baz2b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2442782 Baz2b bromodomain adjacent to zinc finger domain, 2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13900 ? EM:14266 C57BL/6N-Batf3/WtsiIeg EMMA sperm mutant strain Batf3 KOMP targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1925491 Batf3 basic leucine zipper transcription factor, ATF-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14266 ? EM:14400 C57BL/6N-Bap1/WtsiPh EMMA sperm mutant strain MGI:5774999 Bap1 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1206586 Bap1 Brca1 associated protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14400 ? EM:14399 C57BL/6N-Bap1/WtsiPh EMMA sperm mutant strain MGI:5774999 Bap1 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1206586 Bap1 Brca1 associated protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14399 + EM:10885 C57BL/6N-Bag3/H EMMA sperm mutant strain MGI:5760384 Bag3 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1352493 Bag3 BCL2-associated athanogene 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10885 + EM:04807 C57BL/6N-Bag3/H EMMA sperm B6NTac;B6N-Bag3/H mutant strain MGI:4436101 Bag3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1352493 Bag3 BCL2-associated athanogene 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4807 + EM:09104 C57BL/6N-Bach2/Ieg EMMA sperm mutant strain MGI:5605836 Bach2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:894679 Bach2 BTB and CNC homology, basic leucine zipper transcription factor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9104 ? EM:13772 C57BL/6N-B4galt3/WtsiOrl EMMA sperm mutant strain MGI:6358059 B4galt3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1928767 B4galt3 UDP-Gal:betaGlcNAc beta 1,4-galactosyltransferase, polypeptide 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13772 ? EM:14438 C57BL/6N-AW112010/WtsiPh EMMA sperm mutant strain MGI:6153282 AW112010 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2147706 AW112010 expressed sequence AW112010 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14438 + EM:08054 C57BL/6N-Avpi1/Ieg EMMA embryo mutant strain MGI:5548586 Avpi1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1916784 Avpi1 arginine vasopressin-induced 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8054 - EM:05173 C57BL/6N-Avpi1/Cnrm EMMA sperm mutant strain MGI:4434813 Avpi1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916784 Avpi1 arginine vasopressin-induced 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5173 - EM:07776 C57BL/6N-Avp/H EMMA sperm mutant strain MGI:4431847 Avp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88121 Avp arginine vasopressin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7776 + EM:13382 C57BL/6N-Auts2/WtsiCnrm EMMA live mutant strain MGI:6153281 Auts2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919847 Auts2 autism susceptibility candidate 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13382 ? EM:14274 C57BL/6N-Atxn10/WtsiCnbc EMMA archived mutant strain MGI:5636994 Atxn10 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1859293 Atxn10 ataxin 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14274 - EM:05124 C57BL/6N-Atp8a1/H EMMA sperm mutant strain MGI:4434463 Atp8a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1330848 Atp8a1 ATPase, aminophospholipid transporter (APLT), class I, type 8A, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5124 ? EM:14309 C57BL/6N-Atp5pb/WtsiCnbc EMMA archived mutant strain MGI:5636929 Atp5pb targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1100495 Atp5pb ATP synthase peripheral stalk-membrane subunit b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14309 + EM:07834 C57BL/6N-Atp5md/H EMMA sperm B6NTac;B6N-Usmg5/H, C57BL/6N-Usmg5/H mutant strain MGI:4820248 Atp5md targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891435 Atp5md ATP synthase membrane subunit DAPIT https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7834 - EM:07991 C57BL/6N-Atp5l/H EMMA sperm HEPD0653_6_A09, B6NTac;B6N-Atp5l/H mutant strain MGI:4461503 Atp5l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1351597 Atp5l ATP synthase, H+ transporting, mitochondrial F0 complex, subunit G https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7991 + EM:09375 C57BL/6N-Atp5g2/Ieg EMMA sperm mutant strain MGI:5588276 Atp5g2 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1915192 Atp5g2 ATP synthase, H+ transporting, mitochondrial F0 complex, subunit C2 (subunit 9) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9375 + EM:08125 C57BL/6N-Atp5g2/Ieg EMMA sperm B6NTac;B6N-Atp5g2/Ieg mutant strain MGI:5511784 Atp5g2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1915192 Atp5g2 ATP synthase, H+ transporting, mitochondrial F0 complex, subunit C2 (subunit 9) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8125 ? EM:14519 C57BL/6N-Atp5e/WtsiIeg EMMA sperm mutant strain MGI:5636990 Atp5e targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1855697 Atp5e ATP synthase, H+ transporting, mitochondrial F1 complex, epsilon subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14519 - EM:06358 C57BL/6N-Atp2a2/H EMMA sperm B6NTac;B6N-Atp2a2/H mutant strain MGI:4942050 Atp2a2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88110 Atp2a2 ATPase, Ca++ transporting, cardiac muscle, slow twitch 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6358 + EM:10835 C57BL/6N-Atp2a1/H EMMA sperm C57BL/6NTac-Atp2a1/H mutant strain MGI:4458765 Atp2a1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:105058 Atp2a1 ATPase, Ca++ transporting, cardiac muscle, fast twitch 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10835 + EM:08975 C57BL/6N-Atp1a4/H EMMA sperm mutant strain MGI:4880927 Atp1a4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1351335 Atp1a4 ATPase, Na+/K+ transporting, alpha 4 polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8975 - EM:04826 C57BL/6N-Atn1/Cnrm EMMA embryo mutant strain MGI:4433256 Atn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104725 Atn1 atrophin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4826 - EM:04826 C57BL/6N-Atn1/Cnrm EMMA sperm mutant strain MGI:4433256 Atn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104725 Atn1 atrophin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4826 + EM:09539 C57BL/6N-Atl2/H EMMA sperm mutant strain MGI:4451773 Atl2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1929492 Atl2 atlastin GTPase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9539 + EM:11966 C57BL/6N-Atg4b/H EMMA sperm mutant strain MGI:5286293 Atg4b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913865 Atg4b autophagy related 4B, cysteine peptidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11966 - EM:07494 C57BL/6N-Atf3/H EMMA sperm mutant strain MGI:4840692 Atf3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:109384 Atf3 activating transcription factor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7494 + EM:07708 C57BL/6N-Atad2b/IcsOrl EMMA sperm mutant strain MGI:4435777 Atad2b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444798 Atad2b ATPase family, AAA domain containing 2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7708 + EM:13363 C57BL/6N-Asxl3/WtsiCnrm EMMA live mutant strain MGI:6153280 Asxl3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2685175 Asxl3 ASXL transcriptional regulator 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13363 + EM:08118 C57BL/6N-Aspn/Ieg EMMA sperm mutant strain MGI:5548526 Aspn targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1913945 Aspn asporin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8118 + EM:07603 C57BL/6N-Aspn/Ieg EMMA sperm B6NTac;B6N-Aspn/Ieg mutant strain MGI:4455676 Aspn targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913945 Aspn asporin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7603 + EM:08755 C57BL/6N-Aspa/Ieg EMMA sperm mutant strain MGI:5614710 Aspa targeted mutation 1b, Wellcome Trust Sanger Institute MGI:87914 Aspa aspartoacylase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8755 - EM:05307 C57BL/6N-Asns/H EMMA sperm mutant strain MGI:4441742 Asns targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1350929 Asns asparagine synthetase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5307 ? EM:13761 C57BL/6N-Asap2/WtsiIeg EMMA sperm mutant strain MGI:6281940 Asap2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2685438 Asap2 ArfGAP with SH3 domain, ankyrin repeat and PH domain 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13761 ? EM:13764 C57BL/6N-Asap1/WtsiIeg EMMA sperm mutant strain MGI:6281937 Asap1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1342335 Asap1 ArfGAP with SH3 domain, ankyrin repeat and PH domain1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13764 ? EM:14520 C57BL/6N-Arrdc5/WtsiCnbc EMMA archived mutant strain MGI:5637088 Arrdc5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924170 Arrdc5 arrestin domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14520 ? EM:14272 C57BL/6N-Arpin/WtsiIeg EMMA sperm mutant strain MGI:5637045 Arpin targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1917670 Arpin actin-related protein 2/3 complex inhibitor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14272 + EM:13543 C57BL/6N-Armc7/WtsiKieg EMMA embryo mutant strain MGI:5548858 Armc7 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:2679719 Armc7 armadillo repeat containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13543 + EM:13543 C57BL/6N-Armc7/WtsiKieg EMMA sperm mutant strain MGI:5548858 Armc7 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:2679719 Armc7 armadillo repeat containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13543 + EM:10887 C57BL/6N-Armc2/H EMMA sperm mutant strain MGI:5497130 Armc2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916449 Armc2 armadillo repeat containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10887 + EM:09528 C57BL/6N-Arl6ip1/H EMMA sperm mutant strain MGI:5289885 Arl6ip1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1858943 Arl6ip1 ADP-ribosylation factor-like 6 interacting protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9528 + EM:10446 C57BL/6N-Arl15/H EMMA sperm mutant strain MGI:4842768 Arl15 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442308 Arl15 ADP-ribosylation factor-like 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10446 + EM:10446 C57BL/6N-Arl15/H EMMA live mutant strain MGI:4842768 Arl15 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442308 Arl15 ADP-ribosylation factor-like 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10446 ? EM:14526 C57BL/6N-Arid1b/WtsiPh EMMA sperm mutant strain MGI:5771994 Arid1b targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1926129 Arid1b AT rich interactive domain 1B (SWI-like) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14526 ? EM:14022 C57BL/6N-Arid1b/WtsiPh EMMA sperm mutant strain MGI:4435087 Arid1b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1926129 Arid1b AT rich interactive domain 1B (SWI-like) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14022 + EM:10411 C57BL/6N-Arid1b/Cnbc EMMA sperm mutant strain MGI:4435087 Arid1b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1926129 Arid1b AT rich interactive domain 1B (SWI-like) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10411 ? EM:14525 C57BL/6N-Arid1b/WtsiPh EMMA sperm mutant strain Arid1b undef targeted mutation , Wellcome Trust Sanger Institute MGI:1926129 Arid1b AT rich interactive domain 1B (SWI-like) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14525 - EM:06946 C57BL/6N-Arhgef28/H EMMA sperm mutant strain MGI:4842257 Arhgef28 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1346016 Arhgef28 Rho guanine nucleotide exchange factor (GEF) 28 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6946 + EM:11193 C57BL/6N-Arhgef18/H EMMA sperm mutant strain MGI:4840837 Arhgef18 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:2142567 Arhgef18 rho/rac guanine nucleotide exchange factor (GEF) 18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11193 + EM:07064 C57BL/6N-Arhgef11/H EMMA sperm B6NTac;B6N-Arhgef11/H mutant strain MGI:5014576 Arhgef11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2441869 Arhgef11 Rho guanine nucleotide exchange factor (GEF) 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7064 + EM:11674 C57BL/6N-Arhgap26/Ieg EMMA sperm mutant strain MGI:5428627 Arhgap26 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918552 Arhgap26 Rho GTPase activating protein 26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11674 + EM:13386 C57BL/6N-Arhgap17/WtsiCnrm EMMA live mutant strain MGI:5637047 Arhgap17 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1917747 Arhgap17 Rho GTPase activating protein 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13386 + EM:08099 C57BL/6N-Arfip2/Ieg EMMA sperm mutant strain MGI:5548677 Arfip2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924182 Arfip2 ADP-ribosylation factor interacting protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8099 + EM:07606 C57BL/6N-Arfip2/Ieg EMMA embryo B6NTac;B6N-Arfip2/Ieg mutant strain MGI:4842653 Arfip2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924182 Arfip2 ADP-ribosylation factor interacting protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7606 + EM:09350 C57BL/6N-Arf3/Ieg EMMA sperm mutant strain MGI:5614714 Arf3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:99432 Arf3 ADP-ribosylation factor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9350 + EM:09114 C57BL/6N-Arf3/Ieg EMMA sperm mutant strain MGI:4436411 Arf3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99432 Arf3 ADP-ribosylation factor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9114 - EM:07877 C57BL/6N-Areg/H EMMA sperm B6NTac;B6N-Areg/H mutant strain MGI:5299794 Areg targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:88068 Areg amphiregulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7877 + EM:13399 C57BL/6N-Arap2/WtsiCnrm EMMA live mutant strain MGI:5692850 Arap2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2684416 Arap2 ArfGAP with RhoGAP domain, ankyrin repeat and PH domain 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13399 + EM:12426 C57BL/6N-Arap1/Orl EMMA sperm mutant strain MGI:6406675 Arap1 endonuclease-mediated mutation 1, Centre d'ImmunoPhenomique MGI:1916960 Arap1 ArfGAP with RhoGAP domain, ankyrin repeat and PH domain 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12426 + EM:08652 C57BL/6N-Aqp6/Ieg EMMA sperm C57BL/6N-Aqp6/Hmgu mutant strain MGI:5636970 Aqp6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1341204 Aqp6 aquaporin 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8652 + EM:08613 C57BL/6N-Aqp6/Ieg EMMA embryo mutant strain MGI:5287826 Aqp6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1341204 Aqp6 aquaporin 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8613 + EM:08279 C57BL/6N-Aqp3/H EMMA sperm mutant strain MGI:4840639 Aqp3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1333777 Aqp3 aquaporin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8279 ? EM:13620 C57BL/6N-Aprt/Ieg EMMA sperm mutant strain MGI:6377200 Aprt endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:88061 Aprt adenine phosphoribosyl transferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13620 ? EM:14153 C57BL/6N-Apoo/WtsiIeg EMMA sperm mutant strain MGI:5637032 Apoo targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915566 Apoo apolipoprotein O https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14153 ? EM:14595 C57BL/6N-Apold1/WtsiCnbc EMMA sperm mutant strain MGI:6153279 Apold1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2685921 Apold1 apolipoprotein L domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14595 + EM:09229 C57BL/6N-Apoc4/Ieg EMMA sperm mutant strain MGI:5613668 Apoc4 targeted mutation 1.1, Mouse Biology Program, UCDavis MGI:87878 Apoc4 apolipoprotein C-IV https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9229 + EM:08728 C57BL/6N-Apoc4/Ieg EMMA sperm mutant strain MGI:4453980 Apoc4 targeted mutation 1, Mouse Biology Program, UCDavis MGI:87878 Apoc4 apolipoprotein C-IV https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8728 ? EM:14295 C57BL/6N-Apip/WtsiOrl EMMA sperm mutant strain MGI:5637096 Apip targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1926788 Apip APAF1 interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14295 + EM:06357 C57BL/6N-Aph1c/H EMMA sperm B6NTac;B6N-Aph1c/H mutant strain MGI:4458639 Aph1c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915568 Aph1c aph1 homolog C, gamma secretase subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6357 ? EM:14216 C57BL/6N-Ap4m1/WtsiOrl EMMA sperm mutant strain MGI:5636962 Ap4m1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1337063 Ap4m1 adaptor-related protein complex AP-4, mu 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14216 + EM:09035 C57BL/6N-Ap4e1/H EMMA sperm mutant strain MGI:5692615 Ap4e1 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1336993 Ap4e1 adaptor-related protein complex AP-4, epsilon 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9035 + EM:09451 C57BL/6N-Ap4e1/Ieg EMMA sperm mutant strain MGI:5548434 Ap4e1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336993 Ap4e1 adaptor-related protein complex AP-4, epsilon 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9451 - EM:04962 C57BL/6N-Ap3s2/Cnrm EMMA sperm mutant strain MGI:4435108 Ap3s2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1337060 Ap3s2 adaptor-related protein complex 3, sigma 2 subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4962 + EM:08096 C57BL/6N-Ap3s1/Ieg EMMA sperm mutant strain MGI:5548436 Ap3s1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1337062 Ap3s1 adaptor-related protein complex 3, sigma 1 subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8096 + EM:09113 C57BL/6N-Ap3s1/Ieg EMMA embryo mutant strain MGI:4455691 Ap3s1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1337062 Ap3s1 adaptor-related protein complex 3, sigma 1 subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9113 + EM:08575 C57BL/6N-Ap2a2/WtsiH EMMA sperm mutant strain MGI:5548327 Ap2a2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:101920 Ap2a2 adaptor-related protein complex 2, alpha 2 subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8575 + EM:11888 C57BL/6N-Ap2a2/WtsiH EMMA sperm mutant strain MGI:6153278 Ap2a2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:101920 Ap2a2 adaptor-related protein complex 2, alpha 2 subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11888 + EM:09204 C57BL/6N-Aoc1/Ieg EMMA embryo mutant strain MGI:5548670 Aoc1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1923757 Aoc1 amine oxidase, copper-containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9204 + EM:09204 C57BL/6N-Aoc1/Ieg EMMA sperm mutant strain MGI:5548670 Aoc1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1923757 Aoc1 amine oxidase, copper-containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9204 - EM:06923 C57BL/6N-Aoc1/Ieg EMMA sperm mutant strain MGI:4451772 Aoc1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923757 Aoc1 amine oxidase, copper-containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6923 + EM:07577 C57BL/6N-Anxa9/WtsiOulu EMMA embryo mutant strain MGI:5548668 Anxa9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923711 Anxa9 annexin A9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7577 + EM:07577 C57BL/6N-Anxa9/WtsiOulu EMMA sperm mutant strain MGI:5548668 Anxa9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923711 Anxa9 annexin A9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7577 + EM:11585 C57BL/6N-Anxa8/WtsiIeg EMMA sperm mutant strain MGI:6140090 Anxa8 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1201374 Anxa8 annexin A8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11585 + EM:09423 C57BL/6N-Anxa3/Ieg EMMA sperm mutant strain MGI:5617787 Anxa3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1201378 Anxa3 annexin A3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9423 + EM:08635 C57BL/6N-Anxa3/Ieg EMMA embryo mutant strain MGI:4946803 Anxa3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1201378 Anxa3 annexin A3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8635 + EM:09879 C57BL/6N-Anxa2/Cnrm EMMA sperm mutant strain MGI:5811676 Anxa2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:88246 Anxa2 annexin A2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9879 + EM:13546 C57BL/6N-Anxa11/WtsiKieg EMMA embryo mutant strain MGI:6153277 Anxa11 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:108481 Anxa11 annexin A11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13546 + EM:13546 C57BL/6N-Anxa11/WtsiKieg EMMA sperm mutant strain MGI:6153277 Anxa11 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:108481 Anxa11 annexin A11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13546 + EM:13371 C57BL/6N-Anxa10/WtsiCnrm EMMA live mutant strain MGI:6153276 Anxa10 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1347090 Anxa10 annexin A10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13371 ? EM:13913 C57BL/6N-Antxr2/WtsiCnbc EMMA sperm mutant strain MGI:6153738 Antxr2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919164 Antxr2 anthrax toxin receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13913 ? EM:14337 C57BL/6N-Anks6/WtsiIeg EMMA sperm mutant strain MGI:5637085 Anks6 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922941 Anks6 ankyrin repeat and sterile alpha motif domain containing 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14337 ? EM:13883 C57BL/6N-Ankrd22/WtsiPh EMMA sperm mutant strain MGI:6153275 Ankrd22 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1277101 Ankrd22 ankyrin repeat domain 22 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13883 + EM:10044 C57BL/6N-Ankrd10/Ieg EMMA sperm mutant strain MGI:5692732 Ankrd10 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1921840 Ankrd10 ankyrin repeat domain 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10044 + EM:08596 C57BL/6N-Ankrd10/Ieg EMMA embryo mutant strain MGI:5511763 Ankrd10 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1921840 Ankrd10 ankyrin repeat domain 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8596 + EM:09649 C57BL/6N-Ankib1/H EMMA sperm mutant strain MGI:4946703 Ankib1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918047 Ankib1 ankyrin repeat and IBR domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9649 - EM:07440 C57BL/6N-Angptl4/H EMMA sperm B6NTac;B6N-Angptl4/H mutant strain MGI:4458671 Angptl4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1888999 Angptl4 angiopoietin-like 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7440 + EM:11248 C57BL/6N-Ampd2/H EMMA sperm mutant strain MGI:4841576 Ampd2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88016 Ampd2 adenosine monophosphate deaminase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11248 + EM:11248 C57BL/6N-Ampd2/H EMMA live mutant strain MGI:4841576 Ampd2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88016 Ampd2 adenosine monophosphate deaminase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11248 + EM:14466 C57BL/6N-Amfr/WtsiOulu EMMA embryo mutant strain MGI:6153274 Amfr endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1345634 Amfr autocrine motility factor receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14466 + EM:14466 C57BL/6N-Amfr/WtsiOulu EMMA sperm mutant strain MGI:6153274 Amfr endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1345634 Amfr autocrine motility factor receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14466 + EM:09571 C57BL/6N-Alpk3/H EMMA sperm mutant strain MGI:5286300 Alpk3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2151224 Alpk3 alpha-kinase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9571 + EM:11148 C57BL/6N-Alpk1/WtsiH EMMA sperm mutant strain MGI:6149149 Alpk1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1918731 Alpk1 alpha-kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11148 + EM:08572 C57BL/6N-Alox12e/WtsiH EMMA sperm mutant strain MGI:5548415 Alox12e targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1274790 Alox12e arachidonate lipoxygenase, epidermal https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8572 + EM:10127 C57BL/6N-Alkbh8/Ieg EMMA sperm mutant strain MGI:5692677 Alkbh8 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914917 Alkbh8 alkB homolog 8, tRNA methyltransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10127 + EM:09151 C57BL/6N-Alkbh8/Ieg EMMA sperm mutant strain MGI:5008907 Alkbh8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914917 Alkbh8 alkB homolog 8, tRNA methyltransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9151 + EM:09115 C57BL/6N-Alkbh6/Ieg EMMA sperm mutant strain MGI:5427267 Alkbh6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2142037 Alkbh6 alkB homolog 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9115 + EM:10126 C57BL/6N-Alkbh1/Ieg EMMA sperm mutant strain MGI:5695126 Alkbh1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2384034 Alkbh1 alkB homolog 1, histone H2A dioxygenase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10126 + EM:09068 C57BL/6N-Alkbh1/Ieg EMMA embryo mutant strain MGI:5286299 Alkbh1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384034 Alkbh1 alkB homolog 1, histone H2A dioxygenase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9068 + EM:14276 C57BL/6N-Aldh3b1/WtsiOulu EMMA embryo mutant strain MGI:5548549 Aldh3b1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914939 Aldh3b1 aldehyde dehydrogenase 3 family, member B1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14276 + EM:14276 C57BL/6N-Aldh3b1/WtsiOulu EMMA sperm mutant strain MGI:5548549 Aldh3b1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914939 Aldh3b1 aldehyde dehydrogenase 3 family, member B1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14276 - EM:05656 C57BL/6N-Aldh3a1/Cnrm EMMA sperm mutant strain MGI:4842540 Aldh3a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353451 Aldh3a1 aldehyde dehydrogenase family 3, subfamily A1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5656 + EM:11033 C57BL/6N-Aldh2/Ieg EMMA sperm mutant strain MGI:5695134 Aldh2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:99600 Aldh2 aldehyde dehydrogenase 2, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11033 + EM:08657 C57BL/6N-Aldh1l1/Ieg EMMA sperm mutant strain MGI:5548445 Aldh1l1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1340024 Aldh1l1 aldehyde dehydrogenase 1 family, member L1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8657 + EM:09422 C57BL/6N-Akr7a5/Ieg EMMA sperm mutant strain MGI:5617786 Akr7a5 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:107796 Akr7a5 aldo-keto reductase family 7, member A5 (aflatoxin aldehyde reductase) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9422 + EM:08576 C57BL/6N-Akr7a5/Ieg EMMA embryo mutant strain MGI:4950217 Akr7a5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107796 Akr7a5 aldo-keto reductase family 7, member A5 (aflatoxin aldehyde reductase) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8576 ? EM:13702 C57BL/6N-Akr1e1/WtsiOrl EMMA sperm mutant strain MGI:6153273 Akr1e1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914758 Akr1e1 aldo-keto reductase family 1, member E1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13702 + EM:09230 C57BL/6N-Aif1/Ieg EMMA sperm mutant strain MGI:5613637 Aif1 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1343098 Aif1 allograft inflammatory factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9230 + EM:08730 C57BL/6N-Aif1/Ieg EMMA embryo mutant strain MGI:4419468 Aif1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1343098 Aif1 allograft inflammatory factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8730 + EM:08730 C57BL/6N-Aif1/Ieg EMMA sperm mutant strain MGI:4419468 Aif1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1343098 Aif1 allograft inflammatory factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8730 ? EM:14269 C57BL/6N-Aicda/WtsiCnbc EMMA archived mutant strain MGI:5636974 Aicda targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1342279 Aicda activation-induced cytidine deaminase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14269 - EM:12337 C57BL/6N-AI467606/Orl EMMA sperm mutant strain MGI:6357866 AI467606 endonuclease-mediated mutation 1, Centre d'ImmunoPhenomique MGI:2141979 AI467606 expressed sequence AI467606 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12337 + EM:07247 C57BL/6N-Ahnak/H EMMA sperm B6NTac;B6N-Ahnak/H mutant strain MGI:4462489 Ahnak targeted mutation 1a, Mouse Biology Program, UCDavis MGI:1316648 Ahnak AHNAK nucleoprotein (desmoyokin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7247 + EM:07785 C57BL/6N-Agpat4/H EMMA sperm B6NTac;B6N-Agpat4/H mutant strain MGI:4362437 Agpat4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915512 Agpat4 1-acylglycerol-3-phosphate O-acyltransferase 4 (lysophosphatidic acid acyltransferase, delta) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7785 + EM:09754 C57BL/6N-Agl/H EMMA sperm mutant strain MGI:5692749 Agl targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1924809 Agl amylo-1,6-glucosidase, 4-alpha-glucanotransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9754 + EM:09569 C57BL/6N-Agl/H EMMA sperm B6NTac;B6N-Agl/H mutant strain MGI:5548686 Agl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924809 Agl amylo-1,6-glucosidase, 4-alpha-glucanotransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9569 - EM:05784 C57BL/6N-Agl/H EMMA sperm mutant strain MGI:4432988 Agl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924809 Agl amylo-1,6-glucosidase, 4-alpha-glucanotransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5784 ? EM:13907 C57BL/6N-Agbl5/WtsiCnbc EMMA sperm mutant strain MGI:6153272 Agbl5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2441745 Agbl5 ATP/GTP binding protein-like 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13907 + EM:09029 C57BL/6N-Afmid/H EMMA sperm mutant strain MGI:5692841 Afmid targeted mutation 1c, Wellcome Trust Sanger Institute MGI:2448704 Afmid arylformamidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9029 ? EM:14533 C57BL/6N-Afap1l1/WtsiIeg EMMA sperm mutant strain MGI:6120777 Afap1l1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2147199 Afap1l1 actin filament associated protein 1-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14533 + EM:13366 C57BL/6N-Adssl1/WtsiCnrm EMMA live mutant strain MGI:6153270 Adssl1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:87947 Adssl1 adenylosuccinate synthetase like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13366 + EM:11590 C57BL/6N-Adprs/WtsiIeg EMMA sperm C57BL/6N-Adprhl2/WtsiIeg mutant strain MGI:6140089 Adprs endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2140364 Adprs ADP-ribosylserine hydrolase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11590 + EM:11036 C57BL/6N-Adprm/Ieg EMMA sperm mutant strain MGI:5811623 Adprm targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1913608 Adprm ADP-ribose/CDP-alcohol diphosphatase, manganese dependent https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11036 + EM:10070 C57BL/6N-Adprm/Ieg EMMA sperm mutant strain MGI:4847769 Adprm targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913608 Adprm ADP-ribose/CDP-alcohol diphosphatase, manganese dependent https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10070 + EM:08492 C57BL/6N-Adipor2/H EMMA sperm mutant strain MGI:5286361 Adipor2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:93830 Adipor2 adiponectin receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8492 - EM:08491 C57BL/6N-Adipor1/H EMMA sperm B6NTac;B6N-A Adipor1/H mutant strain MGI:5289879 Adipor1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1919924 Adipor1 adiponectin receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8491 + EM:05781 C57BL/6N-Adh5/H EMMA sperm B6NTac;B6N-Adh5/H mutant strain MGI:4432854 Adh5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:87929 Adh5 alcohol dehydrogenase 5 (class III), chi polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5781 + EM:13402 C57BL/6N-Adgrd1/WtsiCnrm EMMA live mutant strain MGI:5548892 Adgrd1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3041203 Adgrd1 adhesion G protein-coupled receptor D1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13402 + EM:13535 C57BL/6N-Adcy9/WtsiKieg EMMA embryo mutant strain MGI:5636912 Adcy9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:108450 Adcy9 adenylate cyclase 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13535 + EM:13535 C57BL/6N-Adcy9/WtsiKieg EMMA sperm mutant strain MGI:5636912 Adcy9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:108450 Adcy9 adenylate cyclase 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13535 + EM:08506 C57BL/6N-Adcy1/H EMMA sperm mutant strain MGI:4441907 Adcy1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99677 Adcy1 adenylate cyclase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8506 + EM:11254 C57BL/6N-Adap2/H EMMA archived mutant strain MGI:5002963 Adap2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2663075 Adap2 ArfGAP with dual PH domains 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11254 + EM:08274 C57BL/6N-Adam23/H EMMA sperm mutant strain MGI:4462649 Adam23 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1345162 Adam23 a disintegrin and metallopeptidase domain 23 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8274 + EM:10836 C57BL/6N-Adam11/H EMMA sperm STOCK Adam11/H, BLA2525, DEPD00534_5_A01 mutant strain MGI:4840783 Adam11 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:1098667 Adam11 a disintegrin and metallopeptidase domain 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10836 - EM:05195 C57BL/6N-Acsbg2/H EMMA sperm mutant strain MGI:4432785 Acsbg2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3587728 Acsbg2 acyl-CoA synthetase bubblegum family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5195 - EM:05128 C57BL/6N-Acp2/H EMMA sperm mutant strain MGI:4431704 Acp2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:87882 Acp2 acid phosphatase 2, lysosomal https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5128 ? EM:13849 C57BL/6N-Acp1/WtsiCnbc EMMA sperm mutant strain MGI:6153269 Acp1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:87881 Acp1 acid phosphatase 1, soluble https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13849 + EM:09380 C57BL/6N-Acox2/Ph EMMA archived B6.Acox2em1 mutant strain MGI:5749441 Acox2 endonuclease-mediated mutation 1, Paul Van Veldhoven MGI:1934852 Acox2 acyl-Coenzyme A oxidase 2, branched chain https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9380 + EM:10125 C57BL/6N-Acmsd/Ieg EMMA sperm mutant strain MGI:5692813 Acmsd targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2386323 Acmsd amino carboxymuconate semialdehyde decarboxylase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10125 + EM:09634 C57BL/6N-Acmsd/Ieg EMMA archived mutant strain MGI:5014638 Acmsd targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2386323 Acmsd amino carboxymuconate semialdehyde decarboxylase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9634 + EM:13214 C57BL/6N-Acbd5/WtsiH EMMA live mutant strain MGI:5637073 Acbd5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921409 Acbd5 acyl-Coenzyme A binding domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13214 + EM:08115 C57BL/6N-Acbd3/Ieg EMMA sperm mutant strain MGI:5548778 Acbd3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2181074 Acbd3 acyl-Coenzyme A binding domain containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8115 + EM:06918 C57BL/6N-Acbd3/Ieg EMMA embryo mutant strain MGI:4458770 Acbd3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2181074 Acbd3 acyl-Coenzyme A binding domain containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6918 + EM:10224 C57BL/6N-Acan/H EMMA sperm mutant strain MGI:4434568 Acan targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99602 Acan aggrecan https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10224 + EM:14268 C57BL/6N-Acad12/WtsiPh EMMA live mutant strain MGI:6120791 Acad12 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443320 Acad12 acyl-Coenzyme A dehydrogenase family, member 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14268 ? EM:13857 C57BL/6N-Acaa2/WtsiCnbc EMMA sperm mutant strain MGI:6153268 Acaa2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1098623 Acaa2 acetyl-Coenzyme A acyltransferase 2 (mitochondrial 3-oxoacyl-Coenzyme A thiolase) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13857 + EM:10727 C57BL/6N-Abce1/H EMMA sperm mutant strain MGI:4841694 Abce1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1195458 Abce1 ATP-binding cassette, sub-family E (OABP), member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10727 + EM:11260 C57BL/6N-Abcc5/H EMMA sperm mutant strain MGI:4435775 Abcc5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1351644 Abcc5 ATP-binding cassette, sub-family C (CFTR/MRP), member 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11260 + EM:06958 C57BL/6N-Abcc2/H EMMA sperm B6NTac;B6N-Abcc2/H mutant strain MGI:4947743 Abcc2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1352447 Abcc2 ATP-binding cassette, sub-family C (CFTR/MRP), member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6958 ? EM:13745 C57BL/6N-Abcb5/WtsiOrl EMMA sperm mutant strain MGI:6153267 Abcb5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1924956 Abcb5 ATP-binding cassette, sub-family B (MDR/TAP), member 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13745 + EM:08089 C57BL/6N-Abcb11/Ieg EMMA embryo C57BL/6N-Abcb11/Hmgu mutant strain MGI:5548476 Abcb11 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1351619 Abcb11 ATP-binding cassette, sub-family B (MDR/TAP), member 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8089 ? EM:14394 C57BL/6N-A Zswim7/WtsiOrl EMMA sperm mutant strain MGI:5287783 Zswim7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916997 Zswim7 zinc finger SWIM-type containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14394 - EM:07669 C57BL/6N-A Zranb1/IcsOrl EMMA sperm mutant strain MGI:4435532 Zranb1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:106441 Zranb1 zinc finger, RAN-binding domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7669 ? EM:14378 C57BL/6N-A Zp1/WtsiOulu EMMA embryo mutant strain MGI:4454080 Zp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:103073 Zp1 zona pellucida glycoprotein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14378 ? EM:14378 C57BL/6N-A Zp1/WtsiOulu EMMA sperm mutant strain MGI:4454080 Zp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:103073 Zp1 zona pellucida glycoprotein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14378 - EM:07385 C57BL/6N-A Zfyve28/WtsiH EMMA sperm B6NTac;B6N-A Zfyve28/WtsiH, EPD0431_1_B06 mutant strain MGI:4432231 Zfyve28 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2684992 Zfyve28 zinc finger, FYVE domain containing 28 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7385 + EM:09396 C57BL/6N-A Zfp879/WtsiOrl EMMA sperm mutant strain MGI:4451426 Zfp879 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:3053099 Zfp879 zinc finger protein 879 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9396 + EM:07512 C57BL/6N-A Zfp84/WtsiOrl EMMA sperm B6NTac;B6N-A Zfp84/WtsiOrl mutant strain MGI:4944422 Zfp84 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107780 Zfp84 zinc finger protein 84 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7512 - EM:08154 C57BL/6N-A Zfp791/WtsiH EMMA sperm B6NTac;B6N-A Zfp791/WtsiH, EPD0729_1_C05 mutant strain MGI:4939698 Zfp791 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3648473 Zfp791 zinc finger protein 791 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8154 - EM:06974 C57BL/6N-A Zfp719/WtsiIeg EMMA sperm mutant strain MGI:4431958 Zfp719 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444708 Zfp719 zinc finger protein 719 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6974 + EM:10708 C57BL/6N-A Zfp664/WtsiIeg EMMA sperm mutant strain MGI:4887721 Zfp664 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442505 Zfp664 zinc finger protein 664 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10708 + EM:07202 C57BL/6N-A Zfp658/WtsiH EMMA sperm B6NTac;B6N-A Zfp658/WtsiH mutant strain MGI:4433212 Zfp658 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2652821 Zfp658 zinc finger protein 658 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7202 ? EM:14027 C57BL/6N-A Zfp618/WtsiPh EMMA sperm mutant strain MGI:4841054 Zfp618 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919950 Zfp618 zinc finger protein 618 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14027 - EM:07383 C57BL/6N-A Zfp616/WtsiH EMMA sperm B6NTac;B6N-A Zfp616/WtsiH, EPD0756_1_D07 mutant strain MGI:4944324 Zfp616 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3650906 Zfp616 zinc finger protein 616 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7383 + EM:07207 C57BL/6N-A Zfp523/WtsiH EMMA sperm B6NTac;B6N-A Zfp523/WtsiH mutant strain MGI:4432173 Zfp523 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2687278 Zfp523 zinc finger protein 523 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7207 ? EM:14372 C57BL/6N-A Zfp426/WtsiOrl EMMA sperm mutant strain MGI:4363568 Zfp426 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920248 Zfp426 zinc finger protein 426 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14372 + EM:07958 C57BL/6N-A Zfp408/WtsiH EMMA sperm B6NTac;B6N-A Zfp408/WtsiHq, B6NTac;B6N-Zfp408 A/WtsiH mutant strain MGI:4433343 Zfp408 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685857 Zfp408 zinc finger protein 408 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7958 + EM:13998 C57BL/6N-A Zfp292/WtsiH EMMA live mutant strain MGI:5013780 Zfp292 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1353423 Zfp292 zinc finger protein 292 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13998 + EM:08933 C57BL/6N-A Zfp266/WtsiOulu EMMA embryo mutant strain MGI:4441662 Zfp266 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924769 Zfp266 zinc finger protein 266 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8933 + EM:08933 C57BL/6N-A Zfp266/WtsiOulu EMMA sperm mutant strain MGI:4441662 Zfp266 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924769 Zfp266 zinc finger protein 266 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8933 + EM:08930 C57BL/6N-A Zfp239/WtsiOulu EMMA embryo mutant strain MGI:5050161 Zfp239 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1306812 Zfp239 zinc finger protein 239 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8930 + EM:08930 C57BL/6N-A Zfp239/WtsiOulu EMMA sperm mutant strain MGI:5050161 Zfp239 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1306812 Zfp239 zinc finger protein 239 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8930 + EM:13970 C57BL/6N-A Zfp182/WtsiOulu EMMA embryo mutant strain MGI:4841252 Zfp182 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442220 Zfp182 zinc finger protein 182 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13970 + EM:13970 C57BL/6N-A Zfp182/WtsiOulu EMMA sperm mutant strain MGI:4841252 Zfp182 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442220 Zfp182 zinc finger protein 182 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13970 - EM:06862 C57BL/6N-A Zfp142/WtsiBiat EMMA sperm mutant strain MGI:4460442 Zfp142 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924514 Zfp142 zinc finger protein 142 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6862 + EM:11562 C57BL/6N-A Zc3h14/WtsiIeg EMMA sperm mutant strain MGI:4419828 Zc3h14 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919824 Zc3h14 zinc finger CCCH type containing 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11562 + EM:08889 C57BL/6N-A Zbed5/WtsiIeg EMMA sperm EPD0593_5_A08, C57BL/6N-A Chchd2l/WtsiIeg mutant strain MGI:4460500 Zbed5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919220 Zbed5 zinc finger BED-type containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8889 - EM:06991 C57BL/6N-A Ypel4/WtsiIeg EMMA sperm mutant strain MGI:4456736 Ypel4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3605071 Ypel4 yippee like 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6991 + EM:09393 C57BL/6N-A Yipf7/WtsiOrl EMMA sperm mutant strain MGI:4452709 Yipf7 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1922831 Yipf7 Yip1 domain family, member 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9393 - EM:07695 C57BL/6N-A Yipf5/IcsOrl EMMA archived STOCK Yipf5/IcsOrl mutant strain MGI:4436322 Yipf5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914430 Yipf5 Yip1 domain family, member 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7695 - EM:07404 C57BL/6N-A Ydjc/WtsiH EMMA sperm B6NTac;B6N-A Ydjc/WtsiH, EPD0408_2_C01 mutant strain MGI:4419362 Ydjc targeted mutation 1, Wellcome Trust Sanger Institute MGI:1916351 Ydjc YdjC homolog (bacterial) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7404 - EM:08048 C57BL/6N-A Xxylt1/WtsiBiat EMMA sperm mutant strain MGI:4456689 Xxylt1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2146443 Xxylt1 xyloside xylosyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8048 + EM:10567 C57BL/6N-A Xpo6/Oulu EMMA embryo mutant strain MGI:4362245 Xpo6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2429950 Xpo6 exportin 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10567 + EM:10567 C57BL/6N-A Xpo6/Oulu EMMA sperm mutant strain MGI:4362245 Xpo6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2429950 Xpo6 exportin 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10567 + EM:08521 C57BL/6N-A Xpnpep1/WtsiH EMMA sperm mutant strain MGI:4419636 Xpnpep1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2180003 Xpnpep1 X-prolyl aminopeptidase (aminopeptidase P) 1, soluble https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8521 - EM:06088 C57BL/6N-A Xndc1/WtsiCnbc EMMA sperm mutant strain MGI:4441710 Xndc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109527 Trpc2 transient receptor potential cation channel, subfamily C, member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6088 - EM:07183 C57BL/6N-A Xkrx/WtsiCnrm EMMA sperm mutant strain MGI:4453683 Xkrx targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3584011 Xkrx X-linked Kx blood group related, X-linked https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7183 - EM:07210 C57BL/6N-A Wrap53/WtsiH EMMA sperm B6NTac;B6N-A Wrap53/WtsiH mutant strain MGI:4842597 Wrap53 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384933 Wrap53 WD repeat containing, antisense to Trp53 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7210 - EM:06106 C57BL/6N-A Wnt3/WtsiCnbc EMMA sperm mutant strain MGI:4455951 Wnt3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:98955 Wnt3 wingless-type MMTV integration site family, member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6106 - EM:06859 C57BL/6N-A Wnt16/WtsiBiat EMMA sperm mutant strain MGI:4840661 Wnt16 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2136018 Wnt16 wingless-type MMTV integration site family, member 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6859 - EM:06982 C57BL/6N-A Wfikkn2/WtsiIeg EMMA sperm mutant strain MGI:4455985 Wfikkn2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2669209 Wfikkn2 WAP, follistatin/kazal, immunoglobulin, kunitz and netrin domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6982 + EM:14079 C57BL/6N-A Wfdc6a/WtsiH EMMA live mutant strain MGI:5141846 Wfdc6a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2684968 Wfdc6a WAP four-disulfide core domain 6A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14079 + EM:10597 C57BL/6N-A Wdr89/WtsiBiat EMMA sperm mutant strain MGI:4944354 Wdr89 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919588 Wdr89 WD repeat domain 89 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10597 - EM:06856 C57BL/6N-A Wdr59/WtsiBiat EMMA sperm mutant strain MGI:4461692 Wdr59 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442115 Wdr59 WD repeat domain 59 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6856 + EM:10185 C57BL/6N-A Washc2/WtsiCnrm EMMA sperm mutant strain MGI:4455547 Washc2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:106463 Washc2 WASH complex subunit 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10185 + EM:09280 C57BL/6N-A Wac/WtsiPh EMMA sperm mutant strain MGI:5527595 Wac targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2387357 Wac WW domain containing adaptor with coiled-coil https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9280 + EM:14072 C57BL/6N-A Vwa5b2/WtsiOulu EMMA embryo mutant strain MGI:4419897 Vwa5b2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2681859 Vwa5b2 von Willebrand factor A domain containing 5B2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14072 + EM:14072 C57BL/6N-A Vwa5b2/WtsiOulu EMMA sperm mutant strain MGI:4419897 Vwa5b2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2681859 Vwa5b2 von Willebrand factor A domain containing 5B2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14072 + EM:08747 C57BL/6N-A Vps72/WtsiOrl EMMA sperm mutant strain MGI:5008033 Vps72 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202305 Vps72 vacuolar protein sorting 72 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8747 - EM:07387 C57BL/6N-A Vps51/WtsiH EMMA sperm EPD0578_1_F02, B6NTac;B6N-A Vps51/WtsiH mutant strain MGI:4458528 Vps51 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915755 Vps51 VPS51 GARP complex subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7387 - EM:07849 C57BL/6N-A Vps33b/WtsiOrl EMMA sperm mutant strain MGI:4431968 Vps33b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446237 Vps33b vacuolar protein sorting 33B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7849 - EM:07284 C57BL/6N-A Vps13a/WtsiIeg EMMA sperm mutant strain MGI:4842502 Vps13a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444304 Vps13a vacuolar protein sorting 13A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7284 + EM:08695 C57BL/6N-A Virma/WtsiH EMMA sperm C57BL/6N-A 1110037F02Rik/WtsiH, C57BL/6N-1110037F02Rik/Wtsi mutant strain MGI:4880937 Virma targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913435 Virma vir like m6A methyltransferase associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8695 + EM:09390 C57BL/6N-A Vamp3/WtsiOrl EMMA sperm mutant strain MGI:5527590 Vamp3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1321389 Vamp3 vesicle-associated membrane protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9390 + EM:09849 C57BL/6N-A Usp5/WtsiPh EMMA sperm mutant strain MGI:4942058 Usp5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1347343 Usp5 ubiquitin specific peptidase 5 (isopeptidase T) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9849 - EM:05904 C57BL/6N-A Usp4/WtsiIeg EMMA sperm mutant strain MGI:4431578 Usp4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98905 Usp4 ubiquitin specific peptidase 4 (proto-oncogene) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5904 + EM:10826 C57BL/6N-A Usp44/WtsiBiat EMMA sperm mutant strain MGI:4455886 Usp44 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3045318 Usp44 ubiquitin specific peptidase 44 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10826 + EM:09734 C57BL/6N-A Usp30/WtsiH EMMA sperm mutant strain MGI:5511766 Usp30 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2140991 Usp30 ubiquitin specific peptidase 30 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9734 + EM:09977 C57BL/6N-A Usp25/IcsOrl EMMA sperm mutant strain MGI:4455349 Usp25 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:1353655 Usp25 ubiquitin specific peptidase 25 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9977 - EM:07280 C57BL/6N-A Usp21/WtsiBiat EMMA sperm mutant strain MGI:4887724 Usp21 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353665 Usp21 ubiquitin specific peptidase 21 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7280 + EM:10869 C57BL/6N-A Usp19/WtsiOulu EMMA embryo mutant strain MGI:5578483 Usp19 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918722 Usp19 ubiquitin specific peptidase 19 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10869 + EM:10869 C57BL/6N-A Usp19/WtsiOulu EMMA sperm mutant strain MGI:5578483 Usp19 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918722 Usp19 ubiquitin specific peptidase 19 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10869 + EM:10186 C57BL/6N-A Usp15/WtsiCnrm EMMA sperm mutant strain MGI:5008042 Usp15 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:101857 Usp15 ubiquitin specific peptidase 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10186 + EM:10352 C57BL/6N-A Usp13/WtsiBiat EMMA sperm mutant strain MGI:5544972 Usp13 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1919857 Usp13 ubiquitin specific peptidase 13 (isopeptidase T-3) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10352 - EM:08053 C57BL/6N-A Usp11/WtsiBiat EMMA archived mutant strain MGI:4419682 Usp11 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2384312 Usp11 ubiquitin specific peptidase 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8053 - EM:07325 C57BL/6N-A Ushbp1/WtsiIeg EMMA sperm mutant strain MGI:4460519 Ushbp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922920 Ushbp1 USH1 protein network component harmonin binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7325 - EM:06784 C57BL/6N-A Usf3/WtsiH EMMA sperm mutant strain MGI:5472989 Usf3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685454 Usf3 upstream transcription factor family member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6784 + EM:11566 C57BL/6N-A Usf1/WtsiIeg EMMA sperm mutant strain MGI:4419941 Usf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99542 Usf1 upstream transcription factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11566 + EM:08474 C57BL/6N-A Uri1/WtsiFlmg EMMA sperm mutant strain MGI:4942141 Uri1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1342294 Uri1 URI1, prefoldin-like chaperone https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8474 + EM:14365 C57BL/6N-A Uqcr11/WtsiH EMMA live mutant strain MGI:4434286 Uqcr11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913844 Uqcr11 ubiquinol-cytochrome c reductase, complex III subunit XI https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14365 + EM:10798 C57BL/6N-A Upk1b/WtsiH EMMA sperm mutant strain MGI:5287790 Upk1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98912 Upk1b uroplakin 1B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10798 + EM:11204 C57BL/6N-A Upb1/WtsiPh EMMA sperm mutant strain MGI:4441733 Upb1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2143535 Upb1 ureidopropionase, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11204 ? EM:14478 C57BL/6N-A Unk/WtsiBiat EMMA sperm mutant strain MGI:4880910 Unk targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442456 Unk unkempt family zinc finger https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14478 + EM:10985 C57BL/6N-A Umodl1/WtsiPh EMMA sperm mutant strain MGI:5289814 Umodl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929785 Umodl1 uromodulin-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10985 - EM:06853 C57BL/6N-A Ubxn10/WtsiCnrm EMMA sperm mutant strain MGI:4458847 Ubxn10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443123 Ubxn10 UBX domain protein 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6853 + EM:09827 C57BL/6N-A Ube2t/WtsiPh EMMA sperm mutant strain MGI:5000371 Ube2t targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914446 Ube2t ubiquitin-conjugating enzyme E2T https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9827 + EM:14352 C57BL/6N-A Ube2d1/WtsiH EMMA live mutant strain MGI:6324191 Ube2d1 targeted mutation 3e, Wellcome Trust Sanger Institute MGI:2384911 Ube2d1 ubiquitin-conjugating enzyme E2D 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14352 - EM:07397 C57BL/6N-A Ubash3a/WtsiH EMMA sperm EPD0736_4_B10, B6NTac;B6N-A Ubash3a/WtsiH mutant strain MGI:4940752 Ubash3a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926074 Ubash3a ubiquitin associated and SH3 domain containing, A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7397 ? EM:14040 C57BL/6N-A Tvp23a/WtsiOrl EMMA sperm mutant strain MGI:4419354 Tvp23a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3665441 Tvp23a trans-golgi network vesicle protein 23A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14040 + EM:11556 C57BL/6N-A Tut4/WtsiOulu EMMA embryo EPD0867_6_A06, C57BL/6N-A Zcchc11/WtsiOulu mutant strain MGI:5296547 Tut4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2445126 Tut4 terminal uridylyl transferase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11556 + EM:11556 C57BL/6N-A Tut4/WtsiOulu EMMA sperm EPD0867_6_A06, C57BL/6N-A Zcchc11/WtsiOulu mutant strain MGI:5296547 Tut4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2445126 Tut4 terminal uridylyl transferase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11556 + EM:09708 C57BL/6N-A Tuft1/WtsiOrl EMMA sperm mutant strain MGI:4419443 Tuft1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109572 Tuft1 tuftelin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9708 + EM:10744 C57BL/6N-A Tufm/Ics EMMA sperm mutant strain MGI:4842271 Tufm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923686 Tufm Tu translation elongation factor, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10744 - EM:07965 C57BL/6N-A Tuba3a/WtsiH EMMA sperm B6NTac;B6N-A Tuba3a/WtsiH mutant strain MGI:5052393 Tuba3a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1095406 Tuba3a tubulin, alpha 3A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7965 - EM:06984 C57BL/6N-A Ttll11/WtsiIeg EMMA sperm mutant strain MGI:4820338 Ttll11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921660 Ttll11 tubulin tyrosine ligase-like family, member 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6984 + EM:14387 C57BL/6N-A Ttll10/WtsiPh EMMA live mutant strain MGI:4458784 Ttll10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921855 Ttll10 tubulin tyrosine ligase-like family, member 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14387 + EM:13950 C57BL/6N-A Ttf2/WtsiH EMMA live mutant strain MGI:4441689 Ttf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921294 Ttf2 transcription termination factor, RNA polymerase II https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13950 ? EM:13946 C57BL/6N-A Tspyl2/WtsiIeg EMMA sperm mutant strain MGI:4880895 Tspyl2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106244 Tspyl2 TSPY-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13946 + EM:08744 C57BL/6N-A Trub2/WtsiOulu EMMA embryo mutant strain MGI:4840623 Trub2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2442186 Trub2 TruB pseudouridine (psi) synthase family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8744 + EM:08744 C57BL/6N-A Trub2/WtsiOulu EMMA sperm mutant strain MGI:4840623 Trub2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2442186 Trub2 TruB pseudouridine (psi) synthase family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8744 - EM:07852 C57BL/6N-A Trp53rkb/WtsiH EMMA sperm B6NTac;B6N-A Trp53rkb/WtsiH, B6NTac;B6N-A Trp53rk/WtsiH mutant strain MGI:4820320 Trp53rkb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914050 Trp53rkb transformation related protein 53 regulating kinase B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7852 - EM:07189 C57BL/6N-A Trmt2a/WtsiCnrm EMMA sperm mutant strain MGI:4840625 Trmt2a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:96270 Trmt2a TRM2 tRNA methyltransferase 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7189 + EM:09278 C57BL/6N-A Trim56/WtsiPh EMMA sperm mutant strain MGI:5527611 Trim56 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685298 Trim56 tripartite motif-containing 56 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9278 - EM:07120 C57BL/6N-A Trim29/WtsiCnrm EMMA sperm mutant strain MGI:4434517 Trim29 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919419 Trim29 tripartite motif-containing 29 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7120 + EM:10191 C57BL/6N-A Trim25/WtsiCnrm EMMA sperm mutant strain MGI:5511539 Trim25 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:102749 Trim25 tripartite motif-containing 25 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10191 - EM:06268 C57BL/6N-A Trim17/WtsiCnbc EMMA sperm mutant strain MGI:4452788 Trim17 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1861440 Trim17 tripartite motif-containing 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6268 + EM:14470 C57BL/6N-A Trappc9/WtsiPh EMMA live mutant strain MGI:4461737 Trappc9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923760 Trappc9 trafficking protein particle complex 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14470 - EM:07518 C57BL/6N-A Trappc10/WtsiOrl EMMA sperm mutant strain MGI:4419611 Trappc10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1336209 Trappc10 trafficking protein particle complex 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7518 + EM:09847 C57BL/6N-A Tram2/WtsiCnrm EMMA sperm mutant strain MGI:4949327 Tram2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924817 Tram2 translocating chain-associating membrane protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9847 + EM:08446 C57BL/6N-A Traf6/WtsiOulu EMMA embryo mutant strain MGI:4840586 Traf6 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:108072 Traf6 TNF receptor-associated factor 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8446 + EM:08446 C57BL/6N-A Traf6/WtsiOulu EMMA sperm mutant strain MGI:4840586 Traf6 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:108072 Traf6 TNF receptor-associated factor 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8446 + EM:08392 C57BL/6N-A Traf2/WtsiOrl EMMA sperm mutant strain MGI:4452008 Traf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:101835 Traf2 TNF receptor-associated factor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8392 - EM:07281 C57BL/6N-A Tor3a/WtsiIeg EMMA sperm mutant strain MGI:4820314 Tor3a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353652 Tor3a torsin family 3, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7281 ? EM:13180 C57BL/6N-A Tomm6/WtsiFlmg EMMA sperm mutant strain MGI:4940754 Tomm6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913369 Tomm6 translocase of outer mitochondrial membrane 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13180 - EM:06848 C57BL/6N-A Tomm20l/WtsiCnrm EMMA sperm mutant strain MGI:4441690 Tomm20l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922516 Tomm20l translocase of outer mitochondrial membrane 20-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6848 - EM:05971 C57BL/6N-A Tnik/WtsiBiat EMMA sperm mutant strain MGI:5002995 Tnik targeted mutation 3a, Wellcome Trust Sanger Institute MGI:1916264 Tnik TRAF2 and NCK interacting kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5971 + EM:10997 C57BL/6N-A Tnfsf18/WtsiPh EMMA sperm mutant strain MGI:5568469 Tnfsf18 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2673064 Tnfsf18 tumor necrosis factor (ligand) superfamily, member 18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10997 + EM:10677 C57BL/6N-A Tmprss6/Ics EMMA sperm mutant strain MGI:4433394 Tmprss6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919003 Tmprss6 transmembrane serine protease 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10677 + EM:10714 C57BL/6N-A Tmprss11c/WtsiIeg EMMA sperm mutant strain MGI:5299570 Tmprss11c targeted mutation 2a, Wellcome Trust Sanger Institute MGI:3521861 Tmprss11c transmembrane protease, serine 11c https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10714 + EM:10697 C57BL/6N-A Tmod1/WtsiIeg EMMA sperm mutant strain MGI:4461475 Tmod1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98775 Tmod1 tropomodulin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10697 - EM:05392 C57BL/6N-A Tmem98/WtsiCnbc EMMA embryo mutant strain MGI:4432615 Tmem98 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923457 Tmem98 transmembrane protein 98 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5392 - EM:05392 C57BL/6N-A Tmem98/WtsiCnbc EMMA sperm mutant strain MGI:4432615 Tmem98 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923457 Tmem98 transmembrane protein 98 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5392 ? EM:14350 C57BL/6N-A Tmem74b/WtsiOrl EMMA sperm mutant strain MGI:4455528 Tmem74b targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1918629 Tmem74b transmembrane protein 74B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14350 + EM:14000 C57BL/6N-A Tmem71/WtsiOulu EMMA embryo mutant strain MGI:4849968 Tmem71 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2146049 Tmem71 transmembrane protein 71 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14000 + EM:14000 C57BL/6N-A Tmem71/WtsiOulu EMMA sperm mutant strain MGI:4849968 Tmem71 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2146049 Tmem71 transmembrane protein 71 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14000 + EM:10225 C57BL/6N-A Tmem50b/Ics EMMA sperm mutant strain MGI:4433648 Tmem50b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1925225 Tmem50b transmembrane protein 50B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10225 + EM:10225 C57BL/6N-A Tmem50b/Ics EMMA live mutant strain MGI:4433648 Tmem50b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1925225 Tmem50b transmembrane protein 50B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10225 - EM:08045 C57BL/6N-A Tmem42/WtsiBiat EMMA sperm mutant strain MGI:5052383 Tmem42 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1277176 Tmem42 transmembrane protein 42 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8045 + EM:11749 C57BL/6N-A Tmem37/WtsiCnrm EMMA sperm mutant strain MGI:4441685 Tmem37 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2157899 Tmem37 transmembrane protein 37 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11749 + EM:09580 C57BL/6N-A Tmem30a/WtsiPh EMMA sperm mutant strain MGI:5286179 Tmem30a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106402 Tmem30a transmembrane protein 30A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9580 - EM:07374 C57BL/6N-A Tmem254b/WtsiH EMMA sperm EPD0753_2_H08, B6NTac;B6N-A Tmem254b/WtsiH, B6NTac;B6N-A Tmem254/WtsiH mutant strain MGI:4944325 Tmem254 targeted mutation 2a, Wellcome Trust Sanger Institute Tmem254b withdrawn, = Tmem254 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7374 - EM:07025 C57BL/6N-A Tmem241/WtsiOulu EMMA embryo mutant strain MGI:4948650 Tmem241 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442435 Tmem241 transmembrane protein 241 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7025 - EM:07025 C57BL/6N-A Tmem241/WtsiOulu EMMA sperm mutant strain MGI:4948650 Tmem241 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442435 Tmem241 transmembrane protein 241 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7025 ? EM:14119 C57BL/6N-A Tmem211/WtsiPh EMMA sperm mutant strain MGI:4888873 Lhfpl7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685700 Lhfpl7 LHFPL tetraspan subfamily member 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14119 + EM:09609 C57BL/6N-A Tmem18/WtsiOulu EMMA embryo mutant strain MGI:4842746 Tmem18 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2387176 Tmem18 transmembrane protein 18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9609 + EM:09609 C57BL/6N-A Tmem18/WtsiOulu EMMA sperm mutant strain MGI:4842746 Tmem18 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2387176 Tmem18 transmembrane protein 18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9609 + EM:08447 C57BL/6N-A Tmem127/WtsiOulu EMMA embryo mutant strain MGI:4419725 Tmem127 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1916720 Tmem127 transmembrane protein 127 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8447 + EM:08260 C57BL/6N-A Tmem126a/WtsiCnrm EMMA sperm mutant strain MGI:4432149 Tmem126a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913521 Tmem126a transmembrane protein 126A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8260 + EM:11565 C57BL/6N-A Tmco2/WtsiIeg EMMA archived mutant strain MGI:4419673 Tmco2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916719 Tmco2 transmembrane and coiled-coil domains 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11565 - EM:07177 C57BL/6N-A Tmc3/WtsiH EMMA sperm mutant strain MGI:4455516 Tmc3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2669033 Tmc3 transmembrane channel-like gene family 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7177 + EM:14066 C57BL/6N-A Tmbim1/WtsiH EMMA live mutant strain MGI:5284926 Tmbim1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916910 Tmbim1 transmembrane BAX inhibitor motif containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14066 + EM:11275 C57BL/6N-A Tlcd3b/Ics EMMA sperm C57BL/6N-A Fam57b/Ics mutant strain MGI:4462642 Tlcd3b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916202 Tlcd3b TLC domain containing 3B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11275 - EM:07029 C57BL/6N-A Timmdc1/WtsiOulu EMMA embryo mutant strain MGI:4441702 Timmdc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922139 Timmdc1 translocase of inner mitochondrial membrane domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7029 - EM:07029 C57BL/6N-A Timmdc1/WtsiOulu EMMA sperm mutant strain MGI:4441702 Timmdc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922139 Timmdc1 translocase of inner mitochondrial membrane domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7029 ? EM:13190 C57BL/6N-A Timm9/WtsiFlmg EMMA sperm mutant strain MGI:4820271 Timm9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353436 Timm9 translocase of inner mitochondrial membrane 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13190 + EM:10347 C57BL/6N-A Timeless/WtsiBiat EMMA sperm mutant strain MGI:5286357 Timeless targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1321393 Timeless timeless circadian clock 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10347 + EM:09761 C57BL/6N-A Tial1/WtsiH EMMA sperm mutant strain MGI:4432495 Tial1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107913 Tial1 Tia1 cytotoxic granule-associated RNA binding protein-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9761 + EM:14117 C57BL/6N-A Thada/WtsiOulu EMMA embryo mutant strain MGI:4887588 Thada targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3039623 Thada thyroid adenoma associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14117 + EM:14117 C57BL/6N-A Thada/WtsiOulu EMMA sperm mutant strain MGI:4887588 Thada targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3039623 Thada thyroid adenoma associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14117 + EM:09167 C57BL/6N-A Tgm6/WtsiPh EMMA sperm mutant strain MGI:4841076 Tgm6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3044321 Tgm6 transglutaminase 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9167 - EM:05979 C57BL/6N-A Tff1/WtsiBiat EMMA sperm mutant strain MGI:4433486 Tff1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88135 Tff1 trefoil factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5979 - EM:07195 C57BL/6N-A Tfdp2/WtsiCnrm EMMA sperm mutant strain MGI:5014714 Tfdp2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107167 Tfdp2 transcription factor Dp 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7195 + EM:10699 C57BL/6N-A Tex261/WtsiIeg EMMA sperm mutant strain MGI:4441776 Tex261 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1096575 Tex261 testis expressed gene 261 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10699 + EM:09888 C57BL/6N-A Tet1/WtsiOrl EMMA sperm mutant strain MGI:5286193 Tet1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098693 Tet1 tet methylcytosine dioxygenase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9888 + EM:10182 C57BL/6N-A Tepsin/WtsiCnrm EMMA sperm mutant strain MGI:4840947 Tepsin targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926027 Tepsin TEPSIN, adaptor related protein complex 4 accessory protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10182 + EM:08485 C57BL/6N-A Tent5c/WtsiFlmg EMMA sperm EPD0824_2_A02, C57BL/6N-A Fam46c/WtsiFlmg mutant strain MGI:5085347 Tent5c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921895 Tent5c terminal nucleotidyltransferase 5C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8485 + EM:10796 C57BL/6N-A Tead3/WtsiH EMMA embryo mutant strain MGI:4431809 Tead3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109241 Tead3 TEA domain family member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10796 ? EM:13182 C57BL/6N-A Tcte1/WtsiFlmg EMMA sperm mutant strain MGI:4820083 Tcte1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98640 Tcte1 t-complex-associated testis expressed 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13182 + EM:08510 C57BL/6N-A Tcp11/WtsiIeg EMMA sperm mutant strain MGI:4842472 Tcp11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98544 Tcp11 t-complex protein 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8510 ? EM:14085 C57BL/6N-A Tcl1b5/WtsiOrl EMMA sperm mutant strain MGI:5013743 Tcl1b5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1351635 Tcl1b5 T cell leukemia/lymphoma 1B, 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14085 + EM:08892 C57BL/6N-A Tchp/WtsiIeg EMMA sperm mutant strain MGI:4433203 Tchp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1925082 Tchp trichoplein, keratin filament binding https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8892 ? EM:13186 C57BL/6N-A Tcerg1l/WtsiFlmg EMMA sperm mutant strain MGI:4820071 Tcerg1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917821 Tcerg1l transcription elongation regulator 1-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13186 + EM:07601 C57BL/6N-A Tceal9/WtsiCnrm EMMA sperm B6NTac;B6N-A Wbp5/WtsiCnrm, C57BL/6N-A Wbp5/WtsiCnrm mutant strain MGI:4455578 Tceal9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109567 Tceal9 transcription elongation factor A like 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7601 - EM:07482 C57BL/6N-A Tceal5/WtsiOulu EMMA embryo mutant strain MGI:4451413 Tceal5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3036236 Tceal5 transcription elongation factor A (SII)-like 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7482 - EM:07482 C57BL/6N-A Tceal5/WtsiOulu EMMA sperm mutant strain MGI:4451413 Tceal5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3036236 Tceal5 transcription elongation factor A (SII)-like 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7482 + EM:14124 C57BL/6N-A Tcam1/WtsiH EMMA live mutant strain MGI:4441899 Tcam1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1923120 Tcam1 testicular cell adhesion molecule 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14124 - EM:08628 C57BL/6N-A Tbc1d22a/WtsiH EMMA sperm B6NTac;B6N-A Tbc1d22a/WtsiH, B6NTac;B6N-A Tbc1d22a/Wtsib mutant strain MGI:5014583 Tbc1d22a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1289265 Tbc1d22a TBC1 domain family, member 22a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8628 - EM:06093 C57BL/6N-A Tatdn3/WtsiCnbc EMMA sperm mutant strain MGI:4431994 Tatdn3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916222 Tatdn3 TatD DNase domain containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6093 + EM:11308 C57BL/6N-A Taok2/Ics EMMA sperm mutant strain MGI:4434943 Taok2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915919 Taok2 TAO kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11308 + EM:11280 C57BL/6N-A Taf11/WtsiOrl EMMA sperm mutant strain MGI:4842481 Taf11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916026 Taf11 TATA-box binding protein associated factor 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11280 - EM:07273 C57BL/6N-A Syt16/WtsiIeg EMMA sperm mutant strain MGI:4842316 Syt16 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2673872 Syt16 synaptotagmin XVI https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7273 + EM:10470 C57BL/6N-A Syap1/Biat EMMA sperm mutant strain MGI:4841544 Syap1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914293 Syap1 synapse associated protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10470 + EM:14368 C57BL/6N-A Sv2c/WtsiH EMMA live mutant strain MGI:4441757 Sv2c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922459 Sv2c synaptic vesicle glycoprotein 2c https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14368 + EM:09473 C57BL/6N-A Supt5/WtsiH EMMA sperm mutant strain MGI:4840996 Supt5 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1202400 Supt5 suppressor of Ty 5, DSIF elongation factor subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9473 + EM:08486 C57BL/6N-A Sult1c1/WtsiFlmg EMMA sperm mutant strain MGI:4841111 Sult1c1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102928 Sult1c1 sulfotransferase family, cytosolic, 1C, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8486 + EM:07199 C57BL/6N-A Stxbp4/WtsiH EMMA sperm B6NTac;B6N-A Stxbp4/WtsiH mutant strain MGI:4441932 Stxbp4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1342296 Stxbp4 syntaxin binding protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7199 - EM:05983 C57BL/6N-A Stk32a/WtsiBiat EMMA sperm B6NTac;B6N-A Stk32a/WtsiBiat mutant strain MGI:4433325 Stk32a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442403 Stk32a serine/threonine kinase 32A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5983 - EM:06814 C57BL/6N-A Stimate/Wtsi EMMA archived mutant strain MGI:4451382 Stimate targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1921500 Stimate STIM activating enhancer https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6814 + EM:11882 C57BL/6N-A Stau2/WtsiH EMMA sperm mutant strain MGI:4431690 Stau2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1352508 Stau2 staufen double-stranded RNA binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11882 + EM:07188 C57BL/6N-A Stard8/WtsiH EMMA sperm B6NTac;B6N-A Stard8/WtsiH mutant strain MGI:4434109 Stard8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2448556 Stard8 START domain containing 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7188 + EM:08931 C57BL/6N-A Ssr2/WtsiOulu EMMA embryo mutant strain MGI:4842268 Ssr2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913506 Ssr2 signal sequence receptor, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8931 + EM:08931 C57BL/6N-A Ssr2/WtsiOulu EMMA sperm mutant strain MGI:4842268 Ssr2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913506 Ssr2 signal sequence receptor, beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8931 + EM:06740 C57BL/6N-A Ssbp1/WtsiH EMMA sperm C57BL/6N-Ssbp1/Wtsi mutant strain MGI:4938520 Ssbp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920040 Ssbp1 single-stranded DNA binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6740 + EM:08520 C57BL/6N-A Srsf7/WtsiH EMMA sperm mutant strain MGI:4433826 Srsf7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926232 Srsf7 serine and arginine-rich splicing factor 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8520 - EM:07126 C57BL/6N-A Srrm4/WtsiCnrm EMMA sperm mutant strain MGI:4451952 Srrm4 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1916205 Srrm4 serine/arginine repetitive matrix 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7126 + EM:08929 C57BL/6N-A Sqle/WtsiOulu EMMA embryo mutant strain MGI:4431854 Sqle targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109296 Sqle squalene epoxidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8929 + EM:08929 C57BL/6N-A Sqle/WtsiOulu EMMA sperm mutant strain MGI:4431854 Sqle targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109296 Sqle squalene epoxidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8929 + EM:09816 C57BL/6N-A Spink14/WtsiPh EMMA sperm mutant strain MGI:4841420 Spink14 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:3646952 Spink14 serine peptidase inhibitor, Kazal type 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9816 - EM:07389 C57BL/6N-A Spink10/WtsiH EMMA sperm EPD0671_2_A06, B6NTac;B6N-A Spink10/WtsiH mutant strain MGI:4841128 Spink10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3584533 Spink10 serine peptidase inhibitor, Kazal type 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7389 + EM:09850 C57BL/6N-A Spata25/WtsiPh EMMA sperm mutant strain MGI:4451280 Spata25 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1922892 Spata25 spermatogenesis associated 25 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9850 + EM:11281 C57BL/6N-A Snx8/WtsiOrl EMMA sperm mutant strain MGI:5546671 Snx8 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2443816 Snx8 sorting nexin 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11281 - EM:06776 C57BL/6N-A Snrnp27/WtsiH EMMA sperm mutant strain MGI:4842426 Snrnp27 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913868 Snrnp27 small nuclear ribonucleoprotein 27 (U4/U6.U5) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6776 ? EM:14077 C57BL/6N-A Smpd4/WtsiIeg EMMA sperm mutant strain MGI:4841172 Smpd4 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1924876 Smpd4 sphingomyelin phosphodiesterase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14077 + EM:10195 C57BL/6N-A Smg9/WtsiCnrm EMMA sperm mutant strain MGI:4433646 Smg9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919247 Smg9 SMG9 nonsense mediated mRNA decay factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10195 + EM:10349 C57BL/6N-A Smg1/WtsiBiat EMMA sperm mutant strain MGI:5497170 Smg1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1919742 Smg1 SMG1 nonsense mediated mRNA decay associated PI3K related kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10349 + EM:09982 C57BL/6N-A Smc5/IcsOrl EMMA sperm mutant strain MGI:4419231 Smc5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385088 Smc5 structural maintenance of chromosomes 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9982 - EM:07197 C57BL/6N-A Slx4ip/WtsiH EMMA sperm C57BL/6N-Slx4ip/WtsiH, B6NTac;B6N-A Slx4ip/WtsiH, B6NTac;B6N-Slx4ip A/WtsiH mutant strain MGI:4433347 Slx4ip targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921493 Slx4ip SLX4 interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7197 ? EM:14112 C57BL/6N-A Slitrk4/WtsiOrl EMMA sperm mutant strain MGI:4460289 Slitrk4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442509 Slitrk4 SLIT and NTRK-like family, member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14112 + EM:07206 C57BL/6N-A Slfnl1/WtsiH EMMA sperm B6NTac;B6N-A Slfnl1/WtsiH mutant strain MGI:4453731 Slfnl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3045330 Slfnl1 schlafen like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7206 + EM:13961 C57BL/6N-A Slfn9/WtsiH EMMA live mutant strain MGI:5286383 Slfn9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2445121 Slfn9 schlafen 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13961 - EM:10585 C57BL/6N-A Slc9a3r2/WtsiPh EMMA sperm C57BL/6N-A Nherf2/WtsiPh mutant strain MGI:5511797 Nherf2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1890662 Nherf2 NHERF family PDZ scaffold protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10585 + EM:08741 C57BL/6N-A Slc5a7/WtsiH EMMA sperm mutant strain MGI:4942035 Slc5a7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927126 Slc5a7 solute carrier family 5 (choline transporter), member 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8741 + EM:12195 C57BL/6N-A Slc38a4/WtsiIeg EMMA sperm mutant strain MGI:4431996 Slc38a4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916604 Slc38a4 solute carrier family 38, member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12195 + EM:09889 C57BL/6N-A Slc38a2/WtsiPh EMMA sperm mutant strain MGI:5293947 Slc38a2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915010 Slc38a2 solute carrier family 38, member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9889 + EM:10868 C57BL/6N-A Slc35f2/WtsiOulu EMMA embryo mutant strain MGI:4441953 Slc35f2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919272 Slc35f2 solute carrier family 35, member F2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10868 + EM:10868 C57BL/6N-A Slc35f2/WtsiOulu EMMA sperm mutant strain MGI:4441953 Slc35f2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919272 Slc35f2 solute carrier family 35, member F2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10868 - EM:07211 C57BL/6N-A Slc31a2/WtsiCnrm EMMA sperm mutant strain MGI:4432041 Slc31a2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1333844 Slc31a2 solute carrier family 31, member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7211 + EM:06192 C57BL/6N-A Slc25a4/WtsiH EMMA sperm B6NTac;B6N-A Slc25a4/WtsiH, C57BL/6N-Slc25a4/Wtsi mutant strain MGI:4432177 Slc25a4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353495 Slc25a4 solute carrier family 25 (mitochondrial carrier, adenine nucleotide translocator), member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6192 - EM:07274 C57BL/6N-A Slc25a30/WtsiIeg EMMA sperm mutant strain MGI:4842343 Slc25a30 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914804 Slc25a30 solute carrier family 25, member 30 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7274 + EM:09787 C57BL/6N-A Slc25a28/WtsiIeg EMMA sperm mutant strain MGI:4452777 Slc25a28 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2180509 Slc25a28 solute carrier family 25, member 28 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9787 - EM:07028 C57BL/6N-A Slc25a20/WtsiOulu EMMA embryo mutant strain MGI:4431570 Slc25a20 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928738 Slc25a20 solute carrier family 25 (mitochondrial carnitine/acylcarnitine translocase), member 20 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7028 - EM:07028 C57BL/6N-A Slc25a20/WtsiOulu EMMA sperm mutant strain MGI:4431570 Slc25a20 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928738 Slc25a20 solute carrier family 25 (mitochondrial carnitine/acylcarnitine translocase), member 20 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7028 - EM:07209 C57BL/6N-A Slc16a4/WtsiH EMMA sperm mutant strain MGI:4840599 Slc16a4 targeted mutation 2e, Wellcome Trust Sanger Institute MGI:2385183 Slc16a4 solute carrier family 16 (monocarboxylic acid transporters), member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7209 + EM:09613 C57BL/6N-A Slamf9/WtsiOulu EMMA embryo mutant strain MGI:4433560 Slamf9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923692 Slamf9 SLAM family member 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9613 + EM:09613 C57BL/6N-A Slamf9/WtsiOulu EMMA sperm mutant strain MGI:4433560 Slamf9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923692 Slamf9 SLAM family member 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9613 + EM:12432 C57BL/6N-A Sik3/WtsiOrl EMMA sperm mutant strain MGI:5085429 Sik3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2446296 Sik3 SIK family kinase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12432 + EM:08381 C57BL/6N-A Sh3pxd2a/WtsiCnrm EMMA sperm mutant strain MGI:4842409 Sh3pxd2a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1298393 Sh3pxd2a SH3 and PX domains 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8381 + EM:10820 C57BL/6N-A Sh3bp4/WtsiPh EMMA sperm mutant strain MGI:4433523 Sh3bp4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2138297 Sh3bp4 SH3-domain binding protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10820 - EM:07198 C57BL/6N-A Sh3bgrl3/WtsiH EMMA sperm B6NTac;B6N-A Sh3bgrl3/WtsiH, EPD0530_1_F04 mutant strain MGI:4840634 Sh3bgrl3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1920973 Sh3bgrl3 SH3 domain binding glutamic acid-rich protein-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7198 - EM:07282 C57BL/6N-A Sh2d5/WtsiOulu EMMA embryo mutant strain MGI:4432348 Sh2d5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446215 Sh2d5 SH2 domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7282 - EM:07282 C57BL/6N-A Sh2d5/WtsiOulu EMMA sperm mutant strain MGI:4432348 Sh2d5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446215 Sh2d5 SH2 domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7282 - EM:07807 C57BL/6N-A Sgsm1/WtsiOrl EMMA sperm mutant strain MGI:4949373 Sgsm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107320 Sgsm1 small G protein signaling modulator 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7807 + EM:09471 C57BL/6N-A Sgms1/WtsiH EMMA sperm Sgms1 Knockout 1 EPD0725_2_G05 mutant strain MGI:4950245 Sgms1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444110 Sgms1 sphingomyelin synthase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9471 ? EM:13179 C57BL/6N-A Sfpq/WtsiFlmg EMMA sperm mutant strain MGI:4847863 Sfpq targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918764 Sfpq splicing factor proline/glutamine rich (polypyrimidine tract binding protein associated) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13179 + EM:09966 C57BL/6N-A Sez6l2/IcsOrl EMMA sperm mutant strain MGI:5285738 Sez6l2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385295 Sez6l2 seizure related 6 homolog like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9966 + EM:09970 C57BL/6N-A Setx/IcsOrl EMMA sperm mutant strain MGI:5014716 Setx targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443480 Setx senataxin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9970 + EM:09474 C57BL/6N-A Septin10/WtsiIeg EMMA sperm C57BL/6N-A Sept10/WtsiIeg mutant strain MGI:5014599 Septin10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918110 Septin10 septin 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9474 + EM:10995 C57BL/6N-A Senp6/WtsiPh EMMA sperm mutant strain MGI:5428614 Senp6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922075 Senp6 SUMO/sentrin specific peptidase 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10995 + EM:09166 C57BL/6N-A Selenow/WtsiPh EMMA sperm mutant strain MGI:4458843 Selenow targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1100878 Selenow selenoprotein W https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9166 + EM:06269 C57BL/6N-A Seh1l/WtsiCnbc EMMA sperm B6NTac;B6N-A Seh1l/WtsiCnbc mutant strain MGI:4453708 Seh1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919374 Seh1l SEH1-like (S. cerevisiae https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6269 - EM:07022 C57BL/6N-A Sec22b/WtsiOulu EMMA embryo mutant strain MGI:4433526 Sec22b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1338759 Sec22b SEC22 homolog B, vesicle trafficking protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7022 - EM:07022 C57BL/6N-A Sec22b/WtsiOulu EMMA sperm mutant strain MGI:4433526 Sec22b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1338759 Sec22b SEC22 homolog B, vesicle trafficking protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7022 - EM:07023 C57BL/6N-A Sec1/WtsiOulu EMMA embryo mutant strain MGI:4842255 Sec1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928893 Sec1 secretory blood group 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7023 - EM:07023 C57BL/6N-A Sec1/WtsiOulu EMMA sperm mutant strain MGI:4842255 Sec1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928893 Sec1 secretory blood group 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7023 - EM:07645 C57BL/6N-A Sdsl/IcsOrl EMMA archived mutant strain MGI:4436390 Sdsl targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2182607 Sdsl serine dehydratase-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7645 + EM:09962 C57BL/6N-A Satb1/IcsOrl EMMA sperm mutant strain MGI:4436287 Satb1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:105084 Satb1 special AT-rich sequence binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9962 + EM:09475 C57BL/6N-A Sap130/WtsiIeg EMMA sperm mutant strain MGI:5141821 Sap130 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:1919782 Sap130 Sin3A associated protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9475 + EM:09956 C57BL/6N-A Rwdd3/IcsOrl EMMA sperm mutant strain MGI:4419570 Rwdd3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920420 Rwdd3 RWD domain containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9956 + EM:10532 C57BL/6N-A Rrp1b/Ics EMMA sperm mutant strain MGI:5511667 Rrp1b targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1919712 Rrp1b ribosomal RNA processing 1B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10532 + EM:10532 C57BL/6N-A Rrp1b/Ics EMMA live mutant strain MGI:5511667 Rrp1b targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1919712 Rrp1b ribosomal RNA processing 1B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10532 ? EM:14057 C57BL/6N-A Rrm2/WtsiIeg EMMA sperm mutant strain MGI:4841063 Rrm2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98181 Rrm2 ribonucleotide reductase M2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14057 + EM:10996 C57BL/6N-A Rreb1/WtsiPh EMMA sperm mutant strain MGI:4441720 Rreb1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443664 Rreb1 ras responsive element binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10996 - EM:05968 C57BL/6N-A Rpgrip1l/WtsiBiat EMMA sperm mutant strain MGI:4432510 Rpgrip1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920563 Rpgrip1l Rpgrip1-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5968 + EM:06266 C57BL/6N-A Ropn1l/WtsiCnbc EMMA embryo B6NTac;B6N-A Ropn1l/WtsiCnbc mutant strain MGI:4842420 Ropn1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2182357 Ropn1l ropporin 1-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6266 + EM:06266 C57BL/6N-A Ropn1l/WtsiCnbc EMMA sperm B6NTac;B6N-A Ropn1l/WtsiCnbc mutant strain MGI:4842420 Ropn1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2182357 Ropn1l ropporin 1-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6266 + EM:10192 C57BL/6N-A Rnf138/WtsiCnrm EMMA sperm mutant strain MGI:4944446 Rnf138 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1929211 Rnf138 ring finger protein 138 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10192 + EM:10679 C57BL/6N-A Rnf125/WtsiPh EMMA sperm mutant strain MGI:4881004 Rnf125 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914914 Rnf125 ring finger protein 125 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10679 + EM:08879 C57BL/6N-A Rnasek/WtsiIeg EMMA sperm mutant strain MGI:4849411 Rnasek targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106369 Rnasek ribonuclease, RNase K https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8879 - EM:05792 C57BL/6N-A Ripk4/WtsiOrl EMMA sperm mutant strain MGI:4442055 Ripk4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919638 Ripk4 receptor-interacting serine-threonine kinase 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5792 + EM:10019 C57BL/6N-A Rida/WtsiPh EMMA sperm mutant strain MGI:5002935 Rida targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1095401 Rida reactive intermediate imine deaminase A homolog https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10019 + EM:08865 C57BL/6N-A Repin1/WtsiIeg EMMA sperm mutant strain MGI:5008938 Repin1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1889817 Repin1 replication initiator 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8865 + EM:14118 C57BL/6N-A Rell2/WtsiH EMMA live mutant strain MGI:5140486 Rell2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918044 Rell2 RELT-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14118 - EM:07980 C57BL/6N-A Reg3d/WtsiH EMMA sperm B6NTac;B6N-A Reg3d/WtsiH mutant strain MGI:4849409 Reg3d targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353426 Reg3d regenerating islet-derived 3 delta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7980 + EM:09983 C57BL/6N-A Rcan1/IcsOrl EMMA sperm mutant strain MGI:5286172 Rcan1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1890564 Rcan1 regulator of calcineurin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9983 - EM:07276 C57BL/6N-A Rbsn/WtsiIeg EMMA sperm mutant strain MGI:4441653 Rbsn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1925537 Rbsn rabenosyn, RAB effector https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7276 - EM:08043 C57BL/6N-A Rbm47/WtsiBiat EMMA sperm mutant strain MGI:4432904 Rbm47 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384294 Rbm47 RNA binding motif protein 47 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8043 + EM:08480 C57BL/6N-A Rbm33/WtsiFlmg EMMA sperm mutant strain MGI:4887695 Rbm33 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919670 Rbm33 RNA binding motif protein 33 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8480 + EM:08877 C57BL/6N-A Rbm14/WtsiIeg EMMA sperm mutant strain MGI:4362139 Rbm14 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929092 Rbm14 RNA binding motif protein 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8877 + EM:08716 C57BL/6N-A Rbfox1/Ics EMMA sperm mutant strain MGI:5428536 Rbfox1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926224 Rbfox1 RNA binding protein, fox-1 homolog (C. elegans) 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8716 ? EM:14045 C57BL/6N-A Rasgrp4/WtsiOrl EMMA sperm mutant strain MGI:4841072 Rasgrp4 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2386851 Rasgrp4 RAS guanyl releasing protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14045 + EM:08259 C57BL/6N-A Rasal2/WtsiCnrm EMMA sperm mutant strain MGI:4939768 Rasal2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443881 Rasal2 RAS protein activator like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8259 ? EM:13790 C57BL/6N-A Rasal2 Atp2b2/WtsiH[cc] EMMA sperm mutant strain MGI:6470863 Atp2b2 Tikho MGI:105368 Atp2b2 ATPase, Ca++ transporting, plasma membrane 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13790 ? EM:13790 C57BL/6N-A Rasal2 Atp2b2/WtsiH[cc] EMMA sperm mutant strain MGI:4939768 Rasal2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443881 Rasal2 RAS protein activator like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13790 + EM:08880 C57BL/6N-A Raph1/WtsiIeg EMMA sperm mutant strain MGI:4842387 Raph1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924550 Raph1 Ras association (RalGDS/AF-6) and pleckstrin homology domains 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8880 - EM:07406 C57BL/6N-A Ralgps2/WtsiBiat EMMA sperm mutant strain MGI:4460462 Ralgps2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1925505 Ralgps2 Ral GEF with PH domain and SH3 binding motif 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7406 - EM:08144 C57BL/6N-A Rala/WtsiCnrm EMMA sperm mutant strain MGI:4451975 Rala targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927243 Rala v-ral simian leukemia viral oncogene A (ras related) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8144 + EM:09823 C57BL/6N-A Rab21/WtsiPh EMMA sperm mutant strain MGI:4458569 Rab21 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:894308 Rab21 RAB21, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9823 + EM:10992 C57BL/6N-A Rab17/WtsiPh EMMA sperm mutant strain MGI:4948606 Rab17 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104640 Rab17 RAB17, member RAS oncogene family https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10992 + EM:11745 C57BL/6N-A Pycr2/WtsiCnrm EMMA sperm mutant strain MGI:4842705 Pycr2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1277956 Pycr2 pyrroline-5-carboxylate reductase family, member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11745 + EM:09818 C57BL/6N-A Pwp1/WtsiPh EMMA sperm mutant strain MGI:4441688 Pwp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914735 Pwp1 PWP1 homolog, endonuclein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9818 + EM:11805 C57BL/6N-A Ptprd/WtsiOrl EMMA sperm mutant strain MGI:4458607 Ptprd targeted mutation 2a, Wellcome Trust Sanger Institute MGI:97812 Ptprd protein tyrosine phosphatase, receptor type, D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11805 + EM:07507 C57BL/6N-A Pthlh/WtsiOrl EMMA sperm B6NTac;B6N-A Pthlh/WtsiOrl mutant strain MGI:4880897 Pthlh targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97800 Pthlh parathyroid hormone-like peptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7507 + EM:08230 C57BL/6N-A Pth/WtsiPh EMMA sperm mutant strain MGI:4849407 Pth targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97799 Pth parathyroid hormone https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8230 + EM:08867 C57BL/6N-A Pth1r/WtsiIeg EMMA sperm mutant strain MGI:5014612 Pth1r targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97801 Pth1r parathyroid hormone 1 receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8867 + EM:09165 C57BL/6N-A Psph/WtsiPh EMMA sperm mutant strain MGI:4950198 Psph targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97788 Psph phosphoserine phosphatase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9165 + EM:10800 C57BL/6N-A Prxl2b/WtsiH EMMA sperm C57BL/6N-A Fam213b/WtsiH mutant strain MGI:5543451 Prxl2b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913719 Prxl2b peroxiredoxin like 2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10800 + EM:11879 C57BL/6N-A Prune2/WtsiH EMMA sperm mutant strain MGI:4841026 Prune2 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1925004 Prune2 prune homolog 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11879 + EM:10220 C57BL/6N-A Prss52/WtsiPh EMMA sperm mutant strain MGI:5299581 Prss52 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1920632 Prss52 protease, serine 52 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10220 + EM:09890 C57BL/6N-A Prrt2/WtsiPh EMMA archived mutant strain MGI:4362325 Prrt2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916267 Prrt2 proline-rich transmembrane protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9890 - EM:07369 C57BL/6N-A Prrg2/WtsiH EMMA sperm B6NTac;B6N-A Prrg2/WtsiH, EPD0520_2_A07 mutant strain MGI:4441650 Prrg2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929596 Prrg2 proline-rich Gla (G-carboxyglutamic acid) polypeptide 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7369 - EM:05981 C57BL/6N-A Prrc2b/WtsiBiat EMMA sperm mutant strain MGI:4461729 Prrc2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923304 Prrc2b proline-rich coiled-coil 2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5981 + EM:08579 C57BL/6N-A Prps1/WtsiH EMMA sperm mutant strain MGI:4434300 Prps1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97775 Prps1 phosphoribosyl pyrophosphate synthetase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8579 + EM:10180 C57BL/6N-A Prps1/IcsOrl EMMA sperm mutant strain MGI:4434300 Prps1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97775 Prps1 phosphoribosyl pyrophosphate synthetase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10180 - EM:07960 C57BL/6N-A Pramex1/WtsiH EMMA sperm mutant strain MGI:4880903 Pramex1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923079 Pramex1 PRAME like, X-linked 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7960 + EM:08939 C57BL/6N-A Pramel31/WtsiOulu EMMA embryo C57BL/6N-A Gm13119/WtsiOulu mutant strain MGI:4454060 Pramel31 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:3651680 Pramel31 PRAME like 31 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8939 + EM:08939 C57BL/6N-A Pramel31/WtsiOulu EMMA sperm C57BL/6N-A Gm13119/WtsiOulu mutant strain MGI:4454060 Pramel31 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:3651680 Pramel31 PRAME like 31 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8939 + EM:14391 C57BL/6N-A Pramel30/WtsiOulu EMMA embryo mutant strain MGI:4419287 Pramel30 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3651261 Pramel30 PRAME like 30 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14391 + EM:14391 C57BL/6N-A Pramel30/WtsiOulu EMMA sperm mutant strain MGI:4419287 Pramel30 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3651261 Pramel30 PRAME like 30 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14391 + EM:11202 C57BL/6N-A Pramel15/WtsiIeg EMMA sperm C57BL/6N-A Pramef20/WtsiIeg mutant strain MGI:4940749 Pramel15 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3712553 Pramel15 PRAME like 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11202 - EM:07271 C57BL/6N-A Praf2/WtsiBiat EMMA sperm mutant strain MGI:4457557 Praf2 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1859607 Praf2 PRA1 domain family 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7271 ? EM:14067 C57BL/6N-A Pqlc3/WtsiOrl EMMA sperm mutant strain MGI:4820031 Slc66a3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444067 Slc66a3 solute carrier family 66 member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14067 - EM:07962 C57BL/6N-A Ppil3/WtsiH EMMA sperm B6NTac;B6N-A Ppil3/WtsiH mutant strain MGI:4460482 Ppil3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917475 Ppil3 peptidylprolyl isomerase (cyclophilin)-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7962 - EM:07128 C57BL/6N-A Pop4/WtsiOulu EMMA embryo mutant strain MGI:4944520 Pop4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913411 Pop4 processing of precursor 4, ribonuclease P/MRP family, (S. cerevisiae) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7128 - EM:07128 C57BL/6N-A Pop4/WtsiOulu EMMA sperm mutant strain MGI:4944520 Pop4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913411 Pop4 processing of precursor 4, ribonuclease P/MRP family, (S. cerevisiae) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7128 + EM:09602 C57BL/6N-A Polr3g/WtsiOulu EMMA embryo mutant strain MGI:4441807 Polr3g targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914736 Polr3g polymerase (RNA) III (DNA directed) polypeptide G https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9602 + EM:09602 C57BL/6N-A Polr3g/WtsiOulu EMMA sperm mutant strain MGI:4441807 Polr3g targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914736 Polr3g polymerase (RNA) III (DNA directed) polypeptide G https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9602 - EM:08173 C57BL/6N-A Polr3f/WtsiOulu EMMA embryo mutant strain MGI:4431549 Polr3f targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924086 Polr3f polymerase (RNA) III (DNA directed) polypeptide F https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8173 - EM:08173 C57BL/6N-A Polr3f/WtsiOulu EMMA sperm mutant strain MGI:4431549 Polr3f targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924086 Polr3f polymerase (RNA) III (DNA directed) polypeptide F https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8173 + EM:08885 C57BL/6N-A Pold3/WtsiIeg EMMA sperm mutant strain MGI:4441785 Pold3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915217 Pold3 polymerase (DNA-directed), delta 3, accessory subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8885 + EM:09391 C57BL/6N-A Polb/WtsiOrl EMMA sperm mutant strain MGI:4950969 Polb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97740 Polb polymerase (DNA directed), beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9391 - EM:08012 C57BL/6N-A Pnpla1/Ics EMMA sperm mutant strain MGI:5085354 Pnpla1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3617850 Pnpla1 patatin-like phospholipase domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8012 + EM:09160 C57BL/6N-A Plxnb3/WtsiPh EMMA sperm mutant strain MGI:4419514 Plxnb3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2154240 Plxnb3 plexin B3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9160 - EM:06930 C57BL/6N-A Plxna2/WtsiBiat EMMA sperm mutant strain MGI:4432861 Plxna2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107684 Plxna2 plexin A2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6930 - EM:07471 C57BL/6N-A Pls3/WtsiOulu EMMA embryo mutant strain MGI:4451991 Pls3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104807 Pls3 plastin 3 (T-isoform) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7471 - EM:07471 C57BL/6N-A Pls3/WtsiOulu EMMA sperm mutant strain MGI:4451991 Pls3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104807 Pls3 plastin 3 (T-isoform) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7471 - EM:06191 C57BL/6N-A Pld3/WtsiCnrm EMMA sperm mutant strain MGI:4842606 Pld3 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1333782 Pld3 phospholipase D family, member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6191 + EM:08385 C57BL/6N-A Pitrm1/WtsiOrl EMMA sperm mutant strain MGI:5085349 Pitrm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916867 Pitrm1 pitrilysin metallepetidase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8385 - EM:07961 C57BL/6N-A Pigl/WtsiH EMMA sperm B6NTac;B6N-A Pigl/WtsiH mutant strain MGI:4820087 Pigl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2681271 Pigl phosphatidylinositol glycan anchor biosynthesis, class L https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7961 + EM:09605 C57BL/6N-A Pigf/WtsiOulu EMMA embryo mutant strain MGI:5013736 Pigf targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99462 Pigf phosphatidylinositol glycan anchor biosynthesis, class F https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9605 + EM:09605 C57BL/6N-A Pigf/WtsiOulu EMMA sperm mutant strain MGI:5013736 Pigf targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99462 Pigf phosphatidylinositol glycan anchor biosynthesis, class F https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9605 - EM:07368 C57BL/6N-A Pias2/WtsiH EMMA sperm EPD0380_1_H08, B6NTac;B6N-A Pias2/WtsiH mutant strain MGI:4419892 Pias2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1096566 Pias2 protein inhibitor of activated STAT 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7368 + EM:08612 C57BL/6N-A Phyhipl/Wtsi EMMA archived mutant strain MGI:4460503 Phyhipl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918161 Phyhipl phytanoyl-CoA hydroxylase interacting protein-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8612 - EM:06023 C57BL/6N-A Phtf2/WtsiBiat EMMA sperm mutant strain MGI:4432782 Phtf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916020 Phtf2 putative homeodomain transcription factor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6023 + EM:09276 C57BL/6N-A Pgap2/WtsiPh EMMA sperm mutant strain MGI:4453763 Pgap2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385286 Pgap2 post-GPI attachment to proteins 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9276 ? EM:14395 C57BL/6N-A Pfkfb1/WtsiIeg EMMA sperm mutant strain MGI:4944400 Pfkfb1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107816 Pfkfb1 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14395 ? EM:14075 C57BL/6N-A Pdzd3/WtsiPh EMMA sperm mutant strain MGI:4419952 Nherf4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2429554 Nherf4 NHERF family PDZ scaffold protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14075 - EM:06261 C57BL/6N-A Pdxk/WtsiCnbc EMMA sperm mutant strain MGI:4441874 Pdxk targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1351869 Pdxk pyridoxal (pyridoxine, vitamin B6) kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6261 + EM:10849 C57BL/6N-A Pdpr/Ics EMMA sperm mutant strain MGI:4441663 Pdpr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442188 Pdpr pyruvate dehydrogenase phosphatase regulatory subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10849 + EM:07503 C57BL/6N-A Pdk3/WtsiOrl EMMA sperm B6NTac;B6N-A Pdk3/WtsiOrl mutant strain MGI:4458498 Pdk3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2384308 Pdk3 pyruvate dehydrogenase kinase, isoenzyme 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7503 - EM:07976 C57BL/6N-A Pdia4/WtsiH EMMA sperm B6NTac;B6N-A Pdia4/WtsiH mutant strain MGI:4842358 Pdia4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104864 Pdia4 protein disulfide isomerase associated 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7976 ? EM:14035 C57BL/6N-A Pde12/WtsiOrl EMMA sperm mutant strain MGI:4451347 Pde12 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443226 Pde12 phosphodiesterase 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14035 + EM:09750 C57BL/6N-A Pdcd2/WtsiIeg EMMA sperm mutant strain MGI:4432528 Pdcd2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104643 Pdcd2 programmed cell death 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9750 + EM:09820 C57BL/6N-A Pclaf/WtsiPh EMMA sperm mutant strain MGI:4461695 Pclaf targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915276 Pclaf PCNA clamp associated factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9820 + EM:07509 C57BL/6N-A Pced1a/WtsiOrl EMMA sperm B6NTac;B6N-A Pced1a/WtsiOrl mutant strain MGI:4842567 Pced1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442177 Pced1a PC-esterase domain containing 1A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7509 ? EM:13793 C57BL/6N-A Pcdh15 Ccdc122/WtsiH[cc] EMMA archived mutant strain MGI:4363388 Ccdc122 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918358 Ccdc122 coiled-coil domain containing 122 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13793 ? EM:13793 C57BL/6N-A Pcdh15 Ccdc122/WtsiH[cc] EMMA archived mutant strain MGI:6470865 Pcdh15 Jiggle MGI:1891428 Pcdh15 protocadherin 15 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13793 ? EM:14019 C57BL/6N-A Pbdc1/WtsiOrl EMMA sperm mutant strain MGI:4451656 Pbdc1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1914933 Pbdc1 polysaccharide biosynthesis domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14019 ? EM:11293 C57BL/6N-A Paupar/WtsiOrl EMMA sperm mutant strain Paupar Sanger Institute targeted mutation 1, William C. Skarnes MGI:5543919 Paupar Pax6 upstream antisense RNA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11293 - EM:07979 C57BL/6N-A Pam16/WtsiH EMMA sperm B6NTac;B6N-A Pam16/WtsiH mutant strain MGI:5000409 Pam16 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913699 Pam16 presequence translocase-asssociated motor 16 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7979 + EM:10537 C57BL/6N-A Pak3/Ics EMMA sperm mutant strain MGI:4841909 Pak3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1339656 Pak3 p21 (RAC1) activated kinase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10537 + EM:10537 C57BL/6N-A Pak3/Ics EMMA live mutant strain MGI:4841909 Pak3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1339656 Pak3 p21 (RAC1) activated kinase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10537 - EM:06104 C57BL/6N-A Pacsin3/WtsiCnbc EMMA embryo mutant strain MGI:4431643 Pacsin3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891410 Pacsin3 protein kinase C and casein kinase substrate in neurons 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6104 - EM:06104 C57BL/6N-A Pacsin3/WtsiCnbc EMMA sperm mutant strain MGI:4431643 Pacsin3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891410 Pacsin3 protein kinase C and casein kinase substrate in neurons 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6104 - EM:07491 C57BL/6N-A Pabpn1l/WtsiOulu EMMA embryo mutant strain MGI:4842589 Pabpn1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685954 Pabpn1l poly(A)binding protein nuclear 1-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7491 - EM:07491 C57BL/6N-A Pabpn1l/WtsiOulu EMMA sperm mutant strain MGI:4842589 Pabpn1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685954 Pabpn1l poly(A)binding protein nuclear 1-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7491 - EM:05715 C57BL/6N-A Pabpc1l/WtsiBiat EMMA sperm mutant strain MGI:4431852 Pabpc1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922908 Pabpc1l poly(A) binding protein, cytoplasmic 1-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5715 - EM:07018 C57BL/6N-A Oxr1/WtsiCnrm EMMA sperm mutant strain MGI:4461745 Oxr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2179326 Oxr1 oxidation resistance 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7018 + EM:09279 C57BL/6N-A Otud7b/WtsiPh EMMA sperm mutant strain MGI:5008026 Otud7b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2654703 Otud7b OTU domain containing 7B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9279 + EM:07715 C57BL/6N-A Otub1/IcsOrl EMMA sperm HEPD0539_8_A05 mutant strain MGI:4434587 Otub1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2147616 Otub1 OTU domain, ubiquitin aldehyde binding 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7715 + EM:09728 C57BL/6N-A Osbpl3/WtsiH EMMA sperm mutant strain MGI:4842360 Osbpl3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918970 Osbpl3 oxysterol binding protein-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9728 - EM:08172 C57BL/6N-A Os9/WtsiOulu EMMA embryo mutant strain MGI:4939774 Os9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924301 Os9 amplified in osteosarcoma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8172 - EM:08172 C57BL/6N-A Os9/WtsiOulu EMMA sperm mutant strain MGI:4939774 Os9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924301 Os9 amplified in osteosarcoma https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8172 - EM:06126 C57BL/6N-A Orc3/WtsiBiat EMMA live mutant strain MGI:4433411 Orc3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354944 Orc3 origin recognition complex, subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6126 + EM:09815 C57BL/6N-A Orc1/WtsiPh EMMA sperm mutant strain MGI:4847686 Orc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1328337 Orc1 origin recognition complex, subunit 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9815 + EM:08504 C57BL/6N-A Oog2/WtsiBiat EMMA sperm mutant strain MGI:4460430 Oog2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2684035 Oog2 oogenesin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8504 + EM:08597 C57BL/6N-A Ogdh/WtsiH EMMA sperm mutant strain MGI:4939737 Ogdh targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1098267 Ogdh oxoglutarate (alpha-ketoglutarate) dehydrogenase (lipoamide) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8597 - EM:06979 C57BL/6N-A Ocm/WtsiIeg EMMA sperm mutant strain MGI:4432497 Ocm targeted mutation 1e, Wellcome Trust Sanger Institute MGI:97401 Ocm oncomodulin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6979 + EM:09979 C57BL/6N-A Obp2a/IcsOrl EMMA sperm mutant strain MGI:4949352 Obp2a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2387617 Obp2a odorant binding protein 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9979 + EM:13534 C57BL/6N-A Oaz1/WtsiKieg EMMA embryo mutant strain MGI:4840706 Oaz1 targeted mutation 2e, Wellcome Trust Sanger Institute MGI:109433 Oaz1 ornithine decarboxylase antizyme 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13534 + EM:13534 C57BL/6N-A Oaz1/WtsiKieg EMMA sperm mutant strain MGI:4840706 Oaz1 targeted mutation 2e, Wellcome Trust Sanger Institute MGI:109433 Oaz1 ornithine decarboxylase antizyme 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13534 + EM:13524 C57BL/6N-A Oas1g/WtsiKieg EMMA embryo mutant strain MGI:4455595 Oas1g targeted mutation 3e, Wellcome Trust Sanger Institute MGI:97429 Oas1g 2'-5' oligoadenylate synthetase 1G https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13524 + EM:13524 C57BL/6N-A Oas1g/WtsiKieg EMMA sperm mutant strain MGI:4455595 Oas1g targeted mutation 3e, Wellcome Trust Sanger Institute MGI:97429 Oas1g 2'-5' oligoadenylate synthetase 1G https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13524 + EM:09478 C57BL/6N-A Oaf/WtsiPh EMMA sperm mutant strain MGI:5284928 Oaf targeted mutation 1a, Wellcome Trust Sanger Institute MGI:94852 Oaf out at first homolog https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9478 + EM:08870 C57BL/6N-A Nutm2/WtsiIeg EMMA sperm mutant strain MGI:4840651 Nutm2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2685652 Nutm2 NUT family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8870 + EM:08258 C57BL/6N-A Nup85/WtsiOrl EMMA sperm mutant strain MGI:4944384 Nup85 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3046173 Nup85 nucleoporin 85 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8258 + EM:09281 C57BL/6N-A Nudt12/WtsiPh EMMA sperm mutant strain MGI:4451360 Nudt12 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915243 Nudt12 nudix hydrolase 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9281 + EM:08866 C57BL/6N-A Nrde2/WtsiIeg EMMA sperm mutant strain MGI:4843855 Nrde2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2670969 Nrde2 nrde-2 necessary for RNA interference, domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8866 + EM:09610 C57BL/6N-A Nrbp1/WtsiOulu EMMA embryo mutant strain MGI:5511930 Nrbp1 targeted mutation 3a, Wellcome Trust Sanger Institute MGI:2183436 Nrbp1 nuclear receptor binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9610 + EM:09610 C57BL/6N-A Nrbp1/WtsiOulu EMMA sperm mutant strain MGI:5511930 Nrbp1 targeted mutation 3a, Wellcome Trust Sanger Institute MGI:2183436 Nrbp1 nuclear receptor binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9610 + EM:08932 C57BL/6N-A Npat/WtsiOulu EMMA embryo mutant strain MGI:4433158 Npat targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107605 Npat nuclear protein in the AT region https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8932 + EM:08932 C57BL/6N-A Npat/WtsiOulu EMMA sperm mutant strain MGI:4433158 Npat targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107605 Npat nuclear protein in the AT region https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8932 + EM:10536 C57BL/6N-A Nox1/Ics EMMA sperm mutant strain MGI:4433133 Nox1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2450016 Nox1 NADPH oxidase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10536 + EM:10536 C57BL/6N-A Nox1/Ics EMMA live mutant strain MGI:4433133 Nox1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2450016 Nox1 NADPH oxidase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10536 + EM:08882 C57BL/6N-A Nmrk1/WtsiIeg EMMA sperm mutant strain MGI:4419121 Nmrk1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2147434 Nmrk1 nicotinamide riboside kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8882 - EM:07978 C57BL/6N-A Nipsnap3a/WtsiH EMMA sperm B6NTac;B6N-A Nipsnap3a/WtsiH mutant strain MGI:4944344 Nipsnap3a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920648 Nipsnap3a nipsnap homolog 3A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7978 ? EM:14389 C57BL/6N-A Ninj2/WtsiPh EMMA sperm mutant strain MGI:4451377 Ninj2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1352751 Ninj2 ninjurin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14389 + EM:11182 C57BL/6N-A Nid1/Ics EMMA sperm mutant strain MGI:4842234 Nid1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97342 Nid1 nidogen 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11182 + EM:10219 C57BL/6N-A Nhlrc2/WtsiOulu EMMA embryo mutant strain MGI:4419640 Nhlrc2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914116 Nhlrc2 NHL repeat containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10219 + EM:10219 C57BL/6N-A Nhlrc2/WtsiOulu EMMA sperm mutant strain MGI:4419640 Nhlrc2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914116 Nhlrc2 NHL repeat containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10219 + EM:08740 C57BL/6N-A Ngrn/WtsiH EMMA sperm mutant strain MGI:4940742 Ngrn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933212 Ngrn neugrin, neurite outgrowth associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8740 + EM:09461 C57BL/6N-A Nfkbil1/WtsiOrl EMMA sperm mutant strain MGI:5286210 Nfkbil1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1340031 Nfkbil1 nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9461 + EM:11123 C57BL/6N-A Nelfe/WtsiH EMMA live mutant strain MGI:4842623 Nelfe targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102744 Nelfe negative elongation factor complex member E, Rdbp https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11123 - EM:06855 C57BL/6N-A Nek9/WtsiBiat EMMA sperm mutant strain MGI:4433670 Nek9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2387995 Nek9 NIMA (never in mitosis gene a)-related expressed kinase 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6855 - EM:06973 C57BL/6N-A Nek3/WtsiIeg EMMA sperm mutant strain MGI:4432332 Nek3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1344371 Nek3 NIMA (never in mitosis gene a)-related expressed kinase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6973 + EM:10351 C57BL/6N-A Nebl/WtsiBiat EMMA sperm mutant strain MGI:5603346 Nebl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921353 Nebl nebulette https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10351 - EM:07185 C57BL/6N-A Ndufb8/WtsiCnrm EMMA sperm mutant strain MGI:4432457 Ndufb8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914514 Ndufb8 NADH:ubiquinone oxidoreductase subunit B8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7185 + EM:14494 C57BL/6N-A Ndufb4/WtsiOulu EMMA embryo mutant strain MGI:4451549 Ndufb4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915444 Ndufb4 NADH:ubiquinone oxidoreductase subunit B4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14494 + EM:14494 C57BL/6N-A Ndufb4/WtsiOulu EMMA sperm mutant strain MGI:4451549 Ndufb4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915444 Ndufb4 NADH:ubiquinone oxidoreductase subunit B4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14494 ? EM:10962 C57BL/6N-A Nctc1/WtsiH EMMA sperm mutant strain Nctc1 Sanger Institute targeted mutation 1, William C. Skarnes MGI:1306816 Nctc1 non-coding transcript 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10962 - EM:06100 C57BL/6N-A Nbeal2/WtsiCnbc EMMA sperm mutant strain MGI:4461705 Nbeal2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2448554 Nbeal2 neurobeachin-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6100 + EM:10801 C57BL/6N-A Nbeal1/WtsiH EMMA sperm mutant strain MGI:5571313 Nbeal1 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2444343 Nbeal1 neurobeachin like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10801 + EM:08881 C57BL/6N-A Nat10/WtsiIeg EMMA sperm mutant strain MGI:5050156 Nat10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2138939 Nat10 N-acetyltransferase 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8881 - EM:07381 C57BL/6N-A Naga/WtsiH EMMA sperm B6NTac;B6N-A Naga/WtsiH mutant strain MGI:4820246 Naga targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1261422 Naga N-acetyl galactosaminidase, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7381 - EM:07683 C57BL/6N-A Nae1/IcsOrl EMMA sperm mutant strain MGI:4434194 Nae1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384561 Nae1 NEDD8 activating enzyme E1 subunit 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7683 - EM:06861 C57BL/6N-A Nadk2/WtsiCnrm EMMA sperm mutant strain MGI:4842252 Nadk2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915896 Nadk2 NAD kinase 2, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6861 - EM:08049 C57BL/6N-A Nacc2/WtsiBiat EMMA sperm mutant strain MGI:4441947 Nacc2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1915241 Nacc2 nucleus accumbens associated 2, BEN and BTB (POZ) domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8049 ? EM:14068 C57BL/6N-A Nacad/WtsiPh EMMA sperm mutant strain MGI:4362585 Nacad targeted mutation 1, Wellcome Trust Sanger Institute MGI:3603030 Nacad NAC alpha domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14068 - EM:07382 C57BL/6N-A Naaa/WtsiH EMMA sperm B6NTac;B6N-A Naaa/WtsiH, EPD0365_3_A02 mutant strain MGI:4419604 Naaa targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914361 Naaa N-acylethanolamine acid amidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7382 + EM:09261 C57BL/6N-A Myt1l/WtsiIeg EMMA sperm mutant strain MGI:4842524 Myt1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1100511 Myt1l myelin transcription factor 1-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9261 - EM:06041 C57BL/6N-A Myrfl/WtsiH EMMA sperm EPD0509_5_A02, B6NTac;B6N-A Myrfl/WtsiH mutant strain MGI:4441747 Myrfl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685085 Myrfl myelin regulatory factor-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6041 + EM:11301 C57BL/6N-A Myocd/Ics EMMA live mutant strain MGI:4942150 Myocd targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2137495 Myocd myocardin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11301 - EM:06098 C57BL/6N-A Myo7a/WtsiCnbc EMMA embryo mutant strain MGI:4431921 Myo7a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6098 - EM:06098 C57BL/6N-A Myo7a/WtsiCnbc EMMA sperm mutant strain MGI:4431921 Myo7a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6098 + EM:11936 C57BL/6N-A Myo19/Cnbc EMMA sperm mutant strain MGI:4434919 Myo19 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913446 Myo19 myosin XIX https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11936 - EM:05899 C57BL/6N-A Myo15/WtsiIeg EMMA sperm mutant strain MGI:4431637 Myo15a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1261811 Myo15a myosin XVA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5899 + EM:08386 C57BL/6N-A Myo10/WtsiOrl EMMA sperm mutant strain MGI:4362966 Myo10 targeted mutation 2, Wellcome Trust Sanger Institute MGI:107716 Myo10 myosin X https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8386 + EM:13942 C57BL/6N-A Myh3/WtsiH EMMA live mutant strain MGI:5000418 Myh3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1339709 Myh3 myosin, heavy polypeptide 3, skeletal muscle, embryonic https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13942 + EM:06262 C57BL/6N-A Myh14/WtsiCnbc EMMA sperm mutant strain MGI:4431529 Myh14 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919210 Myh14 myosin, heavy polypeptide 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6262 + EM:14063 C57BL/6N-A Mto1/WtsiOulu EMMA embryo mutant strain MGI:4432793 Mto1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915541 Mto1 mitochondrial tRNA translation optimization 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14063 + EM:14063 C57BL/6N-A Mto1/WtsiOulu EMMA sperm mutant strain MGI:4432793 Mto1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915541 Mto1 mitochondrial tRNA translation optimization 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14063 + EM:10715 C57BL/6N-A Mtmr1/WtsiIeg EMMA sperm mutant strain MGI:4455465 Mtmr1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1858271 Mtmr1 myotubularin related protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10715 + EM:09974 C57BL/6N-A Mtmr12/IcsOrl EMMA sperm mutant strain MGI:5427201 Mtmr12 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443034 Mtmr12 myotubularin related protein 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9974 - EM:06783 C57BL/6N-A Mrps5/WtsiH EMMA sperm C57BL/6N-Mrps5 A/WtsiH, B6NTac;B6N-A Mrps5/WtsiH, B6NTac;B6N-Mrps5 A/WtsiH mutant strain MGI:4432560 Mrps5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924971 Mrps5 mitochondrial ribosomal protein S5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6783 - EM:07200 C57BL/6N-A Mrps21/WtsiH EMMA sperm mutant strain MGI:4433908 Mrps21 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1913542 Mrps21 mitochondrial ribosomal protein S21 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7200 + EM:10860 C57BL/6N-A Mrpl23/WtsiOulu EMMA embryo mutant strain MGI:4840687 Mrpl23 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1196612 Mrpl23 mitochondrial ribosomal protein L23 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10860 + EM:10860 C57BL/6N-A Mrpl23/WtsiOulu EMMA sperm mutant strain MGI:4840687 Mrpl23 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1196612 Mrpl23 mitochondrial ribosomal protein L23 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10860 + EM:11207 C57BL/6N-A Mroh9/WtsiCnrm EMMA sperm mutant strain MGI:5302347 Mroh9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1925508 Mroh9 maestro heat-like repeat family member 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11207 - EM:07977 C57BL/6N-A Mroh4/WtsiH EMMA sperm B6NTac;B6N-A Mroh4/WtsiH mutant strain MGI:4363764 Mroh4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916689 Mroh4 maestro heat-like repeat family member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7977 ? EM:13997 C57BL/6N-A Mroh1/WtsiOrl EMMA sperm mutant strain MGI:5050151 Mroh1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442558 Mroh1 maestro heat-like repeat family member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13997 + EM:08595 C57BL/6N-A Mrm1/WtsiH EMMA sperm mutant strain MGI:5472694 Mrm1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2443470 Mrm1 mitochondrial rRNA methyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8595 - EM:05973 C57BL/6N-A Mrap2/WtsiBiat EMMA sperm mutant strain MGI:4434054 Mrap2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3609239 Mrap2 melanocortin 2 receptor accessory protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5973 + EM:09275 C57BL/6N-A Mpg/WtsiPh EMMA sperm mutant strain MGI:4432493 Mpg targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97073 Mpg N-methylpurine-DNA glycosylase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9275 + EM:10050 C57BL/6N-A Morc3/Ics EMMA sperm mutant strain MGI:4462644 Morc3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2136841 Morc3 microrchidia 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10050 ? EM:13185 C57BL/6N-A Mob3b/WtsiFlmg EMMA sperm mutant strain MGI:5052418 Mob3b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2664539 Mob3b MOB kinase activator 3B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13185 - EM:06105 C57BL/6N-A Mlec/WtsiCnbc EMMA sperm mutant strain MGI:4461689 Mlec targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924015 Mlec malectin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6105 + EM:14120 C57BL/6N-A Mkrn2/WtsiOulu EMMA embryo mutant strain MGI:4944368 Mkrn2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914277 Mkrn2 makorin, ring finger protein, 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14120 + EM:14120 C57BL/6N-A Mkrn2/WtsiOulu EMMA sperm mutant strain MGI:4944368 Mkrn2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914277 Mkrn2 makorin, ring finger protein, 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14120 + EM:10856 C57BL/6N-A Mirc40/WtsiOulu EMMA embryo mutant strain MGI:5910642 Mirc40 targeted mutation 1, Haydn Prosser MGI:5645902 Mirc40 micro RNA cluster 40, including Mir96 through Mir183 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10856 + EM:10856 C57BL/6N-A Mirc40/WtsiOulu EMMA sperm mutant strain MGI:5910642 Mirc40 targeted mutation 1, Haydn Prosser MGI:5645902 Mirc40 micro RNA cluster 40, including Mir96 through Mir183 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10856 + EM:12803 C57BL/6N-A Mir211/H EMMA sperm mutant strain MGI:5319971 Mir211 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2676887 Mir211 microRNA 211 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12803 - EM:08169 C57BL/6N-A Minar2/WtsiOrl EMMA sperm mutant strain MGI:5000328 Minar2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442934 Minar2 membrane integral NOTCH2 associated receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8169 + EM:11564 C57BL/6N-A Micu2/WtsiIeg EMMA sperm mutant strain MGI:4434182 Micu2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915764 Micu2 mitochondrial calcium uptake 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11564 + EM:10825 C57BL/6N-A Mgat4c/WtsiBiat EMMA sperm mutant strain MGI:4433541 Mgat4c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914819 Mgat4c MGAT4 family, member C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10825 + EM:05815 C57BL/6N-A Mfrp/WtsiOrl EMMA sperm mutant strain MGI:4456645 Mfrp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385957 Mfrp membrane frizzled-related protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5815 + EM:11203 C57BL/6N-A Mep1a/WtsiIeg EMMA sperm mutant strain MGI:4455495 Mep1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96963 Mep1a meprin 1 alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11203 + EM:07514 C57BL/6N-A Medag/WtsiOrl EMMA archived B6NTac;B6N-A Medag/WtsiOrl mutant strain MGI:4431426 Medag targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1917967 Medag mesenteric estrogen dependent adipogenesis https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7514 + EM:09752 C57BL/6N-A Med25/Ics EMMA sperm mutant strain MGI:4362835 Med25 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922863 Med25 mediator complex subunit 25 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9752 - EM:07598 C57BL/6N-A Med22/WtsiIeg EMMA sperm mutant strain MGI:5008031 Med22 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98446 Med22 mediator complex subunit 22 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7598 + EM:14382 C57BL/6N-A Meaf6/WtsiPh EMMA live mutant strain MGI:4433956 Meaf6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917338 Meaf6 MYST/Esa1-associated factor 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14382 - EM:08044 C57BL/6N-A Mau2/WtsiBiat EMMA sperm mutant strain MGI:4419101 Mau2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921799 Mau2 MAU2 sister chromatid cohesion factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8044 - EM:08046 C57BL/6N-A Mast2/WtsiBiat EMMA sperm mutant strain MGI:4363089 Mast2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:894676 Mast2 microtubule associated serine/threonine kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8046 + EM:09975 C57BL/6N-A Mapt/IcsOrl EMMA sperm mutant strain MGI:5008854 Mapt targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MAPT MAPT https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9975 - EM:06099 C57BL/6N-A Mapk10/WtsiCnbc EMMA sperm mutant strain MGI:4842613 Mapk10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1346863 Mapk10 mitogen-activated protein kinase 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6099 - EM:06934 C57BL/6N-A Map2k7/WtsiBiat EMMA sperm mutant strain MGI:4842504 Map2k7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1346871 Map2k7 mitogen-activated protein kinase kinase 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6934 + EM:13989 C57BL/6N-A Mansc4/WtsiOulu EMMA embryo mutant strain MGI:4947759 Mansc4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3645619 Mansc4 MANSC domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13989 + EM:13989 C57BL/6N-A Mansc4/WtsiOulu EMMA sperm mutant strain MGI:4947759 Mansc4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3645619 Mansc4 MANSC domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13989 + EM:08233 C57BL/6N-A Mamstr/WtsiPh EMMA sperm mutant strain MGI:4942136 Mamstr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921740 Mamstr MEF2 activating motif and SAP domain containing transcriptional regulator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8233 + EM:09156 C57BL/6N-A Lyrm9/WtsiOulu EMMA embryo mutant strain MGI:5296077 Lyrm9 targeted mutation 1a, Mouse Biology Program, University of California, Davis MGI:1913524 Lyrm9 LYR motif containing 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9156 + EM:09156 C57BL/6N-A Lyrm9/WtsiOulu EMMA sperm mutant strain MGI:5296077 Lyrm9 targeted mutation 1a, Mouse Biology Program, University of California, Davis MGI:1913524 Lyrm9 LYR motif containing 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9156 ? EM:13178 C57BL/6N-A Lvrn/WtsiFlmg EMMA