Nomenclature Strain ID Strain/Stock Repository State Synonyms Type Allele ID Allele Symbol Allele Name Gene ID Gene Symbol Gene Name URL ? EM:11902 ZranG11Del EMMA sperm mutant strain MGI:106441 Zranb1 zinc finger, RAN-binding domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:11902 ? EM:08917 Zfp507V26AMhda EMMA sperm mutant strain 77T->C 77T->C MGI:1916378 Zfp507 zinc finger protein 507 https://www.infrafrontier.eu/search?keyword=EM:08917 ? EM:05686 Zfp141 (Zinc-finger protein 141) EMMA sperm mutant strain MGI:2678386 Zfp141 gene trap 1, Patricia Ruiz MGI:3584269 Zfp141 zinc finger protein 141 https://www.infrafrontier.eu/search?keyword=EM:05686 - EM:05505 VMP1 KO conv EMMA sperm STOCK Vmp1/Hmgu mutant strain Vmp1 Vmp1 MGI:1923159 Vmp1 vacuole membrane protein 1 https://www.infrafrontier.eu/search?keyword=EM:05505 - EM:05506 VMP1 KO cond EMMA embryo STOCK Vmp1/Hmgu mutant strain Vmp1 Vmp1 MGI:1923159 Vmp1 vacuole membrane protein 1 https://www.infrafrontier.eu/search?keyword=EM:05506 ? EM:05504 Twist1 KO cond EMMA embryo mutant strain Twist1 Twist1 MGI:98872 Twist1 twist basic helix-loop-helix transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:05504 ? EM:05502 Traf7 KO conv EMMA embryo mutant strain Traf7 Traf7 MGI:3042141 Traf7 TNF receptor-associated factor 7 https://www.infrafrontier.eu/search?keyword=EM:05502 ? EM:05503 TRAF7 KO cond EMMA embryo mutant strain Traf7 Traf7 MGI:3042141 Traf7 TNF receptor-associated factor 7 https://www.infrafrontier.eu/search?keyword=EM:05503 ? EM:05501 TNFSF13b KO cond EMMA embryo mutant strain Tnfsf13b Tnfsf13b MGI:1344376 Tnfsf13b tumor necrosis factor (ligand) superfamily, member 13b https://www.infrafrontier.eu/search?keyword=EM:05501 ? EM:13001 Tmx1 EMMA sperm mutant strain Tmx1 targeted mutation 1, University of Reading MGI:1919986 Tmx1 thioredoxin-related transmembrane protein 1 https://www.infrafrontier.eu/search?keyword=EM:13001 ? EM:05498 TMEM45B KO conv EMMA embryo mutant strain Tmem45b Tmem45b MGI:2384574 Tmem45b transmembrane protein 45b https://www.infrafrontier.eu/search?keyword=EM:05498 ? EM:05499 TMEM45B KO cond EMMA sperm mutant strain Tmem45b Tmem45b MGI:2384574 Tmem45b transmembrane protein 45b https://www.infrafrontier.eu/search?keyword=EM:05499 - EM:02167 TM/60 EMMA sperm C3H;B6-Tm60/H mutant strain MGI:5646558 Tm60 mutant Tm60 MGI:5646413 Tm60 mutant Tm60 https://www.infrafrontier.eu/search?keyword=EM:02167 - EM:02166 TM/59 EMMA sperm C3H;B6-Tm59/H mutant strain MGI:5646555 Tm59 mutation Tm59 MGI:5646412 Tm59 mutant Tm59 https://www.infrafrontier.eu/search?keyword=EM:02166 - EM:02165 TM/45 EMMA sperm C3H;B6-Tm45/H mutant strain MGI:5646550 Tm45 mutation Tm45 MGI:5646410 Tm45 mutant Tm45 https://www.infrafrontier.eu/search?keyword=EM:02165 - EM:01894 TM/26 EMMA sperm STOCK Tm26/H mutant strain MGI:5752830 Tm26 mutant Tm26 MGI:5752827 Tm26 mutant Tm26 https://www.infrafrontier.eu/search?keyword=EM:01894 ? EM:05496 Tlr9 KO conv EMMA embryo mutant strain Tlr9 Tlr9 MGI:1932389 Tlr9 toll-like receptor 9 https://www.infrafrontier.eu/search?keyword=EM:05496 ? EM:05497 Tlr9 KO cond EMMA embryo mutant strain Tlr9 Tlr9 MGI:1932389 Tlr9 toll-like receptor 9 https://www.infrafrontier.eu/search?keyword=EM:05497 ? EM:05500 Tlr7 KO cond EMMA embryo mutant strain Tlr7 Tlr7 MGI:2176882 Tlr7 toll-like receptor 7 https://www.infrafrontier.eu/search?keyword=EM:05500 ? EM:12397 Tg(T-cre)1Gos/Biat EMMA sperm mutant strain MGI:3811072 Tg(T-cre)1Gos transgene insertion 1, Achim Gossler MGI:3811067 Tg(T-cre)1Gos transgene insertion 1, Achim Gossler https://www.infrafrontier.eu/search?keyword=EM:12397 - EM:12659 Tg(ROSA26-LSL-SyGCaMP-WPRE)L4 EMMA sperm mutant strain MGI:6414618 Gt(ROSA)26Sor targeted mutation 1, Kate Hampden-Smith MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:12659 - EM:02604 Tg(OvPrP)FM18 EMMA sperm STOCK Prnp Tg(Prnp/PRNP*ARR)FM18Pcg/H mutant strain MGI:5779521 Tg(Prnp/PRNP*ARR)FM18Pcg trangene insertion FM18, Peter Griffiths MGI:5779520 Tg(Prnp/PRNP*ARR)FM18Pcg trangene insertion FM18, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:02604 - EM:04337 Tg(OvPrP)FF8 EMMA embryo STOCK Prnp Tg(Prnp/PRNP*ARR)FF8Pcg/H mutant strain MGI:5779525 Tg(Prnp/PRNP*ARR)FF8Pcg transgene insertion FF8, Peter Griffiths MGI:5779524 Tg(Prnp/PRNP*ARR)FF8Pcg transgene insertion FF8, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:04337 - EM:02615 Tg(OvPrP)EM52 EMMA embryo STOCK Prnp Tg(Prnp/PRNP*AHQ)EM52Pcg/H mutant strain MGI:5776255 Tg(Prnp/PRNP*AHQ)EM52Pcg transgene insertion EM52, Peter Griffiths MGI:5776254 Tg(Prnp/PRNP*AHQ)EM52Pcg transgene insertion EM52, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:02615 - EM:04339 Tg(OvPrP)EM16 EMMA embryo STOCK Prnp Tg(Prnp/PRNP*AHQ)EM16Pcg/H mutant strain MGI:5776247 Tg(Prnp/PRNP*AHQ)EM16Pcg transgene insertion EM16, Peter Griffiths MGI:5776244 Tg(Prnp/PRNP*AHQ)EM16Pcg transgene insertion EM16, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:04339 - EM:04554 Tg(OvPrP)EF50 EMMA embryo STOCK Prnp Tg(Prnp/PRNP*AHQ)EF50Pcg/H mutant strain MGI:5776258 Tg(Prnp/PRNP*AHQ)EF50Pcg transgene insertion EM50, Peter Griffiths MGI:5776257 Tg(Prnp/PRNP*AHQ)EF50Pcg transgene insertion EM50, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:04554 - EM:02600 Tg(BoPrP)2019 EMMA embryo STOCK Prnp Tg(PRNP)2019Pcg/H, Stock Tg(PRNP*)2019Pcg mutant strain MGI:5775986 Tg(PRNP)2019Pcg transgene insertion 2019, Peter Griffiths MGI:5775985 Tg(PRNP)2019Pcg transgene insertion 2019, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:02600 - EM:02588 Tg(BoPrP)2010 EMMA embryo Stock Tg(PRNP*)2010Pcg, STOCK Prnp Tg(PRNP)2010Pcg/H mutant strain MGI:5775933 Tg(PRNP)2010Pcg transgene insertion 2010, Peter Griffiths MGI:5775932 Tg(PRNP)2010Pcg transgene insertion 2010, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:02588 - EM:02537 Tg(BoPrP)1896 EMMA embryo Tg(PRNP*)1896Pcg, STOCK Prnp Tg(PRNP)1896Pcg/H mutant strain MGI:5775352 Tg(PRNP)1896Pcg transgene insertion 1896, Peter Griffiths MGI:5775349 Tg(PRNP)1896Pcg transgene insertion 1896, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:02537 + EM:02207 TFH/H EMMA embryo mutant strain MGI:1856184 T brachyury MGI:98472 T brachyury, T-box transcription factor T https://www.infrafrontier.eu/search?keyword=EM:02207 + EM:02207 TFH/H EMMA embryo mutant strain MGI:1857070 Itpr3 tufted MGI:96624 Itpr3 inositol 1,4,5-triphosphate receptor 3 https://www.infrafrontier.eu/search?keyword=EM:02207 ? EM:11139 TetohBCL-2 in FVB/N EMMA sperm mutant strain Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 https://www.infrafrontier.eu/search?keyword=EM:11139 ? EM:11140 TetohBCL-2 in C57BL/6 EMMA sperm mutant strain Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 https://www.infrafrontier.eu/search?keyword=EM:11140 ? EM:12616 Tardbp RRM2mut (F210I) DBA EMMA sperm mutant strain MGI:6355454 Tardbp Riken Genomic Sciences Center 2268 MGI:2387629 Tardbp TAR DNA binding protein https://www.infrafrontier.eu/search?keyword=EM:12616 ? EM:12615 Tardbp RRM2mut (F210I) B6 EMMA sperm mutant strain MGI:6355454 Tardbp Riken Genomic Sciences Center 2268 MGI:2387629 Tardbp TAR DNA binding protein https://www.infrafrontier.eu/search?keyword=EM:12615 ? EM:12614 Tardbp LCDmut (M323K) DBA EMMA sperm mutant strain MGI:6355456 Tardbp Riken Genomic Sciences Center 2223 MGI:2387629 Tardbp TAR DNA binding protein https://www.infrafrontier.eu/search?keyword=EM:12614 ? EM:12613 Tardbp LCDmut (M323K) B6 EMMA sperm mutant strain MGI:6355456 Tardbp Riken Genomic Sciences Center 2223 MGI:2387629 Tardbp TAR DNA binding protein https://www.infrafrontier.eu/search?keyword=EM:12613 + EM:01332 SY/HgIeg EMMA embryo Hertwig's syndactylism mutant strain MGI:1856182 sy shaker with syndactylism MGI:98457 sy shaker-with-syndactylism deletion region https://www.infrafrontier.eu/search?keyword=EM:01332 - EM:05790 STOCK Zkscan14/WtsiOrl EMMA sperm mutant strain MGI:4432778 Zkscan14 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914485 Zkscan14 zinc finger with KRAB and SCAN domains 14 https://www.infrafrontier.eu/search?keyword=EM:05790 - EM:06813 STOCK Zfp382/Wtsi EMMA embryo mutant strain MGI:4362785 Zfp382 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3588204 Zfp382 zinc finger protein 382 https://www.infrafrontier.eu/search?keyword=EM:06813 - EM:06813 STOCK Zfp382/Wtsi EMMA sperm mutant strain MGI:4362785 Zfp382 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3588204 Zfp382 zinc finger protein 382 https://www.infrafrontier.eu/search?keyword=EM:06813 + EM:11112 STOCK Yod1/H EMMA sperm mutant strain MGI:6473480 Yod1 targeted mutation 1a, National Laboratory Animal Center MGI:1923440 Yod1 YOD1 deubiquitinase https://www.infrafrontier.eu/search?keyword=EM:11112 + EM:02468 STOCK Xpo4/H EMMA sperm 3E, Xpo4 mutant strain MGI:5490885 Xpo4 gene trap mutation 3E, Katherine A Vallis MGI:1888526 Xpo4 exportin 4 https://www.infrafrontier.eu/search?keyword=EM:02468 + EM:01296 STOCK Whrn/H EMMA embryo wi mutant strain MGI:1857090 Whrn whirler MGI:2682003 Whrn whirlin https://www.infrafrontier.eu/search?keyword=EM:01296 + EM:01296 STOCK Whrn/H EMMA sperm wi mutant strain MGI:1857090 Whrn whirler MGI:2682003 Whrn whirlin https://www.infrafrontier.eu/search?keyword=EM:01296 + EM:04326 STOCK Vezt/Vezt/Orl EMMA embryo bi-loxP/null, Vezatin flox5/null mutant strain MGI:3618234 Vezt targeted mutation 1.1, Marie C Simmler MGI:2143698 Vezt vezatin, adherens junctions transmembrane protein https://www.infrafrontier.eu/search?keyword=EM:04326 + EM:04326 STOCK Vezt/Vezt/Orl EMMA embryo bi-loxP/null, Vezatin flox5/null mutant strain MGI:5749802 Vezt targeted mutation 1.2, Marie C Simmler MGI:2143698 Vezt vezatin, adherens junctions transmembrane protein https://www.infrafrontier.eu/search?keyword=EM:04326 + EM:00392 STOCK Utrn Dmd Tg(Ckm-Dmd*)11956Chmb/H EMMA sperm CVBA 3'/Utrophin+/-/mdx, CVBA mutant stock MGI:2148589 Utrn targeted mutation 1, Kay E Davies MGI:104631 Utrn utrophin https://www.infrafrontier.eu/search?keyword=EM:00392 + EM:00392 STOCK Utrn Dmd Tg(Ckm-Dmd*)11956Chmb/H EMMA sperm CVBA 3'/Utrophin+/-/mdx, CVBA mutant stock MGI:5140820 Tg(Ckm-Dmd*)11956Chmb transgene insertion 11956, Jeffrey S Chamberlain MGI:5140819 Tg(Ckm-Dmd*)11956Chmb transgene insertion 11956, Jeffrey S Chamberlain https://www.infrafrontier.eu/search?keyword=EM:00392 + EM:00392 STOCK Utrn Dmd Tg(Ckm-Dmd*)11956Chmb/H EMMA sperm CVBA 3'/Utrophin+/-/mdx, CVBA mutant stock MGI:1856328 Dmd X linked muscular dystrophy MGI:94909 Dmd dystrophin, muscular dystrophy https://www.infrafrontier.eu/search?keyword=EM:00392 + EM:04767 STOCK Tyr/Tyr/Cnbc EMMA embryo albino Tyr NMR/Hsd mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:04767 + EM:04767 STOCK Tyr/Tyr/Cnbc EMMA embryo albino Tyr NMR/Hsd mutant strain MGI:2153771 Tyr albino deletion 32DSD, Oak Ridge MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:04767 + EM:06054 STOCK Tyr Tg(Tyr)YRT3Lmon/Cnbc EMMA embryo Stock HsdWin:NMRI;B6CBA-Tg(Tyr)YRT3/Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06054 + EM:06054 STOCK Tyr Tg(Tyr)YRT3Lmon/Cnbc EMMA embryo Stock HsdWin:NMRI;B6CBA-Tg(Tyr)YRT3/Lmon mutant strain MGI:6202731 Tg(Tyr)YRT3Lmon transgene insertion YRT3, Lluis Montoliu MGI:6202729 Tg(Tyr)YRT3Lmon transgene insertion YRT3, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:06054 + EM:06085 STOCK Tyr Gpr143/Cnbc EMMA embryo HsdWin:NMRI;B6N.129-Gpr143/Cnbc mutant strain MGI:1931862 Gpr143 targeted mutation 1, Barbara Incerti MGI:107193 Gpr143 G protein-coupled receptor 143 https://www.infrafrontier.eu/search?keyword=EM:06085 + EM:06085 STOCK Tyr Gpr143/Cnbc EMMA embryo HsdWin:NMRI;B6N.129-Gpr143/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06085 + EM:04764 STOCK Tyr/Cnbc EMMA embryo Tyr "chinchilla mottled":NMRI/Hsd mutant strain MGI:1855980 Tyr chinchilla mottled MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:04764 + EM:04764 STOCK Tyr/Cnbc EMMA embryo Tyr "chinchilla mottled":NMRI/Hsd mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:04764 + EM:04769 STOCK Tyr/Cnbc EMMA embryo Tyr "extreme dilution mottled":NMRI/Hsd mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:04769 + EM:04769 STOCK Tyr/Cnbc EMMA embryo Tyr "extreme dilution mottled":NMRI/Hsd mutant strain MGI:2683485 Tyr extreme dilution mottled MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:04769 + EM:10543 STOCK Tubb5/Biat EMMA sperm STOCK Tubb5/Biat mutant strain MGI:6119464 Tubb5 targeted mutation 2.1, David A Keays MGI:107812 Tubb5 tubulin, beta 5 class I https://www.infrafrontier.eu/search?keyword=EM:10543 + EM:10542 STOCK Tubb5/Biat EMMA sperm STOCK Tubb5/Biat mutant strain MGI:6119463 Tubb5 targeted mutation 1.1, David A Keays MGI:107812 Tubb5 tubulin, beta 5 class I https://www.infrafrontier.eu/search?keyword=EM:10542 + EM:07317 STOCK Trpm1/H EMMA sperm mutant strain MGI:5287780 Trpm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1330305 Trpm1 transient receptor potential cation channel, subfamily M, member 1 https://www.infrafrontier.eu/search?keyword=EM:07317 + EM:01788 STOCK Trp53 Tg(Wap-HBx)1Gmn/Kctt EMMA embryo mutant stock MGI:5312872 Tg(Wap-HBx)1Gmn transgene insertion 1, Marianne Bruggemann MGI:5312861 Tg(Wap-HBx)1Gmn transgene insertion 1, Marianne Bruggemann https://www.infrafrontier.eu/search?keyword=EM:01788 + EM:01788 STOCK Trp53 Tg(Wap-HBx)1Gmn/Kctt EMMA embryo mutant stock MGI:1857590 Trp53 targeted mutation 1, Allan Bradley MGI:98834 Trp53 transformation related protein 53 https://www.infrafrontier.eu/search?keyword=EM:01788 + EM:10456 STOCK Trmt1/Ics EMMA sperm HEPD0743_6_A06, G4648 mutant strain MGI:5085360 Trmt1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1289155 Trmt1 tRNA methyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:10456 + EM:10456 STOCK Trmt1/Ics EMMA live HEPD0743_6_A06, G4648 mutant strain MGI:5085360 Trmt1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1289155 Trmt1 tRNA methyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:10456 + EM:05824 STOCK Tpm1/WtsiH EMMA embryo EPD0001_3_G07, 129S/SvEvBrd-Tpm1/WtsiH, 129-Tpm1/WtsiH mutant strain MGI:4842867 Tpm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98809 Tpm1 tropomyosin 1, alpha https://www.infrafrontier.eu/search?keyword=EM:05824 + EM:07457 STOCK Tox3/Orl EMMA sperm B6N.Cg-Tox3/Orl mutant strain MGI:6119413 Tox3 targeted mutation 1d, Mouse Biology Program, UCDavis MGI:3039593 Tox3 TOX high mobility group box family member 3 https://www.infrafrontier.eu/search?keyword=EM:07457 + EM:11023 STOCK Tnfrsf1a Tg(Tnf)6074Gkl/Flmg EMMA embryo mutant strain MGI:1861040 Tnfrsf1a targeted mutation 1, Horst Bluethmann MGI:1314884 Tnfrsf1a tumor necrosis factor receptor superfamily, member 1a https://www.infrafrontier.eu/search?keyword=EM:11023 + EM:11023 STOCK Tnfrsf1a Tg(Tnf)6074Gkl/Flmg EMMA embryo mutant strain MGI:3766101 Tg(Tnf)6074Gkl transgene insertion 6074, George Kollias MGI:3766128 Tg(Tnf)6074Gkl transgene insertion 6074, George Kollias https://www.infrafrontier.eu/search?keyword=EM:11023 + EM:08444 STOCK Tnfrsf1a Tg(Gfap-TNF*)K21Gkl/Flmg EMMA embryo CBA;B6-Tnfrsf1a Tg(Gfap-TNF*)K21Gkl/Flmg, TgK21 mutant strain MGI:1861040 Tnfrsf1a targeted mutation 1, Horst Bluethmann MGI:1314884 Tnfrsf1a tumor necrosis factor receptor superfamily, member 1a https://www.infrafrontier.eu/search?keyword=EM:08444 + EM:08444 STOCK Tnfrsf1a Tg(Gfap-TNF*)K21Gkl/Flmg EMMA embryo CBA;B6-Tnfrsf1a Tg(Gfap-TNF*)K21Gkl/Flmg, TgK21 mutant strain MGI:3766134 Tg(Gfap-TNF*)K21Gkl transgene insertion K21, George Kollias MGI:3766211 Tg(Gfap-TNF*)K21Gkl transgene insertion K21, George Kollias https://www.infrafrontier.eu/search?keyword=EM:08444 + EM:08448 STOCK Tnfrsf1a Tg(CD2/HBB-TNF*)5453Gkl/Flmg EMMA embryo Tg5453, CBA;B6-Tnfrsf1atm1Blt Tg(CD2/HBB-TNF*)5453Gkl /Flmg] mutant strain MGI:4818268 Tg(CD2/HBB-TNF*)5453Gkl transgene insertion 5453, George Kollias MGI:4818262 Tg(CD2/HBB-TNF*)5453Gkl transgene insertion 5453, George Kollias https://www.infrafrontier.eu/search?keyword=EM:08448 + EM:08448 STOCK Tnfrsf1a Tg(CD2/HBB-TNF*)5453Gkl/Flmg EMMA embryo Tg5453, CBA;B6-Tnfrsf1atm1Blt Tg(CD2/HBB-TNF*)5453Gkl /Flmg] mutant strain MGI:1861040 Tnfrsf1a targeted mutation 1, Horst Bluethmann MGI:1314884 Tnfrsf1a tumor necrosis factor receptor superfamily, member 1a https://www.infrafrontier.eu/search?keyword=EM:08448 + EM:09860 STOCK Tmprss4/Ph EMMA sperm mutant strain MGI:5806229 Tmprss4 targeted mutation 1.1, Edith Hummler MGI:2384877 Tmprss4 transmembrane protease, serine 4 https://www.infrafrontier.eu/search?keyword=EM:09860 + EM:01908 STOCK Tmem98/H EMMA embryo GENA246, Retinal White Spots, STOCK Rwhs/H, C3H;C-Rwhs/H mutant stock MGI:2178433 Tmem98 retinal white spots MGI:1923457 Tmem98 transmembrane protein 98 https://www.infrafrontier.eu/search?keyword=EM:01908 + EM:00386 STOCK Tmc1/WtsiH EMMA sperm Dn mutant strain MGI:1856845 Tmc1 deafness MGI:2151016 Tmc1 transmembrane channel-like gene family 1 https://www.infrafrontier.eu/search?keyword=EM:00386 + EM:04369 STOCK Thra/Kctt EMMA embryo TRa1-GFP(ven), B6NCrl;129P2-Thra/Kctt mutant strain MGI:4847930 Thra targeted mutation 4.1, Bjorn Vennstrom MGI:98742 Thra thyroid hormone receptor alpha https://www.infrafrontier.eu/search?keyword=EM:04369 - EM:07517 STOCK Tgfb1i1/WtsiOrl EMMA archived B6NTac;B6N-A Tgfb1i1/WtsiOrl mutant strain MGI:5050851 Tgfb1i1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102784 Tgfb1i1 transforming growth factor beta 1 induced transcript 1 https://www.infrafrontier.eu/search?keyword=EM:07517 ? EM:10544 STOCK Tg(Tubb5-EGFP)1Dak/Biat EMMA sperm mutant strain MGI:6330725 Tg(Tubb5-EGFP)1Dak transgene insertion 1, David A Keays MGI:6330724 Tg(Tubb5-EGFP)1Dak transgene insertion 1, David A Keays https://www.infrafrontier.eu/search?keyword=EM:10544 + EM:09494 STOCK Tg(Ttr-SMYD3)1Ital/Flmg EMMA embryo B6.CBA-Tg(Ttr-SMYD3)1Ital/Flmg mutant strain MGI:5749481 Tg(Ttr-SMYD3)1Ital transgene insertion 1, Iannis Talianidis MGI:5749480 Tg(Ttr-SMYD3)1Ital transgene insertion 1, Iannis Talianidis https://www.infrafrontier.eu/search?keyword=EM:09494 ? EM:09469 STOCK Tg(Ttr-SETD7*H297A)1Ital/Flmg EMMA embryo mutant strain Tg(Ttr-SETD7*H297A)1Ital Tg(Ttr-SETD7*H297A)1Ital Tg(Ttr-SETD7*H297A)1Ital Tg(Ttr-SETD7*H297A)1Ital https://www.infrafrontier.eu/search?keyword=EM:09469 ? EM:09468 STOCK Tg(Ttr-SETD7)1Ital/Flmg EMMA embryo mutant strain Tg(Ttr-SETD7)1Ital Tg(Ttr-SETD7)1Ital Tg(Ttr-SETD7)1Ital Tg(Ttr-SETD7)1Ital https://www.infrafrontier.eu/search?keyword=EM:09468 + EM:09491 STOCK Tg(Ttr-NR0B2)1Ital/Flmg EMMA embryo B6.CBA-Tg(Ttr-NR0B2)1Ital/Flmg mutant strain MGI:5645742 Tg(Ttr-NR0B2)1Ital transgene insertion 1, Iannis Talianidis MGI:5645741 Tg(Ttr-NR0B2)1Ital transgene insertion 1, Iannis Talianidis https://www.infrafrontier.eu/search?keyword=EM:09491 + EM:08377 STOCK Tg(TNFRSF1B)1334Gkl/Flmg EMMA sperm CBA.B6-Tg(TNFRSF1B)1334Gkl mutant strain MGI:5645560 Tg(TNFRSF1B)1334Gkl transgene insertion 1334, George Kollias MGI:5645558 Tg(TNFRSF1B)1334Gkl transgene insertion 1334, George Kollias https://www.infrafrontier.eu/search?keyword=EM:08377 + EM:08366 STOCK Tg(Tnf*)A86Gkl/Flmg EMMA sperm CBA.B6-Tg(Tnf*)A86Gkl/Flmg mutant strain MGI:3766228 Tg(Tnf*)A86Gkl transgene insertion A86, George Kollias MGI:3766240 Tg(Tnf*)A86Gkl transgene insertion A86, George Kollias https://www.infrafrontier.eu/search?keyword=EM:08366 + EM:10595 STOCK Tg(tetO-Pax4,-DsRed)/Cnbc EMMA sperm mutant strain Tg(tetO-Pax4,-DsRed) Tg(tetO-Pax4,-DsRed) Tg(tetO-Pax4,-DsRed) Tg(tetO-Pax4,-DsRed) https://www.infrafrontier.eu/search?keyword=EM:10595 ? EM:10596 STOCK Tg(tetO-Pax4*,-DsRed)/Cnbc EMMA sperm mutant strain Tg(tetO-Pax4*,-DsRed) Tg(tetO-Pax4*,-DsRed) Tg(tetO-Pax4*,-DsRed) Tg(tetO-Pax4*,-DsRed) https://www.infrafrontier.eu/search?keyword=EM:10596 - EM:08993 STOCK Tg(tetO-HMOX1)57Gkl/Flmg EMMA embryo mutant strain MGI:5707757 Tg(tetO-HMOX1)57Gkl transgene insertion 57, George Kollias MGI:5707755 Tg(tetO-HMOX1)57Gkl transgene insertion 57, George Kollias https://www.infrafrontier.eu/search?keyword=EM:08993 + EM:04643 STOCK Tg(tetO-AGTR1,-lacZ)1Aco/Cnbc EMMA sperm ZhAT1Rwt1 mutant strain MGI:5648216 Tg(tetO-AGTR1,-lacZ)1Aco transgene insertion 1, Justin Ainscough MGI:5648215 Tg(tetO-AGTR1,-lacZ)1Aco transgene insertion 1, Justin Ainscough https://www.infrafrontier.eu/search?keyword=EM:04643 + EM:04761 STOCK Tg(tetO-AGTR1*N111G,-lacZ)1Aco/Cnbc EMMA embryo ZhAT1Rmut2 mutant strain MGI:5648211 Tg(tetO-AGTR1*N111G,-lacZ)1Aco transgene insertion 1, Justin Ainscough MGI:5648210 Tg(tetO-AGTR1*N111G,-lacZ)1Aco transgene insertion 1, Justin Ainscough https://www.infrafrontier.eu/search?keyword=EM:04761 - EM:07265 STOCK Tg(Tek-Nfkbia*S32A*S36A)1Gkl/Flmg EMMA sperm mutant strain MGI:5575645 Tg(Tek-Nfkbia*S32A*S36A)1Gkl transgene insertion 1, George Kollias MGI:5575644 Tg(Tek-Nfkbia*S32A*S36A)1Gkl transgene insertion 1, George Kollias https://www.infrafrontier.eu/search?keyword=EM:07265 + EM:10853 STOCK Tg(Sox2-cre/ERT2)1Skn/Cnrm EMMA embryo mutant strain MGI:4397776 Tg(Sox2-cre/ERT2)1Skn transgene insertion 1, Silvia K Nicolis MGI:4397777 Tg(Sox2-cre/ERT2)1Skn transgene insertion 1, Silvia K Nicolis https://www.infrafrontier.eu/search?keyword=EM:10853 + EM:10853 STOCK Tg(Sox2-cre/ERT2)1Skn/Cnrm EMMA sperm mutant strain MGI:4397776 Tg(Sox2-cre/ERT2)1Skn transgene insertion 1, Silvia K Nicolis MGI:4397777 Tg(Sox2-cre/ERT2)1Skn transgene insertion 1, Silvia K Nicolis https://www.infrafrontier.eu/search?keyword=EM:10853 + EM:07154 STOCK Tg(Sox2-Bgeo)1Skn/Cnrm EMMA embryo Sox2 beta-geo telencephalic transgen mutant strain MGI:5700640 Tg(Sox2-Bgeo)1Skn transgene insertion 1, Silvia K Nicolis MGI:5700566 Tg(Sox2-Bgeo)1Skn transgene insertion 1, Silvia K Nicolis https://www.infrafrontier.eu/search?keyword=EM:07154 + EM:07154 STOCK Tg(Sox2-Bgeo)1Skn/Cnrm EMMA sperm Sox2 beta-geo telencephalic transgen mutant strain MGI:5700640 Tg(Sox2-Bgeo)1Skn transgene insertion 1, Silvia K Nicolis MGI:5700566 Tg(Sox2-Bgeo)1Skn transgene insertion 1, Silvia K Nicolis https://www.infrafrontier.eu/search?keyword=EM:07154 - EM:09501 STOCK Tg(RasE)290Biat/Biat EMMA sperm mutant strain MGI:5702681 Tg(RasE)290Biat transgene insertion 290, Biomodels Austria MGI:5702677 Tg(RasE)290Biat transgene insertion 290, Biomodels Austria https://www.infrafrontier.eu/search?keyword=EM:09501 + EM:02501 STOCK Tg(Prnp-SMN)92Ahmb/H EMMA sperm PrP : fl-SMN mutant strain MGI:3774945 Tg(Prnp-SMN)92Ahmb transgene insertion 92, Arthur H M Burghes MGI:3774942 Tg(Prnp-SMN)92Ahmb transgene insertion 92, Arthur H M Burghes https://www.infrafrontier.eu/search?keyword=EM:02501 - EM:02538 STOCK Tg(Prnp-PRNP*6OR)K6M6Pcg/PcgH EMMA embryo mutant strain MGI:5775412 Tg(Prnp-PRNP*6OR)K6M6Pcg transgene insertion K6M6, Peter Griffiths MGI:5775410 Tg(Prnp-PRNP*6OR)K6M6Pcg transgene insertion K6M6, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:02538 + EM:02504 STOCK Tg(Prnp-HSPB1)PPks/H EMMA archived HSP27 WT PrP Promoter line, PRP-HSP27-WT mutant strain MGI:5775105 Tg(Prnp-HSPB1)PPks transgene insertion P, Nick Parkinson MGI:5775104 Tg(Prnp-HSPB1)PPks transgene insertion P, Nick Parkinson https://www.infrafrontier.eu/search?keyword=EM:02504 + EM:02517 STOCK Tg(Prm-cre)58Og/H EMMA embryo Pro Cre, STOCK Tg(Prm-cre)58Og, Pro-Cre mutant strain MGI:2176182 Tg(Prm-cre)58Og transgene insertion 58, Stephen O'Gorman MGI:2176181 Tg(Prm-cre)58Og transgene insertion 58, Stephen O'Gorman https://www.infrafrontier.eu/search?keyword=EM:02517 + EM:01344 STOCK Tg(PDGFRA-lacZ)2.2-07Nist/Kctt EMMA archived PDGFRAprom-2.2-lacZ-0.7, MNI-3 mutant strain MGI:5305726 Tg(PDGFRA-lacZ)2.2-07Nist transgene insertion 2.2-07, Monica Nister MGI:5305724 Tg(PDGFRA-lacZ)2.2-07Nist transgene insertion 2.2-07, Monica Nister https://www.infrafrontier.eu/search?keyword=EM:01344 + EM:04365 STOCK Tg(Myh6-tTA)6Smbf/Cnrm EMMA embryo alphaMHC-tTA, STOCK Tg(Myh6-tTA)6Smbf/Ibcm, FVB;B6CBF1-Tg(Myh6-tTA)6Smbf/Ibcm mutant strain MGI:2665551 Tg(Myh6-tTA)6Smbf transgene insertion 6, Section of Myocardial Biology - Fishman Lab MGI:2665552 Tg(Myh6-tTA)6Smbf transgene insertion 6, Section of Myocardial Biology - Fishman Lab https://www.infrafrontier.eu/search?keyword=EM:04365 + EM:04989 STOCK Tg(Myh6-tTA)6Smbf Tg(tetO-Hgf,-EGFP)24Tcre/Cnrm EMMA embryo Hgf-TetO-GFP x alphaMHC-tTA mutant strain MGI:2665551 Tg(Myh6-tTA)6Smbf transgene insertion 6, Section of Myocardial Biology - Fishman Lab MGI:2665552 Tg(Myh6-tTA)6Smbf transgene insertion 6, Section of Myocardial Biology - Fishman Lab https://www.infrafrontier.eu/search?keyword=EM:04989 + EM:04989 STOCK Tg(Myh6-tTA)6Smbf Tg(tetO-Hgf,-EGFP)24Tcre/Cnrm EMMA embryo Hgf-TetO-GFP x alphaMHC-tTA mutant strain MGI:5648118 Tg(tetO-Hgf,-EGFP)24Tcre transgene insertion 24, Tiziana Crepaldi MGI:5648117 Tg(tetO-Hgf,-EGFP)24Tcre transgene insertion 24, Tiziana Crepaldi https://www.infrafrontier.eu/search?keyword=EM:04989 + EM:02188 STOCK Tg(MSR1)3Winth/Cnrm EMMA embryo MSR1 mutant strain MGI:5648236 Tg(MSR1)3Winth transgene insertion 3, Menno de Winther MGI:5648235 Tg(MSR1)3Winth transgene insertion 3, Menno de Winther https://www.infrafrontier.eu/search?keyword=EM:02188 ? EM:11142 STOCK Tg(MMTVtTA)1Mam/Orl EMMA sperm mutant strain MGI:3053958 Tg(MMTVtTA)1Mam transgene insertion 1, Lothar Hennighausen MGI:3053971 Tg(MMTVtTA)1Mam transgene insertion 1, Lothar Hennighausen https://www.infrafrontier.eu/search?keyword=EM:11142 + EM:01362 STOCK Tg(MMTV-Prlr)3Eder/Orl EMMA embryo MMTV-F3 mutant strain MGI:5304928 Tg(MMTV-Prlr)3Eder transgene insertion 3, Marc Edery MGI:5304921 Tg(MMTV-Prlr)3Eder transgene insertion 3, Marc Edery https://www.infrafrontier.eu/search?keyword=EM:01362 + EM:00134 STOCK Tg(Mbp-PDGFB)90Ubc/Kieg EMMA embryo MBP-PDGF B, KFN-1, STOCK Tg(Mbp-PDGFB)90Ubc/Ubc mutant stock MGI:3044166 Tg(Mbp-PDGFB)90Ubc transgene insertion 90, Uppsala University MGI:3044165 Tg(Mbp-PDGFB)90Ubc transgene insertion 90, Uppsala University https://www.infrafrontier.eu/search?keyword=EM:00134 + EM:04971 STOCK Tg(LYS2-rtTA2S*M2,tetO-ELAVL1)632Dkon/Flmg EMMA embryo STOCK Tg(LYS2-rtTA2S*M2;tetO-ELAVL1)632Dkon/Flmg, TgLrT-HAHuRL.632 mutant strain MGI:5429340 Tg(LYS2-rtTA2S*M2,tetO-ELAVL1)632Dkon transgene insertion 632, Dimitris Kontoyiannis MGI:5429341 Tg(LYS2-rtTA2S*M2,tetO-ELAVL1)632Dkon transgene insertion 632, Dimitris Kontoyiannis https://www.infrafrontier.eu/search?keyword=EM:04971 + EM:04971 STOCK Tg(LYS2-rtTA2S*M2,tetO-ELAVL1)632Dkon/Flmg EMMA sperm STOCK Tg(LYS2-rtTA2S*M2;tetO-ELAVL1)632Dkon/Flmg, TgLrT-HAHuRL.632 mutant strain MGI:5429340 Tg(LYS2-rtTA2S*M2,tetO-ELAVL1)632Dkon transgene insertion 632, Dimitris Kontoyiannis MGI:5429341 Tg(LYS2-rtTA2S*M2,tetO-ELAVL1)632Dkon transgene insertion 632, Dimitris Kontoyiannis https://www.infrafrontier.eu/search?keyword=EM:04971 + EM:01916 STOCK Tg(Lck-AVEN)1Zrng/Ieg EMMA embryo Tg(Lck-Aven), lck Aven mutant stock MGI:5317419 Tg(Lck-AVEN)1Zrng transgene insertion 1, Martin Zoernig MGI:5317418 Tg(Lck-AVEN)1Zrng transgene insertion 1, Martin Zoernig https://www.infrafrontier.eu/search?keyword=EM:01916 + EM:02189 STOCK Tg(ITGAM-PLA2G2A)1Winth/Cnrm EMMA embryo sPLA2 mutant strain MGI:5648230 Tg(ITGAM-PLA2G2A)1Winth transgene insertion 1, Menno de Winther MGI:5648228 Tg(ITGAM-PLA2G2A)1Winth transgene insertion 1, Menno de Winther https://www.infrafrontier.eu/search?keyword=EM:02189 - EM:05282 STOCK Tg(H2K-lacZ)1Cba/Orl EMMA embryo B6CBA-Tg(H2K-lacZ)1Cba/Orl, H-2Z1 mutant strain MGI:5645898 Tg(H2K-lacZ)1Cba transgene insertion 1, Charles Babinet MGI:5645897 Tg(H2K-lacZ)1Cba transgene insertion 1, Charles Babinet https://www.infrafrontier.eu/search?keyword=EM:05282 + EM:07149 STOCK Tg(H2-K1-Ifnb1)10Seif Ifnar1/Orl EMMA embryo STOCK Ifnar1 Tg(H2-K1-Ifnb1)10Seif/Orl, Ifnar1tm1Agt/Ifnar1tm1Agt Tg(H2-K1-Ifnb1)10Seif/Tg(H2- K1-Ifnb1)10Seif mutant strain MGI:5141611 Tg(H2-K1-Ifnb1)10Seif transgene insertion 10, Isabelle Seif MGI:5141625 Tg(H2-K1-Ifnb1)10Seif transgene insertion 10, Isabelle Seif https://www.infrafrontier.eu/search?keyword=EM:07149 + EM:07149 STOCK Tg(H2-K1-Ifnb1)10Seif Ifnar1/Orl EMMA embryo STOCK Ifnar1 Tg(H2-K1-Ifnb1)10Seif/Orl, Ifnar1tm1Agt/Ifnar1tm1Agt Tg(H2-K1-Ifnb1)10Seif/Tg(H2- K1-Ifnb1)10Seif mutant strain MGI:1930950 Ifnar1 targeted mutation 1, Michel Aguet MGI:107658 Ifnar1 interferon (alpha and beta) receptor 1 https://www.infrafrontier.eu/search?keyword=EM:07149 + EM:05237 STOCK Tg(Gfap-Pten*)6Rpm/Cnbc EMMA embryo GL1 GFAP-Pten qma mutant strain MGI:5795663 Tg(Gfap-PTEN*)6Rpm transgene insertion 6, Rafael Pulido MGI:5795659 Tg(Gfap-PTEN*)6Rpm transgene insertion 6, Rafael Pulido https://www.infrafrontier.eu/search?keyword=EM:05237 + EM:01347 STOCK Tg(GFAP-lacZ)9Nist/Kctt EMMA embryo hGFAPprom-LacZ line9, MNI-4 mutant strain MGI:5305741 Tg(GFAP-lacZ)9Nist transgene insertion 9, Monica Nister MGI:5305740 Tg(GFAP-lacZ)9Nist transgene insertion 9, Monica Nister https://www.infrafrontier.eu/search?keyword=EM:01347 + EM:01347 STOCK Tg(GFAP-lacZ)9Nist/Kctt EMMA live hGFAPprom-LacZ line9, MNI-4 mutant strain MGI:5305741 Tg(GFAP-lacZ)9Nist transgene insertion 9, Monica Nister MGI:5305740 Tg(GFAP-lacZ)9Nist transgene insertion 9, Monica Nister https://www.infrafrontier.eu/search?keyword=EM:01347 + EM:05989 STOCK Tg(Frzb-cre)1Tylz/Orl EMMA embryo Tg(Frzb-cre)1Tylz mutant strain MGI:3527940 Tg(Frzb-cre)1Tylz transgene insertion 1, Przemko Tylzanowski MGI:3527938 Tg(Frzb-cre)1Tylz transgene insertion 1, Przemko Tylzanowski https://www.infrafrontier.eu/search?keyword=EM:05989 + EM:01133 STOCK Tg(Fabp1-cre)1Jig/JigCnrm EMMA embryo Fabp1-Cre, STOCK Tg(Fabp1-cre)1Jig, STOCK Tg(Fabp1-cre)1Jig/JigIbcm, Fabpl-Cre mutant stock MGI:2447212 Tg(Fabp1-cre)1Jig transgene insertion 1, Jeffrey I Gordon MGI:2447210 Tg(Fabp1-cre)1Jig transgene insertion 1, Jeffrey I Gordon https://www.infrafrontier.eu/search?keyword=EM:01133 + EM:09527 STOCK Tg(CYP19A1-icre)3Fcrt/Biat EMMA embryo Aromatase-iCre mutant strain MGI:5807485 Tg(CYP19A1-icre)3Fcrt transgene insertion 3, Sophie Fouchecourt MGI:5807484 Tg(CYP19A1-icre)3Fcrt transgene insertion 3, Sophie Fouchecourt https://www.infrafrontier.eu/search?keyword=EM:09527 + EM:09527 STOCK Tg(CYP19A1-icre)3Fcrt/Biat EMMA sperm Aromatase-iCre mutant strain MGI:5807485 Tg(CYP19A1-icre)3Fcrt transgene insertion 3, Sophie Fouchecourt MGI:5807484 Tg(CYP19A1-icre)3Fcrt transgene insertion 3, Sophie Fouchecourt https://www.infrafrontier.eu/search?keyword=EM:09527 + EM:02518 STOCK Tg(Col2a1-cre)1Bhr/H EMMA embryo Col2-Cre, STOCK Tg(Col2a1-cre)1Bhr mutant strain MGI:2176070 Tg(Col2a1-cre)1Bhr transgene insertion 1, Richard R Behringer MGI:2176069 Tg(Col2a1-cre)1Bhr transgene insertion 1, Richard R Behringer https://www.infrafrontier.eu/search?keyword=EM:02518 + EM:09617 STOCK Tg(CMV-rtTA)4Bjd Tg(tetO-LINE1*,-lacZ)#Ggs/Ieg EMMA sperm STOCK Tg(CMV-rtTA)4Bjd Tg(TRE-ORFeus,-lacZ)/Ieg, ORFeus lacZ_CMVrtTA mutant strain MGI:6220704 Tg(tetO-LINE1*,-lacZ)#Ggs transgene insertion, Gerald G Schumann MGI:6220703 Tg(tetO-LINE1*,-lacZ)#Ggs transgene insertion, Gerald G Schumann https://www.infrafrontier.eu/search?keyword=EM:09617 + EM:09617 STOCK Tg(CMV-rtTA)4Bjd Tg(tetO-LINE1*,-lacZ)#Ggs/Ieg EMMA sperm STOCK Tg(CMV-rtTA)4Bjd Tg(TRE-ORFeus,-lacZ)/Ieg, ORFeus lacZ_CMVrtTA mutant strain MGI:3056891 Tg(CMV-rtTA)4Bjd transgene insertion 4, Hermann Bujard MGI:3056892 Tg(CMV-rtTA)4Bjd transgene insertion 4, Hermann Bujard https://www.infrafrontier.eu/search?keyword=EM:09617 + EM:06004 STOCK Tg(CAMK2A-KCNIP3*,-lacZ)1Cnbc/Cnbc EMMA sperm B6CBA-Tg(hCaMKIIalpha-hEFmDREAM-IRES-lacZ)JN1Cnbc mutant strain MGI:5646261 Tg(CAMK2A-KCNIP3*,-lacZ)1Cnbc transgene insertion 1, Centro Nacional de Biotecnologia MGI:5646259 Tg(CAMK2A-KCNIP3*,-lacZ)1Cnbc transgene insertion 1, Centro Nacional de Biotecnologia https://www.infrafrontier.eu/search?keyword=EM:06004 + EM:09256 STOCK Tg(Camk2a-Grin2c/itTA)12Rsp Tg(tetO-cre)LC1Bjd/Kctt EMMA sperm TgCN12+LC1 (lab name CN12) mutant strain MGI:2448952 Tg(tetO-cre)LC1Bjd transgene insertion LC1, Hermann Bujard MGI:2671943 Tg(tetO-cre)LC1Bjd transgene insertion LC1, Hermann Bujard https://www.infrafrontier.eu/search?keyword=EM:09256 + EM:09256 STOCK Tg(Camk2a-Grin2c/itTA)12Rsp Tg(tetO-cre)LC1Bjd/Kctt EMMA sperm TgCN12+LC1 (lab name CN12) mutant strain MGI:5432029 Tg(Camk2a-Grin2c/itTA)12Rsp transgene insertion 12, Rolf Sprengel MGI:5432028 Tg(Camk2a-Grin2c/itTA)12Rsp transgene insertion 12, Rolf Sprengel https://www.infrafrontier.eu/search?keyword=EM:09256 + EM:05635 STOCK Tg(CAG-Otx2,-GFP)21Asim/Cnrm EMMA embryo CMV-bOtx2 mutant strain MGI:4887448 Tg(CAG-Otx2,-GFP)21Asim transgene insertion 21, Antonio Simeone MGI:4887463 Tg(CAG-Otx2,-GFP)21Asim transgene insertion 21, Antonio Simeone https://www.infrafrontier.eu/search?keyword=EM:05635 + EM:05635 STOCK Tg(CAG-Otx2,-GFP)21Asim/Cnrm EMMA sperm CMV-bOtx2 mutant strain MGI:4887448 Tg(CAG-Otx2,-GFP)21Asim transgene insertion 21, Antonio Simeone MGI:4887463 Tg(CAG-Otx2,-GFP)21Asim transgene insertion 21, Antonio Simeone https://www.infrafrontier.eu/search?keyword=EM:05635 ? EM:06790 STOCK Tg(CAG-KFP)3Sgo/Cnbc EMMA sperm mutant strain Tg(CAG-KFP)3Sgo Tg(CAG-KFP)3Sgo Tg(CAG-KFP)3Sgo Tg(CAG-KFP)3Sgo https://www.infrafrontier.eu/search?keyword=EM:06790 + EM:01917 STOCK Tg(CAG-AVEN)1Zrng/Ieg EMMA embryo beta-actin-Aven, B6;CD1-Tg(ACTB-Aven)/Ieg mutant stock MGI:5317427 Tg(CAG-AVEN)1Zrng transgene insertion 1, Martin Zoernig MGI:5317426 Tg(CAG-AVEN)1Zrng transgene insertion 1, Martin Zoernig https://www.infrafrontier.eu/search?keyword=EM:01917 + EM:00026 STOCK Tg(APOA4)8022Feb/Cnrm EMMA embryo B6.(C57BL/6 x CBA)-Tg(APOA4)8022Feb/Ibcm, B6.Cg-Tg(APOA4)8022Feb/Ibcm, APOA4-Tg#8022, B6;CD1-Tg(APOA4)8022Feb/Ibcm mutant strain MGI:2652475 Tg(APOA4)8022Feb transgene insertion 8022, Francisco E Baralle MGI:2652470 Tg(APOA4)8022Feb transgene insertion 8022, Francisco E Baralle https://www.infrafrontier.eu/search?keyword=EM:00026 + EM:00025 STOCK Tg(APOA4)8021Feb/Cnrm EMMA embryo B6;CD1-Tg(APOA4)8021Feb, B6;CD1-Tg(APOA4)8021Feb/Ibcm, B6.Cg-Tg(APOA4)8021Feb/Ibcm, STOCK Tg(APOA4)8021Feb/Ibcm, B6.(C57BL/6 x CBA)-Tg(APOA4)8021Feb/Ibcm, APOA4-Tg#8021 mutant strain MGI:2652472 Tg(APOA4)8021Feb transgene insertion 8021, Francisco E Baralle MGI:2652467 Tg(APOA4)8021Feb transgene insertion 8021, Francisco E Baralle https://www.infrafrontier.eu/search?keyword=EM:00025 + EM:00603 STOCK Tg(Alb1-cre)7Gsc/Cnrm EMMA embryo tg alfpCre, STOCK Tg(Alb1-cre)7Gsc/Ibcm mutant strain MGI:2177602 Tg(Alb1-cre)7Gsc transgene insertion 7, Gunther Schutz MGI:2177601 Tg(Alb1-cre)7Gsc transgene insertion 7, Gunther Schutz https://www.infrafrontier.eu/search?keyword=EM:00603 + EM:00603 STOCK Tg(Alb1-cre)7Gsc/Cnrm EMMA live tg alfpCre, STOCK Tg(Alb1-cre)7Gsc/Ibcm mutant strain MGI:2177602 Tg(Alb1-cre)7Gsc transgene insertion 7, Gunther Schutz MGI:2177601 Tg(Alb1-cre)7Gsc transgene insertion 7, Gunther Schutz https://www.infrafrontier.eu/search?keyword=EM:00603 ? EM:11067 STOCK Tg(Alb1-cre) Tg(Alb1-HCVN)35Sml/Orl EMMA archived mutant strain Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) https://www.infrafrontier.eu/search?keyword=EM:11067 ? EM:11067 STOCK Tg(Alb1-cre) Tg(Alb1-HCVN)35Sml/Orl EMMA archived mutant strain MGI:3513779 Tg(Alb1-HCVN)35Sml transgene insertion 35, Stanley M Lemon MGI:3625827 Tg(Alb1-HCVN)35Sml transgene insertion 35, Stanley M Lemon https://www.infrafrontier.eu/search?keyword=EM:11067 ? EM:06347 STOCK Tg(Alb-luc/EGFP)7007Ciem/Cnbc EMMA sperm mutant strain Tg(Alb-luc/EGFP)7007Ciem Tg(Alb-luc/EGFP)7007Ciem Tg(Alb-luc/EGFP)7007Ciem Tg(Alb-luc/EGFP)7007Ciem https://www.infrafrontier.eu/search?keyword=EM:06347 ? EM:06345 STOCK Tg(Alb-luc/EGFP)5190Ciem/Cnbc EMMA sperm mutant strain Tg(Alb-luc/EGFP)5190Ciem Tg(Alb-luc/EGFP)5190Ciem Tg(Alb-luc/EGFP)5190Ciem Tg(Alb-luc/EGFP)5190Ciem https://www.infrafrontier.eu/search?keyword=EM:06345 ? EM:06344 STOCK Tg(Alb-luc/EGFP)5189Ciem/Cnbc EMMA sperm mutant strain Tg(Alb-luc/EGFP)5189Ciem Tg(Alb-luc/EGFP)5189Ciem Tg(Alb-luc/EGFP)5189Ciem Tg(Alb-luc/EGFP)5189Ciem https://www.infrafrontier.eu/search?keyword=EM:06344 ? EM:06346 STOCK Tg(Alb-luc/EGFP)5187Ciem/Cnbc EMMA sperm mutant strain Tg(Alb-luc/EGFP)5187Ciem Tg(Alb-luc/EGFP)5187Ciem Tg(Alb-luc/EGFP)5187Ciem Tg(Alb-luc/EGFP)5187Ciem https://www.infrafrontier.eu/search?keyword=EM:06346 + EM:01100 STOCK Tg(ACTB-Neurog3)1Bzal/Orl EMMA embryo B6;D2-Tg(ACTB-Ngn3)Bzal/Orl, beta-actin-floxed-ngn3, STOCK Tg(ACTB-Ngn3)1Bzal/Orl mutant strain MGI:5750091 Tg(ACTB-Neurog3)1Bzal transgene insertion 1, Bernard Zalc MGI:5750088 Tg(ACTB-Neurog3)1Bzal transgene insertion 1, Bernard Zalc https://www.infrafrontier.eu/search?keyword=EM:01100 + EM:01164 STOCK Tbce +/+ Gli3/PasOrl EMMA embryo XtP-Pasteur mutant strain MGI:1856275 Gli3 extra toes MGI:95729 Gli3 GLI-Kruppel family member GLI3 https://www.infrafrontier.eu/search?keyword=EM:01164 + EM:01164 STOCK Tbce +/+ Gli3/PasOrl EMMA embryo XtP-Pasteur mutant strain MGI:1856997 Tbce progressive motor neuronopathy MGI:1917680 Tbce tubulin-specific chaperone E https://www.infrafrontier.eu/search?keyword=EM:01164 + EM:01717 STOCK Tas6/H EMMA embryo TAS6 mutant strain MGI:5646497 Tas6 mutant Tas6 MGI:5646398 Tas6 mutant Tas6 https://www.infrafrontier.eu/search?keyword=EM:01717 + EM:01717 STOCK Tas6/H EMMA sperm TAS6 mutant strain MGI:5646497 Tas6 mutant Tas6 MGI:5646398 Tas6 mutant Tas6 https://www.infrafrontier.eu/search?keyword=EM:01717 + EM:02206 STOCK T<21H>/H EMMA embryo T<21H> mutant strain MGI:1859667 T<21H> brachyury 21 Harwell MGI:98472 T brachyury, T-box transcription factor T https://www.infrafrontier.eu/search?keyword=EM:02206 + EM:01845 STOCK T(7;19)145H/H EMMA embryo STOCK T(7;19)145H, T(7;19)145H, T145H mutant stock MGI:5316040 T(7;19)145H reciprocal translocation, Chr 7 and 19, Harwell 145 MGI:103979 T(7;19)145H reciprocal translocation, Chr 7 and 19, Harwell 145 https://www.infrafrontier.eu/search?keyword=EM:01845 + EM:02584 STOCK T(2;8)2Wa/H EMMA embryo T2Wa mutant strain T(2;8)2Wa MGI:103706 T(2;8)2Wa reciprocal translocation, Chr 2 and 8, Wageningen 2 https://www.infrafrontier.eu/search?keyword=EM:02584 - EM:05521 STOCK Synj2/WtsiOulu EMMA embryo mutant strain MGI:4432435 Synj2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1201671 Synj2 synaptojanin 2 https://www.infrafrontier.eu/search?keyword=EM:05521 ? EM:13078 STOCK Svbp/Flmg EMMA embryo mutant strain Svbp Svbp MGI:1916466 Svbp small vasohibin binding protein https://www.infrafrontier.eu/search?keyword=EM:13078 ? EM:13078 STOCK Svbp/Flmg EMMA sperm mutant strain Svbp Svbp MGI:1916466 Svbp small vasohibin binding protein https://www.infrafrontier.eu/search?keyword=EM:13078 - EM:05570 STOCK Stmn4/Orl EMMA embryo STOCK Stmn4/Orl mutant strain Stmn4 Stmn4 MGI:1931224 Stmn4 stathmin-like 4 https://www.infrafrontier.eu/search?keyword=EM:05570 - EM:05571 STOCK Stmn3/Orl EMMA embryo STOCK Stmn3/Orl mutant strain Stmn3 Stmn3 MGI:1277137 Stmn3 stathmin-like 3 https://www.infrafrontier.eu/search?keyword=EM:05571 - EM:05571 STOCK Stmn3/Orl EMMA sperm STOCK Stmn3/Orl mutant strain Stmn3 Stmn3 MGI:1277137 Stmn3 stathmin-like 3 https://www.infrafrontier.eu/search?keyword=EM:05571 - EM:05572 STOCK Stmn2/Orl EMMA embryo STOCK Stmn2/Orl mutant strain Stmn2 Stmn2 MGI:98241 Stmn2 stathmin-like 2 https://www.infrafrontier.eu/search?keyword=EM:05572 - EM:08536 STOCK Stap1/Wtsi EMMA embryo mutant strain MGI:4458470 Stap1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926193 Stap1 signal transducing adaptor family member 1 https://www.infrafrontier.eu/search?keyword=EM:08536 - EM:08536 STOCK Stap1/Wtsi EMMA sperm mutant strain MGI:4458470 Stap1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926193 Stap1 signal transducing adaptor family member 1 https://www.infrafrontier.eu/search?keyword=EM:08536 + EM:01315 STOCK Srrm4/WtsiH EMMA embryo bv, bv (Bronx Waltzer), STOCK bv/H, STOCK bv/WtsiH, Bronx Waltzer mutant stock MGI:1856676 Srrm4 Bronx waltzer MGI:1916205 Srrm4 serine/arginine repetitive matrix 4 https://www.infrafrontier.eu/search?keyword=EM:01315 + EM:01315 STOCK Srrm4/WtsiH EMMA sperm bv, bv (Bronx Waltzer), STOCK bv/H, STOCK bv/WtsiH, Bronx Waltzer mutant stock MGI:1856676 Srrm4 Bronx waltzer MGI:1916205 Srrm4 serine/arginine repetitive matrix 4 https://www.infrafrontier.eu/search?keyword=EM:01315 - EM:01859 STOCK Sox4 Foxq1/+ +/H EMMA embryo STOCK Sox4 Foxq1/+ +/H, M91B mutant stock MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01859 - EM:01859 STOCK Sox4 Foxq1/+ +/H EMMA embryo STOCK Sox4 Foxq1/+ +/H, M91B mutant stock MGI:3819793 Sox4 mutation 91, Ruth M Arkell MGI:98366 Sox4 SRY (sex determining region Y)-box 4 https://www.infrafrontier.eu/search?keyword=EM:01859 + EM:05015 STOCK Sox2/WtsiCnbc[cc] EMMA embryo Yellow submarine mutant strain MGI:2447996 Sox2 yellow submarine MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:05015 + EM:07995 STOCK Sox2/Cnrm EMMA embryo Sox2flox mutant strain MGI:4397705 Sox2 targeted mutation 4.1, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:07995 + EM:07995 STOCK Sox2/Cnrm EMMA sperm Sox2flox mutant strain MGI:4397705 Sox2 targeted mutation 4.1, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:07995 + EM:07114 STOCK Sox2/Cnrm EMMA embryo Sox2 deltaENH mutant strain MGI:3052123 Sox2 targeted mutation 3, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:07114 + EM:07114 STOCK Sox2/Cnrm EMMA sperm Sox2 deltaENH mutant strain MGI:3052123 Sox2 targeted mutation 3, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:07114 + EM:07153 STOCK Sox2/Cnrm EMMA embryo Sox2 beta-geo knock-in mutant strain MGI:2181440 Sox2 targeted mutation 2, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:07153 + EM:07153 STOCK Sox2/Cnrm EMMA sperm Sox2 beta-geo knock-in mutant strain MGI:2181440 Sox2 targeted mutation 2, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:07153 + EM:10000 STOCK Snx29/IcsOrl EMMA sperm E254-HEPD0532_2_B10, HEPD0532_2_B10 mutant strain MGI:4434822 Snx29 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921728 Snx29 sorting nexin 29 https://www.infrafrontier.eu/search?keyword=EM:10000 + EM:10367 STOCK Smyd3/Flmg EMMA embryo mutant strain MGI:4346714 Smyd3 gene trap AS0527, Wellcome Trust Sanger Institute MGI:1916976 Smyd3 SET and MYND domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:10367 + EM:02416 STOCK Smg6/H EMMA embryo FVB.Cg-Tg(SMN1*delta5-Smg6)1Pks, SMNDelta5 mutant strain MGI:5493450 Smg6 transgene insertion 1, Nick Parkinson MGI:2144117 Smg6 Smg-6 homolog, nonsense mediated mRNA decay factor (C. elegans) https://www.infrafrontier.eu/search?keyword=EM:02416 + EM:02524 STOCK Smad9/H EMMA sperm Smad8 conditional mutant strain MGI:5514164 Smad9 targeted mutation 2, Elizabeth J Robertson MGI:1859993 Smad9 SMAD family member 9 https://www.infrafrontier.eu/search?keyword=EM:02524 + EM:02507 STOCK Smad9/H EMMA embryo Smad8 LacZ mutant strain MGI:3701868 Smad9 targeted mutation 1, Elizabeth J Robertson MGI:1859993 Smad9 SMAD family member 9 https://www.infrafrontier.eu/search?keyword=EM:02507 + EM:02511 STOCK Smad2/H EMMA embryo Smad2 SF, Smad 2 SF mutant strain MGI:5775212 Smad2 targeted mutation 6, Elizabeth Robertson MGI:108051 Smad2 SMAD family member 2 https://www.infrafrontier.eu/search?keyword=EM:02511 + EM:02512 STOCK Smad2/H EMMA embryo Smad2 FL, Smad 2 FL mutant strain MGI:5775197 Smad2 targeted mutation 5, Elizabeth Robertson MGI:108051 Smad2 SMAD family member 2 https://www.infrafrontier.eu/search?keyword=EM:02512 + EM:02508 STOCK Smad2/H EMMA embryo Smad 2 T3, Smad2 T3 mutant strain MGI:3527156 Smad2 targeted mutation 4, Elizabeth J Robertson MGI:108051 Smad2 SMAD family member 2 https://www.infrafrontier.eu/search?keyword=EM:02508 + EM:02509 STOCK Smad2/H EMMA embryo Smad 2 D2, 129-Smad2/H, Smad2 D2 mutant strain MGI:3527155 Smad2 targeted mutation 3, Elizabeth J Robertson MGI:108051 Smad2 SMAD family member 2 https://www.infrafrontier.eu/search?keyword=EM:02509 + EM:10001 STOCK Slc7a11/IcsOrl EMMA sperm EPD0508_3_E02, E252-EPD0508_3_E02 mutant strain MGI:4441748 Slc7a11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1347355 Slc7a11 solute carrier family 7 (cationic amino acid transporter, y+ system), member 11 https://www.infrafrontier.eu/search?keyword=EM:10001 ? EM:12807 STOCK Slamf1 Ifnar1/Biat EMMA embryo mutant strain MGI:1930950 Ifnar1 targeted mutation 1, Michel Aguet MGI:107658 Ifnar1 interferon (alpha and beta) receptor 1 https://www.infrafrontier.eu/search?keyword=EM:12807 ? EM:12807 STOCK Slamf1 Ifnar1/Biat EMMA embryo mutant strain MGI:3776761 Slamf1 targeted mutation 1, Shinji Ohno MGI:1351314 Slamf1 signaling lymphocytic activation molecule family member 1 https://www.infrafrontier.eu/search?keyword=EM:12807 + EM:06779 STOCK Sirt3/WtsiH EMMA sperm B6NTac;B6N-A Sirt3/WtsiH mutant strain MGI:4441628 Sirt3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927665 Sirt3 sirtuin 3 https://www.infrafrontier.eu/search?keyword=EM:06779 + EM:09786 STOCK Shb/Oulu EMMA embryo HEPD0613_4_G08 mutant strain MGI:4451783 Shb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98294 Shb src homology 2 domain-containing transforming protein B https://www.infrafrontier.eu/search?keyword=EM:09786 + EM:09786 STOCK Shb/Oulu EMMA sperm HEPD0613_4_G08 mutant strain MGI:4451783 Shb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98294 Shb src homology 2 domain-containing transforming protein B https://www.infrafrontier.eu/search?keyword=EM:09786 + EM:09467 STOCK Setd7/Flmg EMMA embryo mutant strain MGI:5828599 Setd7 targeted mutation 1.1, Iannis Talianidis MGI:1920501 Setd7 SET domain containing (lysine methyltransferase) 7 https://www.infrafrontier.eu/search?keyword=EM:09467 + EM:09993 STOCK Setbp1/IcsOrl EMMA sperm EPD0445_3_E05, G6-EPD0445_3_E05 mutant strain MGI:4442011 Setbp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933199 Setbp1 SET binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:09993 + EM:02138 STOCK Selenon/Orl EMMA sperm SEPN1 -/- (K51-326 L-), STOCK Sepn1/Orl mutant strain MGI:4946396 Selenon targeted mutation 1.2, Mathieu Rederstorff MGI:2151208 Selenon selenoprotein N https://www.infrafrontier.eu/search?keyword=EM:02138 + EM:11938 STOCK Selenon Gulo/Cnrm EMMA embryo mutant strain MGI:4946396 Selenon targeted mutation 1.2, Mathieu Rederstorff MGI:2151208 Selenon selenoprotein N https://www.infrafrontier.eu/search?keyword=EM:11938 + EM:11938 STOCK Selenon Gulo/Cnrm EMMA embryo mutant strain MGI:2158350 Gulo targeted mutation 1, Nobuyo Maeda MGI:1353434 Gulo gulonolactone (L-) oxidase https://www.infrafrontier.eu/search?keyword=EM:11938 + EM:11938 STOCK Selenon Gulo/Cnrm EMMA sperm mutant strain MGI:4946396 Selenon targeted mutation 1.2, Mathieu Rederstorff MGI:2151208 Selenon selenoprotein N https://www.infrafrontier.eu/search?keyword=EM:11938 + EM:11938 STOCK Selenon Gulo/Cnrm EMMA sperm mutant strain MGI:2158350 Gulo targeted mutation 1, Nobuyo Maeda MGI:1353434 Gulo gulonolactone (L-) oxidase https://www.infrafrontier.eu/search?keyword=EM:11938 + EM:04400 STOCK Scnn1g/Orl EMMA embryo B6N;129-Scnn1g/Orl, Scnn1g lox/lox mutant strain MGI:3832674 Scnn1g targeted mutation 1.1, Edith Hummer MGI:104695 Scnn1g sodium channel, nonvoltage-gated 1 gamma https://www.infrafrontier.eu/search?keyword=EM:04400 + EM:04397 STOCK Scnn1b/Orl EMMA embryo Liddle, B6;129P2-Scnn1b/Orl mutant strain MGI:2448620 Scnn1b targeted mutation 1.1, Edith Hummler MGI:104696 Scnn1b sodium channel, nonvoltage-gated 1 beta https://www.infrafrontier.eu/search?keyword=EM:04397 + EM:04397 STOCK Scnn1b/Orl EMMA sperm Liddle, B6;129P2-Scnn1b/Orl mutant strain MGI:2448620 Scnn1b targeted mutation 1.1, Edith Hummler MGI:104696 Scnn1b sodium channel, nonvoltage-gated 1 beta https://www.infrafrontier.eu/search?keyword=EM:04397 + EM:04399 STOCK Scnn1b/Orl EMMA embryo B6;129P2-Scnn1b/Orl, Scnn1b lox/lox mutant strain MGI:3832670 Scnn1b targeted mutation 1.1, Edith Hummler MGI:104696 Scnn1b sodium channel, nonvoltage-gated 1 beta https://www.infrafrontier.eu/search?keyword=EM:04399 + EM:10603 STOCK Scaper/Ics EMMA sperm HEPD0654_7_D07, G4647 mutant strain MGI:4455688 Scaper targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1925976 Scaper S phase cyclin A-associated protein in the ER https://www.infrafrontier.eu/search?keyword=EM:10603 + EM:10603 STOCK Scaper/Ics EMMA live HEPD0654_7_D07, G4647 mutant strain MGI:4455688 Scaper targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1925976 Scaper S phase cyclin A-associated protein in the ER https://www.infrafrontier.eu/search?keyword=EM:10603 + EM:01876 STOCK sau Foxq1/sau<+> Foxq1<+>/H EMMA embryo M1239B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01876 + EM:01876 STOCK sau Foxq1/sau<+> Foxq1<+>/H EMMA embryo M1239B mutant strain MGI:3607721 sau sauron MGI:3607718 sau sauron https://www.infrafrontier.eu/search?keyword=EM:01876 + EM:01876 STOCK sau Foxq1/sau<+> Foxq1<+>/H EMMA sperm M1239B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01876 + EM:01876 STOCK sau Foxq1/sau<+> Foxq1<+>/H EMMA sperm M1239B mutant strain MGI:3607721 sau sauron MGI:3607718 sau sauron https://www.infrafrontier.eu/search?keyword=EM:01876 + EM:01691 STOCK Rvm/H EMMA embryo GENA333, C3H;C-Rvm/H mutant stock MGI:1934625 Rvm retinal vascular mass MGI:1934624 Rvm retinal vascular mass https://www.infrafrontier.eu/search?keyword=EM:01691 - EM:05802 STOCK Ripply3/WtsiCnbc EMMA embryo mutant strain MGI:4433779 Ripply3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2181192 Ripply3 ripply transcriptional repressor 3 https://www.infrafrontier.eu/search?keyword=EM:05802 + EM:01388 STOCK Rgs4/Orl EMMA embryo B6;129P2-Rgs4/Orl, Rgs4lacZ mutant strain MGI:3580388 Rgs4 targeted mutation 1, Jean-Francois Brunet MGI:108409 Rgs4 regulator of G-protein signaling 4 https://www.infrafrontier.eu/search?keyword=EM:01388 + EM:05207 STOCK Rffl/Orl EMMA embryo Rffltbetageo mutant strain MGI:3846097 Rffl targeted mutation 1, Michel Cohen-Tannoudji MGI:1914588 Rffl ring finger and FYVE like domain containing protein https://www.infrafrontier.eu/search?keyword=EM:05207 + EM:02081 STOCK Ret/Kctt EMMA embryo Ret KO, Cg-Ret/Kctt mutant strain MGI:2136894 Ret targeted mutation 1, Frank Costantini MGI:97902 Ret ret proto-oncogene https://www.infrafrontier.eu/search?keyword=EM:02081 + EM:02080 STOCK Ret/Kctt EMMA embryo B6;129P2-Ret/Kctt, Ret flox mutant strain MGI:4440475 Ret targeted mutation 1.1, Patrik Ernfors MGI:97902 Ret ret proto-oncogene https://www.infrafrontier.eu/search?keyword=EM:02080 - EM:11111 STOCK Rasgrf1/H EMMA sperm WCW_1413_003, C57BL/6N-Rasgrf1/H mutant strain MGI:6460115 Rasgrf1 targeted mutation 1a, National Laboratory Animal Center MGI:99694 Rasgrf1 RAS protein-specific guanine nucleotide-releasing factor 1 https://www.infrafrontier.eu/search?keyword=EM:11111 + EM:09839 STOCK Rasal3/CipheOrl EMMA sperm HEPD0529_2_H07 mutant strain MGI:4436426 Rasal3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444128 Rasal3 RAS protein activator like 3 https://www.infrafrontier.eu/search?keyword=EM:09839 + EM:10003 STOCK Ralb/H EMMA sperm B6.Cg-Ralb/H mutant strain MGI:5505280 Ralb targeted mutation 1.2, Christopher J Marshall MGI:1927244 Ralb v-ral simian leukemia viral oncogene B https://www.infrafrontier.eu/search?keyword=EM:10003 + EM:10002 STOCK Rala/H EMMA sperm RalA, B6.Cg-Rala/H, C57BL/6-Rala/CjmH mutant strain MGI:5505279 Rala targeted mutation 1.2, Christopher J Marshall MGI:1927243 Rala v-ral simian leukemia viral oncogene A (ras related) https://www.infrafrontier.eu/search?keyword=EM:10002 + EM:00161 STOCK Rag2/Orl EMMA embryo STOCK Rag2/Ciml, STOCK Rag2, Rag2<0> mutant stock MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:00161 + EM:00161 STOCK Rag2/Orl EMMA sperm STOCK Rag2/Ciml, STOCK Rag2, Rag2<0> mutant stock MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:00161 + EM:07459 STOCK Rag2 Thy1 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA embryo Rag2-/- Tg HY +/+ Thy1.1 mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:07459 + EM:07459 STOCK Rag2 Thy1 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA embryo Rag2-/- Tg HY +/+ Thy1.1 mutant strain MGI:3044562 Tg(TcraH-Y,TcrbH-Y)71Vbo transgene insertion 71, Harald von Boehmer MGI:3044559 Tg(TcraH-Y,TcrbH-Y)71Vbo transgene insertion 71, Harald von Boehmer https://www.infrafrontier.eu/search?keyword=EM:07459 + EM:07459 STOCK Rag2 Thy1 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA embryo Rag2-/- Tg HY +/+ Thy1.1 mutant strain MGI:3579311 Thy1 a variant MGI:98747 Thy1 thymus cell antigen 1, theta https://www.infrafrontier.eu/search?keyword=EM:07459 - EM:07003 STOCK Rag2 Ifnar1- Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain Ifnar1 - Ifnar1 - MGI:107658 Ifnar1 interferon (alpha and beta) receptor 1 https://www.infrafrontier.eu/search?keyword=EM:07003 - EM:07003 STOCK Rag2 Ifnar1- Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:07003 - EM:07003 STOCK Rag2 Ifnar1- Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain MGI:2665105 Tg(TcrLCMV)327Sdz transgene insertion 327, Birgit Ledermann MGI:2665109 Tg(TcrLCMV)327Sdz transgene insertion 327, Birgit Ledermann https://www.infrafrontier.eu/search?keyword=EM:07003 + EM:07463 STOCK Rag2 Cd40 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA archived mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:07463 + EM:07463 STOCK Rag2 Cd40 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA archived mutant strain MGI:3044562 Tg(TcraH-Y,TcrbH-Y)71Vbo transgene insertion 71, Harald von Boehmer MGI:3044559 Tg(TcraH-Y,TcrbH-Y)71Vbo transgene insertion 71, Harald von Boehmer https://www.infrafrontier.eu/search?keyword=EM:07463 + EM:07463 STOCK Rag2 Cd40 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA archived mutant strain MGI:1857457 Cd40 targeted mutation 1, Hitoshi Kikutani MGI:88336 Cd40 CD40 antigen https://www.infrafrontier.eu/search?keyword=EM:07463 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/search?keyword=EM:06943 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:06943 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1857235 Prf1 targeted mutation 1, Sandoz Pharmaceuticals MGI:97551 Prf1 perforin 1 (pore forming protein) https://www.infrafrontier.eu/search?keyword=EM:06943 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:06943 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:06943 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/search?keyword=EM:06943 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/° mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:06327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/° mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/search?keyword=EM:06327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/° mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:06327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/° mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:06327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/° mutant strain MGI:2429736 Il2rg targeted mutation 1, Kazuo Sugamura MGI:96551 Il2rg interleukin 2 receptor, gamma chain https://www.infrafrontier.eu/search?keyword=EM:06327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/° mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/search?keyword=EM:06327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/° mutant strain MGI:1857235 Prf1 targeted mutation 1, Sandoz Pharmaceuticals MGI:97551 Prf1 perforin 1 (pore forming protein) https://www.infrafrontier.eu/search?keyword=EM:06327 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/search?keyword=EM:06326 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/search?keyword=EM:06326 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:06326 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:2429736 Il2rg targeted mutation 1, Kazuo Sugamura MGI:96551 Il2rg interleukin 2 receptor, gamma chain https://www.infrafrontier.eu/search?keyword=EM:06326 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:06326 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:06326 - EM:05517 STOCK Rab29/WtsiOulu EMMA embryo mutant strain MGI:4432353 Rab29 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385107 Rab29 RAB29, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:05517 + EM:07825 STOCK Rab27b/SeabH EMMA sperm B6;129-Rab27b/SeabH, Rab27B knock-out mutant strain MGI:3706986 Rab27b targeted mutation 1.2, Miguel C Seabra MGI:1931295 Rab27b RAB27B, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:07825 + EM:09994 STOCK Rab19/IcsOrl EMMA sperm HEPD0535_2_C06, E255-HEPD0535_2_C06 mutant strain MGI:4434870 Rab19 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103292 Rab19 RAB19, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:09994 - EM:11491 STOCK Ptprc Rag2 Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:11491 - EM:11491 STOCK Ptprc Rag2 Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain MGI:4819849 Ptprc a variant MGI:97810 Ptprc protein tyrosine phosphatase, receptor type, C https://www.infrafrontier.eu/search?keyword=EM:11491 - EM:11491 STOCK Ptprc Rag2 Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain MGI:2665105 Tg(TcrLCMV)327Sdz transgene insertion 327, Birgit Ledermann MGI:2665109 Tg(TcrLCMV)327Sdz transgene insertion 327, Birgit Ledermann https://www.infrafrontier.eu/search?keyword=EM:11491 + EM:09841 STOCK Ptpra/CipheOrl EMMA sperm HEPD0511_4_G01 mutant strain MGI:4434690 Ptpra targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97808 Ptpra protein tyrosine phosphatase, receptor type, A https://www.infrafrontier.eu/search?keyword=EM:09841 - EM:05723 STOCK Ptpn2/WtsiBiat EMMA sperm mutant strain MGI:4441737 Ptpn2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97806 Ptpn2 protein tyrosine phosphatase, non-receptor type 2 https://www.infrafrontier.eu/search?keyword=EM:05723 ? EM:12902 STOCK Ptk2b/Orl EMMA sperm mutant strain MGI:6164156 Ptk2b targeted mutation 1.2, Genoway MGI:104908 Ptk2b PTK2 protein tyrosine kinase 2 beta https://www.infrafrontier.eu/search?keyword=EM:12902 - EM:05527 STOCK Ptges2/WtsiOulu EMMA embryo mutant strain MGI:4432215 Ptges2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917592 Ptges2 prostaglandin E synthase 2 https://www.infrafrontier.eu/search?keyword=EM:05527 + EM:10358 STOCK Ptgdr2/Biat EMMA sperm mutant strain MGI:4843032 Ptgdr2 targeted mutation 1, Velocigene MGI:1330275 Ptgdr2 prostaglandin D2 receptor 2 https://www.infrafrontier.eu/search?keyword=EM:10358 ? EM:11052 STOCK Pten Tg(Alb1-cre) Tg(Alb1-HCVN)35Sml/Orl EMMA archived mutant strain MGI:109583 Pten phosphatase and tensin homolog https://www.infrafrontier.eu/search?keyword=EM:11052 ? EM:11052 STOCK Pten Tg(Alb1-cre) Tg(Alb1-HCVN)35Sml/Orl EMMA archived mutant strain Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) https://www.infrafrontier.eu/search?keyword=EM:11052 ? EM:11052 STOCK Pten Tg(Alb1-cre) Tg(Alb1-HCVN)35Sml/Orl EMMA archived mutant strain MGI:3513779 Tg(Alb1-HCVN)35Sml transgene insertion 35, Stanley M Lemon MGI:3625827 Tg(Alb1-HCVN)35Sml transgene insertion 35, Stanley M Lemon https://www.infrafrontier.eu/search?keyword=EM:11052 + EM:09646 STOCK Prnp Tg(Prnp-PRNP)361Jmto/Cnbc EMMA embryo Prpn tm2Edin tg(moPrpn 129Val-HuPrP-361) Jmtorres, tgVal129/tg361 mutant strain MGI:5803836 Tg(Prnp-PRNP)361Jmto transgene insertion 361, Juan Maria Torres MGI:5803835 Tg(Prnp-PRNP)361Jmto transgene insertion 361, Juan Maria Torres https://www.infrafrontier.eu/search?keyword=EM:09646 + EM:09646 STOCK Prnp Tg(Prnp-PRNP)361Jmto/Cnbc EMMA embryo Prpn tm2Edin tg(moPrpn 129Val-HuPrP-361) Jmtorres, tgVal129/tg361 mutant strain MGI:2387688 Prnp targeted mutation 2, Edinburgh University MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:09646 + EM:09644 STOCK Prnp Tg(Prnp-PRNP)340Jmto/Cnbc EMMA embryo Prpn tm2Edin tg(moPrpn 129Met-HuPrP-340) Jmtorres mutant strain MGI:2387688 Prnp targeted mutation 2, Edinburgh University MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:09644 + EM:09644 STOCK Prnp Tg(Prnp-PRNP)340Jmto/Cnbc EMMA embryo Prpn tm2Edin tg(moPrpn 129Met-HuPrP-340) Jmtorres mutant strain MGI:5803821 Tg(Prnp-PRNP)340Jmto transgene insertion 340, Juan Maria Torres MGI:5803814 Tg(Prnp-PRNP)340Jmto transgene insertion 340, Juan Maria Torres https://www.infrafrontier.eu/search?keyword=EM:09644 + EM:05415 STOCK Prnp Tg(Prnp-PRNP)110Jmto/Cnbc EMMA embryo STOCK Prnp Tg(moPrpn BoPrP)110Jmto/Cnbc, Prpn tm2Edin tg(moPrpn BoPrP)110 Jmto mutant strain MGI:2387688 Prnp targeted mutation 2, Edinburgh University MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:05415 + EM:05415 STOCK Prnp Tg(Prnp-PRNP)110Jmto/Cnbc EMMA embryo STOCK Prnp Tg(moPrpn BoPrP)110Jmto/Cnbc, Prpn tm2Edin tg(moPrpn BoPrP)110 Jmto mutant strain MGI:5476799 Tg(Prnp-PRNP)110Jmto transgene insertion 110, Juan Maria Torres MGI:5476796 Tg(Prnp-PRNP)110Jmto transgene insertion 110, Juan Maria Torres https://www.infrafrontier.eu/search?keyword=EM:05415 + EM:05416 STOCK Prnp Tg(Prnp-PRNP)001Jmto/Cnbc EMMA embryo tg(moPrpn PoPrP)001 Jmto, STOCK Prnp Tg(moPrpn PoPrP)001Jmto/Cnb mutant strain MGI:2387688 Prnp targeted mutation 2, Edinburgh University MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:05416 + EM:05416 STOCK Prnp Tg(Prnp-PRNP)001Jmto/Cnbc EMMA embryo tg(moPrpn PoPrP)001 Jmto, STOCK Prnp Tg(moPrpn PoPrP)001Jmto/Cnb mutant strain MGI:5476823 Tg(Prnp-PRNP)001Jmto transgene insertion 001, Juan Maria Torres MGI:5476816 Tg(Prnp-PRNP)001Jmto transgene insertion 001, Juan Maria