sperm mutant strain MGI:4887593 Lvrn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921824 Lvrn laeverin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13178 + EM:11287 C57BL/6N-A Luc7l2/WtsiOrl EMMA sperm mutant strain MGI:4455819 Luc7l2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2183260 Luc7l2 LUC7-like 2 (S. cerevisiae) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11287 ? EM:13991 C57BL/6N-A Ltb/WtsiIeg EMMA sperm mutant strain MGI:5633780 Ltb targeted mutation 2, Wellcome Trust Sanger Institute MGI:104796 Ltb lymphotoxin B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13991 + EM:06778 C57BL/6N-A Lsm10/WtsiH EMMA sperm B6NTac;B6N-A Lsm10/WtsiH mutant strain MGI:4840576 Lsm10 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2151045 Lsm10 U7 snRNP-specific Sm-like protein LSM10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6778 + EM:10993 C57BL/6N-A Lrrk2/WtsiPh EMMA sperm mutant strain MGI:4950117 Lrrk2 targeted mutation 1, Mouse Biology Program, UCDavis MGI:1913975 Lrrk2 leucine-rich repeat kinase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10993 + EM:13995 C57BL/6N-A Lrriq3/WtsiOulu EMMA embryo mutant strain MGI:4841185 Lrriq3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921685 Lrriq3 leucine-rich repeats and IQ motif containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13995 + EM:13995 C57BL/6N-A Lrriq3/WtsiOulu EMMA sperm mutant strain MGI:4841185 Lrriq3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921685 Lrriq3 leucine-rich repeats and IQ motif containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13995 + EM:11276 C57BL/6N-A Lrrc8d/WtsiOrl EMMA sperm mutant strain MGI:4849425 Lrrc8d targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922368 Lrrc8d leucine rich repeat containing 8D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11276 + EM:10678 C57BL/6N-A Lrrc71/WtsiPh EMMA sperm mutant strain MGI:4458520 Lrrc71 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921735 Lrrc71 leucine rich repeat containing 71 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10678 + EM:10359 C57BL/6N-A Lrrc3/Ics EMMA live mutant strain MGI:5289857 Lrrc3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2447899 Lrrc3 leucine rich repeat containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10359 + EM:09892 C57BL/6N-A Lrrc23/WtsiOrl EMMA sperm mutant strain MGI:4944543 Lrrc23 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1315192 Lrrc23 leucine rich repeat containing 23 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9892 - EM:09600 C57BL/6N-A Lrmp/WtsiOulu EMMA embryo C57BL/6N-A Irag2/WtsiOulu mutant strain MGI:4432722 Irag2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108424 Irag2 inositol 1,4,5-triphosphate receptor associated 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9600 - EM:09600 C57BL/6N-A Lrmp/WtsiOulu EMMA sperm C57BL/6N-A Irag2/WtsiOulu mutant strain MGI:4432722 Irag2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108424 Irag2 inositol 1,4,5-triphosphate receptor associated 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9600 + EM:08888 C57BL/6N-A Lrmda/WtsiIeg EMMA sperm mutant strain MGI:5006791 Lrmda targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1923883 Lrmda leucine rich melanocyte differentiation associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8888 + EM:09824 C57BL/6N-A Lpxn/WtsiPh EMMA sperm mutant strain MGI:4843881 Lpxn targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2147677 Lpxn leupaxin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9824 + EM:10577 C57BL/6N-A Lonp2/Ph EMMA sperm mutant strain MGI:5511246 Lonp2 targeted mutation 2e, Helmholtz Zentrum Muenchen GmbH MGI:1914137 Lonp2 lon peptidase 2, peroxisomal https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10577 - EM:10956 C57BL/6N-A Lncenc1/WtsiH EMMA sperm mutant strain Lncenc1 Sanger Institute targeted mutation 1, William C. Skarnes MGI:3780541 Lncenc1 long non-coding RNA, embryonic stem cells expressed 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10956 + EM:09954 C57BL/6N-A Lmna/IcsOrl EMMA sperm mutant strain MGI:4433534 Lmna targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96794 Lmna lamin A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9954 + EM:06287 C57BL/6N-A Lix1l/WtsiBiat EMMA sperm B6NTac;B6N-A Lix1l/WtsiBiat mutant strain MGI:4432131 Lix1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3036267 Lix1l Lix1-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6287 - EM:07279 C57BL/6N-A Lgals7/WtsiIeg EMMA sperm mutant strain MGI:4432104 Lgals7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1316742 Lgals7 lectin, galactose binding, soluble 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7279 + EM:09894 C57BL/6N-A Leo1/WtsiPh EMMA sperm mutant strain MGI:4950249 Leo1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685031 Leo1 Leo1, Paf1/RNA polymerase II complex component https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9894 - EM:07968 C57BL/6N-A Ldlrad4/WtsiH EMMA sperm B6NTac;B6N-A Ldlrad4/WtsiH mutant strain MGI:4820334 Ldlrad4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1277150 Ldlrad4 low density lipoprotein receptor class A domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7968 + EM:08505 C57BL/6N-A Lce3c/WtsiBiat EMMA sperm mutant strain MGI:5472691 Lce3c targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2135932 Lce3c late cornified envelope 3C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8505 + EM:08883 C57BL/6N-A Lce1m/WtsiIeg EMMA sperm mutant strain MGI:5052501 Lce1m targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913453 Lce1m late cornified envelope 1M https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8883 + EM:14106 C57BL/6N-A Lce1h/WtsiOulu EMMA embryo mutant strain MGI:4951095 Lce1h targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914968 Lce1h late cornified envelope 1H https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14106 + EM:14106 C57BL/6N-A Lce1h/WtsiOulu EMMA sperm mutant strain MGI:4951095 Lce1h targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914968 Lce1h late cornified envelope 1H https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14106 + EM:08937 C57BL/6N-A Lars/WtsiOulu EMMA embryo mutant strain MGI:5052388 Lars targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913808 Lars leucyl-tRNA synthetase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8937 + EM:08937 C57BL/6N-A Lars/WtsiOulu EMMA sperm mutant strain MGI:5052388 Lars targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913808 Lars leucyl-tRNA synthetase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8937 ? EM:13949 C57BL/6N-A Lacc1/WtsiOulu EMMA embryo mutant strain MGI:4451304 Lacc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2445077 Lacc1 laccase domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13949 ? EM:13949 C57BL/6N-A Lacc1/WtsiOulu EMMA sperm mutant strain MGI:4451304 Lacc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2445077 Lacc1 laccase domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13949 + EM:09978 C57BL/6N-A Krt8/IcsOrl EMMA sperm mutant strain MGI:4435745 Krt8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96705 Krt8 keratin 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9978 + EM:07853 C57BL/6N-A Krt88/WtsiOulu EMMA embryo C57BL/6N-1700011A15Rik/Wtsi, C57BL/6N-A 1700011A15Rik/WtsiOulu, B6NTac;B6N-A 1700011A15Rik mutant strain MGI:5085345 Krt88 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913572 Krt88 keratin 88 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7853 + EM:07853 C57BL/6N-A Krt88/WtsiOulu EMMA sperm C57BL/6N-1700011A15Rik/Wtsi, C57BL/6N-A 1700011A15Rik/WtsiOulu, B6NTac;B6N-A 1700011A15Rik mutant strain MGI:5085345 Krt88 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913572 Krt88 keratin 88 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7853 - EM:08050 C57BL/6N-A Krt83/WtsiBiat EMMA sperm mutant strain MGI:4887631 Krt83 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3690448 Krt83 keratin 83 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8050 - EM:07394 C57BL/6N-A Krt7/WtsiH EMMA sperm B6NTac;B6N-A Krt7/WtsiH, EPD0626_2_H08 mutant strain MGI:4840979 Krt7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96704 Krt7 keratin 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7394 + EM:08897 C57BL/6N-A Krt31/WtsiPh EMMA sperm mutant strain MGI:4881940 Krt31 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1309993 Krt31 keratin 31 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8897 - EM:07019 C57BL/6N-A Kng2/WtsiOulu EMMA embryo mutant strain MGI:4840572 Kng2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:3027157 Kng2 kininogen 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7019 - EM:07019 C57BL/6N-A Kng2/WtsiOulu EMMA sperm mutant strain MGI:4840572 Kng2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:3027157 Kng2 kininogen 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7019 - EM:07390 C57BL/6N-A Klk9/WtsiH EMMA sperm EPD0368_3_H11, B6NTac;B6N-A Klk9/WtsiH mutant strain MGI:4419836 Klk9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921082 Klk9 kallikrein related-peptidase 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7390 + EM:14080 C57BL/6N-A Klhl42/WtsiH EMMA live mutant strain MGI:5544975 Klhl42 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444786 Klhl42 kelch-like 42 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14080 + EM:10221 C57BL/6N-A Klhl30/WtsiPh EMMA sperm mutant strain MGI:4431509 Klhl30 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918038 Klhl30 kelch-like 30 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10221 + EM:11747 C57BL/6N-A Klhl26/WtsiCnrm EMMA sperm mutant strain MGI:4842308 Klhl26 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443079 Klhl26 kelch-like 26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11747 ? EM:13174 C57BL/6N-A Klhl20/WtsiFlmg EMMA sperm mutant strain MGI:5014725 Klhl20 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444855 Klhl20 kelch-like 20 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13174 ? EM:13181 C57BL/6N-A Klc4/WtsiFlmg EMMA sperm mutant strain MGI:4842274 Klc4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922014 Klc4 kinesin light chain 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13181 + EM:08874 C57BL/6N-A Kifbp/WtsiIeg EMMA sperm C57BL/6N-A Kif1bp/WtsiIeg mutant strain MGI:4939684 Kifbp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919570 Kifbp kinesin family binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8874 + EM:11555 C57BL/6N-A Kifap3/WtsiOulu EMMA embryo mutant strain MGI:4362297 Kifap3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107566 Kifap3 kinesin-associated protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11555 + EM:11555 C57BL/6N-A Kifap3/WtsiOulu EMMA sperm mutant strain MGI:4362297 Kifap3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107566 Kifap3 kinesin-associated protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11555 + EM:08864 C57BL/6N-A Kif24/WtsiIeg EMMA sperm mutant strain MGI:4841207 Kif24 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918345 Kif24 kinesin family member 24 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8864 + EM:10986 C57BL/6N-A Kif18b/WtsiPh EMMA sperm mutant strain MGI:4944522 Kif18b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446979 Kif18b kinesin family member 18B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10986 + EM:08479 C57BL/6N-A Kif13b/WtsiFlmg EMMA sperm mutant strain MGI:4842489 Kif13b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098265 Kif13b kinesin family member 13B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8479 - EM:06989 C57BL/6N-A Kdm7a/WtsiCnrm EMMA sperm mutant strain MGI:4432944 Kdm7a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443388 Kdm7a lysine (K)-specific demethylase 7A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6989 - EM:11128 C57BL/6N-A Kdm6a/WtsiH EMMA sperm mutant strain MGI:6117755 Kdm6a targeted mutation 2c, Wellcome Trust Sanger Institute MGI:1095419 Kdm6a lysine (K)-specific demethylase 6A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11128 + EM:06928 C57BL/6N-A Kdm5c/Ics EMMA sperm mutant strain MGI:5759978 Kdm5c targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:99781 Kdm5c lysine (K)-specific demethylase 5C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6928 - EM:06324 C57BL/6N-A Kdm4d/WtsiBiat EMMA sperm mutant strain MGI:4460459 Kdm4d targeted mutation 2a, Wellcome Trust Sanger Institute MGI:3606484 Kdm4d lysine (K)-specific demethylase 4D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6324 - EM:08291 C57BL/6N-A Kcnv2/WtsiPh EMMA sperm mutant strain MGI:4840969 Kcnv2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2670981 Kcnv2 potassium channel, subfamily V, member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8291 + EM:10850 C57BL/6N-A Kcne1/Ics EMMA sperm mutant strain MGI:4820204 Kcne1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96673 Kcne1 potassium voltage-gated channel, Isk-related subfamily, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10850 + EM:09969 C57BL/6N-A Kansl1/IcsOrl EMMA sperm mutant strain MGI:5296202 Kansl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923969 Kansl1 KAT8 regulatory NSL complex subunit 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9969 ? EM:13799 C57BL/6N-A Jmjd1c/WtsiBiat EMMA sperm mutant strain MGI:5904450 Jmjd1c targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1918614 Jmjd1c jumonji domain containing 1C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13799 - EM:07129 C57BL/6N-A Jmjd1c/WtsiIeg EMMA sperm mutant strain MGI:4842320 Jmjd1c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918614 Jmjd1c jumonji domain containing 1C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7129 + EM:06879 C57BL/6N-A Jak1/Biat EMMA embryo mutant strain MGI:4456720 Jak1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96628 Jak1 Janus kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6879 + EM:06879 C57BL/6N-A Jak1/Biat EMMA sperm mutant strain MGI:4456720 Jak1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96628 Jak1 Janus kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6879 + EM:09388 C57BL/6N-A Izumo1r/WtsiOrl EMMA sperm mutant strain MGI:4363787 Izumo1r targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1929185 Izumo1r IZUMO1 receptor, JUNO https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9388 - EM:07396 C57BL/6N-A Isg20/WtsiH EMMA sperm B6NTac;B6N-A Isg20/WtsiH mutant strain MGI:4820118 Isg20 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928895 Isg20 interferon-stimulated protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7396 ? EM:13794 C57BL/6N-A Isg20 Del(18Ctxn3-Ccdc192)1Kcl/WtsiH[cc] EMMA archived mutant strain MGI:6470868 Del(18Ctxn3-Ccdc192)1Kcl deletion, Chr 18, King's College London 1 MGI:6473455 Del(18Ctxn3-Ccdc192)1Kcl deletion, Chr 18, King's College London 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13794 ? EM:13794 C57BL/6N-A Isg20 Del(18Ctxn3-Ccdc192)1Kcl/WtsiH[cc] EMMA archived mutant strain MGI:4820118 Isg20 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928895 Isg20 interferon-stimulated protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13794 ? EM:14100 C57BL/6N-A Irf7/WtsiOrl EMMA sperm mutant strain MGI:4419590 Irf7 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1859212 Irf7 interferon regulatory factor 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14100 + EM:09730 C57BL/6N-A Irf5/WtsiH EMMA sperm mutant strain MGI:4460527 Irf5 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1350924 Irf5 interferon regulatory factor 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9730 + EM:09606 C57BL/6N-A Irak1/WtsiOulu EMMA embryo mutant strain MGI:5303142 Irak1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107420 Irak1 interleukin-1 receptor-associated kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9606 + EM:09606 C57BL/6N-A Irak1/WtsiOulu EMMA sperm mutant strain MGI:5303142 Irak1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107420 Irak1 interleukin-1 receptor-associated kinase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9606 ? EM:13958 C57BL/6N-A Iqcf4/WtsiOrl EMMA sperm mutant strain MGI:5050849 Iqcf4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914570 Iqcf4 IQ motif containing F4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13958 + EM:10861 C57BL/6N-A Ints9/WtsiOulu EMMA embryo mutant strain MGI:5297877 Ints9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098533 Ints9 integrator complex subunit 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10861 + EM:10861 C57BL/6N-A Ints9/WtsiOulu EMMA sperm mutant strain MGI:5297877 Ints9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098533 Ints9 integrator complex subunit 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10861 + EM:10709 C57BL/6N-A Ints11/WtsiIeg EMMA sperm mutant strain MGI:4433395 Ints11 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1919207 Ints11 integrator complex subunit 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10709 + EM:10015 C57BL/6N-A Inka2/WtsiPh EMMA sperm C57BL/6N-A Fam212b/WtsiPh mutant strain MGI:5013738 Inka2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923497 Inka2 inka box actin regulator 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10015 + EM:09601 C57BL/6N-A Inava/WtsiOulu EMMA embryo C57BL/6N-A 5730559C18Rik/WtsiOulu, MEPD1002_1_E05 mutant strain MGI:5527587 Inava targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1921579 Inava innate immunity activator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9601 + EM:09601 C57BL/6N-A Inava/WtsiOulu EMMA sperm C57BL/6N-A 5730559C18Rik/WtsiOulu, MEPD1002_1_E05 mutant strain MGI:5527587 Inava targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1921579 Inava innate immunity activator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9601 + EM:08997 C57BL/6N-A Ildr1/WtsiH EMMA sperm mutant strain MGI:4419159 Ildr1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2146574 Ildr1 immunoglobulin-like domain containing receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8997 + EM:10189 C57BL/6N-A Il27/WtsiCnrm EMMA sperm mutant strain MGI:5527617 Il27 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384409 Il27 interleukin 27 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10189 + EM:08477 C57BL/6N-A Il23r/WtsiFlmg EMMA sperm mutant strain MGI:5085468 Il23r targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2181693 Il23r interleukin 23 receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8477 ? EM:14887 C57BL/6N-A Il1r2/WtsiPh EMMA sperm mutant strain Il1r2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:96546 Il1r2 interleukin 1 receptor, type II https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14887 + EM:09159 C57BL/6N-A Il1r2/WtsiPh EMMA sperm mutant strain MGI:4842437 Il1r2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96546 Il1r2 interleukin 1 receptor, type II https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9159 ? EM:14062 C57BL/6N-A Ift80/WtsiPh EMMA sperm mutant strain MGI:4419694 Ift80 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915509 Ift80 intraflagellar transport 80 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14062 + EM:10451 C57BL/6N-A Ifnlr1/WtsiPh EMMA sperm mutant strain MGI:5527612 Ifnlr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2429859 Ifnlr1 interferon lambda receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10451 + EM:10181 C57BL/6N-A Ifnar1/WtsiOulu EMMA embryo mutant strain MGI:5527593 Ifnar1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:107658 Ifnar1 interferon (alpha and beta) receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10181 + EM:10181 C57BL/6N-A Ifnar1/WtsiOulu EMMA sperm mutant strain MGI:5527593 Ifnar1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:107658 Ifnar1 interferon (alpha and beta) receptor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10181 + EM:09611 C57BL/6N-A Ifitm6/WtsiOulu EMMA embryo mutant strain MGI:4433041 Ifitm6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2686976 Ifitm6 interferon induced transmembrane protein 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9611 + EM:09611 C57BL/6N-A Ifitm6/WtsiOulu EMMA sperm mutant strain MGI:4433041 Ifitm6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2686976 Ifitm6 interferon induced transmembrane protein 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9611 + EM:10824 C57BL/6N-A Ifitm1/WtsiBiat EMMA sperm mutant strain MGI:4432260 Ifitm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915963 Ifitm1 interferon induced transmembrane protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10824 + EM:08692 C57BL/6N-A Ifi27/WtsiH EMMA sperm mutant strain MGI:5050993 Ifi27 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1277180 Ifi27 interferon, alpha-inducible protein 27 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8692 - EM:07035 C57BL/6N-A Ido2/WtsiCnrm EMMA sperm mutant strain MGI:5002991 Ido2 targeted mutation 3a, Wellcome Trust Sanger Institute MGI:2142489 Ido2 indoleamine 2,3-dioxygenase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7035 + EM:10867 C57BL/6N-A Id2/WtsiOulu EMMA embryo mutant strain MGI:5511998 Id2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:96397 Id2 inhibitor of DNA binding 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10867 + EM:10867 C57BL/6N-A Id2/WtsiOulu EMMA sperm mutant strain MGI:5511998 Id2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:96397 Id2 inhibitor of DNA binding 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10867 + EM:14031 C57BL/6N-A Hsdl1/WtsiH EMMA live mutant strain MGI:5003009 Hsdl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919802 Hsdl1 hydroxysteroid dehydrogenase like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14031 ? EM:14381 C57BL/6N-A Hps3/WtsiOrl EMMA sperm mutant strain MGI:5308292 Hps3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2153839 Hps3 HPS3, biogenesis of lysosomal organelles complex 2 subunit 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14381 + EM:09908 C57BL/6N-A Homez/WtsiOulu EMMA embryo mutant strain MGI:4944412 Homez targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2678023 Homez homeodomain leucine zipper-encoding gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9908 + EM:09908 C57BL/6N-A Homez/WtsiOulu EMMA sperm mutant strain MGI:4944412 Homez targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2678023 Homez homeodomain leucine zipper-encoding gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9908 - EM:07203 C57BL/6N-A Hmgxb3/WtsiCnrm EMMA sperm mutant strain MGI:4460446 Hmgxb3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2441817 Hmgxb3 HMG box domain containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7203 - EM:07398 C57BL/6N-A Hibadh/WtsiH EMMA sperm EPD0809_4_B04, B6NTac;B6N-A Hibadh/WtsiH mutant strain MGI:5014686 Hibadh targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1889802 Hibadh 3-hydroxyisobutyrate dehydrogenase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7398 + EM:08743 C57BL/6N-A Hecw2/WtsiIeg EMMA sperm mutant strain MGI:4441860 Hecw2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685817 Hecw2 HECT, C2 and WW domain containing E3 ubiquitin protein ligase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8743 + EM:11622 C57BL/6N-A Hbs1l/WtsiH EMMA sperm mutant strain MGI:4887599 Hbs1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891704 Hbs1l Hbs1-like (S. cerevisiae) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11622 + EM:11622 C57BL/6N-A Hbs1l/WtsiH EMMA live mutant strain MGI:4887599 Hbs1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891704 Hbs1l Hbs1-like (S. cerevisiae) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11622 ? EM:13188 C57BL/6N-A Haus5/WtsiFlmg EMMA sperm mutant strain MGI:5006767 Haus5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919159 Haus5 HAUS augmin-like complex, subunit 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13188 + EM:08940 C57BL/6N-A H2bl1/WtsiOulu EMMA embryo C57BL/6N-A 1700024P04Rik/WtsiOulu mutant strain MGI:5473122 H2bl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916632 H2bl1 H2B.L histone variant 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8940 + EM:08940 C57BL/6N-A H2bl1/WtsiOulu EMMA sperm C57BL/6N-A 1700024P04Rik/WtsiOulu mutant strain MGI:5473122 H2bl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916632 H2bl1 H2B.L histone variant 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8940 + EM:08525 C57BL/6N-A H2-Eb1/WtsiH EMMA sperm mutant strain MGI:5297122 H2-Eb1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95901 H2-Eb1 histocompatibility 2, class II antigen E beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8525 + EM:08694 C57BL/6N-A H13/WtsiH EMMA sperm mutant strain MGI:5296546 H13 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95886 H13 histocompatibility 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8694 + EM:11292 C57BL/6N-A Gzmd/WtsiOrl EMMA sperm mutant strain MGI:5289864 Gzmd targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109255 Gzmd granzyme D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11292 + EM:14023 C57BL/6N-A Gtf3c6/WtsiH EMMA live mutant strain MGI:4434292 Gtf3c6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914621 Gtf3c6 general transcription factor IIIC, polypeptide 6, alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14023 + EM:14371 C57BL/6N-A Gtf3a/WtsiOulu EMMA embryo mutant strain MGI:5307107 Gtf3a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913846 Gtf3a general transcription factor III A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14371 + EM:14371 C57BL/6N-A Gtf3a/WtsiOulu EMMA sperm mutant strain MGI:5307107 Gtf3a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913846 Gtf3a general transcription factor III A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14371 + EM:08608 C57BL/6N-A Gsto2/WtsiH EMMA sperm mutant strain MGI:4840928 Gsto2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1915464 Gsto2 glutathione S-transferase omega 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8608 - EM:07731 C57BL/6N-A Gsta3/IcsOrl EMMA archived mutant strain MGI:4435234 Gsta3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:95856 Gsta3 glutathione S-transferase, alpha 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7731 + EM:10950 C57BL/6N-A Grsf1/WtsiIeg EMMA sperm mutant strain MGI:4433076 Grsf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106479 Grsf1 G-rich RNA sequence binding factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10950 + EM:09865 C57BL/6N-A Grpel2/Oulu EMMA embryo mutant strain MGI:4842035 Grpel2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1334416 Grpel2 GrpE-like 2, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9865 - EM:07403 C57BL/6N-A Grm8/WtsiH EMMA sperm mutant strain MGI:4841284 Grm8 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1351345 Grm8 glutamate receptor, metabotropic 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7403 - EM:07194 C57BL/6N-A Grb7/WtsiCnrm EMMA sperm mutant strain MGI:4453768 Grb7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102683 Grb7 growth factor receptor bound protein 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7194 + EM:11063 C57BL/6N-A Gprc5b/WtsiBiat EMMA sperm mutant strain MGI:6376612 Gprc5b targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1927596 Gprc5b G protein-coupled receptor, family C, group 5, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11063 - EM:05980 C57BL/6N-A Gprc5b/WtsiBiat EMMA sperm mutant strain MGI:4452803 Gprc5b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927596 Gprc5b G protein-coupled receptor, family C, group 5, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5980 + EM:10348 C57BL/6N-A Gpr35/WtsiBiat EMMA sperm mutant strain MGI:5520229 Gpr35 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1929509 Gpr35 G protein-coupled receptor 35 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10348 - EM:07020 C57BL/6N-A Gpr152/WtsiOulu EMMA embryo mutant strain MGI:5008027 Gpr152 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685519 Gpr152 G protein-coupled receptor 152 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7020 - EM:07020 C57BL/6N-A Gpr152/WtsiOulu EMMA sperm mutant strain MGI:5008027 Gpr152 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685519 Gpr152 G protein-coupled receptor 152 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7020 + EM:13394 C57BL/6N-A Gpr107/WtsiCnrm EMMA live mutant strain MGI:4362797 Gpr107 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2139054 Gpr107 G protein-coupled receptor 107 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13394 - EM:07996 C57BL/6N-A Gpr101/Ics EMMA sperm mutant strain MGI:4843636 Gpr101 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:2685211 Gpr101 G protein-coupled receptor 101 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7996 + EM:13419 C57BL/6N-A Gpn2/WtsiCnrm EMMA live mutant strain MGI:4947823 Gpn2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2140368 Gpn2 GPN-loop GTPase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13419 - EM:06012 C57BL/6N-A Gpc6/WtsiBiat EMMA sperm mutant strain MGI:4453713 Gpc6 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1346322 Gpc6 glypican 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6012 + EM:13408 C57BL/6N-A Gpc5/WtsiCnrm EMMA live mutant strain MGI:4455511 Gpc5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1194894 Gpc5 glypican 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13408 + EM:14472 C57BL/6N-A Gpbp1l1/WtsiPh EMMA live mutant strain MGI:4460432 Gpbp1l1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924360 Gpbp1l1 GC-rich promoter binding protein 1-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14472 + EM:13410 C57BL/6N-A Gpatch8/WtsiCnrm EMMA live mutant strain MGI:5014717 Gpatch8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918667 Gpatch8 G patch domain containing 8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13410 + EM:13395 C57BL/6N-A Gpat2/WtsiCnrm EMMA live mutant strain MGI:4881942 Gpat2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2684962 Gpat2 glycerol-3-phosphate acyltransferase 2, mitochondrial https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13395 + EM:08863 C57BL/6N-A Golm2/WtsiIeg EMMA sperm C57BL/6N-A Casc4/WtsiIeg mutant strain MGI:4458827 Golm2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2443129 Golm2 golgi membrane protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8863 - EM:06986 C57BL/6N-A Gnb3/WtsiIeg EMMA sperm mutant strain MGI:4868086 Gnb3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95785 Gnb3 guanine nucleotide binding protein (G protein), beta 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6986 + EM:08631 C57BL/6N-A Gmnc/WtsiH EMMA sperm mutant strain MGI:4841069 Gmnc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685452 Gmnc geminin coiled-coil domain containing https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8631 ? EM:14373 C57BL/6N-A Gm6578/WtsiOrl EMMA sperm mutant strain MGI:4455593 Gm6578 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3643037 Gm6578 predicted gene 6578 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14373 + EM:09428 C57BL/6N-A Gm6498/Wtsi EMMA embryo mutant strain MGI:5299587 Gm6498 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3647773 Gm6498 predicted gene 6498 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9428 + EM:09428 C57BL/6N-A Gm6498/Wtsi EMMA sperm mutant strain MGI:5299587 Gm6498 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3647773 Gm6498 predicted gene 6498 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9428 - EM:07376 C57BL/6N-A Gm648/WtsiH EMMA sperm mutant strain MGI:4364134 Gm648 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2685494 Gm648 predicted gene 648 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7376 ? EM:14007 C57BL/6N-A Gm5065/WtsiOrl EMMA sperm mutant strain MGI:5052422 Gm5065 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3643170 Gm5065 predicted gene 5065 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14007 ? EM:11751 C57BL/6N-A Gm28050/WtsiCnrm EMMA sperm mutant strain Gm28050 Sanger Institute targeted mutation 1, William C. Skarnes MGI:5547786 Gm28050 predicted gene, 28050 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11751 - EM:09822 C57BL/6N-A Gm16432/WtsiPh EMMA sperm C57BL/6N-A Catspere2/WtsiPh mutant strain MGI:4841221 Catspere2 targeted mutation 1a, Wellcome Trust Sanger Institute Gm16432 withdrawn, = Catspere2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9822 + EM:13953 C57BL/6N-A Gm15440/WtsiOulu EMMA embryo mutant strain MGI:4462605 Gm15440 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3642353 Gm15440 predicted gene 15440 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13953 + EM:13953 C57BL/6N-A Gm15440/WtsiOulu EMMA sperm mutant strain MGI:4462605 Gm15440 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3642353 Gm15440 predicted gene 15440 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13953 + EM:10823 C57BL/6N-A Gm12253/WtsiPh EMMA sperm mutant strain MGI:5008795 Gm12253 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3651568 Gm12253 predicted gene 12253 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10823 + EM:09893 C57BL/6N-A Glo1/WtsiPh EMMA sperm mutant strain MGI:5285714 Glo1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95742 Glo1 glyoxalase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9893 - EM:06101 C57BL/6N-A Gle1/WtsiCnbc EMMA sperm mutant strain MGI:4431602 Gle1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921662 Gle1 GLE1 RNA export mediator (yeast) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6101 + EM:08255 C57BL/6N-A Gldc/WtsiIeg EMMA sperm mutant strain MGI:4820272 Gldc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1341155 Gldc glycine decarboxylase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8255 + EM:10991 C57BL/6N-A Gdpd2/WtsiPh EMMA sperm mutant strain MGI:4880967 Gdpd2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918834 Gdpd2 glycerophosphodiester phosphodiesterase domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10991 + EM:10700 C57BL/6N-A Gda/WtsiIeg EMMA sperm mutant strain MGI:5000323 Gda targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95678 Gda guanine deaminase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10700 + EM:10984 C57BL/6N-A Gbp3/WtsiPh EMMA sperm mutant strain MGI:5426642 Gbp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926263 Gbp3 guanylate binding protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10984 + EM:11597 C57BL/6N-A Gas2l2/WtsiOulu EMMA embryo mutant strain MGI:4841109 Gas2l2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3652048 Gas2l2 growth arrest-specific 2 