Torres https://www.infrafrontier.eu/search?keyword=EM:05416 + EM:04338 STOCK Prnp Tg(Prnp/PRNP*ARR)FM16Pcg/H EMMA embryo mutant strain MGI:5779528 Tg(Prnp/PRNP*ARR)FM16Pcg transgene insertion FM16, Peter Griffiths MGI:5779527 Tg(Prnp/PRNP*ARR)FM16Pcg transgene insertion FM16, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:04338 + EM:04338 STOCK Prnp Tg(Prnp/PRNP*ARR)FM16Pcg/H EMMA embryo mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:04338 + EM:02421 STOCK Prnp Tg(Prnp/PRNP)1Drb/H EMMA embryo mutant strain MGI:5762584 Tg(Prnp/PRNP)1Drb transgene insertion 1, David R Brown MGI:5762582 Tg(Prnp/PRNP)1Drb transgene insertion 1, David R Brown https://www.infrafrontier.eu/search?keyword=EM:02421 + EM:02421 STOCK Prnp Tg(Prnp/PRNP)1Drb/H EMMA embryo mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:02421 + EM:02539 STOCK Prnp Tg(Prnp-PRNP*6OR)K6M16Pcg/H EMMA embryo mutant strain MGI:5775417 Tg(Prnp-PRNP*6OR)K6M16Pcg transgene insertion K6M16, Peter Griffiths MGI:5775416 Tg(Prnp-PRNP*6OR)K6M16Pcg transgene insertion K6M16, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:02539 + EM:02539 STOCK Prnp Tg(Prnp-PRNP*6OR)K6M16Pcg/H EMMA embryo mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:02539 + EM:06144 STOCK Prnp Tg(Prnp*D177N*M128V)G1Rchi/Cnrm EMMA embryo Tg(CJD-G1)/Prnp0/0 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:06144 + EM:06144 STOCK Prnp Tg(Prnp*D177N*M128V)G1Rchi/Cnrm EMMA embryo Tg(CJD-G1)/Prnp0/0 mutant strain MGI:5614760 Tg(Prnp*D177N*M128V)G1Rchi transgene insertion G1, Roberto Chiesa MGI:5614759 Tg(Prnp*D177N*M128V)G1Rchi transgene insertion G1, Roberto Chiesa https://www.infrafrontier.eu/search?keyword=EM:06144 + EM:06144 STOCK Prnp Tg(Prnp*D177N*M128V)G1Rchi/Cnrm EMMA sperm Tg(CJD-G1)/Prnp0/0 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:06144 + EM:06144 STOCK Prnp Tg(Prnp*D177N*M128V)G1Rchi/Cnrm EMMA sperm Tg(CJD-G1)/Prnp0/0 mutant strain MGI:5614760 Tg(Prnp*D177N*M128V)G1Rchi transgene insertion G1, Roberto Chiesa MGI:5614759 Tg(Prnp*D177N*M128V)G1Rchi transgene insertion G1, Roberto Chiesa https://www.infrafrontier.eu/search?keyword=EM:06144 + EM:06142 STOCK Prnp Tg(Prnp*)CDah/Cnrm EMMA embryo STOCK Prnp Tg(Prnp-PG14)1Dah/Cnrm, Tg(PG14-C)/Prnp0/0, STOCK Prnp Tg(Prnp-PG14)CDah/Cnrm mutant strain MGI:5563233 Tg(Prnp*)CDah transgene insertion C, David A Harris MGI:5563232 Tg(Prnp*)CDah transgene insertion C, David A Harris https://www.infrafrontier.eu/search?keyword=EM:06142 + EM:06142 STOCK Prnp Tg(Prnp*)CDah/Cnrm EMMA embryo STOCK Prnp Tg(Prnp-PG14)1Dah/Cnrm, Tg(PG14-C)/Prnp0/0, STOCK Prnp Tg(Prnp-PG14)CDah/Cnrm mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:06142 + EM:06141 STOCK Prnp Tg(Prnp)E1Rchi/Cnrm EMMA embryo Tg(WT-E1)/Prnp0/0 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:06141 + EM:06141 STOCK Prnp Tg(Prnp)E1Rchi/Cnrm EMMA embryo Tg(WT-E1)/Prnp0/0 mutant strain MGI:5563239 Tg(Prnp)E1Rchi transgene insertion E1, Roberto Chiesa MGI:5563236 Tg(Prnp)E1Rchi transgene insertion E1, Roberto Chiesa https://www.infrafrontier.eu/search?keyword=EM:06141 + EM:06141 STOCK Prnp Tg(Prnp)E1Rchi/Cnrm EMMA sperm Tg(WT-E1)/Prnp0/0 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:06141 + EM:06141 STOCK Prnp Tg(Prnp)E1Rchi/Cnrm EMMA sperm Tg(WT-E1)/Prnp0/0 mutant strain MGI:5563239 Tg(Prnp)E1Rchi transgene insertion E1, Roberto Chiesa MGI:5563236 Tg(Prnp)E1Rchi transgene insertion E1, Roberto Chiesa https://www.infrafrontier.eu/search?keyword=EM:06141 + EM:02028 STOCK Prnp Tg(Prnp)941Zbz/Cnrm EMMA embryo PrPmyc, B6,129Sv-Tg941(myc),PrnpZH1/zH1, B6;129/Sv-Tg941(myc),PrnpZH1/zH1, Tg941 PrPmyc mutant strain MGI:5318499 Tg(Prnp)941Zbz transgene insertion 941, University Hospital Zurich MGI:5318498 Tg(Prnp)941Zbz transgene insertion 941, University Hospital Zurich https://www.infrafrontier.eu/search?keyword=EM:02028 + EM:02028 STOCK Prnp Tg(Prnp)941Zbz/Cnrm EMMA embryo PrPmyc, B6,129Sv-Tg941(myc),PrnpZH1/zH1, B6;129/Sv-Tg941(myc),PrnpZH1/zH1, Tg941 PrPmyc mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:02028 + EM:02027 STOCK Prnp Tg(Prnp)940Zbz/Cnrm EMMA embryo PrPmyc, B6,129Sv-Tg940(myc),PrnpZH1/zH1, Tg940 PrPmyc mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:02027 + EM:02027 STOCK Prnp Tg(Prnp)940Zbz/Cnrm EMMA embryo PrPmyc, B6,129Sv-Tg940(myc),PrnpZH1/zH1, Tg940 PrPmyc mutant strain MGI:5318492 Tg(Prnp)940Zbz transgene insertion 940, University Hospital Zurich MGI:5318491 Tg(Prnp)940Zbz transgene insertion 940, University Hospital Zurich https://www.infrafrontier.eu/search?keyword=EM:02027 + EM:01828 STOCK Prnp Tg(Pcp2-Prnp)F332Zbz/Cnrm EMMA embryo Prnp-Tg(PrPdelta134)332Zbz, B6.Cg-Prnp Tg(L7-Prnp)F332/Cnrm, F332 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:01828 + EM:01828 STOCK Prnp Tg(Pcp2-Prnp)F332Zbz/Cnrm EMMA embryo Prnp-Tg(PrPdelta134)332Zbz, B6.Cg-Prnp Tg(L7-Prnp)F332/Cnrm, F332 mutant strain MGI:5014403 Tg(Pcp2-Prnp)F332Zbz transgene insertion F332, Zurich MGI:5014394 Tg(Pcp2-Prnp)F332Zbz transgene insertion F332, Zurich https://www.infrafrontier.eu/search?keyword=EM:01828 + EM:01836 STOCK Prnp Tg(Pcp2-Prnp)F13Zbz/Cnrm EMMA embryo TgF13/Prnp, F13, B6.Cg-Prnp Tg(L7-Prnp)F13/Cnrm mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:01836 + EM:01836 STOCK Prnp Tg(Pcp2-Prnp)F13Zbz/Cnrm EMMA embryo TgF13/Prnp, F13, B6.Cg-Prnp Tg(L7-Prnp)F13/Cnrm mutant strain MGI:5014380 Tg(Pcp2-Prnp)F13Zbz transgene insertion F13, Zurich MGI:5014378 Tg(Pcp2-Prnp)F13Zbz transgene insertion F13, Zurich https://www.infrafrontier.eu/search?keyword=EM:01836 + EM:01824 STOCK Prnp Tg(Pcp2-Prnp)E330Zbz/Cnrm EMMA embryo B6.Cg-Prnp Tg(L7-Prnp)E330, E330 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:01824 + EM:01824 STOCK Prnp Tg(Pcp2-Prnp)E330Zbz/Cnrm EMMA embryo B6.Cg-Prnp Tg(L7-Prnp)E330, E330 mutant strain MGI:5014494 Tg(Pcp2-Prnp)E330Zbz transgene insertion E330, Zurich MGI:5014493 Tg(Pcp2-Prnp)E330Zbz transgene insertion E330, Zurich https://www.infrafrontier.eu/search?keyword=EM:01824 + EM:01837 STOCK Prnp Tg(Eno2-Prnp)#Aag/Cnrm EMMA embryo NSE-PrP, STOCK-Prnp Tg(Eno-Prnp)/Cnrm, NSE-PrP Prnp, B6,129-TgN[NSE]Prnp ZH1/ZH1 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:01837 + EM:01837 STOCK Prnp Tg(Eno2-Prnp)#Aag/Cnrm EMMA embryo NSE-PrP, STOCK-Prnp Tg(Eno-Prnp)/Cnrm, NSE-PrP Prnp, B6,129-TgN[NSE]Prnp ZH1/ZH1 mutant strain MGI:5013941 Tg(Eno2-Prnp)#Aag transgene insertion, Adriano Aguzzi MGI:5013940 Tg(Eno2-Prnp)#Aag transgene insertion, Adriano Aguzzi https://www.infrafrontier.eu/search?keyword=EM:01837 + EM:08437 STOCK Prdm6/Biat EMMA sperm B6.129Ola-Prdm6 tm1Gew mutant strain MGI:5576799 Prdm6 targeted mutation 1.1, Jurgen Ruland MGI:2684938 Prdm6 PR domain containing 6 https://www.infrafrontier.eu/search?keyword=EM:08437 + EM:06222 STOCK Pmel/Kctt EMMA embryo Pmel KO, B6;129-Pmel/Kctt mutant strain MGI:5294792 Pmel targeted mutation 1.1, Leif Andersson MGI:98301 Pmel premelanosome protein https://www.infrafrontier.eu/search?keyword=EM:06222 + EM:09990 STOCK Plekhg3/IcsOrl EMMA sperm E238-HEPD0530_4_D07, HEPD0530_4_D07 mutant strain MGI:4435115 Plekhg3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2388284 Plekhg3 pleckstrin homology domain containing, family G (with RhoGef domain) member 3 https://www.infrafrontier.eu/search?keyword=EM:09990 + EM:01947 STOCK Pk27053/Ieg EMMA sperm PK27506 mutant strain MGI:5752521 Pk27053 pyruvate kinase activity mutant 27053 MGI:5752518 Pk27053 pyruvate kinase activity mutant 27053 https://www.infrafrontier.eu/search?keyword=EM:01947 + EM:05454 STOCK Piwil4/Cnrm EMMA embryo Miwi2 null mutant strain MGI:5320638 Piwil4 targeted mutation 2.1, Donal O'Carroll MGI:3041167 Piwil4 piwi-like RNA-mediated gene silencing 4 https://www.infrafrontier.eu/search?keyword=EM:05454 - EM:05884 STOCK Pitpnm1/WtsiIeg EMMA archived mutant strain MGI:4431584 Pitpnm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1197524 Pitpnm1 phosphatidylinositol transfer protein, membrane-associated 1 https://www.infrafrontier.eu/search?keyword=EM:05884 - EM:12014 STOCK Pik3r2/Wtsi EMMA embryo mutant strain MGI:4363631 Pik3r2 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1098772 Pik3r2 phosphoinositide-3-kinase regulatory subunit 2 https://www.infrafrontier.eu/search?keyword=EM:12014 - EM:12014 STOCK Pik3r2/Wtsi EMMA sperm mutant strain MGI:4363631 Pik3r2 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1098772 Pik3r2 phosphoinositide-3-kinase regulatory subunit 2 https://www.infrafrontier.eu/search?keyword=EM:12014 - EM:05431 STOCK Pik3cg/WtsiOulu EMMA embryo mutant strain MGI:4432229 Pik3cg targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353576 Pik3cg phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit gamma https://www.infrafrontier.eu/search?keyword=EM:05431 - EM:05431 STOCK Pik3cg/WtsiOulu EMMA sperm mutant strain MGI:4432229 Pik3cg targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353576 Pik3cg phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit gamma https://www.infrafrontier.eu/search?keyword=EM:05431 + EM:09618 STOCK Pik3ap1/CipheOrl EMMA sperm EPD0393_2_G04 mutant strain MGI:4419954 Pik3ap1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933177 Pik3ap1 phosphoinositide-3-kinase adaptor protein 1 https://www.infrafrontier.eu/search?keyword=EM:09618 + EM:07453 STOCK Phox2b/Orl EMMA sperm Phox2b27Alacki mutant strain MGI:4418298 Phox2b targeted mutation 4, Jean-Francois Brunet MGI:1100882 Phox2b paired-like homeobox 2b https://www.infrafrontier.eu/search?keyword=EM:07453 - EM:11098 STOCK Phox2b/H EMMA sperm mutant strain MGI:4418265 Phox2b targeted mutation 3.1, Jean-Francois Brunet MGI:1100882 Phox2b paired-like homeobox 2b https://www.infrafrontier.eu/search?keyword=EM:11098 + EM:04758 STOCK Phox2a/Orl EMMA embryo Phox2alox, B6D2.129S2-Phox2a/Orl mutant strain MGI:4438118 Phox2a targeted mutation 2.1, Jean-Francois Brunet MGI:106633 Phox2a paired-like homeobox 2a https://www.infrafrontier.eu/search?keyword=EM:04758 + EM:11939 STOCK Phf10/Ieg EMMA sperm mutant strain MGI:5497157 Phf10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1919307 Phf10 PHD finger protein 10 https://www.infrafrontier.eu/search?keyword=EM:11939 + EM:09987 STOCK Pgd/IcsOrl EMMA sperm EPD0117_4_C03, ICS-EPD0117_4_C03-1 mutant strain MGI:4431737 Pgd targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97553 Pgd phosphogluconate dehydrogenase https://www.infrafrontier.eu/search?keyword=EM:09987 + EM:00142 STOCK Pde6b/H EMMA embryo GENA309, Pde6b, C3H.B6(Cg)-Pde6b/H, C3.Cg-Pde6b/H, C3H.C-Pde6b/H, C3H;C-Pde6b/H mutant strain MGI:2178315 Pde6b atypical retinal degeneration 2 MGI:97525 Pde6b phosphodiesterase 6B, cGMP, rod receptor, beta polypeptide https://www.infrafrontier.eu/search?keyword=EM:00142 + EM:00142 STOCK Pde6b/H EMMA sperm GENA309, Pde6b, C3H.B6(Cg)-Pde6b/H, C3.Cg-Pde6b/H, C3H.C-Pde6b/H, C3H;C-Pde6b/H mutant strain MGI:2178315 Pde6b atypical retinal degeneration 2 MGI:97525 Pde6b phosphodiesterase 6B, cGMP, rod receptor, beta polypeptide https://www.infrafrontier.eu/search?keyword=EM:00142 + EM:09998 STOCK Pcsk1/IcsOrl EMMA sperm EPD0508_1_C08, E253-EPD0508_1_C08 mutant strain MGI:4441678 Pcsk1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97511 Pcsk1 proprotein convertase subtilisin/kexin type 1 https://www.infrafrontier.eu/search?keyword=EM:09998 + EM:11042 STOCK Pcp4l1/Ph EMMA sperm EPD0479_1_F05 mutant strain MGI:4431464 Pcp4l1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913675 Pcp4l1 Purkinje cell protein 4-like 1 https://www.infrafrontier.eu/search?keyword=EM:11042 + EM:11110 STOCK Pcdh10/H EMMA sperm mutant strain MGI:6473471 Pcdh10 targeted mutation 1a, National Laboratory Animal Center MGI:2444165 Pcdh10 protocadherin 10 https://www.infrafrontier.eu/search?keyword=EM:11110 + EM:09446 STOCK Pax7 Mapk14/JpellH EMMA sperm STOCK Mapk14 Pax7/JpellH mutant strain MGI:3715522 Mapk14 targeted mutation 14, Angel R Nebreda MGI:1346865 Mapk14 mitogen-activated protein kinase 14 https://www.infrafrontier.eu/search?keyword=EM:09446 + EM:09446 STOCK Pax7 Mapk14/JpellH EMMA sperm STOCK Mapk14 Pax7/JpellH mutant strain MGI:3497712 Pax7 targeted mutation 1, Mario R Capecchi MGI:97491 Pax7 paired box 7 https://www.infrafrontier.eu/search?keyword=EM:09446 + EM:00998 STOCK Pax6/Cnrm EMMA embryo B6;Cg-Pax6/Ibcm, RLA (Retinal enhancer-LAcZ), STOCK Pax6/Ibcm mutant strain MGI:1934347 Pax6 targeted mutation 1, Peter Gruss MGI:97490 Pax6 paired box 6 https://www.infrafrontier.eu/search?keyword=EM:00998 + EM:09958 STOCK Pax4/IcsOrl EMMA sperm HEPD0670_7_A04 mutant strain MGI:4841624 Pax4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97488 Pax4 paired box 4 https://www.infrafrontier.eu/search?keyword=EM:09958 - EM:05830 STOCK Pax3/Orl EMMA embryo mutant strain MGI:6358026 Pax3 targeted mutation 1.1, INSERM MGI:97487 Pax3 paired box 3 https://www.infrafrontier.eu/search?keyword=EM:05830 + EM:01942 STOCK Pax2/H EMMA embryo GENA380, C3H;C-Pax2/H, Opdc(GENA380), C3H;C-Opdc/H, STOCK Opdc/H mutant stock MGI:1934620 Pax2 optic disc coloboma MGI:97486 Pax2 paired box 2 https://www.infrafrontier.eu/search?keyword=EM:01942 + EM:06218 STOCK Pawr/Cnbc EMMA embryo CD1;129-Pawr/Cnbc mutant strain MGI:2678021 Pawr targeted mutation 1, Jorge Moscat MGI:2149961 Pawr PRKC, apoptosis, WT1, regulator https://www.infrafrontier.eu/search?keyword=EM:06218 + EM:10037 STOCK Parp1/IcsOrl EMMA sperm G4786, HEPD0555_6_C04 mutant strain MGI:4435467 Parp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1340806 Parp1 poly (ADP-ribose) polymerase family, member 1 https://www.infrafrontier.eu/search?keyword=EM:10037 + EM:11256 STOCK Pafah1b1/Ics EMMA sperm G4878b, HEPD0602_6_E12 mutant strain MGI:6117756 Pafah1b1 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:109520 Pafah1b1 platelet-activating factor acetylhydrolase, isoform 1b, subunit 1 https://www.infrafrontier.eu/search?keyword=EM:11256 - EM:05645 STOCK Otx2/Cnrm EMMA embryo STOCK Otx2/Cnrm mutant strain Otx2 Otx2 MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05645 - EM:05643 STOCK Otx2/Cnrm EMMA embryo STOCK Otx2/Cnrm mutant strain Otx2 Otx2 MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05643 - EM:05644 STOCK Otx2/Cnrm EMMA embryo STOCK Otx2/2Cnrm mutant strain Otx2 Otx2 MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05644 - EM:05642 STOCK Otx2/Cnrm EMMA embryo mutant strain Otx2 Otx2 MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05642 + EM:05628 STOCK Otx2/Cnrm EMMA embryo Otx2delta3SS mutant strain MGI:4365828 Otx2 targeted mutation 9, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05628 + EM:05626 STOCK Otx2/Cnrm EMMA embryo Otx2-Flox mutant strain MGI:2661065 Otx2 targeted mutation 6, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05626 + EM:05633 STOCK Otx2/Cnrm EMMA embryo Otx2FL-Otd mutant strain MGI:2157779 Otx2 targeted mutation 4, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05633 + EM:05632 STOCK Otx2/Cnrm EMMA embryo Otx2-Otd mutant strain MGI:2157778 Otx2 targeted mutation 3, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05632 + EM:05630 STOCK Otx2/Cnrm EMMA embryo Otx2-lambda mutant strain MGI:2150146 Otx2 targeted mutation 2, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05630 + EM:05623 STOCK Otx2/Cnrm EMMA embryo Otx2-Lacz mutant strain MGI:1857510 Otx2 targeted mutation 1, Institut Pasteur MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05623 + EM:05647 STOCK Otx2/Cnrm EMMA embryo mutant strain MGI:6468504 Otx2 targeted mutation 14, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05647 + EM:05647 STOCK Otx2/Cnrm EMMA sperm mutant strain MGI:6468504 Otx2 targeted mutation 14, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05647 + EM:05646 STOCK Otx2/Cnrm EMMA embryo mutant strain MGI:6468502 Otx2 targeted mutation 13, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05646 + EM:05646 STOCK Otx2/Cnrm EMMA sperm mutant strain MGI:6468502 Otx2 targeted mutation 13, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05646 + EM:05641 STOCK Otx2/Cnrm EMMA embryo STOCK Otx2/Cnrm, Otx2 RK-AA mutant strain MGI:5573195 Otx2 targeted mutation 12.1, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05641 + EM:05624 STOCK Otx2/Cnrm EMMA embryo Otx2-GFP mutant strain MGI:4365830 Otx2 targeted mutation 11, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05624 + EM:05629 STOCK Otx2/Cnrm EMMA embryo Otx2-deltaCD mutant strain MGI:4365829 Otx2 targeted mutation 10, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05629 + EM:05640 STOCK Otx2/Cnrm EMMA embryo Otx2-CreER mutant strain MGI:5473314 Otx2 targeted mutation 1.1, Magdalena Goetz MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05640 + EM:05640 STOCK Otx2/Cnrm EMMA sperm Otx2-CreER mutant strain MGI:5473314 Otx2 targeted mutation 1.1, Magdalena Goetz MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05640 + EM:05631 STOCK Otx2/Cnrm EMMA embryo Otx2-hOtx1 mutant strain MGI:2153202 Otx2 targeted mutation 1, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05631 + EM:05639 STOCK Otx1/Cnrm EMMA embryo mutant strain Otx1/Cnrm EMMA embryo mutant strain MGI:6468490 Otx1 targeted mutation 5, Antonio Simeone MGI:97450 Otx1 orthodenticle homeobox 1 https://www.infrafrontier.eu/search?keyword=EM:05638 + EM:05622 STOCK Otx1/Cnrm EMMA embryo Otx1-Cre mutant strain MGI:2661060 Otx1 targeted mutation 4, Antonio Simeone MGI:97450 Otx1 orthodenticle homeobox 1 https://www.infrafrontier.eu/search?keyword=EM:05622 + EM:05621 STOCK Otx1/Cnrm EMMA embryo mutant strain MGI:2153199 Otx1 targeted mutation 2, Antonio Simeone MGI:97450 Otx1 orthodenticle homeobox 1 https://www.infrafrontier.eu/search?keyword=EM:05621 + EM:05620 STOCK Otx1/Cnrm EMMA embryo Otx1-LacZ mutant strain MGI:2136272 Otx1 targeted mutation 1, Antonio Simeone MGI:97450 Otx1 orthodenticle homeobox 1 https://www.infrafrontier.eu/search?keyword=EM:05620 + EM:05636 STOCK Otp/Cnrm EMMA embryo Otp-LacZ mutant strain MGI:2180541 Otp targeted mutation 1, Antonio Simeone MGI:99835 Otp orthopedia homeobox https://www.infrafrontier.eu/search?keyword=EM:05636 + EM:00187 STOCK Ostes/H EMMA embryo Ost, T667, trembly, C3H101H-Ostes/H mutant strain MGI:3689329 Ostes ostes MGI:3688249 Ostes ostes https://www.infrafrontier.eu/search?keyword=EM:00187 + EM:00187 STOCK Ostes/H EMMA sperm Ost, T667, trembly, C3H101H-Ostes/H mutant strain MGI:3689329 Ostes ostes MGI:3688249 Ostes ostes https://www.infrafrontier.eu/search?keyword=EM:00187 + EM:09373 STOCK Nub1/Ph EMMA archived HEPD0664_6_C08 mutant strain MGI:4841553 Nub1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1889001 Nub1 negative regulator of ubiquitin-like proteins 1 https://www.infrafrontier.eu/search?keyword=EM:09373 - EM:07818 STOCK Ntf5/IcsOrl EMMA sperm mutant strain MGI:4436129 Ntf5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97381 Ntf5 neurotrophin 5 https://www.infrafrontier.eu/search?keyword=EM:07818 + EM:10414 STOCK Noto/Kctt EMMA sperm mutant strain MGI:5317920 Noto targeted mutation 2.1, Achim Gossler MGI:3053002 Noto notochord homeobox https://www.infrafrontier.eu/search?keyword=EM:10414 + EM:10371 STOCK Noto/Kctt EMMA sperm mutant strain MGI:3053092 Noto targeted mutation 1, Achim Gossler MGI:3053002 Noto notochord homeobox https://www.infrafrontier.eu/search?keyword=EM:10371 + EM:06271 STOCK Nfkbia Tg(KRT14-cre)1Cgn/Ieg EMMA embryo K14cre Ikba mutant strain MGI:3577709 Nfkbia targeted mutation 1, Klaus Pfeffer MGI:104741 Nfkbia nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, alpha https://www.infrafrontier.eu/search?keyword=EM:06271 + EM:06271 STOCK Nfkbia Tg(KRT14-cre)1Cgn/Ieg EMMA embryo K14cre Ikba mutant strain MGI:2652655 Tg(KRT14-cre)1Cgn transgene insertion 1, University of Cologne MGI:2652653 Tg(KRT14-cre)1Cgn transgene insertion 1, University of Cologne https://www.infrafrontier.eu/search?keyword=EM:06271 - EM:07146 STOCK Nebl/Cnrm EMMA embryo STOCK Neb/Cnrm, Nebulette knockout mouse mutant strain Nebl targeted mutation 1, Ju Chen MGI:1921353 Nebl nebulette https://www.infrafrontier.eu/search?keyword=EM:07146 - EM:07146 STOCK Nebl/Cnrm EMMA sperm STOCK Neb/Cnrm, Nebulette knockout mouse mutant strain Nebl targeted mutation 1, Ju Chen MGI:1921353 Nebl nebulette https://www.infrafrontier.eu/search?keyword=EM:07146 + EM:07147 STOCK Neb/Cnrm EMMA embryo mutant strain MGI:5618471 Neb targeted mutation 2.1, Ju Chen MGI:97292 Neb nebulin https://www.infrafrontier.eu/search?keyword=EM:07147 + EM:07147 STOCK Neb/Cnrm EMMA sperm mutant strain MGI:5618471 Neb targeted mutation 2.1, Ju Chen MGI:97292 Neb nebulin https://www.infrafrontier.eu/search?keyword=EM:07147 - EM:07145 STOCK Neb/Cnrm EMMA archived STOCK Nebl/Cnrm, Nebulette knockout mouse mutant strain MGI:3664092 Neb targeted mutation 1, Ju Chen MGI:97292 Neb nebulin https://www.infrafrontier.eu/search?keyword=EM:07145 - EM:11120 STOCK Nanog/Cnrm EMMA embryo mutant strain Nanog Nanog MGI:1919200 Nanog Nanog homeobox https://www.infrafrontier.eu/search?keyword=EM:11120 - EM:11120 STOCK Nanog/Cnrm EMMA sperm mutant strain Nanog Nanog MGI:1919200 Nanog Nanog homeobox https://www.infrafrontier.eu/search?keyword=EM:11120 + EM:05011 STOCK Myo7a/WtsiCnbc EMMA embryo Shaker1 mutant strain MGI:1856716 Myo7a shaker 1 MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:05011 + EM:05020 STOCK Myo7a/WtsiH EMMA embryo Moonwalker, Sanger Moonwalker mutant strain MGI:1860092 Myo7a shaker 1, 6 Jackson MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:05020 + EM:00428 STOCK Myo7a<816SB>/NihrH EMMA sperm Myo7a, Myo7a, CBBS-Myo7a<816SB>/NihrH mutant strain MGI:2155423 Myo7a<816SB> shaker 816SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:00428 + EM:04897 STOCK Myo7a<4626SB>/WtsiCnbc EMMA embryo Myo7a<4626SB> mutant strain MGI:2155422 Myo7a<4626SB> shaker 4626SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:04897 + EM:00442 STOCK Myo7a<4626SB>/NihrH EMMA embryo CBBS-Myo7a<4626SB>/NihrH, Myo7a, Myo7a mutant strain MGI:2155422 Myo7a<4626SB> shaker 4626SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:00442 + EM:00442 STOCK Myo7a<4626SB>/NihrH EMMA sperm CBBS-Myo7a<4626SB>/NihrH, Myo7a, Myo7a mutant strain MGI:2155422 Myo7a<4626SB> shaker 4626SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:00442 + EM:00436 STOCK Myo7a<4494SB>/NihrH EMMA sperm CBBS-Myo7a<4494SB>/NihrH, Myo7a, Myo7a mutant strain MGI:2155421 Myo7a<4494SB> shaker 4494SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:00436 + EM:00427 STOCK Myo7a<3336SB>/NihrH EMMA sperm CBBS-Myo7a<3336SB>/H, Myo7a, Myo7a<3336SB>/NihrH mutant strain MGI:2155420 Myo7a<3336SB> shaker 3336SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:00427 + EM:00441 STOCK Myo7a<26SB>/NihrH EMMA sperm Myo7a, Myo7a, CBBS-Myo7a<26SB>/NihrH mutant strain MGI:2155417 Myo7a<26SB> shaker 26SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:00441 - EM:10988 STOCK Myh7b/WtsiPh EMMA sperm mutant strain MGI:5013737 Myh7b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3710243 Myh7b myosin, heavy chain 7B, cardiac muscle, beta https://www.infrafrontier.eu/search?keyword=EM:10988 - EM:05672 STOCK Mx1/WtsiH EMMA sperm mutant strain MGI:4431734 Mx1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97243 Mx1 MX dynamin-like GTPase 1 https://www.infrafrontier.eu/search?keyword=EM:05672 + EM:01952 STOCK Mut921/H EMMA embryo MUT/921, MUT921 mutant strain MGI:5430732 Mut921 Mut921 MGI:5430735 Mut921 Mut921 https://www.infrafrontier.eu/search?keyword=EM:01952 + EM:01951 STOCK Mut1602/H EMMA embryo MUT1602, MUT/1602 mutant strain MGI:5470123 Mut1602 Mut1602 MGI:5470121 Mut1602 Mut1602 https://www.infrafrontier.eu/search?keyword=EM:01951 + EM:01954 STOCK Mut1544/H EMMA embryo MUT1544, MUT/1544 mutant strain MGI:5442354 Mut1544 Mut1544 MGI:5442350 Mut1544 Mut1544 https://www.infrafrontier.eu/search?keyword=EM:01954 + EM:01977 STOCK Mut1488/H EMMA embryo MUT/1488, MUT1488 mutant strain MGI:5470112 Mut1488 Mut1488 MGI:5470110 Mut1488 Mut1488 https://www.infrafrontier.eu/search?keyword=EM:01977 + EM:01976 STOCK Mut1397/H EMMA embryo MUT/1397, MUT1397 mutant strain MGI:5428963 Mut1397 Mut1397 MGI:5428961 Mut1397 Mut1397 https://www.infrafrontier.eu/search?keyword=EM:01976 + EM:01948 STOCK Mut1305/H EMMA embryo MUT1305, MUT/1305 mutant strain MGI:5429756 Mut1305 Mut1305 MGI:5429751 Mut1305 Mut1305 https://www.infrafrontier.eu/search?keyword=EM:01948 + EM:01950 STOCK Mut1293/H EMMA embryo MUT1293, MUT/1293 mutant strain MGI:5427423 Mut1293 Mut1293 MGI:5427421 Mut1293 Mut1293 https://www.infrafrontier.eu/search?keyword=EM:01950 + EM:01949 STOCK Mut1264/H EMMA embryo MUT/1264, MUT1264 mutant strain MGI:5427414 Mut1264 Mut1264 MGI:5427412 Mut1264 Mut1264 https://www.infrafrontier.eu/search?keyword=EM:01949 + EM:01953 STOCK Mut1154/H EMMA embryo MUT/1154, MUT1154 mutant strain MGI:5427409 Mut1154 Mut1154 MGI:5427407 Mut1154 Mut1154 https://www.infrafrontier.eu/search?keyword=EM:01953 + EM:12155 STOCK Mta3/Wtsi EMMA embryo mutant strain MGI:4419906 Mta3 targeted mutation 3a, Wellcome Trust Sanger Institute MGI:2151172 Mta3 metastasis associated 3 https://www.infrafrontier.eu/search?keyword=EM:12155 - EM:12067 STOCK Mst1/Wtsi EMMA embryo mutant strain MGI:4431447 Mst1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:96080 Mst1 macrophage stimulating 1 (hepatocyte growth factor-like) https://www.infrafrontier.eu/search?keyword=EM:12067 + EM:08236 STOCK Msh5/Cnrm EMMA embryo Msh5 mutant strain MGI:1858057 Msh5 targeted mutation 1, Raju Kucherlapati MGI:1329021 Msh5 mutS homolog 5 https://www.infrafrontier.eu/search?keyword=EM:08236 + EM:08236 STOCK Msh5/Cnrm EMMA sperm Msh5 mutant strain MGI:1858057 Msh5 targeted mutation 1, Raju Kucherlapati MGI:1329021 Msh5 mutS homolog 5 https://www.infrafrontier.eu/search?keyword=EM:08236 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:2180883 Tcra targeted mutation 1, Michael J Owen MGI:98553 Tcra T cell receptor alpha chain https://www.infrafrontier.eu/search?keyword=EM:04509 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:1857253 Tap1 targeted mutation 1, Philip Ashton-Rickardt MGI:98483 Tap1 transporter 1, ATP-binding cassette, sub-family B (MDR/TAP) https://www.infrafrontier.eu/search?keyword=EM:04509 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:1927205 Cd74 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:96534 Cd74 CD74 antigen (invariant polypeptide of major histocompatibility complex, class II antigen-associated) https://www.infrafrontier.eu/search?keyword=EM:04509 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:3664578 Mr1 targeted mutation 1, Susan Gilfillan MGI:1195463 Mr1 major histocompatibility complex, class I-related https://www.infrafrontier.eu/search?keyword=EM:04509 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:5829578 Tg(Tcrb-V6)#Lantz transgene insertion, Olivier Lantz MGI:5829577 Tg(Tcrb-V6)#Lantz transgene insertion, Olivier Lantz https://www.infrafrontier.eu/search?keyword=EM:04509 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:5829575 Tg(Tcra-V19-J33)#Lantz transgene insertion, Olivier Lantz MGI:5829571 Tg(Tcra-V19-J33)#Lantz transgene insertion, Olivier Lantz https://www.infrafrontier.eu/search?keyword=EM:04509 + EM:09986 STOCK Mok/IcsOrl EMMA sperm HEPD0530_7_A11 mutant strain MGI:4841489 Mok targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1336881 Mok MOK protein kinase https://www.infrafrontier.eu/search?keyword=EM:09986 + EM:08367 STOCK Mog/Flmg EMMA sperm B6-Mog/Flmg mutant strain MGI:3689957 Mog targeted mutation 1, George Kollias MGI:97435 Mog myelin oligodendrocyte glycoprotein https://www.infrafrontier.eu/search?keyword=EM:08367 + EM:09960 STOCK Mmp9/IcsOrl EMMA sperm mutant strain MGI:5286404 Mmp9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97011 Mmp9 matrix metallopeptidase 9 https://www.infrafrontier.eu/search?keyword=EM:09960 + EM:05667 STOCK Mlana/Cnbc EMMA sperm Mlana mutant strain MGI:5476663 Mlana targeted mutation 1.2, Friedrich Beermann MGI:108454 Mlana melan-A https://www.infrafrontier.eu/search?keyword=EM:05667 + EM:05333 STOCK Mlana/Cnbc EMMA sperm Mlana, B6;129-Mlana/Cnbc mutant strain MGI:5476658 Mlana targeted mutation 1.1, Friedrich Beermann MGI:108454 Mlana melan-A https://www.infrafrontier.eu/search?keyword=EM:05333 + EM:10361 STOCK Mkrn1/Biat EMMA sperm mutant strain MGI:5430125 Mkrn1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1859353 Mkrn1 makorin, ring finger protein, 1 https://www.infrafrontier.eu/search?keyword=EM:10361 + EM:00439 STOCK Mitf/H EMMA embryo Mitf, GENA336, C3H;C-Mitf/H, Rorp mutant strain MGI:2178357 Mitf retinal orange patches MGI:104554 Mitf melanogenesis associated transcription factor https://www.infrafrontier.eu/search?keyword=EM:00439 + EM:00439 STOCK Mitf/H EMMA sperm Mitf, GENA336, C3H;C-Mitf/H, Rorp mutant strain MGI:2178357 Mitf retinal orange patches MGI:104554 Mitf melanogenesis associated transcription factor https://www.infrafrontier.eu/search?keyword=EM:00439 + EM:05330 STOCK Mir451a/Cnrm EMMA embryo STOCK Mir451/Cnrm mutant strain MGI:4829620 Mir451a targeted mutation 1.2, Donal O'Carroll MGI:3619412 Mir451a microRNA 451a https://www.infrafrontier.eu/search?keyword=EM:05330 + EM:05330 STOCK Mir451a/Cnrm EMMA sperm STOCK Mir451/Cnrm mutant strain MGI:4829620 Mir451a targeted mutation 1.2, Donal O'Carroll MGI:3619412 Mir451a microRNA 451a https://www.infrafrontier.eu/search?keyword=EM:05330 + EM:05328 STOCK Mir144/Mir451a/Cnrm EMMA embryo STOCK Mir144/Mir451/Cnrm mutant strain MGI:4829618 Mir144/Mir451a targeted mutation 1.2, Donal O'Carroll MGI:2676829 Mir144 microRNA 144 https://www.infrafrontier.eu/search?keyword=EM:05328 ? EM:11109 STOCK Micu1/H EMMA sperm mutant strain MGI:6473466 Micu1 targeted mutation 1a, National Laboratory Animal Center MGI:2384909 Micu1 mitochondrial calcium uptake 1 https://www.infrafrontier.eu/search?keyword=EM:11109 + EM:00262 STOCK Mgmt Tg(CRP-cre)1Iz/Cnrm EMMA embryo STOCK Tg(CRP-cre)1Iz Mgmt/Cnrm, STOCK Tg(CRP-cre)1Iz Agat, STOCK Tg(CRP-cre)1Iz Mgmt/Ibcm, floxed(mgmt)-Tg/hCRP-Cre mutant stock MGI:2652462 Mgmt targeted mutation 1, Manfred F Rajewsky MGI:96977 Mgmt O-6-methylguanine-DNA methyltransferase https://www.infrafrontier.eu/search?keyword=EM:00262 + EM:00262 STOCK Mgmt Tg(CRP-cre)1Iz/Cnrm EMMA embryo STOCK Tg(CRP-cre)1Iz Mgmt/Cnrm, STOCK Tg(CRP-cre)1Iz Agat, STOCK Tg(CRP-cre)1Iz Mgmt/Ibcm, floxed(mgmt)-Tg/hCRP-Cre mutant stock MGI:2652465 Tg(CRP-cre)1Iz transgene insertion 1, Manfred F Rajewsky MGI:2652463 Tg(CRP-cre)1Iz transgene insertion 1, Manfred F Rajewsky https://www.infrafrontier.eu/search?keyword=EM:00262 + EM:09502 STOCK Men1/Flmg EMMA embryo Men1floxed/floxed mutant strain MGI:2675250 Men1 targeted mutation 1, Zhao-Qi Wang MGI:1316736 Men1 multiple endocrine neoplasia 1 https://www.infrafrontier.eu/search?keyword=EM:09502 + EM:09755 STOCK Meis3/Cnrm EMMA sperm STOCK Meis3/Cnrm mutant strain MGI:5660020 Meis3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:108519 Meis3 Meis homeobox 3 https://www.infrafrontier.eu/search?keyword=EM:09755 - EM:04964 STOCK Med31 +/+ In(11Trp53;11Wnt3)8Brd/H EMMA sperm 129S5.Cg-Med31 +/+ In(11Trp53;11Wnt3)8Brd/H, Med31l11Jus15 mutant strain MGI:2673211 In(11Trp53;11Wnt3)8Brd inversion, Chr 11, Allan Bradley 8 MGI:2673108 In(11Trp53;11Wnt3)8Brd inversion, Chr 11, Allan Bradley 8 https://www.infrafrontier.eu/search?keyword=EM:04964 - EM:04964 STOCK Med31 +/+ In(11Trp53;11Wnt3)8Brd/H EMMA sperm 129S5.Cg-Med31 +/+ In(11Trp53;11Wnt3)8Brd/H, Med31l11Jus15 mutant strain MGI:2671886 Med31 lethal, Chr 11, Justice 15 MGI:1914529 Med31 mediator complex subunit 31 https://www.infrafrontier.eu/search?keyword=EM:04964 + EM:10029 STOCK Mbd5/Ics EMMA sperm EPD0056_1_E03 mutant strain MGI:4434485 Mbd5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2138934 Mbd5 methyl-CpG binding domain protein 5 https://www.infrafrontier.eu/search?keyword=EM:10029 ? EM:08375 STOCK Mapkapk2/Flmg EMMA sperm mutant strain MGI:6357679 Mapkapk2 targeted mutation 1.2, George Kollias MGI:109298 Mapkapk2 MAP kinase-activated protein kinase 2 https://www.infrafrontier.eu/search?keyword=EM:08375 ? EM:08374 STOCK Mapkapk2/Flmg EMMA sperm mutant strain MGI:6357678 Mapkapk2 targeted mutation 1.1, George Kollias MGI:109298 Mapkapk2 MAP kinase-activated protein kinase 2 https://www.infrafrontier.eu/search?keyword=EM:08374 + EM:08371 STOCK Map3k8/Flmg EMMA sperm B6-Map3k8tm1.2Gkl/Flmg mutant strain MGI:5476711 Map3k8 targeted mutation 1.2, George Kollias MGI:1346878 Map3k8 mitogen-activated protein kinase kinase kinase 8 https://www.infrafrontier.eu/search?keyword=EM:08371 + EM:08428 STOCK Map3k7/Flmg EMMA sperm TAK1delta/+ [B6-Map3k7tm1.2Gkl/Flmg] mutant strain MGI:5576980 Map3k7 targeted mutation 1.2, George Kollias MGI:1346877 Map3k7 mitogen-activated protein kinase kinase kinase 7 https://www.infrafrontier.eu/search?keyword=EM:08428 + EM:08404 STOCK Map3k7/Flmg EMMA sperm TAK1FL/FL mutant strain MGI:5576979 Map3k7 targeted mutation 1.1, George Kollias MGI:1346877 Map3k7 mitogen-activated protein kinase kinase kinase 7 https://www.infrafrontier.eu/search?keyword=EM:08404 + EM:00423 STOCK Maf/H EMMA embryo OFL, C3H101H-Maf/H mutant strain MGI:2654153 Maf opaque flecks in lens MGI:96909 Maf avian musculoaponeurotic fibrosarcoma oncogene homolog https://www.infrafrontier.eu/search?keyword=EM:00423 + EM:00423 STOCK Maf/H EMMA sperm OFL, C3H101H-Maf/H mutant strain MGI:2654153 Maf opaque flecks in lens MGI:96909 Maf avian musculoaponeurotic fibrosarcoma oncogene homolog https://www.infrafrontier.eu/search?keyword=EM:00423 + EM:01877 STOCK M241b Foxq1/M241b<+> Foxq1<+>/H EMMA embryo M241B mutant strain MGI:5515441 M241b mutant 241b MGI:5515439 M241b mutant 241b https://www.infrafrontier.eu/search?keyword=EM:01877 + EM:01877 STOCK M241b Foxq1/M241b<+> Foxq1<+>/H EMMA embryo M241B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01877 + EM:01877 STOCK M241b Foxq1/M241b<+> Foxq1<+>/H EMMA sperm M241B mutant strain MGI:5515441 M241b mutant 241b MGI:5515439 M241b mutant 241b https://www.infrafrontier.eu/search?keyword=EM:01877 + EM:01877 STOCK M241b Foxq1/M241b<+> Foxq1<+>/H EMMA sperm M241B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01877 + EM:09826 STOCK Lsm14b/WtsiPh EMMA sperm DEPD00559_1_C05 mutant strain MGI:4950120 Lsm14b targeted mutation 1a, Mouse Biology Program, UCDavis MGI:3040677 Lsm14b LSM family member 14B https://www.infrafrontier.eu/search?keyword=EM:09826 + EM:11044 STOCK Lpp/Ph EMMA sperm EPD0859_5_F01, IMG-EPD859_5_F01-1 mutant strain MGI:5289817 Lpp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2146570 Lpp LIM domain containing preferred translocation partner in lipoma https://www.infrafrontier.eu/search?keyword=EM:11044 ? EM:12882 STOCK Loxl2/Cnbc EMMA embryo mutant strain MGI:5750228 Loxl2 targeted mutation 1.2, Amparo Cano MGI:2137913 Loxl2 lysyl oxidase-like 2 https://www.infrafrontier.eu/search?keyword=EM:12882 + EM:04898 STOCK Lmx1a/Cnbc EMMA embryo Mutanlallemande mutant strain MGI:5423987 Lmx1a mutanlallemand MGI:1888519 Lmx1a LIM homeobox transcription factor 1 alpha https://www.infrafrontier.eu/search?keyword=EM:04898 + EM:10357 STOCK Lipa/Biat EMMA sperm INFRA-HEPD0960_2_H11-1 mutant strain MGI:5428633 Lipa targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96789 Lipa lysosomal acid lipase A https://www.infrafrontier.eu/search?keyword=EM:10357 + EM:11119 STOCK Lin28b/Cnrm EMMA embryo Lin28bdeltaOBS mutant strain MGI:6468553 Lin28b targeted mutation 1, Antonio Simeone MGI:3584032 Lin28b lin-28 homolog B (C. elegans) https://www.infrafrontier.eu/search?keyword=EM:11119 + EM:11119 STOCK Lin28b/Cnrm EMMA sperm Lin28bdeltaOBS mutant strain MGI:6468553 Lin28b targeted mutation 1, Antonio Simeone MGI:3584032 Lin28b lin-28 homolog B (C. elegans) https://www.infrafrontier.eu/search?keyword=EM:11119 + EM:01706 STOCK Lim2/H EMMA embryo C3H101H-Lim2/H, To3 mutant strain MGI:1862040 Lim2 total opacity 3 MGI:104698 Lim2 lens intrinsic membrane protein 2 https://www.infrafrontier.eu/search?keyword=EM:01706 + EM:02183 STOCK Lig4/ApbH EMMA sperm C57BL/6JSfdAnu-Lig4/ApbH, C57BL/6Apb-Lig4/ApbH, Tiny, Lig4Y288C, C57BL/6JApb-Lig4/ApbH, C57BL/6Apb-Lig4/Apb, C57BL/6Apb-Lig4/Apb mutant strain MGI:3714783 Lig4 tiny MGI:1335098 Lig4 ligase IV, DNA, ATP-dependent https://www.infrafrontier.eu/search?keyword=EM:02183 + EM:02519 STOCK Lhx1/H EMMA embryo Lim-1 (Lhx-1) mutant strain MGI:1857848 Lhx1 targeted mutation 1, Richard R Behringer MGI:99783 Lhx1 LIM homeobox protein 1 https://www.infrafrontier.eu/search?keyword=EM:02519 + EM:00129 STOCK Lcl/H EMMA embryo C3;CAnN-Lcl/H, C3.Cg-Lcl/H, C3H.C-Lcl/H, Lcl, C3N;CAnN-Lcl/H mutant strain MGI:2178627 Lcl lens cloudy MGI:2149028 Lcl lens cloudy https://www.infrafrontier.eu/search?keyword=EM:00129 + EM:00129 STOCK Lcl/H EMMA sperm C3;CAnN-Lcl/H, C3.Cg-Lcl/H, C3H.C-Lcl/H, Lcl, C3N;CAnN-Lcl/H mutant strain MGI:2178627 Lcl lens cloudy MGI:2149028 Lcl lens cloudy https://www.infrafrontier.eu/search?keyword=EM:00129 + EM:12384 STOCK Lama3/Ieg EMMA sperm mutant strain MGI:6121104 Lama3 targeted mutation 1, TaconicArtemis MGI:99909 Lama3 laminin, alpha 3 https://www.infrafrontier.eu/search?keyword=EM:12384 + EM:09157 STOCK L3mbtl2/WtsiPh EMMA sperm EPD0960_5_A06 mutant strain MGI:5472695 L3mbtl2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2443584 L3mbtl2 L3MBTL2 polycomb repressive complex 1 subunit https://www.infrafrontier.eu/search?keyword=EM:09157 + EM:10723 STOCK Klhl4/Oulu EMMA embryo mutant strain MGI:6317340 Klhl4 targeted mutation 1, Kari Alitalo MGI:2442829 Klhl4 kelch-like 4 https://www.infrafrontier.eu/search?keyword=EM:10723 + EM:11386 STOCK Kdm6b/Wtsi EMMA embryo MHHT, BEPD0109_C03 mutant strain MGI:6317387 Kdm6b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2448492 Kdm6b KDM1 lysine (K)-specific demethylase 6B https://www.infrafrontier.eu/search?keyword=EM:11386 + EM:11386 STOCK Kdm6b/Wtsi EMMA sperm MHHT, BEPD0109_C03 mutant strain MGI:6317387 Kdm6b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2448492 Kdm6b KDM1 lysine (K)-specific demethylase 6B https://www.infrafrontier.eu/search?keyword=EM:11386 + EM:11128 STOCK Kdm6a/WtsiH EMMA sperm EPD0506_3_A01 mutant strain MGI:6117755 Kdm6a targeted mutation 2c, Wellcome Trust Sanger Institute MGI:1095419 Kdm6a lysine (K)-specific demethylase 6A https://www.infrafrontier.eu/search?keyword=EM:11128 + EM:10166 STOCK Kcnip3/Orl EMMA sperm P5370-HEPD0546_1_G09, HEPD0546_1_G09 mutant strain MGI:4436314 Kcnip3 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1929258 Kcnip3 Kv channel interacting protein 3, calsenilin https://www.infrafrontier.eu/search?keyword=EM:10166 + EM:02515 STOCK Invs/H EMMA embryo INV mutant strain MGI:1856915 Invs inversion of embryonic turning MGI:1335082 Invs inversin https://www.infrafrontier.eu/search?keyword=EM:02515 + EM:08502 STOCK Il10/Cnbc EMMA sperm EPD0158_4_D06 mutant strain MGI:4432290 Il10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96537 Il10 interleukin 10 https://www.infrafrontier.eu/search?keyword=EM:08502 + EM:02108 STOCK Ighm/Orl EMMA embryo pAp-mu mutant strain MGI:4950361 Ighm targeted mutation 1.1, Ahmed Khamlichi MGI:96448 Ighm immunoglobulin heavy constant mu https://www.infrafrontier.eu/search?keyword=EM:02108 + EM:02111 STOCK Ighg3/Orl EMMA embryo A150 mutant strain MGI:6241553 Ighg3 targeted mutation 1, Ahmed Khamlichi MGI:2144790 Ighg3 Immunoglobulin heavy constant gamma 3 https://www.infrafrontier.eu/search?keyword=EM:02111 + EM:11091 STOCK Igh/Orl EMMA sperm mutant strain MGI:6317346 Igh targeted mutation 9.1 Michel Cogne MGI:96442 Igh immunoglobulin heavy chain complex https://www.infrafrontier.eu/search?keyword=EM:11091 + EM:05659 STOCK Igh/Orl EMMA embryo IgH 3'RR-deficient mice mutant strain MGI:4836663 Igh targeted mutation 5.1, Michel Cogne MGI:96442 Igh immunoglobulin heavy chain complex https://www.infrafrontier.eu/search?keyword=EM:05659 + EM:11092 STOCK Igh/Orl EMMA sperm mutant strain MGI:6317347 Igh targeted mutation 10.1, Michel Cogne MGI:96442 Igh immunoglobulin heavy chain complex https://www.infrafrontier.eu/search?keyword=EM:11092 + EM:02109 STOCK Igh-8/Orl EMMA embryo pAp-gamma3 mutant strain MGI:4950363 Igh-8 targeted mutation 2.1, Ahmed Khamlichi MGI:96450 Igh-8 immunoglobulin heavy chain 8 (heavy chain of IgG3) https://www.infrafrontier.eu/search?keyword=EM:02109 + EM:02110 STOCK Igh-8/Orl EMMA embryo B6;129S2-Igh-8/Orl, Ig1/Ig3 mutant strain MGI:3774279 Igh-8 targeted mutation 2, Ahmed Amine Khamlichi MGI:96450 Igh-8 immunoglobulin heavy chain 8 (heavy chain of IgG3) https://www.infrafrontier.eu/search?keyword=EM:02110 + EM:01732 STOCK Igf2/H EMMA embryo S1.2Neo mutant stock MGI:5309176 Igf2 targeted mutation 4, Wolf Reik MGI:96434 Igf2 insulin-like growth factor 2 https://www.infrafrontier.eu/search?keyword=EM:01732 - EM:10974 STOCK Hspg2/Oulu EMMA embryo C57BL/6-Hspg2/Oulu mutant strain MGI:6468552 Hspg2 targeted mutation 3.1, Raija Soininen MGI:96257 Hspg2 perlecan (heparan sulfate proteoglycan 2) https://www.infrafrontier.eu/search?keyword=EM:10974 - EM:10974 STOCK Hspg2/Oulu EMMA sperm C57BL/6-Hspg2/Oulu mutant strain MGI:6468552 Hspg2 targeted mutation 3.1, Raija Soininen MGI:96257 Hspg2 perlecan (heparan sulfate proteoglycan 2) https://www.infrafrontier.eu/search?keyword=EM:10974 + EM:12344 STOCK Hsd17b4/Ph EMMA archived mutant strain MGI:2385822 Hsd17b4 targeted mutation 1, Myriam Baes MGI:105089 Hsd17b4 hydroxysteroid (17-beta) dehydrogenase 4 https://www.infrafrontier.eu/search?keyword=EM:12344 ? EM:08427 STOCK Hnrnpd/Flmg EMMA archived mutant strain Hnrnpd Hnrnpd MGI:101947 Hnrnpd heterogeneous nuclear ribonucleoprotein D https://www.infrafrontier.eu/search?keyword=EM:08427 ? EM:08426 STOCK Hnrnpd/Flmg EMMA embryo mutant strain Hnrnpd Hnrnpd MGI:101947 Hnrnpd heterogeneous nuclear ribonucleoprotein D https://www.infrafrontier.eu/search?keyword=EM:08426 ? EM:08426 STOCK Hnrnpd/Flmg EMMA sperm mutant strain Hnrnpd Hnrnpd MGI:101947 Hnrnpd heterogeneous nuclear ribonucleoprotein D https://www.infrafrontier.eu/search?keyword=EM:08426 + EM:02506 STOCK Hnf4a/H EMMA embryo Is Cre, Hnf4 cre mutant strain MGI:3052820 Hnf4a targeted mutation 1, Stephane D Vincent MGI:109128 Hnf4a hepatic nuclear factor 4, alpha https://www.infrafrontier.eu/search?keyword=EM:02506 + EM:08992 STOCK Hmox1/Flmg EMMA embryo B6.129-Hmox1/Flmg mutant strain MGI:3846093 Hmox1 targeted mutation 1.2, George Kollias MGI:96163 Hmox1 heme oxygenase 1 https://www.infrafrontier.eu/search?keyword=EM:08992 + EM:01766 STOCK Hgd/Orl EMMA archived alkaptonuria mutant strain MGI:1856664 Hgd alkaptonuria MGI:96078 Hgd homogentisate 1, 2-dioxygenase https://www.infrafrontier.eu/search?keyword=EM:01766 + EM:05325 STOCK Hal/H EMMA embryo Histidinaemic mutant strain MGI:1856300 Hal histidinemia MGI:96010 Hal histidine ammonia lyase https://www.infrafrontier.eu/search?keyword=EM:05325 + EM:02252 STOCK H2 H2-T18 Anta/H EMMA sperm Antonia mutant strain MGI:5758945 Anta antonia MGI:5758943 Anta antonia https://www.infrafrontier.eu/search?keyword=EM:02252 - EM:12135 STOCK H2-M5/Wtsi EMMA embryo mutant strain MGI:4420089 H2-M5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95917 H2-M5 histocompatibility 2, M region locus 5 https://www.infrafrontier.eu/search?keyword=EM:12135 + EM:02617 STOCK Gtf2i/Cnbc EMMA embryo CD1;129-Gtf2i/Cnbc, GTF2I-2loxP mutant strain MGI:5532204 Gtf2i targeted mutation 1, Victoria Campuzano MGI:1202722 Gtf2i general transcription factor II I https://www.infrafrontier.eu/search?keyword=EM:02617 + EM:09667 STOCK Gt(ROSA)26Sor/H EMMA sperm mutant strain MGI:2449039 Gt(ROSA)26Sor targeted mutation 2, Frank Costantini MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:09667 + EM:00410 STOCK Gt(ROSA)26Sor/Cnrm EMMA embryo RCM2, STOCK Gt(ROSA)26Sor/Ibmc mutant strain MGI:3764519 Gt(ROSA)26Sor targeted mutation 2, Anton Berns MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:00410 ? EM:11487 STOCK Gt(ROSA)26Sor/Kctt EMMA sperm mutant strain Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11487 - EM:02112 STOCK Gt(ROSA)26Sor/Ieg EMMA embryo B6(Cg)-Gt(ROSA)26Sor/Ieg, C57BL/6-Gt(ROSA)26Sor/Ieg, Rosa-tdRFP mutant strain MGI:3696099 Gt(ROSA)26Sor targeted mutation 1, Hans Jorg Fehling MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:02112 + EM:08181 STOCK Gt(ROSA)26Sor Tg(Ltf-icre)14Mmul/Biat EMMA sperm B6;129-R26tdRFPfl-Tg(Ltf-Cre)14 mutant strain MGI:3696099 Gt(ROSA)26Sor targeted mutation 1, Hans Jorg Fehling MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:08181 + EM:08181 STOCK Gt(ROSA)26Sor Tg(Ltf-icre)14Mmul/Biat EMMA sperm B6;129-R26tdRFPfl-Tg(Ltf-Cre)14 mutant strain MGI:5571915 Tg(Ltf-icre)14Mmul transgene insertion 14, Mathias Muller MGI:5571911 Tg(Ltf-icre)14Mmul transgene insertion 14, Mathias Muller https://www.infrafrontier.eu/search?keyword=EM:08181 + EM:05648 STOCK Gt(ROSA)26Sor/Cnrm EMMA embryo mutant strain MGI:6468507 Gt(ROSA)26Sor targeted mutation 1, Antonio Simeone MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:05648 + EM:09668 STOCK Gt(ROSA)26Sor/H EMMA sperm STOCK Gt(ROSA)26Sor mutant strain MGI:2449038 Gt(ROSA)26Sor targeted mutation 1, Frank Costantini MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:09668 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA embryo mutant strain MGI:2183509 Gjb2 targeted mutation 1, Unite de Genetique des Deficits Sensoriels MGI:95720 Gjb2 gap junction protein, beta 2 https://www.infrafrontier.eu/search?keyword=EM:11488 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA embryo mutant strain MGI:2445311 Gt(ROSA)26Sor targeted mutation 1, Anton Berns MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11488 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA sperm mutant strain MGI:2183509 Gjb2 targeted mutation 1, Unite de Genetique des Deficits Sensoriels MGI:95720 Gjb2 gap junction protein, beta 2 https://www.infrafrontier.eu/search?keyword=EM:11488 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA sperm mutant strain MGI:2445311 Gt(ROSA)26Sor targeted mutation 1, Anton Berns MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11488 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA live mutant strain MGI:2183509 Gjb2 targeted mutation 1, Unite de Genetique des Deficits Sensoriels MGI:95720 Gjb2 gap junction protein, beta 2 https://www.infrafrontier.eu/search?keyword=EM:11488 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA live mutant strain MGI:2445311 Gt(ROSA)26Sor targeted mutation 1, Anton Berns MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11488 + EM:07451 STOCK Gt(ROSA)26Sor/Kctt EMMA embryo Gt(ROSA)26Sor-mCherry-Rpl10a, mCherryTRAP mutant strain MGI:5569759 Gt(ROSA)26Sor targeted mutation 1, Jan M Stenman MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:07451 ? EM:11486 STOCK Gt(ROSA)26Sor/Kctt EMMA sperm mutant strain Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11486 + EM:12809 STOCK Gsk3a Gsk3b/H EMMA sperm mutant strain MGI:3578225 Gsk3a targeted mutation 1, Dario R Alessi MGI:2152453 Gsk3a glycogen synthase kinase 3 alpha https://www.infrafrontier.eu/search?keyword=EM:12809 + EM:12809 STOCK Gsk3a Gsk3b/H EMMA sperm mutant strain MGI:3578226 Gsk3b targeted mutation 1, Dario R Alessi MGI:1861437 Gsk3b glycogen synthase kinase 3 beta https://www.infrafrontier.eu/search?keyword=EM:12809 - EM:04895 STOCK Grxcr1/WtsiCnbc[cc] EMMA embryo Tasmanian devil, Grxcr1, STOCK Grxcr1/Cnbc mutant strain MGI:2681910 Grxcr1 tasmanian devil MGI:3577767 Grxcr1 glutaredoxin, cysteine rich 1 https://www.infrafrontier.eu/search?keyword=EM:04895 + EM:02397 STOCK Grm7 Smn1 Tg(SMN1*E134K)1Tlbt/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN*E134K)1Pks/H, STOCK Tg(SMN2)89Ahmb Smn1 Tg(SMN1*E134K)1Tlbt/H, SMN2 low/SMN E134K, STOCK Smn1 Tg(SMN1*E134K)1Tlbt Tg(SMN2)89Ahmb/H mutant strain MGI:2448989 Grm7 transgene insertion 89, Arthur H M Burghes MGI:1351344 Grm7 glutamate receptor, metabotropic 7 https://www.infrafrontier.eu/search?keyword=EM:02397 + EM:02397 STOCK Grm7 Smn1 Tg(SMN1*E134K)1Tlbt/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN*E134K)1Pks/H, STOCK Tg(SMN2)89Ahmb Smn1 Tg(SMN1*E134K)1Tlbt/H, SMN2 low/SMN E134K, STOCK Smn1 Tg(SMN1*E134K)1Tlbt Tg(SMN2)89Ahmb/H mutant strain MGI:2183946 Smn1 targeted mutation 1, Michael Sendtner MGI:109257 Smn1 survival motor neuron 1 https://www.infrafrontier.eu/search?keyword=EM:02397 + EM:02397 STOCK Grm7 Smn1 Tg(SMN1*E134K)1Tlbt/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN*E134K)1Pks/H, STOCK Tg(SMN2)89Ahmb Smn1 Tg(SMN1*E134K)1Tlbt/H, SMN2 low/SMN E134K, STOCK Smn1 Tg(SMN1*E134K)1Tlbt Tg(SMN2)89Ahmb/H mutant strain MGI:5493441 Tg(SMN1*E134K)1Tlbt transgene insertion 1, Kevin Talbot MGI:5493438 Tg(SMN1*E134K)1Tlbt transgene insertion 1, Kevin Talbot https://www.infrafrontier.eu/search?keyword=EM:02397 + EM:02500 STOCK Grm7 Smg6 Smn1/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN1*delta5-Smg6)1Pks/H, SMN Delta 5 /SMN2 low, STOCK Tg(SMN2)89Ahmb Smg6 Smn1/H, STOCK Smg6 Smn1 Tg(SMN2)89Ahmb/H mutant strain MGI:2183946 Smn1 targeted mutation 1, Michael Sendtner MGI:109257 Smn1 survival motor neuron 1 https://www.infrafrontier.eu/search?keyword=EM:02500 + EM:02500 STOCK Grm7 Smg6 Smn1/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN1*delta5-Smg6)1Pks/H, SMN Delta 5 /SMN2 low, STOCK Tg(SMN2)89Ahmb Smg6 Smn1/H, STOCK Smg6 Smn1 Tg(SMN2)89Ahmb/H mutant strain MGI:2448989 Grm7 transgene insertion 89, Arthur H M Burghes MGI:1351344 Grm7 glutamate receptor, metabotropic 7 https://www.infrafrontier.eu/search?keyword=EM:02500 + EM:02500 STOCK Grm7 Smg6 Smn1/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN1*delta5-Smg6)1Pks/H, SMN Delta 5 /SMN2 low, STOCK Tg(SMN2)89Ahmb Smg6 Smn1/H, STOCK Smg6 Smn1 Tg(SMN2)89Ahmb/H mutant strain MGI:5493450 Smg6 transgene insertion 1, Nick Parkinson MGI:2144117 Smg6 Smg-6 homolog, nonsense mediated mRNA decay factor (C. elegans) https://www.infrafrontier.eu/search?keyword=EM:02500 - EM:05794 STOCK Grin1/WtsiOrl EMMA sperm mutant strain MGI:4432313 Grin1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95819 Grin1 glutamate receptor, ionotropic, NMDA1 (zeta 1) https://www.infrafrontier.eu/search?keyword=EM:05794 + EM:05216 STOCK Gjd4/Cnrm EMMA embryo Cx39KO mutant strain MGI:5009133 Gjd4 targeted mutation 1.1, Julia von Maltzahn MGI:2444990 Gjd4 gap junction protein, delta 4 https://www.infrafrontier.eu/search?keyword=EM:05216 + EM:01913 STOCK Gjc3/Cnrm EMMA embryo B6NCrl;129P2-Gjc3/Ibcm, STOCK Gjc3/Ibcm, Cx29 LacZ mutant strain MGI:4420945 Gjc3 targeted mutation 1.1, Klaus Willecke MGI:2153041 Gjc3 gap junction protein, gamma 3 https://www.infrafrontier.eu/search?keyword=EM:01913 + EM:07626 STOCK Gjb6/Cnrm EMMA embryo Cx30A88V, CD1;129P2-Gjb6/Cnrm mutant strain MGI:5607781 Gjb6 targeted mutation 2.2, Klaus Willecke MGI:107588 Gjb6 gap junction protein, beta 6 https://www.infrafrontier.eu/search?keyword=EM:07626 + EM:07626 STOCK Gjb6/Cnrm EMMA sperm Cx30A88V, CD1;129P2-Gjb6/Cnrm mutant strain MGI:5607781 Gjb6 targeted mutation 2.2, Klaus Willecke MGI:107588 Gjb6 gap junction protein, beta 6 https://www.infrafrontier.eu/search?keyword=EM:07626 - EM:02193 STOCK Gja8/H EMMA embryo mutant strain MGI:1857499 Gja8 nuclear opacity 2 MGI:99953 Gja8 gap junction protein, alpha 8 https://www.infrafrontier.eu/search?keyword=EM:02193 + EM:06035 STOCK Gja5/Cnrm EMMA embryo Cx40A96S mutant strain MGI:5544269 Gja5 targeted mutation 2.1, Klaus Willecke MGI:95716 Gja5 gap junction protein, alpha 5 https://www.infrafrontier.eu/search?keyword=EM:06035 + EM:01914 STOCK Gja1/Cnrm EMMA embryo Cx43KICx43floxCx31, B6NCrl;129P2-Gja1/Cnrm, B6NCrl;129P2-Gja1/Cnrm mutant strain MGI:5004864 Gja1 targeted mutation 6.2, Klaus Willecke MGI:95713 Gja1 gap junction protein, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:01914 + EM:00330 STOCK Gja1/Cnrm EMMA embryo Cx43-KI-CreER(T), STOCK Gja1/Ibcm mutant stock MGI:2676327 Gja1 targeted mutation 5, Klaus Willecke MGI:95713 Gja1 gap junction protein, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:00330 + EM:08390 STOCK Gatad2b/Ics EMMA sperm HEPD0554_7_E03 mutant strain MGI:4434913 Gatad2b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443225 Gatad2b GATA zinc finger domain containing 2B https://www.infrafrontier.eu/search?keyword=EM:08390 + EM:00073 STOCK G6pdx/H EMMA embryo G6pd, glucose-6-phosphate, G6pdx, C3H.101H-G6pdx/H, C3H.Cg-G6pdx/H mutant strain MGI:2182739 G6pdx mutation 1, Neuherberg MGI:105979 G6pdx glucose-6-phosphate dehydrogenase X-linked https://www.infrafrontier.eu/search?keyword=EM:00073 + EM:06108 STOCK Fzr1/Cnbc EMMA sperm mutant strain MGI:3800718 Fzr1 targeted mutation 1, Marcos Malumbres MGI:1926790 Fzr1 fizzy and cell division cycle 20 related 1 https://www.infrafrontier.eu/search?keyword=EM:06108 + EM:00072 STOCK Fras1/PgrKieg EMMA embryo Fras-1, STOCK Fras1/Pgr, PGr-4, STOCK Fras1/PgrIeg mutant strain MGI:2667194 Fras1 targeted mutation 1, George Chalepakis MGI:2385368 Fras1 Fraser extracellular matrix complex subunit 1 https://www.infrafrontier.eu/search?keyword=EM:00072 + EM:06767 STOCK Fras1/H EMMA sperm B6;SJL-Fras1/H, Fras1 Conditional, Fras1, B6(SJL)-Fras1/H, Fras1 mutant strain MGI:5449386 Fras1 targeted mutation 1.1, Peter J Scambler MGI:2385368 Fras1 Fraser extracellular matrix complex subunit 1 https://www.infrafrontier.eu/search?keyword=EM:06767 + EM:01878 STOCK Foxq1 M876b/Foxq1<+> M876b<+>/H EMMA embryo M876B mutant strain MGI:5515453 M876b mutant 876b MGI:5515451 M876b mutant 876b https://www.infrafrontier.eu/search?keyword=EM:01878 + EM:01878 STOCK Foxq1 M876b/Foxq1<+> M876b<+>/H EMMA embryo M876B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01878 + EM:01868 STOCK Foxq1 M624b/Foxq1<+> M624b<+>/H EMMA embryo M624B mutant strain MGI:5515450 M624b mutant 624b MGI:5515448 M624b mutant 624b https://www.infrafrontier.eu/search?keyword=EM:01868 + EM:01868 STOCK Foxq1 M624b/Foxq1<+> M624b<+>/H EMMA embryo M624B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01868 + EM:01849 STOCK Foxq1 M54b/Foxq1<+> M54b<+>/H EMMA embryo M54B, STOCK M54B/H mutant strain MGI:5515438 M54b mutant 54b MGI:5515436 M54b mutant 54b https://www.infrafrontier.eu/search?keyword=EM:01849 + EM:01849 STOCK Foxq1 M54b/Foxq1<+> M54b<+>/H EMMA embryo M54B, STOCK M54B/H mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01849 + EM:01849 STOCK Foxq1 M54b/Foxq1<+> M54b<+>/H EMMA sperm M54B, STOCK M54B/H mutant strain MGI:5515438 M54b mutant 54b MGI:5515436 M54b mutant 54b https://www.infrafrontier.eu/search?keyword=EM:01849 + EM:01849 STOCK Foxq1 M54b/Foxq1<+> M54b<+>/H EMMA sperm M54B, STOCK M54B/H mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01849 + EM:01850 STOCK Foxq1 M412b/Foxq1<+> M412b<+>/H EMMA embryo M412B mutant strain MGI:5515447 M412b mutant 412b MGI:5515445 M412b mutant 412b https://www.infrafrontier.eu/search?keyword=EM:01850 + EM:01850 STOCK Foxq1 M412b/Foxq1<+> M412b<+>/H EMMA embryo M412B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01850 + EM:01850 STOCK Foxq1 M412b/Foxq1<+> M412b<+>/H EMMA sperm M412B mutant strain MGI:5515447 M412b mutant 412b MGI:5515445 M412b mutant 412b https://www.infrafrontier.eu/search?keyword=EM:01850 + EM:01850 STOCK Foxq1 M412b/Foxq1<+> M412b<+>/H EMMA sperm M412B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01850 + EM:01853 STOCK Foxq1 M369b/Foxq1<+> M369b<+>/H EMMA embryo M369B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01853 + EM:01853 STOCK Foxq1 M369b/Foxq1<+> M369b<+>/H EMMA embryo M369B mutant strain MGI:5515444 M369b mutant 369b MGI:5515442 M369b mutant 369b https://www.infrafrontier.eu/search?keyword=EM:01853 + EM:01853 STOCK Foxq1 M369b/Foxq1<+> M369b<+>/H EMMA sperm M369B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01853 + EM:01853 STOCK Foxq1 M369b/Foxq1<+> M369b<+>/H EMMA sperm M369B mutant strain MGI:5515444 M369b mutant 369b MGI:5515442 M369b mutant 369b https://www.infrafrontier.eu/search?keyword=EM:01853 + EM:01852 STOCK Foxq1 M1645b/Foxq1<+> M1645b<+>/H EMMA embryo M1645B mutant strain MGI:5515465 M1645b mutant 1645b MGI:5515463 M1645b mutant 1645b https://www.infrafrontier.eu/search?keyword=EM:01852 + EM:01852 STOCK Foxq1 M1645b/Foxq1<+> M1645b<+>/H EMMA embryo M1645B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01852 + EM:01852 STOCK Foxq1 M1645b/Foxq1<+> M1645b<+>/H EMMA sperm M1645B mutant strain MGI:5515465 M1645b mutant 1645b MGI:5515463 M1645b mutant 1645b https://www.infrafrontier.eu/search?keyword=EM:01852 + EM:01852 STOCK Foxq1 M1645b/Foxq1<+> M1645b<+>/H EMMA sperm M1645B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01852 + EM:01851 STOCK Foxq1 M1616b/ Foxq1<+> M1616b<+>/H EMMA embryo M1616B mutant strain MGI:5515462 M1616b mutant 1616b MGI:5515460 M1616b mutant 1616b https://www.infrafrontier.eu/search?keyword=EM:01851 + EM:01851 STOCK Foxq1 M1616b/ Foxq1<+> M1616b<+>/H EMMA embryo M1616B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01851 + EM:01858 STOCK Foxq1 M1185b/Foxq1<+> M1185b<+>/H EMMA embryo M1185B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01858 + EM:01858 STOCK Foxq1 M1185b/Foxq1<+> M1185b<+>/H EMMA embryo M1185B mutant strain MGI:5515459 M1185b mutant 1185b MGI:5515457 M1185b mutant 1185b https://www.infrafrontier.eu/search?keyword=EM:01858 + EM:01858 STOCK Foxq1 M1185b/Foxq1<+> M1185b<+>/H EMMA sperm M1185B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01858 + EM:01858 STOCK Foxq1 M1185b/Foxq1<+> M1185b<+>/H EMMA sperm M1185B mutant strain MGI:5515459 M1185b mutant 1185b MGI:5515457 M1185b mutant 1185b https://www.infrafrontier.eu/search?keyword=EM:01858 + EM:01857 STOCK Foxq1 M1073b/Foxq1<+> M1073b<+>/H EMMA embryo M1073B mutant strain MGI:5515456 M1073b mutant 1073b MGI:5515454 M1073b mutant 1073b https://www.infrafrontier.eu/search?keyword=EM:01857 + EM:01857 STOCK Foxq1 M1073b/Foxq1<+> M1073b<+>/H EMMA embryo M1073B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01857 + EM:01857 STOCK Foxq1 M1073b/Foxq1<+> M1073b<+>/H EMMA sperm M1073B mutant strain MGI:5515456 M1073b mutant 1073b MGI:5515454 M1073b mutant 1073b https://www.infrafrontier.eu/search?keyword=EM:01857 + EM:01857 STOCK Foxq1 M1073b/Foxq1<+> M1073b<+>/H EMMA sperm M1073B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01857 + EM:00038 STOCK Foxn1/Orl EMMA archived B6;albino-Foxn1/Orl, C57BL/6 - nu congenic strain MGI:1856108 Foxn1 nude MGI:102949 Foxn1 forkhead box N1 https://www.infrafrontier.eu/search?keyword=EM:00038 + EM:05943 STOCK Fntb/Cnbc EMMA sperm mutant strain MGI:3581447 Fntb targeted mutation 1, Mariano Barbacid MGI:1861305 Fntb farnesyltransferase, CAAX box, beta https://www.infrafrontier.eu/search?keyword=EM:05943 + EM:09463 STOCK Flt4/Oulu EMMA embryo Vegfr3flox/flox mutant strain MGI:3805195 Flt4 targeted mutation 2.1, Kari Alitalo MGI:95561 Flt4 FMS-like tyrosine kinase 4 https://www.infrafrontier.eu/search?keyword=EM:09463 + EM:05992 STOCK Fli1/Orl EMMA sperm mutant strain MGI:4878922 Fli1 targeted mutation 1.1, Francois Morle MGI:95554 Fli1 Friend leukemia integration 1 https://www.infrafrontier.eu/search?keyword=EM:05992 ? EM:10692 STOCK Fkrp/ScbrH EMMA sperm mutant strain MGI:4835411 Fkrp targeted mutation 1, S C Brown MGI:2447586 Fkrp fukutin related protein https://www.infrafrontier.eu/search?keyword=EM:10692 + EM:08500 STOCK Fkrp/H EMMA sperm C57BL/6;129-FKRP Tyr307Asn mutant strain MGI:4835412 Fkrp targeted mutation 1.1, S C Brown MGI:2447586 Fkrp fukutin related protein https://www.infrafrontier.eu/search?keyword=EM:08500 + EM:06912 STOCK Fgf7/H EMMA sperm mutant strain MGI:4455930 Fgf7 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:95521 Fgf7 fibroblast growth factor 7 https://www.infrafrontier.eu/search?keyword=EM:06912 + EM:02540 STOCK Fcgr1/Cnrm EMMA embryo STOCK Fcgr1/Cnrm, STOCK Fcgr1/Ibcm, CD64 KO on C57Bl6 mutant strain MGI:2664927 Fcgr1 targeted mutation 1, J Sjef Verbeek MGI:95498 Fcgr1 Fc receptor, IgG, high affinity I https://www.infrafrontier.eu/search?keyword=EM:02540 + EM:02540 STOCK Fcgr1/Cnrm EMMA sperm STOCK Fcgr1/Cnrm, STOCK Fcgr1/Ibcm, CD64 KO on C57Bl6 mutant strain MGI:2664927 Fcgr1 targeted mutation 1, J Sjef Verbeek MGI:95498 Fcgr1 Fc receptor, IgG, high affinity I https://www.infrafrontier.eu/search?keyword=EM:02540 + EM:04667 STOCK Fcamr/Cnbc EMMA embryo FcamR (4D6)- Null, STOCK Fcamr/Cnbc, FcamR-null mutant strain MGI:5882398 Fcamr targeted mutation 1.2, J Sjef Verbeek MGI:1927803 Fcamr Fc receptor, IgA, IgM, high affinity https://www.infrafrontier.eu/search?keyword=EM:04667 + EM:04668 STOCK Fcamr/Cnbc EMMA embryo FcamR (4D6)- Floxed, STOCK Fcamr/Cnbc mutant strain MGI:5882402 Fcamr targeted mutation 1.1, J Sjef Verbeek MGI:1927803 Fcamr Fc receptor, IgA, IgM, high affinity https://www.infrafrontier.eu/search?keyword=EM:04668 + EM:12632 STOCK Fbxw7/H EMMA sperm mutant strain MGI:4867641 Fbxw7 targeted mutation 1.1, Axel Behrens MGI:1354695 Fbxw7 F-box and WD-40 domain protein 7 https://www.infrafrontier.eu/search?keyword=EM:12632 + EM:01885 STOCK Fasl/Ieg EMMA embryo B6;129-Fasl/Ieg, FasL delta intra k.o./k.i. mutant stock MGI:4888490 Fasl targeted mutation 1.1, Geert Michel MGI:99255 Fasl Fas ligand (TNF superfamily, member 6) https://www.infrafrontier.eu/search?keyword=EM:01885 + EM:09945 STOCK Exd1/CipheOrl EMMA sperm HEPD0647_4_B07 mutant strain MGI:4457525 Exd1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3045306 Exd1 exonuclease 3'-5' domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:09945 + EM:02595 STOCK Epo/H EMMA embryo Epo, TgH(eposvT)1Pjr, Epo-Tag mutant strain MGI:3767166 Epo transgene insertion 134.3 LC, Peter J Ratcliffe MGI:95407 Epo erythropoietin https://www.infrafrontier.eu/search?keyword=EM:02595 + EM:07840 STOCK Eif6/Cnrm EMMA embryo eIF6 knockout mice mutant strain MGI:3817934 Eif6 targeted mutation 1, Stefano Biffo MGI:1196288 Eif6 eukaryotic translation initiation factor 6 https://www.infrafrontier.eu/search?keyword=EM:07840 + EM:07840 STOCK Eif6/Cnrm EMMA sperm eIF6 knockout mice mutant strain MGI:3817934 Eif6 targeted mutation 1, Stefano Biffo MGI:1196288 Eif6 eukaryotic translation initiation factor 6 https://www.infrafrontier.eu/search?keyword=EM:07840 + EM:09406 STOCK Eif2ak4/Cnbc EMMA embryo mutant strain MGI:3582154 Eif2ak4 targeted mutation 1.2, David Ron MGI:1353427 Eif2ak4 eukaryotic translation initiation factor 2 alpha kinase 4 https://www.infrafrontier.eu/search?keyword=EM:09406 + EM:09408 STOCK Eif2ak4 Eif2ak2/Cnbc EMMA embryo GCN2KO.PKRKO.DKO_PKR_GCN2 Mixed Background mutant strain MGI:3582154 Eif2ak4 targeted mutation 1.2, David Ron MGI:1353427 Eif2ak4 eukaryotic translation initiation factor 2 alpha kinase 4 https://www.infrafrontier.eu/search?keyword=EM:09408 + EM:09408 STOCK Eif2ak4 Eif2ak2/Cnbc EMMA embryo GCN2KO.PKRKO.DKO_PKR_GCN2 Mixed Background mutant strain MGI:2182590 Eif2ak2 targeted mutation 1, John C Bell MGI:1353449 Eif2ak2 eukaryotic translation initiation factor 2-alpha kinase 2 https://www.infrafrontier.eu/search?keyword=EM:09408 + EM:11834 STOCK Egr2/Orl EMMA archived unclassified MGI:3798483 Egr2 targeted mutation 4, Patrick Charney MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:11834 + EM:11828 STOCK Egr2/Orl EMMA archived unclassified MGI:2183227 Egr2 targeted mutation 3, Patrick Charnay MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:11828 + EM:04482 STOCK Egr2 Tg(CD2-icre)4Kio/H EMMA sperm STOCK Egr2 Tg(CD2-cre)4Kio/H, Egr-2-cKO mutant strain MGI:2183227 Egr2 targeted mutation 3, Patrick Charnay MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:04482 + EM:04482 STOCK Egr2 Tg(CD2-icre)4Kio/H EMMA sperm STOCK Egr2 Tg(CD2-cre)4Kio/H, Egr-2-cKO mutant strain MGI:2449947 Tg(CD2-icre)4Kio transgene insertion 4, Dimitris Kioussis MGI:2449946 Tg(CD2-icre)4Kio transgene insertion 4, Dimitris Kioussis https://www.infrafrontier.eu/search?keyword=EM:04482 - EM:11389 STOCK Egr2 Egr3 Tg(CD2-icre)4Kio/H EMMA sperm mutant strain MGI:2449947 Tg(CD2-icre)4Kio transgene insertion 4, Dimitris Kioussis MGI:2449946 Tg(CD2-icre)4Kio transgene insertion 4, Dimitris Kioussis https://www.infrafrontier.eu/search?keyword=EM:11389 - EM:11389 STOCK Egr2 Egr3 Tg(CD2-icre)4Kio/H EMMA sperm mutant strain MGI:2183227 Egr2 targeted mutation 3, Patrick Charnay MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:11389 - EM:11389 STOCK Egr2 Egr3 Tg(CD2-icre)4Kio/H EMMA sperm mutant strain MGI:2180063 Egr3 targeted mutation 1, Jeffrey Milbrandt MGI:1306780 Egr3 early growth response 3 https://www.infrafrontier.eu/search?keyword=EM:11389 + EM:11829 STOCK Egr2/Orl EMMA archived unclassified MGI:1931056 Egr2 targeted mutation 2, Patrick Charnay MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:11829 + EM:00438 STOCK Eda/H x C3H101HF1 EMMA sperm Tabby<43H> mutant strain MGI:5509473 Eda tabby 43 Harwell MGI:1195272 Eda ectodysplasin-A https://www.infrafrontier.eu/search?keyword=EM:00438 - EM:04980 STOCK Dynll1/H EMMA sperm EUCE0287_D04, 129P2/OlaHsd-Dynll1/H mutant strain MGI:4368846 Dynll1 gene trap EUCE0287d04, Helmholtz Zentrum Muenchen GmbH MGI:1861457 Dynll1 dynein light chain LC8-type 1 https://www.infrafrontier.eu/search?keyword=EM:04980 + EM:01847 STOCK Dync1h1/H EMMA embryo C3H101H-Dync1h1/H, C3H101H-Dnchc1/H, C3H;101H-Dync1h1/H, Legs at odd angles, Loa mutant strain MGI:2447991 Dync1h1 legs at odd angles MGI:103147 Dync1h1 dynein cytoplasmic 1 heavy chain 1 https://www.infrafrontier.eu/search?keyword=EM:01847 - EM:12065 STOCK Dusp1/Wtsi EMMA embryo mutant strain MGI:4364283 Dusp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:105120 Dusp1 dual specificity phosphatase 1 https://www.infrafrontier.eu/search?keyword=EM:12065 + EM:09991 STOCK Dusp11/IcsOrl EMMA sperm EPD0209_1_C08 mutant strain MGI:4434394 Dusp11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919352 Dusp11 dual specificity phosphatase 11 (RNA/RNP complex 1-interacting) https://www.infrafrontier.eu/search?keyword=EM:09991 + EM:01169 STOCK Dsg4/Orl EMMA embryo lanceolate hair mutant strain MGI:1856929 Dsg4 lanceolate hair MGI:2661061 Dsg4 desmoglein 4 https://www.infrafrontier.eu/search?keyword=EM:01169 + EM:01235 STOCK Dp(2Hoxd11)6Ddu/Orl EMMA embryo B6/129-HoxD, P11 Dup mutant strain MGI:5289967 Dp(2Hoxd11)6Ddu duplication, Chr 2, Denis Duboule 6 MGI:5288507 Dp(2Hoxd11)6Ddu duplication, Chr 2, Denis Duboule 6 https://www.infrafrontier.eu/search?keyword=EM:01235 + EM:05778 STOCK Dp(16App-Runx1)5Yah/Orl EMMA embryo Dp(16App-Runx1)5Yah mutant strain MGI:5789045 Dp(16App-Runx1)5Yah duplication, Chr 16, Yann Herault 5 MGI:5789044 Dp(16App-Runx1)5Yah duplication, Chr 16, Yann Herault 5 https://www.infrafrontier.eu/search?keyword=EM:05778 + EM:05778 STOCK Dp(16App-Runx1)5Yah/Orl EMMA sperm Dp(16App-Runx1)5Yah mutant strain MGI:5789045 Dp(16App-Runx1)5Yah duplication, Chr 16, Yann Herault 5 MGI:5789044 Dp(16App-Runx1)5Yah duplication, Chr 16, Yann Herault 5 https://www.infrafrontier.eu/search?keyword=EM:05778 + EM:09996 STOCK Dnajc5b/IcsOrl EMMA sperm HEPD0532_4_C06, E256-HEPD0532_4_C06 mutant strain MGI:4434677 Dnajc5b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913576 Dnajc5b DnaJ heat shock protein family (Hsp40) member C5 beta https://www.infrafrontier.eu/search?keyword=EM:09996 + EM:05255 STOCK Dnah5/Cnbc EMMA embryo SI-Dnahc5-spontaneous mutant mutant strain MGI:5904965 Dnah5 hydrocephalus with situs inversus or heterotaxy MGI:107718 Dnah5 dynein, axonemal, heavy chain 5 https://www.infrafrontier.eu/search?keyword=EM:05255 + EM:02531 STOCK Dnah11/H EMMA embryo iv, STOCK Dnahc11/H mutant strain MGI:1856917 Dnah11 situs inversus viscerum MGI:1100864 Dnah11 dynein, axonemal, heavy chain 11 https://www.infrafrontier.eu/search?keyword=EM:02531 + EM:00390 STOCK Dmd Tg(tetO-Utrn)1Ked/H EMMA sperm Tg(UTR-TET)Ked, UTR, UTR/mdx (TEX) mutant stock MGI:1856328 Dmd X linked muscular dystrophy MGI:94909 Dmd dystrophin, muscular dystrophy https://www.infrafrontier.eu/search?keyword=EM:00390 + EM:00390 STOCK Dmd Tg(tetO-Utrn)1Ked/H EMMA sperm Tg(UTR-TET)Ked, UTR, UTR/mdx (TEX) mutant stock MGI:2448084 Tg(tetO-Utrn)1Ked transgene insertion 1, Kay E Davies MGI:5140309 Tg(tetO-Utrn)1Ked transgene insertion 1, Kay E Davies https://www.infrafrontier.eu/search?keyword=EM:00390 + EM:00391 STOCK Dmd Tg(Ckm-Dmd_iDp71)MCA-1Chmb/H EMMA sperm MCA/mdx, MCA, Tg(MCA)Ked mutant stock MGI:1856328 Dmd X linked muscular dystrophy MGI:94909 Dmd dystrophin, muscular dystrophy https://www.infrafrontier.eu/search?keyword=EM:00391 + EM:00391 STOCK Dmd Tg(Ckm-Dmd_iDp71)MCA-1Chmb/H EMMA sperm MCA/mdx, MCA, Tg(MCA)Ked mutant stock MGI:5140740 Tg(Ckm-Dmd_iDp71)MCA-1Chmb transgene insertion MCA-1, Jeffrey S Chamberlain MGI:5140736 Tg(Ckm-Dmd_iDp71)MCA-1Chmb transgene insertion MCA-1, Jeffrey S Chamberlain https://www.infrafrontier.eu/search?keyword=EM:00391 + EM:02219 STOCK Dmd Tg(ACTA1-Utrn)3Ked/H EMMA sperm TgN(FLU)Ox, Tg(ACTA1-Utrn)3Ked, TgN(FLU)Ox(Freddie), Fre line, Freddie mutant strain MGI:1856328 Dmd X linked muscular dystrophy MGI:94909 Dmd dystrophin, muscular dystrophy https://www.infrafrontier.eu/search?keyword=EM:02219 + EM:02219 STOCK Dmd Tg(ACTA1-Utrn)3Ked/H EMMA sperm TgN(FLU)Ox, Tg(ACTA1-Utrn)3Ked, TgN(FLU)Ox(Freddie), Fre line, Freddie mutant strain MGI:5566891 Tg(ACTA1-Utrn)3Ked transgene insertion 3, Kay E Davies MGI:5566890 Tg(ACTA1-Utrn)3Ked transgene insertion 3, Kay E Davies https://www.infrafrontier.eu/search?keyword=EM:02219 + EM:05637 STOCK Dlx5/Cnrm EMMA embryo Dlx5-LacZ mutant strain MGI:2180474 Dlx5 targeted mutation 1, Giovanni Levi MGI:101926 Dlx5 distal-less homeobox 5 https://www.infrafrontier.eu/search?keyword=EM:05637 + EM:10388 STOCK Dll1/Biat EMMA sperm Dll1EGF1m, CD1;129-Dll1tm1(Dll1*)Gos/Biat mutant strain MGI:5805253 Dll1 targeted mutation 9.