like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11597 + EM:11597 C57BL/6N-A Gas2l2/WtsiOulu EMMA sperm mutant strain MGI:4841109 Gas2l2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3652048 Gas2l2 growth arrest-specific 2 like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11597 - EM:07972 C57BL/6N-A Galnt18/WtsiH EMMA sperm mutant strain MGI:5085352 Galnt18 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446239 Galnt18 polypeptide N-acetylgalactosaminyltransferase 18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7972 - EM:06323 C57BL/6N-A G3bp2/WtsiCnbc EMMA embryo mutant strain MGI:4461696 G3bp2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442040 G3bp2 GTPase activating protein (SH3 domain) binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6323 - EM:06323 C57BL/6N-A G3bp2/WtsiCnbc EMMA sperm mutant strain MGI:4461696 G3bp2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442040 G3bp2 GTPase activating protein (SH3 domain) binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6323 + EM:09162 C57BL/6N-A Fzd6/WtsiPh EMMA sperm mutant strain MGI:5527589 Fzd6 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:108474 Fzd6 frizzled class receptor 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9162 - EM:06933 C57BL/6N-A Fyn/WtsiBiat EMMA archived mutant strain MGI:4842482 Fyn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95602 Fyn Fyn proto-oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6933 ? EM:14349 C57BL/6N-A Fubp3/WtsiPh EMMA sperm mutant strain MGI:5052386 Fubp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443699 Fubp3 far upstream element (FUSE) binding protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14349 ? EM:14086 C57BL/6N-A Fryl/WtsiPh EMMA sperm mutant strain MGI:4454126 Fryl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919563 Fryl FRY like transcription coactivator https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14086 - EM:07324 C57BL/6N-A Frrs1/WtsiOulu EMMA embryo mutant strain MGI:4842283 Frrs1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108076 Frrs1 ferric-chelate reductase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7324 - EM:07324 C57BL/6N-A Frrs1/WtsiOulu EMMA sperm mutant strain MGI:4842283 Frrs1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108076 Frrs1 ferric-chelate reductase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7324 - EM:07372 C57BL/6N-A Frmd7/WtsiH EMMA sperm mutant strain MGI:4455520 Frmd7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2686379 Frmd7 FERM domain containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7372 + EM:10576 C57BL/6N-A Frg1/Ph EMMA sperm mutant strain MGI:4435564 Frg1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:893597 Frg1 FSHD region gene 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10576 + EM:09971 C57BL/6N-A Fpr3/IcsOrl EMMA sperm mutant strain MGI:5008916 Fpr3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1194495 Fpr3 formyl peptide receptor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9971 + EM:09821 C57BL/6N-A Fnip2/WtsiPh EMMA sperm mutant strain MGI:5303094 Fnip2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2683054 Fnip2 folliculin interacting protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9821 + EM:14021 C57BL/6N-A Fndc1/WtsiOulu EMMA embryo mutant strain MGI:5000326 Fndc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915905 Fndc1 fibronectin type III domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14021 + EM:14021 C57BL/6N-A Fndc1/WtsiOulu EMMA sperm mutant strain MGI:5000326 Fndc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915905 Fndc1 fibronectin type III domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14021 + EM:11568 C57BL/6N-A Flvcr2/WtsiOulu EMMA embryo mutant strain MGI:4435324 Flvcr2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384974 Flvcr2 feline leukemia virus subgroup C cellular receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11568 + EM:11568 C57BL/6N-A Flvcr2/WtsiOulu EMMA sperm mutant strain MGI:4435324 Flvcr2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384974 Flvcr2 feline leukemia virus subgroup C cellular receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11568 + EM:10822 C57BL/6N-A Fkbp3/WtsiPh EMMA sperm mutant strain MGI:5050935 Fkbp3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1353460 Fkbp3 FK506 binding protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10822 ? EM:13191 C57BL/6N-A Fip1l1/WtsiFlmg EMMA sperm mutant strain MGI:4887691 Fip1l1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914149 Fip1l1 FIP1 like 1 (S. cerevisiae) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13191 ? EM:14390 C57BL/6N-A Fibp/WtsiIeg EMMA sperm mutant strain MGI:4820356 Fibp targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1926233 Fibp fibroblast growth factor (acidic) intracellular binding protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14390 + EM:11201 C57BL/6N-A Fgd4/WtsiBiat EMMA sperm mutant strain MGI:4849414 Fgd4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2183747 Fgd4 FYVE, RhoGEF and PH domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11201 + EM:10999 C57BL/6N-A Fes/WtsiPh EMMA sperm mutant strain MGI:5578480 Fes targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:95514 Fes feline sarcoma oncogene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10999 + EM:09417 C57BL/6N-A Fdft1/WtsiOrl EMMA sperm mutant strain MGI:4451370 Fdft1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102706 Fdft1 farnesyl diphosphate farnesyl transferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9417 + EM:10799 C57BL/6N-A Fcho2/WtsiH EMMA sperm mutant strain MGI:4455636 Fcho2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3505790 Fcho2 FCH domain only 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10799 + EM:14093 C57BL/6N-A Fbxw26/WtsiOulu EMMA embryo mutant strain MGI:4947750 Fbxw26 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3646662 Fbxw26 F-box and WD-40 domain protein 26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14093 + EM:14093 C57BL/6N-A Fbxw26/WtsiOulu EMMA sperm mutant strain MGI:4947750 Fbxw26 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3646662 Fbxw26 F-box and WD-40 domain protein 26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14093 - EM:06827 C57BL/6N-A Fbxo7/WtsiCnrm EMMA sperm mutant strain MGI:4842259 Fbxo7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917004 Fbxo7 F-box protein 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6827 - EM:05969 C57BL/6N-A Fbxo47/WtsiBiat EMMA sperm mutant strain MGI:4431644 Fbxo47 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920223 Fbxo47 F-box protein 47 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5969 - EM:06097 C57BL/6N-A Fbxl7/WtsiCnbc EMMA embryo mutant strain MGI:4820357 Fbxl7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3052506 Fbxl7 F-box and leucine-rich repeat protein 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6097 - EM:06097 C57BL/6N-A Fbxl7/WtsiCnbc EMMA sperm mutant strain MGI:4820357 Fbxl7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3052506 Fbxl7 F-box and leucine-rich repeat protein 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6097 + EM:14358 C57BL/6N-A Fbf1/WtsiCnrm EMMA live mutant strain MGI:4432655 Fbf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922033 Fbf1 Fas (TNFRSF6) binding factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14358 - EM:05963 C57BL/6N-A Farsa/WtsiBiat EMMA sperm mutant strain MGI:4441679 Farsa targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1913840 Farsa phenylalanyl-tRNA synthetase, alpha subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5963 - EM:07475 C57BL/6N-A Fanci/WtsiOulu EMMA embryo mutant strain MGI:4456047 Fanci targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384790 Fanci Fanconi anemia, complementation group I https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7475 - EM:07475 C57BL/6N-A Fanci/WtsiOulu EMMA sperm mutant strain MGI:4456047 Fanci targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384790 Fanci Fanconi anemia, complementation group I https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7475 + EM:13962 C57BL/6N-A Fancd2os/WtsiOulu EMMA embryo mutant strain MGI:4840597 Fancd2os targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1918229 Fancd2os Fancd2 opposite strand https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13962 + EM:13962 C57BL/6N-A Fancd2os/WtsiOulu EMMA sperm mutant strain MGI:4840597 Fancd2os targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1918229 Fancd2os Fancd2 opposite strand https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13962 ? EM:14048 C57BL/6N-A Fam76a/WtsiOrl EMMA sperm mutant strain MGI:4947812 Fam76a targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2385211 Fam76a family with sequence similarity 76, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14048 + EM:10862 C57BL/6N-A Fam47e/WtsiOulu EMMA embryo mutant strain MGI:4940801 Fam47e targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2686227 Fam47e family with sequence similarity 47, member E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10862 + EM:10862 C57BL/6N-A Fam47e/WtsiOulu EMMA sperm mutant strain MGI:4940801 Fam47e targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2686227 Fam47e family with sequence similarity 47, member E https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10862 + EM:10531 C57BL/6N-A Fam3b/Ics EMMA sperm mutant strain MGI:5299788 Fam3b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1270150 Fam3b FAM3 metabolism regulating signaling molecule B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10531 + EM:10531 C57BL/6N-A Fam3b/Ics EMMA live mutant strain MGI:5299788 Fam3b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1270150 Fam3b FAM3 metabolism regulating signaling molecule B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10531 + EM:10676 C57BL/6N-A Fam207a/Ics EMMA sperm mutant strain MGI:4841692 Fam207a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916334 Fam207a family with sequence similarity 207, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10676 + EM:10676 C57BL/6N-A Fam207a/Ics EMMA live mutant strain MGI:4841692 Fam207a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916334 Fam207a family with sequence similarity 207, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10676 + EM:08886 C57BL/6N-A Fam163a/WtsiIeg EMMA sperm mutant strain MGI:5141829 Fam163a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:3618859 Fam163a family with sequence similarity 163, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8886 - EM:08938 C57BL/6N-A Fam160a1/WtsiOulu EMMA embryo C57BL/6N-A Fhip1a/WtsiOulu mutant strain MGI:4849420 Fhip1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444746 Fhip1a FHF complex subunit HOOK interacting protein 1A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8938 - EM:08938 C57BL/6N-A Fam160a1/WtsiOulu EMMA sperm C57BL/6N-A Fhip1a/WtsiOulu mutant strain MGI:4849420 Fhip1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444746 Fhip1a FHF complex subunit HOOK interacting protein 1A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8938 + EM:06267 C57BL/6N-A Fam13b/WtsiCnbc EMMA embryo B6NTac;B6N-A Fam13b/WtsiCnbc mutant strain MGI:4842400 Fam13b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2447834 Fam13b family with sequence similarity 13, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6267 + EM:06267 C57BL/6N-A Fam13b/WtsiCnbc EMMA sperm B6NTac;B6N-A Fam13b/WtsiCnbc mutant strain MGI:4842400 Fam13b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2447834 Fam13b family with sequence similarity 13, member B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6267 - EM:06837 C57BL/6N-A Fam136a/Wtsi EMMA archived mutant strain MGI:4944370 Fam136a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913738 Fam136a family with sequence similarity 136, member A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6837 - EM:06996 C57BL/6N-A Fam122c/WtsiIeg EMMA sperm mutant strain MGI:4432565 Pabir3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921116 Pabir3 PABIR family member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6996 + EM:10193 C57BL/6N-A Fads3/WtsiCnrm EMMA sperm mutant strain MGI:5568477 Fads3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1928740 Fads3 fatty acid desaturase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10193 ? EM:10953 C57BL/6N-A F730043M19Rik/WtsiH EMMA sperm mutant strain F730043M19Rik Sanger Institute targeted mutation 1, William C. Skarnes MGI:2443237 F730043M19Rik RIKEN cDNA F730043M19 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10953 ? EM:13184 C57BL/6N-A Extl2/WtsiFlmg EMMA sperm mutant strain MGI:5299624 Extl2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1889574 Extl2 exostosin-like glycosyltransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13184 + EM:08935 C57BL/6N-A Exosc9/WtsiOulu EMMA embryo mutant strain MGI:4434326 Exosc9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1355319 Exosc9 exosome component 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8935 + EM:08935 C57BL/6N-A Exosc9/WtsiOulu EMMA sperm mutant strain MGI:4434326 Exosc9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1355319 Exosc9 exosome component 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8935 ? EM:14369 C57BL/6N-A Exoc3l2/WtsiOrl EMMA sperm mutant strain MGI:4363569 Exoc3l2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921713 Exoc3l2 exocyst complex component 3-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14369 + EM:10998 C57BL/6N-A Exoc3/WtsiPh EMMA sperm mutant strain MGI:5532949 Exoc3 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2443972 Exoc3 exocyst complex component 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10998 + EM:08511 C57BL/6N-A Evi5/WtsiFlmg EMMA sperm mutant strain MGI:4458636 Evi5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104736 Evi5 ecotropic viral integration site 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8511 - EM:06288 C57BL/6N-A Espn/WtsiH EMMA sperm mutant strain MGI:4431731 Espn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1861630 Espn espin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6288 ? EM:13796 C57BL/6N-A Espn Slc35f2/WtsiH[cc] EMMA archived mutant strain MGI:4441953 Slc35f2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919272 Slc35f2 solute carrier family 35, member F2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13796 ? EM:13796 C57BL/6N-A Espn Slc35f2/WtsiH[cc] EMMA archived mutant strain MGI:6470866 Espn spindizzy MGI:1861630 Espn espin https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13796 - EM:06195 C57BL/6N-A Esco2/WtsiCnrm EMMA sperm mutant strain MGI:4431943 Esco2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919238 Esco2 establishment of sister chromatid cohesion N-acetyltransferase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6195 - EM:07399 C57BL/6N-A Erp44/WtsiH EMMA sperm mutant strain MGI:5052408 Erp44 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923549 Erp44 endoplasmic reticulum protein 44 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7399 - EM:07193 C57BL/6N-A Erp29/WtsiH EMMA sperm mutant strain MGI:4842664 Erp29 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914647 Erp29 endoplasmic reticulum protein 29 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7193 + EM:08508 C57BL/6N-A Erlin2/WtsiIeg EMMA sperm mutant strain MGI:4820210 Erlin2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2387215 Erlin2 ER lipid raft associated 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8508 + EM:08998 C57BL/6N-A Enc1/WtsiIeg EMMA sperm mutant strain MGI:5051006 Enc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109610 Enc1 ectodermal-neural cortex 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8998 - EM:06865 C57BL/6N-A Elmo1/WtsiCnrm EMMA sperm mutant strain MGI:4939780 Elmo1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153044 Elmo1 engulfment and cell motility 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6865 - EM:07267 C57BL/6N-A Ell2/WtsiCnrm EMMA sperm mutant strain MGI:4441868 Ell2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2183438 Ell2 elongation factor for RNA polymerase II 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7267 + EM:10987 C57BL/6N-A Elapor2/WtsiPh EMMA sperm C57BL/6N-A 9330182L06Rik/WtsiPh mutant strain MGI:4841114 Elapor2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443264 Elapor2 endosome-lysosome associated apoptosis and autophagy regulator family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10987 + EM:09812 C57BL/6N-A Eif3h/WtsiPh EMMA sperm mutant strain MGI:5008832 Eif3h targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915385 Eif3h eukaryotic translation initiation factor 3, subunit H https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9812 + EM:11596 C57BL/6N-A Eif3c/Ics EMMA live mutant strain MGI:5544983 Eif3c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926966 Eif3c eukaryotic translation initiation factor 3, subunit C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11596 + EM:10184 C57BL/6N-A Ehmt1/WtsiCnrm EMMA sperm mutant strain MGI:5013778 Ehmt1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924933 Ehmt1 euchromatic histone methyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10184 - EM:07388 C57BL/6N-A Ehbp1l1/WtsiH EMMA sperm mutant strain MGI:4432707 Ehbp1l1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3612340 Ehbp1l1 EH domain binding protein 1-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7388 - EM:05900 C57BL/6N-A Egfr/WtsiIeg EMMA sperm mutant strain MGI:4433235 Egfr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95294 Egfr epidermal growth factor receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5900 + EM:10218 C57BL/6N-A Eftud2/Ics EMMA sperm mutant strain MGI:4458495 Eftud2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1336880 Eftud2 elongation factor Tu GTP binding domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10218 + EM:08257 C57BL/6N-A Edc4/WtsiIeg EMMA sperm mutant strain MGI:4433903 Edc4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446249 Edc4 enhancer of mRNA decapping 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8257 + EM:06263 C57BL/6N-A Eci3/WtsiCnbc EMMA embryo B6NTac;B6N-A Eci3/WtsiCnbc mutant strain MGI:4441787 Eci3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916373 Eci3 enoyl-Coenzyme A delta isomerase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6263 + EM:06263 C57BL/6N-A Eci3/WtsiCnbc EMMA sperm B6NTac;B6N-A Eci3/WtsiCnbc mutant strain MGI:4441787 Eci3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916373 Eci3 enoyl-Coenzyme A delta isomerase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6263 + EM:10419 C57BL/6N-A Dyrk1b/Ics EMMA sperm mutant strain MGI:4951098 Dyrk1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1330302 Dyrk1b dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 1b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10419 ? EM:14128 C57BL/6N-A Dynlt4/WtsiCnbc EMMA sperm mutant strain MGI:4457572 Dynlt4 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:3045358 Dynlt4 dynein light chain Tctex-type 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14128 + EM:10863 C57BL/6N-A Dynlt2b/WtsiOulu EMMA embryo C57BL/6N-A Tctex1d2/WtsiOulu mutant strain MGI:5472698 Dynlt2b targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1913311 Dynlt2b dynein light chain Tctex-type 2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10863 + EM:10863 C57BL/6N-A Dynlt2b/WtsiOulu EMMA sperm C57BL/6N-A Tctex1d2/WtsiOulu mutant strain MGI:5472698 Dynlt2b targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1913311 Dynlt2b dynein light chain Tctex-type 2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10863 + EM:08748 C57BL/6N-A Dynlt2b/WtsiBiat EMMA sperm C57BL/6N-A Tctex1d2/WtsiBiat mutant strain MGI:4431764 Dynlt2b targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1913311 Dynlt2b dynein light chain Tctex-type 2B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8748 + EM:09389 C57BL/6N-A Dynlrb2/WtsiOrl EMMA sperm mutant strain MGI:5052400 Dynlrb2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922715 Dynlrb2 dynein light chain roadblock-type 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9389 - EM:06995 C57BL/6N-A Dynlrb1/WtsiCnrm EMMA sperm mutant strain MGI:4432163 Dynlrb1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914318 Dynlrb1 dynein light chain roadblock-type 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6995 + EM:08517 C57BL/6N-A Dusp5/WtsiOrl EMMA sperm mutant strain MGI:4456654 Dusp5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685183 Dusp5 dual specificity phosphatase 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8517 - EM:07182 C57BL/6N-A Dus2/WtsiCnrm EMMA sperm mutant strain MGI:4452769 Dus2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913619 Dus2 dihydrouridine synthase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7182 + EM:09460 C57BL/6N-A Duoxa2/WtsiOrl EMMA sperm mutant strain MGI:5305622 Duoxa2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914061 Duoxa2 dual oxidase maturation factor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9460 + EM:08664 C57BL/6N-A Dsn1/Wtsi EMMA embryo mutant strain MGI:4452782 Dsn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914184 Dsn1 DSN1 homolog, MIS12 kinetochore complex component https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8664 + EM:08664 C57BL/6N-A Dsn1/Wtsi EMMA sperm mutant strain MGI:4452782 Dsn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914184 Dsn1 DSN1 homolog, MIS12 kinetochore complex component https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8664 ? EM:13993 C57BL/6N-A Dsc2/WtsiIeg EMMA sperm mutant strain MGI:4455602 Dsc2 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:103221 Dsc2 desmocollin 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13993 ? EM:13183 C57BL/6N-A Dpys/WtsiFlmg EMMA sperm mutant strain MGI:4950254 Dpys targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928679 Dpys dihydropyrimidinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13183 + EM:09575 C57BL/6N-A Dpy30/WtsiCnrm EMMA sperm mutant strain MGI:4887610 Dpy30 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913560 Dpy30 dpy-30, histone methyltransferase complex regulatory subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9575 + EM:08623 C57BL/6N-A Dpm1/WtsiH EMMA sperm mutant strain MGI:4458473 Dpm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1330239 Dpm1 dolichol-phosphate (beta-D) mannosyltransferase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8623 + EM:09484 C57BL/6N-A Dph6/WtsiFlmg EMMA sperm mutant strain MGI:4880925 Dph6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913882 Dph6 diphthamine biosynthesis 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9484 + EM:06782 C57BL/6N-A Dph2/WtsiH EMMA sperm C57BL/6N-Dph2/Wtsi mutant strain MGI:4840638 Dph2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1914978 Dph2 DPH2 homolog https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6782 + EM:06092 C57BL/6N-A Dop1b/WtsiCnbc EMMA embryo B6NTac;B6N-A Dopey2/WtsiCnbc mutant strain MGI:4452820 Dop1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917278 Dop1b DOP1 leucine zipper like protein B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6092 + EM:06092 C57BL/6N-A Dop1b/WtsiCnbc EMMA sperm B6NTac;B6N-A Dopey2/WtsiCnbc mutant strain MGI:4452820 Dop1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917278 Dop1b DOP1 leucine zipper like protein B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6092 + EM:09164 C57BL/6N-A Dnpep/WtsiPh EMMA sperm mutant strain MGI:6117753 Dnpep targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1278328 Dnpep aspartyl aminopeptidase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9164 ? EM:13219 C57BL/6N-A Dnmt3a/WtsiOrl EMMA sperm mutant strain Dnmt3a targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1261827 Dnmt3a DNA methyltransferase 3A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13219 + EM:07510 C57BL/6N-A Dnmt3a/WtsiOrl EMMA sperm B6NTac;B6N-A Dnmt3a/WtsiOrl mutant strain MGI:4364077 Dnmt3a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1261827 Dnmt3a DNA methyltransferase 3A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7510 + EM:08240 C57BL/6N-A Dnm1l/Ics EMMA sperm mutant strain MGI:4364147 Dnm1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921256 Dnm1l dynamin 1-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8240 + EM:08862 C57BL/6N-A Dnajc8/WtsiIeg EMMA sperm mutant strain MGI:5050155 Dnajc8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915848 Dnajc8 DnaJ heat shock protein family (Hsp40) member C8 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8862 + EM:11561 C57BL/6N-A Dnah17/WtsiIeg EMMA sperm mutant strain MGI:4940768 Dnah17 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1917176 Dnah17 dynein, axonemal, heavy chain 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11561 + EM:06852 C57BL/6N-A Dmxl2/WtsiH EMMA sperm C57BL/6N-Dmxl2/Wtsi mutant strain MGI:4432280 Dmxl2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444630 Dmxl2 Dmx-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6852 ? EM:14006 C57BL/6N-A Dmgdh/WtsiOrl EMMA sperm mutant strain MGI:4451237 Dmgdh targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921379 Dmgdh dimethylglycine dehydrogenase precursor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14006 + EM:10859 C57BL/6N-A Dlgap4/WtsiOulu EMMA embryo mutant strain MGI:5296545 Dlgap4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2138865 Dlgap4 DLG associated protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10859 + EM:10859 C57BL/6N-A Dlgap4/WtsiOulu EMMA sperm mutant strain MGI:5296545 Dlgap4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2138865 Dlgap4 DLG associated protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10859 + EM:10013 C57BL/6N-A Dlg4/WtsiCnrm EMMA sperm mutant strain MGI:5805884 Dlg4 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1277959 Dlg4 discs large MAGUK scaffold protein 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10013 + EM:08995 C57BL/6N-A Dlg3/WtsiCnrm EMMA sperm mutant strain MGI:4441739 Dlg3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1888986 Dlg3 discs large MAGUK scaffold protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8995 - EM:06194 C57BL/6N-A Dlg2/WtsiCnrm EMMA sperm mutant strain MGI:4842622 Dlg2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1344351 Dlg2 discs large MAGUK scaffold protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6194 ? EM:14009 C57BL/6N-A Dip2a/WtsiIeg EMMA sperm mutant strain MGI:4841025 Dip2a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2385920 Dip2a disco interacting protein 2 homolog A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14009 ? EM:14039 C57BL/6N-A Dhx40/WtsiIeg EMMA sperm mutant strain MGI:4419814 Dhx40 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914737 Dhx40 DEAH (Asp-Glu-Ala-His) box polypeptide 40 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14039 - EM:08051 C57BL/6N-A Dhx35/WtsiBiat EMMA sperm mutant strain MGI:4453709 Dhx35 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918965 Dhx35 DEAH (Asp-Glu-Ala-His) box polypeptide 35 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8051 + EM:08228 C57BL/6N-A Dhx33/WtsiPh EMMA sperm mutant strain MGI:5000320 Dhx33 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2445102 Dhx33 DEAH (Asp-Glu-Ala-His) box polypeptide 33 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8228 + EM:10021 C57BL/6N-A Dhps/WtsiPh EMMA sperm mutant strain MGI:4842333 Dhps targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2683592 Dhps deoxyhypusine synthase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10021 - EM:06847 C57BL/6N-A Dhodh/WtsiBiat EMMA sperm mutant strain MGI:4842671 Dhodh targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928378 Dhodh dihydroorotate dehydrogenase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6847 + EM:10530 C57BL/6N-A Derl2/Ics EMMA sperm mutant strain MGI:4456730 Derl2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2151483 Derl2 Der1-like domain family, member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10530 + EM:10530 C57BL/6N-A Derl2/Ics EMMA live mutant strain MGI:4456730 Derl2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2151483 Derl2 Der1-like domain family, member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10530 + EM:07180 C57BL/6N-A Deptor/WtsiH EMMA sperm B6NTac;B6N-A Deptor/WtsiH mutant strain MGI:4457558 Deptor targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2146322 Deptor DEP domain containing MTOR-interacting protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7180 + EM:11289 C57BL/6N-A Depdc7/WtsiOrl EMMA sperm mutant strain MGI:5052484 Depdc7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2139258 Depdc7 DEP domain containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11289 ? EM:13172 C57BL/6N-A Dennd5a/WtsiFlmg EMMA sperm mutant strain MGI:5051004 Dennd5a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1201681 Dennd5a DENN domain containing 5A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13172 + EM:08934 C57BL/6N-A Dennd4c/WtsiOulu EMMA embryo mutant strain MGI:5141837 Dennd4c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914769 Dennd4c DENN domain containing 4C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8934 + EM:08934 C57BL/6N-A Dennd4c/WtsiOulu EMMA sperm mutant strain MGI:5141837 Dennd4c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914769 Dennd4c DENN domain containing 4C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8934 - EM:06285 C57BL/6N-A Dennd1c/WtsiCnrm EMMA sperm mutant strain MGI:4432505 Dennd1c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918035 Dennd1c DENN domain containing 1C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6285 + EM:08926 C57BL/6N-A Dennd1b/WtsiOulu EMMA embryo mutant strain MGI:4841996 Dennd1b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2447812 Dennd1b DENN domain containing 1B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8926 + EM:08926 C57BL/6N-A Dennd1b/WtsiOulu EMMA sperm mutant strain MGI:4841996 Dennd1b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2447812 Dennd1b DENN domain containing 1B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8926 ? EM:13795 C57BL/6N-A Del(10Map3k5-Map7)2Kcl Rhox13/WtsiH[cc] EMMA archived mutant strain MGI:4820151 Rhox13 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920864 Rhox13 reproductive homeobox 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13795 ? EM:13795 C57BL/6N-A Del(10Map3k5-Map7)2Kcl Rhox13/WtsiH[cc] EMMA archived mutant strain Del(10Map3k5-Map7)2Kcl Del(10Map3k5-Map7)2Kcl Del(10Map3k5-Map7)2Kcl Del(10Map3k5-Map7)2Kcl https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13795 - EM:07975 C57BL/6N-A Defb30/WtsiH EMMA sperm mutant strain MGI:4454128 Defb30 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1920920 Defb30 defensin beta 30 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7975 + EM:08526 C57BL/6N-A Defb22/WtsiBiat EMMA sperm mutant strain MGI:5013746 Defb22 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3045368 Defb22 defensin beta 22 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8526 + EM:08229 C57BL/6N-A Defb14/WtsiPh EMMA sperm mutant strain MGI:4362993 Defb14 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2675345 Defb14 defensin beta 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8229 - EM:07034 C57BL/6N-A Def6/WtsiIeg EMMA sperm mutant strain MGI:4944563 Def6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1346328 Def6 differentially expressed in FDCP 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7034 + EM:10972 C57BL/6N-A Deaf1/Ics EMMA sperm mutant strain MGI:4462643 Deaf1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1858496 Deaf1 DEAF1, transcription factor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10972 - EM:06987 C57BL/6N-A Ddx56/WtsiIeg EMMA sperm mutant strain MGI:4888928 Ddx56 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1277172 Ddx56 DEAD box helicase 56 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6987 + EM:08519 C57BL/6N-A Ddx55/WtsiIeg EMMA sperm mutant strain MGI:4434030 Ddx55 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915098 Ddx55 DEAD box helicase 55 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8519 + EM:09608 C57BL/6N-A Ddx51/WtsiOulu EMMA embryo mutant strain MGI:4431446 Ddx51 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916913 Ddx51 DEAD box helicase 51 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9608 + EM:09608 C57BL/6N-A Ddx51/WtsiOulu EMMA sperm mutant strain MGI:4431446 Ddx51 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916913 Ddx51 DEAD box helicase 51 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9608 + EM:10983 C57BL/6N-A Ddx42/WtsiIeg EMMA sperm mutant strain MGI:4948648 Ddx42 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919297 Ddx42 DEAD box helicase 42 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10983 - EM:07204 C57BL/6N-A Ddhd2/WtsiCnrm EMMA sperm mutant strain MGI:4820273 Ddhd2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919358 Ddhd2 DDHD domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7204 + EM:09603 C57BL/6N-A Ddah1/WtsiOulu EMMA embryo mutant strain MGI:5527610 Ddah1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1916469 Ddah1 dimethylarginine dimethylaminohydrolase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9603 + EM:09603 C57BL/6N-A Ddah1/WtsiOulu EMMA sperm mutant strain MGI:5527610 Ddah1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1916469 Ddah1 dimethylarginine dimethylaminohydrolase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9603 - EM:06877 C57BL/6N-A Dctn1/WtsiBiat EMMA sperm mutant strain MGI:4432339 Dctn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107745 Dctn1 dynactin 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6877 - EM:08005 C57BL/6N-A Dcp2/Ics EMMA sperm mutant strain MGI:4362601 Dcp2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917890 Dcp2 decapping mRNA 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8005 + EM:14037 C57BL/6N-A Dcdc2c/WtsiOulu EMMA embryo mutant strain MGI:4458574 Dcdc2c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915761 Dcdc2c doublecortin domain containing 2C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14037 + EM:14037 C57BL/6N-A Dcdc2c/WtsiOulu EMMA sperm mutant strain MGI:4458574 Dcdc2c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915761 Dcdc2c doublecortin domain containing 2C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14037 + EM:08227 C57BL/6N-A Dcdc2b/WtsiPh EMMA sperm mutant strain MGI:5050845 Dcdc2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2686212 Dcdc2b doublecortin domain containing 