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:10388 + EM:10370 STOCK Dll1/Kctt EMMA sperm Dll1EGF8m, CD1;129-Dll1/Kctt mutant strain MGI:5805246 Dll1 targeted mutation 8.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:10370 - EM:12225 STOCK Dll1/Biat EMMA sperm mutant strain MGI:5790945 Dll1 targeted mutation 7.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:12225 - EM:12224 STOCK Dll1/Biat EMMA sperm mutant strain MGI:5779556 Dll1 targeted mutation 4.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:12224 + EM:10394 STOCK Dll1/Kctt EMMA sperm Dll1EGF7m, CD1;129-Dll1/Kctt mutant strain MGI:5805295 Dll1 targeted mutation 15.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:10394 + EM:10393 STOCK Dll1/Kctt EMMA sperm Dll1EGF6m, CD1;129-Dll1/Kctt mutant strain MGI:5805291 Dll1 targeted mutation 14.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:10393 + EM:10392 STOCK Dll1/Biat EMMA sperm Dll1EGF5m, CD1;129-Dll1/Biat mutant strain MGI:5805267 Dll1 targeted mutation 13.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:10392 + EM:10391 STOCK Dll1/Biat EMMA sperm CD1;129-Dll1/Biat, Dll1EGF4m mutant strain MGI:5805265 Dll1 targeted mutation 12.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:10391 + EM:10390 STOCK Dll1/Biat EMMA sperm Dll1EGF3m, CD1;129-Dll1/Biat mutant strain MGI:5805263 Dll1 targeted mutation 11.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:10390 + EM:10389 STOCK Dll1/Biat EMMA sperm CD1;129-Dll1/Biat, Dll1EGF2m mutant strain MGI:5805257 Dll1 targeted mutation 10.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:10389 + EM:10589 STOCK Ddi2/Ph EMMA sperm HEPD0660_5_E02, IMG-HEPD0660_5_E02-1 mutant strain MGI:4842030 Ddi2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916067 Ddi2 DNA-damage inducible protein 2 https://www.infrafrontier.eu/search?keyword=EM:10589 + EM:10589 STOCK Ddi2/Ph EMMA live HEPD0660_5_E02, IMG-HEPD0660_5_E02-1 mutant strain MGI:4842030 Ddi2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916067 Ddi2 DNA-damage inducible protein 2 https://www.infrafrontier.eu/search?keyword=EM:10589 + EM:02489 STOCK Dbp Hlf Tef/Cnrm EMMA embryo STOCK Dbp Hlf Tef/Ibmc, HLF-KO/DBP-KO/TEF-heterozygous mutant strain MGI:2183196 Dbp targeted mutation 1, Ueli Schibler MGI:94866 Dbp D site albumin promoter binding protein https://www.infrafrontier.eu/search?keyword=EM:02489 + EM:02489 STOCK Dbp Hlf Tef/Cnrm EMMA embryo STOCK Dbp Hlf Tef/Ibmc, HLF-KO/DBP-KO/TEF-heterozygous mutant strain MGI:3045480 Hlf targeted mutation 1, Ueli Schibler MGI:96108 Hlf hepatic leukemia factor https://www.infrafrontier.eu/search?keyword=EM:02489 + EM:02489 STOCK Dbp Hlf Tef/Cnrm EMMA embryo STOCK Dbp Hlf Tef/Ibmc, HLF-KO/DBP-KO/TEF-heterozygous mutant strain MGI:3045494 Tef targeted mutation 1, Ueli Schibler MGI:98663 Tef thyrotroph embryonic factor https://www.infrafrontier.eu/search?keyword=EM:02489 + EM:09624 STOCK Dbnl/CipheOrl EMMA sperm EPD0504_4_A04 mutant strain MGI:4451400 Dbnl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:700006 Dbnl drebrin-like https://www.infrafrontier.eu/search?keyword=EM:09624 + EM:07405 STOCK Cyld/Flmg EMMA embryo Cyldtm1.1Gmos, Cylddelta9 mutant strain MGI:4819959 Cyld targeted mutation 1.1, George Mosialos MGI:1921506 Cyld CYLD lysine 63 deubiquitinase https://www.infrafrontier.eu/search?keyword=EM:07405 + EM:07405 STOCK Cyld/Flmg EMMA sperm Cyldtm1.1Gmos, Cylddelta9 mutant strain MGI:4819959 Cyld targeted mutation 1.1, George Mosialos MGI:1921506 Cyld CYLD lysine 63 deubiquitinase https://www.infrafrontier.eu/search?keyword=EM:07405 + EM:10588 STOCK Cul4b/Ph EMMA sperm HEPD0735_3_E03, IMG-HEPD0735_3_E03-1 mutant strain MGI:5050183 Cul4b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3034471 Cul4b cullin 4B https://www.infrafrontier.eu/search?keyword=EM:10588 + EM:10587 STOCK Cul4a/Ph EMMA sperm HEPD0649_1_F11, IMG-HEPD0649_1_F11-1 mutant strain MGI:4461484 Cul4a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914487 Cul4a cullin 4A https://www.infrafrontier.eu/search?keyword=EM:10587 + EM:00136 STOCK Ctsl/Ieg EMMA embryo (house mouse)-Ctsl/Ieg, Nkt mutant strain MGI:1889860 Ctsl nackt MGI:88564 Ctsl cathepsin L https://www.infrafrontier.eu/search?keyword=EM:00136 + EM:09118 STOCK Csf2rb/CipheOrl EMMA sperm HEPD0596_1_D09 mutant strain MGI:4460364 Csf2rb targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1339759 Csf2rb colony stimulating factor 2 receptor, beta, low-affinity (granulocyte-macrophage) https://www.infrafrontier.eu/search?keyword=EM:09118 + EM:00612 STOCK Col4a1/H EMMA embryo Svc, C3H;C-Svc/H, GENA291, C3H;C-Col4a1/H mutant strain MGI:2178448 Col4a1 small with vacuolar cataract MGI:88454 Col4a1 collagen, type IV, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:00612 + EM:00612 STOCK Col4a1/H EMMA sperm Svc, C3H;C-Svc/H, GENA291, C3H;C-Col4a1/H mutant strain MGI:2178448 Col4a1 small with vacuolar cataract MGI:88454 Col4a1 collagen, type IV, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:00612 + EM:00379 STOCK Col4a1/H EMMA embryo GENA257, C3H;C-Raw/H, C3H;C-Col4a1/H mutant strain MGI:2178446 Col4a1 retinal arteriolar wiring MGI:88454 Col4a1 collagen, type IV, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:00379 + EM:00379 STOCK Col4a1/H EMMA sperm GENA257, C3H;C-Raw/H, C3H;C-Col4a1/H mutant strain MGI:2178446 Col4a1 retinal arteriolar wiring MGI:88454 Col4a1 collagen, type IV, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:00379 - EM:12097 STOCK Chia1/Wtsi EMMA embryo mutant strain MGI:4363305 Chia1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1932052 Chia1 chitinase, acidic 1 https://www.infrafrontier.eu/search?keyword=EM:12097 ? EM:12825 STOCK Cfap43/Biat EMMA sperm mutant strain Cfap43 Cfap43 MGI:1289258 Cfap43 cilia and flagella associated protein 43 https://www.infrafrontier.eu/search?keyword=EM:12825 ? EM:12396 STOCK Cfap157/Biat EMMA sperm mutant strain MGI:5907283 Cfap157 targeted mutation 1d, Helmholtz Zentrum Muenchen GmbH MGI:2447809 Cfap157 cilia and flagella associated protein 157 https://www.infrafrontier.eu/search?keyword=EM:12396 + EM:07170 STOCK Cers6/Cnrm EMMA embryo CerS6KILacZ mutant strain MGI:5523623 Cers6 targeted mutation 1.1, Klaus Willecke MGI:2442564 Cers6 ceramide synthase 6 https://www.infrafrontier.eu/search?keyword=EM:07170 + EM:07170 STOCK Cers6/Cnrm EMMA sperm CerS6KILacZ mutant strain MGI:5523623 Cers6 targeted mutation 1.1, Klaus Willecke MGI:2442564 Cers6 ceramide synthase 6 https://www.infrafrontier.eu/search?keyword=EM:07170 - EM:07171 STOCK Cers4/Cnrm EMMA embryo mutant strain MGI:5638668 Cers4 targeted mutation 1.1, Klaus Willecke MGI:1914510 Cers4 ceramide synthase 4 https://www.infrafrontier.eu/search?keyword=EM:07171 - EM:07171 STOCK Cers4/Cnrm EMMA sperm mutant strain MGI:5638668 Cers4 targeted mutation 1.1, Klaus Willecke MGI:1914510 Cers4 ceramide synthase 4 https://www.infrafrontier.eu/search?keyword=EM:07171 + EM:07163 STOCK Cers1/Cnrm EMMA embryo CerS1KO mutant strain MGI:5475110 Cers1 targeted mutation 1.1, Klaus Willecke MGI:2136690 Cers1 ceramide synthase 1 https://www.infrafrontier.eu/search?keyword=EM:07163 + EM:07163 STOCK Cers1/Cnrm EMMA sperm CerS1KO mutant strain MGI:5475110 Cers1 targeted mutation 1.1, Klaus Willecke MGI:2136690 Cers1 ceramide synthase 1 https://www.infrafrontier.eu/search?keyword=EM:07163 + EM:04677 STOCK Cebpb/Kctt EMMA embryo Cebpbfl (ICER/129Sv/C57BL6), STOCK Cebpb/Kctt mutant strain MGI:6260173 Cebpb targeted mutation 1.1, Magnus Nord MGI:88373 Cebpb CCAAT/enhancer binding protein (C/EBP), beta https://www.infrafrontier.eu/search?keyword=EM:04677 + EM:04995 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a INK4a-/- mutant strain MGI:2384177 Cdkn2a targeted mutation 2.1, Ronald DePinho MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/search?keyword=EM:04995 + EM:04995 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a INK4a-/- mutant strain MGI:5648077 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University MGI:5648074 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University https://www.infrafrontier.eu/search?keyword=EM:04995 + EM:04997 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a Ink4a-Arf-/- mutant strain MGI:1857942 Cdkn2a targeted mutation 1, Ronald DePinho MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/search?keyword=EM:04997 + EM:04997 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a Ink4a-Arf-/- mutant strain MGI:5648077 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University MGI:5648074 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University https://www.infrafrontier.eu/search?keyword=EM:04997 + EM:04996 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a Arf-/- mutant strain MGI:5648077 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University MGI:5648074 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University https://www.infrafrontier.eu/search?keyword=EM:04996 + EM:04996 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a Arf-/- mutant strain MGI:1926877 Cdkn2a targeted mutation 1, Charles J Scherr MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/search?keyword=EM:04996 - EM:05879 STOCK Cdkn2a/WtsiIeg EMMA embryo mutant strain MGI:4460436 Cdkn2a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/search?keyword=EM:05879 - EM:07633 STOCK Cdk8/IcsOrl EMMA sperm mutant strain MGI:4842014 Cdk8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1196224 Cdk8 cyclin-dependent kinase 8 https://www.infrafrontier.eu/search?keyword=EM:07633 + EM:06841 STOCK Cdk7/Cnbc EMMA sperm Cdk7lox mutant strain MGI:5429213 Cdk7 gene trap D032B11, 1.1, German Gene Trap Consortium MGI:102956 Cdk7 cyclin-dependent kinase 7 https://www.infrafrontier.eu/search?keyword=EM:06841 + EM:06842 STOCK Cdk6 Cdk4/Cnbc EMMA sperm Cdk4tm1Bbd; Cdk6R31C, Cdk4R24C; Cdk6R31C mutant strain MGI:5141514 Cdk6 targeted mutation 2.1, Philip Hinds MGI:1277162 Cdk6 cyclin-dependent kinase 6 https://www.infrafrontier.eu/search?keyword=EM:06842 + EM:06842 STOCK Cdk6 Cdk4/Cnbc EMMA sperm Cdk4tm1Bbd; Cdk6R31C, Cdk4R24C; Cdk6R31C mutant strain MGI:2154520 Cdk4 targeted mutation 1, Mariano Barbacid MGI:88357 Cdk4 cyclin-dependent kinase 4 https://www.infrafrontier.eu/search?keyword=EM:06842 - EM:05702 STOCK Cdk5rap2/WtsiIeg EMMA sperm mutant strain MGI:4433427 Cdk5rap2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384875 Cdk5rap2 CDK5 regulatory subunit associated protein 2 https://www.infrafrontier.eu/search?keyword=EM:05702 + EM:00197 STOCK Cdk5rap2/Ieg EMMA embryo STOCK an/Ieg, (house mouse)-an/Ieg, an mutant strain MGI:1856646 Cdk5rap2 Hertwig's anemia MGI:2384875 Cdk5rap2 CDK5 regulatory subunit associated protein 2 https://www.infrafrontier.eu/search?keyword=EM:00197 + EM:08029 STOCK Cdk4/Cnbc EMMA sperm Cdk4, Cd4<->, Cdk4 KO mutant strain MGI:3759558 Cdk4 targeted mutation 2.1, Mariano Barbacid MGI:88357 Cdk4 cyclin-dependent kinase 4 https://www.infrafrontier.eu/search?keyword=EM:08029 + EM:05931 STOCK Cdk2/Cnbc EMMA sperm mutant strain MGI:3759555 Cdk2 targeted mutation 2, Sagrario Ortega MGI:104772 Cdk2 cyclin-dependent kinase 2 https://www.infrafrontier.eu/search?keyword=EM:05931 + EM:05941 STOCK Cdk2/Cnbc EMMA embryo mutant strain MGI:2675585 Cdk2 targeted mutation 1, Sagrario Ortega MGI:104772 Cdk2 cyclin-dependent kinase 2 https://www.infrafrontier.eu/search?keyword=EM:05941 + EM:04896 STOCK Cdh23/WtsiCnbc EMMA embryo Waltzer mutant strain MGI:1856228 Cdh23 waltzer MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/search?keyword=EM:04896 + EM:01316 STOCK Cdh23/WtsiH EMMA sperm v, v(ALB) mutant stock MGI:1857310 Cdh23 Albany waltzer MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/search?keyword=EM:01316 + EM:06117 STOCK Cdc20/Cnbc EMMA sperm mutant strain MGI:4887480 Cdc20 targeted mutation 1.1, Marcos Malumbres MGI:1859866 Cdc20 cell division cycle 20 https://www.infrafrontier.eu/search?keyword=EM:06117 + EM:09989 STOCK Ccdc189/IcsOrl EMMA sperm STOCK Gm166/IcsOrl, HEPD0530_3_B05 mutant strain MGI:4434616 Ccdc189 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2685012 Ccdc189 coiled-coil domain containing 189 https://www.infrafrontier.eu/search?keyword=EM:09989 + EM:08421 STOCK Cacna2d1/AschwAdlpnH EMMA sperm mutant strain MGI:4353680 Cacna2d1 targeted mutation 1, Arnold Schwartz MGI:88295 Cacna2d1 calcium channel, voltage-dependent, alpha2/delta subunit 1 https://www.infrafrontier.eu/search?keyword=EM:08421 + EM:05944 STOCK Braf/Cnbc EMMA sperm mutant strain MGI:4946645 Braf targeted mutation 1, Mariano Barbacid MGI:88190 Braf Braf transforming gene https://www.infrafrontier.eu/search?keyword=EM:05944 + EM:02513 STOCK Bmp7/H EMMA embryo Bmp7 LacZ mutant strain MGI:2136986 Bmp7 targeted mutation 2, Elizabeth J Robertson MGI:103302 Bmp7 bone morphogenetic protein 7 https://www.infrafrontier.eu/search?keyword=EM:02513 + EM:02198 STOCK Bmp7/H EMMA embryo BMP7 neo mutant strain MGI:1857654 Bmp7 targeted mutation 1, Elizabeth J Robertson MGI:103302 Bmp7 bone morphogenetic protein 7 https://www.infrafrontier.eu/search?keyword=EM:02198 + EM:02505 STOCK Bmp6/H EMMA embryo CD1;129-Bmp6/H mutant strain MGI:2136985 Bmp6 targeted mutation 1, Elizabeth J Robertson MGI:88182 Bmp6 bone morphogenetic protein 6 https://www.infrafrontier.eu/search?keyword=EM:02505 + EM:00381 STOCK Bhv26/H EMMA sperm BHV26 mutant strain MGI:5646243 Bhv26 behavioral mutation 26 MGI:5646241 Bhv26 behavioral mutation 26 https://www.infrafrontier.eu/search?keyword=EM:00381 + EM:09988 STOCK Bag1/IcsOrl EMMA sperm HEPD0505_2_B06, ICS-HEPD0505_2_B06-1 mutant strain MGI:4434714 Bag1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108047 Bag1 BCL2-associated athanogene 1 https://www.infrafrontier.eu/search?keyword=EM:09988 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/search?keyword=EM:01783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:01783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/search?keyword=EM:01783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:01783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA live STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/search?keyword=EM:01783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA live STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:01783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA live STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/search?keyword=EM:01783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA live STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:01783 - EM:05922 STOCK B2m H2-Ab1 Tg(Cd4-EGFP)1Lt Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:05922 - EM:05922 STOCK B2m H2-Ab1 Tg(Cd4-EGFP)1Lt Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/search?keyword=EM:05922 - EM:05922 STOCK B2m H2-Ab1 Tg(Cd4-EGFP)1Lt Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/search?keyword=EM:05922 - EM:05922 STOCK B2m H2-Ab1 Tg(Cd4-EGFP)1Lt Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:05922 - EM:05922 STOCK B2m H2-Ab1 Tg(Cd4-EGFP)1Lt Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived mutant strain MGI:3720219 Tg(Cd4-EGFP)1Lt transgene insertion 1, Edward Leiter MGI:3720218 Tg(Cd4-EGFP)1Lt transgene insertion 1, Edward Leiter https://www.infrafrontier.eu/search?keyword=EM:05922 ? EM:10977 STOCK B2m H2-Ab1 Foxp3 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:10977 ? EM:10977 STOCK B2m H2-Ab1 Foxp3 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain Foxp3 H2-Ab1 Foxp3 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:10977 ? EM:10977 STOCK B2m H2-Ab1 Foxp3 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/search?keyword=EM:10977 ? EM:10977 STOCK B2m H2-Ab1 Foxp3 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/search?keyword=EM:10977 + EM:01789 STOCK Axin2/Ieg EMMA embryo CG;129P2-Axin2/Ieg, B6.129P2-Axin2/Ieg, Conductin (Axin2)-lacZ mutant strain MGI:3579503 Axin2 targeted mutation 1, Walter Birchmeier MGI:1270862 Axin2 axin 2 https://www.infrafrontier.eu/search?keyword=EM:01789 + EM:02424 STOCK Axd/Cnrm EMMA embryo C.Cg-Axd/Ibcm, BALB/c - Axial defects, C.Cg-Axd/Cnrm mutant strain MGI:1856670 Axd axial defects MGI:88125 Axd axial defects https://www.infrafrontier.eu/search?keyword=EM:02424 + EM:10409 STOCK Avil/Cnrm EMMA embryo Avil-iDTR, STOCK Avil/Cnrm mutant strain MGI:5805490 Avil targeted mutation 1, Paul A Heppenstall MGI:1333798 Avil advillin https://www.infrafrontier.eu/search?keyword=EM:10409 + EM:10409 STOCK Avil/Cnrm EMMA sperm Avil-iDTR, STOCK Avil/Cnrm mutant strain MGI:5805490 Avil targeted mutation 1, Paul A Heppenstall MGI:1333798 Avil advillin https://www.infrafrontier.eu/search?keyword=EM:10409 + EM:01886 STOCK Aven/Ieg EMMA embryo B6;129-Aven/Ieg, Aven knockout mutant stock MGI:5317759 Aven targeted mutation 1.1, Martin Zoernig MGI:1921518 Aven apoptosis, caspase activation inhibitor https://www.infrafrontier.eu/search?keyword=EM:01886 + EM:06109 STOCK Aurkb/Cnbc EMMA embryo mutant strain MGI:5056426 Aurkb targeted mutation 1.1, Marcos Malumbres MGI:107168 Aurkb aurora kinase B https://www.infrafrontier.eu/search?keyword=EM:06109 + EM:06109 STOCK Aurkb/Cnbc EMMA sperm mutant strain MGI:5056426 Aurkb targeted mutation 1.1, Marcos Malumbres MGI:107168 Aurkb aurora kinase B https://www.infrafrontier.eu/search?keyword=EM:06109 + EM:06220 STOCK Atr/Cnbc EMMA sperm mutant strain MGI:4355009 Atr targeted mutation 2, Oscar Fernandez-Capetillo MGI:108028 Atr ataxia telangiectasia and Rad3 related https://www.infrafrontier.eu/search?keyword=EM:06220 + EM:06221 STOCK Atr/Cnbc EMMA sperm mutant strain MGI:4355008 Atr targeted mutation 1, Oscar Fernandez-Capetillo MGI:108028 Atr ataxia telangiectasia and Rad3 related https://www.infrafrontier.eu/search?keyword=EM:06221 + EM:07148 STOCK Atat1/Cnrm EMMA embryo Atat1 Flx mutant strain MGI:5549959 Atat1 targeted mutation 1.1, Paul A Heppenstall MGI:1913869 Atat1 alpha tubulin acetyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:07148 + EM:07148 STOCK Atat1/Cnrm EMMA sperm Atat1 Flx mutant strain MGI:5549959 Atat1 targeted mutation 1.1, Paul A Heppenstall MGI:1913869 Atat1 alpha tubulin acetyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:07148 + EM:10742 STOCK Arpc2/WtsiBiat EMMA sperm B6Dnk;B6Brd;B6N-Tyr Arpc2/WtsiBiat mutant strain MGI:5819114 Arpc2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1923959 Arpc2 actin related protein 2/3 complex, subunit 2 https://www.infrafrontier.eu/search?keyword=EM:10742 + EM:02443 STOCK Arap2/H EMMA sperm PARX, A9 mutant strain MGI:5514159 Arap2 gene trap mutation 9A, Katherine A Vallis MGI:2684416 Arap2 ArfGAP with RhoGAP domain, ankyrin repeat and PH domain 2 https://www.infrafrontier.eu/search?keyword=EM:02443 + EM:05566 STOCK Apc/Orl EMMA embryo B6;129P2-Apc/Orl, Apc-lox-exon14 mutant strain MGI:3521822 Apc targeted mutation 2, Christine Perret MGI:88039 Apc APC, WNT signaling pathway regulator https://www.infrafrontier.eu/search?keyword=EM:05566 + EM:05566 STOCK Apc/Orl EMMA sperm B6;129P2-Apc/Orl, Apc-lox-exon14 mutant strain MGI:3521822 Apc targeted mutation 2, Christine Perret MGI:88039 Apc APC, WNT signaling pathway regulator https://www.infrafrontier.eu/search?keyword=EM:05566 - EM:07651 STOCK Ankrd11/IcsOrl EMMA archived mutant strain MGI:4842657 Ankrd11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924337 Ankrd11 ankyrin repeat domain 11 https://www.infrafrontier.eu/search?keyword=EM:07651 + EM:11043 STOCK Angptl3/Ph EMMA live EPD0853_3_C10, IMG-EPD0853_3_C10-1 mutant strain MGI:5287774 Angptl3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1353627 Angptl3 angiopoietin-like 3 https://www.infrafrontier.eu/search?keyword=EM:11043 + EM:02255 STOCK andra/H EMMA sperm Andromeda mutant strain MGI:5568106 andra andromeda MGI:5568104 andra andromeda https://www.infrafrontier.eu/search?keyword=EM:02255 + EM:02254 STOCK anaya/H EMMA sperm Anaya mutant strain MGI:5568096 anaya anaya MGI:5568094 anaya anaya https://www.infrafrontier.eu/search?keyword=EM:02254 + EM:02253 STOCK anan/H EMMA sperm Ananisi mutant strain MGI:5568076 anan ananisi MGI:5568074 anan ananisi https://www.infrafrontier.eu/search?keyword=EM:02253 + EM:09992 STOCK Ahsa2/IcsOrl EMMA sperm EPD0209_2_C03 mutant strain MGI:4434221 Ahsa2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916133 Ahsa2 AHA1, activator of heat shock protein ATPase 2 https://www.infrafrontier.eu/search?keyword=EM:09992 + EM:05690 STOCK Actr3/Ieg EMMA archived Actr3 (ARP3 actin-related protein 3 homolog (yeast)) mutant strain MGI:3765916 Actr3 gene trap mutation A009F03, Franz Vauti MGI:1921367 Actr3 ARP3 actin-related protein 3 https://www.infrafrontier.eu/search?keyword=EM:05690 + EM:05448 STOCK 2700049A03Rik/H EMMA sperm Talpid3 Floxed Mutant, 2700049A03Rik mutant strain MGI:5287574 2700049A03Rik targeted mutation 1.1, TaconicArtemis MGI:1924217 2700049A03Rik RIKEN cDNA 2700049A03 gene https://www.infrafrontier.eu/search?keyword=EM:05448 - EM:12096 STOCK 2210016L21Rik/Wtsi EMMA embryo mutant strain MGI:4419127 2210016L21Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919607 2210016L21Rik RIKEN cDNA 2210016L21 gene https://www.infrafrontier.eu/search?keyword=EM:12096 ? EM:09784 StarD10-F10 EMMA sperm mutant strain mouse StarD10 mouse StarD10 https://www.infrafrontier.eu/search?keyword=EM:09784 ? EM:09724 SPC tetCre loxP VEGF (conditional inducible alveolar epithelial cell VEGF knockout mouse) EMMA sperm mutant strain TetCreLoxPVEGF TetCreLoxPVEGF TetCreLoxPVEGF TetCreLoxPVEGF https://www.infrafrontier.eu/search?keyword=EM:09724 ? EM:11118 Sox2deltaOBS EMMA embryo mutant strain MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:11118 ? EM:11118 Sox2deltaOBS EMMA sperm mutant strain MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:11118 ? EM:13085 Slc20a2 EMMA sperm mutant strain Slc20a2 Slc20a2 MGI:97851 Slc20a2 solute carrier family 20, member 2 https://www.infrafrontier.eu/search?keyword=EM:13085 - EM:11807 Slc1a3-CreERT2 EMMA sperm mutant strain MGI:6414570 Slc1a3 targeted mutation 1.1, Walker Jackson MGI:99917 Slc1a3 solute carrier family 1 (glial high affinity glutamate transporter), member 3 https://www.infrafrontier.eu/search?keyword=EM:11807 ? EM:12462 SKH1/Alox12bflox/K14CreJ EMMA archived mutant strain MGI:5908393 Krt14 targeted mutation 1.1, Hermann-Josef Grone MGI:96688 Krt14 keratin 14 https://www.infrafrontier.eu/search?keyword=EM:12462 ? EM:12462 SKH1/Alox12bflox/K14CreJ EMMA archived mutant strain Alox12b targeted mutation Peter Krieg MGI:1274782 Alox12b arachidonate 12-lipoxygenase, 12R type https://www.infrafrontier.eu/search?keyword=EM:12462 - EM:07421 SJLJ;129S-Lgals1/H EMMA sperm mutant strain MGI:2181809 Lgals1 targeted mutation 1, Elizabeth J Robertson MGI:96777 Lgals1 lectin, galactose binding, soluble 1 https://www.infrafrontier.eu/search?keyword=EM:07421 - EM:07422 SJL;Cg-Lgals3/H EMMA sperm mutant strain MGI:2183057 Lgals3 targeted mutation 1, Francoise Poirier MGI:96778 Lgals3 lectin, galactose binding, soluble 3 https://www.infrafrontier.eu/search?keyword=EM:07422 + EM:04546 SJL.129(B6)-Nr1i2/H EMMA sperm SJL/PXR-/-, SJL.Cg-Nr1i2/H mutant strain MGI:3609633 Nr1i2 targeted mutation 1, Steven A Kliewer MGI:1337040 Nr1i2 nuclear receptor subfamily 1, group I, member 2 https://www.infrafrontier.eu/search?keyword=EM:04546 - EM:12763 Siglec-F KO mouse EMMA sperm mutant strain SiglecF SiglecF MGI:2681107 Siglecf sialic acid binding Ig-like lectin F https://www.infrafrontier.eu/search?keyword=EM:12763 ? EM:12765 Siglec-1 (CD169) KO mouse EMMA sperm mutant strain MGI:3617694 Siglec1 targeted mutation 1, Paul R Crocker MGI:99668 Siglec1 sialic acid binding Ig-like lectin 1, sialoadhesin https://www.infrafrontier.eu/search?keyword=EM:12765 - EM:12927 SHP KO EMMA embryo unclassified Tm1 Tm1 MGI:1346344 Nr0b2 nuclear receptor subfamily 0, group B, member 2 https://www.infrafrontier.eu/search?keyword=EM:12927 - EM:12926 SHP CM EMMA embryo unclassified Tm1 Tm1 MGI:1346344 Nr0b2 nuclear receptor subfamily 0, group B, member 2 https://www.infrafrontier.eu/search?keyword=EM:12926 ? EM:05678 Rsu1 (Ras suppressor protein 1) EMMA sperm mutant strain Rsu1 Rsu1 MGI:103040 Rsu1 Ras suppressor protein 1 https://www.infrafrontier.eu/search?keyword=EM:05678 - EM:12428 Rnf2 I53A (Ring1B I53A) EMMA sperm mutant strain MGI:6414568 Rnf2 targeted mutation 1.1, MRC Human Genetics Unit MGI:1101759 Rnf2 ring finger protein 2 https://www.infrafrontier.eu/search?keyword=EM:12428 + EM:06764 RIII EMMA embryo mutant strain RIII RIII RIII RIII https://www.infrafrontier.eu/search?keyword=EM:06764 + EM:06764 RIII EMMA sperm mutant strain RIII RIII RIII RIII https://www.infrafrontier.eu/search?keyword=EM:06764 - EM:12933 RevErbb KO EMMA embryo unclassified Tm1 Tm1 MGI:2449205 Nr1d2 nuclear receptor subfamily 1, group D, member 2 https://www.infrafrontier.eu/search?keyword=EM:12933 - EM:12932 RevErbb CM EMMA embryo unclassified Tm1 Tm1 MGI:2449205 Nr1d2 nuclear receptor subfamily 1, group D, member 2 https://www.infrafrontier.eu/search?keyword=EM:12932 - EM:08405 RENF EMMA sperm mutant strain MGI:5435289 Xdh Renal Failure MGI:98973 Xdh xanthine dehydrogenase https://www.infrafrontier.eu/search?keyword=EM:08405 ? EM:11359 Rb(8.12)5Bnr_BALB/c EMMA sperm mutant strain Rb(8.12)5Bnr Robertsonian translocation, Chr 8 and 12, Universitat Bonn/Rhein 5 MGI:103992 Rb(8.12)5Bnr Robertsonian translocation, Chr 8 and 12, Universitat Bonn/Rhein 5 https://www.infrafrontier.eu/search?keyword=EM:11359 ? EM:11358 Rb(8.12)5Bnr EMMA sperm mutant strain Rb(8.12)5Bnr Robertsonian translocation, Chr 8 and 12, Universitat Bonn/Rhein 5 MGI:103992 Rb(8.12)5Bnr Robertsonian translocation, Chr 8 and 12, Universitat Bonn/Rhein 5 https://www.infrafrontier.eu/search?keyword=EM:11358 ? EM:11357 Rb(6.12)3Sic EMMA sperm mutant strain Rb(6.12)3Sic Robertsonian translocation, Chr 6 and 12, Sicily 3 MGI:103896 Rb(6.12)3Sic Robertsonian translocation, Chr 6 and 12, Sicily 3 https://www.infrafrontier.eu/search?keyword=EM:11357 ? EM:11356 Rb(4.12)9Bnr EMMA sperm mutant strain Rb(4.12)9Bnr Robertsonian translocation, Chr 4 MGI:103796 Rb(4.12)9Bnr Robertsonian translocation, Chr 4 and 12, Universitat Bonn/Rhein 9 https://www.infrafrontier.eu/search?keyword=EM:11356 ? EM:12461 RalGDS Floxed Mouse EMMA sperm mutant strain MGI:6317416 Ralgds targeted mutation 2, Christopher J Marshall MGI:107485 Ralgds ral guanine nucleotide dissociation stimulator https://www.infrafrontier.eu/search?keyword=EM:12461 - EM:12221 R6/2_700 EMMA sperm B6;CBA-Tg(HDexon1)62Gpb/700Ajfm mutant strain MGI:2386951 Tg(HDexon1)62Gpb transgene insertion 62, Gillian Bates MGI:2653601 Tg(HDexon1)62Gpb transgene insertion 62, Gillian Bates https://www.infrafrontier.eu/search?keyword=EM:12221 - EM:12220 R6/2_500 EMMA sperm B6;CBA-Tg(HDexon1)62Gpb/500Ajfm mutant strain MGI:2386951 Tg(HDexon1)62Gpb transgene insertion 62, Gillian Bates MGI:2653601 Tg(HDexon1)62Gpb transgene insertion 62, Gillian Bates https://www.infrafrontier.eu/search?keyword=EM:12220 ? EM:11937 R6/2_50 EMMA sperm mutant strain MGI:2386951 Tg(HDexon1)62Gpb transgene insertion 62, Gillian Bates MGI:2653601 Tg(HDexon1)62Gpb transgene insertion 62, Gillian Bates https://www.infrafrontier.eu/search?keyword=EM:11937 - EM:12219 R6/2_48i EMMA sperm mutant strain MGI:2386951 Tg(HDexon1)62Gpb transgene insertion 62, Gillian Bates MGI:2653601 Tg(HDexon1)62Gpb transgene insertion 62, Gillian Bates https://www.infrafrontier.eu/search?keyword=EM:12219 - EM:12703 R6/2_450 EMMA sperm mutant strain MGI:2386951 Tg(HDexon1)62Gpb transgene insertion 62, Gillian Bates MGI:2653601 Tg(HDexon1)62Gpb transgene insertion 62, Gillian Bates https://www.infrafrontier.eu/search?keyword=EM:12703 - EM:12218 R6/2_40 EMMA sperm B6;CBA-Tg(HDexon1)62Gpb/40Ajfm mutant strain MGI:2386951 Tg(HDexon1)62Gpb transgene insertion 62, Gillian Bates MGI:2653601 Tg(HDexon1)62Gpb transgene insertion 62, Gillian Bates https://www.infrafrontier.eu/search?keyword=EM:12218 - EM:12946 PXR KO EMMA embryo unclassified Tm1 Tm1 MGI:1337040 Nr1i2 nuclear receptor subfamily 1, group I, member 2 https://www.infrafrontier.eu/search?keyword=EM:12946 - EM:12947 PXR CM EMMA embryo unclassified Tm1 Tm1 MGI:1337040 Nr1i2 nuclear receptor subfamily 1, group I, member 2 https://www.infrafrontier.eu/search?keyword=EM:12947 - EM:12930 PPARa CM EMMA embryo unclassified Tm1 Tm1 MGI:104740 Ppara peroxisome proliferator activated receptor alpha https://www.infrafrontier.eu/search?keyword=EM:12930 - EM:01285 PLAY19 EMMA sperm C3H;C-Play19/H, C3C-Play19/H mutant strain MGI:5496405 Play19 Play19 MGI:5495800 Play19 Play19 https://www.infrafrontier.eu/search?keyword=EM:01285 - EM:12993 PGC1-b CM EMMA embryo unclassified Tm1 Tm1 MGI:2444934 Ppargc1b peroxisome proliferative activated receptor, gamma, coactivator 1 beta https://www.infrafrontier.eu/search?keyword=EM:12993 ? EM:07293 PER3 VNTR 5 EMMA sperm mutant strain MGI:5645738 Per3 targeted mutation 2.1, Simon Archer MGI:1277134 Per3 period circadian clock 3 https://www.infrafrontier.eu/search?keyword=EM:07293 ? EM:07292 PER3 VNTR 4 EMMA sperm mutant strain MGI:5645736 Per3 targeted mutation 1.1, Simon Archer MGI:1277134 Per3 period circadian clock 3 https://www.infrafrontier.eu/search?keyword=EM:07292 - EM:02197 PEDM/35 EMMA sperm C3H;B6-Pedm/35/H, C3H;B6-Pedm35/H mutant strain MGI:5499204 Pedm35 Pedm/35, Harwell MGI:5499187 Pedm35 Pedm35, Harwell https://www.infrafrontier.eu/search?keyword=EM:02197 - EM:02159 PEDM/14 EMMA sperm C3H;B6-Pedm14/H, C3H;B6-Pedm/14/H mutant strain MGI:5499202 Pedm14 Pedm/14, Harwell MGI:5499185 Pedm14 Pedm14, Harwell https://www.infrafrontier.eu/search?keyword=EM:02159 + EM:01165 PDT/Pas EMMA embryo polydactyly mutant strain MGI:2684436 Twist1 Pasteur MGI:98872 Twist1 twist basic helix-loop-helix transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:01165 ? EM:07263 pCAGGS-Arl13bGFP EMMA embryo mutant strain Tg(CAGGS-Arl13b-GFP) Tg(CAGGS-Arl13b-GFP) https://www.infrafrontier.eu/search?keyword=EM:07263 ? EM:11122 pCAG-Otx2ER EMMA embryo mutant strain https://www.infrafrontier.eu/search?keyword=EM:11122 ? EM:11122 pCAG-Otx2ER EMMA sperm mutant strain https://www.infrafrontier.eu/search?keyword=EM:11122 ? EM:11502 p110delta PI3K S1039A EMMA sperm mutant strain Pik3cdtm1(S1039A)Bva Pik3cdtm1(S1039A)Bva MGI:1098211 Pik3cd phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit delta https://www.infrafrontier.eu/search?keyword=EM:11502 ? EM:11633 p110beta DEL (Sv129/J background) EMMA sperm unclassified MGI:3795850 Pik3cb targeted mutation 1.1, Bart Vanhaesebroeck MGI:1922019 Pik3cb phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit beta https://www.infrafrontier.eu/search?keyword=EM:11633 ? EM:11121 Otp-CreER EMMA embryo mutant strain Otp-creER Otp-creER MGI:99835 Otp orthopedia homeobox https://www.infrafrontier.eu/search?keyword=EM:11121 ? EM:11121 Otp-CreER EMMA sperm mutant strain Otp-creER Otp-creER MGI:99835 Otp orthopedia homeobox https://www.infrafrontier.eu/search?keyword=EM:11121 ? EM:05512 NYBR1 TG targ EMMA embryo mutant strain Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:05512 + EM:04931 NOD/NckOrl EMMA embryo mutant strain NOD NOD NOD NOD https://www.infrafrontier.eu/search?keyword=EM:04931 + EM:05139 NOD.FVB-Tg(Rip-RASA1*)1Wid/Orl EMMA embryo NOD-Tg(RIP::N)1Wid mutant strain MGI:5648069 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann MGI:5648068 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann https://www.infrafrontier.eu/search?keyword=EM:05139 + EM:05139 NOD.FVB-Tg(Rip-RASA1*)1Wid/Orl EMMA sperm NOD-Tg(RIP::N)1Wid mutant strain MGI:5648069 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann MGI:5648068 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann https://www.infrafrontier.eu/search?keyword=EM:05139 + EM:00726 NOD.Cg-Tg(TcraDN32D3)86Alhn Tg(Ins2-NP)25-3Olds/Orl EMMA embryo A14-86 RIP-NP NOD mutant strain MGI:3505887 Tg(TcraDN32D3)86Alhn transgene insertion 86, Agnes Lehuen MGI:3505886 Tg(TcraDN32D3)86Alhn transgene insertion 86, Agnes Lehuen https://www.infrafrontier.eu/search?keyword=EM:00726 + EM:00726 NOD.Cg-Tg(TcraDN32D3)86Alhn Tg(Ins2-NP)25-3Olds/Orl EMMA embryo A14-86 RIP-NP NOD mutant strain MGI:3573697 Tg(Ins2-NP)25-3Olds transgene insertion 25-3, Michael BA Oldstone, MD MGI:3531505 Tg(Ins2-NP)25-3Olds transgene insertion 25-3, Michael BA Oldstone, MD https://www.infrafrontier.eu/search?keyword=EM:00726 + EM:00215 NOD.Cg-Tcra Tg(TcraCDC35)1Alhn/Orl EMMA embryo A8 Ca-/- NOD, A8, NOD.Cg-Tcra Tg(TcraCDC35)1Alhn, Valpha8 Tg Calpha<-/-> NOD mutant strain MGI:2180883 Tcra targeted mutation 1, Michael J Owen MGI:98553 Tcra T cell receptor alpha chain https://www.infrafrontier.eu/search?keyword=EM:00215 + EM:00215 NOD.Cg-Tcra Tg(TcraCDC35)1Alhn/Orl EMMA embryo A8 Ca-/- NOD, A8, NOD.Cg-Tcra Tg(TcraCDC35)1Alhn, Valpha8 Tg Calpha<-/-> NOD mutant strain MGI:3528229 Tg(TcraCDC35)1Alhn transgene insertion 1, Agnes Lehuen MGI:3528227 Tg(TcraCDC35)1Alhn transgene insertion 1, Agnes Lehuen https://www.infrafrontier.eu/search?keyword=EM:00215 + EM:01648 NOD.Cg-(D1Mit15-D1Mit359) Cd1d1/Orl EMMA embryo NOD CD1d KO, NOD.B6-L2.Cd1d-/- mutant strain MGI:2430510 Fcgr2b<+> wild type MGI:95499 Fcgr2b Fc receptor, IgG, low affinity IIb https://www.infrafrontier.eu/search?keyword=EM:01648 + EM:01648 NOD.Cg-(D1Mit15-D1Mit359) Cd1d1/Orl EMMA embryo NOD CD1d KO, NOD.B6-L2.Cd1d-/- mutant strain MGI:2180711 Cd1d1 targeted mutation 1, Luc Van Kaer MGI:107674 Cd1d1 CD1d1 antigen https://www.infrafrontier.eu/search?keyword=EM:01648 + EM:01648 NOD.Cg-(D1Mit15-D1Mit359) Cd1d1/Orl EMMA embryo NOD CD1d KO, NOD.B6-L2.Cd1d-/- mutant strain MGI:2681149 Nktcn1 C57BL/6J MGI:2681136 Nktcn1 natural killer T cell numbers 1 https://www.infrafrontier.eu/search?keyword=EM:01648 + EM:01648 NOD.Cg-(D1Mit15-D1Mit359) Cd1d1/Orl EMMA embryo NOD CD1d KO, NOD.B6-L2.Cd1d-/- mutant strain MGI:2154342 Stia1 C57BL/6J MGI:2151739 Stia1 serum transfer induced arthritis 1 https://www.infrafrontier.eu/search?keyword=EM:01648 + EM:01637 NOD.B6-Ptprc/Orl EMMA embryo NOD.CD45.2 mutant strain MGI:4819850 Ptprc b variant MGI:97810 Ptprc protein tyrosine phosphatase, receptor type, C https://www.infrafrontier.eu/search?keyword=EM:01637 + EM:00143 NOD.B6-Prf1/Cnrm EMMA embryo Pfp-KO, Prf-1(perforin)-KO, NOD-Prf1, B6.Cg-Prf1/Ibcm, B6.Cg-Prf1, NOD.B6-Prf1/Ibcm mutant strain MGI:1857235 Prf1 targeted mutation 1, Sandoz Pharmaceuticals MGI:97551 Prf1 perforin 1 (pore forming protein) https://www.infrafrontier.eu/search?keyword=EM:00143 + EM:01413 NOD.B6-Idd5(R33)/GhjOrl EMMA archived NOD.B6-Idd5-R33 mutant strain Ctla4 Ctla4 MGI:88556 Ctla4 cytotoxic T-lymphocyte-associated protein 4 https://www.infrafrontier.eu/search?keyword=EM:01413 + EM:01413 NOD.B6-Idd5(R33)/GhjOrl EMMA archived NOD.B6-Idd5-R33 mutant strain MGI:3037292 Idd5 C57BL/6 MGI:96407 Idd5 insulin dependent diabetes susceptibility 5 https://www.infrafrontier.eu/search?keyword=EM:01413 + EM:01414 NOD.B6-Idd5(R32)/GhjOrl EMMA archived NOD.B6-Idd5-R32 mutant strain MGI:3037292 Idd5 C57BL/6 MGI:96407 Idd5 insulin dependent diabetes susceptibility 5 https://www.infrafrontier.eu/search?keyword=EM:01414 + EM:01412 NOD.B6-Idd5(R198)/GhjOrl EMMA archived NOD.B6-Idd5-R198 mutant strain MGI:3037292 Idd5 C57BL/6 MGI:96407 Idd5 insulin dependent diabetes susceptibility 5 https://www.infrafrontier.eu/search?keyword=EM:01412 + EM:01390 NOD.B6-Hc<1>/Cnrm EMMA embryo NOD.B6-Hc, NOD.B6-Hc<1>/Ibcm mutant strain MGI:3044820 Hc<1> sufficient MGI:96031 Hc hemolytic complement https://www.infrafrontier.eu/search?keyword=EM:01390 + EM:01404 NOD.B6-(H2-Q4-D17Mit36)/GhjOrl EMMA archived R89, NOD.B6-C17(R289) mutant strain H2-Q4 histocompatibility 2, Q region locus 4 MGI:95933 H2-Q4 histocompatibility 2, Q region locus 4 https://www.infrafrontier.eu/search?keyword=EM:01404 + EM:01404 NOD.B6-(H2-Q4-D17Mit36)/GhjOrl EMMA archived R89, NOD.B6-C17(R289) mutant strain MGI:3525333 Idd16 C57BL/6J MGI:107544 Idd16 insulin dependent diabetes susceptibility 16 https://www.infrafrontier.eu/search?keyword=EM:01404 + EM:01711 NOD.B6-(D6Mit254-D6Mit14)/Orl EMMA embryo NOD.B6-Idd6 Klrb1c/CarOrl, NOD.B6-NK1.1 mutant strain MGI:3036668 Idd6 C57BL/6 MGI:96408 Idd6 insulin dependent diabetes susceptibility 6 https://www.infrafrontier.eu/search?keyword=EM:01711 + EM:01711 NOD.B6-(D6Mit254-D6Mit14)/Orl EMMA embryo NOD.B6-Idd6 Klrb1c/CarOrl, NOD.B6-NK1.1 mutant strain MGI:2384434 Klrb1c antigen Nk-1.1 allele MGI:107538 Klrb1c killer cell lectin-like receptor subfamily B member 1C https://www.infrafrontier.eu/search?keyword=EM:01711 + EM:01394 NOD.B6-(D1Mit359-D1Mit155)/GhjCnrm EMMA embryo NOD.B6-C1D(3), L3 mutant strain D1Mit155 DNA segment, Chr 1, Massachusetts Institute of Technology 155 MGI:91529 D1Mit155 DNA segment, Chr 1, Massachusetts Institute of Technology 155 https://www.infrafrontier.eu/search?keyword=EM:01394 + EM:01392 NOD.B6-(D1Mit302-D1Mit178)/GhjCnrm EMMA embryo R39, NOD.B6-Idd5-R39 congenic strain MGI:2158432 Idd5.1 C57BL/6J MGI:2158421 Idd5.1 insulin dependent diabetes susceptibility 5.1 https://www.infrafrontier.eu/search?keyword=EM:01392 + EM:01791 NOD.B6-(D1Mit19-D1Mit14)/GhjCnrm EMMA embryo NOD.B6-C1M mutant strain MGI:2385541 Ssial1 C57BL/6 MGI:2385531 Ssial1 susceptibility to sialadenitis 1 https://www.infrafrontier.eu/search?keyword=EM:01791 + EM:01791 NOD.B6-(D1Mit19-D1Mit14)/GhjCnrm EMMA embryo NOD.B6-C1M mutant strain Bcl2 Bcl2 MGI:88138 Bcl2 B cell leukemia/lymphoma 2 https://www.infrafrontier.eu/search?keyword=EM:01791 + EM:01396 NOD.B6-(D1Mit15-D1Mit359)/GhjCnrm EMMA embryo L2, NOD.C57BL/6-Nkt1(L2), NOD.B6-C1D(L2) mutant strain MGI:2681149 Nktcn1 C57BL/6J MGI:2681136 Nktcn1 natural killer T cell numbers 1 https://www.infrafrontier.eu/search?keyword=EM:01396 + EM:01396 NOD.B6-(D1Mit15-D1Mit359)/GhjCnrm EMMA embryo L2, NOD.C57BL/6-Nkt1(L2), NOD.B6-C1D(L2) mutant strain MGI:2430510 Fcgr2b<+> wild type MGI:95499 Fcgr2b Fc receptor, IgG, low affinity IIb https://www.infrafrontier.eu/search?keyword=EM:01396 + EM:01397 NOD.B6-(D1Mit113-D1Mit359)/GhjOrl EMMA archived NOD.B6-C1D(L6), L6 mutant strain MGI:2681149 Nktcn1 C57BL/6J MGI:2681136 Nktcn1 natural killer T cell numbers 1 https://www.infrafrontier.eu/search?keyword=EM:01397 + EM:01401 NOD.B6-(D17Mit260-D17Mit199)/GhjOrl EMMA archived R76, NOD.B6-C17(R76) mutant strain MGI:3525335 Idd23 C57BL/6J MGI:3525329 Idd23 insulin dependent diabetes susceptibility 23 https://www.infrafrontier.eu/search?keyword=EM:01401 + EM:01401 NOD.B6-(D17Mit260-D17Mit199)/GhjOrl EMMA archived R76, NOD.B6-C17(R76) mutant strain Idd16.1 C57BL/6J MGI:3579885 Idd16.1 insulin dependent diabetes susceptibility 16.1 https://www.infrafrontier.eu/search?keyword=EM:01401 + EM:01400 NOD.B6-(D17Mit248-D17Mit199)/GhjOrl EMMA archived R115, NOD.B6-C17(R115) mutant strain Idd16.1 C57BL/6J MGI:3579885 Idd16.1 insulin dependent diabetes susceptibility 16.1 https://www.infrafrontier.eu/search?keyword=EM:01400 + EM:01398 NOD.B6-(D17Mit16-D17Mit36)/GhjCnrm EMMA embryo R2, NOD.B6-C17(R2) mutant strain MGI:3037294 Idd1 C57BL/6 MGI:96400 Idd1 insulin dependent diabetes susceptibility 1 https://www.infrafrontier.eu/search?keyword=EM:01398 + EM:01398 NOD.B6-(D17Mit16-D17Mit36)/GhjCnrm EMMA embryo R2, NOD.B6-C17(R2) mutant strain MGI:3579319 H2 b variant MGI:95894 H2 histocompatibility-2, MHC https://www.infrafrontier.eu/search?keyword=EM:01398 + EM:01402 NOD.B6-(D17Mit114-D17Mit101)/Orl EMMA archived NOD.B6-C17(R76.22), NOD.B6-Idd16.1(R76.22)/Orl mutant strain Idd16.1 insulin dependent diabetes susceptibility 16.1 MGI:3579885 Idd16.1 insulin dependent diabetes susceptibility 16.1 https://www.infrafrontier.eu/search?keyword=EM:01402 + EM:01402 NOD.B6-(D17Mit114-D17Mit101)/Orl EMMA archived NOD.B6-C17(R76.22), NOD.B6-Idd16.1(R76.22)/Orl mutant strain Ceat1 chronic experimental autoimmune thyroiditis 1 MGI:3526118 Ceat1 chronic experimental autoimmune thyroiditis 1 https://www.infrafrontier.eu/search?keyword=EM:01402 + EM:01403 NOD.B6-(D17Mit113-D17Mit260)/GhjOrl EMMA archived R156, NOD.B6-C17(R156) mutant strain Idd16.2 insulin dependent diabetes susceptibility 16.2 MGI:3579886 Idd16.2 insulin dependent diabetes susceptibility 16.2 https://www.infrafrontier.eu/search?keyword=EM:01403 + EM:01403 NOD.B6-(D17Mit113-D17Mit260)/GhjOrl EMMA archived R156, NOD.B6-C17(R156) mutant strain MGI:3525335 Idd23 C57BL/6J MGI:3525329 Idd23 insulin dependent diabetes susceptibility 23 https://www.infrafrontier.eu/search?keyword=EM:01403 + EM:01403 NOD.B6-(D17Mit113-D17Mit260)/GhjOrl EMMA archived R156, NOD.B6-C17(R156) mutant strain Ceat1 chronic experimental autoimmune thyroiditis 1 MGI:3526118 Ceat1 chronic experimental autoimmune thyroiditis 1 https://www.infrafrontier.eu/search?keyword=EM:01403 + EM:01399 NOD.B6-(D17Mit113-D17Mit199)/GhjOrl EMMA archived R114, NOD.B6-C17(R114) mutant strain MGI:3525335 Idd23 C57BL/6J MGI:3525329 Idd23 insulin dependent diabetes susceptibility 23 https://www.infrafrontier.eu/search?keyword=EM:01399 + EM:01399 NOD.B6-(D17Mit113-D17Mit199)/GhjOrl EMMA archived R114, NOD.B6-C17(R114) mutant strain Ceat1 C57BL/6J MGI:3526118 Ceat1 chronic experimental autoimmune thyroiditis 1 https://www.infrafrontier.eu/search?keyword=EM:01399 + EM:01399 NOD.B6-(D17Mit113-D17Mit199)/GhjOrl EMMA archived R114, NOD.B6-C17(R114) mutant strain MGI:3525333 Idd16 C57BL/6J MGI:107544 Idd16 insulin dependent diabetes susceptibility 16 https://www.infrafrontier.eu/search?keyword=EM:01399 + EM:01803 NOD.129S6-Cd1d1/Orl EMMA embryo NOD CD1d KO mutant strain MGI:2180711 Cd1d1 targeted mutation 1, Luc Van Kaer MGI:107674 Cd1d1 CD1d1 antigen https://www.infrafrontier.eu/search?keyword=EM:01803 + EM:06909 NOD.129S2-Parp1/Ieg EMMA sperm NOD-Parp1tm1Zqw mutant strain MGI:1857862 Parp1 targeted mutation 1, Zhao-Qi Wang MGI:1340806 Parp1 poly (ADP-ribose) polymerase family, member 1 https://www.infrafrontier.eu/search?keyword=EM:06909 + EM:09914 NOD.129P2(B6)-Nos2/Ieg EMMA sperm NOD.B6;129P2-Nos2tm1Lau mutant strain MGI:1857228 Nos2 targeted mutation 1, Victor E Laubach MGI:97361 Nos2 nitric oxide synthase 2, inducible https://www.infrafrontier.eu/search?keyword=EM:09914 + EM:01638 NOD.129-Rag1 B2m H2-Ab1/Orl EMMA embryo NOD-IAbeta-beta2m-RAG1-/- mutant strain MGI:2448994 Rag1 targeted mutation 1, David Baltimore MGI:97848 Rag1 recombination activating 1 https://www.infrafrontier.eu/search?keyword=EM:01638 + EM:01638 NOD.129-Rag1 B2m H2-Ab1/Orl EMMA embryo NOD-IAbeta-beta2m-RAG1-/- mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:01638 + EM:01638 NOD.129-Rag1 B2m H2-Ab1/Orl EMMA embryo NOD-IAbeta-beta2m-RAG1-/- mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:01638 + EM:01422 NOD.129-Fasl/Orl EMMA embryo FasLfl/fl mutant strain MGI:3032852 Fasl targeted mutation 1, Matthieu Levi-Strauss MGI:99255 Fasl Fas ligand (TNF superfamily, member 6) https://www.infrafrontier.eu/search?keyword=EM:01422 + EM:00213 NOD.129(B6)-B2m H2-Ab1/DoiLpfOrl EMMA embryo NOD.129(B6)-B2m H2-Ab1/DimLpfOrl, Nod-beta2M-IAbeta, NOD.129(B6)-B2m H2-Ab1, NOD.129(B6)-B2m H2-Ab1/DimLpfCiml mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:00213 + EM:00213 NOD.129(B6)-B2m H2-Ab1/DoiLpfOrl EMMA embryo NOD.129(B6)-B2m H2-Ab1/DimLpfOrl, Nod-beta2M-IAbeta, NOD.129(B6)-B2m H2-Ab1, NOD.129(B6)-B2m H2-Ab1/DimLpfCiml mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:00213 + EM:00204 NOD-Tg(TcraDN32D3)78Alhn/Orl EMMA embryo NOD-Tg(TcraDN32D3)78Alhn/Ciml, NOD-Tg(TcraCD1d1)78Alhn, A14-78 NOD, NOD-Tg(TcraDN32D3)78Alhn mutant strain MGI:3526073 Tg(TcraDN32D3)78Alhn transgene insertion 78, Agnes Lehuen MGI:3526031 Tg(TcraDN32D3)78Alhn transgene insertion 78, Agnes Lehuen https://www.infrafrontier.eu/search?keyword=EM:00204 + EM:00214 NOD-Tg(TcraDN32D3)10Alhn/Orl EMMA embryo A14-10 NOD, NOD-Tg(TcraCD1d1)10Alhn, NOD-Tg(TcraDN32D3)10Alhn mutant strain MGI:3505746 Tg(TcraDN32D3)10Alhn transgene insertion 10, Agnes Lehuen MGI:3505713 Tg(TcraDN32D3)10Alhn transgene insertion 10, Agnes Lehuen https://www.infrafrontier.eu/search?keyword=EM:00214 + EM:01409 NOD-Chr 17/GhjCnrs EMMA embryo NOD.CBA-C17S mutant strain Chr 17 Chr 17 Chr 17 Chr 17 https://www.infrafrontier.eu/search?keyword=EM:01409 + EM:01408 NOD-Chr 17/GhjCnrm EMMA embryo NOD.B6-C17S consomic or chromosome substitution strain Chr 17 Chr 17 Chr 17 Chr 17 https://www.infrafrontier.eu/search?keyword=EM:01408 + EM:04372 NMRI.Cg-Tg(CMV-cre)1Nagy/Cnbc EMMA embryo CMV-cre mutant strain MGI:2178227 Tg(CMV-cre)1Nagy transgene insertion 1, Andras Nagy MGI:2178226 Tg(CMV-cre)1Nagy transgene insertion 1, Andras Nagy https://www.infrafrontier.eu/search?keyword=EM:04372 - EM:09255 NMRI.Cg-Tg(Camk2a-Grin2c/itTA)10Rsp/Kctt EMMA sperm STOCK Tg(Camk2a-Grin2c/itTA)10Rsp/Kctt, TgCN10 mutant strain MGI:5708649 Tg(Camk2a-Grin2c/itTA)10Rsp transgene insertion 10, Rolf Sprengel MGI:5708646 Tg(Camk2a-Grin2c/itTA)10Rsp transgene insertion 10, Rolf Sprengel https://www.infrafrontier.eu/search?keyword=EM:09255 + EM:04371 NMRI.Cg-Tg(CAG-cre)1Nagy/Cnbc EMMA embryo pCX-NLS-cre mutant strain MGI:3586452 Tg(CAG-cre)1Nagy transgene insertion 1, Andras Nagy MGI:3586450 Tg(CAG-cre)1Nagy transgene insertion 1, Andras Nagy https://www.infrafrontier.eu/search?keyword=EM:04371 + EM:01017 NMRI.129-Apaf1/Cnrm EMMA embryo Apaf-1/XIX-18, NMRI.129-Apaf1/Ibcm mutant strain MGI:1857868 Apaf1 gene trap XIX18, Peter Gruss MGI:1306796 Apaf1 apoptotic peptidase activating factor 1 https://www.infrafrontier.eu/search?keyword=EM:01017 + EM:01785 NMRI-Tg(Wap-Tag)8Gmn/Kctt EMMA embryo WAP-SVT/t mutant strain MGI:3621350 Tg(Wap-Tag)8Gmn transgene insertion 8, A Graessmann MGI:3784787 Tg(Wap-Tag)8Gmn transgene insertion 8, A Graessmann https://www.infrafrontier.eu/search?keyword=EM:01785 + EM:01787 NMRI-Tg(WAP-tAg)1Gmn/Kctt EMMA embryo WAP-SVt/1, WAP-SVt mutant strain MGI:5313806 Tg(Wap-tAg)1Gmn transgene insertion 1, A Graessmann MGI:5313805 Tg(Wap-tAg)1Gmn transgene insertion 1, A Graessmann https://www.infrafrontier.eu/search?keyword=EM:01787 + EM:01786 NMRI-Tg(WAP-TAg)12Gmn/Kctt EMMA embryo WAP-SVT/12, WAP-SVT mutant strain MGI:5312328 Tg(Wap-TAg)12Gmn transgene insertion 12, A Graessmann MGI:5312327 Tg(Wap-TAg)12Gmn transgene insertion 12, A Graessmann https://www.infrafrontier.eu/search?keyword=EM:01786 + EM:02484 NMRI-Tg(Agt)123Uhg/Cnrm EMMA embryo TGM(rAOGEN)102, NMRI-Tg(Agt)123Uhg/Ibcm mutant strain MGI:4453970 Tg(Agt)123Uhg transgene insertion 123, University of Heidelberg MGI:4453973 Tg(Agt)123Uhg transgene insertion 123, University of Heidelberg https://www.infrafrontier.eu/search?keyword=EM:02484 ? EM:05494 Nexilin KO conv EMMA embryo mutant strain Nexn Nexn MGI:1916060 Nexn nexilin https://www.infrafrontier.eu/search?keyword=EM:05494 ? EM:05495 Nexilin KO cond EMMA embryo mutant strain Nexn Nexn MGI:1916060 Nexn nexilin https://www.infrafrontier.eu/search?keyword=EM:05495 ? EM:06115 Nbr1D50R EMMA sperm mutant strain MGI:108498 Nbr1 NBR1, autophagy cargo receptor https://www.infrafrontier.eu/search?keyword=EM:06115 ? EM:09080 Myo18aD850GMhda EMMA sperm mutant strain 2549A->G 2549A->G MGI:2667185 Myo18a myosin XVIIIA https://www.infrafrontier.eu/search?keyword=EM:09080 + EM:04845 MSOSLOW/Orl EMMA archived MSO "resistant", MSOS/CloixOrl, MSO-Slow, STOCK MSO-Slow mutant strain MSO-Slow MSO-Slow MSO-Slow MSO-Slow https://www.infrafrontier.eu/search?keyword=EM:04845 + EM:04844 MSOFAST/Orl EMMA archived STOCK MSO-Fast, MSO-Fast mutant strain MSO-Fast MSO-Fast MSO-Fast MSO-Fast https://www.infrafrontier.eu/search?keyword=EM:04844 ? EM:11833 MSE Cre EMMA archived unclassified MSE-Cre MSE-Cre MSE-Cre MSE-Cre https://www.infrafrontier.eu/search?keyword=EM:11833 - EM:11832 MSE EMMA archived unclassified https://www.infrafrontier.eu/search?keyword=EM:11832 ? EM:11135 MRP8NRASD12 EMMA sperm mutant strain Tg(MRP8-Nras*)1 Tg(MRP8-Nras*)1 Tg(MRP8-Nras*)1 Tg(MRP8-Nras*)1 https://www.infrafrontier.eu/search?keyword=EM:11135 + EM:08424 MRL.Cg-Ccr5 Fas/Cnbc EMMA sperm 5-LM mutant strain MGI:3613371 Ccr5 targeted mutation 1, Bruno Luckow MGI:107182 Ccr5 chemokine (C-C motif) receptor 5 https://www.infrafrontier.eu/search?keyword=EM:08424 + EM:08424 MRL.Cg-Ccr5 Fas/Cnbc EMMA sperm 5-LM mutant strain MGI:1856334 Fas lymphoproliferation MGI:95484 Fas Fas (TNF receptor superfamily member 6) https://www.infrafrontier.eu/search?keyword=EM:08424 + EM:08423 MRL.Cg-Ccr2 Fas/Cnbc EMMA sperm 2L-M mutant strain MGI:1856334 Fas lymphoproliferation MGI:95484 Fas Fas (TNF receptor superfamily member 6) https://www.infrafrontier.eu/search?keyword=EM:08423 + EM:08423 MRL.Cg-Ccr2 Fas/Cnbc EMMA sperm 2L-M mutant strain MGI:3613374 Ccr2 targeted mutation 1, Bruno Luckow MGI:106185 Ccr2 chemokine (C-C motif) receptor 2 https://www.infrafrontier.eu/search?keyword=EM:08423 + EM:08425 MRL.Cg-Ccr1 Ccr5 Fas/Cnbc EMMA sperm 15L-M mutant strain MGI:1931850 Ccr1 targeted mutation 1, Ji-Liang Gao MGI:104618 Ccr1 chemokine (C-C motif) receptor 1 https://www.infrafrontier.eu/search?keyword=EM:08425 + EM:08425 MRL.Cg-Ccr1 Ccr5 Fas/Cnbc EMMA sperm 15L-M mutant strain MGI:1856334 Fas lymphoproliferation MGI:95484 Fas Fas (TNF receptor superfamily member 6) https://www.infrafrontier.eu/search?keyword=EM:08425 + EM:08425 MRL.Cg-Ccr1 Ccr5 Fas/Cnbc EMMA sperm 15L-M mutant strain MGI:3613371 Ccr5 targeted mutation 1, Bruno Luckow MGI:107182 Ccr5 chemokine (C-C motif) receptor 5 https://www.infrafrontier.eu/search?keyword=EM:08425 - EM:08422 MRL.129S4(B6)-Ccr1 Fas/Cnbc EMMA sperm mutant strain MGI:1931850 Ccr1 targeted mutation 1, Ji-Liang Gao MGI:104618 Ccr1 chemokine (C-C motif) receptor 1 https://www.infrafrontier.eu/search?keyword=EM:08422 - EM:08422 MRL.129S4(B6)-Ccr1 Fas/Cnbc EMMA sperm mutant strain MGI:1856334 Fas lymphoproliferation MGI:95484 Fas Fas (TNF receptor superfamily member 6) https://www.infrafrontier.eu/search?keyword=EM:08422 - EM:12979 MR CM EMMA embryo unclassified Tm1 Tm1 MGI:99459 Nr3c2 nuclear receptor subfamily 3, group C, member 2 https://www.infrafrontier.eu/search?keyword=EM:12979 ? EM:08925 mPhl p 5 IRES GFP BALB/c EMMA sperm mutant strain allergen Phl p 5 allergen Phl p 5 https://www.infrafrontier.eu/search?keyword=EM:08925 + EM:00135 MP1/BiozOrl EMMA archived MP, L1 inbred strain Bioz:MP1 Bioz:MP1 Bioz:MP1 Bioz:MP1 https://www.infrafrontier.eu/search?keyword=EM:00135 + EM:00124 MP1.BP1-Im7/DnmOrl EMMA archived LcH18, MP1.BP1-Im7/DnmOrl congenic strain MGI:3033084 Im7 Bioz:BP1 MGI:3032863 Im7 immunoregulatory 7 https://www.infrafrontier.eu/search?keyword=EM:00124 + EM:00123 MP1.BP1-Im5/DnmOrl EMMA archived MP1.BP1-Im5/DnmOrl, LcH10 congenic strain MGI:3033076 Im5 Bioz:BP1 MGI:3032858 Im5 immunoregulatory 5 https://www.infrafrontier.eu/search?keyword=EM:00123 + EM:00126 MP1.BP1-Im4/DnmOrl EMMA archived LcH6, MP1.BP1-Im4/DnmOrl congenic strain MGI:3033074 Im4 Bioz:BP1 MGI:3032855 Im4 immunoregulatory 4 https://www.infrafrontier.eu/search?keyword=EM:00126 + EM:00127 MP1.BP1-Im3/DnmOrl EMMA archived LcH8-30, MP1.BP1-Im3/DnmOrl congenic strain MGI:3033072 Im3 Bioz:BP1 MGI:3032849 Im3 immunoregulatory 3 https://www.infrafrontier.eu/search?keyword=EM:00127 + EM:00125 MP1.BP1-Im2/DnmOrl EMMA archived LcH4, MP1.BP1-Im2/DnmOrl congenic strain MGI:2157092 Im2 Bioz:BP1 MGI:2149679 Im2 immunoregulatory 2 https://www.infrafrontier.eu/search?keyword=EM:00125 + EM:00128 MP1.BP1-Im1/DnmOrl EMMA archived LcH8-60, MP1.BP1-Im1/DnmOrl congenic strain MGI:2157088 Im1 Bioz:BP1 MGI:2148963 Im1 Immunoregulatory 1 https://www.infrafrontier.eu/search?keyword=EM:00128 ? EM:05507 Mir 221 KO cond EMMA embryo mutant strain Mir221 Mir221 MGI:3619066 Mir221 microRNA 221 https://www.infrafrontier.eu/search?keyword=EM:05507 + EM:00198 MI/HgDstIeg EMMA embryo Hertwig's microphthalmia, MI/HgDst, STOCK Mitf/Hg, MI/HgDstNeu mutant strain MGI:1856085 Mitf microphthalmia MGI:104554 Mitf melanogenesis associated transcription factor https://www.infrafrontier.eu/search?keyword=EM:00198 - EM:12460 MF1;129X1-Ralgds/H EMMA sperm mutant strain MGI:3574574 Ralgds targeted mutation 1, Christopher J Marshall MGI:107485 Ralgds ral guanine nucleotide dissociation stimulator https://www.infrafrontier.eu/search?keyword=EM:12460 ? EM:12505 Mapk10-Gln100Leu EMMA sperm mutant strain Mapk10, c.299A-->T; p.Gln100Leu Mapk10, c.299A-->T; p.Gln100Leu MGI:1346863 Mapk10 mitogen-activated protein kinase 10 https://www.infrafrontier.eu/search?keyword=EM:12505 ? EM:11865 LSHOFF (TV2) EMMA sperm mutant strain MGI:106209 Hells helicase, lymphoid specific https://www.infrafrontier.eu/search?keyword=EM:11865 - EM:02514 Lrig3 (Kol3) EMMA embryo mutant strain MGI:2443955 Lrig3 leucine-rich repeats and immunoglobulin-like domains 3 https://www.infrafrontier.eu/search?keyword=EM:02514 ? EM:12427 LifeAct-GFP EMMA sperm mutant strain LifeAct-GFP LifeAct-GFP LifeAct-GFP LifeAct-GFP https://www.infrafrontier.eu/search?keyword=EM:12427 ? EM:11835 Krox20 NA*A EMMA archived unclassified MGI:1857507 Egr2 targeted mutation 1, Patrick Charnay MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:11835 ? EM:11836 Krox20 C flox EMMA archived unclassified Egr2 Egr2 MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:11836 ? EM:11827 Krox 20 gfp EMMA archived unclassified Egr2 Egr2 MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:11827 + EM:01320 KREIS/HgIeg EMMA embryo kreisler mutant strain MGI:1856419 Mafb kreisler MGI:104555 Mafb v-maf musculoaponeurotic fibrosarcoma oncogene family, protein B (avian) https://www.infrafrontier.eu/search?keyword=EM:01320 ? EM:11997 K5-CXCL13-F3 EMMA sperm mutant strain MGI:6331225 Tg(KRT5-Cxcl13)F3Rlep transgene insertion F3, Rozen Le Panse MGI:6331222 Tg(KRT5-Cxcl13)F3Rlep transgene insertion F3, Rozen Le Panse https://www.infrafrontier.eu/search?keyword=EM:11997 ? EM:11996 K5-CXCL13-F12 EMMA sperm mutant strain MGI:6331227 Tg(KRT5-Cxcl13)F12Rlep transgene insertion F12, Rozen Le Panse MGI:6331226 Tg(KRT5-Cxcl13)F12Rlep transgene insertion F12, Rozen Le Panse https://www.infrafrontier.eu/search?keyword=EM:11996 - EM:10468 INS1Cre EMMA sperm B6(Cg)-Ins1/H mutant strain MGI:5614359 Ins1 targeted mutation 1.1, Bernard Thorens MGI:96572 Ins1 insulin I https://www.infrafrontier.eu/search?keyword=EM:10468 + EM:12213 ICR/H[cc] EMMA live mutant strain ICR/H[cc] ICR/H[cc] ICR/H[cc] ICR/H[cc] https://www.infrafrontier.eu/search?keyword=EM:12213 - EM:06321 Hsurivong/CD4-EGFP EMMA archived mutant strain MGI:5494673 Tg(H2-Aa-HLA-DPA1)1Lone transgene insertion 1, Yu Chun Lone MGI:5494672 Tg(H2-Aa-HLA-DPA1)1Lone transgene insertion 1, Yu Chun Lone https://www.infrafrontier.eu/search?keyword=EM:06321 - EM:06321 Hsurivong/CD4-EGFP EMMA archived mutant strain MGI:5494677 Tg(H2-Ab1-HLA-DPB1)1Lone transgene insertion 1, Yu Chun Lone MGI:5494676 Tg(H2-Ab1-HLA-DPB1)1Lone transgene insertion 1, Yu Chun Lone https://www.infrafrontier.eu/search?keyword=EM:06321 - EM:06321 Hsurivong/CD4-EGFP EMMA archived mutant strain MGI:3720219 Tg(Cd4-EGFP)1Lt transgene insertion 1, Edward Leiter MGI:3720218 Tg(Cd4-EGFP)1Lt transgene insertion 1, Edward Leiter https://www.infrafrontier.eu/search?keyword=EM:06321 - EM:06321 Hsurivong/CD4-EGFP EMMA archived mutant strain MGI:3702083 Tg(Cd4-CD4)2362Litt transgene insertion 2362, Dan R Littman MGI:2673105 Tg(Cd4-CD4)2362Litt transgene insertion 2362, Dan R Littman https://www.infrafrontier.eu/search?keyword=EM:06321 - EM:06321 Hsurivong/CD4-EGFP EMMA archived mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:06321 - EM:06321 Hsurivong/CD4-EGFP EMMA archived mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:06321 - EM:06321 Hsurivong/CD4-EGFP EMMA archived mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/search?keyword=EM:06321 - EM:06321 Hsurivong/CD4-EGFP EMMA archived mutant strain MGI:1857281 Cd4 targeted mutation 1, Dan R Littman MGI:88335 Cd4 CD4 antigen https://www.infrafrontier.eu/search?keyword=EM:06321 - EM:02610 HsdWin:NMRI-Tg(Tyr-Th,-Gch1)6775Lmon/Cnbc EMMA embryo TyrTH, NMRI-Tg(Tyr-Th,-Gch1)6775Lmon/Cnbc mutant strain MGI:4443311 Tg(Tyr-Th,-Gch1)6775Lmon transgene insertion 6775, Lluis Montoliu MGI:4443324 Tg(Tyr-Th,-Gch1)6775Lmon transgene insertion 6775, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:02610 - EM:02610 HsdWin:NMRI-Tg(Tyr-Th,-Gch1)6775Lmon/Cnbc EMMA embryo TyrTH, NMRI-Tg(Tyr-Th,-Gch1)6775Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:02610 + EM:01166 HR2/PasOrl EMMA archived mutant strain MGI:5289957 Hr hairless 2 Institut Pasteur MGI:96223 Hr lysine demethylase and nuclear receptor corepressor https://www.infrafrontier.eu/search?keyword=EM:01166 ? EM:12228 HprtDll1ECD_Dll4ICD EMMA sperm mutant strain HprtDll1ECD_Dll4ICD HprtDll1ECD_Dll4ICD MGI:96217 Hprt hypoxanthine guanine phosphoribosyl transferase https://www.infrafrontier.eu/search?keyword=EM:12228 ? EM:12229 Hprt-Dll4ECD_Dll1ICD EMMA sperm mutant strain HprtDll4ECD_Dll1ICD HprtDll4ECD_Dll1ICD MGI:96217 Hprt hypoxanthine guanine phosphoribosyl transferase https://www.infrafrontier.eu/search?keyword=EM:12229 ? EM:11383 Hprt-CAG-LSL-ROCK2:ER EMMA sperm mutant strain MGI:96217 Hprt hypoxanthine guanine phosphoribosyl transferase https://www.infrafrontier.eu/search?keyword=EM:11383 - EM:08406 Hpr EMMA sperm mutant strain MGI:5435304 Phex hypophosphatemic rickets MGI:107489 Phex phosphate regulating endopeptidase homolog, X-linked https://www.infrafrontier.eu/search?keyword=EM:08406 ? EM:11995 HM_Y139C EMMA sperm mutant strain MGI:3605985 Vkorc1 Tyr139Cys MGI:106442 Vkorc1 vitamin K epoxide reductase complex, subunit 1 https://www.infrafrontier.eu/search?keyword=EM:11995 ? EM:11065 HLE-2/w x AlbCRE EMMA archived mutant strain Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) https://www.infrafrontier.eu/search?keyword=EM:11065 ? EM:11065 HLE-2/w x AlbCRE EMMA archived mutant strain NS5A weak transactivator NS5A weak transactivator NS5A weak transactivator NS5A weak transactivator https://www.infrafrontier.eu/search?keyword=EM:11065 ? EM:11064 HLE-1/S x AlbCRE EMMA archived mutant strain Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) https://www.infrafrontier.eu/search?keyword=EM:11064 ? EM:11064 HLE-1/S x AlbCRE EMMA archived mutant strain NS5A high transactivator NS5A high transactivator NS5A high transactivator NS5A high transactivator https://www.infrafrontier.eu/search?keyword=EM:11064 + EM:01368 GRS/ADkcsKieg EMMA embryo GRS/A, IFLa-3 mutant strain MGI:3579297 Mtv2 mammary tumor virus locus 2, present MGI:97188 Mtv2 mammary tumor virus locus 2 https://www.infrafrontier.eu/search?keyword=EM:01368 + EM:00397 GRS.Cg-Tg(MMTV-S100a4)463Oku/Kctt EMMA embryo GR.CBB6-Tg(MMTV-S100a4)463/Kctt, tg463 mutant strain MGI:3620787 Tg(MMTV-S100a4)463Oku transgene insertion 463, Olle Karlstrom MGI:5141468 Tg(MMTV-S100a4)463Oku transgene insertion 463, Olle Karlstrom https://www.infrafrontier.eu/search?keyword=EM:00397 + EM:00397 GRS.Cg-Tg(MMTV-S100a4)463Oku/Kctt EMMA live GR.CBB6-Tg(MMTV-S100a4)463/Kctt, tg463 mutant strain MGI:3620787 Tg(MMTV-S100a4)463Oku transgene insertion 463, Olle Karlstrom MGI:5141468 Tg(MMTV-S100a4)463Oku transgene insertion 463, Olle Karlstrom https://www.infrafrontier.eu/search?keyword=EM:00397 - EM:09367 Gnptab EMMA sperm mutant strain MGI:5616922 Gnptab Nymphe MGI:3643902 Gnptab N-acetylglucosamine-1-phosphate transferase, alpha and beta subunits https://www.infrafrontier.eu/search?keyword=EM:09367 ? EM:11503 Glau-IRFMN EMMA embryo mutant strain Mut-XDH cDNA Mut-XDH cDNA https://www.infrafrontier.eu/search?keyword=EM:11503 ? EM:11503 Glau-IRFMN EMMA sperm mutant strain Mut-XDH cDNA Mut-XDH cDNA https://www.infrafrontier.eu/search?keyword=EM:11503 ? EM:08193 GalR2- hrGFP tagged mice EMMA sperm mutant strain MGI:5806062 Galr2 targeted mutation 1.1, David Wynick MGI:1337018 Galr2 galanin receptor 2 https://www.infrafrontier.eu/search?keyword=EM:08193 - EM:08192 GalR1- mCherry tagged mice EMMA sperm 129P2(Cg)-Galr1/H mutant strain MGI:5806061 Galr1 targeted mutation 1.1, David Wynick MGI:1096364 Galr1 galanin receptor 1 https://www.infrafrontier.eu/search?keyword=EM:08192 ? EM:11453 G3 EMMA embryo mutant strain MGI:3619125 Prnp targeted mutation 3, Enrico Cancellotti MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:11453 ? EM:11452 G2 EMMA embryo mutant strain MGI:3619124 Prnp targeted mutation 2, Enrico Cancellotti MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:11452 ? EM:11451 G1 EMMA archived mutant strain MGI:3619122 Prnp targeted mutation 1, Enrico Cancellotti MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:11451 ? EM:05508 Fyco1 KO cond EMMA embryo mutant strain Fyco1 Fyco1 MGI:107277 Fyco1 FYVE and coiled-coil domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:05508 + EM:00432 FVB;129P2-Trp53/Cnrm EMMA embryo P53F, FVB;129P2-Trp53/Ibcm mutant strain MGI:1931011 Trp53 targeted mutation 1, Anton Berns MGI:98834 Trp53 transformation related protein 53 https://www.infrafrontier.eu/search?keyword=EM:00432 + EM:00433 FVB;129P2-Rb1/Cnrm EMMA embryo RbF, FVB;129P2-Rb1/Ibcm mutant strain MGI:1931018 Rb1 targeted mutation 2, Anton Berns MGI:97874 Rb1 RB transcriptional corepressor 1 https://www.infrafrontier.eu/search?keyword=EM:00433 + EM:00434 FVB;129P2-Rb1/Cnrm EMMA embryo FVB;129P2-Rb1/Ibcm, RbFR mutant strain MGI:1931015 Rb1 targeted mutation 1, Anton Berns MGI:97874 Rb1 RB transcriptional corepressor 1 https://www.infrafrontier.eu/search?keyword=EM:00434 + EM:00406 FVB;129P2-Pten/Cnrm EMMA embryo FVB;129P2-Pten/Ibcm, PtnF mutant strain MGI:2183284 Pten targeted mutation 1, Silvia Marino MGI:109583 Pten phosphatase and tensin homolog https://www.infrafrontier.eu/search?keyword=EM:00406 + EM:00408 FVB;129P2-Nf2/Cnrm EMMA embryo FVB;129P2-Nf2/Ibcm, Nf2F mutant strain MGI:1926955 Nf2 targeted mutation 2, Gilles Thomas MGI:97307 Nf2 neurofibromin 2 https://www.infrafrontier.eu/search?keyword=EM:00408 + EM:00407 FVB;129P2-Cdkn2a/Cnrm EMMA sperm I4aF, FVB;129P2-Cdkn2a/Ibcm mutant strain MGI:2384163 Cdkn2a targeted mutation 2, Anton Berns MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/search?keyword=EM:00407 + EM:00435 FVB;129P2-Cdkn2a/Cnrm EMMA embryo FVB;129P2-Cdkn2a/Ibcm, P16B or Cdkn2a, FVB;129P2-Cdkn2a/Ibcm mutant strain MGI:2384165 Cdkn2a targeted mutation 1.1, Anton Berns MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/search?keyword=EM:00435 + EM:01642 FVB;129P2-Brca2/Cnrm EMMA embryo FVB;129P2-Brca2/Ibcm, Br2F mutant strain MGI:2156556 Brca2 targeted mutation 1, Anton Berns MGI:109337 Brca2 breast cancer 2, early onset https://www.infrafrontier.eu/search?keyword=EM:01642 + EM:01631 FVB/NPas-Tg(H2-D)2Bujf/Orl EMMA sperm FVB H2-Db2 mutant strain MGI:5306998 Tg(H2-D)2Bujf transgene insertion 2, Jean-Francois Bureau MGI:5306997 Tg(H2-D)2Bujf transgene insertion 2, Jean-Francois Bureau https://www.infrafrontier.eu/search?keyword=EM:01631 + EM:00120 FVB/NIco-Tg(Pcp2/Jun)18Dcrl/Cnrm EMMA embryo FVB/NIco-Tg(Pcp2/Jun)18Dcrl/Ibcm, L7-c-jun-Tg mutant strain MGI:3573864 Tg(Pcp2/Jun)18Dcrl transgene insertion 18, Daniella Carulli MGI:3573861 Tg(Pcp2/Jun)18Dcrl transgene insertion 18, Daniella Carulli https://www.infrafrontier.eu/search?keyword=EM:00120 + EM:01722 FVB/N-Tg(Wap-cre)1Gsc/Ieg EMMA sperm WAPiCre mutant strain MGI:3527260 Tg(Wap-cre)1Gsc transgene insertion 1, Gunther Schutz MGI:3527253 Tg(Wap-cre)1Gsc transgene insertion 1, Gunther Schutz https://www.infrafrontier.eu/search?keyword=EM:01722 + EM:02472 FVB/N-Tg(Tagln-Nppc)1Wlthr/Ieg EMMA embryo FVB/N SM22 CNP mutant strain MGI:5762679 Tg(Tagln-Nppc)1Wlthr transgene insertion 1, Thomas Walther MGI:5762675 Tg(Tagln-Nppc)1Wlthr transgene insertion 1, Thomas Walther https://www.infrafrontier.eu/search?keyword=EM:02472 + EM:01710 FVB/N-Tg(Slc6a3-icre)1Fto/Orl EMMA sperm FVB/N-Tg(Slc6a3-cre)1Fto/Orl, FVB/N-BAC-DATCre, FVB/N-Tg(Slc6a3-cre)1Fto mutant strain MGI:3852083 Tg(Slc6a3-icre)1Fto transgene insertion 1, Francois Tronche MGI:3852082 Tg(Slc6a3-icre)1Fto transgene insertion 1, Francois Tronche https://www.infrafrontier.eu/search?keyword=EM:01710 + EM:02376 FVB/N-Tg(SAA2)1Woo/H EMMA sperm SAA2 mutant strain MGI:5759854 Tg(SAA2)1Woo transgene insertion 1, Patricia Woo MGI:5759851 Tg(SAA2)1Woo transgene insertion 1, Patricia Woo https://www.infrafrontier.eu/search?keyword=EM:02376 ? EM:12211 FVB/N-Tg(S100A8-BCL2)1Lgs/Orl EMMA sperm mutant strain MGI:2448741 Tg(S100A8-BCL2)1Lgs transgene insertion 1, Eric Lagasse MGI:2676367 Tg(S100A8-BCL2)1Lgs transgene insertion 1, Eric Lagasse https://www.infrafrontier.eu/search?keyword=EM:12211 + EM:05367 FVB/N-Tg(Rnu6-RNAi:IE-PRV)SH30Gjo/Orl EMMA embryo SH30 mutant strain MGI:5645894 Tg(Rnu6-RNAi:IE-PRV)SH30Gjo transgene insertion SH30, Genevieve Jolivet MGI:5645891 Tg(Rnu6-RNAi:IE-PRV)SH30Gjo transgene insertion SH30, Genevieve Jolivet https://www.infrafrontier.eu/search?keyword=EM:05367 + EM:05365 FVB/N-Tg(Rnu6-RNAi:IE-PRV)SH05Gjo/Orl EMMA embryo SH05 mutant strain MGI:5645892 Tg(Rnu6-RNAi:IE-PRV)SH05Gjo transgene insertion SH05, Genevieve Jolivet MGI:5645889 Tg(Rnu6-RNAi:IE-PRV)SH05Gjo transgene insertion SH05, Genevieve Jolivet https://www.infrafrontier.eu/search?keyword=EM:05365 + EM:05366 FVB/N-Tg(Rnu6-RNAi:IE-PRV)SH03Gjo/Orl EMMA sperm SH03 mutant strain MGI:5645893 Tg(Rnu6-RNAi:IE-PRV)SH03Gjo transgene insertion SH03, Genevieve Jolivet MGI:5645890 Tg(Rnu6-RNAi:IE-PRV)SH03Gjo transgene insertion SH03, Genevieve Jolivet https://www.infrafrontier.eu/search?keyword=EM:05366 + EM:04569 FVB/N-Tg(Rip-RASA1*)1Wid/Orl EMMA archived FVB/N-Tg(RIP::N)1Wid mutant strain MGI:5648069 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann MGI:5648068 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann https://www.infrafrontier.eu/search?keyword=EM:04569 + EM:00250 FVB/N-Tg(Prm1-Tfam)4Lrsn/Kieg EMMA embryo FVB/N-Tg(Prm1-Tfam)4Lrsn, NGLa-1, Prm1-TFAM mutant strain MGI:3525701 Tg(Prm1-Tfam)4Lrsn transgene insertion 4, Nils-Goran Larsson MGI:3525692 Tg(Prm1-Tfam)4Lrsn transgene insertion 4, Nils-Goran Larsson https://www.infrafrontier.eu/search?keyword=EM:00250 + EM:01183 FVB/N-Tg(Nes-rtTA)306Rvs/Cnrm EMMA embryo FVB/N-Tg(Nes-rtTA)306Rvs/Ibcm, Nes-rtTA mutant strain MGI:3505574 Tg(Nes-rtTA)306Rvs transgene insertion 306, Steven A Reeves MGI:2136292 Tg(Nes-rtTA)306Rvs transgene insertion 306, Steven A Reeves https://www.infrafrontier.eu/search?keyword=EM:01183 + EM:01183 FVB/N-Tg(Nes-rtTA)306Rvs/Cnrm EMMA live FVB/N-Tg(Nes-rtTA)306Rvs/Ibcm, Nes-rtTA mutant strain MGI:3505574 Tg(Nes-rtTA)306Rvs transgene insertion 306, Steven A Reeves MGI:2136292 Tg(Nes-rtTA)306Rvs transgene insertion 306, Steven A Reeves https://www.infrafrontier.eu/search?keyword=EM:01183 + EM:07462 FVB/N-Tg(Krt14-Col18a1)J4Pih/Oulu EMMA embryo K14-endostatin (J4) FVB/N mutant strain MGI:5645734 Tg(Krt14-Col18a1)J4Pih transgene insertion J4, Taina Pihlajaniemi MGI:5645733 Tg(Krt14-Col18a1)J4Pih transgene insertion J4, Taina Pihlajaniemi https://www.infrafrontier.eu/search?keyword=EM:07462 + EM:07462 FVB/N-Tg(Krt14-Col18a1)J4Pih/Oulu EMMA sperm K14-endostatin (J4) FVB/N mutant strain MGI:5645734 Tg(Krt14-Col18a1)J4Pih transgene insertion J4, Taina Pihlajaniemi MGI:5645733 Tg(Krt14-Col18a1)J4Pih transgene insertion J4, Taina Pihlajaniemi https://www.infrafrontier.eu/search?keyword=EM:07462 + EM:00411 FVB/N-Tg(Gfap-cre)2Brn/Cnrm EMMA embryo FVB/N-Tg(Gfap-cre)2Brn/Ibcm mutant strain MGI:2663939 Tg(Gfap-cre)2Brn transgene insertion 2, Anton Berns MGI:2671944 Tg(Gfap-cre)2Brn transgene insertion 2, Anton Berns https://www.infrafrontier.eu/search?keyword=EM:00411 + EM:05364 FVB/N-Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo/Orl EMMA embryo mutant strain MGI:5645887 Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo transgene insertion miL15, Genevieve Jolivet MGI:5645819 Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo transgene insertion miL15, Genevieve Jolivet https://www.infrafrontier.eu/search?keyword=EM:05364 + EM:05364 FVB/N-Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo/Orl EMMA sperm mutant strain MGI:5645887 Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo transgene insertion miL15, Genevieve Jolivet MGI:5645819 Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo transgene insertion miL15, Genevieve Jolivet https://www.infrafrontier.eu/search?keyword=EM:05364 + EM:04994 FVB/N-Tg(E2F1-luc)1Ech/Kctt EMMA embryo Ef-luc mutant strain MGI:5648123 Tg(E2F1-luc)1Ech transgene insertion 1, Eric C Holland MGI:5648121 Tg(E2F1-luc)1Ech transgene insertion 1, Eric C Holland https://www.infrafrontier.eu/search?keyword=EM:04994 + EM:00195 FVB/N-Tg(Cryaa-Six3)53Pgr/Ieg EMMA sperm FVB/N-Tg(Cryaa-Six3)53Pgr/Neu, FVB/N-Tg(Cryaa-Six3)53Pgr/PgrNeu, alphaASix3, FVB/N-Tg(Cryaa-Six3)53Pgr/Pgr, FVB-Tg(aAcryst-Six3)F53 mutant strain MGI:3057335 Tg(Cryaa-Six3)53Pgr transgene insertion 53, Peter Gruss MGI:3057330 Tg(Cryaa-Six3)53Pgr transgene insertion 53, Peter Gruss https://www.infrafrontier.eu/search?keyword=EM:00195 + EM:04993 FVB/N-Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a wild type mutant strain MGI:5648077 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University MGI:5648074 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University https://www.infrafrontier.eu/search?keyword=EM:04993 ? EM:10886 FVB/N-Tg(CAG-Itga11)1Dgul/Kctt EMMA sperm mutant strain Tg(CAG-Itga11)1Dgul Tg(CAG-Itga11)1Dgul Tg(CAG-Itga11)1Dgul Tg(CAG-Itga11)1Dgul https://www.infrafrontier.eu/search?keyword=EM:10886 - EM:09799 FVB.D2(B6)-Bmx/Oulu EMMA embryo mutant strain MGI:2660714 Bmx targeted mutation 1, Kari Alitalo MGI:1101778 Bmx BMX non-receptor tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:09799 - EM:09799 FVB.D2(B6)-Bmx/Oulu EMMA sperm mutant strain MGI:2660714 Bmx targeted mutation 1, Kari Alitalo MGI:1101778 Bmx BMX non-receptor tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:09799 + EM:07013 FVB.Cg-Tg(Wap-Shh)119Mig/Cnbc EMMA embryo Tg(WAP-Shh)119Mig-FVB mutant strain MGI:5645728 Tg(Wap-Shh)119Mig transgene insertion 119, Marta I Gallego MGI:5645727 Tg(Wap-Shh)119Mig transgene insertion 119, Marta I Gallego https://www.infrafrontier.eu/search?keyword=EM:07013 + EM:01804 FVB.Cg-Tg(Nfh/lacZ)44AApt/Orl EMMA sperm FVB.B6C3F2-Tg(Nfh/lacZ)44AApt/Orl, NFH-LacZ/FVB mutant strain MGI:2182128 Tg(Nfh/lacZ)44AApt transgene insertion 44A, Alan Peterson MGI:2388168 Tg(Nfh/lacZ)44AApt transgene insertion 44A, Alan Peterson https://www.infrafrontier.eu/search?keyword=EM:01804 + EM:06074 FVB.Cg-Tg(Kap)L49Msgr/Cnbc EMMA embryo KAP L49 (FVB background), FVB.Cg-Tg(Kap)L49/Cnbc mutant strain MGI:5792809 Tg(Kap)L49Msgr transgene insertion L49, Anna Meseguer MGI:5792808 Tg(Kap)L49Msgr transgene insertion L49, Anna Meseguer https://www.infrafrontier.eu/search?keyword=EM:06074 + EM:00412 FVB.Cg-Tg(IghMyc)186Brn/Cnrm EMMA sperm Emyc, FVB.Cg-Tg(IghMyc)186Brn/Ibcm mutant strain MGI:3039690 Tg(IghMyc)186Brn transgene insertion 186, Anton Berns MGI:3039691 Tg(IghMyc)186Brn transgene insertion 186, Anton Berns https://www.infrafrontier.eu/search?keyword=EM:00412 + EM:09628 FVB.Cg-Tg(Col13a1)2Pih/Oulu EMMA embryo FVB/NHanHsd-Tg(Col13a1)2Pih mutant strain MGI:5645740 Tg(Col13a1)2Pih transgene insertion 2, Taina Pihlajaniemi MGI:5645739 Tg(Col13a1)2Pih transgene insertion 2, Taina Pihlajaniemi https://www.infrafrontier.eu/search?keyword=EM:09628 + EM:09628 FVB.Cg-Tg(Col13a1)2Pih/Oulu EMMA sperm FVB/NHanHsd-Tg(Col13a1)2Pih mutant strain MGI:5645740 Tg(Col13a1)2Pih transgene insertion 2, Taina Pihlajaniemi MGI:5645739 Tg(Col13a1)2Pih transgene insertion 2, Taina Pihlajaniemi https://www.infrafrontier.eu/search?keyword=EM:09628 + EM:05565 FVB.Cg-Tg(Camk2a-Grik2)28Cmul/Orl EMMA embryo GluK2 -6 Myc FVB mutant strain MGI:5645814 Tg(Camk2a-Grik2)28Cmul transgene insertion 28, Christophe Mulle MGI:5645813 Tg(Camk2a-Grik2)28Cmul transgene insertion 28, Christophe Mulle https://www.infrafrontier.eu/search?keyword=EM:05565 + EM:02503 FVB.Cg-Tg(CAG-HSPB1)LPks/H EMMA sperm PCAGGS-HSP27-WT-LOW-COPY, HSP27 WT Low copy line mutant strain MGI:5775102 Tg(CAG-HSPB1)LPks transgene insertion L, Nick Parkinson MGI:5775101 Tg(CAG-HSPB1)LPks transgene insertion L, Nick Parkinson https://www.infrafrontier.eu/search?keyword=EM:02503 + EM:02502 FVB.Cg-Tg(CAG-HSPB1)HPks/H EMMA sperm PCAGGS-HSP27-WT-HIGH-COPY, HSP27 WT High copy line mutant strain MGI:5775094 Tg(CAG-HSPB1)HPks transgene insertion H, Nick Parkinson MGI:5775092 Tg(CAG-HSPB1)HPks transgene insertion H, Nick Parkinson https://www.infrafrontier.eu/search?keyword=EM:02502 ? EM:11431 FVB.Cg-Dnajc5 Tg(Thy1-GFP*)1Rfc/Cnbc EMMA embryo mutant strain MGI:3050763 Dnajc5 targeted mutation 1, Thomas C Sudhof MGI:892995 Dnajc5 DnaJ heat shock protein family (Hsp40) member C5 https://www.infrafrontier.eu/search?keyword=EM:11431 ? EM:11431 FVB.Cg-Dnajc5 Tg(Thy1-GFP*)1Rfc/Cnbc EMMA embryo mutant strain MGI:6343356 Tg(Thy1-GFP*)1Rfc transgene insertion 1, Rafael Fernandez-Chacon MGI:6343363 Tg(Thy1-GFP*)1Rfc transgene insertion 1, Rafael Fernandez-Chacon https://www.infrafrontier.eu/search?keyword=EM:11431 - EM:09898 FVB.AK-Del(17)T/Biat EMMA sperm FVB.AK(Cg)-Del(17)T/Biat mutant strain MGI:1856187 Del(17)T deletion, Chr 17, T, hairpin tail MGI:5427967 Del(17)T deletion, Chr 17, T, hairpin tail https://www.infrafrontier.eu/search?keyword=EM:09898 + EM:09913 FVB.129S6(B6)-Col13a1/Oulu EMMA embryo mutant strain MGI:6116692 Col13a1 targeted mutation 4.1, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:09913 + EM:09913 FVB.129S6(B6)-Col13a1/Oulu EMMA sperm mutant strain MGI:6116692 Col13a1 targeted mutation 4.1, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:09913 + EM:10425 FVB.129S6(B6)-Col13a1/Oulu EMMA embryo mutant strain MGI:4838408 Col13a1 targeted mutation 2, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:10425 + EM:10425 FVB.129S6(B6)-Col13a1/Oulu EMMA sperm mutant strain MGI:4838408 Col13a1 targeted mutation 2, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:10425 - EM:11029 FVB.129S4-Col18a1/Oulu EMMA embryo mutant strain MGI:2179134 Col18a1 targeted mutation 1, Harvard Medical School MGI:88451 Col18a1 collagen, type XVIII, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:11029 - EM:11029 FVB.129S4-Col18a1/Oulu EMMA sperm mutant strain MGI:2179134 Col18a1 targeted mutation 1, Harvard Medical School MGI:88451 Col18a1 collagen, type XVIII, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:11029 + EM:05562 FVB.129P2-Tiam1/Cnbc EMMA sperm FVB-Tiam1 KO mutant strain MGI:2183309 Tiam1 targeted mutation 1, John G Collard MGI:103306 Tiam1 T cell lymphoma invasion and metastasis 1 https://www.infrafrontier.eu/search?keyword=EM:05562 + EM:02142 FVB.129P2-Peg12/Cnrm EMMA embryo FVB.129P2-Peg12/Ibcm, F3H mutant strain MGI:3530465 Peg12 targeted mutation 1, Anton Berns MGI:1351637 Peg12 paternally expressed 12 https://www.infrafrontier.eu/search?keyword=EM:02142 - EM:09897 FVB.129P2-Igf2r/Biat EMMA sperm mutant strain MGI:2445841 Igf2r targeted mutation 2, Erwin F Wagner MGI:96435 Igf2r insulin-like growth factor 2 receptor https://www.infrafrontier.eu/search?keyword=EM:09897 ? EM:09896 FVB.129P2-Igf2r/Biat EMMA sperm mutant strain MGI:6317421 Igf2r targeted mutation 1, Denise P Barlow MGI:96435 Igf2r insulin-like growth factor 2 receptor https://www.infrafrontier.eu/search?keyword=EM:09896 + EM:02141 FVB.129P2-Frat2/Cnrm EMMA embryo FVB.129P2-Frat2/Ibcm, F2H mutant strain MGI:3530460 Frat2 targeted mutation 1, Anton Berns MGI:2673967 Frat2 frequently rearranged in advanced T cell lymphomas 2 https://www.infrafrontier.eu/search?keyword=EM:02141 + EM:02140 FVB.129P2-Frat1/Cnrm EMMA embryo FVB.129P2-Frat1/Ibcm, F1H mutant strain MGI:2384128 Frat1 targeted mutation 1, Anton Berns MGI:109450 Frat1 frequently rearranged in advanced T cell lymphomas https://www.infrafrontier.eu/search?keyword=EM:02140 + EM:02143 FVB.129P2-Frat1 Frat2/Cnrm EMMA embryo F1F2, FVB.129P2-Frat1 Frat2/Ibcm mutant strain MGI:2384128 Frat1 targeted mutation 1, Anton Berns MGI:109450 Frat1 frequently rearranged in advanced T cell lymphomas https://www.infrafrontier.eu/search?keyword=EM:02143 + EM:02143 FVB.129P2-Frat1 Frat2/Cnrm EMMA embryo F1F2, FVB.129P2-Frat1 Frat2/Ibcm mutant strain MGI:3530463 Frat2 targeted mutation 2, Anton Berns MGI:2673967 Frat2 frequently rearranged in advanced T cell lymphomas 2 https://www.infrafrontier.eu/search?keyword=EM:02143 + EM:00054 FVB.129P2-Csf3r/Cnrm EMMA embryo FVB.129P2-Csf3r/Ibcm, FVB.129P2-Csf3r, Csfgr-KO mutant strain MGI:2655452 Csf3r targeted mutation 2, Erasmus University Rotterdam MGI:1339755 Csf3r colony stimulating factor 3 receptor (granulocyte) https://www.infrafrontier.eu/search?keyword=EM:00054 + EM:00053 FVB.129P2-Csf3r/Cnrm EMMA embryo FVB.129P2-Csf3r/Ibcm, FVB.129P2-Csf3r, Csfgr-delta715 mutant strain MGI:2156882 Csf3r targeted mutation 1, Erasmus University Rotterdam MGI:1339755 Csf3r colony stimulating factor 3 receptor (granulocyte) https://www.infrafrontier.eu/search?keyword=EM:00053 + EM:01645 FVB.129P2-Brca1/Cnrm EMMA embryo FVB.Cg-Brca1/Ibcm, Br1F, FVB.129P2-Brca1/Ibcm mutant strain MGI:3696057 Brca1 targeted mutation 1, Anton Berns MGI:104537 Brca1 breast cancer 1, early onset https://www.infrafrontier.eu/search?keyword=EM:01645 - EM:09895 FVB.129P2-Airn/Biat EMMA sperm FVB.129P2(B6)-Airn/Biat mutant strain MGI:2677157 Airn targeted mutation 1, Denise P Barlow MGI:1353471 Airn antisense Igf2r RNA https://www.infrafrontier.eu/search?keyword=EM:09895 ? EM:09900 FVB.129P2-AIDup EMMA sperm mutant strain Airn to Igf2r Airn to Igf2r https://www.infrafrontier.eu/search?keyword=EM:09900 ? EM:09899 FVB.129P2-AIDel EMMA sperm mutant strain Airn and Igf2r Airn and Igf2r https://www.infrafrontier.eu/search?keyword=EM:09899 + EM:04424 FVB.129P2(B6)-Mfge8/Orl EMMA embryo MFGE8/TMbetageo FVB mutant strain MGI:3578644 Mfge8 gene trap KST227, BayGenomics MGI:102768 Mfge8 milk fat globule EGF and factor V/VIII domain containing https://www.infrafrontier.eu/search?keyword=EM:04424 + EM:09263 FVB.129-Col15a1/Oulu EMMA embryo Collagen XV knock-out mouse in FVB background mutant strain MGI:2386162 Col15a1 targeted mutation 1, Taina Pihlajaniemi MGI:88449 Col15a1 collagen, type XV, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:09263 + EM:09263 FVB.129-Col15a1/Oulu EMMA sperm Collagen XV knock-out mouse in FVB background mutant strain MGI:2386162 Col15a1 targeted mutation 1, Taina Pihlajaniemi MGI:88449 Col15a1 collagen, type XV, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:09263 + EM:10424 FVB.129(B6)-Col13a1/Oulu EMMA embryo mutant strain MGI:4838409 Col13a1 targeted mutation 3.1, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:10424 + EM:10424 FVB.129(B6)-Col13a1/Oulu EMMA sperm mutant strain MGI:4838409 Col13a1 targeted mutation 3.1, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:10424 + EM:04774 FVB-Tg(Wap-Hgf)402Mig/Cnbc EMMA embryo mutant strain MGI:3036575 Tg(Wap-Hgf)402Mig transgene insertion 402, Marta I Gallego MGI:3037894 Tg(Wap-Hgf)402Mig transgene insertion 402, Marta I Gallego https://www.infrafrontier.eu/search?keyword=EM:04774 ? EM:11430 FVB-Tg(Thy1-GFP*)1Rfc/Cnbc EMMA embryo mutant strain MGI:6343356 Tg(Thy1-GFP*)1Rfc transgene insertion 1, Rafael Fernandez-Chacon MGI:6343363 Tg(Thy1-GFP*)1Rfc transgene insertion 1, Rafael Fernandez-Chacon https://www.infrafrontier.eu/search?keyword=EM:11430 + EM:04778 FVB-Tg(tetO-TPR/MET,-EGFP)12Tcre/Cnrm EMMA embryo Tpr-Met-TetO-GFP, FVB-Tg(TPRMET-tetO-GFP)Tcre/Ibcm, FVB-Tg(tetO-TPR/MET,-EGFP)12Tcre/Ibcm mutant strain MGI:4949465 Tg(tetO-TPR/MET,-EGFP)12Tcre transgene insertion 12, Tiziana Crepaldi MGI:4949460 Tg(tetO-TPR/MET,-EGFP)12Tcre transgene insertion 12, Tiziana Crepaldi https://www.infrafrontier.eu/search?keyword=EM:04778 + EM:04364 FVB-Tg(tetO-Hgf,-EGFP)24Tcre/Cnrm EMMA embryo Hgf-TetO-GFP mutant strain MGI:5648118 Tg(tetO-Hgf,-EGFP)24Tcre transgene insertion 24, Tiziana Crepaldi MGI:5648117 Tg(tetO-Hgf,-EGFP)24Tcre transgene insertion 24, Tiziana Crepaldi https://www.infrafrontier.eu/search?keyword=EM:04364 + EM:04322 FVB-Tg(tetO-Chrnb2*V287L)H5Gica/Cnrm EMMA embryo Tg(TRE-Chrnb2VL)/H5 mutant strain MGI:5014761 Tg(tetO-Chrnb2*V287L)H5Gica transgene insertion H5, Giorgio Casari MGI:5014756 Tg(tetO-Chrnb2*V287L)H5Gica transgene insertion H5, Giorgio Casari https://www.infrafrontier.eu/search?keyword=EM:04322 + EM:04321 FVB-Tg(tetO-Chrnb2*V287L)H3Gica/Cnrm EMMA embryo Tg(TRE-Chrnb2VL)/H3, FVB-Tg(tetO-Chrnb2*V287L)H3Gica/Ibcm mutant strain MGI:3843695 Tg(tetO-Chrnb2*V287L)H3Gica transgene insertion H3, Giorgio Casari MGI:3843694 Tg(tetO-Chrnb2*V287L)H3Gica transgene insertion H3, Giorgio Casari https://www.infrafrontier.eu/search?keyword=EM:04321 + EM:00121 FVB-Tg(Pcp2-Gap43)L1657Fro/Cnrm EMMA embryo FVB-Tg(Pcp2-Gap43)L1657Fro/Ibcm, FVB-Tg(Pcp2-Gap43)L1657Fro, L7promoter/GAP43-ORF mutant strain MGI:2652499 Tg(Pcp2-Gap43)L1657Fro transgene insertion L1657, Ferdinando Rossi MGI:2652497 Tg(Pcp2-Gap43)L1657Fro transgene insertion L1657, Ferdinando Rossi https://www.infrafrontier.eu/search?keyword=EM:00121 + EM:00756 FVB-Tg(Pax6-cre,GFP)2Pgr/PgrCnrm EMMA embryo FVB-Tg(Pax6-cre,GFP)2Pgr/PgrIbcm, ECG mutant strain MGI:3052661 Tg(Pax6-cre,GFP)2Pgr transgene insertion 2, Peter Gruss MGI:3052668 Tg(Pax6-cre,GFP)2Pgr transgene insertion 2, Peter Gruss https://www.infrafrontier.eu/search?keyword=EM:00756 + EM:00755 FVB-Tg(Pax6-cre,GFP)1Pgr/PgrCnrm EMMA embryo FVB-Tg(Pax6-cre,GFP)1Pgr/PgrIbcm, Lens-Cre, FVB-Tg(Pax6-cre,-GFP)1Pgr/PgrIbcm mutant strain MGI:3045749 Tg(Pax6-cre,GFP)1Pgr transgene insertion 1, Peter Gruss MGI:3045750 Tg(Pax6-cre,GFP)1Pgr transgene insertion 1, Peter Gruss https://www.infrafrontier.eu/search?keyword=EM:00755 + EM:00205 FVB-Tg(Pax4-lacZ)2Pgr/Ieg EMMA sperm FVB-Tg(Pax4 0.5Kb-LacZ)cb11, FVB-Tg(Pax4-lacZ)2Pgr/Pgr, FVB-Tg(Pax4-lacZ)2Pgr/Neu mutant strain MGI:3057320 Tg(Pax4-lacZ)2Pgr transgene insertion 2, Peter Gruss MGI:3057319 Tg(Pax4-lacZ)2Pgr transgene insertion 2, Peter Gruss https://www.infrafrontier.eu/search?keyword=EM:00205 + EM:00042 FVB-Tg(Pax4-lacZ)1Pgr/PgrIeg EMMA sperm CBII(Pax4-LacZ)Tg, CBIID, FVB-Tg(Pax4-lacZ)1Pgr/Pgr mutant strain MGI:3044158 Tg(Pax4-lacZ)1Pgr transgene insertion 1, Peter Gruss MGI:3044157 Tg(Pax4-lacZ)1Pgr transgene insertion 1, Peter Gruss https://www.infrafrontier.eu/search?keyword=EM:00042 + EM:01839 FVB-Tg(Nefh/EGFP)1Eyer/Orl EMMA archived NFH-GFP, FVB-Tg(Nefh-GFP)/Orl mutant strain MGI:5315129 Tg(Nefh/EGFP)1Eyer transgene insertion 1, Joel Eyer MGI:5315128 Tg(Nefh/EGFP)1Eyer transgene insertion 1, Joel Eyer https://www.infrafrontier.eu/search?keyword=EM:01839 + EM:00140 FVB-Tg(Mpz-cre)1Brn/Orl EMMA embryo P0 Cre-B mutant strain MGI:2445228 Tg(Mpz-cre)1Brn transgene insertion 1, Anton Berns MGI:2445223 Tg(Mpz-cre)1Brn transgene insertion 1, Anton Berns https://www.infrafrontier.eu/search?keyword=EM:00140 + EM:00314 FVB-Tg(Mpz*L106I)3Msch/Cnrm EMMA embryo FVB-Tg(P0)sub3Msch/Cnrm, P0sub3 mutant strain MGI:5003316 Tg(Mpz*L106I)3Msch transgene insertion 3, Melitta Schachner MGI:5003308 Tg(Mpz*L106I)3Msch transgene insertion 3, Melitta Schachner https://www.infrafrontier.eu/search?keyword=EM:00314 + EM:00313 FVB-Tg(Mpz*L106I)1Msch/Cnrm EMMA embryo FVB-Tg(P0)sub1Msch/Cnrm, P0sub1 mutant strain MGI:5003283 Tg(Mpz*L106I)1Msch transgene insertion 1, Melitta Schachner MGI:5003282 Tg(Mpz*L106I)1Msch transgene insertion 1, Melitta Schachner https://www.infrafrontier.eu/search?keyword=EM:00313 + EM:00315 FVB-Tg(Mpz*Ala221fs)4Msch/Cnrm EMMA embryo FVB-Tg(P0)ins4Msch/Cnrm, P0ins4 mutant strain MGI:5003323 Tg(Mpz*Ala221fs)4Msch transgene insertion 4, Melitta Schachner MGI:5003322 Tg(Mpz*Ala221fs)4Msch transgene insertion 4, Melitta Schachner https://www.infrafrontier.eu/search?keyword=EM:00315 ? EM:09937 FVB-Tg(MMTV-PRUNE)/Cnrm EMMA embryo mutant strain Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) https://www.infrafrontier.eu/search?keyword=EM:09937 ? EM:09937 FVB-Tg(MMTV-PRUNE)/Cnrm EMMA sperm mutant strain Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) https://www.infrafrontier.eu/search?keyword=EM:09937 + EM:05152 FVB-Tg(MMTV-ERBB2*)#Arbs/Cnbc EMMA embryo FVB-Tg(MMTV-Erbb2*)#Arbs/Cnbc, FVB HER2M687, FVB-Tg(MMTV-Erbb2)/Cnbc mutant strain MGI:5883855 Tg(MMTV-ERBB2*)#Arbs transgene insertion, Joaquin Arribas MGI:5883853 Tg(MMTV-ERBB2*)#Arbs transgene insertion, Joaquin Arribas https://www.infrafrontier.eu/search?keyword=EM:05152 ? EM:10733 FVB-Tg(KRT14-VEGFC)1Ali/Oulu EMMA embryo mutant strain MGI:6273971 Tg(KRT14-VEGFC)1Ali transgene insertion 1, Kari Alitalo MGI:6273970 Tg(KRT14-VEGFC)1Ali transgene insertion 1, Kari Alitalo https://www.infrafrontier.eu/search?keyword=EM:10733 ? EM:10733 FVB-Tg(KRT14-VEGFC)1Ali/Oulu EMMA sperm mutant strain MGI:6273971 Tg(KRT14-VEGFC)1Ali transgene insertion 1, Kari Alitalo MGI:6273970 Tg(KRT14-VEGFC)1Ali transgene insertion 1, Kari Alitalo https://www.infrafrontier.eu/search?keyword=EM:10733 + EM:09798 FVB-Tg(KRT14-Figf)1Ali/Oulu EMMA embryo K14-mVEGF-D mutant strain MGI:3804466 Tg(KRT14-Figf)1Ali transgene insertion 1, Kari Alitalo MGI:3804465 Tg(KRT14-Figf)1Ali transgene insertion 1, Kari Alitalo https://www.infrafrontier.eu/search?keyword=EM:09798 + EM:09798 FVB-Tg(KRT14-Figf)1Ali/Oulu EMMA sperm K14-mVEGF-D mutant strain MGI:3804466 Tg(KRT14-Figf)1Ali transgene insertion 1, Kari Alitalo MGI:3804465 Tg(KRT14-Figf)1Ali transgene insertion 1, Kari Alitalo https://www.infrafrontier.eu/search?keyword=EM:09798 + EM:05159 FVB-Tg(Fabp2-Arg1)1Wla/Cnbc EMMA embryo FA/2 FVB mutant strain MGI:2446302 Tg(Fabp2-Arg1)1Wla transgene insertion 1, Wouters H Lamers MGI:2652048 Tg(Fabp2-Arg1)1Wla transgene insertion 1, Wouters H Lamers https://www.infrafrontier.eu/search?keyword=EM:05159 + EM:01657 FVB-Tg(Dll1-Dll3)3Gos/Ieg EMMA sperm Tg(Dll3)3Gos, FVB-Tg(Dll3)3Gos/Ieg mutant strain MGI:5501066 Tg(Dll1-Dll3)3Gos transgene insertion 3, Achim Gossler MGI:5501062 Tg(Dll1-Dll3)3Gos transgene insertion 3, Achim Gossler https://www.infrafrontier.eu/search?keyword=EM:01657 + EM:01237 FVB-Tg(CEPHY285E6)84Hgc/Orl EMMA embryo YAC Lg 84 mutant strain MGI:5293466 Tg(CEPHY285E6)84Hgc transgene insertion 84, Edward Rubin MGI:5293462 Tg(CEPHY285E6)84Hgc transgene insertion 84, Edward Rubin https://www.infrafrontier.eu/search?keyword=EM:01237 + EM:01748 FVB-Tg(CEPHY285E6)67Hgc/Orl EMMA embryo YAC Lg 67 mutant strain MGI:5293460 Tg(CEPHY285E6)67Hgc transgene insertion 67, Edward Rubin MGI:5293459 Tg(CEPHY285E6)67Hgc transgene insertion 67, Edward Rubin https://www.infrafrontier.eu/search?keyword=EM:01748 + EM:01245 FVB-Tg(CEPHY230E8)55Hgc/Orl EMMA embryo YAC Lg 55, FVB-Tg(YAC230E)55Hgc/Orl mutant strain MGI:5291627 Tg(CEPHY230E8)55Hgc transgene insertion 55, Edward M Rubin MGI:5291626 Tg(CEPHY230E8)55Hgc transgene insertion 55, Edward M Rubin https://www.infrafrontier.eu/search?keyword=EM:01245 + EM:01246 FVB-Tg(CEPHY230E8)50Hgc/Orl EMMA embryo YAC Lg 50, FVB-Tg(YAC230E)50Hgc/Orl mutant strain MGI:5291633 Tg(CEPHY230E8)50Hgc transgene insertion 50, Edward M Rubin MGI:5291632 Tg(CEPHY230E8)50Hgc transgene insertion 50, Edward M Rubin https://www.infrafrontier.eu/search?keyword=EM:01246 + EM:01238 FVB-Tg(CEPHY152F7)57Hgc/Orl EMMA embryo YAC Lg 57 mutant strain MGI:5293456 Tg(CEPHY152F7)57Hgc transgene insertion 57, Edward Rubin MGI:5293454 Tg(CEPHY152F7)57Hgc transgene insertion 57, Edward Rubin https://www.infrafrontier.eu/search?keyword=EM:01238 + EM:01238 FVB-Tg(CEPHY152F7)57Hgc/Orl EMMA sperm YAC Lg 57 mutant strain MGI:5293456 Tg(CEPHY152F7)57Hgc transgene insertion 57, Edward Rubin MGI:5293454 Tg(CEPHY152F7)57Hgc transgene insertion 57, Edward Rubin https://www.infrafrontier.eu/search?keyword=EM:01238 + EM:01303 FVB-Tg(CEPHY152F7)12Hgc/Orl EMMA embryo YAC Lg 12, FVB-Tg(YAC152F7)12Hgc/Orl mutant strain MGI:5293446 Tg(CEPHY152F7)12Hgc transgene insertion 12, Edward M Rubin MGI:5293445 Tg(CEPHY152F7)12Hgc transgene insertion 12, Edward M Rubin https://www.infrafrontier.eu/search?keyword=EM:01303 + EM:01304 FVB-Tg(CEPHY141G6)4Hgc/Orl EMMA embryo YAC Lg 4, FVB-Tg(YAC141G6)4Hgc/Orl mutant strain MGI:5293441 Tg(CEPHY141G6)4Hgc transgene insertion 4, Edward M Rubin MGI:5293440 Tg(CEPHY141G6)4Hgc transgene insertion 4, Edward M Rubin https://www.infrafrontier.eu/search?keyword=EM:01304 + EM:01302 FVB-Tg(CEPHY141G6)28Hgc/Orl EMMA embryo FVB-Tg(YAC141G6)28Hgc/Orl, YAC Lg 28 mutant strain MGI:5293437 Tg(CEPHY141G6)28Hgc transgene insertion 28, Edward M Rubin MGI:5293436 Tg(CEPHY141G6)28Hgc transgene insertion 28, Edward M Rubin https://www.infrafrontier.eu/search?keyword=EM:01302 ? EM:09109 FVB-Tg(CD19-Zap70)1Icgb/Cnrm EMMA embryo mutant strain Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb https://www.infrafrontier.eu/search?keyword=EM:09109 ? EM:09109 FVB-Tg(CD19-Zap70)1Icgb/Cnrm EMMA sperm mutant strain Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb https://www.infrafrontier.eu/search?keyword=EM:09109 + EM:00005 FVB-Tg(CAG-cat-lacZ)1Brn/StmOrl EMMA embryo FVB-Tg(ACTB-cat-lacZ)1Brn/BrnStm, FVB-Tg(ACTB-cat-lacZ)1Brn/StmOrl, ACZL mutant strain MGI:3044043 Tg(CAG-cat-lacZ)1Brn transgene insertion 1, Anton Berns MGI:3044042 Tg(CAG-cat-lacZ)1Brn transgene insertion 1, Anton Berns https://www.infrafrontier.eu/search?keyword=EM:00005 + EM:01415 FVB-Tg(ACTB-tTS)1Mllo/Cnrm EMMA embryo pAct-tTS, FVB-Tg(ACTB-tTS)1Mllo/Ibcm mutant strain MGI:3717162 Tg(ACTB-tTS)1Mllo transgene insertion 1, Moises Mallo MGI:3717161 Tg(ACTB-tTS)1Mllo transgene insertion 1, Moises Mallo https://www.infrafrontier.eu/search?keyword=EM:01415 + EM:11961 FVB-Il31ra/Cnrm EMMA embryo mutant strain MGI:6342541 Il31ra endonuclease-mediated mutation 2, Paul A Heppenstall MGI:2180511 Il31ra interleukin 31 receptor A https://www.infrafrontier.eu/search?keyword=EM:11961 + EM:11961 FVB-Il31ra/Cnrm EMMA sperm mutant strain MGI:6342541 Il31ra endonuclease-mediated mutation 2, Paul A Heppenstall MGI:2180511 Il31ra interleukin 31 receptor A https://www.infrafrontier.eu/search?keyword=EM:11961 ? EM:11960 FVB-Il31ra/Cnrm EMMA archived mutant strain MGI:6342540 Il31ra endonuclease-mediated mutation 1, Paul A Heppenstall MGI:2180511 Il31ra interleukin 31 receptor A https://www.infrafrontier.eu/search?keyword=EM:11960 ? EM:09147 Ftl1Ate007Mhda; internal lab code ATE007 EMMA sperm mutant strain splice 2nd base upst splice 2nd base upst MGI:95589 Ftl1 ferritin light polypeptide 1 https://www.infrafrontier.eu/search?keyword=EM:09147 - EM:01286 FNOS2 EMMA sperm STOCK Fnos2/H mutant strain MGI:6241419 Fnos2 FNOS2 MGI:6241416 Fnos2 FNOS2 https://www.infrafrontier.eu/search?keyword=EM:01286 - EM:12618 Floxed-PCBP4 EMMA embryo mutant strain MGI:6407112 Pcbp4 targeted mutation 1, Genoway MGI:1890471 Pcbp4 poly(rC) binding protein 4 https://www.infrafrontier.eu/search?keyword=EM:12618 - EM:12618 Floxed-PCBP4 EMMA sperm mutant strain MGI:6407112 Pcbp4 targeted mutation 1, Genoway MGI:1890471 Pcbp4 poly(rC) binding protein 4 https://www.infrafrontier.eu/search?keyword=EM:12618 ? EM:12163 flox scrambled sponge EMMA archived mutant strain Col1A1 Col1A1 MGI:88467 Col1a1 collagen, type I, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:12163 ? EM:12162 flox miR-26 sponge EMMA sperm mutant strain Col1A1 Col1A1 MGI:88467 Col1a1 collagen, type I, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:12162 ? EM:05513 FLG KO conv EMMA embryo mutant strain Flg Flg MGI:95553 Flg filaggrin https://www.infrafrontier.eu/search?keyword=EM:05513 ? EM:12222 Fam183b EMMA sperm mutant strain Fam183b Fam183b MGI:1922679 Fam183b family with sequence similarity 183, member B https://www.infrafrontier.eu/search?keyword=EM:12222 - EM:12969 ERR1 CM EMMA embryo unclassified Tm1 Tm1 MGI:1346831 Esrra estrogen related receptor, alpha https://www.infrafrontier.eu/search?keyword=EM:12969 ? EM:11953 erGAP3 EMMA sperm mutant strain erGAP3 erGAP3 https://www.infrafrontier.eu/search?keyword=EM:11953 ? EM:11141 EmuTEL-AML1 EMMA sperm mutant strain Tg(Emu-TEL/AML1) Tg(Emu-TEL/AML1) Tg(Emu-TEL/AML1) Tg(Emu-TEL/AML1) https://www.infrafrontier.eu/search?keyword=EM:11141 ? EM:05492 Emp3 KO conv EMMA embryo mutant strain Emp3 Emp3 MGI:1098729 Emp3 epithelial membrane protein 3 https://www.infrafrontier.eu/search?keyword=EM:05492 ? EM:05493 Emp3 KO cond EMMA embryo mutant strain Emp3 Emp3 MGI:1098729 Emp3 epithelial membrane protein 3 https://www.infrafrontier.eu/search?keyword=EM:05493 ? EM:11391 Egr2-GFP knock-in mouse EMMA sperm mutant strain MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:11391 ? EM:11831 Ebf3 EMMA archived unclassified MGI:894289 Ebf3 early B cell factor 3 https://www.infrafrontier.eu/search?keyword=EM:11831 + EM:01167 DW-Lepr/Orl EMMA archived diabete-Pasteur mutant strain MGI:1856013 Lepr diabetes Institut Pasteur MGI:104993 Lepr leptin receptor https://www.infrafrontier.eu/search?keyword=EM:01167 ? EM:11372 DUSP1flox EMMA embryo mutant strain Dusp1 Dusp1 MGI:105120 Dusp1 dual specificity phosphatase 1 https://www.infrafrontier.eu/search?keyword=EM:11372 ? EM:12226 Dll1D1N-E3_D4ki EMMA sperm mutant strain Dll1D1N-E3_D4ki Dll1D1N-E3_D4ki MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:12226 ? EM:12227 Dll1D1contD4ki EMMA sperm mutant strain Dll1D1contD4ki Dll1D1contD4ki MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:12227 + EM:02026 DBA/1UguOrl EMMA archived DBA/1 CD44WT mutant strain Cd44 wt CD44 wild type MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02026 - EM:11300 DBA.Cg-Synb/Orl EMMA embryo DBA.129S2(Cg)-Synb/Orl mutant strain MGI:5308859 Synb targeted mutation 1.2, Mouse Clinical Institute MGI:3045308 Synb syncytin b https://www.infrafrontier.eu/search?keyword=EM:11300 + EM:07011 D2.Cg-Tg(Wap-Shh)186Mig/Cnbc EMMA embryo Tg(WAP-Shh)186Mig-DBA2 mutant strain MGI:5645729 Tg(Wap-Shh)186Mig transgene insertion 186, Marta I Gallego MGI:5645725 Tg(Wap-Shh)186Mig transgene insertion 186, Marta I Gallego https://www.infrafrontier.eu/search?keyword=EM:07011 + EM:01721 D2.Cg-Tg(TG-Gnas*R201H)1Rho/Orl EMMA embryo gsp mice, gsp transgenic mice, 2211D mutant strain MGI:5308857 Tg(TG-Gnas*R201H)1Rho transgene insertion 1, Rhone-Poulenc Sante MGI:5308854 Tg(TG-Gnas*R201H)1Rho transgene insertion 1, Rhone-Poulenc Sante https://www.infrafrontier.eu/search?keyword=EM:01721 - EM:11814 D1OlaHsd.D1LacJ-Tg(Tcra172,Tcrb172)1Wcl/MmmhOrl EMMA sperm D1OlaHsd.Cg-Tg(Tcra172,Tcrb172)1Wcl/MmmhOrl mutant strain MGI:3699517 Tg(Tcra172,Tcrb172)1Wcl transgene insertion 1, Warren C Ladiges MGI:3767797 Tg(Tcra172,Tcrb172)1Wcl transgene insertion 1, Warren C Ladiges https://www.infrafrontier.eu/search?keyword=EM:11814 + EM:12679 D1OlaHsd.Cg-Thy1/Orl EMMA sperm D1.Cg-Thy1/Orl mutant strain MGI:3579311 Thy1 a variant MGI:98747 Thy1 thymus cell antigen 1, theta https://www.infrafrontier.eu/search?keyword=EM:12679 ? EM:11813 D1.B6-Tg(CAG-EGFP)1Osb/JOrl EMMA sperm mutant strain MGI:2686773 Tg(CAG-EGFP)1Osb transgene insertion 1, Research Institute for Microbial Diseases, Osaka University MGI:2686899 Tg(CAG-EGFP)1Osb transgene insertion 1, Research Institute for Microbial Diseases, Osaka University https://www.infrafrontier.eu/search?keyword=EM:11813 + EM:11812 D1.129P2(B6)-Il10/JOrl EMMA sperm D1.B6(129P2)-Il10/JOrl mutant strain MGI:1857199 Il10 targeted mutation 1, University of Cologne MGI:96537 Il10 interleukin 10 https://www.infrafrontier.eu/search?keyword=EM:11812 + EM:02025 D1.129-Cd44/Orl EMMA archived mutant strain MGI:2679704 Cd44 targeted mutation 1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02025 + EM:02024 D1.129-Cd44/Orl EMMA archived DBA/1 CD44v6v7-/- mutant strain MGI:2679706 Cd44 targeted mutation 1.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02024 ? EM:12504 Cyp4v3-Ile50Val EMMA sperm mutant strain Cyp4v3; c.1519, C-->T; Ile50Val Cyp4v3; c.1519, C-->T; Ile50Val MGI:2142763 Cyp4v3 cytochrome P450, family 4, subfamily v, polypeptide 3 https://www.infrafrontier.eu/search?keyword=EM:12504 ? EM:05509 Csemp1 KO conv EMMA embryo mutant strain Fyco1 Fyco1 MGI:107277 Fyco1 FYVE and coiled-coil domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:05509 - EM:02113 Crl:SKH1-Hr
Tg(HSE-EYFP)1Mklv/Kctt EMMA embryo mutant strain MGI:5573168 Tg(HSE-EYFP)1Mklv transgene insertion 1, Andrey Mikhailov MGI:5573167 Tg(HSE-EYFP)1Mklv transgene insertion 1, Andrey Mikhailov https://www.infrafrontier.eu/search?keyword=EM:02113 - EM:02157 Crl:SKH1-Hr
Tg(CMV-EYFP/DsRed2)1Mklv/Kctt EMMA embryo mutant strain MGI:5573173 Tg(CMV-EYFP/DsRed2)1Mklv transgene insertion 1, Andrey Mikhailov MGI:5573171 Tg(CMV-EYFP/DsRed2)1Mklv transgene insertion 1, Andrey Mikhailov https://www.infrafrontier.eu/search?keyword=EM:02157 - EM:10790 Crl:CD1-Tie1/Oulu EMMA embryo STOCK Tie1/Oulu, Tie1/LacZ (CD1/ICR) mutant strain MGI:2159370 Tie1 targeted mutation 1, Juha Partanen MGI:99906 Tie1 tyrosine kinase with immunoglobulin-like and EGF-like domains 1 https://www.infrafrontier.eu/search?keyword=EM:10790 - EM:10790 Crl:CD1-Tie1/Oulu EMMA sperm STOCK Tie1/Oulu, Tie1/LacZ (CD1/ICR) mutant strain MGI:2159370 Tie1 targeted mutation 1, Juha Partanen MGI:99906 Tie1 tyrosine kinase with immunoglobulin-like and EGF-like domains 1 https://www.infrafrontier.eu/search?keyword=EM:10790 ? EM:11361 Col1a2-Cre-ER(T);Rosa26-floxed stop eYFP EMMA sperm mutant strain MGI:2449038 Gt(ROSA)26Sor targeted mutation 1, Frank Costantini MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11361 ? EM:11361 Col1a2-Cre-ER(T);Rosa26-floxed stop eYFP EMMA sperm mutant strain MGI:3785760 Tg(Col1a2-cre/ERT,-ALPP)7Cpd transgene insertion 7, Christopher P Denton MGI:3785759 Tg(Col1a2-cre/ERT,-ALPP)7Cpd transgene insertion 7, Christopher P Denton https://www.infrafrontier.eu/search?keyword=EM:11361 - EM:02611 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon/Cnbc EMMA embryo mutant strain MGI:4443331 Tg(Tyr-rtTA)4111Lmon transgene insertion 4111, Lluis Montoliu MGI:4443327 Tg(Tyr-rtTA)4111Lmon transgene insertion 4111, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:02611 - EM:02611 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon/Cnbc EMMA embryo mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:02611 - EM:02611 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon/Cnbc EMMA embryo mutant strain MGI:4443329 Tg(tetO-Tyr)1335Lmon transgene insertion 1335, Lluis Montoliu MGI:4443325 Tg(tetO-Tyr)1335Lmon transgene insertion 1335, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:02611 - EM:08317 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon Gnat2<+> EMMA embryo mutant strain MGI:4443331 Tg(Tyr-rtTA)4111Lmon transgene insertion 4111, Lluis Montoliu MGI:4443327 Tg(Tyr-rtTA)4111Lmon transgene insertion 4111, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:08317 - EM:08317 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon Gnat2<+> EMMA embryo mutant strain MGI:2430747 Gnat2<+> wild type MGI:95779 Gnat2 guanine nucleotide binding protein, alpha transducing 2 https://www.infrafrontier.eu/search?keyword=EM:08317 - EM:08317 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon Gnat2<+> EMMA embryo mutant strain MGI:4443329 Tg(tetO-Tyr)1335Lmon transgene insertion 1335, Lluis Montoliu MGI:4443325 Tg(tetO-Tyr)1335Lmon transgene insertion 1335, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:08317 - EM:08317 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon Gnat2<+> EMMA embryo mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:08317 + EM:06056 Cnbc:NMRI-Tg(Wap-ALPP*)p1938Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)p1938Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06056 + EM:06056 Cnbc:NMRI-Tg(Wap-ALPP*)p1938Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)p1938Lmon mutant strain MGI:6202757 Tg(Wap-ALPP*)p1938Lmon transgene insertion p1938, Lluis Montoliu MGI:6202755 Tg(Wap-ALPP*)p1938Lmon transgene insertion p1938, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:06056 + EM:06055 Cnbc:NMRI-Tg(Wap-ALPP*)p1435Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)p1435Lmon mutant strain MGI:6202751 Tg(Wap-ALPP*)p1435Lmon transgene insertion p1435, Lluis Montoliu MGI:6202750 Tg(Wap-ALPP*)p1435Lmon transgene insertion p1435, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:06055 + EM:06055 Cnbc:NMRI-Tg(Wap-ALPP*)p1435Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)p1435Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06055 + EM:06059 Cnbc:NMRI-Tg(Wap-ALPP*)b6733Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6733Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06059 + EM:06059 Cnbc:NMRI-Tg(Wap-ALPP*)b6733Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6733Lmon mutant strain MGI:6202771 Tg(Wap-ALPP*)b6733Lmon transgene insertion b6733, Lluis Montoliu MGI:6202770 Tg(Wap-ALPP*)b6733Lmon transgene insertion b6733, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:06059 + EM:06058 Cnbc:NMRI-Tg(Wap-ALPP*)b6727Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6727Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06058 + EM:06058 Cnbc:NMRI-Tg(Wap-ALPP*)b6727Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6727Lmon mutant strain MGI:6202768 Tg(Wap-ALPP*)b6727Lmon transgene insertion b6727, Lluis Montoliu MGI:6202767 Tg(Wap-ALPP*)b6727Lmon transgene insertion b6727, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:06058 + EM:06057 Cnbc:NMRI-Tg(Wap-ALPP*)b6725Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6725Lmon mutant strain MGI:6202764 Tg(Wap-ALPP*)b6725Lmon transgene insertion b6725, Lluis Montoliu MGI:6202763 Tg(Wap-ALPP*)b6725Lmon transgene insertion b6725, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:06057 + EM:06057 Cnbc:NMRI-Tg(Wap-ALPP*)b6725Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6725Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06057 + EM:05261 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2017Lmon EMMA embryo Hsd:NMRI-Tg(Tyr,aEHS1.4)2017Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2017Lmon mutant strain MGI:5645903 Tg(Tyr,aEHS1.4)2017Lmon transgene insertion 2017, Lluis Montoliu MGI:5645900 Tg(Tyr,aEHS1.4)2017Lmon transgene insertion 2017, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05261 + EM:05261 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2017Lmon EMMA embryo Hsd:NMRI-Tg(Tyr,aEHS1.4)2017Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2017Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05261 + EM:05262 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2005Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2005Lmon, Hsd:NMRI-Tg(Tyr,aEHS1.4)2005Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05262 + EM:05262 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2005Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2005Lmon, Hsd:NMRI-Tg(Tyr,aEHS1.4)2005Lmon/Cnbc mutant strain MGI:5645904 Tg(Tyr,aEHS1.4)2005Lmon transgene insertion 2005, Lluis Montoliu MGI:5645901 Tg(Tyr,aEHS1.4)2005Lmon transgene insertion 2005, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05262 + EM:03109 Cnbc:NMRI-Tg(Tyr*)8749Lmon EMMA embryo YRT2deltaAB line 8749, YRT2deltaAB, NMRI-Tg(Tyr*)8749Lmon/Cnbc mutant strain MGI:5788264 Tg(Tyr*)8749Lmon transgene insertion 8749, Lluis Montoliu MGI:5788263 Tg(Tyr*)8749Lmon transgene insertion 8749, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:03109 + EM:03109 Cnbc:NMRI-Tg(Tyr*)8749Lmon EMMA embryo YRT2deltaAB line 8749, YRT2deltaAB, NMRI-Tg(Tyr*)8749Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:03109 + EM:03104 Cnbc:NMRI-Tg(Tyr*)8748Lmon EMMA embryo YRT2deltaAB line 8748, NMRI-Tg(Tyr*)8748Lmon/Cnbc, YRT2deltaAB mutant strain MGI:5787964 Tg(Tyr*)8748Lmon transgene insertion 8748, Lluis Montoliu MGI:5787963 Tg(Tyr*)8748Lmon transgene insertion 8748, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:03104 + EM:03104 Cnbc:NMRI-Tg(Tyr*)8748Lmon EMMA embryo YRT2deltaAB line 8748, NMRI-Tg(Tyr*)8748Lmon/Cnbc, YRT2deltaAB mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:03104 + EM:03103 Cnbc:NMRI-Tg(Tyr*)6968Lmon EMMA embryo YRT2deltaA, YRT2deltaA line 6968, NMRI-Tg(Tyr*)6968Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:03103 + EM:03103 Cnbc:NMRI-Tg(Tyr*)6968Lmon EMMA embryo YRT2deltaA, YRT2deltaA line 6968, NMRI-Tg(Tyr*)6968Lmon/Cnbc mutant strain MGI:5787961 Tg(Tyr*)6968Lmon transgene insertion 6968, Lluis Montoliu MGI:5787960 Tg(Tyr*)6968Lmon transgene insertion 6968, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:03103 + EM:03105 Cnbc:NMRI-Tg(Tyr*)4794Lmon/Cnbc EMMA embryo STOCK Tg(Tyr*)4794Lmon/Cnbc, YRT2deltaLCR mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:03105 + EM:03105 Cnbc:NMRI-Tg(Tyr*)4794Lmon/Cnbc EMMA embryo STOCK Tg(Tyr*)4794Lmon/Cnbc, YRT2deltaLCR mutant strain MGI:5787978 Tg(Tyr*)4794Lmon transgene insertion 4794, Lluis Montoliu MGI:5787970 Tg(Tyr*)4794Lmon transgene insertion 4794, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:03105 + EM:03102 Cnbc:NMRI-Tg(Tyr*)2138Lmon EMMA embryo YRT4 mutant strain MGI:5787956 Tg(Tyr*)2138Lmon transgene insertion 2138, Lluis Montoliu MGI:5787955 Tg(Tyr*)2138Lmon transgene insertion 2138, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:03102 + EM:03102 Cnbc:NMRI-Tg(Tyr*)2138Lmon EMMA embryo YRT4 mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:03102 + EM:05257 Cnbc:NMRI-Tg(Tyr)2331Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr)2331Lmon, Hsd:NMRI-Tg(Tyr)2331Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05257 + EM:05257 Cnbc:NMRI-Tg(Tyr)2331Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr)2331Lmon, Hsd:NMRI-Tg(Tyr)2331Lmon/Cnbc mutant strain MGI:5645916 Tg(Tyr)2331Lmon transgene insertion 2331, Lluis Montoliu MGI:5645909 Tg(Tyr)2331Lmon transgene insertion 2331, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05257 + EM:05259 Cnbc:NMRI-Tg(Tyr)2231Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2231Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2231Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05259 + EM:05259 Cnbc:NMRI-Tg(Tyr)2231Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2231Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2231Lmon mutant strain MGI:5645920 Tg(Tyr)2231Lmon transgene insertion 2231, Lluis Montoliu MGI:5645912 Tg(Tyr)2231Lmon transgene insertion 2231, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05259 + EM:05256 Cnbc:NMRI-Tg(Tyr)2222Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr)2222Lmon/Cnbc, Hsd:NMRI-Tg(Tyr)2222Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05256 + EM:05256 Cnbc:NMRI-Tg(Tyr)2222Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr)2222Lmon/Cnbc, Hsd:NMRI-Tg(Tyr)2222Lmon/Cnbc mutant strain MGI:5645915 Tg(Tyr)2222Lmon transgene insertion 2222, Lluis Montoliu MGI:5645908 Tg(Tyr)2222Lmon transgene insertion 2222, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05256 + EM:05260 Cnbc:NMRI-Tg(Tyr)2131Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2131Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2131Lmon mutant strain MGI:5645925 Tg(Tyr)2131Lmon transgene insertion 2131, Lluis Montoliu MGI:5645913 Tg(Tyr)2131Lmon transgene insertion 2131, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05260 + EM:05260 Cnbc:NMRI-Tg(Tyr)2131Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2131Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2131Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05260 + EM:05258 Cnbc:NMRI-Tg(Tyr)2028Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2028Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2028Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05258 + EM:05258 Cnbc:NMRI-Tg(Tyr)2028Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2028Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2028Lmon mutant strain MGI:5645918 Tg(Tyr)2028Lmon transgene insertion 2028, Lluis Montoliu MGI:5645911 Tg(Tyr)2028Lmon transgene insertion 2028, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05258 + EM:03096 Cnbc:NMRI-Tg(Tyr)1999Lmon EMMA embryo NMRI-Tg(Tyr)1999Lmon/Cnbc, YRT2 mutant strain MGI:5787939 Tg(Tyr)1999Lmon transgene insertion 1999, Lluis Montoliu MGI:5787936 Tg(Tyr)1999Lmon transgene insertion 1999, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:03096 + EM:03096 Cnbc:NMRI-Tg(Tyr)1999Lmon EMMA embryo NMRI-Tg(Tyr)1999Lmon/Cnbc, YRT2 mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:03096 + EM:06053 Cnbc:NMRI-conls<+> EMMA embryo stock Hsd:NMRI-coneless+/Lmon mutant strain MGI:6198563 conls<+> wild type MGI:6198564 conls coneless https://www.infrafrontier.eu/search?keyword=EM:06053 + EM:06053 Cnbc:NMRI-conls<+> EMMA embryo stock Hsd:NMRI-coneless+/Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06053 + EM:06052 Cnbc:NMRI-conls EMMA embryo stock HsdWin:NMRI-coneless/Lmon mutant strain MGI:6198566 conls coneless MGI:6198564 conls coneless https://www.infrafrontier.eu/search?keyword=EM:06052 + EM:06052 Cnbc:NMRI-conls EMMA embryo stock HsdWin:NMRI-coneless/Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06052 ? EM:05489 Cited 4 KO conv EMMA embryo mutant strain Cited4 Cited4 MGI:1861694 Cited4 Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 https://www.infrafrontier.eu/search?keyword=EM:05489 ? EM:05491 Cited 4 KO cond EMMA embryo mutant strain Cited4 Cited4 MGI:1861694 Cited4 Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 https://www.infrafrontier.eu/search?keyword=EM:05491 - EM:07826 CHM Flox EMMA sperm mutant strain MGI:3617903 Chm targeted mutation 1.1, Miguel C Seabra MGI:892979 Chm choroidermia (RAB escort protein 1) https://www.infrafrontier.eu/search?keyword=EM:07826 + EM:12506 CFW-Em/JG EMMA sperm mutant strain MGI:1861119 Em Emory cataract MGI:95319 Em Emory cataract https://www.infrafrontier.eu/search?keyword=EM:12506 ? EM:05687 Cdk11b (cell division cycle 2-like 1) EMMA sperm mutant strain Cdk11b Cdk11b MGI:88353 Cdk11b cyclin-dependent kinase 11B https://www.infrafrontier.eu/search?keyword=EM:05687 + EM:00220 CD2-Tg(HK2-luc)279Uku/Orl EMMA embryo Uku279, CD2-Tg(HK2-luc)279Uku/Ciml, CD2-Tg(HK2-luc)279Uku mutant strain MGI:3522710 Tg(HK2-luc)279Uku transgene insertion 279, University of Kuopio MGI:3522709 Tg(HK2-luc)279Uku transgene insertion 279, University of Kuopio https://www.infrafrontier.eu/search?keyword=EM:00220 + EM:00219 CD2-Tg(HK2-luc)253Uku/Orl EMMA embryo CD2-Tg(HK2-luc)253Uku, CD2-Tg(HK2-luc)253Uku/Ciml mutant strain MGI:3522707 Tg(HK2-luc)253Uku transgene insertion 253, University of Kuopio MGI:3522705 Tg(HK2-luc)253Uku transgene insertion 253, University of Kuopio https://www.infrafrontier.eu/search?keyword=EM:00219 + EM:00218 CD2-Tg(HK2-luc)242Uku/Orl EMMA embryo CD2-Tg(HK2-luc)242Uku, CD2-Tg(HK2-luc)242Uku/Ciml mutant strain MGI:3522703 Tg(HK2-luc)242Uku transgene insertion 242, University of Kuopio MGI:3522701 Tg(HK2-luc)242Uku transgene insertion 242, University of Kuopio https://www.infrafrontier.eu/search?keyword=EM:00218 + EM:00217 CD2-Tg(HK2-luc)231Uku/Orl EMMA embryo CD2-Tg(HK2-luc)231Uku/Ciml, CD2-Tg(HK2-luc)231Uku mutant strain MGI:3522676 Tg(HK2-luc)231Uku transgene insertion 231, University of Kuopio MGI:3522674 Tg(HK2-luc)231Uku transgene insertion 231, University of Kuopio https://www.infrafrontier.eu/search?keyword=EM:00217 + EM:02073 CD2-Hk2/Kctt EMMA embryo Ukko1; Hk2+/-, CD2.129P2-Hk2/Kctt mutant strain MGI:3624862 Hk2 targeted mutation 1, Markku Laakso MGI:1315197 Hk2 hexokinase 2 https://www.infrafrontier.eu/search?keyword=EM:02073 ? EM:11390 CD2-Egr2 transgenic (Tg) mouse EMMA sperm mutant strain CD2-Egr2-Tg CD2-Egr2-Tg https://www.infrafrontier.eu/search?keyword=EM:11390 - EM:08030 CD1;129-Vav2 Vav1/Cnbc EMMA embryo STOCK Vav2 Vav1/Cnbc mutant strain MGI:2387822 Vav2 targeted mutation 1, Klaus-Dieter Fischer MGI:102718 Vav2 vav 2 oncogene https://www.infrafrontier.eu/search?keyword=EM:08030 - EM:08030 CD1;129-Vav2 Vav1/Cnbc EMMA embryo STOCK Vav2 Vav1/Cnbc mutant strain MGI:2387840 Vav1 targeted mutation 2, Mariano Barbacid MGI:98923 Vav1 vav 1 oncogene https://www.infrafrontier.eu/search?keyword=EM:08030 ? EM:12821 CD1;129-Cfap43/Biat EMMA sperm mutant strain MGI:6431400 Cfap43 endonuclease-mediated mutation 1.1, Achim Gossler MGI:1289258 Cfap43 cilia and flagella associated protein 43 https://www.infrafrontier.eu/search?keyword=EM:12821 - EM:12662 CD1; B6D2-Tg(Prm1EGFP, CAG-mRFP1, HS4i-TyrC)85Ltku EMMA embryo mutant strain Tg(Prm1-EGFP)85Ltku transgene insertion 85, Pawel Pelczar Tg(Prm1-EGFP)85Ltku transgene insertion 85, Pawel Pelczar https://www.infrafrontier.eu/search?keyword=EM:12662 - EM:12662 CD1; B6D2-Tg(Prm1EGFP, CAG-mRFP1, HS4i-TyrC)85Ltku EMMA live mutant strain Tg(Prm1-EGFP)85Ltku transgene insertion 85, Pawel Pelczar Tg(Prm1-EGFP)85Ltku transgene insertion 85, Pawel Pelczar https://www.infrafrontier.eu/search?keyword=EM:12662 - EM:10734 CD1.Cg-Vegfc/Oulu EMMA embryo STOCK Vegfc/Oulu mutant strain MGI:3026650 Vegfc targeted mutation 1, Kari Alitalo MGI:109124 Vegfc vascular endothelial growth factor C https://www.infrafrontier.eu/search?keyword=EM:10734 - EM:10734 CD1.Cg-Vegfc/Oulu EMMA sperm STOCK Vegfc/Oulu mutant strain MGI:3026650 Vegfc targeted mutation 1, Kari Alitalo MGI:109124 Vegfc vascular endothelial growth factor C https://www.infrafrontier.eu/search?keyword=EM:10734 + EM:06065 CD1.Cg-Stat1/Cnbc EMMA embryo CD1.129-Stat1/Dlv-Tg(APN)270<-/->/Cnbc mutant strain MGI:1930947 Stat1 targeted mutation 1, David E Levy MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/search?keyword=EM:06065 + EM:06061 CD1.Cg-Stat1 Tg(ANPEP)861Mmul/Cnbc EMMA embryo CD1.129-Stat1 Tg(ANPEP)861Mmul/Cnbc, CD1.129-Stat1/Dlv-Tg(APN)861<+/+>/Cnbc mutant strain MGI:5645779 Tg(ANPEP)861Mmul transgene insertion 861, Mathias Muller MGI:5645777 Tg(ANPEP)861Mmul transgene insertion 861, Mathias Muller https://www.infrafrontier.eu/search?keyword=EM:06061 + EM:06061 CD1.Cg-Stat1 Tg(ANPEP)861Mmul/Cnbc EMMA embryo CD1.129-Stat1 Tg(ANPEP)861Mmul/Cnbc, CD1.129-Stat1/Dlv-Tg(APN)861<+/+>/Cnbc mutant strain MGI:1930947 Stat1 targeted mutation 1, David E Levy MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/search?keyword=EM:06061 + EM:06060 CD1.Cg-Stat1 Tg(ANPEP)270Mmul/Cnbc EMMA embryo mutant strain MGI:1930947 Stat1 targeted mutation 1, David E Levy MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/search?keyword=EM:06060 + EM:06060 CD1.Cg-Stat1 Tg(ANPEP)270Mmul/Cnbc EMMA embryo mutant strain MGI:5645778 Tg(ANPEP)270Mmul transgene insertion 270, Mathias Muller MGI:5645776 Tg(ANPEP)270Mmul transgene insertion 270, Mathias Muller https://www.infrafrontier.eu/search?keyword=EM:06060 + EM:02488 CD1.Cg-Fgfr2/H EMMA sperm CD1-FGFR2c342y, CD1.Cg-Fgfr2 mutant strain MGI:3053095 Fgfr2 targeted mutation 4, Peter Lonai MGI:95523 Fgfr2 fibroblast growth factor receptor 2 https://www.infrafrontier.eu/search?keyword=EM:02488 + EM:05990 CD1.A-Gdf5/Orl EMMA embryo Gdf5bp-J mutant strain MGI:1855974 Gdf5 brachypodism Jackson MGI:95688 Gdf5 growth differentiation factor 5 https://www.infrafrontier.eu/search?keyword=EM:05990 + EM:04663 CD1.192P2-Zfp647/H EMMA sperm CD1.192P2-Zfp647/H, Zfp647Gt(betageo)1Hgs CD1 mutant strain MGI:4353070 Zfp647 gene trap ES492, Heidi Sutherland MGI:3052806 Zfp647 zinc finger protein 647 https://www.infrafrontier.eu/search?keyword=EM:04663 + EM:05397 CD1.129X1-Kat2b/Orl EMMA embryo PCAF -/- CD1 mutant strain MGI:2386307 Kat2b targeted mutation 1, Yoshihiro Nakatani MGI:1343094 Kat2b K(lysine) acetyltransferase 2B https://www.infrafrontier.eu/search?keyword=EM:05397 + EM:06064 CD1.129S-Stat1<+>/Cnbc EMMA embryo CD1.129-Stat1<+/+>-Tg(APN)270<-/->/Cnbc mutant strain MGI:2433148 Stat1<+> wild type MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/search?keyword=EM:06064 + EM:02389 CD1.129P2-Afp/Cnrm EMMA embryo CD1.129P2-Afp/Ibcm, CD1-Afptm1Ibmm (AFP KO1) mutant strain MGI:2388722 Afp targeted mutation 1, Claude Szpirer MGI:87951 Afp alpha fetoprotein https://www.infrafrontier.eu/search?keyword=EM:02389 + EM:02450 CD1.129P2(Cg)-Sp6/Cnrm EMMA embryo STOCK Sp6/Ibcm, CD1.129P2(Cg)-Sp6/Ibcm, CD1-Sp6 tm1Ibmm, CD1.129P2-Sp6/Ibcm mutant strain MGI:3778294 Sp6 targeted mutation 1.1, Claude Szpirer MGI:1932575 Sp6 trans-acting transcription factor 6 https://www.infrafrontier.eu/search?keyword=EM:02450 + EM:02450 CD1.129P2(Cg)-Sp6/Cnrm EMMA sperm STOCK Sp6/Ibcm, CD1.129P2(Cg)-Sp6/Ibcm, CD1-Sp6 tm1Ibmm, CD1.129P2-Sp6/Ibcm mutant strain MGI:3778294 Sp6 targeted mutation 1.1, Claude Szpirer MGI:1932575 Sp6 trans-acting transcription factor 6 https://www.infrafrontier.eu/search?keyword=EM:02450 + EM:05335 CD1.129P2(B6)-Sox9/H EMMA sperm Sox9-neo mutant strain MGI:3817218 Sox9 targeted mutation 2, Gerd Scherer MGI:98371 Sox9 SRY (sex determining region Y)-box 9 https://www.infrafrontier.eu/search?keyword=EM:05335 + EM:02449 CD1.129-Sp6/Cnrm EMMA embryo CD1.129P2-Sp6/Ibcm, CD1.129-Sp6/Ibcm, Sp6.loxp-tm1Ibmm/CD1 mutant strain MGI:3778292 Sp6 targeted mutation 1, Claude Szpirer MGI:1932575 Sp6 trans-acting transcription factor 6 https://www.infrafrontier.eu/search?keyword=EM:02449 + EM:07742 CD1.129-Sigmar1/Cnbc EMMA embryo STOCK CD1 Sigmar1 mutant strain MGI:3044771 Sigmar1 targeted mutation 1, Lluis Montoliu MGI:1195268 Sigmar1 sigma non-opioid intracellular receptor 1 https://www.infrafrontier.eu/search?keyword=EM:07742 + EM:00160 CD1.129-Ptch1/Cnrm EMMA embryo CD1-Ptc-KO, CD1.129-Ptch, CD1.129-Ptch1/Ibcm, CD-1.129-Ptch, Ptc-CD1 KO mutant strain MGI:1857935 Ptch1 targeted mutation 1, Andreas Zimmer MGI:105373 Ptch1 patched 1 https://www.infrafrontier.eu/search?keyword=EM:00160 + EM:05988 CD1.129-Nog/Orl EMMA archived Nogtm1Amc mutant strain MGI:1862000 Nog targeted mutation 1, Andrew P McMahon MGI:104327 Nog noggin https://www.infrafrontier.eu/search?keyword=EM:05988 + EM:04858 CD1.129-Nodal/Orl EMMA embryo 129 Nodal-LacZ (KO) mutant strain MGI:2180793 Nodal targeted mutation 1, Elizabeth J Robertson MGI:97359 Nodal nodal https://www.infrafrontier.eu/search?keyword=EM:04858 + EM:10583 CD1.129-Cnr1/Cnbc EMMA embryo mutant strain MGI:1857736 Cnr1 targeted mutation 1, Marc Parmentier MGI:104615 Cnr1 cannabinoid receptor 1 (brain) https://www.infrafrontier.eu/search?keyword=EM:10583 + EM:10583 CD1.129-Cnr1/Cnbc EMMA sperm mutant strain MGI:1857736 Cnr1 targeted mutation 1, Marc Parmentier MGI:104615 Cnr1 cannabinoid receptor 1 (brain) https://www.infrafrontier.eu/search?keyword=EM:10583 + EM:06068 CD1.129-Ccr6/Cnbc EMMA embryo mutant strain MGI:2179613 Ccr6 targeted mutation 1, Gabriel Marquez MGI:1333797 Ccr6 chemokine (C-C motif) receptor 6 https://www.infrafrontier.eu/search?keyword=EM:06068 + EM:06068 CD1.129-Ccr6/Cnbc EMMA sperm mutant strain MGI:2179613 Ccr6 targeted mutation 1, Gabriel Marquez MGI:1333797 Ccr6 chemokine (C-C motif) receptor 6 https://www.infrafrontier.eu/search?keyword=EM:06068 + EM:10582 CD1.129-Adora2a/Cnbc EMMA embryo mutant strain MGI:2152583 Adora2a targeted mutation 1, Marc Parmentier MGI:99402 Adora2a adenosine A2a receptor https://www.infrafrontier.eu/search?keyword=EM:10582 ? EM:04678 CD1-Rce1/Cnbc EMMA embryo mutant strain MGI:1336895 Rce1 Ras converting CAAX endopeptidase 1 https://www.infrafrontier.eu/search?keyword=EM:04678 + EM:06063 CD1(129S)-Tg(ANPEP)861Mmul/Cnbc EMMA embryo CD1.129-Stat1<+/+>-Tg(APN)861<+/+>/Cnbc mutant strain MGI:2433148 Stat1<+> wild type MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/search?keyword=EM:06063 + EM:06063 CD1(129S)-Tg(ANPEP)861Mmul/Cnbc EMMA embryo CD1.129-Stat1<+/+>-Tg(APN)861<+/+>/Cnbc mutant strain MGI:5645779 Tg(ANPEP)861Mmul transgene insertion 861, Mathias Muller MGI:5645777 Tg(ANPEP)861Mmul transgene insertion 861, Mathias Muller https://www.infrafrontier.eu/search?keyword=EM:06063 + EM:06062 CD1(129S)-Tg(ANPEP)270Mmul/Cnbc EMMA embryo CD1.129-Stat1<+/+>-Tg(APN)270<+/+>/Cnbc mutant strain MGI:2433148 Stat1<+> wild type MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/search?keyword=EM:06062 + EM:06062 CD1(129S)-Tg(ANPEP)270Mmul/Cnbc EMMA embryo CD1.129-Stat1<+/+>-Tg(APN)270<+/+>/Cnbc mutant strain MGI:5645778 Tg(ANPEP)270Mmul transgene insertion 270, Mathias Muller MGI:5645776 Tg(ANPEP)270Mmul transgene insertion 270, Mathias Muller https://www.infrafrontier.eu/search?keyword=EM:06062 + EM:01382 CD-1 x B6.129S1-Pax1/Ieg EMMA sperm Pax1 mutant strain MGI:1857741 Pax1 targeted mutation 2, Neuherberg MGI:97485 Pax1 paired box 1 https://www.infrafrontier.eu/search?keyword=EM:01382 + EM:02105 CByIco.Cg-Tg(DO11.10)10Dlo/Cnrm EMMA embryo BALB/cByJIco DO11.10, CBy.Cg-Tg(DO11.10)10Dlo/Ibcm, CByIco.Cg-Tg(DO11.10)10Dlo/Ibcm mutant strain MGI:2664398 Tg(DO11.10)10Dlo transgene insertion 10, Dennis Y Loh MGI:2664401 Tg(DO11.10)10Dlo transgene insertion 10, Dennis Y Loh https://www.infrafrontier.eu/search?keyword=EM:02105 + EM:02106 CByIco.129S7-Ifng/Cnrm EMMA embryo BALB/cByJIco IFNg-/-, CByIco.129S7-Ifng/Ibcm, CBy.129S7-Ifng/Ibcm mutant strain MGI:1857184 Ifng targeted mutation 1, Timothy Stewart MGI:107656 Ifng interferon gamma https://www.infrafrontier.eu/search?keyword=EM:02106 + EM:02106 CByIco.129S7-Ifng/Cnrm EMMA sperm BALB/cByJIco IFNg-/-, CByIco.129S7-Ifng/Ibcm, CBy.129S7-Ifng/Ibcm mutant strain MGI:1857184 Ifng targeted mutation 1, Timothy Stewart MGI:107656 Ifng interferon gamma https://www.infrafrontier.eu/search?keyword=EM:02106 + EM:02017 CByIco.129S-Rag2/H EMMA embryo Rag2-/- CD44WT, CBy.129-Rag2/H, BALB/cByJIco Rag2-/- CD44WT mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:02017 + EM:02021 CByIco.129-Rag2 Cd44/H EMMA embryo CBy.129-Cd44 Rag2/H, BALB/cByJIco Rag2-/- CD44v10-/- mutant strain MGI:4835490 Cd44 targeted mutation 2.