2b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8227 + EM:10395 C57BL/6N-A Dcaf7/Ics EMMA sperm mutant strain MGI:4432724 Dcaf7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919083 Dcaf7 DDB1 and CUL4 associated factor 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10395 + EM:10395 C57BL/6N-A Dcaf7/Ics EMMA live mutant strain MGI:4432724 Dcaf7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919083 Dcaf7 DDB1 and CUL4 associated factor 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10395 + EM:08999 C57BL/6N-A Dcaf11/WtsiIeg EMMA sperm mutant strain MGI:4841129 Dcaf11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:90168 Dcaf11 DDB1 and CUL4 associated factor 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8999 + EM:08873 C57BL/6N-A Dap/WtsiIeg EMMA sperm mutant strain MGI:4455440 Dap targeted mutation 1a, Mouse Biology Program, UCDavis MGI:1918190 Dap death-associated protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8873 + EM:08693 C57BL/6N-A Dact3/WtsiH EMMA sperm mutant strain MGI:5319818 Dact3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3654828 Dact3 dishevelled-binding antagonist of beta-catenin 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8693 + EM:10345 C57BL/6N-A Daam2/WtsiBiat EMMA sperm mutant strain MGI:4841108 Daam2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923691 Daam2 dishevelled associated activator of morphogenesis 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10345 + EM:13982 C57BL/6N-A D930028M14Rik/WtsiCnrm EMMA live mutant strain MGI:4432198 D930028M14Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3687343 D930028M14Rik RIKEN cDNA D930028M14 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13982 + EM:09392 C57BL/6N-A D7Ertd443e/WtsiOrl EMMA sperm mutant strain MGI:4455573 D7Ertd443e targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1196431 D7Ertd443e DNA segment, Chr 7, ERATO Doi 443, expressed https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9392 + EM:09579 C57BL/6N-A D6Wsu163e/WtsiPh EMMA sperm mutant strain MGI:4951107 D6Wsu163e targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107893 D6Wsu163e DNA segment, Chr 6, Wayne State University 163, expressed https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9579 + EM:10795 C57BL/6N-A D630023F18Rik/WtsiH EMMA sperm mutant strain MGI:4949325 D630023F18Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2138198 D630023F18Rik RIKEN cDNA D630023F18 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10795 - EM:07370 C57BL/6N-A Cyp3a11/WtsiH EMMA sperm mutant strain MGI:4841233 Cyp3a11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88609 Cyp3a11 cytochrome P450, family 3, subfamily a, polypeptide 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7370 + EM:12580 C57BL/6N-A Cyp2u1/IcsOrl EMMA live mutant strain MGI:5141847 Cyp2u1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918769 Cyp2u1 cytochrome P450, family 2, subfamily u, polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12580 - EM:07184 C57BL/6N-A Cyp2r1/WtsiCnrm EMMA sperm mutant strain MGI:4456014 Cyp2r1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2449771 Cyp2r1 cytochrome P450, family 2, subfamily r, polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7184 + EM:08878 C57BL/6N-A Cyp2b13/WtsiIeg EMMA sperm mutant strain MGI:4431428 Cyp2b13 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88599 Cyp2b13 cytochrome P450, family 2, subfamily b, polypeptide 13 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8878 - EM:07108 C57BL/6N-A Cyp20a1/WtsiOulu EMMA embryo mutant strain MGI:4842859 Cyp20a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1925201 Cyp20a1 cytochrome P450, family 20, subfamily a, polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7108 - EM:07108 C57BL/6N-A Cyp20a1/WtsiOulu EMMA sperm mutant strain MGI:4842859 Cyp20a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1925201 Cyp20a1 cytochrome P450, family 20, subfamily a, polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7108 + EM:09883 C57BL/6N-A Cyp11a1/WtsiPh EMMA sperm mutant strain MGI:5565260 Cyp11a1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88582 Cyp11a1 cytochrome P450, family 11, subfamily a, polypeptide 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9883 - EM:07001 C57BL/6N-A Cyfip2/WtsiBiat EMMA sperm mutant strain MGI:4434196 Cyfip2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924134 Cyfip2 cytoplasmic FMR1 interacting protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7001 - EM:07275 C57BL/6N-A Cyba/WtsiIeg EMMA sperm mutant strain MGI:4432216 Cyba targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1316658 Cyba cytochrome b-245, alpha polypeptide https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7275 + EM:09700 C57BL/6N-A Cxcr2/WtsiOulu EMMA embryo mutant strain MGI:4842593 Cxcr2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105303 Cxcr2 chemokine (C-X-C motif) receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9700 + EM:09700 C57BL/6N-A Cxcr2/WtsiOulu EMMA sperm mutant strain MGI:4842593 Cxcr2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105303 Cxcr2 chemokine (C-X-C motif) receptor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9700 - EM:06980 C57BL/6N-A Cutal/WtsiIeg EMMA sperm mutant strain MGI:4432816 Cutal targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1925246 Cutal cutA divalent cation tolerance homolog-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6980 + EM:08231 C57BL/6N-A Cttnbp2/WtsiPh EMMA sperm mutant strain MGI:4455588 Cttnbp2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353467 Cttnbp2 cortactin binding protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8231 + EM:10864 C57BL/6N-A Cstdc1/WtsiOulu EMMA embryo C57BL/6N-A 8030411F24Rik/WtsiOulu mutant strain MGI:4840668 Cstdc1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1925859 Cstdc1 cystatin domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10864 + EM:10864 C57BL/6N-A Cstdc1/WtsiOulu EMMA sperm C57BL/6N-A 8030411F24Rik/WtsiOulu mutant strain MGI:4840668 Cstdc1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1925859 Cstdc1 cystatin domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10864 - EM:06860 C57BL/6N-A Csnk1g3/WtsiCnrm EMMA sperm mutant strain MGI:4461713 Csnk1g3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917675 Csnk1g3 casein kinase 1, gamma 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6860 + EM:11288 C57BL/6N-A Csf2/WtsiOrl EMMA archived mutant strain MGI:4819997 Csf2 targeted mutation 1, Mouse Biology Program, UCDavis MGI:1339752 Csf2 colony stimulating factor 2 (granulocyte-macrophage) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11288 ? EM:13173 C57BL/6N-A Cryab/WtsiFlmg EMMA sperm mutant strain MGI:5002972 Cryab targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88516 Cryab crystallin, alpha B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13173 + EM:10865 C57BL/6N-A Crls1/WtsiOulu EMMA embryo mutant strain MGI:4432552 Crls1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913836 Crls1 cardiolipin synthase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10865 + EM:10865 C57BL/6N-A Crls1/WtsiOulu EMMA sperm mutant strain MGI:4432552 Crls1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913836 Crls1 cardiolipin synthase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10865 + EM:11750 C57BL/6N-A Crip2/WtsiCnrm EMMA sperm mutant strain MGI:4849417 Crip2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915587 Crip2 cysteine rich protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11750 - EM:06200 C57BL/6N-A Creb3l1/WtsiCnrm EMMA sperm mutant strain MGI:4842311 Creb3l1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1347062 Creb3l1 cAMP responsive element binding protein 3-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6200 - EM:07854 C57BL/6N-A Crb2/WtsiH EMMA sperm mutant strain MGI:4818586 Crb2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2679260 Crb2 crumbs family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7854 - EM:07266 C57BL/6N-A Cpsf3/WtsiCnrm EMMA sperm mutant strain MGI:4432649 Cpsf3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859328 Cpsf3 cleavage and polyadenylation specificity factor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7266 - EM:11126 C57BL/6N-A Cpgi81/WtsiH EMMA live mutant strain MGI:6755530 Cpgi81 targeted mutation 1, William C Skarnes MGI:5665212 Cpgi81 CpG island 81 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11126 - EM:10955 C57BL/6N-A Cpgi5563/WtsiH EMMA sperm mutant strain MGI:6359755 Cpgi5563 targeted mutation 1, William C Skarnes MGI:5670665 Cpgi5563 CpG island 5563 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10955 ? EM:11222 C57BL/6N-A Cpgi5176/WtsiIeg EMMA sperm mutant strain Cpgi5176 Sanger Institute targeted mutation 1, William C. Skarnes MGI:5670278 Cpgi5176 CpG island 5176 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11222 ? EM:11221 C57BL/6N-A Cpgi399/WtsiIeg EMMA sperm mutant strain Cpgi399 Sanger Institute targeted mutation 1, William C. Skarnes MGI:5665530 Cpgi399 CpG island 399 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11221 ? EM:11223 C57BL/6N-A Cpgi23001/WtsiIeg EMMA sperm mutant strain Cpgi23001 Sanger Institute targeted mutation 1, William C. Skarnes MGI:5688069 Cpgi23001 CpG island 23001 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11223 ? EM:14017 C57BL/6N-A Cpgi16218/WtsiIeg EMMA sperm mutant strain Cpgi16218 Sanger Institute targeted mutation 1, William C. Skarnes MGI:5681297 Cpgi16218 CpG island 16218 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14017 ? EM:10960 C57BL/6N-A Cpgi15497/WtsiH EMMA sperm mutant strain Cpgi15497 Sanger Institute targeted mutation 1, William C. Skarnes MGI:5680577 Cpgi15497 CpG island 15497 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10960 ? EM:11224 C57BL/6N-A Cpgi15344/WtsiIeg EMMA sperm mutant strain Cpgi15344 Sanger Institute targeted mutation 1, William C. Skarnes MGI:5680424 Cpgi15344 CpG island 15344 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11224 ? EM:11294 C57BL/6N-A Cpgi15342/WtsiOrl EMMA sperm mutant strain Cpgi15342 Sanger Institute targeted mutation 1, William C. Skarnes MGI:5680422 Cpgi15342 CpG island 15342 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11294 ? EM:10961 C57BL/6N-A Cpgi13569/WtsiH EMMA sperm mutant strain Cpgi13569 Sanger MGP targeted mutation 1, William C. Skarnes MGI:5678653 Cpgi13569 CpG island 13569 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10961 ? EM:14351 C57BL/6N-A Cpgi13568/WtsiIeg EMMA sperm mutant strain Cpgi13568 undef targeted mutation , William C. Skarnes MGI:5678652 Cpgi13568 CpG island 13568 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14351 ? EM:10957 C57BL/6N-A Cpgi13101/WtsiH EMMA sperm mutant strain Cpgi13101 Sanger Institute targeted mutation 1, William C. Skarnes MGI:5678185 Cpgi13101 CpG island 13101 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10957 ? EM:10954 C57BL/6N-A Cpgi1230/WtsiH EMMA sperm mutant strain Cpgi1230 Sanger Institute targeted mutation 1, William C. Skarnes MGI:5666359 Cpgi1230 CpG island 1230 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10954 ? EM:11225 C57BL/6N-A Cpgi11865/WtsiIeg EMMA sperm mutant strain Cpgi11865 Sanger Institute targeted mutation 1, William C. Skarnes MGI:5676951 Cpgi11865 CpG island 11865 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11225 + EM:08749 C57BL/6N-A Coro6/WtsiFlmg EMMA sperm mutant strain MGI:5000412 Coro6 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2183448 Coro6 coronin 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8749 + EM:14530 C57BL/6N-A Coro1c/WtsiOulu EMMA embryo mutant strain MGI:4419168 Coro1c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1345964 Coro1c coronin, actin binding protein 1C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14530 + EM:14530 C57BL/6N-A Coro1c/WtsiOulu EMMA sperm mutant strain MGI:4419168 Coro1c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1345964 Coro1c coronin, actin binding protein 1C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14530 - EM:07033 C57BL/6N-A Coq4/WtsiCnrm EMMA sperm mutant strain MGI:4441729 Coq4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098826 Coq4 coenzyme Q4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7033 + EM:07181 C57BL/6N-A Coq10b/WtsiH EMMA sperm B6NTac;B6N-A Coq10b/WtsiH mutant strain MGI:4820231 Coq10b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915126 Coq10b coenzyme Q10B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7181 - EM:07323 C57BL/6N-A Commd10/WtsiIeg EMMA sperm mutant strain MGI:4842273 Commd10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916706 Commd10 COMM domain containing 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7323 + EM:10819 C57BL/6N-A Cog6/WtsiFlmg EMMA sperm mutant strain MGI:4820323 Cog6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914792 Cog6 component of oligomeric golgi complex 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10819 + EM:09576 C57BL/6N-A Cnot4/WtsiPh EMMA sperm mutant strain MGI:4842581 Cnot4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859026 Cnot4 CCR4-NOT transcription complex, subunit 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9576 + EM:10978 C57BL/6N-A Cnih3/WtsiBiat EMMA sperm mutant strain MGI:4947746 Cnih3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920228 Cnih3 cornichon family AMPA receptor auxiliary protein 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10978 - EM:07191 C57BL/6N-A Cnbd1/WtsiCnrm EMMA sperm mutant strain MGI:4434076 Cnbd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3650508 Cnbd1 cyclic nucleotide binding domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7191 - EM:06094 C57BL/6N-A Cmtm6/WtsiCnbc EMMA sperm mutant strain MGI:4441838 Cmtm6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2447165 Cmtm6 CKLF-like MARVEL transmembrane domain containing 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6094 + EM:09727 C57BL/6N-A Cmtm5/WtsiH EMMA sperm mutant strain MGI:5286201 Cmtm5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2447164 Cmtm5 CKLF-like MARVEL transmembrane domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9727 - EM:06038 C57BL/6N-A Cmtm4/WtsiBiat EMMA sperm mutant strain MGI:4441855 Cmtm4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2142888 Cmtm4 CKLF-like MARVEL transmembrane domain containing 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6038 - EM:08146 C57BL/6N-A Cmip/WtsiH EMMA sperm mutant strain MGI:5286409 Cmip targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921690 Cmip c-Maf inducing protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8146 + EM:07501 C57BL/6N-A Cmbl/WtsiOrl EMMA sperm B6NTac;B6N-A Cmbl/WtsiOrl mutant strain MGI:5286220 Cmbl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916824 Cmbl carboxymethylenebutenolidase-like (Pseudomonas) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7501 + EM:09701 C57BL/6N-A Clpp/WtsiH EMMA sperm mutant strain MGI:4820264 Clpp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858213 Clpp caseinolytic mitochondrial matrix peptidase proteolytic subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9701 ? EM:13944 C57BL/6N-A Clec4a3/WtsiPh EMMA sperm mutant strain MGI:4840936 Clec4a3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920399 Clec4a3 C-type lectin domain family 4, member a3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13944 + EM:10719 C57BL/6N-A Cidea/Ics EMMA sperm mutant strain MGI:4842219 Cidea targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH CIDEA CIDEA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10719 + EM:14102 C57BL/6N-A Cibar2/WtsiH EMMA live mutant strain MGI:5296610 Cibar2 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:3588213 Cibar2 CBY1 interacting BAR domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14102 + EM:09577 C57BL/6N-A Cibar1/WtsiOrl EMMA sperm C57BL/6N-A Fam92a/WtsiOrl mutant strain MGI:5013734 Cibar1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915349 Cibar1 CBY1 interacting BAR domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9577 + EM:05970 C57BL/6N-A Ciao2a/WtsiBiat EMMA sperm B6NTac;B6N-A Fam96a/WtsiBiat mutant strain MGI:4451949 Ciao2a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1915500 Ciao2a cytosolic iron-sulfur assembly component 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5970 + EM:09273 C57BL/6N-A Chtop/WtsiH EMMA sperm mutant strain MGI:4842477 Chtop targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913761 Chtop chromatin target of PRMT1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9273 + EM:09704 C57BL/6N-A Chst11/WtsiFlmg EMMA sperm mutant strain MGI:4363643 Chst11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927166 Chst11 carbohydrate sulfotransferase 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9704 + EM:09277 C57BL/6N-A Chmp6/WtsiPh EMMA sperm mutant strain MGI:5006732 Chmp6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3583942 Chmp6 charged multivesicular body protein 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9277 + EM:11558 C57BL/6N-A Chka/WtsiOulu EMMA embryo mutant strain MGI:5050150 Chka targeted mutation 2a, Wellcome Trust Sanger Institute MGI:107760 Chka choline kinase alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11558 + EM:11558 C57BL/6N-A Chka/WtsiOulu EMMA sperm mutant strain MGI:5050150 Chka targeted mutation 2a, Wellcome Trust Sanger Institute MGI:107760 Chka choline kinase alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11558 + EM:10797 C57BL/6N-A Chil4/WtsiH EMMA live mutant strain MGI:5520258 Chil4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1341098 Chil4 chitinase-like 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10797 + EM:09163 C57BL/6N-A Chd9/WtsiPh EMMA sperm mutant strain MGI:4820270 Chd9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924001 Chd9 chromodomain helicase DNA binding protein 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9163 + EM:11560 C57BL/6N-A Chchd6/WtsiIeg EMMA sperm mutant strain MGI:4842800 Chchd6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913348 Chchd6 coiled-coil-helix-coiled-coil-helix domain containing 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11560 + EM:09274 C57BL/6N-A Cgrrf1/WtsiPh EMMA sperm mutant strain MGI:5294970 Cgrrf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916368 Cgrrf1 cell growth regulator with ring finger domain 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9274 - EM:05871 C57BL/6N-A Cfh/WtsiH EMMA sperm B6NTac;B6N-Cfh A/WtsiH, C57BL/6N-Cfh A/WtsiH, B6NTac;B6N-A Cfh/WtsiH mutant strain MGI:4434438 Cfh targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88385 Cfh complement component factor h https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5871 + EM:09707 C57BL/6N-A Cfap61/WtsiPh EMMA sperm mutant strain MGI:5527609 Cfap61 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1926024 Cfap61 cilia and flagella associated protein 61 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9707 ? EM:14014 C57BL/6N-A Cfap44/WtsiPh EMMA sperm mutant strain MGI:4431950 Cfap44 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1277238 Cfap44 cilia and flagella associated protein 44 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14014 + EM:08488 C57BL/6N-A Cert1/WtsiFlmg EMMA sperm C57BL/6N-A Col4a3bp/WtsiFlmg mutant strain MGI:5287775 Cert1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915268 Cert1 ceramide transporter 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8488 + EM:10951 C57BL/6N-A Cerox1/WtsiH EMMA sperm C57BL/6N-A 2810468N07Rik/WtsiH mutant strain MGI:6716839 Cerox1 targeted mutation 1, William C Skarnes MGI:1920084 Cerox1 cytoplasmic endogenous regulator of oxidative phosphorylation 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10951 + EM:07178 C57BL/6N-A Cep250/WtsiH EMMA sperm B6NTac;B6N-Cep250 A/WtsiH, B6NTac;B6N-A Cep250/WtsiH, MFCU mutant strain MGI:4431949 Cep250 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108084 Cep250 centrosomal protein 250 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7178 + EM:11290 C57BL/6N-A Cep120/WtsiOrl EMMA sperm mutant strain MGI:4841669 Cep120 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2147298 Cep120 centrosomal protein 120 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11290 - EM:06849 C57BL/6N-A Cenpl/WtsiCnrm EMMA sperm mutant strain MGI:4433140 Cenpl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917704 Cenpl centromere protein L https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6849 ? EM:14069 C57BL/6N-A Celf6/WtsiIeg EMMA sperm mutant strain MGI:4843838 Celf6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923433 Celf6 CUGBP, Elav-like family member 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14069 + EM:09705 C57BL/6N-A Celf4/WtsiPh EMMA sperm mutant strain MGI:4433345 Celf4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1932407 Celf4 CUGBP, Elav-like family member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9705 + EM:10866 C57BL/6N-A Celf2/WtsiOulu EMMA embryo mutant strain MGI:4434482 Celf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1338822 Celf2 CUGBP, Elav-like family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10866 + EM:10866 C57BL/6N-A Celf2/WtsiOulu EMMA sperm mutant strain MGI:4434482 Celf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1338822 Celf2 CUGBP, Elav-like family member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10866 + EM:06264 C57BL/6N-A Cdkal1/WtsiCnbc EMMA sperm B6NTac;B6N-A Cdkal1/WtsiCnbc mutant strain MGI:4842388 Cdkal1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1921765 Cdkal1 CDK5 regulatory subunit associated protein 1-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6264 + EM:11341 C57BL/6N-A Cdh9/Ics EMMA sperm mutant strain MGI:4420137 Cdh9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107433 Cdh9 cadherin 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11341 ? EM:14393 C57BL/6N-A Cdh26/WtsiPh EMMA sperm mutant strain MGI:4942041 Cdh26 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685856 Cdh26 cadherin-like 26 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14393 + EM:10188 C57BL/6N-A Cdh23/WtsiCnrm EMMA sperm mutant strain MGI:5527600 Cdh23 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10188 - EM:06978 C57BL/6N-A Cdh19/WtsiIeg EMMA sperm mutant strain MGI:4432826 Cdh19 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3588198 Cdh19 cadherin 19, type 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6978 + EM:12081 C57BL/6N-A Cdc6/Wtsi EMMA embryo mutant strain MGI:4454064 Cdc6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1345150 Cdc6 cell division cycle 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12081 - EM:07205 C57BL/6N-A Cdc42bpa/WtsiCnrm EMMA sperm mutant strain MGI:4431983 Cdc42bpa targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2441841 Cdc42bpa CDC42 binding protein kinase alpha https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7205 - EM:07694 C57BL/6N-A Cd9/IcsOrl EMMA sperm mutant strain MGI:4435382 Cd9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88348 Cd9 CD9 antigen https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7694 + EM:07400 C57BL/6N-A Cd55b/WtsiH EMMA sperm B6NTac;B6N-Daf2 A/WtsiH, B6NTac;B6N-Cd55b A/WtsiH, B6NTac;B6N-A Daf2/WtsiH mutant strain MGI:4868034 Cd55b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104849 Cd55b CD55 molecule, decay accelerating factor for complement B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7400 + EM:13983 C57BL/6N-A Ccnc/WtsiOulu EMMA embryo mutant strain MGI:5301390 Ccnc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858199 Ccnc cyclin C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13983 + EM:13983 C57BL/6N-A Ccnc/WtsiOulu EMMA sperm mutant strain MGI:5301390 Ccnc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858199 Ccnc cyclin C https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13983 + EM:07278 C57BL/6N-A Ccl22/WtsiH EMMA sperm B6NTac;B6N-A Ccl22/WtsiH mutant strain MGI:4441963 Ccl22 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1306779 Ccl22 chemokine (C-C motif) ligand 22 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7278 ? EM:13977 C57BL/6N-A Ccdc24/WtsiPh EMMA sperm mutant strain MGI:4455549 Ccdc24 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685874 Ccdc24 coiled-coil domain containing 24 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13977 + EM:08868 C57BL/6N-A Ccdc18/WtsiIeg EMMA sperm mutant strain MGI:4460455 Ccdc18 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922974 Ccdc18 coiled-coil domain containing 18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8868 - EM:06854 C57BL/6N-A Ccdc160/WtsiBiat EMMA sperm mutant strain MGI:4453700 Ccdc160 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3588225 Ccdc160 coiled-coil domain containing 160 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6854 + EM:08996 C57BL/6N-A Ccdc159/WtsiOrl EMMA sperm mutant strain MGI:4419403 Ccdc159 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914369 Ccdc159 coiled-coil domain containing 159 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8996 ? EM:14099 C57BL/6N-A Ccdc14/WtsiIeg EMMA sperm mutant strain MGI:4880921 Ccdc14 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443448 Ccdc14 coiled-coil domain containing 14 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14099 + EM:07959 C57BL/6N-A Ccdc134/WtsiH EMMA sperm B6NTac;B6N-A Ccdc134/WtsiH mutant strain MGI:4362536 Ccdc134 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923707 Ccdc134 coiled-coil domain containing 134 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7959 + EM:08475 C57BL/6N-A Ccdc127/WtsiFlmg EMMA sperm mutant strain MGI:4432124 Ccdc127 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914683 Ccdc127 coiled-coil domain containing 127 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8475 + EM:07609 C57BL/6N-A Ccdc122/WtsiH EMMA sperm B6NTac;B6N-A Ccdc122/WtsiH mutant strain MGI:4363388 Ccdc122 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918358 Ccdc122 coiled-coil domain containing 122 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7609 - EM:05701 C57BL/6N-A Cc2d2a/WtsiIeg EMMA sperm mutant strain MGI:4431801 Cc2d2a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924487 Cc2d2a coiled-coil and C2 domain containing 2A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5701 - EM:06102 C57BL/6N-A Cbx6/WtsiCnbc EMMA sperm mutant strain MGI:4441849 Cbx6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3512628 Cbx6 chromobox 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6102 - EM:05787 C57BL/6N-A Cbx5/WtsiOrl EMMA sperm mutant strain MGI:4441648 Cbx5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109372 Cbx5 chromobox 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5787 + EM:09825 C57BL/6N-A Cbr2/WtsiPh EMMA sperm mutant strain MGI:4947775 Cbr2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107200 Cbr2 carbonyl reductase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9825 ? EM:14097 C57BL/6N-A Casp12/WtsiOrl EMMA sperm mutant strain MGI:4939736 Casp12 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1312922 Casp12 caspase 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14097 - EM:07856 C57BL/6N-A Card9/WtsiOrl EMMA sperm mutant strain MGI:4841496 Card9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2685628 Card9 caspase recruitment domain family, member 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7856 + EM:08872 C57BL/6N-A Capza2/WtsiIeg EMMA sperm mutant strain MGI:4880887 Capza2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106222 Capza2 capping actin protein of muscle Z-line subunit alpha 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8872 - EM:06845 C57BL/6N-A Capn11/WtsiCnrm EMMA sperm mutant strain MGI:4432998 Capn11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1352490 Capn11 calpain 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6845 + EM:10669 C57BL/6N-A Capn10/Ics EMMA sperm mutant strain MGI:4842347 Capn10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1344392 Capn10 calpain 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10669 + EM:11496 C57BL/6N-A Camsap3/WtsiPh EMMA sperm mutant strain MGI:4431915 Camsap3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916947 Camsap3 calmodulin regulated spectrin-associated protein family, member 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11496 - EM:07974 C57BL/6N-A Camkmt/WtsiH EMMA sperm mutant strain MGI:4820305 Camkmt targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920832 Camkmt calmodulin-lysine N-methyltransferase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7974 + EM:14376 C57BL/6N-A Calr4/WtsiOulu EMMA embryo mutant strain MGI:5008777 Calr4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2140435 Calr4 calreticulin 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14376 + EM:14376 C57BL/6N-A Calr4/WtsiOulu EMMA sperm mutant strain MGI:5008777 Calr4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2140435 Calr4 calreticulin 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14376 - EM:06089 C57BL/6N-A Cabp1/WtsiCnbc EMMA sperm mutant strain MGI:4441861 Cabp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1352750 Cabp1 calcium binding protein 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6089 ? EM:14380 C57BL/6N-A Btnl2/WtsiOrl EMMA sperm mutant strain MGI:5521882 Btnl2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1859549 Btnl2 butyrophilin-like 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14380 ? EM:14025 C57BL/6N-A Btbd1/WtsiOrl EMMA sperm mutant strain MGI:4419700 Btbd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933765 Btbd1 BTB (POZ) domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14025 - EM:05972 C57BL/6N-A Btbd11/WtsiBiat EMMA sperm mutant strain MGI:4441636 Abtb3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921257 Abtb3 ankyrin repeat and BTB domain containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5972 + EM:07392 C57BL/6N-A Bpifb5/WtsiH EMMA sperm EPD0684_2_C04, B6NTac;B6N-A Bpifb5/WtsiH, B6NTac;B6N-Bpifb5 A/WtsiH mutant strain MGI:4843822 Bpifb5 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2385160 Bpifb5 BPI fold containing family B, member 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7392 + EM:08876 C57BL/6N-A Bpifb1/WtsiIeg EMMA sperm mutant strain Bpifb1 KOMP targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2137431 Bpifb1 BPI fold containing family B, member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8876 - EM:07201 C57BL/6N-A Bola3/WtsiCnrm EMMA sperm mutant strain MGI:4842419 Bola3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1925903 Bola3 bolA-like 3 (E. coli) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7201 - EM:07967 C57BL/6N-A Bnip2/WtsiH EMMA sperm mutant strain MGI:4432551 Bnip2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109327 Bnip2 BCL2/adenovirus E1B interacting protein 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7967 - EM:05788 C57BL/6N-A Blzf1/WtsiOrl EMMA sperm mutant strain MGI:4441856 Blzf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1201607 Blzf1 basic leucine zipper nuclear factor 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5788 ? EM:14475 C57BL/6N-A Begain/WtsiBiat EMMA sperm mutant strain MGI:4460489 Begain targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3044626 Begain brain-enriched guanylate kinase-associated https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14475 + EM:13537 C57BL/6N-A BC049762/WtsiKieg EMMA embryo mutant strain MGI:5050166 BC049762 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:3039622 BC049762 cDNA sequence BC049762 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13537 + EM:13537 C57BL/6N-A BC049762/WtsiKieg EMMA sperm mutant strain MGI:5050166 BC049762 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:3039622 BC049762 cDNA sequence BC049762 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13537 - EM:08168 C57BL/6N-A Bach2/WtsiOrl EMMA sperm mutant strain MGI:4882014 Bach2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:894679 Bach2 BTB and CNC homology, basic leucine zipper transcription factor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8168 - EM:07032 C57BL/6N-A B9d2/WtsiBiat EMMA sperm mutant strain MGI:4441794 B9d2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2387643 B9d2 B9 protein domain 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7032 ? EM:10952 C57BL/6N-A B230312C02Rik/WtsiH EMMA sperm mutant strain B230312C02Rik Sanger Institute targeted mutation 1, William C. Skarnes MGI:2444130 B230312C02Rik RIKEN cDNA B230312C02 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10952 + EM:09455 C57BL/6N-A Atxn7l3/Ics EMMA sperm mutant strain Atxn7l3 KOMP targeted mutation 1, Wellcome Trust Sanger Institute MGI:3036270 Atxn7l3 ataxin 7-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9455 + EM:09455 C57BL/6N-A Atxn7l3/Ics EMMA live mutant strain Atxn7l3 KOMP targeted mutation 1, Wellcome Trust Sanger Institute MGI:3036270 Atxn7l3 ataxin 7-like 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9455 + EM:08928 C57BL/6N-A Atxn10/WtsiOulu EMMA embryo mutant strain MGI:4942022 Atxn10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859293 Atxn10 ataxin 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8928 + EM:08928 C57BL/6N-A Atxn10/WtsiOulu EMMA sperm mutant strain MGI:4942022 Atxn10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859293 Atxn10 ataxin 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8928 + EM:07614 C57BL/6N-A Atp8b2/WtsiH EMMA sperm B6NTac;B6N-A Atp8b2/WtsiH mutant strain MGI:4419232 Atp8b2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859660 Atp8b2 ATPase, class I, type 8B, member 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7614 - EM:07030 C57BL/6N-A Atp5pb/WtsiOulu EMMA embryo mutant strain MGI:4431782 Atp5pb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1100495 Atp5pb ATP synthase peripheral stalk-membrane subunit b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7030 - EM:07030 C57BL/6N-A Atp5pb/WtsiOulu EMMA sperm mutant strain MGI:4431782 Atp5pb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1100495 Atp5pb ATP synthase peripheral stalk-membrane subunit b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7030 - EM:06863 C57BL/6N-A Atp5e/WtsiCnrm EMMA sperm mutant strain MGI:4842692 Atp5e targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1855697 Atp5e ATP synthase, H+ transporting, mitochondrial F1 complex, epsilon subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6863 - EM:07125 C57BL/6N-A Atg16l2/WtsiCnrm EMMA sperm mutant strain MGI:4433064 Atg16l2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920933 Atg16l2 autophagy related 16-like 2 (S. cerevisiae) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7125 + EM:09148 C57BL/6N-A Atf2/Ph EMMA sperm mutant strain MGI:5289859 Atf2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109349 