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02021 + EM:02021 CByIco.129-Rag2 Cd44/H EMMA embryo CBy.129-Cd44 Rag2/H, BALB/cByJIco Rag2-/- CD44v10-/- mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:02021 + EM:02020 CByIco.129-Rag2 Cd44/H EMMA embryo BALB/cByJIco Rag2-/- CD44v7-/-, Rag2-/-CD44v7-/-, CBy.129-Rag2 Cd44/H mutant strain MGI:2679704 Cd44 targeted mutation 1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02020 + EM:02020 CByIco.129-Rag2 Cd44/H EMMA embryo BALB/cByJIco Rag2-/- CD44v7-/-, Rag2-/-CD44v7-/-, CBy.129-Rag2 Cd44/H mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:02020 + EM:02022 CByIco.129-Rag2 Cd44/H EMMA embryo CBy.129-Cd44 Rag2/H, CBy.129-Rag2 Cd44/H, BALB/cByJIco Rag2-/- CD44v6v7-/- mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:02022 + EM:02022 CByIco.129-Rag2 Cd44/H EMMA embryo CBy.129-Cd44 Rag2/H, CBy.129-Rag2 Cd44/H, BALB/cByJIco Rag2-/- CD44v6v7-/- mutant strain MGI:2679706 Cd44 targeted mutation 1.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02022 + EM:02018 CByIco.129-Cd44/Ieg EMMA archived CBy.129-Cd44/Ieg, BALB/cByJIco CD44v7-/- mutant strain MGI:2679704 Cd44 targeted mutation 1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02018 + EM:02019 CByIco.129-Cd44/Ieg EMMA archived BALB/cByJIco CD44v6v7-/- mutant strain MGI:2679706 Cd44 targeted mutation 1.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02019 + EM:02079 CByIco.129(Cg)-Cd44/Ieg EMMA archived BALB/cByJIco CD44v10-/-, CBy.129X1-Cd44/Ieg mutant strain MGI:4835490 Cd44 targeted mutation 2.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02079 + EM:02427 CBy.Cg-Cd44 Tg(DO11.10)10Dlo/Cnrm EMMA embryo CBy.Cg-Cd44 Tg(DO11.10)10Dlo/Ibcm, BALB/cByJIco DO11.10 CD44v6v7-/-, CBy.129X1-Tg(DO11.10)10Dlo Cd44/Ibcm mutant strain MGI:2664398 Tg(DO11.10)10Dlo transgene insertion 10, Dennis Y Loh MGI:2664401 Tg(DO11.10)10Dlo transgene insertion 10, Dennis Y Loh https://www.infrafrontier.eu/search?keyword=EM:02427 + EM:02427 CBy.Cg-Cd44 Tg(DO11.10)10Dlo/Cnrm EMMA embryo CBy.Cg-Cd44 Tg(DO11.10)10Dlo/Ibcm, BALB/cByJIco DO11.10 CD44v6v7-/-, CBy.129X1-Tg(DO11.10)10Dlo Cd44/Ibcm mutant strain MGI:2679706 Cd44 targeted mutation 1.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02427 + EM:06070 CBy.129-Ccr8/Cnbc EMMA embryo C.129-Ccr8/Cnbc, C.129-Ccr8 mutant strain MGI:2450726 Ccr8 targeted mutation 1, Gabriel Marquez MGI:1201402 Ccr8 chemokine (C-C motif) receptor 8 https://www.infrafrontier.eu/search?keyword=EM:06070 - EM:02115 CBB6(129P2)-Dach1/Kctt EMMA embryo mutant strain MGI:2448366 Dach1 targeted mutation 1, Stefan Krauss MGI:1277991 Dach1 dachshund family transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:02115 + EM:04575 CBB10-Tg(myl2-cre)1118Tmhn/H EMMA sperm XMLC2.CRE, CBB10F1-Tg(myl2-cre)1118Tmhn/H mutant strain MGI:3712342 Tg(myl2-cre)1118Tmhn transgene insertion 1118, Tim Mohun MGI:3712335 Tg(myl2-cre)1118Tmhn transgene insertion 1118, Tim Mohun https://www.infrafrontier.eu/search?keyword=EM:04575 + EM:04922 CBACa;129P2-Ube3b/WtsiCnbc EMMA embryo CBA;129P2-Ube3b/WtsiCnbc, Ube3b genetrap mutant strain MGI:4129255 Ube3b gene trap RRJ142, BayGenomics MGI:1891295 Ube3b ubiquitin protein ligase E3B https://www.infrafrontier.eu/search?keyword=EM:04922 + EM:05013 CBACa;129P2-Prkab1/WtsiCnbc EMMA embryo Prkab1 genetrap, CBA;129P2-Prkab1/WtsiCnbc mutant strain MGI:3838355 Prkab1 gene trap RRR454, BayGenomics MGI:1336167 Prkab1 protein kinase, AMP-activated, beta 1 non-catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:05013 + EM:05012 CBACa;129P2-Kctd10/WtsiCnbc EMMA embryo CBA;129P2-Kctd10/WtsiCnbc, Kctd10 genetrap, CBA;129P2-Kctd10/WtsiCnbc mutant strain MGI:4128950 Kctd10 gene trap RRG305, BayGenomics MGI:2141207 Kctd10 potassium channel tetramerisation domain containing 10 https://www.infrafrontier.eu/search?keyword=EM:05012 + EM:05019 CBACa;129P2-Git2/WtsiCnbc EMMA embryo Git2 genetrap, CBA;129P2-Git2/WtsiCnbc mutant strain MGI:3762635 Git2 gene trap XG510, BayGenomics MGI:1347053 Git2 GIT ArfGAP 2 https://www.infrafrontier.eu/search?keyword=EM:05019 + EM:05014 CBACa;129P2-Ankrd13a/WtsiCnbc EMMA embryo Ankrd13a genetrap, CBA;129P2-Ankrd13a/WtsiCnbc mutant strain MGI:4128768 Ankrd13a gene trap RRH308, BayGenomics MGI:1915670 Ankrd13a ankyrin repeat domain 13a https://www.infrafrontier.eu/search?keyword=EM:05014 - EM:09003 CBAB6-Tg(TNFRSF1B)1335Gkl/Flmg EMMA sperm mutant strain MGI:5645569 Tg(TNFRSF1B)1335Gkl transgene insertion 1335, George Kollias MGI:5645567 Tg(TNFRSF1B)1335Gkl transgene insertion 1335, George Kollias https://www.infrafrontier.eu/search?keyword=EM:09003 + EM:01406 CBA/J-Chr 17/GhjCnrm EMMA embryo CBA.NOD-C17S consomic or chromosome substitution strain Chr 17 Chr 17 Chr 17 Chr 17 https://www.infrafrontier.eu/search?keyword=EM:01406 + EM:04614 CBA/Ca-Tg(TcraBM3.3,TcrbBM3.3)1Alm/Orl EMMA embryo BM3.3 TCR Tg mutant strain MGI:3793487 Tg(TcraBM3.3,TcrbBM3.3)1Alm transgene insertion 1, Andrew L Mellor MGI:3793488 Tg(TcraBM3.3,TcrbBM3.3)1Alm transgene insertion 1, Andrew L Mellor https://www.infrafrontier.eu/search?keyword=EM:04614 + EM:00248 CBA.Cg-Tg(Ins1-Frk-Y504F)1Ubc/Kieg EMMA embryo CBA-Tg(Ins1-Frk-Y504F)1Ubc, RIP-GTK mutant strain MGI:3487260 Tg(Ins1-Frk-Y504F)1Ubc transgene insertion 1, Uppsala University MGI:3487259 Tg(Ins1-Frk-Y504F)1Ubc transgene insertion 1, Uppsala University https://www.infrafrontier.eu/search?keyword=EM:00248 - EM:11299 CBA.Cg-Synb/Orl EMMA sperm mutant strain MGI:5308859 Synb targeted mutation 1.2, Mouse Clinical Institute MGI:3045308 Synb syncytin b https://www.infrafrontier.eu/search?keyword=EM:11299 + EM:05123 CBA.Cg-Bnc2/Orl EMMA embryo CBA(B6)-Bnc2/Orl, CBA.Ayu21-18 mutant strain MGI:3639337 Bnc2 gene trap 18, Institute of Molecular Embryology and Genetics MGI:2443805 Bnc2 basonuclin 2 https://www.infrafrontier.eu/search?keyword=EM:05123 ? EM:11021 CBA.B6-Tnfrsf1a Tg(CD2-TNF/HBB)211Gkl/Flmg EMMA embryo mutant strain Tg(CD2-TNF/HBB)211Gkl Tg(CD2-TNF/HBB)211Gkl Tg(CD2-TNF/HBB)211Gkl Tg(CD2-TNF/HBB)211Gkl https://www.infrafrontier.eu/search?keyword=EM:11021 ? EM:11021 CBA.B6-Tnfrsf1a Tg(CD2-TNF/HBB)211Gkl/Flmg EMMA embryo mutant strain MGI:1861040 Tnfrsf1a targeted mutation 1, Horst Bluethmann MGI:1314884 Tnfrsf1a tumor necrosis factor receptor superfamily, member 1a https://www.infrafrontier.eu/search?keyword=EM:11021 ? EM:11020 CBA.B6-Tg(CD2-TNF)7Gkl/Flmg EMMA sperm mutant strain Tg(CD2-TNF)7Gkl Tg(CD2-TNF)7Gkl Tg(CD2-TNF)7Gkl Tg(CD2-TNF)7Gkl https://www.infrafrontier.eu/search?keyword=EM:11020 + EM:11297 CBA.129S2(B6)-Synb/Orl EMMA sperm mutant strain MGI:6406921 Synb targeted mutation 2.1, Mouse Clinical Institute MGI:3045308 Synb syncytin b https://www.infrafrontier.eu/search?keyword=EM:11297 + EM:05541 CBA.129S(B6)-Tectb/H EMMA sperm CBA/Tectbtm1Gpr mutant strain MGI:3711698 Tectb targeted mutation 1, Guy P Richardson MGI:109574 Tectb tectorin beta https://www.infrafrontier.eu/search?keyword=EM:05541 + EM:05544 CBA.129S(B6)-Tecta/H EMMA sperm CBA/Tectatm2Gpr mutant strain MGI:3605485 Tecta targeted mutation 2, Guy P Richardson MGI:109575 Tecta tectorin alpha https://www.infrafrontier.eu/search?keyword=EM:05544 + EM:05539 CBA.129S(B6)-Tecta/H EMMA sperm CBA/Tectatm1Gpr mutant strain MGI:2183148 Tecta targeted mutation 1, Guy P Richardson MGI:109575 Tecta tectorin alpha https://www.infrafrontier.eu/search?keyword=EM:05539 + EM:05546 CBA.129S(B6)-Otoa/H EMMA sperm CBA/OtoaEGFP mutant strain MGI:5469411 Otoa targeted mutation 1, Guy P Richardson MGI:2149209 Otoa otoancorin https://www.infrafrontier.eu/search?keyword=EM:05546 + EM:05097 CBA.129P2(B6)-Efnb1/RhaH EMMA sperm CBA.129P2-Efnb1/Rha, Efnb1LoxP mutant strain MGI:3653699 Efnb1 targeted mutation 1, Ralf H Adams MGI:102708 Efnb1 ephrin B1 https://www.infrafrontier.eu/search?keyword=EM:05097 ? EM:10943 CB;B6-Tg(Ttr-USP22)1Ital/Flmg EMMA sperm mutant strain Tg(Ttr-USP22)1Ital Tg(Ttr-USP22)1Ital Tg(Ttr-USP22)1Ital Tg(Ttr-USP22)1Ital https://www.infrafrontier.eu/search?keyword=EM:10943 ? EM:12547 Cat3vl EMMA sperm unclassified MGI:1855998 Cat3 dominant cataract 3, vacuolated lens and microphthalmia MGI:88273 Cat3 dominant cataract 3 https://www.infrafrontier.eu/search?keyword=EM:12547 ? EM:12522 Cat3vao EMMA sperm mutant strain MGI:1855997 Cat3 dominant cataract 3, vaculoes, axial opacity and microphthal MGI:88273 Cat3 dominant cataract 3 https://www.infrafrontier.eu/search?keyword=EM:12522 ? EM:12546 Cat2t EMMA sperm unclassified MGI:1857598 Cryge total opacity and microphthalmia MGI:88525 Cryge crystallin, gamma E https://www.infrafrontier.eu/search?keyword=EM:12546 ? EM:12545 Cat2ro EMMA sperm unclassified MGI:1855996 Crygf dominant cataract 2, radial opacity MGI:88526 Crygf crystallin, gamma F https://www.infrafrontier.eu/search?keyword=EM:12545 ? EM:12544 Cat2nz EMMA sperm unclassified MGI:1855995 Cryge dominant cataract 2, nuclear and zonular opacity MGI:88525 Cryge crystallin, gamma E https://www.infrafrontier.eu/search?keyword=EM:12544 ? EM:12560 Cat2ns EMMA sperm unclassified MGI:1855994 Cryge dominant cataract 2, nuclear and anterior suture opacity MGI:88525 Cryge crystallin, gamma E https://www.infrafrontier.eu/search?keyword=EM:12560 + EM:02425 CAnNCrl.GFF(CB)-Grhl3/Cnrm EMMA embryo STOCK ct/Ibcm, STOCK Grhl3/Ibcm, CAnNCrl.GFF(CB)-Grhl3/Ibcm mutant strain MGI:1856837 Grhl3 curly tail MGI:2655333 Grhl3 grainyhead like transcription factor 3 https://www.infrafrontier.eu/search?keyword=EM:02425 + EM:02496 CAnN.129S7(B6)-Il1r1/NickH EMMA sperm C.Cg-Il1r1/Nick, BALB/cAnNHsd Il1r1Tm1Imx mutant strain MGI:1861112 Il1r1 targeted mutation 1, Immunex Research and Development Corporation MGI:96545 Il1r1 interleukin 1 receptor, type I https://www.infrafrontier.eu/search?keyword=EM:02496 - EM:02497 CAnN.129P2(MF1)-Il1rn/NickH EMMA sperm mutant strain MGI:3038876 Il1rn targeted mutation 1, Martin J H Nicklin MGI:96547 Il1rn interleukin 1 receptor antagonist https://www.infrafrontier.eu/search?keyword=EM:02497 - EM:02162 Candy4 EMMA sperm C3H;B6-Candy4/H mutant strain MGI:5499492 Candy4 Candy4 MGI:5499477 Candy4 Candy4 https://www.infrafrontier.eu/search?keyword=EM:02162 - EM:02161 Candy3 EMMA sperm C3H;B6-Candy3/H mutant strain MGI:5499491 Candy3 Candy3 MGI:5499475 Candy3 Candy3 https://www.infrafrontier.eu/search?keyword=EM:02161 - EM:02160 Candy2 EMMA sperm C3H;B6-Candy2/H mutant strain MGI:5499481 Candy2 Candy2 MGI:5499473 Candy2 Candy2 https://www.infrafrontier.eu/search?keyword=EM:02160 - EM:02164 Candy EMMA sperm C3H;B6-Candy/H mutant strain MGI:5499480 Candy Candy MGI:5499471 Candy Candy https://www.infrafrontier.eu/search?keyword=EM:02164 ? EM:05510 CAMP1 KO conv EMMA embryo mutant strain Fam40b Fam40b MGI:2444363 Strip2 striatin interacting protein 2 https://www.infrafrontier.eu/search?keyword=EM:05510 ? EM:05511 CAMP1 KO cond EMMA embryo mutant strain Fam40b Fam40b MGI:2444363 Strip2 striatin interacting protein 2 https://www.infrafrontier.eu/search?keyword=EM:05511 + EM:04560 C;129P2-Thra/Kctt EMMA embryo Thra-tm2Ven mutant strain MGI:2654864 Thra targeted mutation 2, Bjorn Vennstrom MGI:98742 Thra thyroid hormone receptor alpha https://www.infrafrontier.eu/search?keyword=EM:04560 + EM:05103 C;129P2-Pomt1/Cnbc EMMA embryo mutant strain MGI:3497739 Pomt1 targeted mutation 1, Jesus Cruces MGI:2138994 Pomt1 protein-O-mannosyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:05103 - EM:11736 C;129P2-Pi4k2a/H EMMA sperm mutant strain MGI:4345401 Pi4k2a gene trap AK0094, Wellcome Trust Sanger Institute MGI:1934031 Pi4k2a phosphatidylinositol 4-kinase type 2 alpha https://www.infrafrontier.eu/search?keyword=EM:11736 + EM:00122 C;129P2-Lbp/Orl EMMA embryo C;129P2-Lbp/Orl, LBP mutant strain MGI:1857976 Lbp targeted mutation 1, Robert S Jack MGI:1098776 Lbp lipopolysaccharide binding protein https://www.infrafrontier.eu/search?keyword=EM:00122 + EM:01999 C57BL/6RccCnrm EMMA embryo C57BL/6RccIbcm, C57BL/6Rcc mutant strain Cd44 wt CD44 wild type MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:01999 + EM:06669 C57BL/6NTac-Zscan2/Wtsi EMMA embryo mutant strain MGI:4363795 Zscan2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99176 Zscan2 zinc finger and SCAN domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:06669 + EM:06669 C57BL/6NTac-Zscan2/Wtsi EMMA sperm mutant strain MGI:4363795 Zscan2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99176 Zscan2 zinc finger and SCAN domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:06669 + EM:06375 C57BL/6NTac-Zscan10/WtsiCnrm EMMA sperm mutant strain MGI:4431612 Zscan10 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:3040700 Zscan10 zinc finger and SCAN domain containing 10 https://www.infrafrontier.eu/search?keyword=EM:06375 + EM:06858 C57BL/6NTac-Zkscan17/WtsiBiat EMMA sperm mutant strain MGI:4431816 Zkscan17 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2679270 Zkscan17 zinc finger with KRAB and SCAN domains 17 https://www.infrafrontier.eu/search?keyword=EM:06858 - EM:08860 C57BL/6NTac-Zfp819/WtsiH EMMA sperm mutant strain MGI:5633874 Zfp819 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1921650 Zfp819 zinc finger protein 819 https://www.infrafrontier.eu/search?keyword=EM:08860 + EM:04480 C57BL/6NTac-Zfp715/H EMMA sperm HEPD0520_1_F11 mutant strain MGI:4435328 Zfp715 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917180 Zfp715 zinc finger protein 715 https://www.infrafrontier.eu/search?keyword=EM:04480 - EM:09561 C57BL/6NTac-Zfp629/WtsiIeg EMMA archived mutant strain MGI:5633873 Zfp629 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2444524 Zfp629 zinc finger protein 629 https://www.infrafrontier.eu/search?keyword=EM:09561 + EM:08383 C57BL/6NTac-Zfp365/WtsiOrl EMMA archived mutant strain MGI:4364171 Zfp365 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2143676 Zfp365 zinc finger protein 365 https://www.infrafrontier.eu/search?keyword=EM:08383 + EM:11563 C57BL/6NTac-Zfp341/WtsiIeg EMMA sperm mutant strain MGI:4362726 Zfp341 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2682937 Zfp341 zinc finger protein 341 https://www.infrafrontier.eu/search?keyword=EM:11563 + EM:10982 C57BL/6NTac-Zfp287/WtsiIeg EMMA archived mutant strain MGI:4433358 Zfp287 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2176561 Zfp287 zinc finger protein 287 https://www.infrafrontier.eu/search?keyword=EM:10982 + EM:10994 C57BL/6NTac-Zfp219/WtsiPh EMMA sperm mutant strain MGI:5514579 Zfp219 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917140 Zfp219 zinc finger protein 219 https://www.infrafrontier.eu/search?keyword=EM:10994 + EM:07709 C57BL/6NTac-Zfp13/IcsOrl EMMA archived mutant strain MGI:4435325 Zfp13 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99159 Zfp13 zinc finger protein 13 https://www.infrafrontier.eu/search?keyword=EM:07709 + EM:07806 C57BL/6NTac-Zcchc14/WtsiOrl EMMA archived mutant strain MGI:4362839 Zcchc14 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2159407 Zcchc14 zinc finger, CCHC domain containing 14 https://www.infrafrontier.eu/search?keyword=EM:07806 + EM:11756 C57BL/6NTac-Zc3h12a/Ieg EMMA sperm mutant strain MGI:4434879 Zc3h12a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385891 Zc3h12a zinc finger CCCH type containing 12A https://www.infrafrontier.eu/search?keyword=EM:11756 - EM:08958 C57BL/6NTac-Zbtb32/Cnrm EMMA sperm mutant strain MGI:5633872 Zbtb32 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1891838 Zbtb32 zinc finger and BTB domain containing 32 https://www.infrafrontier.eu/search?keyword=EM:08958 - EM:05170 C57BL/6NTac-Ywhab/Cnrm EMMA sperm mutant strain MGI:4435431 Ywhab targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1891917 Ywhab tyrosine 3-monooxygenase/tryptophan 5-monooxygenase activation protein, beta polypeptide https://www.infrafrontier.eu/search?keyword=EM:05170 + EM:07718 C57BL/6NTac-Xiap/IcsOrl EMMA sperm mutant strain MGI:4435758 Xiap targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107572 Xiap X-linked inhibitor of apoptosis https://www.infrafrontier.eu/search?keyword=EM:07718 + EM:13138 C57BL/6NTac-Xbp1/IcsOrl EMMA sperm mutant strain MGI:6468279 Xbp1 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:98970 Xbp1 X-box binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:13138 + EM:07516 C57BL/6NTac-Xbp1/IcsOrl EMMA archived mutant strain MGI:4432347 Xbp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98970 Xbp1 X-box binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:07516 - EM:11412 C57BL/6NTac-Wwp1/H EMMA sperm mutant strain MGI:6149154 Wwp1 endonuclease mediated mutation 1, Harwell MGI:1861728 Wwp1 WW domain containing E3 ubiquitin protein ligase 1 https://www.infrafrontier.eu/search?keyword=EM:11412 - EM:05171 C57BL/6NTac-Wsb2/Cnrm EMMA sperm mutant strain MGI:4434956 Wsb2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2144041 Wsb2 WD repeat and SOCS box-containing 2 https://www.infrafrontier.eu/search?keyword=EM:05171 - EM:03971 C57BL/6NTac-Wrnip1/Cnrm EMMA embryo B6NDen;B6N-Wrnip1/Cnrm, B6Dnk;B6N-Wrnip1/Cnrm mutant strain MGI:4432335 Wrnip1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926153 Wrnip1 Werner helicase interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:03971 - EM:03971 C57BL/6NTac-Wrnip1/Cnrm EMMA sperm B6NDen;B6N-Wrnip1/Cnrm, B6Dnk;B6N-Wrnip1/Cnrm mutant strain MGI:4432335 Wrnip1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926153 Wrnip1 Werner helicase interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:03971 - EM:09731 C57BL/6NTac-Wnt9a/WtsiH EMMA sperm mutant strain MGI:5633871 Wnt9a targeted mutation 1, Wellcome Trust Sanger Institute MGI:2446084 Wnt9a wingless-type MMTV integration site family, member 9A https://www.infrafrontier.eu/search?keyword=EM:09731 + EM:05873 C57BL/6NTac-Whrn/WtsiH EMMA sperm MCJH, EPD0200_4_C04 mutant strain MGI:4432119 Whrn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2682003 Whrn whirlin https://www.infrafrontier.eu/search?keyword=EM:05873 + EM:11407 C57BL/6NTac-Wfdc2/H EMMA live mutant strain MGI:6149155 Wfdc2 endonuclease mediated mutation 1, Harwell MGI:1914951 Wfdc2 WAP four-disulfide core domain 2 https://www.infrafrontier.eu/search?keyword=EM:11407 + EM:08232 C57BL/6NTac-Wdtc1/WtsiPh EMMA sperm mutant strain MGI:4362336 Wdtc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685541 Wdtc1 WD and tetratricopeptide repeats 1 https://www.infrafrontier.eu/search?keyword=EM:08232 ? EM:11074 C57BL/6NTac-Wdr62/Ics EMMA sperm mutant strain Wdr62 Wdr62 MGI:1923696 Wdr62 WD repeat domain 62 https://www.infrafrontier.eu/search?keyword=EM:11074 + EM:05860 C57BL/6NTac-Wbp2/WtsiH EMMA sperm EPD0037_2_D06, MBYF mutant strain MGI:4847848 Wbp2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:104709 Wbp2 WW domain binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:05860 - EM:04409 C57BL/6NTac-Wbp2/Cnrm EMMA embryo mutant strain MGI:4847848 Wbp2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:104709 Wbp2 WW domain binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:04409 - EM:04409 C57BL/6NTac-Wbp2/Cnrm EMMA sperm mutant strain MGI:4847848 Wbp2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:104709 Wbp2 WW domain binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:04409 + EM:12311 C57BL/6NTac-Vwf/Ics EMMA sperm mutant strain Vwf EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:98941 Vwf Von Willebrand factor https://www.infrafrontier.eu/search?keyword=EM:12311 + EM:12036 C57BL/6NTac-Vwa5b1/Wtsi EMMA embryo mutant strain MGI:4460271 Vwa5b1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922968 Vwa5b1 von Willebrand factor A domain containing 5B1 https://www.infrafrontier.eu/search?keyword=EM:12036 + EM:12036 C57BL/6NTac-Vwa5b1/Wtsi EMMA sperm mutant strain MGI:4460271 Vwa5b1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922968 Vwa5b1 von Willebrand factor A domain containing 5B1 https://www.infrafrontier.eu/search?keyword=EM:12036 + EM:09168 C57BL/6NTac-Vwa3a/WtsiPh EMMA sperm mutant strain MGI:4363306 Vwa3a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3041229 Vwa3a von Willebrand factor A domain containing 3A https://www.infrafrontier.eu/search?keyword=EM:09168 + EM:12039 C57BL/6NTac-Vps53/Wtsi EMMA embryo mutant strain MGI:4451513 Vps53 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915549 Vps53 VPS53 GARP complex subunit https://www.infrafrontier.eu/search?keyword=EM:12039 + EM:12409 C57BL/6NTac-Vps35/H EMMA sperm mutant strain MGI:6153830 Vps35 endonuclease-mediated mutation 1, Harwell MGI:1890467 Vps35 VPS35 retromer complex component https://www.infrafrontier.eu/search?keyword=EM:12409 + EM:11409 C57BL/6NTac-Vgll3/H EMMA sperm mutant strain MGI:6149157 Vgll3 endonuclease mediated mutation 2, Harwell MGI:1920819 Vgll3 vestigial like family member 3 https://www.infrafrontier.eu/search?keyword=EM:11409 + EM:11403 C57BL/6NTac-Vgll3/H EMMA live mutant strain MGI:6149156 Vgll3 endonuclease mediated mutation 1, Harwell MGI:1920819 Vgll3 vestigial like family member 3 https://www.infrafrontier.eu/search?keyword=EM:11403 + EM:10784 C57BL/6NTac-Vgf/H EMMA sperm mutant strain MGI:6144255 Vgf endonuclease mediated mutation 1, Harwell MGI:2685898 Vgf VGF nerve growth factor inducible https://www.infrafrontier.eu/search?keyword=EM:10784 - EM:09737 C57BL/6NTac-Vav1/WtsiH EMMA sperm mutant strain MGI:5633870 Vav1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:98923 Vav1 vav 1 oncogene https://www.infrafrontier.eu/search?keyword=EM:09737 + EM:07673 C57BL/6NTac-Vat1l/IcsOrl EMMA sperm mutant strain MGI:4436304 Vat1l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2142534 Vat1l vesicle amine transport protein 1 like https://www.infrafrontier.eu/search?keyword=EM:07673 + EM:12006 C57BL/6NTac-Vangl1/Wtsi EMMA embryo mutant strain MGI:4365105 Vangl1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2159344 Vangl1 VANGL planar cell polarity 1 https://www.infrafrontier.eu/search?keyword=EM:12006 + EM:12006 C57BL/6NTac-Vangl1/Wtsi EMMA sperm mutant strain MGI:4365105 Vangl1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2159344 Vangl1 VANGL planar cell polarity 1 https://www.infrafrontier.eu/search?keyword=EM:12006 + EM:10755 C57BL/6NTac-Usp45/H EMMA sperm mutant strain MGI:5693168 Usp45 endonuclease-mediated mutation 1, Harwell MGI:2140372 Usp45 ubiquitin specific petidase 45 https://www.infrafrontier.eu/search?keyword=EM:10755 + EM:05826 C57BL/6NTac-Usp3/WtsiH EMMA embryo USP3(A11) mutant strain MGI:4432395 Usp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2152450 Usp3 ubiquitin specific peptidase 3 https://www.infrafrontier.eu/search?keyword=EM:05826 + EM:05384 C57BL/6NTac-Usp33/WtsiCnbc EMMA embryo mutant strain MGI:4433766 Usp33 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2159711 Usp33 ubiquitin specific peptidase 33 https://www.infrafrontier.eu/search?keyword=EM:05384 + EM:06392 C57BL/6NTac-Usp22/WtsiH EMMA sperm mutant strain MGI:4364127 Usp22 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144157 Usp22 ubiquitin specific peptidase 22 https://www.infrafrontier.eu/search?keyword=EM:06392 + EM:09477 C57BL/6NTac-Usp20/WtsiPh EMMA sperm mutant strain MGI:4434938 Usp20 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921520 Usp20 ubiquitin specific peptidase 20 https://www.infrafrontier.eu/search?keyword=EM:09477 + EM:11883 C57BL/6NTac-Usp1/WtsiH EMMA sperm mutant strain MGI:4363583 Usp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385198 Usp1 ubiquitin specific peptidase 1 https://www.infrafrontier.eu/search?keyword=EM:11883 + EM:12070 C57BL/6NTac-Ush1c/Wtsi EMMA embryo mutant strain MGI:4363497 Ush1c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919338 Ush1c USH1 protein network component harmonin https://www.infrafrontier.eu/search?keyword=EM:12070 + EM:12070 C57BL/6NTac-Ush1c/Wtsi EMMA sperm mutant strain MGI:4363497 Ush1c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919338 Ush1c USH1 protein network component harmonin https://www.infrafrontier.eu/search?keyword=EM:12070 + EM:04616 C57BL/6NTac-Uros/H EMMA sperm EPD0100_5_A01 mutant strain MGI:4433834 Uros targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98917 Uros uroporphyrinogen III synthase https://www.infrafrontier.eu/search?keyword=EM:04616 + EM:11346 C57BL/6NTac-Uqcrq/H EMMA live mutant strain MGI:5497330 Uqcrq targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923247 Uqcrq ubiquinol-cytochrome c reductase, complex III subunit VII https://www.infrafrontier.eu/search?keyword=EM:11346 - EM:08456 C57BL/6NTac-Unc45a/Ieg EMMA sperm mutant strain MGI:4434645 Unc45a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2142246 Unc45a unc-45 myosin chaperone A https://www.infrafrontier.eu/search?keyword=EM:08456 + EM:12447 C57BL/6NTac-Unc13c/H EMMA sperm mutant strain MGI:6153829 Unc13c endonuclease-mediated mutation 1, Harwell MGI:2149021 Unc13c unc-13 homolog C https://www.infrafrontier.eu/search?keyword=EM:12447 - EM:07069 C57BL/6NTac-Ugt2b5/Wtsi EMMA embryo mutant strain MGI:4362467 Ugt2b5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98900 Ugt2b5 UDP glucuronosyltransferase 2 family, polypeptide B5 https://www.infrafrontier.eu/search?keyword=EM:07069 - EM:07069 C57BL/6NTac-Ugt2b5/Wtsi EMMA sperm mutant strain MGI:4362467 Ugt2b5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98900 Ugt2b5 UDP glucuronosyltransferase 2 family, polypeptide B5 https://www.infrafrontier.eu/search?keyword=EM:07069 - EM:06608 C57BL/6NTac-Ugt2b1/Wtsi EMMA embryo mutant strain MGI:4362666 Ugt2b1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919023 Ugt2b1 UDP glucuronosyltransferase 2 family, polypeptide B1 https://www.infrafrontier.eu/search?keyword=EM:06608 - EM:06608 C57BL/6NTac-Ugt2b1/Wtsi EMMA sperm mutant strain MGI:4362666 Ugt2b1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919023 Ugt2b1 UDP glucuronosyltransferase 2 family, polypeptide B1 https://www.infrafrontier.eu/search?keyword=EM:06608 + EM:05791 C57BL/6NTac-Ufl1/WtsiOrl EMMA sperm mutant strain MGI:4432479 Ufl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914740 Ufl1 UFM1 specific ligase 1 https://www.infrafrontier.eu/search?keyword=EM:05791 + EM:07850 C57BL/6NTac-Uevld/WtsiOulu EMMA embryo mutant strain MGI:4434449 Uevld targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1860490 Uevld UEV and lactate/malate dehyrogenase domains https://www.infrafrontier.eu/search?keyword=EM:07850 + EM:07850 C57BL/6NTac-Uevld/WtsiOulu EMMA sperm mutant strain MGI:4434449 Uevld targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1860490 Uevld UEV and lactate/malate dehyrogenase domains https://www.infrafrontier.eu/search?keyword=EM:07850 - EM:08947 C57BL/6NTac-Ucp1/WtsiH EMMA sperm mutant strain MGI:5633869 Ucp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:98894 Ucp1 uncoupling protein 1 (mitochondrial, proton carrier) https://www.infrafrontier.eu/search?keyword=EM:08947 + EM:12054 C57BL/6NTac-Uck1/Wtsi EMMA embryo mutant strain MGI:4362314 Uck1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:98904 Uck1 uridine-cytidine kinase 1 https://www.infrafrontier.eu/search?keyword=EM:12054 + EM:12054 C57BL/6NTac-Uck1/Wtsi EMMA sperm mutant strain MGI:4362314 Uck1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:98904 Uck1 uridine-cytidine kinase 1 https://www.infrafrontier.eu/search?keyword=EM:12054 - EM:07015 C57BL/6NTac-Ube2u/H EMMA sperm mutant strain MGI:4363149 Ube2u targeted mutation 1e, Wellcome Trust Sanger Institute MGI:3588216 Ube2u ubiquitin-conjugating enzyme E2U (putative) https://www.infrafrontier.eu/search?keyword=EM:07015 + EM:07693 C57BL/6NTac-Ube2b/IcsOrl EMMA sperm mutant strain MGI:4431903 Ube2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102944 Ube2b ubiquitin-conjugating enzyme E2B https://www.infrafrontier.eu/search?keyword=EM:07693 + EM:05232 C57BL/6NTac-Twf1/WtsiCnbc EMMA embryo mutant strain MGI:4434218 Twf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1100520 Twf1 twinfilin actin binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:05232 + EM:06981 C57BL/6NTac-Tulp3/H EMMA sperm mutant strain MGI:4435073 Tulp3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1329045 Tulp3 tubby-like protein 3 https://www.infrafrontier.eu/search?keyword=EM:06981 - EM:09763 C57BL/6NTac-Ttr/WtsiH EMMA sperm mutant strain MGI:5633868 Ttr targeted mutation 1, Wellcome Trust Sanger Institute MGI:98865 Ttr transthyretin https://www.infrafrontier.eu/search?keyword=EM:09763 - EM:08966 C57BL/6NTac-Ttll5/Cnrm EMMA sperm mutant strain MGI:5633867 Ttll5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2443657 Ttll5 tubulin tyrosine ligase-like family, member 5 https://www.infrafrontier.eu/search?keyword=EM:08966 + EM:07712 C57BL/6NTac-Ttll1/IcsOrl EMMA archived mutant strain MGI:4432051 Ttll1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443047 Ttll1 tubulin tyrosine ligase-like 1 https://www.infrafrontier.eu/search?keyword=EM:07712 + EM:05838 C57BL/6NTac-Ttll12/Cnrm EMMA sperm mutant strain MGI:4433627 Ttll12 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:3039573 Ttll12 tubulin tyrosine ligase-like family, member 12 https://www.infrafrontier.eu/search?keyword=EM:05838 - EM:09546 C57BL/6NTac-Ttc21a/WtsiIeg EMMA archived mutant strain MGI:5633866 Ttc21a targeted mutation 1, Wellcome Trust Sanger Institute MGI:1921302 Ttc21a tetratricopeptide repeat domain 21A https://www.infrafrontier.eu/search?keyword=EM:09546 + EM:12444 C57BL/6NTac-Tspoap1/H EMMA sperm mutant strain MGI:6153864 Tspoap1 endonuclease-mediated mutation 1, Harwell MGI:2450877 Tspoap1 TSPO associated protein 1 https://www.infrafrontier.eu/search?keyword=EM:12444 + EM:11473 C57BL/6NTac-Tspan17/H EMMA live mutant strain MGI:6152699 Tspan17 endonuclease mediated mutation 2, Harwell MGI:1921507 Tspan17 tetraspanin 17 https://www.infrafrontier.eu/search?keyword=EM:11473 + EM:11472 C57BL/6NTac-Tspan17/H EMMA sperm mutant strain MGI:6153828 Tspan17 endonuclease-mediated mutation 1, Harwell MGI:1921507 Tspan17 tetraspanin 17 https://www.infrafrontier.eu/search?keyword=EM:11472 + EM:11472 C57BL/6NTac-Tspan17/H EMMA live mutant strain MGI:6153828 Tspan17 endonuclease-mediated mutation 1, Harwell MGI:1921507 Tspan17 tetraspanin 17 https://www.infrafrontier.eu/search?keyword=EM:11472 + EM:11427 C57BL/6NTac-Tspan14/H EMMA live mutant strain MGI:6149216 Tspan14 endonuclease mediated mutation 1, Harwell MGI:1196325 Tspan14 tetraspanin 14 https://www.infrafrontier.eu/search?keyword=EM:11427 - EM:08950 C57BL/6NTac-Tshb/WtsiH EMMA sperm mutant strain MGI:5633865 Tshb targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:98848 Tshb thyroid stimulating hormone, beta subunit https://www.infrafrontier.eu/search?keyword=EM:08950 + EM:06260 C57BL/6NTac-Tsfm/WtsiCnbc EMMA sperm mutant strain MGI:4432572 Tsfm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913649 Tsfm Ts translation elongation factor, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:06260 - EM:08859 C57BL/6NTac-Trpv1/WtsiH EMMA sperm mutant strain MGI:5633864 Trpv1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1341787 Trpv1 transient receptor potential cation channel, subfamily V, member 1 https://www.infrafrontier.eu/search?keyword=EM:08859 + EM:12316 C57BL/6NTac-Trpc1/Ics EMMA sperm mutant strain Trpc1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:109528 Trpc1 transient receptor potential cation channel, subfamily C, member 1 https://www.infrafrontier.eu/search?keyword=EM:12316 + EM:11422 C57BL/6NTac-Trp73/H EMMA sperm mutant strain MGI:6149215 Trp73 endonuclease mediated mutation 1, Harwell MGI:1336991 Trp73 transformation related protein 73 https://www.infrafrontier.eu/search?keyword=EM:11422 + EM:08542 C57BL/6NTac-Trp53tg5/Wtsi EMMA embryo mutant strain MGI:4363427 Trp53tg5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920853 Trp53tg5 transformation related protein 53 target 5 https://www.infrafrontier.eu/search?keyword=EM:08542 + EM:08542 C57BL/6NTac-Trp53tg5/Wtsi EMMA sperm mutant strain MGI:4363427 Trp53tg5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920853 Trp53tg5 transformation related protein 53 target 5 https://www.infrafrontier.eu/search?keyword=EM:08542 ? EM:13022 C57BL/6NTac-Trmt9b/H EMMA sperm unclassified MGI:6451748 Trmt9b endonuclease-mediated mutation 2, Harwell MGI:2442328 Trmt9b tRNA methyltransferase 9B https://www.infrafrontier.eu/search?keyword=EM:13022 + EM:05441 C57BL/6NTac-Trmt10a/WtsiOulu EMMA embryo mutant strain MGI:4432852 Trmt10a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920421 Trmt10a tRNA methyltransferase 10A https://www.infrafrontier.eu/search?keyword=EM:05441 + EM:05893 C57BL/6NTac-Trim66/WtsiIeg EMMA archived mutant strain MGI:4431799 Trim66 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2152406 Trim66 tripartite motif-containing 66 https://www.infrafrontier.eu/search?keyword=EM:05893 + EM:08871 C57BL/6NTac-Trim65/WtsiIeg EMMA archived mutant strain MGI:4363168 Trim65 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442815 Trim65 tripartite motif-containing 65 https://www.infrafrontier.eu/search?keyword=EM:08871 + EM:07820 C57BL/6NTac-Trib3/IcsOrl EMMA sperm mutant strain MGI:4435061 Trib3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1345675 Trib3 tribbles pseudokinase 3 https://www.infrafrontier.eu/search?keyword=EM:07820 + EM:10857 C57BL/6NTac-Trex1/WtsiOulu EMMA embryo mutant strain MGI:4362876 Trex1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1328317 Trex1 three prime repair exonuclease 1 https://www.infrafrontier.eu/search?keyword=EM:10857 + EM:10857 C57BL/6NTac-Trex1/WtsiOulu EMMA sperm mutant strain MGI:4362876 Trex1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1328317 Trex1 three prime repair exonuclease 1 https://www.infrafrontier.eu/search?keyword=EM:10857 + EM:12045 C57BL/6NTac-Traf3ip3/Wtsi EMMA embryo mutant strain MGI:4363678 Traf3ip3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2441706 Traf3ip3 TRAF3 interacting protein 3 https://www.infrafrontier.eu/search?keyword=EM:12045 + EM:10839 C57BL/6NTac-Tox2/H EMMA live C57BL/6N-Tox2/H mutant strain MGI:5749960 Tox2 endonuclease-mediated mutation 2, Harwell MGI:2139242 Tox2 TOX high mobility group box family member 2 https://www.infrafrontier.eu/search?keyword=EM:10839 + EM:10767 C57BL/6NTac-Tox2/H EMMA archived C57BL/6N-Tox2/H mutant strain MGI:5749959 Tox2 endonuclease-mediated mutation 1, Harwell MGI:2139242 Tox2 TOX high mobility group box family member 2 https://www.infrafrontier.eu/search?keyword=EM:10767 + EM:09684 C57BL/6NTac-Tor1aip1/H EMMA sperm mutant strain MGI:5514583 Tor1aip1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3582693 Tor1aip1 torsin A interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:09684 + EM:12445 C57BL/6NTac-Tor1a/H EMMA sperm mutant strain MGI:6153827 Tor1a endonuclease-mediated mutation 1, Harwell MGI:1353568 Tor1a torsin family 1, member A (torsin A) https://www.infrafrontier.eu/search?keyword=EM:12445 - EM:08848 C57BL/6NTac-Tns1/WtsiH EMMA sperm mutant strain MGI:5633856 Tns1 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:104552 Tns1 tensin 1 https://www.infrafrontier.eu/search?keyword=EM:08848 + EM:11022 C57BL/6NTac-Tnip1/H EMMA sperm mutant strain MGI:4435909 Tnip1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1926194 Tnip1 TNFAIP3 interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:11022 + EM:11022 C57BL/6NTac-Tnip1/H EMMA live mutant strain MGI:4435909 Tnip1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1926194 Tnip1 TNFAIP3 interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:11022 + EM:09976 C57BL/6NTac-Tnfrsf9/IcsOrl EMMA sperm mutant strain MGI:4432147 Tnfrsf9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1101059 Tnfrsf9 tumor necrosis factor receptor superfamily, member 9 https://www.infrafrontier.eu/search?keyword=EM:09976 + EM:07654 C57BL/6NTac-Tnfrsf1b/IcsOrl EMMA archived mutant strain MGI:4433096 Tnfrsf1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1314883 Tnfrsf1b tumor necrosis factor receptor superfamily, member 1b https://www.infrafrontier.eu/search?keyword=EM:07654 + EM:12066 C57BL/6NTac-Tmprss15/Wtsi EMMA embryo mutant strain MGI:4364308 Tmprss15 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1197523 Tmprss15 transmembrane protease, serine 15 https://www.infrafrontier.eu/search?keyword=EM:12066 + EM:07721 C57BL/6NTac-Tmod3/IcsOrl EMMA archived mutant strain MGI:4435232 Tmod3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1355315 Tmod3 tropomodulin 3 https://www.infrafrontier.eu/search?keyword=EM:07721 + EM:05865 C57BL/6NTac-Tmem9/WtsiH EMMA sperm MCXG, EPD0144_3_A09 mutant strain MGI:4433014 Tmem9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913491 Tmem9 transmembrane protein 9 https://www.infrafrontier.eu/search?keyword=EM:05865 + EM:07679 C57BL/6NTac-Tmem94/IcsOrl EMMA archived C57BL/6NTac-2310067B10Rik/IcsOrl, EPD0215_1_D09 mutant strain MGI:4432189 Tmem94 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919197 Tmem94 transmembrane protein 94 https://www.infrafrontier.eu/search?keyword=EM:07679 + EM:07707 C57BL/6NTac-Tmem68/IcsOrl EMMA archived mutant strain MGI:4431978 Tmem68 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919348 Tmem68 transmembrane protein 68 https://www.infrafrontier.eu/search?keyword=EM:07707 + EM:07650 C57BL/6NTac-Tmem63b/IcsOrl EMMA sperm mutant strain MGI:4433726 Tmem63b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2387609 Tmem63b transmembrane protein 63b https://www.infrafrontier.eu/search?keyword=EM:07650 - EM:06903 C57BL/6NTac-Tmem54/Wtsi EMMA embryo mutant strain MGI:4362446 Tmem54 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913510 Tmem54 transmembrane protein 54 https://www.infrafrontier.eu/search?keyword=EM:06903 - EM:06903 C57BL/6NTac-Tmem54/Wtsi EMMA sperm mutant strain MGI:4362446 Tmem54 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913510 Tmem54 transmembrane protein 54 https://www.infrafrontier.eu/search?keyword=EM:06903 + EM:08208 C57BL/6NTac-Tmem260/Wtsi EMMA embryo mutant strain MGI:4365196 Tmem260 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443219 Tmem260 transmembrane protein 260 https://www.infrafrontier.eu/search?keyword=EM:08208 + EM:08208 C57BL/6NTac-Tmem260/Wtsi EMMA sperm mutant strain MGI:4365196 Tmem260 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443219 Tmem260 transmembrane protein 260 https://www.infrafrontier.eu/search?keyword=EM:08208 + EM:11315 C57BL/6NTac-Tmem203/H EMMA sperm mutant strain MGI:6144257 Tmem203 endonuclease mediated mutation 2, Harwell MGI:2443597 Tmem203 transmembrane protein 203 https://www.infrafrontier.eu/search?keyword=EM:11315 + EM:10841 C57BL/6NTac-Tmem203/H EMMA sperm mutant strain MGI:6144256 Tmem203 endonuclease mediated mutation 1, Harwell MGI:2443597 Tmem203 transmembrane protein 203 https://www.infrafrontier.eu/search?keyword=EM:10841 + EM:09726 C57BL/6NTac-Tmem132a/WtsiH EMMA sperm mutant strain MGI:4362366 Tmem132a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2147810 Tmem132a transmembrane protein 132A https://www.infrafrontier.eu/search?keyword=EM:09726 + EM:09972 C57BL/6NTac-Tmem108/IcsOrl EMMA sperm mutant strain MGI:4441635 Tmem108 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1932411 Tmem108 transmembrane protein 108 https://www.infrafrontier.eu/search?keyword=EM:09972 + EM:09973 C57BL/6NTac-Tmem108/Ics EMMA live mutant strain MGI:4441635 Tmem108 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1932411 Tmem108 transmembrane protein 108 https://www.infrafrontier.eu/search?keyword=EM:09973 + EM:07677 C57BL/6NTac-Tmc8/IcsOrl EMMA sperm mutant strain MGI:4432152 Tmc8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2669037 Tmc8 transmembrane channel-like gene family 8 https://www.infrafrontier.eu/search?keyword=EM:07677 + EM:05883 C57BL/6NTac-Tmc6/WtsiIeg EMMA embryo mutant strain MGI:4434247 Tmc6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098686 Tmc6 transmembrane channel-like gene family 6 https://www.infrafrontier.eu/search?keyword=EM:05883 + EM:12130 C57BL/6NTac-Tm9sf4/Wtsi EMMA embryo mutant strain MGI:4363779 Tm9sf4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2139220 Tm9sf4 transmembrane 9 superfamily member 4 https://www.infrafrontier.eu/search?keyword=EM:12130 + EM:11054 C57BL/6NTac-Tm6sf2/H EMMA sperm mutant strain MGI:4362886 Tm6sf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933210 Tm6sf2 transmembrane 6 superfamily member 2 https://www.infrafrontier.eu/search?keyword=EM:11054 + EM:11318 C57BL/6NTac-Tm6sf2/H EMMA sperm mutant strain MGI:6152701 Tm6sf2 endonuclease mediated mutation 4, Harwell MGI:1933210 Tm6sf2 transmembrane 6 superfamily member 2 https://www.infrafrontier.eu/search?keyword=EM:11318 - EM:04555 C57BL/6NTac-Tln1/Cnrm EMMA embryo mutant strain MGI:4433023 Tln1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1099832 Tln1 talin 1 https://www.infrafrontier.eu/search?keyword=EM:04555 - EM:04555 C57BL/6NTac-Tln1/Cnrm EMMA sperm mutant strain MGI:4433023 Tln1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1099832 Tln1 talin 1 https://www.infrafrontier.eu/search?keyword=EM:04555 - EM:08946 C57BL/6NTac-Tle6/WtsiH EMMA sperm mutant strain MGI:5633854 Tle6 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:2149593 Tle6 transducin-like enhancer of split 6 https://www.infrafrontier.eu/search?keyword=EM:08946 + EM:10028 C57BL/6NTac-Tlcd4/WtsiIeg EMMA archived C57BL/6NTac-Tmem56/WtsiIeg mutant strain MGI:5633855 Tlcd4 targeted mutation 1, Tmem56 MGI:1923195 Tlcd4 TLC domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:10028 + EM:04437 C57BL/6NTac-Timm50/Ics EMMA sperm EPD0144_2_D04 mutant strain MGI:4433575 Timm50 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913775 Timm50 translocase of inner mitochondrial membrane 50 https://www.infrafrontier.eu/search?keyword=EM:04437 + EM:11780 C57BL/6NTac-Tigit/Wtsi EMMA embryo mutant strain Tigit undef targeted mutation , Wellcome Trust Sanger Institute MGI:3642260 Tigit T cell immunoreceptor with Ig and ITIM domains https://www.infrafrontier.eu/search?keyword=EM:11780 + EM:11780 C57BL/6NTac-Tigit/Wtsi EMMA sperm mutant strain Tigit undef targeted mutation , Wellcome Trust Sanger Institute MGI:3642260 Tigit T cell immunoreceptor with Ig and ITIM domains https://www.infrafrontier.eu/search?keyword=EM:11780 + EM:07187 C57BL/6NTac-Tigar/WtsiH EMMA sperm EPD0192_3_E06, C57BL/6NTac-9630033F20Rik/WtsiH, MFCG mutant strain MGI:4441746 Tigar targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442752 Tigar Trp53 induced glycolysis regulatory phosphatase https://www.infrafrontier.eu/search?keyword=EM:07187 - EM:09740 C57BL/6NTac-Tie1/WtsiH EMMA sperm mutant strain MGI:5633853 Tie1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:99906 Tie1 tyrosine kinase with immunoglobulin-like and EGF-like domains 1 https://www.infrafrontier.eu/search?keyword=EM:09740 + EM:10533 C57BL/6NTac-Tiam1/Ics EMMA sperm mutant strain MGI:5511857 Tiam1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103306 Tiam1 T cell lymphoma invasion and metastasis 1 https://www.infrafrontier.eu/search?keyword=EM:10533 - EM:11228 C57BL/6NTac-Tia1/Wtsi EMMA embryo mutant strain Tia1 KOMP targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1889799 Tia1 cytotoxic granule-associated RNA binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:11228 - EM:11228 C57BL/6NTac-Tia1/Wtsi EMMA sperm mutant strain Tia1 KOMP targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1889799 Tia1 cytotoxic granule-associated RNA binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:11228 + EM:07613 C57BL/6NTac-Thra/Ics EMMA sperm mutant strain MGI:4455948 Thra targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98742 Thra thyroid hormone receptor alpha https://www.infrafrontier.eu/search?keyword=EM:07613 + EM:12361 C57BL/6NTac-Th/H EMMA sperm mutant strain MGI:6153826 Th endonuclease-mediated mutation 1, Harwell MGI:98735 Th tyrosine hydroxylase https://www.infrafrontier.eu/search?keyword=EM:12361 + EM:10178 C57BL/6NTac-Tgif2/IcsOrl EMMA sperm mutant strain MGI:4433717 Tgif2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915299 Tgif2 TGFB-induced factor homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:10178 + EM:06107 C57BL/6NTac-Tg(ACTB-cre)3Mrt/H EMMA embryo mutant strain MGI:5316983 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin MGI:5316982 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin https://www.infrafrontier.eu/search?keyword=EM:06107 + EM:06107 C57BL/6NTac-Tg(ACTB-cre)3Mrt/H EMMA sperm mutant strain MGI:5316983 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin MGI:5316982 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin https://www.infrafrontier.eu/search?keyword=EM:06107 + EM:06107 C57BL/6NTac-Tg(ACTB-cre)3Mrt/H EMMA live mutant strain MGI:5316983 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin MGI:5316982 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin https://www.infrafrontier.eu/search?keyword=EM:06107 - EM:09773 C57BL/6NTac-Tff1/WtsiH EMMA sperm mutant strain MGI:5633852 Tff1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:88135 Tff1 trefoil factor 1 https://www.infrafrontier.eu/search?keyword=EM:09773 + EM:09846 C57BL/6NTac-Tex38/WtsiOrl EMMA archived mutant strain MGI:4363110 Tex38 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922423 Tex38 testis expressed 38 https://www.infrafrontier.eu/search?keyword=EM:09846 + EM:10081 C57BL/6NTac-Tex101/WtsiIeg EMMA archived mutant strain MGI:5633851 Tex101 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1930791 Tex101 testis expressed gene 101 https://www.infrafrontier.eu/search?keyword=EM:10081 - EM:09738 C57BL/6NTac-Tecta/WtsiH EMMA sperm mutant strain MGI:5633850 Tecta targeted mutation 1, Wellcome Trust Sanger Institute MGI:109575 Tecta tectorin alpha https://www.infrafrontier.eu/search?keyword=EM:09738 + EM:12302 C57BL/6NTac-Tcte2/Ics EMMA sperm mutant strain Tcte2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:98641 Tcte2 t-complex-associated testis expressed 2 https://www.infrafrontier.eu/search?keyword=EM:12302 + EM:07858 C57BL/6NTac-Tcf7l2/WtsiIeg EMMA sperm mutant strain MGI:4431951 Tcf7l2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202879 Tcf7l2 transcription factor 7 like 2, T cell specific, HMG box https://www.infrafrontier.eu/search?keyword=EM:07858 + EM:07661 C57BL/6NTac-Tcf7/IcsOrl EMMA sperm mutant strain MGI:4441645 Tcf7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98507 Tcf7 transcription factor 7, T cell specific https://www.infrafrontier.eu/search?keyword=EM:07661 + EM:06992 C57BL/6NTac-Tcf4/WtsiBiat EMMA archived mutant strain MGI:4432303 Tcf4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98506 Tcf4 transcription factor 4 https://www.infrafrontier.eu/search?keyword=EM:06992 - EM:09756 C57BL/6NTac-Tbx2/WtsiH EMMA sperm mutant strain MGI:5633849 Tbx2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:98494 Tbx2 T-box 2 https://www.infrafrontier.eu/search?keyword=EM:09756 - EM:04685 C57BL/6NTac-Tbc1d10a/Cnrm EMMA embryo mutant strain MGI:4432519 Tbc1d10a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2144164 Tbc1d10a TBC1 domain family, member 10a https://www.infrafrontier.eu/search?keyword=EM:04685 - EM:04685 C57BL/6NTac-Tbc1d10a/Cnrm EMMA sperm mutant strain MGI:4432519 Tbc1d10a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2144164 Tbc1d10a TBC1 domain family, member 10a https://www.infrafrontier.eu/search?keyword=EM:04685 + EM:12293 C57BL/6NTac-Tac2/Ics EMMA sperm mutant strain Tac2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:98476 Tac2 tachykinin 2 https://www.infrafrontier.eu/search?keyword=EM:12293 + EM:06829 C57BL/6NTac-Syt1/WtsiCnrm EMMA sperm mutant strain MGI:4433781 Syt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99667 Syt1 synaptotagmin I https://www.infrafrontier.eu/search?keyword=EM:06829 + EM:07636 C57BL/6NTac-Synpo2/IcsOrl EMMA sperm mutant strain MGI:4441661 Synpo2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153070 Synpo2 synaptopodin 2 https://www.infrafrontier.eu/search?keyword=EM:07636 - EM:09447 C57BL/6NTac-Syndig1l/Cnrm EMMA sperm mutant strain MGI:5633848 Syndig1l targeted mutation 1, Wellcome Trust Sanger Institute MGI:2685107 Syndig1l synapse differentiation inducing 1 like https://www.infrafrontier.eu/search?keyword=EM:09447 + EM:10085 C57BL/6NTac-Syce1/WtsiIeg EMMA archived mutant strain MGI:5633847 Syce1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1921325 Syce1 synaptonemal complex central element protein 1 https://www.infrafrontier.eu/search?keyword=EM:10085 + EM:11459 C57BL/6NTac-Svop/H EMMA live mutant strain MGI:6152697 Svop endonuclease mediated mutation 2, Harwell MGI:1915916 Svop SV2 related protein https://www.infrafrontier.eu/search?keyword=EM:11459 + EM:11460 C57BL/6NTac-Svop/H EMMA sperm mutant strain MGI:6153863 Svop endonuclease-mediated mutation 1, Harwell MGI:1915916 Svop SV2 related protein https://www.infrafrontier.eu/search?keyword=EM:11460 + EM:11460 C57BL/6NTac-Svop/H EMMA live mutant strain MGI:6153863 Svop endonuclease-mediated mutation 1, Harwell MGI:1915916 Svop SV2 related protein https://www.infrafrontier.eu/search?keyword=EM:11460 + EM:05444 C57BL/6NTac-Supt7l/WtsiOulu EMMA embryo mutant strain MGI:4432224 Supt7l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919445 Supt7l SPT7-like, STAGA complex gamma subunit https://www.infrafrontier.eu/search?keyword=EM:05444 + EM:09848 C57BL/6NTac-Supt3/WtsiPh EMMA sperm mutant strain MGI:4435781 Supt3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923723 Supt3 SPT3, SAGA and STAGA complex component https://www.infrafrontier.eu/search?keyword=EM:09848 - EM:03992 C57BL/6NTac-Stx8/Cnrm EMMA sperm B6NDen;B6N-Stx8/Cnrm, B6Dnk;B6N-Stx8/Cnrm mutant strain MGI:4432376 Stx8 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1890156 Stx8 syntaxin 8 https://www.infrafrontier.eu/search?keyword=EM:03992 + EM:11421 C57BL/6NTac-Stk3/H EMMA sperm mutant strain MGI:6152695 Stk3 endonuclease mediated mutation 2, Harwell MGI:1928487 Stk3 serine/threonine kinase 3 https://www.infrafrontier.eu/search?keyword=EM:11421 + EM:11411 C57BL/6NTac-Stk3/H EMMA sperm mutant strain MGI:6149213 Stk3 endonuclease mediated mutation 1, Harwell MGI:1928487 Stk3 serine/threonine kinase 3 https://www.infrafrontier.eu/search?keyword=EM:11411 + EM:06040 C57BL/6NTac-Stk39/WtsiH EMMA sperm EPD0169_4_D02, MCJB mutant strain MGI:4433935 Stk39 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858416 Stk39 serine/threonine kinase 39 https://www.infrafrontier.eu/search?keyword=EM:06040 + EM:07272 C57BL/6NTac-Stard7/WtsiOulu EMMA embryo mutant strain MGI:4433666 Stard7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2139090 Stard7 START domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:07272 + EM:07272 C57BL/6NTac-Stard7/WtsiOulu EMMA sperm mutant strain MGI:4433666 Stard7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2139090 Stard7 START domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:07272 + EM:12148 C57BL/6NTac-Stard6/Wtsi EMMA embryo mutant strain MGI:4362248 Stard6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2156774 Stard6 StAR-related lipid transfer (START) domain containing 6 https://www.infrafrontier.eu/search?keyword=EM:12148 + EM:11127 C57BL/6NTac-Star/WtsiH EMMA sperm mutant strain MGI:5660124 Star targeted mutation 1, Wellcome Trust Sanger Institute MGI:102760 Star steroidogenic acute regulatory protein https://www.infrafrontier.eu/search?keyword=EM:11127 + EM:11429 C57BL/6NTac-St6gal2/H EMMA live mutant strain MGI:6152694 St6gal2 endonuclease mediated mutation 2, Harwell MGI:2445190 St6gal2 beta galactoside alpha 2,6 sialyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:11429 + EM:11418 C57BL/6NTac-St6gal2/H EMMA sperm mutant strain MGI:6149212 St6gal2 endonuclease mediated mutation 1, Harwell MGI:2445190 St6gal2 beta galactoside alpha 2,6 sialyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:11418 + EM:12035 C57BL/6NTac-St18/Wtsi EMMA embryo mutant strain MGI:4363363 St18 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446700 St18 suppression of tumorigenicity 18 https://www.infrafrontier.eu/search?keyword=EM:12035 + EM:12035 C57BL/6NTac-St18/Wtsi EMMA sperm mutant strain MGI:4363363 St18 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446700 St18 suppression of tumorigenicity 18 https://www.infrafrontier.eu/search?keyword=EM:12035 + EM:07637 C57BL/6NTac-Srsf4/IcsOrl EMMA archived mutant strain MGI:4431961 Srsf4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1890577 Srsf4 serine and arginine-rich splicing factor 4 https://www.infrafrontier.eu/search?keyword=EM:07637 + EM:11364 C57BL/6NTac-Srebf2/Wtsi EMMA embryo mutant strain MGI:6406765 Srebf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107585 Srebf2 sterol regulatory element binding factor 2 https://www.infrafrontier.eu/search?keyword=EM:11364 + EM:11364 C57BL/6NTac-Srebf2/Wtsi EMMA sperm mutant strain MGI:6406765 Srebf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107585 Srebf2 sterol regulatory element binding factor 2 https://www.infrafrontier.eu/search?keyword=EM:11364 - EM:09557 C57BL/6NTac-Spp2/WtsiIeg EMMA archived mutant strain MGI:5633846 Spp2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1922646 Spp2 secreted phosphoprotein 2 https://www.infrafrontier.eu/search?keyword=EM:09557 + EM:06850 C57BL/6NTac-Spopl/WtsiCnrm EMMA embryo mutant strain MGI:4455963 Spopl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924107 Spopl speckle-type BTB/POZ protein-like https://www.infrafrontier.eu/search?keyword=EM:06850 + EM:06850 C57BL/6NTac-Spopl/WtsiCnrm EMMA sperm mutant strain MGI:4455963 Spopl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924107 Spopl speckle-type BTB/POZ protein-like https://www.infrafrontier.eu/search?keyword=EM:06850 + EM:12357 C57BL/6NTac-Spock1/H EMMA sperm mutant strain MGI:6153825 Spock1 endonuclease-mediated mutation 1, Harwell MGI:105371 Spock1 sparc/osteonectin, cwcv and kazal-like domains proteoglycan 1 https://www.infrafrontier.eu/search?keyword=EM:12357 + EM:07663 C57BL/6NTac-Spns1/IcsOrl EMMA archived mutant strain MGI:4434332 Spns1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1920908 Spns1 spinster homolog 1 https://www.infrafrontier.eu/search?keyword=EM:07663 - EM:09547 C57BL/6NTac-Spink8/WtsiIeg EMMA archived mutant strain MGI:5633845 Spink8 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1925959 Spink8 serine peptidase inhibitor, Kazal type 8 https://www.infrafrontier.eu/search?keyword=EM:09547 - EM:08964 C57BL/6NTac-Spink8/Cnrm EMMA sperm mutant strain MGI:5633845 Spink8 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1925959 Spink8 serine peptidase inhibitor, Kazal type 8 https://www.infrafrontier.eu/search?keyword=EM:08964 - EM:08974 