Atf2 activating transcription factor 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9148 ? EM:13192 C57BL/6N-A Aspm/WtsiFlmg EMMA sperm mutant strain MGI:4362345 Aspm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1334448 Aspm abnormal spindle microtubule assembly https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13192 + EM:12751 C57BL/6N-A Asphd1/Ics EMMA live mutant strain MGI:5497168 Asphd1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2685014 Asphd1 aspartate beta-hydroxylase domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12751 + EM:14392 C57BL/6N-A Asb3/WtsiPh EMMA live mutant strain MGI:4840680 Asb3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1929749 Asb3 ankyrin repeat and SOCS box-containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14392 - EM:06994 C57BL/6N-A Arrdc5/WtsiIeg EMMA sperm mutant strain MGI:4433019 Arrdc5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924170 Arrdc5 arrestin domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6994 + EM:07192 C57BL/6N-A Arpin/WtsiH EMMA sperm B6NTac;B6N-A 2610034B18Rik/WtsiH, B6NTac;B6N-A Arpin/WtsiH mutant strain MGI:4842572 Arpin targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917670 Arpin actin-related protein 2/3 complex inhibitor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7192 - EM:07283 C57BL/6N-A Arpc3/WtsiCnrm EMMA sperm mutant strain MGI:4842449 Arpc3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928375 Arpc3 actin related protein 2/3 complex, subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7283 ? EM:13792 C57BL/6N-A Arpc3 Muc3 Kmt2d Tbx1/WtsiH[cc] EMMA archived mutant strain MGI:4842449 Arpc3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928375 Arpc3 actin related protein 2/3 complex, subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13792 ? EM:13792 C57BL/6N-A Arpc3 Muc3 Kmt2d Tbx1/WtsiH[cc] EMMA archived mutant strain Muc3 Muc3 MGI:1203527 Muc3 mucin 3, intestinal https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13792 ? EM:13792 C57BL/6N-A Arpc3 Muc3 Kmt2d Tbx1/WtsiH[cc] EMMA archived mutant strain MGI:6470864 Tbx1 twitch MGI:98493 Tbx1 T-box 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13792 ? EM:13792 C57BL/6N-A Arpc3 Muc3 Kmt2d Tbx1/WtsiH[cc] EMMA archived mutant strain Kmt2d Kmt2d MGI:2682319 Kmt2d lysine (K)-specific methyltransferase 2D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13792 - EM:05965 C57BL/6N-A Arpc1b/WtsiBiat EMMA sperm mutant strain MGI:4431851 Arpc1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1343142 Arpc1b actin related protein 2/3 complex, subunit 1B https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5965 + EM:08869 C57BL/6N-A Armh3/WtsiIeg EMMA sperm EPD0557_1_D11, C57BL/6N-A 9130011E15Rik/WtsiIeg mutant strain MGI:4455980 Armh3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918867 Armh3 armadillo-like helical domain containing 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8869 + EM:13542 C57BL/6N-A Armc7/WtsiKieg EMMA embryo mutant strain MGI:4419537 Armc7 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2679719 Armc7 armadillo repeat containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13542 + EM:13542 C57BL/6N-A Armc7/WtsiKieg EMMA sperm mutant strain MGI:4419537 Armc7 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2679719 Armc7 armadillo repeat containing 7 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13542 - EM:06377 C57BL/6N-A Arhgef7/WtsiBiat EMMA sperm mutant strain MGI:5009652 Arhgef7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1860493 Arhgef7 Rho guanine nucleotide exchange factor (GEF7) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6377 ? EM:13189 C57BL/6N-A Arhgap30/WtsiFlmg EMMA sperm mutant strain MGI:4433173 Arhgap30 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2684948 Arhgap30 Rho GTPase activating protein 30 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13189 + EM:10042 C57BL/6N-A Arhgap24/Ics EMMA sperm mutant strain MGI:4948613 Arhgap24 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922647 Arhgap24 Rho GTPase activating protein 24 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10042 + EM:10042 C57BL/6N-A Arhgap24/Ics EMMA live mutant strain MGI:4948613 Arhgap24 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922647 Arhgap24 Rho GTPase activating protein 24 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10042 - EM:06864 C57BL/6N-A Arhgap17/WtsiCnrm EMMA sperm mutant strain MGI:4842587 Arhgap17 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917747 Arhgap17 Rho GTPase activating protein 17 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6864 + EM:10190 C57BL/6N-A Arap2/WtsiCnrm EMMA sperm mutant strain MGI:5527598 Arap2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2684416 Arap2 ArfGAP with RhoGAP domain, ankyrin repeat and PH domain 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10190 + EM:09980 C57BL/6N-A App/IcsOrl EMMA sperm mutant strain MGI:5008790 App targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88059 App amyloid beta (A4) precursor protein https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9980 + EM:07971 C57BL/6N-A Apoo/WtsiH EMMA sperm B6NTac;B6N-A Apoo/WtsiH mutant strain MGI:5052398 Apoo targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915566 Apoo apolipoprotein O https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7971 + EM:10020 C57BL/6N-A Apol9b/WtsiPh EMMA sperm mutant strain MGI:5287779 Apol9b targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1919148 Apol9b apolipoprotein L 9b https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10020 + EM:14011 C57BL/6N-A Apol7a/WtsiOulu EMMA embryo mutant strain MGI:4419740 Apol7a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923011 Apol7a apolipoprotein L 7a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14011 + EM:14011 C57BL/6N-A Apol7a/WtsiOulu EMMA sperm mutant strain MGI:4419740 Apol7a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923011 Apol7a apolipoprotein L 7a https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14011 + EM:08226 C57BL/6N-A Ap4m1/WtsiPh EMMA sperm mutant strain MGI:5014709 Ap4m1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1337063 Ap4m1 adaptor-related protein complex AP-4, mu 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8226 + EM:06773 C57BL/6N-A Ap2a2/WtsiH EMMA sperm STOCK Ap2a2/Wtsi, B6NTac;B6N-A Ap2a2/WtsiH mutant strain MGI:4888954 Ap2a2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:101920 Ap2a2 adaptor-related protein complex 2, alpha 2 subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6773 - EM:07017 C57BL/6N-A Anxa9/WtsiOulu EMMA embryo mutant strain MGI:4441796 Anxa9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923711 Anxa9 annexin A9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7017 - EM:07017 C57BL/6N-A Anxa9/WtsiOulu EMMA sperm mutant strain MGI:4441796 Anxa9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923711 Anxa9 annexin A9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7017 + EM:08927 C57BL/6N-A Ano10/WtsiOulu EMMA embryo mutant strain MGI:4820361 Ano10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2143103 Ano10 anoctamin 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8927 + EM:08927 C57BL/6N-A Ano10/WtsiOulu EMMA sperm mutant strain MGI:4820361 Ano10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2143103 Ano10 anoctamin 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8927 + EM:07371 C57BL/6N-A Ankrd9/WtsiH EMMA sperm B6NTac;B6N-A Ankrd9/WtsiH mutant strain MGI:4419197 Ankrd9 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1921501 Ankrd9 ankyrin repeat domain 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7371 ? EM:14015 C57BL/6N-A Ankrd6/WtsiPh EMMA sperm mutant strain MGI:4419782 Ankrd6 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2154278 Ankrd6 ankyrin repeat domain 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14015 + EM:09967 C57BL/6N-A Ankrd27/IcsOrl EMMA sperm mutant strain MGI:4841657 Ankrd27 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444103 Ankrd27 ankyrin repeat domain 27 (VPS9 domain) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9967 + EM:09907 C57BL/6N-A Ankrd13d/WtsiOulu EMMA embryo mutant strain MGI:5503344 Ankrd13d targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1915673 Ankrd13d ankyrin repeat domain 13 family, member D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9907 + EM:09907 C57BL/6N-A Ankrd13d/WtsiOulu EMMA sperm mutant strain MGI:5503344 Ankrd13d targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1915673 Ankrd13d ankyrin repeat domain 13 family, member D https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9907 + EM:11748 C57BL/6N-A Ankhd1/WtsiCnrm EMMA sperm mutant strain MGI:4847680 Ankhd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921733 Ankhd1 ankyrin repeat and KH domain containing 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11748 + EM:08600 C57BL/6N-A Amz2/WtsiH EMMA sperm mutant strain MGI:4451419 Amz2 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:104837 Amz2 archaelysin family metallopeptidase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8600 + EM:07393 C57BL/6N-A Alox12e/WtsiH EMMA sperm B6NTac;B6N-A Alox12e/WtsiH mutant strain MGI:4441885 Alox12e targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1274790 Alox12e arachidonate lipoxygenase, epidermal https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7393 - EM:07492 C57BL/6N-A Aldh3b1/WtsiOulu EMMA embryo mutant strain MGI:5003007 Aldh3b1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914939 Aldh3b1 aldehyde dehydrogenase 3 family, member B1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7492 - EM:07492 C57BL/6N-A Aldh3b1/WtsiOulu EMMA sperm mutant strain MGI:5003007 Aldh3b1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914939 Aldh3b1 aldehyde dehydrogenase 3 family, member B1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7492 + EM:09729 C57BL/6N-A Aldh1b1/WtsiH EMMA sperm mutant strain MGI:4840594 Aldh1b1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1919785 Aldh1b1 aldehyde dehydrogenase 1 family, member B1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9729 + EM:11212 C57BL/6N-A Akr1c20/WtsiOulu EMMA embryo mutant strain MGI:4950952 Akr1c20 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2151104 Akr1c20 aldo-keto reductase family 1, member C20 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11212 + EM:11212 C57BL/6N-A Akr1c20/WtsiOulu EMMA sperm mutant strain MGI:4950952 Akr1c20 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2151104 Akr1c20 aldo-keto reductase family 1, member C20 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11212 + EM:06777 C57BL/6N-A Aif1l/WtsiH EMMA sperm MEVR, B6NTac;B6N-Aif1l A/WtsiH, B6NTac;B6N-A Aif1l/WtsiH mutant strain MGI:4432419 Aif1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919598 Aif1l allograft inflammatory factor 1-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6777 + EM:08875 C57BL/6N-A Aicda/WtsiIeg EMMA sperm mutant strain MGI:4460367 Aicda targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1342279 Aicda activation-induced cytidine deaminase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8875 + EM:14018 C57BL/6N-A AI182371/WtsiOulu EMMA embryo mutant strain MGI:5286211 AI182371 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2138853 AI182371 expressed sequence AI182371 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14018 + EM:14018 C57BL/6N-A AI182371/WtsiOulu EMMA sperm mutant strain MGI:5286211 AI182371 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2138853 AI182371 expressed sequence AI182371 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14018 - EM:07123 C57BL/6N-A Ahcyl1/WtsiCnrm EMMA sperm mutant strain MGI:4431930 Ahcyl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385184 Ahcyl1 S-adenosylhomocysteine hydrolase-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7123 + EM:14020 C57BL/6N-A Ago3/WtsiOulu EMMA embryo mutant strain MGI:4880894 Ago3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446634 Ago3 argonaute RISC catalytic subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14020 + EM:14020 C57BL/6N-A Ago3/WtsiOulu EMMA sperm mutant strain MGI:4880894 Ago3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446634 Ago3 argonaute RISC catalytic subunit 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14020 - EM:08153 C57BL/6N-A Agap1/WtsiBiat EMMA sperm mutant strain MGI:4820274 Agap1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2653690 Agap1 ArfGAP with GTPase domain, ankyrin repeat and PH domain 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8153 - EM:07277 C57BL/6N-A Afap1l1/WtsiIeg EMMA sperm mutant strain MGI:4842406 Afap1l1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2147199 Afap1l1 actin filament associated protein 1-like 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7277 + EM:08384 C57BL/6N-A Adpgk/WtsiOrl EMMA sperm mutant strain MGI:4840602 Adpgk targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1919391 Adpgk ADP-dependent glucokinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8384 + EM:08738 C57BL/6N-A Adgrb1/WtsiBiat EMMA sperm mutant strain MGI:5006776 Adgrb1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1933736 Adgrb1 adhesion G protein-coupled receptor B1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8738 - EM:07963 C57BL/6N-A Adcy9/WtsiH EMMA sperm mutant strain MGI:4433478 Adcy9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108450 Adcy9 adenylate cyclase 9 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7963 + EM:11881 C57BL/6N-A Adcy3/WtsiH EMMA sperm mutant strain MGI:4432916 Adcy3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99675 Adcy3 adenylate cyclase 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11881 + EM:08737 C57BL/6N-A Adcy2/WtsiH EMMA sperm mutant strain MGI:4451651 Adcy2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99676 Adcy2 adenylate cyclase 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8737 - EM:07477 C57BL/6N-A Adap1/WtsiOulu EMMA embryo mutant strain MGI:4944490 Adap1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442201 Adap1 ArfGAP with dual PH domains 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7477 - EM:07477 C57BL/6N-A Adap1/WtsiOulu EMMA sperm mutant strain MGI:4944490 Adap1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442201 Adap1 ArfGAP with dual PH domains 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7477 + EM:07375 C57BL/6N-A Adamts3/WtsiH EMMA sperm B6NTac;B6N-A Adamts3/WtsiH mutant strain MGI:4841315 Adamts3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3045353 Adamts3 a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7375 + EM:09395 C57BL/6N-A Adamts19/WtsiOrl EMMA sperm mutant strain MGI:5527601 Adamts19 targeted mutation 4a, Wellcome Trust Sanger Institute MGI:2442875 Adamts19 a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 19 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9395 + EM:11746 C57BL/6N-A Adal/WtsiCnrm EMMA sperm mutant strain MGI:5302350 Adal targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923144 Adal adenosine deaminase-like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11746 - EM:06796 C57BL/6N-A Actr6/WtsiBiat EMMA sperm mutant strain MGI:4434280 Actr6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914269 Actr6 ARP6 actin-related protein 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6796 - EM:05964 C57BL/6N-A Actn4/WtsiBiat EMMA sperm mutant strain MGI:4441842 Actn4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1890773 Actn4 actinin alpha 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5964 + EM:09607 C57BL/6N-A Actl10/WtsiOulu EMMA embryo mutant strain MGI:5473172 Actl10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917612 Actl10 actin-like 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9607 + EM:09607 C57BL/6N-A Actl10/WtsiOulu EMMA sperm mutant strain MGI:5473172 Actl10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917612 Actl10 actin-like 10 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9607 + EM:09984 C57BL/6N-A Ackr3/IcsOrl EMMA sperm mutant strain MGI:5085477 Ackr3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:109562 Ackr3 atypical chemokine receptor 3 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9984 + EM:08275 C57BL/6N-A Acer1/WtsiH EMMA sperm C57BL/6N-Acer1/Wtsi mutant strain MGI:4432648 Acer1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2181962 Acer1 alkaline ceramidase 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8275 + EM:06265 C57BL/6N-A Acbd5/WtsiCnbc EMMA sperm B6NTac;B6N-A Acbd5/WtsiCnbc mutant strain MGI:4842354 Acbd5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921409 Acbd5 acyl-Coenzyme A binding domain containing 5 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6265 - EM:07179 C57BL/6N-A Acad12/WtsiCnrm EMMA sperm mutant strain MGI:4842615 Acad12 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443320 Acad12 acyl-Coenzyme A dehydrogenase family, member 12 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7179 ? EM:14033 C57BL/6N-A Acaa1a/WtsiPh EMMA sperm mutant strain MGI:4451483 Acaa1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2148491 Acaa1a acetyl-Coenzyme A acyltransferase 1A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14033 + EM:08739 C57BL/6N-A Abtb2/WtsiH EMMA sperm C57BL/6N-Abtb2/Wtsi mutant strain MGI:4451397 Abtb2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2139365 Abtb2 ankyrin repeat and BTB (POZ) domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8739 - EM:06851 C57BL/6N-A Abraxas2/WtsiBiat EMMA sperm mutant strain MGI:4431611 Abraxas2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926116 Abraxas2 BRISC complex subunit https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6851 - EM:06569 C57BL/6N-A Abracl/Wtsi EMMA archived mutant strain MGI:4944406 Abracl targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1920362 Abracl ABRA C-terminal like https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6569 + EM:09476 C57BL/6N-A Abhd17a/WtsiPh EMMA sperm mutant strain MGI:5013744 Abhd17a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106388 Abhd17a abhydrolase domain containing 17A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9476 + EM:11495 C57BL/6N-A Abhd16a/WtsiPh EMMA sperm mutant strain MGI:4820220 Abhd16a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99476 Abhd16a abhydrolase domain containing 16A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11495 + EM:09814 C57BL/6N-A Abhd14a/WtsiPh EMMA sperm mutant strain MGI:4842383 Abhd14a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1915894 Abhd14a abhydrolase domain containing 14A https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9814 + EM:07502 C57BL/6N-A Abcb6/WtsiOrl EMMA sperm B6NTac;B6N-A Abcb6/WtsiOrl mutant strain MGI:4362220 Abcb6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921354 Abcb6 ATP-binding cassette, sub-family B (MDR/TAP), member 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7502 - EM:05898 C57BL/6N-A Abca4/WtsiIeg EMMA sperm mutant strain MGI:4441732 Abca4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109424 Abca4 ATP-binding cassette, sub-family A (ABC1), member 4 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=5898 + EM:11200 C57BL/6N-A A930004D18Rik/WtsiBiat EMMA sperm mutant strain MGI:4441782 A930004D18Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1925190 A930004D18Rik RIKEN cDNA A930004D18 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11200 + EM:10698 C57BL/6N-A A830019P07Rik/WtsiIeg EMMA sperm mutant strain MGI:4820036 A830019P07Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3028035 A830019P07Rik RIKEN cDNA A830019P07 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10698 - EM:11279 C57BL/6N-A A430078G23Rik/WtsiOrl EMMA sperm mutant strain MGI:5426632 Arhgef18 targeted mutation 1a, Wellcome Trust Sanger Institute A430078G23Rik withdrawn, = Arhgef18 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11279 + EM:07384 C57BL/6N-A A430005L14Rik/WtsiH EMMA sperm EPD0360_1_E07, B6NTac;B6N-A A430005L14Rik/WtsiH mutant strain MGI:4419175 A430005L14Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2140680 A430005L14Rik RIKEN cDNA A430005L14 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7384 - EM:06846 C57BL/6N-A 4933434E20Rik/WtsiCnrm EMMA sperm mutant strain MGI:4432969 4933434E20Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914027 4933434E20Rik RIKEN cDNA 4933434E20 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6846 + EM:07855 C57BL/6N-A 4933402N03Rik/WtsiH EMMA sperm B6NTac;B6N-A 4933402N03Rik/WtsiH mutant strain MGI:4820121 4933402N03Rik targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1914681 4933402N03Rik RIKEN cDNA 4933402N03 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7855 + EM:06096 C57BL/6N-A 4932438H23Rik/WtsiCnbc EMMA sperm B6NTac;B6N-A 4932438H23Rik/WtsiCnbc mutant strain MGI:4433980 4932438H23Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921637 4932438H23Rik RIKEN cDNA 4932438H23 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6096 + EM:09876 C57BL/6N-A 4931429L15Rik/WtsiPh EMMA sperm mutant strain MGI:4460419 4931429L15Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921611 4931429L15Rik RIKEN cDNA 4931429L15 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9876 + EM:07373 C57BL/6N-A 4930591A17Rik/WtsiH EMMA sperm B6NTac;B6N-A 4930591A17Rik/WtsiH mutant strain MGI:4944391 4930591A17Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915425 4930591A17Rik RIKEN cDNA 4930591A17 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7373 + EM:10821 C57BL/6N-A 4930590J08Rik/WtsiPh EMMA sperm mutant strain MGI:4882021 4930590J08Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685917 4930590J08Rik RIKEN cDNA 4930590J08 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10821 + EM:07513 C57BL/6N-A 4930449E01Rik/WtsiOrl EMMA sperm B6NTac;B6N-A 4930449E01Rik/WtsiOrl mutant strain MGI:4841164 4930449E01Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922114 4930449E01Rik RIKEN cDNA 4930449E01 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7513 + EM:11206 C57BL/6N-A 4930404H24Rik/WtsiPh EMMA sperm mutant strain MGI:5050148 4930404H24Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1925401 4930404H24Rik RIKEN cDNA 4930404H24 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11206 + EM:08890 C57BL/6N-A 3830406C13Rik/WtsiIeg EMMA sperm mutant strain MGI:5286250 3830406C13Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917937 3830406C13Rik RIKEN cDNA 3830406C13 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8890 + EM:07597 C57BL/6N-A 3300002A11Rik/WtsiOrl EMMA sperm B6NTac;B6N-A 3300002A11Rik/WtsiOrl mutant strain MGI:4887592 3300002A11Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919073 3300002A11Rik RIKEN cDNA 3300002A11 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7597 - EM:10959 C57BL/6N-A 2810001G20Rik/WtsiH EMMA sperm mutant strain 2810001G20Rik Sanger Institute targeted mutation 1, William C. Skarnes MGI:1913706 2810001G20Rik RIKEN cDNA 2810001G20 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10959 - EM:10958 C57BL/6N-A 2610509F24Rik/WtsiH EMMA sperm mutant strain 2610509F24Rik Sanger Institute targeted mutation 1, William C. Skarnes MGI:1917165 2610509F24Rik RIKEN cDNA 2610509F24 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10958 + EM:06785 C57BL/6N-A 2610318N02Rik/WtsiH EMMA sperm MEJW, B6NTac;B6N-A 2610318N02Rik/WtsiH, EPD0535_4_A09 mutant strain MGI:4451963 2610318N02Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917708 2610318N02Rik RIKEN cDNA 2610318N02 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6785 + EM:08476 C57BL/6N-A 1700123O20Rik/WtsiFlmg EMMA sperm 57BL/6N-1700123O20Rik/Wtsi mutant strain MGI:4434270 1700123O20Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920893 1700123O20Rik RIKEN cDNA 1700123O20 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8476 + EM:10183 C57BL/6N-A 1700034J05Rik/WtsiCnrm EMMA sperm mutant strain MGI:4849971 1700034J05Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920594 1700034J05Rik RIKEN cDNA 1700034J05 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=10183 + EM:08884 C57BL/6N-A 1700029H14Rik/WtsiIeg EMMA sperm mutant strain MGI:4419600 1700029H14Rik targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1913751 1700029H14Rik RIKEN cDNA 1700029H14 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8884 + EM:08487 C57BL/6N-A 1700008O03Rik/WtsiFlmg EMMA sperm mutant strain MGI:4451336 1700008O03Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916599 1700008O03Rik RIKEN cDNA 1700008O03 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8487 - EM:07969 C57BL/6N-A 1700007K13Rik/WtsiH EMMA sperm B6NTac;B6N-A 1700007K13Rik/WtsiH, C57BL/6N-A Pierce1/WtsiH mutant strain MGI:5472700 Pierce1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1916577 Pierce1 piercer of microtubule wall 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=7969 ? EM:13979 C57BL/6N-A 1110059G10Rik/WtsiPh EMMA sperm mutant strain MGI:4419470 1110059G10Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913452 1110059G10Rik RIKEN cDNA 1110059G10 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13979 ? EM:14087 C57BL/6N-A 1110051M20Rik/WtsiOrl EMMA sperm mutant strain MGI:4431671 Cstpp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915079 Cstpp1 centriolar satellite-associated tubulin polyglutamylase complex regulator 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14087 - EM:06921 C57BL/6N-5330417C22Rik/Ics EMMA embryo C57BL/6N-Elapor1/Ics mutant strain MGI:4436415 Elapor1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923930 Elapor1 endosome-lysosome associated apoptosis and autophagy regulator 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6921 - EM:06921 C57BL/6N-5330417C22Rik/Ics EMMA sperm C57BL/6N-Elapor1/Ics mutant strain MGI:4436415 Elapor1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923930 Elapor1 endosome-lysosome associated apoptosis and autophagy regulator 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6921 - EM:09232 C57BL/6N-4932438A13Rik/Ieg EMMA sperm C57BL/6N-Bltp1/Ieg mutant strain MGI:5613665 Bltp1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2444631 Bltp1 bridge-like lipid transfer protein family member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9232 - EM:09457 C57BL/6N-4932438A13Rik/Ieg EMMA sperm C57BL/6N-Bltp1/Ieg mutant strain MGI:4841479 Bltp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444631 Bltp1 bridge-like lipid transfer protein family member 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9457 - EM:11158 C57BL/6N-4932431P20Rik/WtsiH EMMA sperm C57BL/6N-Wdr87-ps/WtsiH mutant strain 4932431P20Rik CRISPR/CAS9 targeted mutation, Wellcome Trust Sanger Institute MGI:6723881 4932431P20Rik withdrawn, = Wdr87-ps https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11158 ? EM:14324 C57BL/6N-3830406C13Rik/WtsiIeg EMMA sperm mutant strain MGI:5637049 3830406C13Rik targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1917937 3830406C13Rik RIKEN cDNA 3830406C13 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14324 - EM:13540 C57BL/6N-2810001G20Rik/WtsiKieg EMMA embryo mutant strain MGI:7343895 2810001G20Rik targeted mutation 1.1, William C Skarnes MGI:1913706 2810001G20Rik RIKEN cDNA 2810001G20 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13540 - EM:13540 C57BL/6N-2810001G20Rik/WtsiKieg EMMA sperm mutant strain MGI:7343895 2810001G20Rik targeted mutation 1.1, William C Skarnes MGI:1913706 2810001G20Rik RIKEN cDNA 2810001G20 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13540 ? EM:14509 C57BL/6N-2610509F24Rik/WtsiIeg EMMA sperm mutant strain 2610509F24Rik Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:1917165 2610509F24Rik RIKEN cDNA 2610509F24 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14509 + EM:08568 C57BL/6N-2610318N02Rik/WtsiH EMMA sperm mutant strain MGI:5548598 2610318N02Rik targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1917708 2610318N02Rik RIKEN cDNA 2610318N02 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8568 + EM:04855 C57BL/6N-2310022B05Rik/H EMMA sperm B6NTac;B6N-2310022B05Rik/H mutant strain MGI:4436328 2310022B05Rik targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916801 2310022B05Rik RIKEN cDNA 2310022B05 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=4855 ? EM:13834 C57BL/6N-1810013L24Rik/WtsiPh EMMA sperm mutant strain 1810013L24Rik CRISPR/CAS9 targeted mutation , Wellcome Trust Sanger Institute MGI:1916303 Hapstr1 HUWE1 associated protein modifying stress responses https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13834 ? EM:13697 C57BL/6N-1810010H24Rik/WtsiOrl EMMA sperm mutant strain MGI:6336202 1810010H24Rik endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1916316 1810010H24Rik RIKEN cDNA 1810010H24 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13697 ? EM:14139 C57BL/6N-1700029H14Rik/WtsiIeg EMMA sperm mutant strain MGI:5637012 1700029H14Rik targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1913751 1700029H14Rik RIKEN cDNA 1700029H14 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14139 ? EM:13770 C57BL/6N-1700016C15Rik/WtsiIeg EMMA sperm mutant strain MGI:6302754 1700016C15Rik endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1916678 1700016C15Rik RIKEN cDNA 1700016C15 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13770 + EM:14313 C57BL/6N-1700007K13Rik/WtsiH EMMA live mutant strain MGI:5637039 Pierce1 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1916577 Pierce1 piercer of microtubule wall 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14313 + EM:09231 C57BL/6N-1600029I14Rik/Ieg EMMA sperm mutant strain MGI:5613647 1600029I14Rik targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1917047 1600029I14Rik RIKEN cDNA 1600029I14 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=9231 + EM:08952 C57BL/6N-1600029I14Rik/Ieg EMMA sperm mutant strain MGI:4451242 1600029I14Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917047 1600029I14Rik RIKEN cDNA 1600029I14 gene https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=8952 + EM:02173 C57BL/6JSfdAnu-Zap70/ApbH EMMA sperm Mr T-Less, C57BL/6Apb-Zap70/Apb, C57BL/6SfdAnu-Zap70/ApbH mutant strain MGI:3614790 Zap70 mr t-less MGI:99613 Zap70 zeta-chain (TCR) associated protein kinase https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2173 + EM:02169 C57BL/6JSfdAnu-Ikzf1/ApbH EMMA sperm C57BL/6Apb-Ikzf1/Apb, C57BL/6JApb-Ikzf1/ApbH, Plastic, C57BL/6Apb-Ikzf1/Apb mutant strain MGI:2669987 Ikzf1 plastic MGI:1342540 Ikzf1 IKAROS family zinc finger 1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2169 + EM:02174 C57BL/6JSfdAnu-Card11/ApbH EMMA sperm C57BL/6Apb-Card11/Apb, C57BL/6Apb-Card11/ApbH, C57BL/6JApb-Card11/ApbH, Unmodulated, C57BL/6Apb-Card11/Apb, C57BL/6Apb-Card11/Apb mutant strain MGI:3045963 Card11 unmodulated MGI:1916978 Card11 caspase recruitment domain family, member 11 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=2174 ? EM:06047 C57BL/6JOlaHsd-Ubiquitin-GFP EMMA sperm mutant strain Tg(Ubiquitin-GFP) Tg(Ubiquitin-GFP) Tg(Ubiquitin-GFP) Tg(Ubiquitin-GFP) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6047 ? EM:06048 C57BL/6JOlaHsd-Ubiquitin-BiPro-IGF2BP2 EMMA sperm mutant strain Tg(Ubiquitin-BiPro-IGF2BP2) Tg(Ubiquitin-BiPro-IGF2BP2) Tg(Ubiquitin-BiPro-IGF2BP2) Tg(Ubiquitin-BiPro-IGF2BP2) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6048 ? EM:06046 C57BL/6JOlaHsd-Albumin-HA-IGF2BP3 EMMA sperm mutant strain Tg(Albumin-HA-IGF2BP3) Tg(Albumin-HA-IGF2BP3) Tg(Albumin-HA-IGF2BP3) Tg(Albumin-HA-IGF2BP3) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6046 ? EM:06044 C57BL/6JOlaHsd-Albumin-Flag-IGF2BP1 EMMA sperm mutant strain Albumin-Flag-IGF2BP1 Albumin-Flag-IGF2BP1 Albumin-Flag-IGF2BP1 Albumin-Flag-IGF2BP1 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6044 ? EM:06045 C57BL/6JOlaHsd-Albumin-BiPro-IGF2BP2 EMMA sperm mutant strain Tg(Albumin-BiPro-IGF2BP2) Tg(Albumin-BiPro-IGF2BP2) Tg(Albumin-BiPro-IGF2BP2) Tg(Albumin-BiPro-IGF2BP2) https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6045 ? EM:06043 C57BL/6JOlaHsd-Albumin-BiPro-GFP EMMA sperm mutant strain Albumin-BiPro-GFP Albumin-BiPro-GFP Albumin-BiPro-GFP Albumin-BiPro-GFP https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=6043 + EM:11456 C57BL/6J-Ythdc2/Cnrm EMMA embryo mutant strain MGI:5911568 Ythdc2 endonuclease-mediated mutation 2, Ramesh Pillai MGI:2448561 Ythdc2 YTH domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11456 + EM:11456 C57BL/6J-Ythdc2/Cnrm EMMA sperm mutant strain MGI:5911568 Ythdc2 endonuclease-mediated mutation 2, Ramesh Pillai MGI:2448561 Ythdc2 YTH domain containing 2 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11456 + EM:13016 C57BL/6J-Wdr25/H EMMA sperm unclassified MGI:6451754 Wdr25 endonuclease-mediated mutation 2, Harwell MGI:3045255 Wdr25 WD repeat domain 25 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13016 + EM:13033 C57BL/6J-Wdr25/H EMMA sperm C57BL/6J-Wdrenhdel/H unclassified MGI:6451752 Wdr25 endonuclease-mediated mutation 1, Harwell MGI:3045255 Wdr25 WD repeat domain 25 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13033 + EM:12536 C57BL/6J-Vcan/H EMMA sperm unclassified MGI:6451750 Vcan endonuclease-mediated mutation 1, Harwell MGI:102889 Vcan versican https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12536 ? EM:13762 C57BL/6J-Ttc6/WtsiIeg EMMA sperm mutant strain MGI:6287374 Ttc6 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2684915 Ttc6 tetratricopeptide repeat domain 6 https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=13762 ? EM:14762 C57BL/6J-Tshr/Cnbc EMMA sperm mutant strain Tshr Tshr MGI:98849 Tshr thyroid stimulating hormone receptor https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=14762 + EM:12532 C57BL/6J-Tra2b/H EMMA sperm unclassified MGI:6451746 Tra2b endonuclease-mediated mutation 1, Harwell MGI:106016 Tra2b transformer 2 beta https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=12532 + EM:01895 C57BL/6J-Tg(Vpreb1-IL2RB)F133Ilm/H EMMA embryo -214BpreB1-huCD122 line F133, Tg(-214VpreB1-huCD122)F133Lmb mutant strain MGI:5505492 Tg(Vpreb1-IL2RB)F133Ilm transgene insertion F133, Inga-Lill Martensson MGI:5505484 Tg(Vpreb1-IL2RB)F133Ilm transgene insertion F133, Inga-Lill Martensson https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=1895 ? EM:11952 C57BL/6J-Tg(TH-tTA2syn)1EKra EMMA sperm mutant strain TH-tTA TH-tTA https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11952 ? EM:11951 C57BL/6J-Tg(TH-rtTA3G)4EKra EMMA sperm mutant strain mTH-rtTA3G mTH-rtTA3G https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=11951 + EM:00253 C57BL/6J-Tg(tetO-cre)1Lin/Kieg EMMA embryo TEb-2, C57BL/6J-Tg(tetO-cre)1Lin mutant strain MGI:3046554 Tg(tetO-cre)1Lin transgene insertion 1, Jonas Lindeberg MGI:3046552 Tg(tetO-cre)1Lin transgene insertion 1, Jonas Lindeberg https://www.infrafrontier.eu/emma/strain-search/straindetails/?q=253