C57BL/6NTac-Spic/Cnrm EMMA sperm mutant strain MGI:5633844 Spic targeted mutation 1, Wellcome Trust Sanger Institute MGI:1341168 Spic Spi-C transcription factor (Spi-1/PU.1 related) https://www.infrafrontier.eu/search?keyword=EM:08974 - EM:05201 C57BL/6NTac-Spg20/Cnrm EMMA sperm mutant strain MGI:4436639 Spg20 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2139806 Spg20 spastic paraplegia 20, spartin (Troyer syndrome) homolog (human) https://www.infrafrontier.eu/search?keyword=EM:05201 + EM:09424 C57BL/6NTac-Spats1/H EMMA sperm mutant strain MGI:5436890 Spats1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918270 Spats1 spermatogenesis associated, serine-rich 1 https://www.infrafrontier.eu/search?keyword=EM:09424 + EM:12355 C57BL/6NTac-Spatc1l/H EMMA sperm mutant strain MGI:6153862 Spatc1l endonuclease-mediated mutation 1, Harwell MGI:1923823 Spatc1l spermatogenesis and centriole associated 1 like https://www.infrafrontier.eu/search?keyword=EM:12355 + EM:11414 C57BL/6NTac-Spata13/H EMMA sperm mutant strain MGI:6153824 Spata13 endonuclease-mediated mutation 1, Harwell MGI:104838 Spata13 spermatogenesis associated 13 https://www.infrafrontier.eu/search?keyword=EM:11414 + EM:11414 C57BL/6NTac-Spata13/H EMMA live mutant strain MGI:6153824 Spata13 endonuclease-mediated mutation 1, Harwell MGI:104838 Spata13 spermatogenesis associated 13 https://www.infrafrontier.eu/search?keyword=EM:11414 + EM:07671 C57BL/6NTac-Sox13/IcsOrl EMMA archived mutant strain MGI:4433017 Sox13 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98361 Sox13 SRY (sex determining region Y)-box 13 https://www.infrafrontier.eu/search?keyword=EM:07671 - EM:09221 C57BL/6NTac-Sost/Cnrm EMMA sperm mutant strain MGI:5633843 Sost targeted mutation 1, Wellcome Trust Sanger Institute MGI:1921749 Sost sclerostin https://www.infrafrontier.eu/search?keyword=EM:09221 + EM:08481 C57BL/6NTac-Snx31/WtsiFlmg EMMA sperm mutant strain MGI:5497029 Snx31 targeted mutation 1a, Mouse Biology Program, University of California, Davis MGI:1913946 Snx31 sorting nexin 31 https://www.infrafrontier.eu/search?keyword=EM:08481 + EM:12383 C57BL/6NTac-Snx14/H EMMA sperm mutant strain MGI:6153823 Snx14 endonuclease-mediated mutation 1, Harwell MGI:2155664 Snx14 sorting nexin 14 https://www.infrafrontier.eu/search?keyword=EM:12383 - EM:09542 C57BL/6NTac-Snhg11/WtsiIeg EMMA archived mutant strain MGI:5633842 Snhg11 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2441845 Snhg11 small nucleolar RNA host gene 11 https://www.infrafrontier.eu/search?keyword=EM:09542 + EM:11550 C57BL/6NTac-Snca/H EMMA live mutant strain MGI:6149211 Snca endonuclease mediated mutation 1, Harwell MGI:1277151 Snca synuclein, alpha https://www.infrafrontier.eu/search?keyword=EM:11550 + EM:06013 C57BL/6NTac-Snap47/WtsiBiat EMMA sperm mutant strain MGI:4433792 Snap47 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915076 Snap47 synaptosomal-associated protein, 47 https://www.infrafrontier.eu/search?keyword=EM:06013 + EM:05226 C57BL/6NTac-Snap29/WtsiCnbc EMMA embryo mutant strain MGI:4433565 Snap29 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914724 Snap29 synaptosomal-associated protein 29 https://www.infrafrontier.eu/search?keyword=EM:05226 - EM:08853 C57BL/6NTac-Snap29/WtsiH EMMA sperm mutant strain MGI:5633841 Snap29 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1914724 Snap29 synaptosomal-associated protein 29 https://www.infrafrontier.eu/search?keyword=EM:08853 + EM:10162 C57BL/6NTac-Smyd5/WtsiCnbcFlmg EMMA sperm mutant strain MGI:6317356 Smyd5 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:108048 Smyd5 SET and MYND domain containing 5 https://www.infrafrontier.eu/search?keyword=EM:10162 + EM:06942 C57BL/6NTac-Smyd5/WtsiCnbc EMMA embryo mutant strain MGI:4431696 Smyd5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108048 Smyd5 SET and MYND domain containing 5 https://www.infrafrontier.eu/search?keyword=EM:06942 + EM:06942 C57BL/6NTac-Smyd5/WtsiCnbc EMMA sperm mutant strain MGI:4431696 Smyd5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108048 Smyd5 SET and MYND domain containing 5 https://www.infrafrontier.eu/search?keyword=EM:06942 + EM:12334 C57BL/6NTac-Smyd3/Ics EMMA sperm mutant strain Smyd3 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1916976 Smyd3 SET and MYND domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:12334 + EM:08345 C57BL/6NTac-Smurf1/H EMMA sperm mutant strain MGI:4433314 Smurf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923038 Smurf1 SMAD specific E3 ubiquitin protein ligase 1 https://www.infrafrontier.eu/search?keyword=EM:08345 + EM:10069 C57BL/6NTac-Smim6/Ieg EMMA sperm mutant strain MGI:4362996 Smim6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915778 Smim6 small integral membrane protein 6 https://www.infrafrontier.eu/search?keyword=EM:10069 - EM:05341 C57BL/6NTac-Smco4/Cnrm EMMA sperm mutant strain MGI:4433435 Smco4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3039636 Smco4 single-pass membrane protein with coiled-coil domains 4 https://www.infrafrontier.eu/search?keyword=EM:05341 + EM:08248 C57BL/6NTac-Smc6/Ieg EMMA embryo mutant strain MGI:4435686 Smc6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914491 Smc6 structural maintenance of chromosomes 6 https://www.infrafrontier.eu/search?keyword=EM:08248 + EM:05700 C57BL/6NTac-Smarcal1/WtsiIeg EMMA sperm mutant strain MGI:4433467 Smarcal1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859183 Smarcal1 SWI/SNF related matrix associated, actin dependent regulator of chromatin, subfamily a-like 1 https://www.infrafrontier.eu/search?keyword=EM:05700 + EM:09702 C57BL/6NTac-Slu7/WtsiPh EMMA sperm mutant strain MGI:4363740 Slu7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385598 Slu7 SLU7 splicing factor homolog (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:09702 - EM:07309 C57BL/6NTac-Slit1/H EMMA sperm mutant strain MGI:4363887 Slit1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1315203 Slit1 slit guidance ligand 1 https://www.infrafrontier.eu/search?keyword=EM:07309 + EM:08724 C57BL/6NTac-Slc6a20a/Ieg EMMA sperm mutant strain MGI:4362653 Slc6a20a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2143217 Slc6a20a solute carrier family 6 (neurotransmitter transporter), member 20A https://www.infrafrontier.eu/search?keyword=EM:08724 + EM:05389 C57BL/6NTac-Slc5a6/WtsiCnbc EMMA embryo mutant strain MGI:4432225 Slc5a6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2660847 Slc5a6 solute carrier family 5 (sodium-dependent vitamin transporter), member 6 https://www.infrafrontier.eu/search?keyword=EM:05389 + EM:12050 C57BL/6NTac-Slc44a5/Wtsi EMMA embryo mutant strain MGI:4364041 Slc44a5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3035141 Slc44a5 solute carrier family 44, member 5 https://www.infrafrontier.eu/search?keyword=EM:12050 + EM:08703 C57BL/6NTac-Slc44a3/Ieg EMMA sperm mutant strain MGI:4434043 Slc44a3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384860 Slc44a3 solute carrier family 44, member 3 https://www.infrafrontier.eu/search?keyword=EM:08703 - EM:05285 C57BL/6NTac-Slc39a8/Cnrm EMMA sperm mutant strain MGI:4432011 Slc39a8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914797 Slc39a8 solute carrier family 39 (metal ion transporter), member 8 https://www.infrafrontier.eu/search?keyword=EM:05285 + EM:05442 C57BL/6NTac-Slc35f6/WtsiOulu EMMA embryo mutant strain MGI:4432047 Slc35f6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922169 Slc35f6 solute carrier family 35, member F6 https://www.infrafrontier.eu/search?keyword=EM:05442 + EM:09802 C57BL/6NTac-Slc35b1/Wtsi EMMA embryo mutant strain MGI:5306495 Slc35b1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1343133 Slc35b1 solute carrier family 35, member B1 https://www.infrafrontier.eu/search?keyword=EM:09802 + EM:09802 C57BL/6NTac-Slc35b1/Wtsi EMMA sperm mutant strain MGI:5306495 Slc35b1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1343133 Slc35b1 solute carrier family 35, member B1 https://www.infrafrontier.eu/search?keyword=EM:09802 - EM:08857 C57BL/6NTac-Slc32a1/WtsiH EMMA sperm mutant strain MGI:5633840 Slc32a1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1194488 Slc32a1 solute carrier family 32 (GABA vesicular transporter), member 1 https://www.infrafrontier.eu/search?keyword=EM:08857 + EM:11999 C57BL/6NTac-Slc30a8/Wtsi EMMA embryo mutant strain MGI:4363904 Slc30a8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442682 Slc30a8 solute carrier family 30 (zinc transporter), member 8 https://www.infrafrontier.eu/search?keyword=EM:11999 + EM:12363 C57BL/6NTac-Slc28a3/H EMMA sperm mutant strain MGI:6153822 Slc28a3 endonuclease-mediated mutation 1, Harwell MGI:2137361 Slc28a3 solute carrier family 28 (sodium-coupled nucleoside transporter), member 3 https://www.infrafrontier.eu/search?keyword=EM:12363 - EM:09759 C57BL/6NTac-Slc26a5/WtsiH EMMA sperm mutant strain MGI:5633839 Slc26a5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1933154 Slc26a5 solute carrier family 26, member 5 https://www.infrafrontier.eu/search?keyword=EM:09759 - EM:09769 C57BL/6NTac-Slc26a4/WtsiH EMMA sperm mutant strain MGI:5633838 Slc26a4 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1346029 Slc26a4 solute carrier family 26, member 4 https://www.infrafrontier.eu/search?keyword=EM:09769 + EM:06198 C57BL/6NTac-Slc25a43/WtsiCnrm EMMA sperm mutant strain MGI:4431833 Slc25a43 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2684854 Slc25a43 solute carrier family 25, member 43 https://www.infrafrontier.eu/search?keyword=EM:06198 - EM:07667 C57BL/6NTac-Slc25a38/IcsOrl EMMA sperm mutant strain MGI:4431760 Slc25a38 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384782 Slc25a38 solute carrier family 25, member 38 https://www.infrafrontier.eu/search?keyword=EM:07667 + EM:12107 C57BL/6NTac-Slc23a4/Wtsi EMMA embryo mutant strain MGI:4363429 Slc23a4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917272 Slc23a4 solute carrier family 23 member 4 https://www.infrafrontier.eu/search?keyword=EM:12107 + EM:12107 C57BL/6NTac-Slc23a4/Wtsi EMMA sperm mutant strain MGI:4363429 Slc23a4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917272 Slc23a4 solute carrier family 23 member 4 https://www.infrafrontier.eu/search?keyword=EM:12107 + EM:10783 C57BL/6NTac-Slc22a17/H EMMA sperm C57BL/6N-Slc22a17/H mutant strain MGI:6144258 Slc22a17 endonuclease mediated mutation 2, Harwell MGI:1920806 Slc22a17 solute carrier family 22 (organic cation transporter), member 17 https://www.infrafrontier.eu/search?keyword=EM:10783 + EM:07119 C57BL/6NTac-Slc20a2/WtsiBiat EMMA sperm mutant strain MGI:4431725 Slc20a2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97851 Slc20a2 solute carrier family 20, member 2 https://www.infrafrontier.eu/search?keyword=EM:07119 + EM:05549 C57BL/6NTac-Slc20a2/Ieg EMMA embryo mutant strain MGI:4431725 Slc20a2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97851 Slc20a2 solute carrier family 20, member 2 https://www.infrafrontier.eu/search?keyword=EM:05549 + EM:07736 C57BL/6NTac-Slc1a7/IcsOrl EMMA sperm mutant strain MGI:4436714 Slc1a7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444087 Slc1a7 solute carrier family 1 (glutamate transporter), member 7 https://www.infrafrontier.eu/search?keyword=EM:07736 + EM:06521 C57BL/6NTac-Slc1a4/Wtsi EMMA embryo mutant strain MGI:6256798 Slc1a4 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2135601 Slc1a4 solute carrier family 1 (glutamate/neutral amino acid transporter), member 4 https://www.infrafrontier.eu/search?keyword=EM:06521 + EM:06521 C57BL/6NTac-Slc1a4/Wtsi EMMA sperm mutant strain MGI:6256798 Slc1a4 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2135601 Slc1a4 solute carrier family 1 (glutamate/neutral amino acid transporter), member 4 https://www.infrafrontier.eu/search?keyword=EM:06521 + EM:12448 C57BL/6NTac-Slc17a7/H EMMA sperm mutant strain MGI:6153821 Slc17a7 endonuclease-mediated mutation 1, Harwell MGI:1920211 Slc17a7 solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 7 https://www.infrafrontier.eu/search?keyword=EM:12448 + EM:07340 C57BL/6NTac-Slc17a3/H EMMA sperm C57BL/6N-Slc17a3/H mutant strain MGI:4362759 Slc17a3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2389216 Slc17a3 solute carrier family 17 (sodium phosphate), member 3 https://www.infrafrontier.eu/search?keyword=EM:07340 + EM:06972 C57BL/6NTac-Slc16a6/WtsiIeg EMMA sperm mutant strain MGI:4431916 Slc16a6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144585 Slc16a6 solute carrier family 16 (monocarboxylic acid transporters), member 6 https://www.infrafrontier.eu/search?keyword=EM:06972 - EM:07873 C57BL/6NTac-Slc15a3/H EMMA sperm C57BL/6N-Slc15a3/H mutant strain MGI:4363498 Slc15a3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929691 Slc15a3 solute carrier family 15, member 3 https://www.infrafrontier.eu/search?keyword=EM:07873 + EM:11047 C57BL/6NTac-Slc12a9/Ieg EMMA sperm mutant strain MGI:4433292 Slc12a9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933532 Slc12a9 solute carrier family 12 (potassium/chloride transporters), member 9 https://www.infrafrontier.eu/search?keyword=EM:11047 - EM:09549 C57BL/6NTac-Slc12a3/WtsiIeg EMMA archived mutant strain MGI:5633837 Slc12a3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:108114 Slc12a3 solute carrier family 12, member 3 https://www.infrafrontier.eu/search?keyword=EM:09549 + EM:06599 C57BL/6NTac-Skida1/Wtsi EMMA embryo mutant strain MGI:4841167 Skida1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1919918 Skida1 SKI/DACH domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:06599 + EM:06599 C57BL/6NTac-Skida1/Wtsi EMMA sperm mutant strain MGI:4841167 Skida1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1919918 Skida1 SKI/DACH domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:06599 + EM:05857 C57BL/6NTac-Sirt2/H EMMA sperm mutant strain MGI:4431586 Sirt2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927664 Sirt2 sirtuin 2 https://www.infrafrontier.eu/search?keyword=EM:05857 + EM:12466 C57BL/6NTac-Shisa9/H EMMA sperm mutant strain MGI:6257819 Shisa9 endonuclease-mediated mutation 1, Harwell MGI:1919805 Shisa9 shisa family member 9 https://www.infrafrontier.eu/search?keyword=EM:12466 + EM:11647 C57BL/6NTac-Shank3/H EMMA sperm mutant strain MGI:6153882 Shank3 endonuclease-mediated mutation 2, Harwell MGI:1930016 Shank3 SH3 and multiple ankyrin repeat domains 3 https://www.infrafrontier.eu/search?keyword=EM:11647 + EM:04609 C57BL/6NTac-Sgf29/Cnrm EMMA embryo B6Dnk;B6N-Ccdc101/Cnrm, B6Dnk;B6N-Sgf29/Cnrm, B6NDen;B6N-Ccdc101/Cnrm, HEPD0527_4_B10 mutant strain MGI:4434904 Sgf29 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922815 Sgf29 SAGA complex associated factor 29 https://www.infrafrontier.eu/search?keyword=EM:04609 + EM:04609 C57BL/6NTac-Sgf29/Cnrm EMMA sperm B6Dnk;B6N-Ccdc101/Cnrm, B6Dnk;B6N-Sgf29/Cnrm, B6NDen;B6N-Ccdc101/Cnrm, HEPD0527_4_B10 mutant strain MGI:4434904 Sgf29 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922815 Sgf29 SAGA complex associated factor 29 https://www.infrafrontier.eu/search?keyword=EM:04609 - EM:08957 C57BL/6NTac-Sgca/Cnrm EMMA sperm mutant strain MGI:5633836 Sgca targeted mutation 1, Wellcome Trust Sanger Institute MGI:894698 Sgca sarcoglycan, alpha (dystrophin-associated glycoprotein) https://www.infrafrontier.eu/search?keyword=EM:08957 - EM:09559 C57BL/6NTac-Sfrp1/WtsiIeg EMMA sperm mutant strain MGI:5633835 Sfrp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:892014 Sfrp1 secreted frizzled-related protein 1 https://www.infrafrontier.eu/search?keyword=EM:09559 + EM:12390 C57BL/6NTac-Sez6/H EMMA sperm mutant strain MGI:6153819 Sez6 endonuclease-mediated mutation 1, Harwell MGI:104745 Sez6 seizure related gene 6 https://www.infrafrontier.eu/search?keyword=EM:12390 + EM:05302 C57BL/6NTac-Setmar/WtsiCnbc EMMA embryo mutant strain MGI:4432061 Setmar targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921979 Setmar SET domain without mariner transposase fusion https://www.infrafrontier.eu/search?keyword=EM:05302 + EM:11199 C57BL/6NTac-Setd5/WtsiOulu EMMA embryo mutant strain MGI:4432631 Setd5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920145 Setd5 SET domain containing 5 https://www.infrafrontier.eu/search?keyword=EM:11199 + EM:11199 C57BL/6NTac-Setd5/WtsiOulu EMMA sperm mutant strain MGI:4432631 Setd5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920145 Setd5 SET domain containing 5 https://www.infrafrontier.eu/search?keyword=EM:11199 + EM:06586 C57BL/6NTac-Setd4/Wtsi EMMA embryo mutant strain MGI:4364212 Setd4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2136890 Setd4 SET domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:06586 + EM:06586 C57BL/6NTac-Setd4/Wtsi EMMA sperm mutant strain MGI:4364212 Setd4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2136890 Setd4 SET domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:06586 + EM:06857 C57BL/6NTac-Setd1a/WtsiCnrm EMMA sperm mutant strain MGI:4432882 Setd1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446244 Setd1a SET domain containing 1A https://www.infrafrontier.eu/search?keyword=EM:06857 + EM:05719 C57BL/6NTac-Sesn3/WtsiBiat EMMA embryo mutant strain MGI:4432370 Sesn3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922997 Sesn3 sestrin 3 https://www.infrafrontier.eu/search?keyword=EM:05719 + EM:12301 C57BL/6NTac-Serpinc1/Ics EMMA sperm mutant strain Serpinc1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:88095 Serpinc1 serine (or cysteine) peptidase inhibitor, clade C (antithrombin), member 1 https://www.infrafrontier.eu/search?keyword=EM:12301 + EM:09492 C57BL/6NTac-Serpinb12/H EMMA sperm mutant strain MGI:4362859 Serpinb12 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919119 Serpinb12 serine (or cysteine) peptidase inhibitor, clade B (ovalbumin), member 12 https://www.infrafrontier.eu/search?keyword=EM:09492 + EM:06395 C57BL/6NTac-Serpina3c/Wtsi EMMA embryo mutant strain MGI:4363850 Serpina3c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102848 Serpina3c serine (or cysteine) peptidase inhibitor, clade A, member 3C https://www.infrafrontier.eu/search?keyword=EM:06395 + EM:06395 C57BL/6NTac-Serpina3c/Wtsi EMMA sperm mutant strain MGI:4363850 Serpina3c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102848 Serpina3c serine (or cysteine) peptidase inhibitor, clade A, member 3C https://www.infrafrontier.eu/search?keyword=EM:06395 + EM:08482 C57BL/6NTac-Serinc3/WtsiFlmg EMMA sperm mutant strain MGI:4363849 Serinc3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1349457 Serinc3 serine incorporator 3 https://www.infrafrontier.eu/search?keyword=EM:08482 + EM:10640 C57BL/6NTac-Serf2/H EMMA sperm mutant strain MGI:5771993 Serf2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2139496 Serf2 small EDRK-rich factor 2 https://www.infrafrontier.eu/search?keyword=EM:10640 - EM:07630 C57BL/6NTac-Sept8/IcsOrl EMMA archived C57BL/6NTac-Septin8/IcsOrl mutant strain MGI:4433986 Septin8 targeted mutation 1a, Wellcome Trust Sanger Institute Sep-08 Sep-08 https://www.infrafrontier.eu/search?keyword=EM:07630 + EM:12469 C57BL/6NTac-Senp5/H EMMA sperm mutant strain MGI:6153818 Senp5 endonuclease-mediated mutation 1, Harwell MGI:2443596 Senp5 SUMO/sentrin specific peptidase 5 https://www.infrafrontier.eu/search?keyword=EM:12469 - EM:04003 C57BL/6NTac-Sema5b/Cnrm EMMA sperm mutant strain MGI:4432860 Sema5b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107555 Sema5b sema domain, seven thrombospondin repeats (type 1 and type 1-like), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 5B https://www.infrafrontier.eu/search?keyword=EM:04003 + EM:07987 C57BL/6NTac-Sema4d/H EMMA sperm mutant strain MGI:4433529 Sema4d targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109244 Sema4d sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4D https://www.infrafrontier.eu/search?keyword=EM:07987 - EM:09222 C57BL/6NTac-Sell/Cnrm EMMA sperm mutant strain MGI:5633834 Sell targeted mutation 2, Wellcome Trust Sanger Institute MGI:98279 Sell selectin, lymphocyte https://www.infrafrontier.eu/search?keyword=EM:09222 + EM:06095 C57BL/6NTac-Selenok/WtsiCnbc EMMA sperm C57BL/6NTac-Selk/WtsiCnbc mutant strain MGI:4431818 Selenok targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1931466 Selenok selenoprotein K https://www.infrafrontier.eu/search?keyword=EM:06095 + EM:06457 C57BL/6NTac-Sec23a/Wtsi EMMA embryo mutant strain MGI:4362215 Sec23a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1349635 Sec23a SEC23 homolog A, COPII coat complex component https://www.infrafrontier.eu/search?keyword=EM:06457 + EM:06457 C57BL/6NTac-Sec23a/Wtsi EMMA sperm mutant strain MGI:4362215 Sec23a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1349635 Sec23a SEC23 homolog A, COPII coat complex component https://www.infrafrontier.eu/search?keyword=EM:06457 + EM:12052 C57BL/6NTac-Sec16b/Wtsi EMMA embryo mutant strain MGI:4365061 Sec16b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2148802 Sec16b SEC16 homolog B (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:12052 + EM:12052 C57BL/6NTac-Sec16b/Wtsi EMMA sperm mutant strain MGI:4365061 Sec16b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2148802 Sec16b SEC16 homolog B (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:12052 - EM:08973 C57BL/6NTac-Sds/Cnrm EMMA sperm mutant strain MGI:5633833 Sds targeted mutation 1, Wellcome Trust Sanger Institute MGI:98270 Sds serine dehydratase https://www.infrafrontier.eu/search?keyword=EM:08973 + EM:06193 C57BL/6NTac-Sdhc/WtsiCnrm EMMA sperm mutant strain MGI:4433079 Sdhc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913302 Sdhc succinate dehydrogenase complex, subunit C, integral membrane protein https://www.infrafrontier.eu/search?keyword=EM:06193 + EM:06284 C57BL/6NTac-Sdc2/Ieg EMMA embryo mutant strain MGI:4364777 Sdc2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1349165 Sdc2 syndecan 2 https://www.infrafrontier.eu/search?keyword=EM:06284 + EM:12122 C57BL/6NTac-Sco1/Wtsi EMMA embryo mutant strain MGI:4363778 Sco1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106362 Sco1 SCO1 cytochrome c oxidase assembly protein https://www.infrafrontier.eu/search?keyword=EM:12122 + EM:12122 C57BL/6NTac-Sco1/Wtsi EMMA sperm mutant strain MGI:4363778 Sco1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106362 Sco1 SCO1 cytochrome c oxidase assembly protein https://www.infrafrontier.eu/search?keyword=EM:12122 + EM:06511 C57BL/6NTac-Scn3b/Wtsi EMMA embryo mutant strain MGI:4363292 Scn3b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918882 Scn3b sodium channel, voltage-gated, type III, beta https://www.infrafrontier.eu/search?keyword=EM:06511 + EM:06511 C57BL/6NTac-Scn3b/Wtsi EMMA sperm mutant strain MGI:4363292 Scn3b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918882 Scn3b sodium channel, voltage-gated, type III, beta https://www.infrafrontier.eu/search?keyword=EM:06511 + EM:12073 C57BL/6NTac-Scimp/Wtsi EMMA embryo mutant strain MGI:4362812 Scimp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3610314 Scimp SLP adaptor and CSK interacting membrane protein https://www.infrafrontier.eu/search?keyword=EM:12073 + EM:09694 C57BL/6NTac-Scgb1a1/Cnrm EMMA sperm C57BL/6NTac-Scgb1a1/Cnrm mutant strain MGI:5660121 Scgb1a1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:98919 Scgb1a1 secretoglobin, family 1A, member 1 (uteroglobin) https://www.infrafrontier.eu/search?keyword=EM:09694 + EM:08110 C57BL/6NTac-Sarnp/Ieg EMMA embryo mutant strain MGI:4434696 Sarnp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913368 Sarnp SAP domain containing ribonucleoprotein https://www.infrafrontier.eu/search?keyword=EM:08110 + EM:05863 C57BL/6NTac-Sar1b/WtsiH EMMA sperm MCSS, EPD0113_3_C11 mutant strain MGI:4432515 Sar1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913647 Sar1b secretion associated Ras related GTPase 1B https://www.infrafrontier.eu/search?keyword=EM:05863 + EM:05978 C57BL/6NTac-Sag/WtsiBiat EMMA sperm mutant strain MGI:4433619 Sag targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98227 Sag S-antigen, retina and pineal gland (arrestin) https://www.infrafrontier.eu/search?keyword=EM:05978 - EM:09768 C57BL/6NTac-S100a4/WtsiH EMMA sperm mutant strain MGI:5633831 S100a4 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1330282 S100a4 S100 calcium binding protein A4 https://www.infrafrontier.eu/search?keyword=EM:09768 + EM:04941 C57BL/6NTac-Rxfp2/Ieg EMMA embryo mutant strain MGI:4433327 Rxfp2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153463 Rxfp2 relaxin/insulin-like family peptide receptor 2 https://www.infrafrontier.eu/search?keyword=EM:04941 + EM:10535 C57BL/6NTac-Rwdd2b/Ics EMMA sperm mutant strain MGI:4433511 Rwdd2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858215 Rwdd2b RWD domain containing 2B https://www.infrafrontier.eu/search?keyword=EM:10535 + EM:07505 C57BL/6NTac-Rwdd1/WtsiOrl EMMA archived mutant strain MGI:4362724 Rwdd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913771 Rwdd1 RWD domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:07505 + EM:07732 C57BL/6NTac-Ruvbl1/IcsOrl EMMA sperm mutant strain MGI:4432034 Ruvbl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928760 Ruvbl1 RuvB-like protein 1 https://www.infrafrontier.eu/search?keyword=EM:07732 + EM:07402 C57BL/6NTac-Rundc1/WtsiOulu EMMA embryo mutant strain MGI:4441618 Rundc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144506 Rundc1 RUN domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:07402 + EM:07402 C57BL/6NTac-Rundc1/WtsiOulu EMMA sperm mutant strain MGI:4441618 Rundc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144506 Rundc1 RUN domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:07402 + EM:06127 C57BL/6NTac-Rufy2/WtsiBiat EMMA sperm mutant strain MGI:4434385 Rufy2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917682 Rufy2 RUN and FYVE domain-containing 2 https://www.infrafrontier.eu/search?keyword=EM:06127 + EM:05977 C57BL/6NTac-Rtbdn/WtsiBiat EMMA sperm mutant strain MGI:4433926 Rtbdn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443686 Rtbdn retbindin https://www.infrafrontier.eu/search?keyword=EM:05977 + EM:09813 C57BL/6NTac-Rspo4/WtsiPh EMMA sperm mutant strain MGI:4364711 Rspo4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924467 Rspo4 R-spondin 4 https://www.infrafrontier.eu/search?keyword=EM:09813 + EM:10774 C57BL/6NTac-Rras/H EMMA sperm mutant strain MGI:6144259 Rras endonuclease mediated mutation 1, Harwell MGI:98179 Rras related RAS viral (r-ras) oncogene https://www.infrafrontier.eu/search?keyword=EM:10774 + EM:09394 C57BL/6NTac-Rpia/WtsiOrl EMMA archived mutant strain MGI:4364474 Rpia targeted mutation 1a, Wellcome Trust Sanger Institute MGI:103254 Rpia ribose 5-phosphate isomerase A https://www.infrafrontier.eu/search?keyword=EM:09394 + EM:06273 C57BL/6NTac-Rora/Ieg EMMA embryo mutant strain MGI:4432489 Rora targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104661 Rora RAR-related orphan receptor alpha https://www.infrafrontier.eu/search?keyword=EM:06273 + EM:07377 C57BL/6NTac-Rnf157/WtsiH EMMA sperm mutant strain MGI:4432623 Rnf157 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442484 Rnf157 ring finger protein 157 https://www.infrafrontier.eu/search?keyword=EM:07377 - EM:07699 C57BL/6NTac-Rnf144b/IcsOrl EMMA archived mutant strain MGI:4435770 Rnf144b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384986 Rnf144b ring finger protein 144B https://www.infrafrontier.eu/search?keyword=EM:07699 + EM:11644 C57BL/6NTac-Rnf115/H EMMA sperm mutant strain MGI:6152692 Rnf115 endonuclease mediated mutation 2, Harwell MGI:1915095 Rnf115 ring finger protein 115 https://www.infrafrontier.eu/search?keyword=EM:11644 + EM:11424 C57BL/6NTac-Rnf115/H EMMA sperm mutant strain MGI:6153813 Rnf115 endonuclease-mediated mutation 1, Harwell MGI:1915095 Rnf115 ring finger protein 115 https://www.infrafrontier.eu/search?keyword=EM:11424 + EM:11424 C57BL/6NTac-Rnf115/H EMMA live mutant strain MGI:6153813 Rnf115 endonuclease-mediated mutation 1, Harwell MGI:1915095 Rnf115 ring finger protein 115 https://www.infrafrontier.eu/search?keyword=EM:11424 + EM:10651 C57BL/6NTac-Rnf10/Wtsi EMMA embryo mutant strain MGI:4362564 Rnf10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859162 Rnf10 ring finger protein 10 https://www.infrafrontier.eu/search?keyword=EM:10651 + EM:10651 C57BL/6NTac-Rnf10/Wtsi EMMA sperm mutant strain MGI:4362564 Rnf10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859162 Rnf10 ring finger protein 10 https://www.infrafrontier.eu/search?keyword=EM:10651 + EM:08040 C57BL/6NTac-Rnd3/H EMMA sperm mutant strain MGI:4434854 Rnd3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921444 Rnd3 Rho family GTPase 3 https://www.infrafrontier.eu/search?keyword=EM:08040 + EM:08943 C57BL/6NTac-Rnaset2b/H EMMA sperm mutant strain MGI:5497319 Rnaset2b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3702087 Rnaset2b ribonuclease T2B https://www.infrafrontier.eu/search?keyword=EM:08943 + EM:06505 C57BL/6NTac-Rnaseh2c/Wtsi EMMA embryo mutant strain MGI:4364620 Rnaseh2c targeted mutation 1, Wellcome Trust Sanger Institute MGI:1915459 Rnaseh2c ribonuclease H2, subunit C https://www.infrafrontier.eu/search?keyword=EM:06505 + EM:06505 C57BL/6NTac-Rnaseh2c/Wtsi EMMA sperm mutant strain MGI:4364620 Rnaseh2c targeted mutation 1, Wellcome Trust Sanger Institute MGI:1915459 Rnaseh2c ribonuclease H2, subunit C https://www.infrafrontier.eu/search?keyword=EM:06505 + EM:07690 C57BL/6NTac-Rnase10/IcsOrl EMMA sperm mutant strain MGI:4435923 Rnase10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922269 Rnase10 ribonuclease, RNase A family, 10 (non-active) https://www.infrafrontier.eu/search?keyword=EM:07690 + EM:10378 C57BL/6NTac-Rlbp1/Cnrm EMMA embryo mutant strain MGI:5812261 Rlbp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:97930 Rlbp1 retinaldehyde binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:10378 + EM:10378 C57BL/6NTac-Rlbp1/Cnrm EMMA sperm mutant strain MGI:5812261 Rlbp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:97930 Rlbp1 retinaldehyde binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:10378 + EM:12114 C57BL/6NTac-Rhou/Wtsi EMMA embryo mutant strain MGI:4363423 Rhou targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916831 Rhou ras homolog family member U https://www.infrafrontier.eu/search?keyword=EM:12114 + EM:12114 C57BL/6NTac-Rhou/Wtsi EMMA sperm mutant strain MGI:4363423 Rhou targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916831 Rhou ras homolog family member U https://www.infrafrontier.eu/search?keyword=EM:12114 + EM:08733 C57BL/6NTac-Rhd/H EMMA sperm mutant strain MGI:4431572 Rhd targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202882 Rhd Rh blood group, D antigen https://www.infrafrontier.eu/search?keyword=EM:08733 + EM:12294 C57BL/6NTac-Rgs14/Ics EMMA sperm mutant strain Rgs14 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1859709 Rgs14 regulator of G-protein signaling 14 https://www.infrafrontier.eu/search?keyword=EM:12294 + EM:10771 C57BL/6NTac-Rgl3/H EMMA sperm C57BL/6N-Rgl3/H mutant strain MGI:6149210 Rgl3 endonuclease mediated mutation 1, Harwell MGI:1918996 Rgl3 ral guanine nucleotide dissociation stimulator-like 3 https://www.infrafrontier.eu/search?keyword=EM:10771 + EM:06286 C57BL/6NTac-Rftn2/WtsiBiat EMMA sperm mutant strain MGI:4433645 Rftn2 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1921263 Rftn2 raftlin family member 2 https://www.infrafrontier.eu/search?keyword=EM:06286 + EM:05438 C57BL/6NTac-Retreg3/WtsiOulu EMMA embryo C57BL/6NTac-Fam134c/WtsiOulu mutant strain MGI:4433416 Retreg3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1915248 Retreg3 reticulophagy regulator family member 3 https://www.infrafrontier.eu/search?keyword=EM:05438 + EM:05762 C57BL/6NTac-Rest/Ieg EMMA embryo mutant strain MGI:4431796 Rest targeted mutation 2a, Wellcome Trust Sanger Institute MGI:104897 Rest RE1-silencing transcription factor https://www.infrafrontier.eu/search?keyword=EM:05762 + EM:12299 C57BL/6NTac-Ren1/Ics EMMA sperm mutant strain Ren1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97898 Ren1 renin 1 structural https://www.infrafrontier.eu/search?keyword=EM:12299 + EM:06672 C57BL/6NTac-Rdh16f2/Wtsi EMMA embryo mutant strain MGI:4363554 Rdh16f2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3583955 Rdh16f2 RDH16 family member 2 https://www.infrafrontier.eu/search?keyword=EM:06672 + EM:06672 C57BL/6NTac-Rdh16f2/Wtsi EMMA sperm mutant strain MGI:4363554 Rdh16f2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3583955 Rdh16f2 RDH16 family member 2 https://www.infrafrontier.eu/search?keyword=EM:06672 + EM:12108 C57BL/6NTac-Rdh16/Wtsi EMMA live mutant strain MGI:4362960 Rdh16 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1201375 Rdh16 retinol dehydrogenase 16 https://www.infrafrontier.eu/search?keyword=EM:12108 + EM:05885 C57BL/6NTac-Rcor2/WtsiIeg EMMA sperm mutant strain MGI:4431639 Rcor2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859854 Rcor2 REST corepressor 2 https://www.infrafrontier.eu/search?keyword=EM:05885 + EM:05357 C57BL/6NTac-Rc3h2/Ieg EMMA embryo mutant strain MGI:4364357 Rc3h2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442789 Rc3h2 ring finger and CCCH-type zinc finger domains 2 https://www.infrafrontier.eu/search?keyword=EM:05357 + EM:07733 C57BL/6NTac-Rc3h1/IcsOrl EMMA archived mutant strain MGI:4434899 Rc3h1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2685397 Rc3h1 RING CCCH (C3H) domains 1 https://www.infrafrontier.eu/search?keyword=EM:07733 + EM:08806 C57BL/6NTac-Rbpjl/H EMMA sperm mutant strain MGI:4364029 Rbpjl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1196616 Rbpjl recombination signal binding protein for immunoglobulin kappa J region-like https://www.infrafrontier.eu/search?keyword=EM:08806 + EM:12298 C57BL/6NTac-Rbpjl/Ics EMMA sperm mutant strain Rbpjl EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1196616 Rbpjl recombination signal binding protein for immunoglobulin kappa J region-like https://www.infrafrontier.eu/search?keyword=EM:12298 ? EM:12527 C57BL/6NTac-Rbpj/H EMMA sperm unclassified MGI:6451740 Rbpj endonuclease-mediated mutation 2, Harwell MGI:96522 Rbpj recombination signal binding protein for immunoglobulin kappa J region https://www.infrafrontier.eu/search?keyword=EM:12527 + EM:07608 C57BL/6NTac-Rbmx/WtsiH EMMA sperm EPD0170_3_E04 mutant strain MGI:4363716 Rbmx targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1343044 Rbmx RNA binding motif protein, X chromosome https://www.infrafrontier.eu/search?keyword=EM:07608 - EM:04571 C57BL/6NTac-Rbm4/Cnrm EMMA embryo mutant strain MGI:4435180 Rbm4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1100865 Rbm4 RNA binding motif protein 4 https://www.infrafrontier.eu/search?keyword=EM:04571 - EM:04571 C57BL/6NTac-Rbm4/Cnrm EMMA sperm mutant strain MGI:4435180 Rbm4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1100865 Rbm4 RNA binding motif protein 4 https://www.infrafrontier.eu/search?keyword=EM:04571 + EM:09370 C57BL/6NTac-Rbl1/Ieg EMMA sperm mutant strain MGI:5497361 Rbl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103300 Rbl1 RB transcriptional corepressor like 1 https://www.infrafrontier.eu/search?keyword=EM:09370 + EM:12292 C57BL/6NTac-Rbfox3/Ics EMMA sperm mutant strain Rbfox3 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:106368 Rbfox3 RNA binding protein, fox-1 homolog (C. elegans) 3 https://www.infrafrontier.eu/search?keyword=EM:12292 + EM:08887 C57BL/6NTac-Rbak/WtsiIeg EMMA archived mutant strain MGI:4364920 Rbak targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927369 Rbak RB-associated KRAB zinc finger https://www.infrafrontier.eu/search?keyword=EM:08887 + EM:05886 C57BL/6NTac-Rars/WtsiIeg EMMA archived mutant strain MGI:4432394 Rars targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914297 Rars arginyl-tRNA synthetase https://www.infrafrontier.eu/search?keyword=EM:05886 + EM:12128 C57BL/6NTac-Rapgefl1/Wtsi EMMA embryo mutant strain MGI:4362680 Rapgefl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3611446 Rapgefl1 Rap guanine nucleotide exchange factor (GEF)-like 1 https://www.infrafrontier.eu/search?keyword=EM:12128 + EM:11400 C57BL/6NTac-Rapgef5/H EMMA sperm mutant strain MGI:6153844 Rapgef5 endonuclease mediated mutation 1, Harwell MGI:2444365 Rapgef5 Rap guanine nucleotide exchange factor (GEF) 5 https://www.infrafrontier.eu/search?keyword=EM:11400 + EM:11400 C57BL/6NTac-Rapgef5/H EMMA live mutant strain MGI:6153844 Rapgef5 endonuclease mediated mutation 1, Harwell MGI:2444365 Rapgef5 Rap guanine nucleotide exchange factor (GEF) 5 https://www.infrafrontier.eu/search?keyword=EM:11400 + EM:06643 C57BL/6NTac-Ralgapb/Wtsi EMMA embryo mutant strain MGI:4363602 Ralgapb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444531 Ralgapb Ral GTPase activating protein, beta subunit (non-catalytic) https://www.infrafrontier.eu/search?keyword=EM:06643 + EM:06643 C57BL/6NTac-Ralgapb/Wtsi EMMA sperm mutant strain MGI:4363602 Ralgapb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444531 Ralgapb Ral GTPase activating protein, beta subunit (non-catalytic) https://www.infrafrontier.eu/search?keyword=EM:06643 + EM:06781 C57BL/6NTac-Ralb/WtsiH EMMA sperm mutant strain MGI:4433898 Ralb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927244 Ralb v-ral simian leukemia viral oncogene B https://www.infrafrontier.eu/search?keyword=EM:06781 + EM:07652 C57BL/6NTac-Raf1/IcsOrl EMMA archived mutant strain MGI:4433410 Raf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97847 Raf1 v-raf-leukemia viral oncogene 1 https://www.infrafrontier.eu/search?keyword=EM:07652 + EM:07127 C57BL/6NTac-Rab5c/WtsiOulu EMMA embryo mutant strain MGI:4432624 Rab5c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105306 Rab5c RAB5C, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:07127 + EM:07127 C57BL/6NTac-Rab5c/WtsiOulu EMMA sperm mutant strain MGI:4432624 Rab5c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105306 Rab5c RAB5C, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:07127 + EM:06276 C57BL/6NTac-Rab35/Ieg EMMA embryo mutant strain MGI:4436336 Rab35 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924657 Rab35 RAB35, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:06276 + EM:06612 C57BL/6NTac-Rab15/Wtsi EMMA embryo mutant strain MGI:4363640 Rab15 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916865 Rab15 RAB15, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:06612 + EM:06612 C57BL/6NTac-Rab15/Wtsi EMMA sperm mutant strain MGI:4363640 Rab15 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916865 Rab15 RAB15, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:06612 - EM:08970 C57BL/6NTac-Pyy/Cnrm EMMA sperm mutant strain MGI:5633829 Pyy targeted mutation 1, Wellcome Trust Sanger Institute MGI:99924 Pyy peptide YY https://www.infrafrontier.eu/search?keyword=EM:08970 + EM:12019 C57BL/6NTac-Pus7l/Wtsi EMMA embryo mutant strain MGI:4451717 Pus7l targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1926145 Pus7l pseudouridylate synthase 7-like https://www.infrafrontier.eu/search?keyword=EM:12019 + EM:09612 C57BL/6NTac-Pus10/WtsiOulu EMMA embryo mutant strain MGI:4434872 Pus10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921717 Pus10 pseudouridylate synthase 10 https://www.infrafrontier.eu/search?keyword=EM:09612 + EM:09612 C57BL/6NTac-Pus10/WtsiOulu EMMA sperm mutant strain MGI:4434872 Pus10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921717 Pus10 pseudouridylate synthase 10 https://www.infrafrontier.eu/search?keyword=EM:09612 + EM:11426 C57BL/6NTac-Pttg1ip/H EMMA sperm mutant strain MGI:6149209 Pttg1ip endonuclease mediated mutation 1, Harwell MGI:2652132 Pttg1ip pituitary tumor-transforming 1 interacting protein https://www.infrafrontier.eu/search?keyword=EM:11426 - EM:08858 C57BL/6NTac-Ptprcap/WtsiH EMMA sperm mutant strain MGI:5633828 Ptprcap targeted mutation 1, Wellcome Trust Sanger Institute MGI:97811 Ptprcap protein tyrosine phosphatase, receptor type, C polypeptide-associated protein https://www.infrafrontier.eu/search?keyword=EM:08858 - EM:06017 C57BL/6NTac-Ptpn22/Cnrm EMMA sperm mutant strain Ptpn22 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:107170 Ptpn22 protein tyrosine phosphatase, non-receptor type 22 (lymphoid) https://www.infrafrontier.eu/search?keyword=EM:06017 - EM:06015 C57BL/6NTac-Ptpn22/Cnrm EMMA sperm mutant strain Ptpn22 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:107170 Ptpn22 protein tyrosine phosphatase, non-receptor type 22 (lymphoid) https://www.infrafrontier.eu/search?keyword=EM:06015 + EM:12319 C57BL/6NTac-Pth/Ics EMMA sperm mutant strain Pth EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97799 Pth parathyroid hormone https://www.infrafrontier.eu/search?keyword=EM:12319 + EM:06628 C57BL/6NTac-Pth2r/Wtsi EMMA embryo mutant strain MGI:4364506 Pth2r targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2180917 Pth2r parathyroid hormone 2 receptor https://www.infrafrontier.eu/search?keyword=EM:06628 + EM:06628 C57BL/6NTac-Pth2r/Wtsi EMMA sperm mutant strain MGI:4364506 Pth2r targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2180917 Pth2r parathyroid hormone 2 receptor https://www.infrafrontier.eu/search?keyword=EM:06628 + EM:10858 C57BL/6NTac-Ptgr1/WtsiOulu EMMA embryo mutant strain MGI:4432266 Ptgr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914353 Ptgr1 prostaglandin reductase 1 https://www.infrafrontier.eu/search?keyword=EM:10858 + EM:10858 C57BL/6NTac-Ptgr1/WtsiOulu EMMA sperm mutant strain MGI:4432266 Ptgr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914353 Ptgr1 prostaglandin reductase 1 https://www.infrafrontier.eu/search?keyword=EM:10858 + EM:07687 C57BL/6NTac-Ptdss1/IcsOrl EMMA archived mutant strain MGI:4434934 Ptdss1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1276575 Ptdss1 phosphatidylserine synthase 1 https://www.infrafrontier.eu/search?keyword=EM:07687 + EM:10546 C57BL/6NTac-Ptch1/IcsOrl EMMA sperm mutant strain MGI:4435107 Ptch1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:105373 Ptch1 patched 1 https://www.infrafrontier.eu/search?keyword=EM:10546 ? EM:13030 C57BL/6NTac-Prune1/H EMMA sperm unclassified MGI:6451737 Prune1 endonuclease-mediated mutation 1, Harwell MGI:1925152 Prune1 prune exopolyphosphatase https://www.infrafrontier.eu/search?keyword=EM:13030 + EM:07638 C57BL/6NTac-Prpsap2/IcsOrl EMMA sperm mutant strain MGI:4432556 Prpsap2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384838 Prpsap2 phosphoribosyl pyrophosphate synthetase-associated protein 2 https://www.infrafrontier.eu/search?keyword=EM:07638 + EM:12331 C57BL/6NTac-Proc/Ics EMMA sperm mutant strain Proc EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97771 Proc protein C https://www.infrafrontier.eu/search?keyword=EM:12331 + EM:05699 C57BL/6NTac-Prmt2/WtsiIeg EMMA sperm mutant strain MGI:4433170 Prmt2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1316652 Prmt2 protein arginine N-methyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:05699 + EM:05070 C57BL/6NTac-Prmt1/H EMMA sperm mutant strain MGI:4432476 Prmt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107846 Prmt1 protein arginine N-methyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:05070 + EM:10647 C57BL/6NTac-Prkab1/Wtsi EMMA embryo mutant strain MGI:4362414 Prkab1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1336167 Prkab1 protein kinase, AMP-activated, beta 1 non-catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:10647 + EM:10647 C57BL/6NTac-Prkab1/Wtsi EMMA sperm mutant strain MGI:4362414 Prkab1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1336167 Prkab1 protein kinase, AMP-activated, beta 1 non-catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:10647 ? EM:13023 C57BL/6NTac-Prdm8/H EMMA sperm unclassified MGI:6451733 Prdm8 endonuclease-mediated mutation 1, Harwell MGI:1924880 Prdm8 PR domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:13023 + EM:08951 C57BL/6NTac-Prdm16/WtsiH EMMA sperm mutant strain MGI:5633825 Prdm16 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1917923 Prdm16 PR domain containing 16 https://www.infrafrontier.eu/search?keyword=EM:08951 - EM:08850 C57BL/6NTac-Prdm16/WtsiH EMMA sperm mutant strain MGI:5633826 Prdm16 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1917923 Prdm16 PR domain containing 16 https://www.infrafrontier.eu/search?keyword=EM:08850 - EM:07644 C57BL/6NTac-Prdm10/IcsOrl EMMA sperm mutant strain MGI:4434635 Prdm10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2682952 Prdm10 PR domain containing 10 https://www.infrafrontier.eu/search?keyword=EM:07644 + EM:10164 C57BL/6NTac-Ppy/Ieg EMMA embryo mutant strain MGI:4362546 Ppy targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97753 Ppy pancreatic polypeptide https://www.infrafrontier.eu/search?keyword=EM:10164 - EM:07711 C57BL/6NTac-Ppp6c/IcsOrl EMMA archived mutant strain MGI:4435995 Ppp6c targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915107 Ppp6c protein phosphatase 6, catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:07711 + EM:09648 C57BL/6NTac-Ppp3cc/H EMMA sperm mutant strain MGI:4434809 Ppp3cc targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107162 Ppp3cc protein phosphatase 3, catalytic subunit, gamma isoform https://www.infrafrontier.eu/search?keyword=EM:09648 + EM:05704 C57BL/6NTac-Ppp3ca/WtsiBiat EMMA embryo mutant strain MGI:4432193 Ppp3ca targeted mutation 2e, Wellcome Trust Sanger Institute MGI:107164 Ppp3ca protein phosphatase 3, catalytic subunit, alpha isoform https://www.infrafrontier.eu/search?keyword=EM:05704 + EM:12106 C57BL/6NTac-Ppp2r2b/Wtsi EMMA embryo mutant strain MGI:4364039 Ppp2r2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920180 Ppp2r2b protein phosphatase 2, regulatory subunit B, beta https://www.infrafrontier.eu/search?keyword=EM:12106 + EM:12106 C57BL/6NTac-Ppp2r2b/Wtsi EMMA sperm mutant strain MGI:4364039 Ppp2r2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920180 Ppp2r2b protein phosphatase 2, regulatory subunit B, beta https://www.infrafrontier.eu/search?keyword=EM:12106 + EM:12305 C57BL/6NTac-Pou2f1/Ics EMMA sperm mutant strain Pou2f1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:101898 Pou2f1 POU domain, class 2, transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:12305 + EM:11880 C57BL/6NTac-Polr2f/WtsiH EMMA sperm mutant strain Polr2f EUCOMM targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1349393 Polr2f polymerase (RNA) II (DNA directed) polypeptide F https://www.infrafrontier.eu/search?keyword=EM:11880 - EM:08987 C57BL/6NTac-Polr2f/Cnrm EMMA sperm mutant strain MGI:5633824 Polr2f targeted mutation 1, Wellcome Trust Sanger Institute MGI:1349393 Polr2f polymerase (RNA) II (DNA directed) polypeptide F https://www.infrafrontier.eu/search?keyword=EM:08987 + EM:05889 C57BL/6NTac-Polg2/WtsiIeg EMMA archived mutant strain MGI:4432134 Polg2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354947 Polg2 polymerase (DNA directed), gamma 2, accessory subunit https://www.infrafrontier.eu/search?keyword=EM:05889 + EM:11433 C57BL/6NTac-Podxl/H EMMA sperm mutant strain MGI:6153807 Podxl endonuclease-mediated mutation 1, Harwell MGI:1351317 Podxl podocalyxin-like https://www.infrafrontier.eu/search?keyword=EM:11433 + EM:11433 C57BL/6NTac-Podxl/H EMMA live mutant strain MGI:6153807 Podxl endonuclease-mediated mutation 1, Harwell MGI:1351317 Podxl podocalyxin-like https://www.infrafrontier.eu/search?keyword=EM:11433 + EM:12144 C57BL/6NTac-Pnpo/Wtsi EMMA embryo mutant strain MGI:4363478 Pnpo targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144151 Pnpo pyridoxine 5'-phosphate oxidase https://www.infrafrontier.eu/search?keyword=EM:12144 + EM:05892 C57BL/6NTac-Plxnb2/WtsiIeg EMMA archived mutant strain MGI:4433461 Plxnb2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2154239 Plxnb2 plexin B2 https://www.infrafrontier.eu/search?keyword=EM:05892 + EM:04074 C57BL/6NTac-Plxnb2/Ieg EMMA embryo EPD0051_2_D09 mutant strain MGI:4433461 Plxnb2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2154239 Plxnb2 plexin B2 https://www.infrafrontier.eu/search?keyword=EM:04074 + EM:08483 C57BL/6NTac-Plscr2/WtsiFlmg EMMA sperm mutant strain MGI:4363158 Plscr2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1270860 Plscr2 phospholipid scramblase 2 https://www.infrafrontier.eu/search?keyword=EM:08483 + EM:07824 C57BL/6NTac-Plscr1/IcsOrl EMMA archived mutant strain MGI:4435862 Plscr1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:893575 Plscr1 phospholipid scramblase 1 https://www.infrafrontier.eu/search?keyword=EM:07824 - EM:10506 C57BL/6NTac-Plpp1/IcsOrl EMMA archived C57BL/6N-Ppap2a/IcsOrl, C57BL/6NTac-Plpp1/IcsOrl, HEPD0531_4_G04 mutant strain MGI:4435089 Plpp1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:108412 Plpp1 phospholipid phosphatase 1 https://www.infrafrontier.eu/search?keyword=EM:10506 + EM:05522 C57BL/6NTac-Plin2/WtsiOulu EMMA embryo mutant strain MGI:4432810 Plin2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:87920 Plin2 perilipin 2 https://www.infrafrontier.eu/search?keyword=EM:05522 + EM:12313 C57BL/6NTac-Plin1/Ics EMMA sperm mutant strain Plin1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1890505 Plin1 perilipin 1 https://www.infrafrontier.eu/search?keyword=EM:12313 + EM:05894 C57BL/6NTac-Plekhg1/WtsiIeg EMMA archived mutant strain MGI:4431598 Plekhg1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2676551 Plekhg1 pleckstrin homology domain containing, family G (with RhoGef domain) member 1 https://www.infrafrontier.eu/search?keyword=EM:05894 + EM:10759 C57BL/6NTac-Plcz1/H EMMA sperm mutant strain MGI:5749950 Plcz1 endonuclease-mediate mutation 1, Harwell MGI:2150308 Plcz1 phospholipase C, zeta 1 https://www.infrafrontier.eu/search?keyword=EM:10759 + EM:11642 C57BL/6NTac-Plaur/H EMMA sperm mutant strain MGI:6152691 Plaur endonuclease mediated mutation 2, Harwell MGI:97612 Plaur plasminogen activator, urokinase receptor https://www.infrafrontier.eu/search?keyword=EM:11642 + EM:11723 C57BL/6NTac-Plaur/H EMMA live mutant strain MGI:6149208 Plaur endonuclease mediated mutation 1, Harwell MGI:97612 Plaur plasminogen activator, urokinase receptor https://www.infrafrontier.eu/search?keyword=EM:11723 - EM:07628 C57BL/6NTac-Pla2g4f/IcsOrl EMMA archived mutant strain MGI:4435081 Pla2g4f targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2685493 Pla2g4f phospholipase A2, group IVF https://www.infrafrontier.eu/search?keyword=EM:07628 + EM:07196 C57BL/6NTac-Pla2g2c/WtsiH EMMA sperm MFDP, EPD0201_1_F03 mutant strain MGI:4455976 Pla2g2c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106638 Pla2g2c phospholipase A2, group IIC https://www.infrafrontier.eu/search?keyword=EM:07196 - EM:07366 C57BL/6NTac-Pkn1/H EMMA sperm C57BL/6N-Pkn1/H mutant strain MGI:4365010 Pkn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108022 Pkn1 protein kinase N1 https://www.infrafrontier.eu/search?keyword=EM:07366 - EM:11428 C57BL/6NTac-Pkhd1l1/H EMMA sperm mutant strain MGI:6149161 Pkhd1l1 endonuclease mediated mutation 1, Harwell MGI:2183153 Pkhd1l1 polycystic kidney and hepatic disease 1-like 1 https://www.infrafrontier.eu/search?keyword=EM:11428 + EM:12336 C57BL/6NTac-Pkd2l1/Ics EMMA sperm mutant strain Pkd2l1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1352448 Pkd2l1 polycystic kidney disease 2-like 1 https://www.infrafrontier.eu/search?keyword=EM:12336 - EM:06135 C57BL/6NTac-Pkd1l2/H EMMA sperm C57BL/6N-Pkd1l2/H mutant strain MGI:4455437 Pkd1l2 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:2664668 Pkd1l2 polycystic kidney disease 1 like 2 https://www.infrafrontier.eu/search?keyword=EM:06135 + EM:09774 C57BL/6NTac-Pkd1l2/WtsiH EMMA sperm C57BL/6NTac-Pkd1l2/WtsiH mutant strain MGI:5660024 Pkd1l2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2664668 Pkd1l2 polycystic kidney disease 1 like 2 https://www.infrafrontier.eu/search?keyword=EM:09774 + EM:12057 C57BL/6NTac-Pip5k1c/Wtsi EMMA embryo mutant strain MGI:4362880 Pip5k1c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1298224 Pip5k1c phosphatidylinositol-4-phosphate 5-kinase, type 1 gamma https://www.infrafrontier.eu/search?keyword=EM:12057 + EM:05526 C57BL/6NTac-Pik3cb/WtsiOulu EMMA embryo mutant strain MGI:4434375 Pik3cb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922019 Pik3cb phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit beta https://www.infrafrontier.eu/search?keyword=EM:05526 + EM:07688 C57BL/6NTac-Pik3c3/IcsOrl EMMA sperm mutant strain MGI:4433098 Pik3c3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2445019 Pik3c3 phosphatidylinositol 3-kinase catalytic subunit type 3 https://www.infrafrontier.eu/search?keyword=EM:07688 + EM:07662 C57BL/6NTac-Pigu/IcsOrl EMMA sperm mutant strain MGI:4435661 Pigu targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3039607 Pigu phosphatidylinositol glycan anchor biosynthesis, class U https://www.infrafrontier.eu/search?keyword=EM:07662 + EM:09652 C57BL/6NTac-Pias3/Cnrm EMMA sperm C57BL/6NTac-Pias3/Cnrm mutant strain MGI:5660021 Pias3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1913126 Pias3 protein inhibitor of activated STAT 3 https://www.infrafrontier.eu/search?keyword=EM:09652 + EM:07722 C57BL/6NTac-Phykpl/IcsOrl EMMA embryo mutant strain MGI:4431628 Phykpl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920197 Phykpl 5-phosphohydroxy-L-lysine phospholyase https://www.infrafrontier.eu/search?keyword=EM:07722 + EM:07722 C57BL/6NTac-Phykpl/IcsOrl EMMA sperm mutant strain MGI:4431628 Phykpl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920197 Phykpl 5-phosphohydroxy-L-lysine phospholyase https://www.infrafrontier.eu/search?keyword=EM:07722 + EM:11416 C57BL/6NTac-Phldb2/H EMMA live mutant strain MGI:6149207 Phldb2 endonuclease mediated mutation 1, Harwell MGI:2444981 Phldb2 pleckstrin homology like domain, family B, member 2 https://www.infrafrontier.eu/search?keyword=EM:11416 + EM:05800 C57BL/6NTac-Phf6/Ics EMMA sperm mutant strain MGI:4432234 Phf6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918248 Phf6 PHD finger protein 6 https://www.infrafrontier.eu/search?keyword=EM:05800 - EM:09732 C57BL/6NTac-Phex/WtsiH EMMA sperm mutant strain MGI:5633823 Phex targeted mutation 1, Wellcome Trust Sanger Institute MGI:107489 Phex phosphate regulating endopeptidase homolog, X-linked https://www.infrafrontier.eu/search?keyword=EM:09732 + EM:09258 C57BL/6NTac-Pgam5/IcsOrl EMMA sperm mutant strain MGI:4432458 Pgam5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919792 Pgam5 phosphoglycerate mutase family member 5 https://www.infrafrontier.eu/search?keyword=EM:09258 - EM:07599 C57BL/6NTac-Pfkfb4/WtsiCnrm EMMA sperm mutant strain MGI:4362852 Pfkfb4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2687284 Pfkfb4 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 4 https://www.infrafrontier.eu/search?keyword=EM:07599 + EM:05793 C57BL/6NTac-Pex3/WtsiOrl EMMA sperm mutant strain MGI:4431895 Pex3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929646 Pex3 peroxisomal biogenesis factor 3 https://www.infrafrontier.eu/search?keyword=EM:05793 + EM:07735 C57BL/6NTac-Pex16/IcsOrl EMMA sperm mutant strain MGI:4434961 Pex16 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1338829 Pex16 peroxisomal biogenesis factor 16 https://www.infrafrontier.eu/search?keyword=EM:07735 + EM:08734 C57BL/6NTac-Pex10/H EMMA sperm mutant strain MGI:4432787 Pex10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2684988 Pex10 peroxisomal biogenesis factor 10 https://www.infrafrontier.eu/search?keyword=EM:08734 + EM:08458 C57BL/6NTac-Pef1/Ieg EMMA sperm mutant strain MGI:4434599 Pef1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915148 Pef1 penta-EF hand domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:08458 - EM:04556 C57BL/6NTac-Pebp4/Cnrm EMMA embryo mutant strain MGI:4436202 Pebp4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920773 Pebp4 phosphatidylethanolamine binding protein 4 https://www.infrafrontier.eu/search?keyword=EM:04556 - EM:04556 C57BL/6NTac-Pebp4/Cnrm EMMA sperm mutant strain MGI:4436202 Pebp4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920773 Pebp4 phosphatidylethanolamine binding protein 4 https://www.infrafrontier.eu/search?keyword=EM:04556 + EM:07386 C57BL/6NTac-Pear1/WtsiH EMMA sperm mutant strain MGI:4363617 Pear1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920432 Pear1 platelet endothelial aggregation receptor 1 https://www.infrafrontier.eu/search?keyword=EM:07386 + EM:10187 C57BL/6NTac-Pdzk1/WtsiCnrm EMMA sperm mutant strain MGI:5497391 Pdzk1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1928901 Pdzk1 PDZ domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:10187 + EM:10350 C57BL/6NTac-Pdzd8/WtsiBiat EMMA sperm mutant strain MGI:4431887 Pdzd8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2677270 Pdzd8 PDZ domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:10350 + EM:06275 C57BL/6NTac-Pdia6/Ieg EMMA sperm mutant strain MGI:4435366 Pdia6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1919103 Pdia6 protein disulfide isomerase associated 6 https://www.infrafrontier.eu/search?keyword=EM:06275 + EM:09479 C57BL/6NTac-Pdhx/Ieg EMMA sperm mutant strain MGI:4435592 Pdhx targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1351627 Pdhx pyruvate dehydrogenase complex, component X https://www.infrafrontier.eu/search?keyword=EM:09479 + EM:12306 C57BL/6NTac-Pdgfrb/Ics EMMA sperm mutant strain Pdgfrb EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97531 Pdgfrb platelet derived growth factor receptor, beta polypeptide https://www.infrafrontier.eu/search?keyword=EM:12306 + EM:12318 C57BL/6NTac-Pdgfb/Ics EMMA sperm mutant strain Pdgfb EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97528 Pdgfb platelet derived growth factor, B polypeptide https://www.infrafrontier.eu/search?keyword=EM:12318 + EM:12326 C57BL/6NTac-Pde6c/Ics EMMA sperm mutant strain Pde6c EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:105956 Pde6c phosphodiesterase 6C, cGMP specific, cone, alpha prime https://www.infrafrontier.eu/search?keyword=EM:12326 ? EM:13018 C57BL/6NTac-Pde2a/H EMMA sperm unclassified MGI:6451729 Pde2a endonuclease-mediated mutation 3, Harwell MGI:2446107 Pde2a phosphodiesterase 2A, cGMP-stimulated https://www.infrafrontier.eu/search?keyword=EM:13018 + EM:10090 C57BL/6NTac-Pde1b/WtsiIeg EMMA archived mutant strain MGI:5633822 Pde1b targeted mutation 1, Wellcome Trust Sanger Institute MGI:97523 Pde1b phosphodiesterase 1B, Ca2+-calmodulin dependent https://www.infrafrontier.eu/search?keyword=EM:10090 + EM:06279 C57BL/6NTac-Pcx/Ieg EMMA sperm mutant strain MGI:4432994 Pcx targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97520 Pcx pyruvate carboxylase https://www.infrafrontier.eu/search?keyword=EM:06279 + EM:06114 C57BL/6NTac-Pcx/Cnrm EMMA sperm mutant strain MGI:4432994 Pcx targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97520 Pcx pyruvate carboxylase https://www.infrafrontier.eu/search?keyword=EM:06114 - EM:09772 C57BL/6NTac-Pbx3/WtsiH EMMA sperm mutant strain MGI:5633821 Pbx3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:97496 Pbx3 pre B cell leukemia homeobox 3 https://www.infrafrontier.eu/search?keyword=EM:09772 - EM:08967 C57BL/6NTac-Pbx2/Cnrm EMMA sperm mutant strain MGI:5633820 Pbx2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1341793 Pbx2 pre B cell leukemia homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:08967 + EM:08409 C57BL/6NTac-Pbrm1/Ieg EMMA embryo mutant strain MGI:4432389 Pbrm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923998 Pbrm1 polybromo 1 https://www.infrafrontier.eu/search?keyword=EM:08409 + EM:10075 C57BL/6NTac-Pax5/Ieg EMMA sperm mutant strain MGI:4433183 Pax5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97489 Pax5 paired box 5 https://www.infrafrontier.eu/search?keyword=EM:10075 ? EM:13020 C57BL/6NTac-Pax2/H EMMA sperm unclassified MGI:6156350 Pax2 endonuclease mediated mutation 1, Harwell MGI:97486 Pax2 paired box 2 https://www.infrafrontier.eu/search?keyword=EM:13020 + EM:07706 C57BL/6NTac-Patl2/IcsOrl EMMA sperm mutant strain MGI:4435914 Patl2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914828 Patl2 protein associated with topoisomerase II homolog 2 (yeast) https://www.infrafrontier.eu/search?keyword=EM:07706 - EM:04410 C57BL/6NTac-Parvb/Cnrm EMMA embryo mutant strain MGI:4431642 Parvb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153063 Parvb parvin, beta https://www.infrafrontier.eu/search?keyword=EM:04410 - EM:04410 C57BL/6NTac-Parvb/Cnrm EMMA sperm mutant strain MGI:4431642 Parvb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153063 Parvb parvin, beta https://www.infrafrontier.eu/search?keyword=EM:04410 + EM:04692 C57BL/6NTac-Parl/H EMMA sperm HEPD0513_3_B04 mutant strain MGI:4435986 Parl targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1277152 Parl presenilin associated, rhomboid-like https://www.infrafrontier.eu/search?keyword=EM:04692 - EM:04600 C57BL/6NTac-Palm3/Cnrm EMMA embryo mutant strain MGI:4434121 Palm3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921587 Palm3 paralemmin 3 https://www.infrafrontier.eu/search?keyword=EM:04600 - EM:04600 C57BL/6NTac-Palm3/Cnrm EMMA sperm mutant strain MGI:4434121 Palm3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921587 Palm3 paralemmin 3 https://www.infrafrontier.eu/search?keyword=EM:04600 + EM:07655 C57BL/6NTac-Pacs2/IcsOrl EMMA sperm mutant strain MGI:4435377 Pacs2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924399 Pacs2 phosphofurin acidic cluster sorting protein 2 https://www.infrafrontier.eu/search?keyword=EM:07655 + EM:12030 C57BL/6NTac-Pabpc4/Wtsi EMMA embryo mutant strain MGI:4364130 Pabpc4 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2385206 Pabpc4 poly(A) binding protein, cytoplasmic 4 https://www.infrafrontier.eu/search?keyword=EM:12030 + EM:06648 C57BL/6NTac-Pabpc4/Wtsi EMMA embryo mutant strain MGI:4364054 Pabpc4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385206 Pabpc4 poly(A) binding protein, cytoplasmic 4 https://www.infrafrontier.eu/search?keyword=EM:06648 + EM:06648 C57BL/6NTac-Pabpc4/Wtsi EMMA sperm mutant strain MGI:4364054 Pabpc4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385206 Pabpc4 poly(A) binding protein, cytoplasmic 4 https://www.infrafrontier.eu/search?keyword=EM:06648 + EM:10766 C57BL/6NTac-P2ry14/H EMMA sperm P2RY14-DEL1176-EM1-B6N, C57BL/6NTac-P2ry14/H mutant strain MGI:5749947 P2ry14 endonuclease-mediated mutation 1, Harwell MGI:2155705 P2ry14 purinergic receptor P2Y, G-protein coupled, 14 https://www.infrafrontier.eu/search?keyword=EM:10766 + EM:12304 C57BL/6NTac-P2rx7/Ics EMMA sperm mutant strain P2rx7 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1339957 P2rx7 purinergic receptor P2X, ligand-gated ion channel, 7 https://www.infrafrontier.eu/search?keyword=EM:12304 + EM:12317 C57BL/6NTac-Ovgp1/Ics EMMA sperm mutant strain Ovgp1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:106661 Ovgp1 oviductal glycoprotein 1 https://www.infrafrontier.eu/search?keyword=EM:12317 - EM:07803 C57BL/6NTac-Ovgp1/H EMMA sperm mutant strain MGI:4362777 Ovgp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106661 Ovgp1 oviductal glycoprotein 1 https://www.infrafrontier.eu/search?keyword=EM:07803 + EM:06780 C57BL/6NTac-Otub2/WtsiH EMMA sperm MCWA, EPD0157_3_B05 mutant strain MGI:4433067 Otub2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915399 Otub2 OTU domain, ubiquitin aldehyde binding 2 https://www.infrafrontier.eu/search?keyword=EM:06780 + EM:07674 C57BL/6NTac-Otop3/IcsOrl EMMA sperm mutant strain MGI:4431640 Otop3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916852 Otop3 otopetrin 3 https://www.infrafrontier.eu/search?keyword=EM:07674 + EM:11419 C57BL/6NTac-Otop2/H EMMA sperm mutant strain MGI:6152690 Otop2 endonuclease mediated mutation 2, Harwell MGI:2388365 Otop2 otopetrin 2 https://www.infrafrontier.eu/search?keyword=EM:11419 + EM:11423 C57BL/6NTac-Otop2/H EMMA live mutant strain MGI:6149206 Otop2 endonuclease mediated mutation 1, Harwell MGI:2388365 Otop2 otopetrin 2 https://www.infrafrontier.eu/search?keyword=EM:11423 + EM:07634 C57BL/6NTac-Orc4/IcsOrl EMMA sperm mutant strain MGI:4433141 Orc4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1347043 Orc4 origin recognition complex, subunit 4 https://www.infrafrontier.eu/search?keyword=EM:07634 + EM:05525 C57BL/6NTac-Optn/WtsiOulu EMMA embryo mutant strain MGI:4432769 Optn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918898 Optn optineurin https://www.infrafrontier.eu/search?keyword=EM:05525 + EM:05346 C57BL/6NTac-Optn/Ieg EMMA embryo mutant strain MGI:4432769 Optn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918898 Optn optineurin https://www.infrafrontier.eu/search?keyword=EM:05346 - EM:07315 C57BL/6NTac-Oplah/Ieg EMMA embryo mutant strain MGI:4363400 Oplah targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922725 Oplah 5-oxoprolinase (ATP-hydrolysing) https://www.infrafrontier.eu/search?keyword=EM:07315 - EM:09777 C57BL/6NTac-Olfm1/WtsiH EMMA sperm mutant strain MGI:5633819 Olfm1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1860437 Olfm1 olfactomedin 1 https://www.infrafrontier.eu/search?keyword=EM:09777 + EM:06444 C57BL/6NTac-Ogfod3/Wtsi EMMA embryo mutant strain MGI:4364925 Ogfod3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913429 Ogfod3 2-oxoglutarate and iron-dependent oxygenase domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:06444 + EM:06444 C57BL/6NTac-Ogfod3/Wtsi EMMA sperm mutant strain MGI:4364925 Ogfod3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913429 Ogfod3 2-oxoglutarate and iron-dependent oxygenase domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:06444 + EM:05388 C57BL/6NTac-Oasl2/WtsiCnbc EMMA embryo mutant strain MGI:4431962 Oasl2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1344390 Oasl2 2'-5' oligoadenylate synthetase-like 2 https://www.infrafrontier.eu/search?keyword=EM:05388 + EM:05537 C57BL/6NTac-Nxn/Ieg EMMA embryo mutant strain MGI:4432925 Nxn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109331 Nxn nucleoredoxin https://www.infrafrontier.eu/search?keyword=EM:05537 - EM:06692 C57BL/6NTac-Nutm1/Wtsi EMMA embryo mutant strain MGI:4363742 Nutm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2661384 Nutm1 NUT midline carcinoma, family member 1 https://www.infrafrontier.eu/search?keyword=EM:06692 - EM:06692 C57BL/6NTac-Nutm1/Wtsi EMMA sperm mutant strain MGI:4363742 Nutm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2661384 Nutm1 NUT midline carcinoma, family member 1 https://www.infrafrontier.eu/search?keyword=EM:06692 + EM:06614 C57BL/6NTac-Nubpl/Wtsi EMMA embryo mutant strain MGI:4363128 Nubpl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924076 Nubpl nucleotide binding protein-like https://www.infrafrontier.eu/search?keyword=EM:06614 + EM:06614 C57BL/6NTac-Nubpl/Wtsi EMMA sperm mutant strain MGI:4363128 Nubpl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924076 Nubpl nucleotide binding protein-like https://www.infrafrontier.eu/search?keyword=EM:06614 + EM:12146 C57BL/6NTac-Nsmf/Wtsi EMMA embryo mutant strain MGI:4363881 Nsmf targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1861755 Nsmf NMDA receptor synaptonuclear signaling and neuronal migration factor https://www.infrafrontier.eu/search?keyword=EM:12146 + EM:11733 C57BL/6NTac-Nrxn2/H EMMA live mutant strain MGI:6149205 Nrxn2 endonuclease mediated mutation 1, Harwell MGI:1096362 Nrxn2 neurexin II https://www.infrafrontier.eu/search?keyword=EM:11733 + EM:11124 C57BL/6NTac-Nrg4/WtsiH EMMA sperm mutant strain MGI:5633817 Nrg4 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1933833 Nrg4 neuregulin 4 https://www.infrafrontier.eu/search?keyword=EM:11124 + EM:10083 C57BL/6NTac-Nr5a1/WtsiIeg EMMA archived mutant strain MGI:5633816 Nr5a1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1346833 Nr5a1 nuclear receptor subfamily 5, group A, member 1 https://www.infrafrontier.eu/search?keyword=EM:10083 + EM:10788 C57BL/6NTac-Nr2f6/H EMMA sperm mutant strain MGI:6153804 Nr2f6 endonuclease-mediated mutation 1, Harwell MGI:99530 Nr2f6 nuclear receptor subfamily 2, group F, member 6 https://www.infrafrontier.eu/search?keyword=EM:10788 + EM:10788 C57BL/6NTac-Nr2f6/H EMMA live mutant strain MGI:6153804 Nr2f6 endonuclease-mediated mutation 1, Harwell MGI:99530 Nr2f6 nuclear receptor subfamily 2, group F, member 6 https://www.infrafrontier.eu/search?keyword=EM:10788 + EM:10065 C57BL/6NTac-Nphs2/WtsiIeg EMMA sperm mutant strain MGI:5633815 Nphs2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:2157018 Nphs2 nephrosis 2, podocin https://www.infrafrontier.eu/search?keyword=EM:10065 + EM:09635 C57BL/6NTac-Nolc1/Ieg EMMA sperm mutant strain MGI:4432873 Nolc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918019 Nolc1 nucleolar and coiled-body phosphoprotein 1 https://www.infrafrontier.eu/search?keyword=EM:09635 - EM:07664 C57BL/6NTac-Nol8/IcsOrl EMMA sperm mutant strain MGI:4436496 Nol8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918180 Nol8 nucleolar protein 8 https://www.infrafrontier.eu/search?keyword=EM:07664 + EM:10453 C57BL/6NTac-Nodal/H EMMA sperm mutant strain MGI:4433629 Nodal targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97359 Nodal nodal https://www.infrafrontier.eu/search?keyword=EM:10453 + EM:12373 C57BL/6NTac-Nnt/H EMMA sperm mutant strain MGI:6257492 Nnt endonuclease-mediated mutation 1, Harwell MGI:109279 Nnt nicotinamide nucleotide transhydrogenase https://www.infrafrontier.eu/search?keyword=EM:12373 + EM:09639 C57BL/6NTac-Nmt2/Ieg EMMA sperm mutant strain MGI:4436550 Nmt2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1202298 Nmt2 N-myristoyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:09639 - EM:04346 C57BL/6NTac-Nmnat1/Cnrm EMMA embryo mutant strain MGI:4431754 Nmnat1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913704 Nmnat1 nicotinamide nucleotide adenylyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:04346 - EM:04346 C57BL/6NTac-Nmnat1/Cnrm EMMA sperm mutant strain MGI:4431754 Nmnat1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913704 Nmnat1 nicotinamide nucleotide adenylyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:04346 + EM:08624 C57BL/6NTac-Nme4/WtsiH EMMA sperm mutant strain MGI:4441641 Nme4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1931148 Nme4 NME/NM23 nucleoside diphosphate kinase 4 https://www.infrafrontier.eu/search?keyword=EM:08624 + EM:10706 C57BL/6NTac-Nkx2-6/WtsiIeg EMMA archived mutant strain MGI:5633814 Nkx2-6 targeted mutation 2, Wellcome Trust Sanger Institute MGI:97351 Nkx2-6 NK2 homeobox 6 https://www.infrafrontier.eu/search?keyword=EM:10706 + EM:05386 C57BL/6NTac-Nkiras2/WtsiCnbc EMMA embryo mutant strain MGI:4432279 Nkiras2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919216 Nkiras2 NFKB inhibitor interacting Ras-like protein 2 https://www.infrafrontier.eu/search?keyword=EM:05386 + EM:08150 C57BL/6NTac-Nhp2/WtsiH EMMA sperm EPD0134_3_B06 mutant strain MGI:4362251 Nhp2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098547 Nhp2 NHP2 ribonucleoprotein https://www.infrafrontier.eu/search?keyword=EM:08150 + EM:07691 C57BL/6NTac-Ngfr/IcsOrl EMMA archived mutant strain MGI:4432054 Ngfr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97323 Ngfr nerve growth factor receptor (TNFR superfamily, member 16) https://www.infrafrontier.eu/search?keyword=EM:07691 + EM:07657 C57BL/6NTac-Nfxl1/IcsOrl EMMA archived mutant strain MGI:4432670 Nfxl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923646 Nfxl1 nuclear transcription factor, X-box binding-like 1 https://www.infrafrontier.eu/search?keyword=EM:07657 - EM:03982 C57BL/6NTac-Nfkbid/Cnrm EMMA embryo B6NTac;B6N-Nfkbid/Cnrm, EPD0100_4_A03 mutant strain MGI:4432464 Nfkbid targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3041243 Nfkbid nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, delta https://www.infrafrontier.eu/search?keyword=EM:03982 - EM:03982 C57BL/6NTac-Nfkbid/Cnrm EMMA sperm B6NTac;B6N-Nfkbid/Cnrm, EPD0100_4_A03 mutant strain MGI:4432464 Nfkbid targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3041243 Nfkbid nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, delta https://www.infrafrontier.eu/search?keyword=EM:03982 + EM:07668 C57BL/6NTac-Nfasc/IcsOrl EMMA archived mutant strain MGI:4435919 Nfasc targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104753 Nfasc neurofascin https://www.infrafrontier.eu/search?keyword=EM:07668 + EM:12328 C57BL/6NTac-Nefh/Ics EMMA sperm mutant strain Nefh EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97309 Nefh neurofilament, heavy polypeptide https://www.infrafrontier.eu/search?keyword=EM:12328 + EM:07730 C57BL/6NTac-Ndufs3/IcsOrl EMMA archived mutant strain MGI:4433795 Ndufs3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915599 Ndufs3 NADH:ubiquinone oxidoreductase core subunit S3 https://www.infrafrontier.eu/search?keyword=EM:07730 - EM:03968 C57BL/6NTac-Ndufaf6/Cnrm EMMA sperm B6Dnk;B6N-Ndufaf6/Cnrm, B6Dnk;B6N-2310030N02Rik/Cnrm, B6NDen;B6N-2310030N02Rik/Cnrm mutant strain MGI:4433125 Ndufaf6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924197 Ndufaf6 NADH:ubiquinone oxidoreductase complex assembly factor 6 https://www.infrafrontier.eu/search?keyword=EM:03968 + EM:05197 C57BL/6NTac-Ndufa8/Ieg EMMA embryo mutant strain MGI:4436517 Ndufa8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915625 Ndufa8 NADH:ubiquinone oxidoreductase subunit A8 https://www.infrafrontier.eu/search?keyword=EM:05197 - EM:07789 C57BL/6NTac-Ndrg4/H EMMA sperm C57BL/6N-Ndrg4/H mutant strain MGI:4362496 Ndrg4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384590 Ndrg4 N-myc downstream regulated gene 4 https://www.infrafrontier.eu/search?keyword=EM:07789 + EM:07717 C57BL/6NTac-Ncs1/IcsOrl EMMA archived mutant strain MGI:4436379 Ncs1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109166 Ncs1 neuronal calcium sensor 1 https://www.infrafrontier.eu/search?keyword=EM:07717 + EM:07176 C57BL/6NTac-Ncf2/WtsiH EMMA sperm C57BL/6N-Ncf2/WtsiH mutant strain MGI:4432766 Ncf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97284 Ncf2 neutrophil cytosolic factor 2 https://www.infrafrontier.eu/search?keyword=EM:07176 + EM:07989 C57BL/6NTac-Ncbp3/H EMMA sperm EPD0046_2_C06, C57BL/6NTac-1200014J11Rik/H mutant strain MGI:4433298 Ncbp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144640 Ncbp3 nuclear cap binding subunit 3 https://www.infrafrontier.eu/search?keyword=EM:07989 + EM:05671 C57BL/6NTac-Ncaph/WtsiH EMMA sperm MCEE, EPD0156_5_B09 mutant strain MGI:4431609 Ncaph targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444777 Ncaph non-SMC condensin I complex, subunit H https://www.infrafrontier.eu/search?keyword=EM:05671 - EM:06960 C57BL/6NTac-Nbr1/H EMMA sperm C57BL/6N-Nbr1/H mutant strain MGI:4362162 Nbr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108498 Nbr1 NBR1, autophagy cargo receptor https://www.infrafrontier.eu/search?keyword=EM:06960 + EM:07021 C57BL/6NTac-Natd1/WtsiOulu EMMA embryo C57BL/6NTac-Gm16515/WtsiOulu mutant strain MGI:4432892 Natd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1344388 Natd1 N-acetyltransferase domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:07021 + EM:07021 C57BL/6NTac-Natd1/WtsiOulu EMMA sperm C57BL/6NTac-Gm16515/WtsiOulu mutant strain MGI:4432892 Natd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1344388 Natd1 N-acetyltransferase domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:07021 ? EM:13026 C57BL/6NTac-Nars/H EMMA sperm unclassified MGI:6451612 Nars endonuclease-mediated mutation 1, Harwell MGI:1917473 Nars asparaginyl-tRNA synthetase https://www.infrafrontier.eu/search?keyword=EM:13026 + EM:05558 C57BL/6NTac-Napb/Cnrm EMMA sperm mutant strain MGI:4434916 Napb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104562 Napb N-ethylmaleimide sensitive fusion protein attachment protein beta https://www.infrafrontier.eu/search?keyword=EM:05558 + EM:10080 C57BL/6NTac-Nalcn/WtsiIeg EMMA archived mutant strain MGI:5633812 Nalcn targeted mutation 2, Wellcome Trust Sanger Institute MGI:2444306 Nalcn sodium leak channel, non-selective https://www.infrafrontier.eu/search?keyword=EM:10080 + EM:10496 C57BL/6NTac-Nab2/IcsOrl EMMA archived mutant strain MGI:4435541 Nab2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107563 Nab2 Ngfi-A binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:10496 + EM:06322 C57BL/6NTac-Myo9a/WtsiCnbc EMMA sperm mutant strain MGI:4433267 Myo9a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107735 Myo9a myosin IXa https://www.infrafrontier.eu/search?keyword=EM:06322 - EM:09558 C57BL/6NTac-Myo1a/WtsiIeg EMMA archived mutant strain MGI:5633811 Myo1a targeted mutation 1, Wellcome Trust Sanger Institute MGI:107732 Myo1a myosin IA https://www.infrafrontier.eu/search?keyword=EM:09558 + EM:04445 C57BL/6NTac-Myl4/Ieg EMMA embryo EPD0155_1_D04 mutant strain MGI:4431641 Myl4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97267 Myl4 myosin, light polypeptide 4 https://www.infrafrontier.eu/search?keyword=EM:04445 + EM:10087 C57BL/6NTac-Myh7/WtsiIeg EMMA archived mutant strain MGI:5633809 Myh7 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2155600 Myh7 myosin, heavy polypeptide 7, cardiac muscle, beta https://www.infrafrontier.eu/search?keyword=EM:10087 - EM:09116 C57BL/6NTac-Myh4/Cnrm EMMA sperm mutant strain MGI:5633807 Myh4 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1339713 Myh4 myosin, heavy polypeptide 4, skeletal muscle https://www.infrafrontier.eu/search?keyword=EM:09116 + EM:10086 C57BL/6NTac-Myh2/WtsiIeg EMMA archived mutant strain MGI:5633801 Myh2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1339710 Myh2 myosin, heavy polypeptide 2, skeletal muscle, adult https://www.infrafrontier.eu/search?keyword=EM:10086 - EM:05518 C57BL/6NTac-Myd88/WtsiOulu EMMA embryo mutant strain MGI:4434029 Myd88 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108005 Myd88 myeloid differentiation primary response gene 88 https://www.infrafrontier.eu/search?keyword=EM:05518 + EM:06526 C57BL/6NTac-Mybphl/Wtsi EMMA embryo mutant strain MGI:4364468 Mybphl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916003 Mybphl myosin binding protein H-like https://www.infrafrontier.eu/search?keyword=EM:06526 + EM:06526 C57BL/6NTac-Mybphl/Wtsi EMMA sperm mutant strain MGI:4364468 Mybphl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916003 Mybphl myosin binding protein H-like https://www.infrafrontier.eu/search?keyword=EM:06526 + EM:05477 C57BL/6NTac-Mxra7/H EMMA sperm EPD0059_1_G06 mutant strain MGI:4433751 Mxra7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914872 Mxra7 matrix-remodelling associated 7 https://www.infrafrontier.eu/search?keyword=EM:05477 + EM:11649 C57BL/6NTac-Mul1/H EMMA sperm mutant strain MGI:6153802 Mul1 endonuclease-mediated mutation 1, Harwell MGI:1915600 Mul1 mitochondrial ubiquitin ligase activator of NFKB 1 https://www.infrafrontier.eu/search?keyword=EM:11649 + EM:12300 C57BL/6NTac-Muc5ac/Ics EMMA sperm mutant strain Muc5ac EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:104697 Muc5ac mucin 5, subtypes A and C, tracheobronchial/gastric https://www.infrafrontier.eu/search?keyword=EM:12300 + EM:07666 C57BL/6NTac-Mtrf1/IcsOrl EMMA archived mutant strain MGI:4434932 Mtrf1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384815 Mtrf1 mitochondrial translational release factor 1 https://www.infrafrontier.eu/search?keyword=EM:07666 + EM:05373 C57BL/6NTac-Mtor/WtsiCnbc EMMA embryo mutant strain MGI:4432158 Mtor targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928394 Mtor mechanistic target of rapamycin kinase https://www.infrafrontier.eu/search?keyword=EM:05373 + EM:07723 C57BL/6NTac-Mtmr14/IcsOrl EMMA archived mutant strain MGI:4362891 Mtmr14 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916075 Mtmr14 myotubularin related protein 14 https://www.infrafrontier.eu/search?keyword=EM:07723 - EM:04455 C57BL/6NTac-Mtch2/Cnrm EMMA embryo mutant strain MGI:4436614 Mtch2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1929260 Mtch2 mitochondrial carrier 2 https://www.infrafrontier.eu/search?keyword=EM:04455 - EM:04455 C57BL/6NTac-Mtch2/Cnrm EMMA sperm mutant strain MGI:4436614 Mtch2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1929260 Mtch2 mitochondrial carrier 2 https://www.infrafrontier.eu/search?keyword=EM:04455 - EM:09201 C57BL/6NTac-Msx2/Cnrm EMMA sperm mutant strain MGI:5633794 Msx2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:97169 Msx2 msh homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:09201 + EM:06037 C57BL/6NTac-Msmo1/WtsiBiat EMMA sperm C57BL/6NTac-Sc4mol/WtsiBiat mutant strain MGI:4432850 Msmo1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913484 Msmo1 methylsterol monoxygenase 1 https://www.infrafrontier.eu/search?keyword=EM:06037 + EM:12315 C57BL/6NTac-Msln/Ics EMMA sperm mutant strain Msln EUCOMM targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1888992 Msln mesothelin https://www.infrafrontier.eu/search?keyword=EM:12315 + EM:07698 C57BL/6NTac-Mrps35/IcsOrl EMMA archived mutant strain MGI:4433487 Mrps35 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385255 Mrps35 mitochondrial ribosomal protein S35 https://www.infrafrontier.eu/search?keyword=EM:07698 + EM:07738 C57BL/6NTac-Mrpl54/IcsOrl EMMA archived mutant strain MGI:4432901 Mrpl54 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913297 Mrpl54 mitochondrial ribosomal protein L54 https://www.infrafrontier.eu/search?keyword=EM:07738 + EM:10775 C57BL/6NTac-Mrpl23/H EMMA sperm C57BL/6NTac-Mrpl23/H mutant strain MGI:6144261 Mrpl23 endonuclease mediated mutation 1, Harwell MGI:1196612 Mrpl23 mitochondrial ribosomal protein L23 https://www.infrafrontier.eu/search?keyword=EM:10775 + EM:07697 C57BL/6NTac-Mrpl10/IcsOrl EMMA archived mutant strain MGI:4435617 Mrpl10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1333801 Mrpl10 mitochondrial ribosomal protein L10 https://www.infrafrontier.eu/search?keyword=EM:07697 + EM:05870 C57BL/6NTac-Mroh7/WtsiH EMMA sperm mutant strain MGI:4434135 Mroh7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685873 Mroh7 maestro heat-like repeat family member 7 https://www.infrafrontier.eu/search?keyword=EM:05870 - EM:08847 C57BL/6NTac-Mroh7/WtsiH EMMA sperm mutant strain MGI:5633793 Mroh7 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:2685873 Mroh7 maestro heat-like repeat family member 7 https://www.infrafrontier.eu/search?keyword=EM:08847 + EM:04617 C57BL/6NTac-Mpi/H EMMA sperm EPD0227_5_D08 mutant strain MGI:4432151 Mpi targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97075 Mpi mannose phosphate isomerase https://www.infrafrontier.eu/search?keyword=EM:04617 - EM:04738 C57BL/6NTac-Mphosph9/Cnrm EMMA embryo mutant strain MGI:6324154 Mphosph9 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:2443138 Mphosph9 M-phase phosphoprotein 9 https://www.infrafrontier.eu/search?keyword=EM:04738 - EM:04738 C57BL/6NTac-Mphosph9/Cnrm EMMA sperm mutant strain MGI:6324154 Mphosph9 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:2443138 Mphosph9 M-phase phosphoprotein 9 https://www.infrafrontier.eu/search?keyword=EM:04738 ? EM:13019 C57BL/6NTac-Mpeg1/H EMMA sperm unclassified MGI:6451609 Mpeg1 endonuclease-mediated mutation 1, Harwell MGI:1333743 Mpeg1 macrophage expressed gene 1 https://www.infrafrontier.eu/search?keyword=EM:13019 + EM:09161 C57BL/6NTac-Mospd1/WtsiPh EMMA sperm mutant strain MGI:4362521 Mospd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917630 Mospd1 motile sperm domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:09161 - EM:09764 C57BL/6NTac-Mog/WtsiH EMMA sperm mutant strain MGI:5633791 Mog targeted mutation 1, Wellcome Trust Sanger Institute MGI:97435 Mog myelin oligodendrocyte glycoprotein https://www.infrafrontier.eu/search?keyword=EM:09764 + EM:10670 C57BL/6NTac-Mmp11/Ics EMMA sperm mutant strain MGI:4436340 Mmp11 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97008 Mmp11 matrix metallopeptidase 11 https://www.infrafrontier.eu/search?keyword=EM:10670 + EM:11230 C57BL/6NTac-Mlycd/H EMMA live mutant strain MGI:4362673 Mlycd targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2142507 Mlycd malonyl-CoA decarboxylase https://www.infrafrontier.eu/search?keyword=EM:11230 - EM:04517 C57BL/6NTac-Mlh1/Cnrm EMMA embryo mutant strain MGI:4435839 Mlh1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:101938 Mlh1 mutL homolog 1 https://www.infrafrontier.eu/search?keyword=EM:04517 - EM:04517 C57BL/6NTac-Mlh1/Cnrm EMMA sperm mutant strain MGI:4435839 Mlh1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:101938 Mlh1 mutL homolog 1 https://www.infrafrontier.eu/search?keyword=EM:04517 + EM:10702 C57BL/6NTac-Mitf/WtsiIeg EMMA sperm mutant strain MGI:5633787 Mitf targeted mutation 2, Wellcome Trust Sanger Institute MGI:104554 Mitf melanogenesis associated transcription factor https://www.infrafrontier.eu/search?keyword=EM:10702 + EM:12321 C57BL/6NTac-Mip/Ics EMMA sperm mutant strain Mip EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:96990 Mip major intrinsic protein of lens fiber https://www.infrafrontier.eu/search?keyword=EM:12321 + EM:11417 C57BL/6NTac-Mindy4/H EMMA live mutant strain MGI:6149204 Mindy4 endonuclease mediated mutation 1, Harwell MGI:3583959 Mindy4 MINDY lysine 48 deubiquitinase 4 https://www.infrafrontier.eu/search?keyword=EM:11417 + EM:11405 C57BL/6NTac-Mindy3/H EMMA live mutant strain MGI:6149950 Mindy3 endonuclease mediated mutation 2, Harwell MGI:1914210 Mindy3 MINDY lysine 48 deubiquitinase 3 https://www.infrafrontier.eu/search?keyword=EM:11405 + EM:11415 C57BL/6NTac-Mindy3/H EMMA live mutant strain MGI:6149203 Mindy3 endonuclease mediated mutation 1, Harwell MGI:1914210 Mindy3 MINDY lysine 48 deubiquitinase 3 https://www.infrafrontier.eu/search?keyword=EM:11415 - EM:11447 C57BL/6NTac-Mindy2/H EMMA live mutant strain MGI:6149160 Mindy2 endonuclease mediated mutation 1, Harwell MGI:2443086 Mindy2 MINDY lysine 48 deubiquitinase 2 https://www.infrafrontier.eu/search?keyword=EM:11447 + EM:07670 C57BL/6NTac-Mindy1/IcsOrl EMMA sperm C57BL/6NTac-Fam63a/IcsOrl mutant strain MGI:4433829 Mindy1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3034747 Mindy1 MINDY lysine 48 deubiquitinase 1 https://www.infrafrontier.eu/search?keyword=EM:07670 + EM:07640 C57BL/6NTac-Mib2/IcsOrl EMMA archived mutant strain MGI:4431678 Mib2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2679684 Mib2 mindbomb E3 ubiquitin protein ligase 2 https://www.infrafrontier.eu/search?keyword=EM:07640 - EM:08962 C57BL/6NTac-Mia/Cnrm EMMA sperm mutant strain MGI:5633786 Mia targeted mutation 1, Wellcome Trust Sanger Institute MGI:109615 Mia melanoma inhibitory activity https://www.infrafrontier.eu/search?keyword=EM:08962 + EM:08593 C57BL/6NTac-Mettl24/WtsiH EMMA sperm mutant strain MGI:4363211 Mettl24 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3045338 Mettl24 methyltransferase like 24 https://www.infrafrontier.eu/search?keyword=EM:08593 - EM:07966 C57BL/6NTac-Metrnl/WtsiH EMMA sperm C57BL/6N-Metrnl/WtsiH mutant strain MGI:4362702 Metrnl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384806 Metrnl meteorin, glial cell differentiation regulator-like https://www.infrafrontier.eu/search?keyword=EM:07966 + EM:12001 C57BL/6NTac-Melk/Wtsi EMMA embryo mutant strain MGI:4362376 Melk targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106924 Melk maternal embryonic leucine zipper kinase https://www.infrafrontier.eu/search?keyword=EM:12001 + EM:12001 C57BL/6NTac-Melk/Wtsi EMMA sperm mutant strain MGI:4362376 Melk targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106924 Melk maternal embryonic leucine zipper kinase https://www.infrafrontier.eu/search?keyword=EM:12001 + EM:11557 C57BL/6NTac-Med19/WtsiOulu EMMA embryo mutant strain MGI:4432772 Med19 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914234 Med19 mediator complex subunit 19 https://www.infrafrontier.eu/search?keyword=EM:11557 + EM:11557 C57BL/6NTac-Med19/WtsiOulu EMMA sperm mutant strain MGI:4432772 Med19 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914234 Med19 mediator complex subunit 19 https://www.infrafrontier.eu/search?keyword=EM:11557 + EM:10828 C57BL/6NTac-Med18/H EMMA sperm mutant strain MGI:4432982 Med18 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914469 Med18 mediator complex subunit 18 https://www.infrafrontier.eu/search?keyword=EM:10828 + EM:08720 C57BL/6NTac-Me3/Ieg EMMA embryo mutant strain MGI:4362498 Me3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916679 Me3 malic enzyme 3, NADP(+)-dependent, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:08720 + EM:08646 C57BL/6NTac-Me2/Ieg EMMA sperm mutant strain MGI:4434603 Me2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2147351 Me2 malic enzyme 2, NAD(+)-dependent, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:08646 - EM:04413 C57BL/6NTac-Mcf2l/Cnrm EMMA embryo mutant strain MGI:4436065 Mcf2l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103263 Mcf2l mcf.2 transforming sequence-like https://www.infrafrontier.eu/search?keyword=EM:04413 - EM:04413 C57BL/6NTac-Mcf2l/Cnrm EMMA sperm mutant strain MGI:4436065 Mcf2l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103263 Mcf2l mcf.2 transforming sequence-like https://www.infrafrontier.eu/search?keyword=EM:04413 + EM:10705 C57BL/6NTac-Mbp/WtsiIeg EMMA sperm mutant strain MGI:5633783 Mbp targeted mutation 2, Wellcome Trust Sanger Institute MGI:96925 Mbp myelin basic protein https://www.infrafrontier.eu/search?keyword=EM:10705 + EM:08273 C57BL/6NTac-Mboat7/H EMMA sperm mutant strain MGI:4363399 Mboat7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924832 Mboat7 membrane bound O-acyltransferase domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:08273 - EM:08949 C57BL/6NTac-Mb/WtsiH EMMA sperm mutant strain MGI:5633782 Mb targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:96922 Mb myoglobin https://www.infrafrontier.eu/search?keyword=EM:08949 + EM:07685 C57BL/6NTac-Mat2a/IcsOrl EMMA sperm mutant strain MGI:4435877 Mat2a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443731 Mat2a methionine adenosyltransferase II, alpha https://www.infrafrontier.eu/search?keyword=EM:07685 - EM:05708 C57BL/6NTac-March5/WtsiBiat EMMA sperm C57BL/6NTac-Marchf5/WtsiBiat mutant strain MGI:4433802 Marchf5 targeted mutation 1a, Wellcome Trust Sanger Institute Mar-05 Mar-05 https://www.infrafrontier.eu/search?keyword=EM:05708 - EM:07705 C57BL/6NTac-Marc2/IcsOrl EMMA sperm mutant strain MGI:4435988 Mtarc2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1914497 Mtarc2 mitochondrial amidoxime reducing component 2 https://www.infrafrontier.eu/search?keyword=EM:07705 + EM:07740 C57BL/6NTac-Mapre3/IcsOrl EMMA sperm mutant strain MGI:4432919 Mapre3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2140967 Mapre3 microtubule-associated protein, RP/EB family, member 3 https://www.infrafrontier.eu/search?keyword=EM:07740 + EM:04557 C57BL/6NTac-Mapkbp1/H EMMA sperm mutant strain MGI:4436014 Mapkbp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1347004 Mapkbp1 mitogen-activated protein kinase binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:04557 + EM:10072 C57BL/6NTac-Mapkapk5/Ieg EMMA sperm mutant strain MGI:4432027 Mapkapk5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1333110 Mapkapk5 MAP kinase-activated protein kinase 5 https://www.infrafrontier.eu/search?keyword=EM:10072 - EM:04733 C57BL/6NTac-Mapk8ip2/Cnrm EMMA embryo mutant strain MGI:4433297 Mapk8ip2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926555 Mapk8ip2 mitogen-activated protein kinase 8 interacting protein 2 https://www.infrafrontier.eu/search?keyword=EM:04733 - EM:04733 C57BL/6NTac-Mapk8ip2/Cnrm EMMA sperm mutant strain MGI:4433297 Mapk8ip2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926555 Mapk8ip2 mitogen-activated protein kinase 8 interacting protein 2 https://www.infrafrontier.eu/search?keyword=EM:04733 + EM:12100 C57BL/6NTac-Maneal/Wtsi EMMA embryo mutant strain MGI:4362994 Maneal targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2684896 Maneal mannosidase, endo-alpha-like https://www.infrafrontier.eu/search?keyword=EM:12100 + EM:12100 C57BL/6NTac-Maneal/Wtsi EMMA sperm mutant strain MGI:4362994 Maneal targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2684896 Maneal mannosidase, endo-alpha-like https://www.infrafrontier.eu/search?keyword=EM:12100 + EM:06422 C57BL/6NTac-Man2b2/Wtsi EMMA embryo mutant strain MGI:4362174 Man2b2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1195262 Man2b2 mannosidase 2, alpha B2 https://www.infrafrontier.eu/search?keyword=EM:06422 + EM:06422 C57BL/6NTac-Man2b2/Wtsi EMMA sperm mutant strain MGI:4362174 Man2b2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1195262 Man2b2 mannosidase 2, alpha B2 https://www.infrafrontier.eu/search?keyword=EM:06422 + EM:05374 C57BL/6NTac-Mad2l2/WtsiCnbc EMMA embryo mutant strain MGI:4432091 Mad2l2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919140 Mad2l2 MAD2 mitotic arrest deficient-like 2 https://www.infrafrontier.eu/search?keyword=EM:05374 + EM:12002 C57BL/6NTac-Mab21l4/Wtsi EMMA embryo mutant strain MGI:4362992 Mab21l4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919124 Mab21l4 mab-21-like 4 https://www.infrafrontier.eu/search?keyword=EM:12002 + EM:12002 C57BL/6NTac-Mab21l4/Wtsi EMMA sperm mutant strain MGI:4362992 Mab21l4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919124 Mab21l4 mab-21-like 4 https://www.infrafrontier.eu/search?keyword=EM:12002 + EM:06794 C57BL/6NTac-Lztr1/WtsiH EMMA sperm MDLF, EPD0140_5_E07 mutant strain MGI:4432946 Lztr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914113 Lztr1 leucine-zipper-like transcriptional regulator, 1 https://www.infrafrontier.eu/search?keyword=EM:06794 - EM:08969 C57BL/6NTac-Lztfl1/Cnrm EMMA sperm mutant strain MGI:5633781 Lztfl1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1934860 Lztfl1 leucine zipper transcription factor-like 1 https://www.infrafrontier.eu/search?keyword=EM:08969 + EM:08717 C57BL/6NTac-Lss/Ieg EMMA archived mutant strain MGI:4362667 Lss targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1336155 Lss lanosterol synthase https://www.infrafrontier.eu/search?keyword=EM:08717 + EM:12072 C57BL/6NTac-Lsm11/Wtsi EMMA embryo mutant strain MGI:4362146 Lsm11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919540 Lsm11 U7 snRNP-specific Sm-like protein LSM11 https://www.infrafrontier.eu/search?keyword=EM:12072 + EM:11425 C57BL/6NTac-Lrr1/H EMMA sperm mutant strain MGI:6149202 Lrr1 endonuclease mediated mutation 1, Harwell MGI:1916956 Lrr1 leucine rich repeat protein 1 https://www.infrafrontier.eu/search?keyword=EM:11425 + EM:12143 C57BL/6NTac-Lrpprc/Wtsi EMMA embryo mutant strain MGI:4363281 Lrpprc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919666 Lrpprc leucine-rich PPR-motif containing https://www.infrafrontier.eu/search?keyword=EM:12143 + EM:05547 C57BL/6NTac-Lpo/Ieg EMMA embryo mutant strain MGI:4432905 Lpo targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923363 Lpo lactoperoxidase https://www.infrafrontier.eu/search?keyword=EM:05547 + EM:07485 C57BL/6NTac-Lonrf3/WtsiOulu EMMA embryo mutant strain MGI:4363930 Lonrf3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921615 Lonrf3 LON peptidase N-terminal domain and ring finger 3 https://www.infrafrontier.eu/search?keyword=EM:07485 + EM:07485 C57BL/6NTac-Lonrf3/WtsiOulu EMMA sperm mutant strain MGI:4363930 Lonrf3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921615 Lonrf3 LON peptidase N-terminal domain and ring finger 3 https://www.infrafrontier.eu/search?keyword=EM:07485 + EM:05714 C57BL/6NTac-Lnx2/WtsiBiat EMMA embryo mutant strain MGI:4433509 Lnx2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2155959 Lnx2 ligand of numb-protein X 2 https://www.infrafrontier.eu/search?keyword=EM:05714 + EM:07701 C57BL/6NTac-Limk2/IcsOrl EMMA archived mutant strain MGI:4431692 Limk2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1197517 Limk2 LIM motif-containing protein kinase 2 https://www.infrafrontier.eu/search?keyword=EM:07701 + EM:07692 C57BL/6NTac-Lhx1/IcsOrl EMMA archived mutant strain Lhx1 EUCOMM targeted mutation 1e, Wellcome Trust Sanger Institute MGI:99783 Lhx1 LIM homeobox protein 1 https://www.infrafrontier.eu/search?keyword=EM:07692 + EM:06647 C57BL/6NTac-Leprot/Wtsi EMMA embryo mutant strain MGI:4364337 Leprot targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2687005 Leprot leptin receptor overlapping transcript https://www.infrafrontier.eu/search?keyword=EM:06647 + EM:06647 C57BL/6NTac-Leprot/Wtsi EMMA sperm mutant strain MGI:4364337 Leprot targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2687005 Leprot leptin receptor overlapping transcript https://www.infrafrontier.eu/search?keyword=EM:06647 + EM:10707 C57BL/6NTac-Lef1/WtsiIeg EMMA archived mutant strain MGI:5633779 Lef1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:96770 Lef1 lymphoid enhancer binding factor 1 https://www.infrafrontier.eu/search?keyword=EM:10707 + EM:08936 C57BL/6NTac-Ldhb/WtsiOulu EMMA embryo mutant strain MGI:5299501 Ldhb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96763 Ldhb lactate dehydrogenase B https://www.infrafrontier.eu/search?keyword=EM:08936 + EM:08936 C57BL/6NTac-Ldhb/WtsiOulu EMMA sperm mutant strain MGI:5299501 Ldhb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96763 Ldhb lactate dehydrogenase B https://www.infrafrontier.eu/search?keyword=EM:08936 + EM:07865 C57BL/6NTac-Lbp/H EMMA sperm mutant strain MGI:4436125 Lbp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1098776 Lbp lipopolysaccharide binding protein https://www.infrafrontier.eu/search?keyword=EM:07865 + EM:05705 C57BL/6NTac-Laptm5/WtsiBiat EMMA archived mutant strain MGI:4433224 Laptm5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108046 Laptm5 lysosomal-associated protein transmembrane 5 https://www.infrafrontier.eu/search?keyword=EM:05705 + EM:07646 C57BL/6NTac-Laptm4a/IcsOrl EMMA archived mutant strain MGI:4435176 Laptm4a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108017 Laptm4a lysosomal-associated protein transmembrane 4A https://www.infrafrontier.eu/search?keyword=EM:07646 + EM:06458 C57BL/6NTac-Lamc3/Wtsi EMMA embryo mutant strain MGI:4364864 Lamc3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1344394 Lamc3 laminin gamma 3 https://www.infrafrontier.eu/search?keyword=EM:06458 + EM:06458 C57BL/6NTac-Lamc3/Wtsi EMMA sperm mutant strain MGI:4364864 Lamc3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1344394 Lamc3 laminin gamma 3 https://www.infrafrontier.eu/search?keyword=EM:06458 + EM:06294 C57BL/6NTac-Lamb3/H EMMA sperm C57BL/6N-Lamb3/H mutant strain MGI:4364410 Lamb3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99915 Lamb3 laminin, beta 3 https://www.infrafrontier.eu/search?keyword=EM:06294 + EM:08811 C57BL/6NTac-Lama5/H EMMA sperm mutant strain MGI:4363608 Lama5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105382 Lama5 laminin, alpha 5 https://www.infrafrontier.eu/search?keyword=EM:08811 + EM:10043 C57BL/6NTac-Krt82/WtsiIeg EMMA archived mutant strain MGI:5633778 Krt82 targeted mutation 2, Wellcome Trust Sanger Institute MGI:2149248 Krt82 keratin 82 https://www.infrafrontier.eu/search?keyword=EM:10043 + EM:10712 C57BL/6NTac-Krt79/WtsiIeg EMMA archived mutant strain MGI:5297893 Krt79 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2385030 Krt79 keratin 79 https://www.infrafrontier.eu/search?keyword=EM:10712 - EM:08852 C57BL/6NTac-Krt17/WtsiH EMMA sperm mutant strain MGI:5633777 Krt17 targeted mutation 1, Wellcome Trust Sanger Institute MGI:96691 Krt17 keratin 17 https://www.infrafrontier.eu/search?keyword=EM:08852 - EM:07686 C57BL/6NTac-Knstrn/IcsOrl EMMA sperm mutant strain MGI:4362164 Knstrn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1289298 Knstrn kinetochore-localized astrin/SPAG5 binding https://www.infrafrontier.eu/search?keyword=EM:07686 + EM:09658 C57BL/6NTac-Klrg1/Wtsi EMMA embryo C57BL/6NTac-Klrg1/Wtsi mutant strain MGI:5660019 Klrg1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1355294 Klrg1 killer cell lectin-like receptor subfamily G, member 1 https://www.infrafrontier.eu/search?keyword=EM:09658 + EM:10664 C57BL/6NTac-Klrb1a/WtsiBiat EMMA sperm mutant strain MGI:4364549 Klrb1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107540 Klrb1a killer cell lectin-like receptor subfamily B member 1A https://www.infrafrontier.eu/search?keyword=EM:10664 + EM:11262 C57BL/6NTac-Klk5/WtsiCnrm EMMA sperm mutant strain MGI:4364033 Klk5 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1915918 Klk5 kallikrein related-peptidase 5 https://www.infrafrontier.eu/search?keyword=EM:11262 - EM:09760 C57BL/6NTac-Klk5/WtsiH EMMA sperm mutant strain MGI:5633775 Klk5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1915918 Klk5 kallikrein related-peptidase 5 https://www.infrafrontier.eu/search?keyword=EM:09760 + EM:09948 C57BL/6NTac-Klk10/Cnrm EMMA sperm mutant strain MGI:5811913 Klk10 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1916790 Klk10 kallikrein related-peptidase 10 https://www.infrafrontier.eu/search?keyword=EM:09948 + EM:07649 C57BL/6NTac-Klhl29/IcsOrl EMMA archived mutant strain MGI:4435268 Klhl29 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2683857 Klhl29 kelch-like 29 https://www.infrafrontier.eu/search?keyword=EM:07649 + EM:07395 C57BL/6NTac-Klhl21/WtsiH EMMA sperm EPD0122_3_B03 mutant strain MGI:4363013 Klhl21 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919288 Klhl21 kelch-like 21 https://www.infrafrontier.eu/search?keyword=EM:07395 + EM:08742 C57BL/6NTac-Klhl18/WtsiH EMMA sperm mutant strain MGI:4362936 Klhl18 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2143315 Klhl18 kelch-like 18 https://www.infrafrontier.eu/search?keyword=EM:08742 + EM:04619 C57BL/6NTac-Klhdc2/H EMMA sperm HEPD0523_4_G08 mutant strain MGI:4436518 Klhdc2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916804 Klhdc2 kelch domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:04619 + EM:07508 C57BL/6NTac-Klf17/WtsiOrl EMMA archived mutant strain MGI:4362369 Klf17 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2181068 Klf17 Kruppel-like factor 17 https://www.infrafrontier.eu/search?keyword=EM:07508 + EM:11404 C57BL/6NTac-Klf14/H EMMA sperm mutant strain MGI:5749946 Klf14 endonuclease-mediated mutation 2, Harwell MGI:3577024 Klf14 Kruppel-like factor 14 https://www.infrafrontier.eu/search?keyword=EM:11404 + EM:10760 C57BL/6NTac-Klf14/H EMMA live mutant strain MGI:5749945 Klf14 endonuclease-mediated mutation 1, Harwell MGI:3577024 Klf14 Kruppel-like factor 14 https://www.infrafrontier.eu/search?keyword=EM:10760 + EM:08515 C57BL/6NTac-Klc2/WtsiOrl EMMA archived mutant strain MGI:4434042 Klc2 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:107953 Klc2 kinesin light chain 2 https://www.infrafrontier.eu/search?keyword=EM:08515 + EM:12033 C57BL/6NTac-Kif21b/Wtsi EMMA embryo mutant strain MGI:4364527 Kif21b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109234 Kif21b kinesin family member 21B https://www.infrafrontier.eu/search?keyword=EM:12033 + EM:07659 C57BL/6NTac-Kdm8/IcsOrl EMMA archived mutant strain MGI:4431607 Kdm8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924285 Kdm8 lysine (K)-specific demethylase 8 https://www.infrafrontier.eu/search?keyword=EM:07659 + EM:12083 C57BL/6NTac-Kdm4c/Wtsi EMMA embryo mutant strain MGI:4362199 Kdm4c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924054 Kdm4c lysine (K)-specific demethylase 4C https://www.infrafrontier.eu/search?keyword=EM:12083 - EM:09733 C57BL/6NTac-Kdm4c/WtsiH EMMA sperm mutant strain MGI:5633774 Kdm4c targeted mutation 1, Wellcome Trust Sanger Institute MGI:1924054 Kdm4c lysine (K)-specific demethylase 4C https://www.infrafrontier.eu/search?keyword=EM:09733 + EM:11316 C57BL/6NTac-Kctd17/H EMMA sperm C57BL/6N-Kctd17/H mutant strain MGI:6149895 Kctd17 endonuclease mediated mutation 2, Harwell MGI:2146317 Kctd17 potassium channel tetramerisation domain containing 17 https://www.infrafrontier.eu/search?keyword=EM:11316 + EM:10781 C57BL/6NTac-Kctd17/H EMMA sperm mutant strain MGI:6144262 Kctd17 endonuclease mediated mutation 1, Harwell MGI:2146317 Kctd17 potassium channel tetramerisation domain containing 17 https://www.infrafrontier.eu/search?keyword=EM:10781 + EM:07689 C57BL/6NTac-Kctd15/IcsOrl EMMA archived mutant strain MGI:4432583 Kctd15 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385276 Kctd15 potassium channel tetramerisation domain containing 15 https://www.infrafrontier.eu/search?keyword=EM:07689 + EM:08514 C57BL/6NTac-Kcnn3/H EMMA sperm mutant strain MGI:4433082 Kcnn3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153183 Kcnn3 potassium intermediate/small conductance calcium-activated channel, subfamily N, member 3 https://www.infrafrontier.eu/search?keyword=EM:08514 + EM:11195 C57BL/6NTac-Kcnk13/H EMMA live mutant strain MGI:5749944 Kcnk13 endonuclease-mediated mutation 2, Harwell MGI:2686531 Kcnk13 potassium channel, subfamily K, member 13 https://www.infrafrontier.eu/search?keyword=EM:11195 + EM:10764 C57BL/6NTac-Kcnk13/H EMMA sperm mutant strain MGI:5749943 Kcnk13 endonuclease-mediated mutation 1, Harwell MGI:2686531 Kcnk13 potassium channel, subfamily K, member 13 https://www.infrafrontier.eu/search?keyword=EM:10764 ? EM:12523 C57BL/6NTac-Kcnj11/H EMMA sperm unclassified MGI:6156348 Kcnj11 endonuclease-mediated mutation 1, Harwell MGI:107501 Kcnj11 potassium inwardly rectifying channel, subfamily J, member 11 https://www.infrafrontier.eu/search?keyword=EM:12523 + EM:08235 C57BL/6NTac-Kcnh4/WtsiPh EMMA sperm mutant strain MGI:4460286 Kcnh4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2156184 Kcnh4 potassium voltage-gated channel, subfamily H (eag-related), member 4 https://www.infrafrontier.eu/search?keyword=EM:08235 + EM:05862 C57BL/6NTac-Kcne2/WtsiH EMMA sperm MCSJ, EPD0156_2_F10 mutant strain MGI:4431909 Kcne2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891123 Kcne2 potassium voltage-gated channel, Isk-related subfamily, gene 2 https://www.infrafrontier.eu/search?keyword=EM:05862 + EM:09508 C57BL/6NTac-Kbtbd2/H EMMA sperm mutant strain MGI:4436648 Kbtbd2 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:2384811 Kbtbd2 kelch repeat and BTB (POZ) domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:09508 + EM:04584 C57BL/6NTac-Jmjd6/Ieg EMMA embryo EPD0158_3_A11 mutant strain MGI:4432550 Jmjd6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858910 Jmjd6 jumonji domain containing 6 https://www.infrafrontier.eu/search?keyword=EM:04584 - EM:09767 C57BL/6NTac-Jchain/WtsiH EMMA sperm mutant strain MGI:5633773 Jchain targeted mutation 1, Wellcome Trust Sanger Institute MGI:96493 Jchain immunoglobulin joining chain https://www.infrafrontier.eu/search?keyword=EM:09767 + EM:07436 C57BL/6NTac-Ivd/Ieg EMMA embryo mutant strain MGI:4436446 Ivd targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1929242 Ivd isovaleryl coenzyme A dehydrogenase https://www.infrafrontier.eu/search?keyword=EM:07436 - EM:09545 C57BL/6NTac-Itih1/WtsiIeg EMMA archived mutant strain MGI:5633771 Itih1 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:96618 Itih1 inter-alpha trypsin inhibitor, heavy chain 1 https://www.infrafrontier.eu/search?keyword=EM:09545 - EM:09550 C57BL/6NTac-Itih1/WtsiIeg EMMA archived mutant strain MGI:5633772 Itih1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:96618 Itih1 inter-alpha trypsin inhibitor, heavy chain 1 https://www.infrafrontier.eu/search?keyword=EM:09550 + EM:07739 C57BL/6NTac-Itgb5/IcsOrl EMMA archived mutant strain MGI:4433020 Itgb5 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:96614 Itgb5 integrin beta 5 https://www.infrafrontier.eu/search?keyword=EM:07739 + EM:12320 C57BL/6NTac-Itgax/Ics EMMA sperm mutant strain Itgax EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:96609 Itgax integrin alpha X https://www.infrafrontier.eu/search?keyword=EM:12320 + EM:12446 C57BL/6NTac-Irx3/H EMMA sperm mutant strain MGI:6155634 Irx3 endonuclease-mediated mutation 2, Harwell MGI:2142650 Irx3 Iroquois related homeobox 3 https://www.infrafrontier.eu/search?keyword=EM:12446 + EM:06341 C57BL/6NTac-Iqce/Ics EMMA embryo mutant strain MGI:4435267 Iqce targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921489 Iqce IQ motif containing E https://www.infrafrontier.eu/search?keyword=EM:06341 + EM:07611 C57BL/6NTac-Ints2/WtsiH EMMA sperm EPD0205_3_C04 mutant strain MGI:4362455 Ints2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917672 Ints2 integrator complex subunit 2 https://www.infrafrontier.eu/search?keyword=EM:07611 + EM:12332 C57BL/6NTac-Insl3/Ics EMMA sperm mutant strain Insl3 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:108427 Insl3 insulin-like 3 https://www.infrafrontier.eu/search?keyword=EM:12332 + EM:10047 C57BL/6NTac-Ins1/WtsiIeg EMMA sperm mutant strain MGI:5633769 Ins1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:96572 Ins1 insulin I https://www.infrafrontier.eu/search?keyword=EM:10047 ? EM:13024 C57BL/6NTac-Inpp5k/H EMMA sperm unclassified MGI:6451583 Inpp5k endonuclease-mediated mutation 3, Harwell MGI:1194899 Inpp5k inositol polyphosphate 5-phosphatase K https://www.infrafrontier.eu/search?keyword=EM:13024 + EM:10016 C57BL/6NTac-Inpp1/WtsiFlmg EMMA sperm mutant strain MGI:4363818 Inpp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104848 Inpp1 inositol polyphosphate-1-phosphatase https://www.infrafrontier.eu/search?keyword=EM:10016 - EM:04025 C57BL/6NTac-Ino80e/Cnrm EMMA embryo mutant strain MGI:4433084 Ino80e targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2141881 Ino80e INO80 complex subunit E https://www.infrafrontier.eu/search?keyword=EM:04025 - EM:04025 C57BL/6NTac-Ino80e/Cnrm EMMA sperm mutant strain MGI:4433084 Ino80e targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2141881 Ino80e INO80 complex subunit E https://www.infrafrontier.eu/search?keyword=EM:04025 + EM:07816 C57BL/6NTac-Ino80/IcsOrl EMMA archived mutant strain MGI:4436542 Ino80 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915392 Ino80 INO80 complex subunit https://www.infrafrontier.eu/search?keyword=EM:07816 + EM:10038 C57BL/6NTac-Il7/WtsiIeg EMMA sperm mutant strain MGI:5633768 Il7 targeted mutation 2, Wellcome Trust Sanger Institute MGI:96561 Il7 interleukin 7 https://www.infrafrontier.eu/search?keyword=EM:10038 + EM:05520 C57BL/6NTac-Il22ra1/WtsiOulu EMMA embryo mutant strain MGI:4431742 Il22ra1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2663588 Il22ra1 interleukin 22 receptor, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:05520 + EM:11397 C57BL/6NTac-Ikbke/Wtsi EMMA embryo mutant strain Ikbke Sanger Institute targeted mutation 1, Wellcome Trust Sanger Institute MGI:2138621 Ikbke inhibitor of kappaB kinase epsilon https://www.infrafrontier.eu/search?keyword=EM:11397 + EM:11397 C57BL/6NTac-Ikbke/Wtsi EMMA sperm mutant strain Ikbke Sanger Institute targeted mutation 1, Wellcome Trust Sanger Institute MGI:2138621 Ikbke inhibitor of kappaB kinase epsilon https://www.infrafrontier.eu/search?keyword=EM:11397 - EM:06359 C57BL/6NTac-Igfbp3/H EMMA sperm mutant strain MGI:4363852 Igfbp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96438 Igfbp3 insulin-like growth factor binding protein 3 https://www.infrafrontier.eu/search?keyword=EM:06359 + EM:07714 C57BL/6NTac-Ift20/IcsOrl EMMA archived mutant strain MGI:4431815 Ift20 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915585 Ift20 intraflagellar transport 20 https://www.infrafrontier.eu/search?keyword=EM:07714 + EM:09158 C57BL/6NTac-Ift140/WtsiPh EMMA archived mutant strain MGI:4363217 Ift140 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2146906 Ift140 intraflagellar transport 140 https://www.infrafrontier.eu/search?keyword=EM:09158 + EM:07822 C57BL/6NTac-Ift122/IcsOrl EMMA archived mutant strain MGI:4432086 Ift122 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1932386 Ift122 intraflagellar transport 122 https://www.infrafrontier.eu/search?keyword=EM:07822 + EM:05803 C57BL/6NTac-Ido1/WtsiCnbc EMMA embryo mutant strain MGI:4432044 Ido1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96416 Ido1 indoleamine 2,3-dioxygenase 1 https://www.infrafrontier.eu/search?keyword=EM:05803 - EM:04551 C57BL/6NTac-Ibsp/Cnrm EMMA embryo mutant strain MGI:4434523 Ibsp targeted mutation 1e, Wellcome Trust Sanger Institute MGI:96389 Ibsp integrin binding sialoprotein https://www.infrafrontier.eu/search?keyword=EM:04551 - EM:04551 C57BL/6NTac-Ibsp/Cnrm EMMA sperm mutant strain MGI:4434523 Ibsp targeted mutation 1e, Wellcome Trust Sanger Institute MGI:96389 Ibsp integrin binding sialoprotein https://www.infrafrontier.eu/search?keyword=EM:04551 - EM:07642 C57BL/6NTac-Iah1/IcsOrl EMMA archived mutant strain MGI:4435023 Iah1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914982 Iah1 isoamyl acetate-hydrolyzing esterase 1 homolog https://www.infrafrontier.eu/search?keyword=EM:07642 + EM:05264 C57BL/6NTac-Hsph1/Cnrm EMMA sperm mutant strain MGI:4431540 Hsph1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105053 Hsph1 heat shock 105kDa/110kDa protein 1 https://www.infrafrontier.eu/search?keyword=EM:05264 + EM:06679 C57BL/6NTac-Hsp90aa1/Wtsi EMMA embryo mutant strain MGI:4364475 Hsp90aa1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:96250 Hsp90aa1 heat shock protein 90, alpha (cytosolic), class A member 1 https://www.infrafrontier.eu/search?keyword=EM:06679 + EM:06679 C57BL/6NTac-Hsp90aa1/Wtsi EMMA sperm mutant strain MGI:4364475 Hsp90aa1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:96250 Hsp90aa1 heat shock protein 90, alpha (cytosolic), class A member 1 https://www.infrafrontier.eu/search?keyword=EM:06679 - EM:04414 C57BL/6NTac-Hsf2bp/Cnrm EMMA embryo mutant strain MGI:4435082 Hsf2bp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921627 Hsf2bp heat shock transcription factor 2 binding protein https://www.infrafrontier.eu/search?keyword=EM:04414 - EM:04414 C57BL/6NTac-Hsf2bp/Cnrm EMMA sperm mutant strain MGI:4435082 Hsf2bp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921627 Hsf2bp heat shock transcription factor 2 binding protein https://www.infrafrontier.eu/search?keyword=EM:04414 + EM:10710 C57BL/6NTac-Hrg/WtsiIeg EMMA archived mutant strain MGI:5633767 Hrg targeted mutation 1, Wellcome Trust Sanger Institute MGI:2146636 Hrg histidine-rich glycoprotein https://www.infrafrontier.eu/search?keyword=EM:10710 - EM:09448 C57BL/6NTac-Hoxa3/Cnrm EMMA sperm mutant strain MGI:5633766 Hoxa3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:96175 Hoxa3 homeobox A3 https://www.infrafrontier.eu/search?keyword=EM:09448 + EM:12333 C57BL/6NTac-Hoxa2/Ics EMMA sperm mutant strain Hoxa2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:96174 Hoxa2 homeobox A2 https://www.infrafrontier.eu/search?keyword=EM:12333 - EM:09551 C57BL/6NTac-Hnf4a/WtsiIeg EMMA archived mutant strain MGI:5632505 Hnf4a targeted mutation 1, Wellcome Trust Sanger Institute MGI:109128 Hnf4a hepatic nuclear factor 4, alpha https://www.infrafrontier.eu/search?keyword=EM:09551 + EM:09688 C57BL/6NTac-Hmox2/H EMMA sperm mutant strain MGI:4434868 Hmox2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109373 Hmox2 heme oxygenase 2 https://www.infrafrontier.eu/search?keyword=EM:09688 + EM:05901 C57BL/6NTac-Hira/WtsiIeg EMMA sperm mutant strain MGI:4431679 Hira targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99430 Hira histone cell cycle regulator https://www.infrafrontier.eu/search?keyword=EM:05901 - EM:05113 C57BL/6NTac-Hipk2/Cnrm EMMA sperm mutant strain MGI:4435696 Hipk2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1314872 Hipk2 homeodomain interacting protein kinase 2 https://www.infrafrontier.eu/search?keyword=EM:05113 + EM:12335 C57BL/6NTac-Hhip/Ics EMMA sperm mutant strain Hhip EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1341847 Hhip Hedgehog-interacting protein https://www.infrafrontier.eu/search?keyword=EM:12335 - EM:08960 C57BL/6NTac-Hes5/Cnrm EMMA sperm mutant strain MGI:5632504 Hes5 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:104876 Hes5 hes family bHLH transcription factor 5 https://www.infrafrontier.eu/search?keyword=EM:08960 + EM:04583 C57BL/6NTac-Hells/Ieg EMMA embryo EPD0102_4_A04 mutant strain MGI:4431905 Hells targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106209 Hells helicase, lymphoid specific https://www.infrafrontier.eu/search?keyword=EM:04583 + EM:08688 C57BL/6NTac-Heatr6/Wtsi EMMA embryo mutant strain MGI:4364452 Heatr6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919790 Heatr6 HEAT repeat containing 6 https://www.infrafrontier.eu/search?keyword=EM:08688 + EM:08688 C57BL/6NTac-Heatr6/Wtsi EMMA sperm mutant strain MGI:4364452 Heatr6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919790 Heatr6 HEAT repeat containing 6 https://www.infrafrontier.eu/search?keyword=EM:08688 + EM:07726 C57BL/6NTac-Heatr3/IcsOrl EMMA archived mutant strain MGI:4435825 Heatr3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444491 Heatr3 HEAT repeat containing 3 https://www.infrafrontier.eu/search?keyword=EM:07726 + EM:10703 C57BL/6NTac-Hdc/WtsiIeg EMMA archived mutant strain MGI:5632502 Hdc targeted mutation 2, Wellcome Trust Sanger Institute MGI:96062 Hdc histidine decarboxylase https://www.infrafrontier.eu/search?keyword=EM:10703 + EM:05717 C57BL/6NTac-Hdac8/WtsiBiat EMMA sperm mutant strain MGI:4432268 Hdac8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917565 Hdac8 histone deacetylase 8 https://www.infrafrontier.eu/search?keyword=EM:05717 + EM:07737 C57BL/6NTac-Hcn4/IcsOrl EMMA archived mutant strain MGI:4435096 Hcn4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1298209 Hcn4 hyperpolarization-activated, cyclic nucleotide-gated K+ 4 https://www.infrafrontier.eu/search?keyword=EM:07737 + EM:11725 C57BL/6NTac-Hcn1/H EMMA live mutant strain MGI:6149894 Hcn1 endonuclease mediated mutation 2, Harwell MGI:1096392 Hcn1 hyperpolarization activated cyclic nucleotide gated potassium channel 1 https://www.infrafrontier.eu/search?keyword=EM:11725 + EM:11420 C57BL/6NTac-Hcn1/H EMMA sperm mutant strain MGI:6153798 Hcn1 endonuclease-mediated mutation 1, Harwell MGI:1096392 Hcn1 hyperpolarization activated cyclic nucleotide gated potassium channel 1 https://www.infrafrontier.eu/search?keyword=EM:11420 + EM:11420 C57BL/6NTac-Hcn1/H EMMA live mutant strain MGI:6153798 Hcn1 endonuclease-mediated mutation 1, Harwell MGI:1096392 Hcn1 hyperpolarization activated cyclic nucleotide gated potassium channel 1 https://www.infrafrontier.eu/search?keyword=EM:11420 + EM:06532 C57BL/6NTac-Hacl1/Wtsi EMMA embryo mutant strain MGI:4362181 Hacl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929657 Hacl1 2-hydroxyacyl-CoA lyase 1 https://www.infrafrontier.eu/search?keyword=EM:06532 + EM:06532 C57BL/6NTac-Hacl1/Wtsi EMMA sperm mutant strain MGI:4362181 Hacl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929657 Hacl1 2-hydroxyacyl-CoA lyase 1 https://www.infrafrontier.eu/search?keyword=EM:06532 + EM:07643 C57BL/6NTac-H6pd/IcsOrl EMMA archived mutant strain MGI:4432827 H6pd targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2140356 H6pd hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase) https://www.infrafrontier.eu/search?keyword=EM:07643 + EM:09981 C57BL/6NTac-Gzmk/IcsOrl EMMA sperm mutant strain MGI:4362377 Gzmk targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1298232 Gzmk granzyme K https://www.infrafrontier.eu/search?keyword=EM:09981 + EM:11261 C57BL/6NTac-Gtpbp3/WtsiPh EMMA sperm mutant strain MGI:4364401 Gtpbp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917609 Gtpbp3 GTP binding protein 3 https://www.infrafrontier.eu/search?keyword=EM:11261 + EM:10194 C57BL/6NTac-Gtf2h2/WtsiCnrm EMMA sperm mutant strain MGI:4432932 Gtf2h2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1345669 Gtf2h2 general transcription factor II H, polypeptide 2 https://www.infrafrontier.eu/search?keyword=EM:10194 + EM:06551 C57BL/6NTac-Gtf2a1/Wtsi EMMA embryo mutant strain MGI:4363802 Gtf2a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933277 Gtf2a1 general transcription factor II A, 1 https://www.infrafrontier.eu/search?keyword=EM:06551 + EM:06551 C57BL/6NTac-Gtf2a1/Wtsi EMMA sperm mutant strain MGI:4363802 Gtf2a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933277 Gtf2a1 general transcription factor II A, 1 https://www.infrafrontier.eu/search?keyword=EM:06551 + EM:05490 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA embryo C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285396 Gt(ROSA)26Sor targeted mutation 2, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:05490 + EM:05490 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA sperm C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285396 Gt(ROSA)26Sor targeted mutation 2, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:05490 + EM:05490 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA live C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285396 Gt(ROSA)26Sor targeted mutation 2, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:05490 + EM:11220 C57BL/6NTac-Gt(ROSA)26Sor/WtsiIeg EMMA archived mutant strain Gt(ROSA)26Sor EUCOMM targeted mutation 1, Wellcome Trust Sanger Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11220 + EM:05488 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA embryo C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285392 Gt(ROSA)26Sor targeted mutation 1, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:05488 + EM:05488 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA sperm C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285392 Gt(ROSA)26Sor targeted mutation 1, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:05488 + EM:05488 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA live C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285392 Gt(ROSA)26Sor targeted mutation 1, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:05488 + EM:09604 C57BL/6NTac-Gsdme/WtsiOulu EMMA embryo mutant strain MGI:4363231 Gsdme targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3703053 Gsdme gasdermin E https://www.infrafrontier.eu/search?keyword=EM:09604 + EM:09604 C57BL/6NTac-Gsdme/WtsiOulu EMMA sperm mutant strain MGI:4363231 Gsdme targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3703053 Gsdme gasdermin E https://www.infrafrontier.eu/search?keyword=EM:09604 + EM:10838 C57BL/6NTac-Grp/H EMMA live Grp-DEL483INS5-EM2-B6N Grp-DEL483INS5-EM2-B6N, C57BL/6N-Grp/H, H-Grp-DEL483INS5-EM2-B6N (IMPC) mutant strain MGI:5749871 Grp endonuclease-mediated mutation 2, Harwell MGI:95833 Grp gastrin releasing peptide https://www.infrafrontier.eu/search?keyword=EM:10838 + EM:10765 C57BL/6NTac-Grp/H EMMA sperm C57BL/6N-Grp/H, Grp-DEL2DEL396-EM1-B6N mutant strain MGI:5749869 Grp endonuclease-mediated mutation 1, Harwell MGI:95833 Grp gastrin releasing peptide https://www.infrafrontier.eu/search?keyword=EM:10765 + EM:11317 C57BL/6NTac-Grm7/H EMMA sperm mutant strain MGI:6149200 Grm7 endonuclease mediated mutation 1, Harwell MGI:1351344 Grm7 glutamate receptor, metabotropic 7 https://www.infrafrontier.eu/search?keyword=EM:11317 + EM:12463 C57BL/6NTac-Grm1/H EMMA sperm mutant strain MGI:6266821 Grm1 endonuclease-mediated mutation 2, Harwell MGI:1351338 Grm1 glutamate receptor, metabotropic 1 https://www.infrafrontier.eu/search?keyword=EM:12463 ? EM:12530 C57BL/6NTac-Grm1/H EMMA sperm unclassified MGI:6451428 Grm1 endonuclease-mediated mutation 1, Harwell MGI:1351338 Grm1 glutamate receptor, metabotropic 1 https://www.infrafrontier.eu/search?keyword=EM:12530 - EM:09776 C57BL/6NTac-Grin2c/WtsiH EMMA sperm mutant strain MGI:5632501 Grin2c targeted mutation 1, Wellcome Trust Sanger Institute MGI:95822 Grin2c glutamate receptor, ionotropic, NMDA2C (epsilon 3) https://www.infrafrontier.eu/search?keyword=EM:09776 + EM:07681 C57BL/6NTac-Grhl3/IcsOrl EMMA sperm mutant strain MGI:4433681 Grhl3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2655333 Grhl3 grainyhead like transcription factor 3 https://www.infrafrontier.eu/search?keyword=EM:07681 - EM:08948 C57BL/6NTac-Gpx3/WtsiH EMMA sperm mutant strain MGI:5632499 Gpx3 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:105102 Gpx3 glutathione peroxidase 3 https://www.infrafrontier.eu/search?keyword=EM:08948 - EM:08854 C57BL/6NTac-Gpx3/WtsiH EMMA sperm mutant strain MGI:5632500 Gpx3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:105102 Gpx3 glutathione peroxidase 3 https://www.infrafrontier.eu/search?keyword=EM:08854 + EM:12378 C57BL/6NTac-Gprin1/H EMMA sperm mutant strain MGI:6153795 Gprin1 endonuclease-mediated mutation 1, Harwell MGI:1349455 Gprin1 G protein-regulated inducer of neurite outgrowth 1 https://www.infrafrontier.eu/search?keyword=EM:12378 + EM:10175 C57BL/6NTac-Gpr88/Cnrm EMMA sperm mutant strain MGI:5811828 Gpr88 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1927653 Gpr88 G-protein coupled receptor 88 https://www.infrafrontier.eu/search?keyword=EM:10175 + EM:11307 C57BL/6NTac-Gnl3/WtsiOrl EMMA sperm mutant strain Gnl3 Sanger Institute targeted mutation 1, Wellcome Trust Sanger Institute MGI:2387185 Gnl3 guanine nucleotide binding protein-like 3 (nucleolar) https://www.infrafrontier.eu/search?keyword=EM:11307 + EM:12308 C57BL/6NTac-Gngt2/Ics EMMA sperm mutant strain Gngt2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:893584 Gngt2 guanine nucleotide binding protein (G protein), gamma transducing activity polypeptide 2 https://www.infrafrontier.eu/search?keyword=EM:12308 - EM:09778 C57BL/6NTac-Gng7/WtsiH EMMA sperm mutant strain MGI:5632498 Gng7 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95787 Gng7 guanine nucleotide binding protein (G protein), gamma 7 https://www.infrafrontier.eu/search?keyword=EM:09778 + EM:10716 C57BL/6NTac-Gng4/WtsiIeg EMMA archived mutant strain MGI:5660016 Gng4 targeted mutation 2, Wellcome Trust Sanger Institute MGI:102703 Gng4 guanine nucleotide binding protein (G protein), gamma 4 https://www.infrafrontier.eu/search?keyword=EM:10716 + EM:12372 C57BL/6NTac-Gng11/H EMMA sperm mutant strain MGI:6153855 Gng11 endonuclease-mediated mutation 1, Harwell MGI:1913316 Gng11 guanine nucleotide binding protein (G protein), gamma 11 https://www.infrafrontier.eu/search?keyword=EM:12372 + EM:10758 C57BL/6NTac-Gnb4/H EMMA sperm C57BL/6N-Gnb4/H, GNB4-DEL617-EM1-B6N, C57BL/6N-Gnb4/H mutant strain MGI:5755155 Gnb4 endonuclease-mediated mutation 1, Harwell MGI:104581 Gnb4 guanine nucleotide binding protein (G protein), beta 4 https://www.infrafrontier.eu/search?keyword=EM:10758 - EM:08855 C57BL/6NTac-Gnai2/WtsiH EMMA sperm mutant strain MGI:5632497 Gnai2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95772 Gnai2 guanine nucleotide binding protein (G protein), alpha inhibiting 2 https://www.infrafrontier.eu/search?keyword=EM:08855 + EM:10091 C57BL/6NTac-Gnai1/WtsiIeg EMMA archived mutant strain MGI:5632496 Gnai1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:95771 Gnai1 guanine nucleotide binding protein (G protein), alpha inhibiting 1 https://www.infrafrontier.eu/search?keyword=EM:10091 - EM:04385 C57BL/6NTac-Gna11/Cnrm EMMA embryo mutant strain MGI:4432307 Gna11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95766 Gna11 guanine nucleotide binding protein, alpha 11 https://www.infrafrontier.eu/search?keyword=EM:04385 - EM:04385 C57BL/6NTac-Gna11/Cnrm EMMA sperm mutant strain MGI:4432307 Gna11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95766 Gna11 guanine nucleotide binding protein, alpha 11 https://www.infrafrontier.eu/search?keyword=EM:04385 + EM:07710 C57BL/6NTac-Gmfg/IcsOrl EMMA sperm mutant strain MGI:4434689 Gmfg targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1927135 Gmfg glia maturation factor, gamma https://www.infrafrontier.eu/search?keyword=EM:07710 + EM:09706 C57BL/6NTac-Gmds/WtsiIeg EMMA archived mutant strain MGI:4363597 Gmds targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891112 Gmds GDP-mannose 4, 6-dehydratase https://www.infrafrontier.eu/search?keyword=EM:09706 + EM:08391 C57BL/6NTac-Gm5544/WtsiOrl EMMA archived mutant strain MGI:4364386 Gm5544 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3648209 Gm5544 predicted gene 5544 https://www.infrafrontier.eu/search?keyword=EM:08391 + EM:04485 C57BL/6NTac-Gm5134/H EMMA sperm mutant strain MGI:4435240 Gm5134 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3646667 Gm5134 predicted gene 5134 https://www.infrafrontier.eu/search?keyword=EM:04485 - EM:08143 C57BL/6NTac-Gm16379/WtsiCnrm EMMA sperm C57BL/6NTac-Mif-ps6/WtsiCnrm mutant strain MGI:4364434 Mif-ps6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3647120 Mif-ps6 macrophage migration inhibitory factor, pseudogene 6 https://www.infrafrontier.eu/search?keyword=EM:08143 + EM:06207 C57BL/6NTac-Gm12258/Ics EMMA embryo mutant strain MGI:4436398 Gm12258 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3651534 Gm12258 predicted gene 12258 https://www.infrafrontier.eu/search?keyword=EM:06207 + EM:06621 C57BL/6NTac-Glt8d2/Wtsi EMMA embryo mutant strain MGI:4364018 Glt8d2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922032 Glt8d2 glycosyltransferase 8 domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:06621 + EM:06621 C57BL/6NTac-Glt8d2/Wtsi EMMA sperm mutant strain MGI:4364018 Glt8d2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922032 Glt8d2 glycosyltransferase 8 domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:06621 + EM:09800 C57BL/6NTac-Glra4/Wtsi EMMA embryo mutant strain MGI:4363311 Glra4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95750 Glra4 glycine receptor, alpha 4 subunit https://www.infrafrontier.eu/search?keyword=EM:09800 + EM:09800 C57BL/6NTac-Glra4/Wtsi EMMA sperm mutant strain MGI:4363311 Glra4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95750 Glra4 glycine receptor, alpha 4 subunit https://www.infrafrontier.eu/search?keyword=EM:09800 ? EM:12534 C57BL/6NTac-Gldc/H EMMA sperm unclassified MGI:6451426 Gldc endonuclease-mediated mutation 1, Harwell MGI:1341155 Gldc glycine decarboxylase https://www.infrafrontier.eu/search?keyword=EM:12534 + EM:08261 C57BL/6NTac-Gimap6/WtsiPh EMMA sperm mutant strain MGI:4364125 Gimap6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918876 Gimap6 GTPase, IMAP family member 6 https://www.infrafrontier.eu/search?keyword=EM:08261 + EM:04434 C57BL/6NTac-Ggt1/H EMMA sperm EPD0183_3_C02, GGT1-B6N-USA mutant strain MGI:4432621 Ggt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95706 Ggt1 gamma-glutamyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:04434 + EM:07321 C57BL/6NTac-Gfpt1/H EMMA sperm mutant strain MGI:4431600 Gfpt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95698 Gfpt1 glutamine fructose-6-phosphate transaminase 1 https://www.infrafrontier.eu/search?keyword=EM:07321 + EM:05706 C57BL/6NTac-Gfm1/WtsiBiat EMMA archived mutant strain MGI:4432285 Gfm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107339 Gfm1 G elongation factor, mitochondrial 1 https://www.infrafrontier.eu/search?keyword=EM:05706 + EM:06985 C57BL/6NTac-Gfi1b/H EMMA sperm mutant strain MGI:4434882 Gfi1b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1276578 Gfi1b growth factor independent 1B https://www.infrafrontier.eu/search?keyword=EM:06985 + EM:12291 C57BL/6NTac-Gdf9/Ics EMMA sperm mutant strain Gdf9 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:95692 Gdf9 growth differentiation factor 9 https://www.infrafrontier.eu/search?keyword=EM:12291 + EM:10851 C57BL/6NTac-Gcsh/H EMMA sperm mutant strain MGI:6153793 Gcsh endonuclease-mediated mutation 1, Harwell MGI:1915663 Gcsh glycine cleavage system protein H (aminomethyl carrier) https://www.infrafrontier.eu/search?keyword=EM:10851 + EM:05085 C57BL/6NTac-Gclc/WtsiCnbc EMMA embryo mutant strain MGI:4432329 Gclc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104990 Gclc glutamate-cysteine ligase, catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:05085 - EM:11645 C57BL/6NTac-Gckr/H EMMA live mutant strain MGI:6149159 Gckr endonuclease mediated mutation 2, Harwell MGI:1096345 Gckr glucokinase regulatory protein https://www.infrafrontier.eu/search?keyword=EM:11645 - EM:11406 C57BL/6NTac-Gckr/H EMMA live mutant strain MGI:6149158 Gckr endonuclease mediated mutation 1, Harwell MGI:1096345 Gckr glucokinase regulatory protein https://www.infrafrontier.eu/search?keyword=EM:11406 + EM:11373 C57BL/6NTac-Gck/H EMMA sperm mutant strain MGI:6149199 Gck endonuclease mediated mutation 1, Harwell MGI:1270854 Gck glucokinase https://www.infrafrontier.eu/search?keyword=EM:11373 + EM:10030 C57BL/6NTac-Gchfr/WtsiIeg EMMA archived mutant strain MGI:5632495 Gchfr targeted mutation 2, Wellcome Trust Sanger Institute MGI:2443977 Gchfr GTP cyclohydrolase I feedback regulator https://www.infrafrontier.eu/search?keyword=EM:10030 + EM:05385 C57BL/6NTac-Gba2/WtsiCnbc EMMA embryo mutant strain MGI:4433071 Gba2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2654325 Gba2 glucosidase beta 2 https://www.infrafrontier.eu/search?keyword=EM:05385 + EM:06283 C57BL/6NTac-Gatm/Ieg EMMA embryo mutant strain MGI:4362557 Gatm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914342 Gatm glycine amidinotransferase (L-arginine:glycine amidinotransferase) https://www.infrafrontier.eu/search?keyword=EM:06283 + EM:10059 C57BL/6NTac-Gata2/WtsiIeg EMMA sperm mutant strain MGI:5632494 Gata2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95662 Gata2 GATA binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:10059 - EM:09552 C57BL/6NTac-Gast/WtsiIeg EMMA archived mutant strain MGI:5632493 Gast targeted mutation 1, Wellcome Trust Sanger Institute MGI:104768 Gast gastrin https://www.infrafrontier.eu/search?keyword=EM:09552 + EM:12329 C57BL/6NTac-Gas2/Ics EMMA sperm mutant strain Gas2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:95657 Gas2 growth arrest specific 2 https://www.infrafrontier.eu/search?keyword=EM:12329 + EM:07676 C57BL/6NTac-Gar1/IcsOrl EMMA archived mutant strain MGI:4432700 Gar1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1930948 Gar1 GAR1 ribonucleoprotein https://www.infrafrontier.eu/search?keyword=EM:07676 - EM:09770 C57BL/6NTac-Gap43/WtsiH EMMA sperm mutant strain MGI:5632492 Gap43 targeted mutation 2, Wellcome Trust Sanger Institute MGI:95639 Gap43 growth associated protein 43 https://www.infrafrontier.eu/search?keyword=EM:09770 + EM:08941 C57BL/6NTac-Galntl5/WtsiOulu EMMA embryo mutant strain MGI:4363889 Galntl5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915159 Galntl5 UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase-like 5 https://www.infrafrontier.eu/search?keyword=EM:08941 + EM:08941 C57BL/6NTac-Galntl5/WtsiOulu EMMA sperm mutant strain MGI:4363889 Galntl5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915159 Galntl5 UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase-like 5 https://www.infrafrontier.eu/search?keyword=EM:08941 + EM:08238 C57BL/6NTac-Galk2/Ieg EMMA sperm mutant strain MGI:4435970 Galk2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917226 Galk2 galactokinase 2 https://www.infrafrontier.eu/search?keyword=EM:08238 + EM:12467 C57BL/6NTac-Gabra2/H EMMA sperm mutant strain MGI:6149191 Gabra2 endonuclease mediated mutation 1, Harwell MGI:95614 Gabra2 gamma-aminobutyric acid (GABA) A receptor, subunit alpha 2 https://www.infrafrontier.eu/search?keyword=EM:12467 + EM:06406 C57BL/6NTac-Fxyd3/Wtsi EMMA embryo mutant strain MGI:4362906 Fxyd3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107497 Fxyd3 FXYD domain-containing ion transport regulator 3 https://www.infrafrontier.eu/search?keyword=EM:06406 + EM:06406 C57BL/6NTac-Fxyd3/Wtsi EMMA sperm mutant strain MGI:4362906 Fxyd3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107497 Fxyd3 FXYD domain-containing ion transport regulator 3 https://www.infrafrontier.eu/search?keyword=EM:06406 - EM:04412 C57BL/6NTac-Furin/Cnrm EMMA embryo mutant strain MGI:4434157 Furin targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97513 Furin furin (paired basic amino acid cleaving enzyme) https://www.infrafrontier.eu/search?keyword=EM:04412 - EM:04412 C57BL/6NTac-Furin/Cnrm EMMA sperm mutant strain MGI:4434157 Furin targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97513 Furin furin (paired basic amino acid cleaving enzyme) https://www.infrafrontier.eu/search?keyword=EM:04412 - EM:09765 C57BL/6NTac-Fto/WtsiH EMMA sperm mutant strain MGI:5632490 Fto targeted mutation 1, Wellcome Trust Sanger Institute MGI:1347093 Fto fat mass and obesity associated https://www.infrafrontier.eu/search?keyword=EM:09765 + EM:10770 C57BL/6NTac-Frmd6/H EMMA archived mutant strain MGI:6149190 Frmd6 endonuclease mediated mutation 1, Harwell MGI:2145018 Frmd6 FERM domain containing 6 https://www.infrafrontier.eu/search?keyword=EM:10770 + EM:07719 C57BL/6NTac-Fpgs/IcsOrl EMMA archived mutant strain MGI:4435288 Fpgs targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:95576 Fpgs folylpolyglutamyl synthetase https://www.infrafrontier.eu/search?keyword=EM:07719 + EM:07713 C57BL/6NTac-Flot2/IcsOrl EMMA archived mutant strain MGI:4433811 Flot2 targeted mutation 2e, Wellcome Trust Sanger Institute MGI:103309 Flot2 flotillin 2 https://www.infrafrontier.eu/search?keyword=EM:07713 - EM:07725 C57BL/6NTac-Fkbp9/IcsOrl EMMA archived mutant strain MGI:4435917 Fkbp9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1350921 Fkbp9 FK506 binding protein 9 https://www.infrafrontier.eu/search?keyword=EM:07725 + EM:07823 C57BL/6NTac-Fkbp10/IcsOrl EMMA archived mutant strain MGI:5432211 Fkbp10 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:104769 Fkbp10 FK506 binding protein 10 https://www.infrafrontier.eu/search?keyword=EM:07823 + EM:11667 C57BL/6NTac-Filip1/Wtsi EMMA embryo mutant strain MGI:6406758 Filip1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1917848 Filip1 filamin A interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:11667 + EM:11667 C57BL/6NTac-Filip1/Wtsi EMMA sperm mutant strain MGI:6406758 Filip1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1917848 Filip1 filamin A interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:11667 - EM:07970 C57BL/6NTac-Fgf9/H EMMA sperm C57BL/6N-Fgf9/H mutant strain MGI:4364690 Fgf9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104723 Fgf9 fibroblast growth factor 9 https://www.infrafrontier.eu/search?keyword=EM:07970 - EM:08180 C57BL/6NTac-Fgf2/H EMMA sperm C57BL/6N-Fgf2/H mutant strain MGI:4433040 Fgf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95516 Fgf2 fibroblast growth factor 2 https://www.infrafrontier.eu/search?keyword=EM:08180 - EM:04411 C57BL/6NTac-Fgf11/Cnrm EMMA embryo mutant strain MGI:4432799 Fgf11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109167 Fgf11 fibroblast growth factor 11 https://www.infrafrontier.eu/search?keyword=EM:04411 - EM:04411 C57BL/6NTac-Fgf11/Cnrm EMMA sperm mutant strain MGI:4432799 Fgf11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109167 Fgf11 fibroblast growth factor 11 https://www.infrafrontier.eu/search?keyword=EM:04411 - EM:09735 C57BL/6NTac-Fga/WtsiH EMMA sperm mutant strain MGI:5632489 Fga targeted mutation 2, Wellcome Trust Sanger Institute MGI:1316726 Fga fibrinogen alpha chain https://www.infrafrontier.eu/search?keyword=EM:09735 + EM:11125 C57BL/6NTac-Fcgr1/WtsiH EMMA sperm mutant strain MGI:5660015 Fcgr1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95498 Fcgr1 Fc receptor, IgG, high affinity I https://www.infrafrontier.eu/search?keyword=EM:11125 + EM:07208 C57BL/6NTac-Fbxo33/WtsiCnrm EMMA sperm mutant strain MGI:4432600 Fbxo33 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917861 Fbxo33 F-box protein 33 https://www.infrafrontier.eu/search?keyword=EM:07208 + EM:10990 C57BL/6NTac-Fam71b/WtsiPh EMMA sperm mutant strain MGI:4364165 Fam71b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3650836 Fam71b family with sequence similarity 71, member B https://www.infrafrontier.eu/search?keyword=EM:10990 - EM:04359 C57BL/6NTac-Fam234b/Cnrm EMMA embryo mutant strain MGI:4432729 Fam234b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921775 Fam234b family with sequence similarity 234, member B https://www.infrafrontier.eu/search?keyword=EM:04359 - EM:04359 C57BL/6NTac-Fam234b/Cnrm EMMA sperm mutant strain MGI:4432729 Fam234b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921775 Fam234b family with sequence similarity 234, member B https://www.infrafrontier.eu/search?keyword=EM:04359 - EM:04544 C57BL/6NTac-Fam110b/Cnrm EMMA embryo mutant strain MGI:4432846 Fam110b targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1916593 Fam110b family with sequence similarity 110, member B https://www.infrafrontier.eu/search?keyword=EM:04544 - EM:04544 C57BL/6NTac-Fam110b/Cnrm EMMA sperm mutant strain MGI:4432846 Fam110b targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1916593 Fam110b family with sequence similarity 110, member B https://www.infrafrontier.eu/search?keyword=EM:04544 + EM:06090 C57BL/6NTac-Fahd2a/WtsiCnbc EMMA sperm mutant strain MGI:4431777 Fahd2a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915376 Fahd2a fumarylacetoacetate hydrolase domain containing 2A https://www.infrafrontier.eu/search?keyword=EM:06090 + EM:12360 C57BL/6NTac-Fabp7/H EMMA sperm mutant strain MGI:6153790 Fabp7 endonuclease-mediated mutation 1, Harwell MGI:101916 Fabp7 fatty acid binding protein 7, brain https://www.infrafrontier.eu/search?keyword=EM:12360 + EM:07665 C57BL/6NTac-Fabp3/IcsOrl EMMA sperm mutant strain MGI:4431873 Fabp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95476 Fabp3 fatty acid binding protein 3, muscle and heart https://www.infrafrontier.eu/search?keyword=EM:07665 + EM:09830 C57BL/6NTac-Fabp1/Cnrm EMMA sperm C57BL/6NTac-Fabp1/Cnrm mutant strain MGI:5660005 Fabp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95479 Fabp1 fatty acid binding protein 1, liver https://www.infrafrontier.eu/search?keyword=EM:09830 + EM:07648 C57BL/6NTac-Fabp12/IcsOrl EMMA archived mutant strain MGI:4433784 Fabp12 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922747 Fabp12 fatty acid binding protein 12 https://www.infrafrontier.eu/search?keyword=EM:07648 + EM:05974 C57BL/6NTac-Ezr/WtsiBiat EMMA sperm mutant strain MGI:4431855 Ezr targeted mutation 2a, Wellcome Trust Sanger Institute MGI:98931 Ezr ezrin https://www.infrafrontier.eu/search?keyword=EM:05974 + EM:05698 C57BL/6NTac-Ezh2/WtsiIeg EMMA sperm mutant strain MGI:4432638 Ezh2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107940 Ezh2 enhancer of zeste 2 polycomb repressive complex 2 subunit https://www.infrafrontier.eu/search?keyword=EM:05698 + EM:08714 C57BL/6NTac-Ethe1/H EMMA sperm mutant strain MGI:4432299 Ethe1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913321 Ethe1 ethylmalonic encephalopathy 1 https://www.infrafrontier.eu/search?keyword=EM:08714 + EM:12259 C57BL/6NTac-Ermn/H EMMA sperm mutant strain MGI:6153851 Ermn endonuclease-mediated mutation 1, Harwell MGI:1925017 Ermn ermin, ERM-like protein https://www.infrafrontier.eu/search?keyword=EM:12259 + EM:09757 C57BL/6NTac-Epx/WtsiH EMMA sperm C57BL/6NTac-Epx/WtsiH mutant strain MGI:5660003 Epx targeted mutation 1, Wellcome Trust Sanger Institute MGI:107569 Epx eosinophil peroxidase https://www.infrafrontier.eu/search?keyword=EM:09757 + EM:07716 C57BL/6NTac-Ephx1/IcsOrl EMMA sperm mutant strain MGI:4434687 Ephx1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:95405 Ephx1 epoxide hydrolase 1, microsomal https://www.infrafrontier.eu/search?keyword=EM:07716 - EM:05198 C57BL/6NTac-Epc2/Ieg EMMA embryo mutant strain MGI:4431957 Epc2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1278321 Epc2 enhancer of polycomb homolog 2 https://www.infrafrontier.eu/search?keyword=EM:05198 - EM:08971 C57BL/6NTac-Eomes/Cnrm EMMA sperm mutant strain MGI:5632488 Eomes targeted mutation 1, Wellcome Trust Sanger Institute MGI:1201683 Eomes eomesodermin https://www.infrafrontier.eu/search?keyword=EM:08971 + EM:11983 C57BL/6NTac-Entpd6/Wtsi EMMA embryo mutant strain MGI:4363445 Entpd6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202295 Entpd6 ectonucleoside triphosphate diphosphohydrolase 6 https://www.infrafrontier.eu/search?keyword=EM:11983 + EM:11983 C57BL/6NTac-Entpd6/Wtsi EMMA sperm mutant strain MGI:4363445 Entpd6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202295 Entpd6 ectonucleoside triphosphate diphosphohydrolase 6 https://www.infrafrontier.eu/search?keyword=EM:11983 - EM:08963 C57BL/6NTac-Entpd5/Cnrm EMMA sperm mutant strain MGI:5632487 Entpd5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1321385 Entpd5 ectonucleoside triphosphate diphosphohydrolase 5 https://www.infrafrontier.eu/search?keyword=EM:08963 + EM:08727 C57BL/6NTac-Enpep/Ieg EMMA sperm mutant strain MGI:4363369 Enpep targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106645 Enpep glutamyl aminopeptidase https://www.infrafrontier.eu/search?keyword=EM:08727 - EM:04384 C57BL/6NTac-Emid1/Cnrm EMMA embryo mutant strain MGI:4433762 Emid1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2155091 Emid1 EMI domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:04384 - EM:04384 C57BL/6NTac-Emid1/Cnrm EMMA sperm mutant strain MGI:4433762 Emid1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2155091 Emid1 EMI domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:04384 + EM:09951 C57BL/6NTac-Elapor1/IcsOrl EMMA archived C57BL/6NTac-5330417C22Rik/IcsOrl mutant strain MGI:4436415 Elapor1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923930 Elapor1 endosome-lysosome associated apoptosis and autophagy regulator 1 https://www.infrafrontier.eu/search?keyword=EM:09951 + EM:05966 C57BL/6NTac-Elac2/WtsiBiat EMMA sperm mutant strain MGI:4456058 Elac2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1890496 Elac2 elaC ribonuclease Z 2 https://www.infrafrontier.eu/search?keyword=EM:05966 + EM:07702 C57BL/6NTac-Eif2b5/IcsOrl EMMA archived mutant strain MGI:4432328 Eif2b5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446176 Eif2b5 eukaryotic translation initiation factor 2B, subunit 5 epsilon https://www.infrafrontier.eu/search?keyword=EM:07702 + EM:12150 C57BL/6NTac-Eif2b2/Wtsi EMMA embryo mutant strain MGI:4364625 Eif2b2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2145118 Eif2b2 eukaryotic translation initiation factor 2B, subunit 2 beta https://www.infrafrontier.eu/search?keyword=EM:12150 + EM:12150 C57BL/6NTac-Eif2b2/Wtsi EMMA sperm mutant strain MGI:4364625 Eif2b2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2145118 Eif2b2 eukaryotic translation initiation factor 2B, subunit 2 beta https://www.infrafrontier.eu/search?keyword=EM:12150 + EM:05712 C57BL/6NTac-Ehd1/WtsiBiat EMMA embryo mutant strain MGI:4432418 Ehd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1341878 Ehd1 EH-domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:05712 + EM:05927 C57BL/6NTac-Efcab11/Cnrm EMMA sperm mutant strain MGI:4434986 Efcab11 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1926017 Efcab11 EF-hand calcium binding domain 11 https://www.infrafrontier.eu/search?keyword=EM:05927 - EM:04570 C57BL/6NTac-Eef2kmt/Cnrm EMMA embryo mutant strain MGI:4433018 Eef2kmt targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1917761 Eef2kmt eukaryotic elongation factor 2 lysine methyltransferase https://www.infrafrontier.eu/search?keyword=EM:04570 - EM:04570 C57BL/6NTac-Eef2kmt/Cnrm EMMA sperm mutant strain MGI:4433018 Eef2kmt targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1917761 Eef2kmt eukaryotic elongation factor 2 lysine methyltransferase https://www.infrafrontier.eu/search?keyword=EM:04570 + EM:07851 C57BL/6NTac-Eef1akmt1/WtsiOrl EMMA sperm C57BL/6NTac-N6amt2/WtsiOrl mutant strain MGI:4431797 Eef1akmt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2145784 Eef1akmt1 EEF1A alpha lysine methyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:07851 + EM:09964 C57BL/6NTac-Ect2/IcsOrl EMMA sperm mutant strain MGI:4433090 Ect2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95281 Ect2 ect2 oncogene https://www.infrafrontier.eu/search?keyword=EM:09964 + EM:05789 C57BL/6NTac-Ears2/WtsiOrl EMMA sperm mutant strain MGI:4432622 Ears2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914667 Ears2 glutamyl-tRNA synthetase 2, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:05789 + EM:05795 C57BL/6NTac-Dusp4/WtsiOrl EMMA sperm mutant strain MGI:4431999 Dusp4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442191 Dusp4 dual specificity phosphatase 4 https://www.infrafrontier.eu/search?keyword=EM:05795 + EM:10346 C57BL/6NTac-Dusp3/WtsiBiat EMMA sperm mutant strain MGI:4820135 Dusp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919599 Dusp3 dual specificity phosphatase 3 (vaccinia virus phosphatase VH1-related) https://www.infrafrontier.eu/search?keyword=EM:10346 + EM:06472 C57BL/6NTac-Dusp26/Wtsi EMMA embryo mutant strain MGI:4363735 Dusp26 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914209 Dusp26 dual specificity phosphatase 26 (putative) https://www.infrafrontier.eu/search?keyword=EM:06472 + EM:12450 C57BL/6NTac-Dtx1/H EMMA sperm mutant strain MGI:6153785 Dtx1 endonuclease-mediated mutation 1, Harwell MGI:1352744 Dtx1 deltex 1, E3 ubiquitin ligase https://www.infrafrontier.eu/search?keyword=EM:12450 + EM:06631 C57BL/6NTac-Dsg1b/Wtsi EMMA embryo mutant strain MGI:4364614 Dsg1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2664357 Dsg1b desmoglein 1 beta https://www.infrafrontier.eu/search?keyword=EM:06631 + EM:06631 C57BL/6NTac-Dsg1b/Wtsi EMMA sperm mutant strain MGI:4364614 Dsg1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2664357 Dsg1b desmoglein 1 beta https://www.infrafrontier.eu/search?keyword=EM:06631 + EM:07821 C57BL/6NTac-Drg2/IcsOrl EMMA archived mutant strain MGI:4432942 Drg2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1342307 Drg2 developmentally regulated GTP binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:07821 + EM:12310 C57BL/6NTac-Drd1/Ics EMMA sperm mutant strain Drd1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:99578 Drd1 dopamine receptor D1 https://www.infrafrontier.eu/search?keyword=EM:12310 + EM:07639 C57BL/6NTac-Dpy19l3/IcsOrl EMMA archived mutant strain MGI:4433660 Dpy19l3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443952 Dpy19l3 dpy-19-like 3 (C. elegans) https://www.infrafrontier.eu/search?keyword=EM:07639 + EM:06531 C57BL/6NTac-Dppa1/Wtsi EMMA embryo mutant strain MGI:4362687 Dppa1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2157522 Dppa1 developmental pluripotency associated 1 https://www.infrafrontier.eu/search?keyword=EM:06531 + EM:06531 C57BL/6NTac-Dppa1/Wtsi EMMA sperm mutant strain MGI:4362687 Dppa1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2157522 Dppa1 developmental pluripotency associated 1 https://www.infrafrontier.eu/search?keyword=EM:06531 + EM:09968 C57BL/6NTac-Dpp4/IcsOrl EMMA sperm mutant strain MGI:4433896 Dpp4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:94919 Dpp4 dipeptidylpeptidase 4 https://www.infrafrontier.eu/search?keyword=EM:09968 + EM:04393 C57BL/6NTac-Dpm2/H EMMA sperm HEPD0510_6_G06 mutant strain MGI:4435371 Dpm2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1330238 Dpm2 dolichol-phosphate (beta-D) mannosyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:04393 - EM:06134 C57BL/6NTac-Dp(7Sult1a1-Spn)7Yah/Orl EMMA sperm mutant strain MGI:6342836 Dp(7Sult1a1-Spn)7Yah duplication, Chr 7, Yann Herault 7 MGI:6342919 Dp(7Sult1a1-Spn)7Yah duplication, Chr 7, Yann Herault 6 https://www.infrafrontier.eu/search?keyword=EM:06134 + EM:05670 C57BL/6NTac-Donson/WtsiH EMMA sperm MAVY, EPD0243_2_A05 mutant strain MGI:4433969 Donson targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1890621 Donson downstream neighbor of SON https://www.infrafrontier.eu/search?keyword=EM:05670 + EM:08389 C57BL/6NTac-Dner/Ieg EMMA archived mutant strain MGI:4435871 Dner targeted mutation 3a, Helmholtz Zentrum Muenchen GmbH MGI:2152889 Dner delta/notch-like EGF repeat containing https://www.infrafrontier.eu/search?keyword=EM:08389 + EM:09691 C57BL/6NTac-Dnase1l2/Wtsi EMMA embryo mutant strain MGI:4362265 Dnase1l2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1913955 Dnase1l2 deoxyribonuclease 1-like 2 https://www.infrafrontier.eu/search?keyword=EM:09691 + EM:09691 C57BL/6NTac-Dnase1l2/Wtsi EMMA sperm mutant strain MGI:4362265 Dnase1l2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1913955 Dnase1l2 deoxyribonuclease 1-like 2 https://www.infrafrontier.eu/search?keyword=EM:09691 + EM:06204 C57BL/6NTac-Dnal4/Ics EMMA embryo mutant strain MGI:4441730 Dnal4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859217 Dnal4 dynein, axonemal, light chain 4 https://www.infrafrontier.eu/search?keyword=EM:06204 + EM:04949 C57BL/6NTac-Dnajc17/Ieg EMMA embryo mutant strain MGI:4434811 Dnajc17 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916658 Dnajc17 DnaJ heat shock protein family (Hsp40) member C17 https://www.infrafrontier.eu/search?keyword=EM:04949 + EM:04535 C57BL/6NTac-Dnajc10/H EMMA sperm HEPD0507_5_B06 mutant strain MGI:4436651 Dnajc10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914111 Dnajc10 DnaJ heat shock protein family (Hsp40) member C10 https://www.infrafrontier.eu/search?keyword=EM:04535 + EM:12330 C57BL/6NTac-Dmrtc2/Ics EMMA sperm mutant strain Dmrtc2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1918491 Dmrtc2 doublesex and mab-3 related transcription factor like family C2 https://www.infrafrontier.eu/search?keyword=EM:12330 - EM:09553 C57BL/6NTac-Dmbx1/WtsiIeg EMMA archived mutant strain MGI:5632486 Dmbx1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2153518 Dmbx1 diencephalon/mesencephalon homeobox 1 https://www.infrafrontier.eu/search?keyword=EM:09553 + EM:04133 C57BL/6NTac-Dlec1/Ieg EMMA embryo EPD0183_3_F08 mutant strain MGI:4432388 Dlec1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443671 Dlec1 deleted in lung and esophageal cancer 1 https://www.infrafrontier.eu/search?keyword=EM:04133 - EM:09543 C57BL/6NTac-Dkk3/WtsiIeg EMMA archived mutant strain MGI:5632485 Dkk3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1354952 Dkk3 dickkopf WNT signaling pathway inhibitor 3 https://www.infrafrontier.eu/search?keyword=EM:09543 + EM:09710 C57BL/6NTac-Dipk1a/WtsiPh EMMA sperm C57BL/6NTac-Fam69a/WtsiPh mutant strain MGI:5548321 Dipk1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914516 Dipk1a divergent protein kinase domain 1A https://www.infrafrontier.eu/search?keyword=EM:09710 + EM:06604 C57BL/6NTac-Dhrs2/Wtsi EMMA embryo mutant strain MGI:4364555 Dhrs2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918662 Dhrs2 dehydrogenase/reductase member 2 https://www.infrafrontier.eu/search?keyword=EM:06604 + EM:06604 C57BL/6NTac-Dhrs2/Wtsi EMMA sperm mutant strain MGI:4364555 Dhrs2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918662 Dhrs2 dehydrogenase/reductase member 2 https://www.infrafrontier.eu/search?keyword=EM:06604 + EM:08729 C57BL/6NTac-Dhdds/Ieg EMMA sperm mutant strain MGI:4362250 Dhdds targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914672 Dhdds dehydrodolichyl diphosphate synthase https://www.infrafrontier.eu/search?keyword=EM:08729 - EM:08171 C57BL/6NTac-Denr/WtsiOrl EMMA archived mutant strain MGI:4451332 Denr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915434 Denr density-regulated protein https://www.infrafrontier.eu/search?keyword=EM:08171 - EM:06133 C57BL/6NTac-Del(7Sult1a1-Spn)6Yah/Orl EMMA sperm mutant strain MGI:6342834 Del(7Sult1a1-Spn)6Yah deletion, Chr 7, Yann Herault 6 MGI:6342918 Del(7Sult1a1-Spn)6Yah deletion, Chr 7, Yann Herault 6 https://www.infrafrontier.eu/search?keyword=EM:06133 + EM:07728 C57BL/6NTac-Ddx52/IcsOrl EMMA archived mutant strain MGI:4434081 Ddx52 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1925644 Ddx52 DExD box helicase 52 https://www.infrafrontier.eu/search?keyword=EM:07728 - EM:05109 C57BL/6NTac-Ddx43/Cnrm EMMA sperm mutant strain MGI:4433882 Ddx43 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3642857 Ddx43 DEAD box helicase 43 https://www.infrafrontier.eu/search?keyword=EM:05109 + EM:06620 C57BL/6NTac-Ddhd1/Wtsi EMMA embryo mutant strain MGI:4362938 Ddhd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2150302 Ddhd1 DDHD domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:06620 + EM:06620 C57BL/6NTac-Ddhd1/Wtsi EMMA sperm mutant strain MGI:4362938 Ddhd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2150302 Ddhd1 DDHD domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:06620 + EM:05962 C57BL/6NTac-Dcx/WtsiBiat EMMA sperm mutant strain MGI:4441970 Dcx targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1277171 Dcx doublecortin https://www.infrafrontier.eu/search?keyword=EM:05962 + EM:09711 C57BL/6NTac-Dclk1/WtsiOrl EMMA archived mutant strain MGI:5543459 Dclk1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1330861 Dclk1 doublecortin-like kinase 1 https://www.infrafrontier.eu/search?keyword=EM:09711 + EM:08380 C57BL/6NTac-Dcbld2/WtsiPh EMMA sperm mutant strain MGI:4363322 Dcbld2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920629 Dcbld2 discoidin, CUB and LCCL domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:08380 - EM:09560 C57BL/6NTac-Dbx1/WtsiIeg EMMA archived mutant strain MGI:5632484 Dbx1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:94867 Dbx1 developing brain homeobox 1 https://www.infrafrontier.eu/search?keyword=EM:09560 + EM:12309 C57BL/6NTac-Dbi/Ics EMMA sperm mutant strain Dbi EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:94865 Dbi diazepam binding inhibitor https://www.infrafrontier.eu/search?keyword=EM:12309 + EM:06677 C57BL/6NTac-Dars2/Wtsi EMMA embryo mutant strain MGI:4362200 Dars2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442510 Dars2 aspartyl-tRNA synthetase 2 (mitochondrial) https://www.infrafrontier.eu/search?keyword=EM:06677 + EM:06677 C57BL/6NTac-Dars2/Wtsi EMMA sperm mutant strain MGI:4362200 Dars2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442510 Dars2 aspartyl-tRNA synthetase 2 (mitochondrial) https://www.infrafrontier.eu/search?keyword=EM:06677 + EM:06844 C57BL/6NTac-Dapk2/WtsiCnrm EMMA sperm mutant strain MGI:4434345 Dapk2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1341297 Dapk2 death-associated protein kinase 2 https://www.infrafrontier.eu/search?keyword=EM:06844 + EM:06356 C57BL/6NTac-Dapk1/H EMMA sperm mutant strain MGI:4435674 Dapk1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916885 Dapk1 death associated protein kinase 1 https://www.infrafrontier.eu/search?keyword=EM:06356 + EM:10084 C57BL/6NTac-Dagla/WtsiIeg EMMA archived mutant strain MGI:5632483 Dagla targeted mutation 1, Wellcome Trust Sanger Institute MGI:2677061 Dagla diacylglycerol lipase, alpha https://www.infrafrontier.eu/search?keyword=EM:10084 + EM:12323 C57BL/6NTac-D130043K22Rik/Ics EMMA sperm mutant strain D130043K22Rik EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:3036268 D130043K22Rik RIKEN cDNA D130043K22 gene https://www.infrafrontier.eu/search?keyword=EM:12323 + EM:08705 C57BL/6NTac-Cyp4f16/H EMMA sperm mutant strain MGI:4364137 Cyp4f16 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917351 Cyp4f16 cytochrome P450, family 4, subfamily f, polypeptide 16 https://www.infrafrontier.eu/search?keyword=EM:08705 + EM:08718 C57BL/6NTac-Cyp4b1/Ieg EMMA embryo C57BL/6NTac-Cyp4b1tm1a(KOMP)Wtsi/Ieg mutant strain MGI:4364022 Cyp4b1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:103225 Cyp4b1 cytochrome P450, family 4, subfamily b, polypeptide 1 https://www.infrafrontier.eu/search?keyword=EM:08718 - EM:09537 C57BL/6NTac-Cyp1a1/Cnrm EMMA sperm mutant strain MGI:5632482 Cyp1a1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:88588 Cyp1a1 cytochrome P450, family 1, subfamily a, polypeptide 1 https://www.infrafrontier.eu/search?keyword=EM:09537 + EM:12013 C57BL/6NTac-Cybc1/Wtsi EMMA embryo mutant strain MGI:4363837 Cybc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384959 Cybc1 cytochrome b 245 chaperone 1 https://www.infrafrontier.eu/search?keyword=EM:12013 + EM:12013 C57BL/6NTac-Cybc1/Wtsi EMMA sperm mutant strain MGI:4363837 Cybc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384959 Cybc1 cytochrome b 245 chaperone 1 https://www.infrafrontier.eu/search?keyword=EM:12013 + EM:09709 C57BL/6NTac-Cxcr1/WtsiPh EMMA sperm mutant strain MGI:5497392 Cxcr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2448715 Cxcr1 chemokine (C-X-C motif) receptor 1 https://www.infrafrontier.eu/search?keyword=EM:09709 ? EM:12524 C57BL/6NTac-Cx3cl1/H EMMA sperm unclassified MGI:6451422 Cx3cl1 endonuclease-mediated mutation 1, Harwell MGI:1097153 Cx3cl1 chemokine (C-X3-C motif) ligand 1 https://www.infrafrontier.eu/search?keyword=EM:12524 - EM:09771 C57BL/6NTac-Ctsq/WtsiH EMMA sperm mutant strain MGI:5632481 Ctsq targeted mutation 1, Wellcome Trust Sanger Institute MGI:2137385 Ctsq cathepsin Q https://www.infrafrontier.eu/search?keyword=EM:09771 + EM:10223 C57BL/6NTac-Ctsq/Cnrm EMMA embryo mutant strain MGI:5632481 Ctsq targeted mutation 1, Wellcome Trust Sanger Institute MGI:2137385 Ctsq cathepsin Q https://www.infrafrontier.eu/search?keyword=EM:10223 + EM:10223 C57BL/6NTac-Ctsq/Cnrm EMMA sperm mutant strain MGI:5632481 Ctsq targeted mutation 1, Wellcome Trust Sanger Institute MGI:2137385 Ctsq cathepsin Q https://www.infrafrontier.eu/search?keyword=EM:10223 + EM:06216 C57BL/6NTac-Ctsd/Ics EMMA embryo mutant strain MGI:4433100 Ctsd targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88562 Ctsd cathepsin D https://www.infrafrontier.eu/search?keyword=EM:06216 + EM:12640 C57BL/6NTac-Ctsa/H EMMA live mutant strain MGI:4435627 Ctsa targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2139179 Ctsa cathepsin A https://www.infrafrontier.eu/search?keyword=EM:12640 + EM:07024 C57BL/6NTac-Ctr9/WtsiOulu EMMA embryo mutant strain MGI:4433989 Ctr9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109345 Ctr9 CTR9 homolog, Paf1/RNA polymerase II complex component https://www.infrafrontier.eu/search?keyword=EM:07024 + EM:07024 C57BL/6NTac-Ctr9/WtsiOulu EMMA sperm mutant strain MGI:4433989 Ctr9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109345 Ctr9 CTR9 homolog, Paf1/RNA polymerase II complex component https://www.infrafrontier.eu/search?keyword=EM:07024 + EM:08586 C57BL/6NTac-Cth/Ieg EMMA sperm mutant strain MGI:5435787 Cth targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1339968 Cth cystathionase (cystathionine gamma-lyase) https://www.infrafrontier.eu/search?keyword=EM:08586 - EM:09739 C57BL/6NTac-Csn1s2a/WtsiH EMMA sperm mutant strain MGI:5632480 Csn1s2a targeted mutation 1, Wellcome Trust Sanger Institute MGI:88542 Csn1s2a casein alpha s2-like A https://www.infrafrontier.eu/search?keyword=EM:09739 - EM:09554 C57BL/6NTac-Csk/WtsiIeg EMMA archived mutant strain MGI:5632479 Csk targeted mutation 1, Wellcome Trust Sanger Institute MGI:88537 Csk c-src tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:09554 - EM:09766 C57BL/6NTac-Crym/WtsiH EMMA sperm mutant strain MGI:5632478 Crym targeted mutation 1, Wellcome Trust Sanger Institute MGI:102675 Crym crystallin, mu https://www.infrafrontier.eu/search?keyword=EM:09766 - EM:09736 C57BL/6NTac-Crygd/WtsiH EMMA sperm mutant strain MGI:5632477 Crygd targeted mutation 2, Wellcome Trust Sanger Institute MGI:88524 Crygd crystallin, gamma D https://www.infrafrontier.eu/search?keyword=EM:09736 + EM:10051 C57BL/6NTac-Crygb/WtsiIeg EMMA archived mutant strain MGI:5632476 Crygb targeted mutation 2, Wellcome Trust Sanger Institute MGI:88522 Crygb crystallin, gamma B https://www.infrafrontier.eu/search?keyword=EM:10051 + EM:10704 C57BL/6NTac-Cryga/WtsiIeg EMMA archived mutant strain MGI:5632475 Cryga targeted mutation 2, Wellcome Trust Sanger Institute MGI:88521 Cryga crystallin, gamma A https://www.infrafrontier.eu/search?keyword=EM:10704 + EM:10763 C57BL/6NTac-Cry1/H EMMA live mutant strain MGI:5755154 Cry1 endonuclease-mediated mutation 1, Harwell MGI:2143771 Cry1 cryptochrome 1 (photolyase-like) https://www.infrafrontier.eu/search?keyword=EM:10763 + EM:10014 C57BL/6NTac-Crlf3/WtsiFlmg EMMA sperm mutant strain MGI:4363171 Crlf3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1860086 Crlf3 cytokine receptor-like factor 3 https://www.infrafrontier.eu/search?keyword=EM:10014 + EM:10713 C57BL/6NTac-Crisp3/WtsiIeg EMMA archived mutant strain MGI:5632474 Crisp3 targeted mutation 2, Wellcome Trust Sanger Institute MGI:102552 Crisp3 cysteine-rich secretory protein 3 https://www.infrafrontier.eu/search?keyword=EM:10713 - EM:08170 C57BL/6NTac-Cracdl/WtsiOrl EMMA archived mutant strain MGI:4364312 Cracdl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919347 Cracdl capping protein inhibiting regulator of actin like https://www.infrafrontier.eu/search?keyword=EM:08170 + EM:08052 C57BL/6NTac-Cpt2/WtsiBiat EMMA sperm mutant strain MGI:4362863 Cpt2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109176 Cpt2 carnitine palmitoyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:08052 + EM:10778 C57BL/6NTac-Cps1/H EMMA sperm C57BL/6N-Cps1/H mutant strain MGI:6144263 Cps1 endonuclease mediated mutation 1, Harwell MGI:3036229 Cps1 carbamoyl-phosphate synthetase 1 https://www.infrafrontier.eu/search?keyword=EM:10778 - EM:08849 C57BL/6NTac-Cpne6/WtsiH EMMA sperm mutant strain MGI:5632472 Cpne6 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1334445 Cpne6 copine VI https://www.infrafrontier.eu/search?keyword=EM:08849 - EM:08861 C57BL/6NTac-Cpne6/WtsiH EMMA sperm mutant strain MGI:5632473 Cpne6 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1334445 Cpne6 copine VI https://www.infrafrontier.eu/search?keyword=EM:08861 - EM:04002 C57BL/6NTac-Cpeb4/Cnrm EMMA sperm mutant strain MGI:4434181 Cpeb4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914829 Cpeb4 cytoplasmic polyadenylation element binding protein 4 https://www.infrafrontier.eu/search?keyword=EM:04002 + EM:05349 C57BL/6NTac-Cpa2/Ieg EMMA embryo mutant strain MGI:4436075 Cpa2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3617840 Cpa2 carboxypeptidase A2, pancreatic https://www.infrafrontier.eu/search?keyword=EM:05349 + EM:12312 C57BL/6NTac-Corin/Ics EMMA sperm mutant strain Corin EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1349451 Corin corin, serine peptidase https://www.infrafrontier.eu/search?keyword=EM:12312 + EM:12131 C57BL/6NTac-Coq9/Wtsi EMMA embryo mutant strain MGI:4362815 Coq9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915164 Coq9 coenzyme Q9 https://www.infrafrontier.eu/search?keyword=EM:12131 + EM:12131 C57BL/6NTac-Coq9/Wtsi EMMA sperm mutant strain MGI:4362815 Coq9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915164 Coq9 coenzyme Q9 https://www.infrafrontier.eu/search?keyword=EM:12131 + EM:09952 C57BL/6NTac-Coq6/IcsOrl EMMA sperm mutant strain MGI:4435820 Coq6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924408 Coq6 coenzyme Q6 monooxygenase https://www.infrafrontier.eu/search?keyword=EM:09952 + EM:07680 C57BL/6NTac-Cops4/IcsOrl EMMA sperm mutant strain MGI:4435445 Cops4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1349414 Cops4 COP9 signalosome subunit 4 https://www.infrafrontier.eu/search?keyword=EM:07680 + EM:06775 C57BL/6NTac-Copg1/WtsiH EMMA sperm EPD0102_1_D08, MCGY mutant strain MGI:4432009 Copg1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858696 Copg1 coatomer protein complex, subunit gamma 1 https://www.infrafrontier.eu/search?keyword=EM:06775 + EM:09482 C57BL/6NTac-Commd9/H EMMA sperm mutant strain MGI:4365175 Commd9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923751 Commd9 COMM domain containing 9 https://www.infrafrontier.eu/search?keyword=EM:09482 + EM:07703 C57BL/6NTac-Col5a1/IcsOrl EMMA archived mutant strain MGI:4435753 Col5a1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88457 Col5a1 collagen, type V, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:07703 - EM:04732 C57BL/6NTac-Col4a5/Cnrm EMMA embryo mutant strain MGI:4432414 Col4a5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88456 Col4a5 collagen, type IV, alpha 5 https://www.infrafrontier.eu/search?keyword=EM:04732 - EM:04732 C57BL/6NTac-Col4a5/Cnrm EMMA sperm mutant strain MGI:4432414 Col4a5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88456 Col4a5 collagen, type IV, alpha 5 https://www.infrafrontier.eu/search?keyword=EM:04732 + EM:12376 C57BL/6NTac-Col4a4/H EMMA sperm mutant strain MGI:6153784 Col4a4 endonuclease-mediated mutation 1, Harwell MGI:104687 Col4a4 collagen, type IV, alpha 4 https://www.infrafrontier.eu/search?keyword=EM:12376 + EM:08609 C57BL/6NTac-Col24a1/WtsiH EMMA sperm mutant strain MGI:4433574 Col24a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918605 Col24a1 collagen, type XXIV, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:08609 + EM:11402 C57BL/6NTac-Cntnap2/H EMMA live mutant strain MGI:6149219 Cntnap2 endonuclease mediated mutation 2, Harwell MGI:1914047 Cntnap2 contactin associated protein-like 2 https://www.infrafrontier.eu/search?keyword=EM:11402 + EM:11408 C57BL/6NTac-Cntnap2/H EMMA sperm mutant strain MGI:6153781 Cntnap2 endonuclease-mediated mutation 1, Harwell MGI:1914047 Cntnap2 contactin associated protein-like 2 https://www.infrafrontier.eu/search?keyword=EM:11408 + EM:09950 C57BL/6NTac-Cntnap1/IcsOrl EMMA sperm mutant strain MGI:4431603 Cntnap1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858201 Cntnap1 contactin associated protein-like 1 https://www.infrafrontier.eu/search?keyword=EM:09950 + EM:10965 C57BL/6NTac-Cnp/H EMMA sperm C57BL/6NTac-Cnptm1a(EUCOMM)Wtsi/H mutant strain MGI:4433004 Cnp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88437 Cnp 2',3'-cyclic nucleotide 3' phosphodiesterase https://www.infrafrontier.eu/search?keyword=EM:10965 - EM:09548 C57BL/6NTac-Cnp/WtsiIeg EMMA archived mutant strain MGI:5632471 Cnp targeted mutation 1, Wellcome Trust Sanger Institute MGI:88437 Cnp 2',3'-cyclic nucleotide 3' phosphodiesterase https://www.infrafrontier.eu/search?keyword=EM:09548 + EM:05872 C57BL/6NTac-Cnot9/WtsiH EMMA sperm EPD0156_3_A07, MCWG, C57BL/6NTac-Rqcd1/WtsiH mutant strain MGI:4431867 Cnot9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2138295 Cnot9 CCR4-NOT transcription complex, subunit 9 https://www.infrafrontier.eu/search?keyword=EM:05872 + EM:12040 C57BL/6NTac-Cnot6/Wtsi EMMA embryo mutant strain MGI:4451305 Cnot6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144529 Cnot6 CCR4-NOT transcription complex, subunit 6 https://www.infrafrontier.eu/search?keyword=EM:12040 + EM:12040 C57BL/6NTac-Cnot6/Wtsi EMMA sperm mutant strain MGI:4451305 Cnot6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144529 Cnot6 CCR4-NOT transcription complex, subunit 6 https://www.infrafrontier.eu/search?keyword=EM:12040 - EM:09762 C57BL/6NTac-Cmtm5/WtsiH EMMA sperm mutant strain MGI:5632412 Cmtm5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2447164 Cmtm5 CKLF-like MARVEL transmembrane domain containing 5 https://www.infrafrontier.eu/search?keyword=EM:09762 + EM:07704 C57BL/6NTac-Clk1/IcsOrl EMMA archived mutant strain MGI:4432186 Clk1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107403 Clk1 CDC-like kinase 1 https://www.infrafrontier.eu/search?keyword=EM:07704 - EM:08965 C57BL/6NTac-Cldn7/Cnrm EMMA sperm mutant strain MGI:5632404 Cldn7 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1859285 Cldn7 claudin 7 https://www.infrafrontier.eu/search?keyword=EM:08965 + EM:12433 C57BL/6NTac-Cldn3/H EMMA sperm mutant strain MGI:6153848 Cldn3 endonuclease-mediated mutation 1, Harwell MGI:1329044 Cldn3 claudin 3 https://www.infrafrontier.eu/search?keyword=EM:12433 + EM:04395 C57BL/6NTac-Cisd2/H EMMA sperm mutant strain MGI:4434148 Cisd2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914256 Cisd2 CDGSH iron sulfur domain 2 https://www.infrafrontier.eu/search?keyword=EM:04395 + EM:04395 C57BL/6NTac-Cisd2/H EMMA live mutant strain MGI:4434148 Cisd2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914256 Cisd2 CDGSH iron sulfur domain 2 https://www.infrafrontier.eu/search?keyword=EM:04395 + EM:11497 C57BL/6NTac-Cir1/WtsiIeg EMMA archived mutant strain MGI:5577261 Cir1 targeted mutation 3a, Wellcome Trust Sanger Institute MGI:1914185 Cir1 corepressor interacting with RBPJ, 1 https://www.infrafrontier.eu/search?keyword=EM:11497 - EM:04019 C57BL/6NTac-Cidec/Cnrm EMMA sperm mutant strain MGI:4433521 Cidec targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95585 Cidec cell death-inducing DFFA-like effector c https://www.infrafrontier.eu/search?keyword=EM:04019 + EM:12307 C57BL/6NTac-Cidec/Ics EMMA sperm mutant strain Cidec EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:95585 Cidec cell death-inducing DFFA-like effector c https://www.infrafrontier.eu/search?keyword=EM:12307 + EM:12362 C57BL/6NTac-Cib3/H EMMA sperm mutant strain MGI:6153778 Cib3 endonuclease-mediated mutation 1, Harwell MGI:2685953 Cib3 calcium and integrin binding family member 3 https://www.infrafrontier.eu/search?keyword=EM:12362 ? EM:13187 C57BL/6NTac-Churc1/WtsiFlmg EMMA live mutant strain MGI:4441753 Churc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923684 Churc1 churchill domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:13187 + EM:12471 C57BL/6NTac-Chrna5/H EMMA sperm mutant strain MGI:6153777 Chrna5 endonuclease-mediated mutation 1, Harwell MGI:87889 Chrna5 cholinergic receptor, nicotinic, alpha polypeptide 5 https://www.infrafrontier.eu/search?keyword=EM:12471 + EM:07658 C57BL/6NTac-Chrna1/IcsOrl EMMA sperm mutant strain MGI:4435231 Chrna1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:87885 Chrna1 cholinergic receptor, nicotinic, alpha polypeptide 1 (muscle) https://www.infrafrontier.eu/search?keyword=EM:07658 + EM:11314 C57BL/6NTac-Chrdl1/H EMMA live mutant strain MGI:5749866 Chrdl1 endonuclease-mediated mutation 2, Harwell MGI:1933172 Chrdl1 chordin-like 1 https://www.infrafrontier.eu/search?keyword=EM:11314 + EM:10757 C57BL/6NTac-Chrdl1/H EMMA sperm Chrdl1-DEL694-EM1-B6N mutant strain MGI:5749864 Chrdl1 endonuclease-mediated mutation 1, Harwell MGI:1933172 Chrdl1 chordin-like 1 https://www.infrafrontier.eu/search?keyword=EM:10757 + EM:10200 C57BL/6NTac-Chpf/Ieg EMMA sperm mutant strain MGI:4460343 Chpf targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:106576 Chpf chondroitin polymerizing factor https://www.infrafrontier.eu/search?keyword=EM:10200 + EM:10840 C57BL/6NTac-Chodl/H EMMA sperm mutant strain MGI:6149218 Chodl endonuclease mediated mutation 2, Harwell MGI:1920461 Chodl chondrolectin https://www.infrafrontier.eu/search?keyword=EM:10840 + EM:10769 C57BL/6NTac-Chodl/H EMMA sperm H-CHODL-DEL576-EM1-B6N (IMPC), CHODL-DEL576-EM1-B6N, C57BL/6N-Chodl/H mutant strain MGI:5755153 Chodl endonuclease-mediated mutation 1, Harwell MGI:1920461 Chodl chondrolectin https://www.infrafrontier.eu/search?keyword=EM:10769 + EM:07874 C57BL/6NTac-Chmp4c/H EMMA sperm EPD0113_1_B10 mutant strain MGI:4431890 Chmp4c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913621 Chmp4c charged multivesicular body protein 4C https://www.infrafrontier.eu/search?keyword=EM:07874 + EM:10088 C57BL/6NTac-Chgb/WtsiIeg EMMA sperm mutant strain MGI:5632403 Chgb targeted mutation 1, Wellcome Trust Sanger Institute MGI:88395 Chgb chromogranin B https://www.infrafrontier.eu/search?keyword=EM:10088 - EM:09574 C57BL/6NTac-Chga/Cnrm EMMA sperm mutant strain MGI:5632402 Chga targeted mutation 1, Wellcome Trust Sanger Institute MGI:88394 Chga chromogranin A https://www.infrafrontier.eu/search?keyword=EM:09574 + EM:07632 C57BL/6NTac-Cgas/IcsOrl EMMA sperm C57BL/6NTac-Mb21d1/IcsOrl mutant strain MGI:4435548 Cgas targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2442261 Cgas cyclic GMP-AMP synthase https://www.infrafrontier.eu/search?keyword=EM:07632 + EM:10082 C57BL/6NTac-Cga/WtsiIeg EMMA archived mutant strain MGI:5632399 Cga targeted mutation 1, Wellcome Trust Sanger Institute MGI:88390 Cga glycoprotein hormones, alpha subunit https://www.infrafrontier.eu/search?keyword=EM:10082 + EM:11291 C57BL/6NTac-Cfap410/WtsiOrl EMMA archived C57BL/6NTac-1810043G02Rik/WtsiOrl mutant strain MGI:4432613 Cfap410 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915134 Cfap410 cilia and flagella associated protein 410 https://www.infrafrontier.eu/search?keyword=EM:11291 + EM:05669 C57BL/6NTac-Cfap36/WtsiH EMMA sperm EPD0059_1_A09, MBUU, C57BL/6NTac-Ccdc104/WtsiH mutant strain MGI:4433419 Cfap36 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913994 Cfap36 cilia and flagella associated protein 36 https://www.infrafrontier.eu/search?keyword=EM:05669 - EM:09562 C57BL/6NTac-Cfap126/WtsiIeg EMMA archived mutant strain MGI:5632398 Cfap126 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1922722 Cfap126 cilia and flagella associated protein 126 https://www.infrafrontier.eu/search?keyword=EM:09562 + EM:05888 C57BL/6NTac-Cep41/WtsiIeg EMMA sperm mutant strain MGI:4432442 Cep41 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891414 Cep41 centrosomal protein 41 https://www.infrafrontier.eu/search?keyword=EM:05888 ? EM:12526 C57BL/6NTac-Cep290/H EMMA sperm unclassified MGI:6450518 Cep290 endonuclease-mediated mutation 1, Harwell MGI:2384917 Cep290 centrosomal protein 290 https://www.infrafrontier.eu/search?keyword=EM:12526 + EM:08128 C57BL/6NTac-Cenph/Ieg EMMA embryo mutant strain MGI:4436053 Cenph targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1349448 Cenph centromere protein H https://www.infrafrontier.eu/search?keyword=EM:08128 - EM:09456 C57BL/6NTac-Ceacam1/Cnrm EMMA sperm mutant strain MGI:5632397 Ceacam1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1347245 Ceacam1 carcinoembryonic antigen-related cell adhesion molecule 1 https://www.infrafrontier.eu/search?keyword=EM:09456 - EM:08846 C57BL/6NTac-Cdx2/WtsiH EMMA sperm mutant strain MGI:5632396 Cdx2 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:88361 Cdx2 caudal type homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:08846 + EM:09369 C57BL/6NTac-Cdsn/Ieg EMMA embryo mutant strain MGI:4436163 Cdsn targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3505689 Cdsn corneodesmosin https://www.infrafrontier.eu/search?keyword=EM:09369 + EM:06431 C57BL/6NTac-Cdkn2aipnl/Wtsi EMMA embryo mutant strain MGI:4362329 Cdkn2aipnl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1261797 Cdkn2aipnl CDKN2A interacting protein N-terminal like https://www.infrafrontier.eu/search?keyword=EM:06431 + EM:06431 C57BL/6NTac-Cdkn2aipnl/Wtsi EMMA sperm mutant strain MGI:4362329 Cdkn2aipnl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1261797 Cdkn2aipnl CDKN2A interacting protein N-terminal like https://www.infrafrontier.eu/search?keyword=EM:06431 + EM:08637 C57BL/6NTac-Cdk5rap3/Ieg EMMA sperm mutant strain MGI:4435510 Cdk5rap3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1933126 Cdk5rap3 CDK5 regulatory subunit associated protein 3 https://www.infrafrontier.eu/search?keyword=EM:08637 + EM:06725 C57BL/6NTac-Cdk14/Wtsi EMMA embryo mutant strain MGI:4362247 Cdk14 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:894318 Cdk14 cyclin-dependent kinase 14 https://www.infrafrontier.eu/search?keyword=EM:06725 + EM:06725 C57BL/6NTac-Cdk14/Wtsi EMMA sperm mutant strain MGI:4362247 Cdk14 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:894318 Cdk14 cyclin-dependent kinase 14 https://www.infrafrontier.eu/search?keyword=EM:06725 - EM:09322 C57BL/6NTac-Cdh2/Cnrm EMMA sperm mutant strain MGI:5632395 Cdh2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:88355 Cdh2 cadherin 2 https://www.infrafrontier.eu/search?keyword=EM:09322 + EM:10890 C57BL/6NTac-Cdh23/H EMMA sperm mutant strain MGI:5749861 Cdh23 endonuclease-mediated revertant 3, Harwell MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/search?keyword=EM:10890 - EM:09758 C57BL/6NTac-Cdh16/WtsiH EMMA sperm mutant strain MGI:5632394 Cdh16 targeted mutation 1, Wellcome Trust Sanger Institute MGI:106671 Cdh16 cadherin 16 https://www.infrafrontier.eu/search?keyword=EM:09758 + EM:10529 C57BL/6NTac-Cdh13/Ics EMMA live mutant strain MGI:4436162 Cdh13 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99551 Cdh13 cadherin 13 https://www.infrafrontier.eu/search?keyword=EM:10529 + EM:12055 C57BL/6NTac-Cdca8/Wtsi EMMA embryo mutant strain MGI:4362476 Cdca8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1196274 Cdca8 cell division cycle associated 8 https://www.infrafrontier.eu/search?keyword=EM:12055 + EM:06210 C57BL/6NTac-Cdc26/Ics EMMA embryo mutant strain MGI:4436708 Cdc26 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913690 Cdc26 cell division cycle 26 https://www.infrafrontier.eu/search?keyword=EM:06210 - EM:08851 C57BL/6NTac-Cd63/WtsiH EMMA sperm mutant strain MGI:5632393 Cd63 targeted mutation 1, Wellcome Trust Sanger Institute MGI:99529 Cd63 CD63 antigen https://www.infrafrontier.eu/search?keyword=EM:08851 - EM:09153 C57BL/6NTac-Cd4/Cnrm EMMA sperm mutant strain MGI:5632392 Cd4 targeted mutation 2, Wellcome Trust Sanger Institute MGI:88335 Cd4 CD4 antigen https://www.infrafrontier.eu/search?keyword=EM:09153 + EM:12295 C57BL/6NTac-Cd3e/Ics EMMA sperm mutant strain Cd3e EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:88332 Cd3e CD3 antigen, epsilon polypeptide https://www.infrafrontier.eu/search?keyword=EM:12295 + EM:12314 C57BL/6NTac-Cd34/Ics EMMA sperm mutant strain Cd34 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:88329 Cd34 CD34 antigen https://www.infrafrontier.eu/search?keyword=EM:12314 + EM:11981 C57BL/6NTac-Cd300lg/Wtsi EMMA embryo mutant strain MGI:4364847 Cd300lg targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1289168 Cd300lg CD300 molecule like family member G https://www.infrafrontier.eu/search?keyword=EM:11981 + EM:11981 C57BL/6NTac-Cd300lg/Wtsi EMMA sperm mutant strain MGI:4364847 Cd300lg targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1289168 Cd300lg CD300 molecule like family member G https://www.infrafrontier.eu/search?keyword=EM:11981 + EM:06554 C57BL/6NTac-Cd209e/Wtsi EMMA embryo mutant strain MGI:4363909 Cd209e targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2157948 Cd209e CD209e antigen https://www.infrafrontier.eu/search?keyword=EM:06554 + EM:06554 C57BL/6NTac-Cd209e/Wtsi EMMA sperm mutant strain MGI:4363909 Cd209e targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2157948 Cd209e CD209e antigen https://www.infrafrontier.eu/search?keyword=EM:06554 + EM:04396 C57BL/6NTac-Ccnyl1/H EMMA sperm EPD0177_5_F06 mutant strain MGI:4432945 Ccnyl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2138614 Ccnyl1 cyclin Y-like 1 https://www.infrafrontier.eu/search?keyword=EM:04396 - EM:08961 C57BL/6NTac-Ccl25/Cnrm EMMA sperm mutant strain MGI:5632391 Ccl25 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1099448 Ccl25 chemokine (C-C motif) ligand 25 https://www.infrafrontier.eu/search?keyword=EM:08961 + EM:12437 C57BL/6NTac-Cckbr/H EMMA sperm mutant strain MGI:6157678 Cckbr endonuclease-mediated mutation 1, Harwell MGI:99479 Cckbr cholecystokinin B receptor https://www.infrafrontier.eu/search?keyword=EM:12437 + EM:05967 C57BL/6NTac-Ccdc77/WtsiBiat EMMA sperm mutant strain MGI:4432801 Ccdc77 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914450 Ccdc77 coiled-coil domain containing 77 https://www.infrafrontier.eu/search?keyword=EM:05967 + EM:09578 C57BL/6NTac-Ccdc69/WtsiPh EMMA sperm mutant strain MGI:4364083 Ccdc69 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1196234 Ccdc69 coiled-coil domain containing 69 https://www.infrafrontier.eu/search?keyword=EM:09578 + EM:06206 C57BL/6NTac-Ccdc189/Ics EMMA embryo C57BL/6NTac-Gm166/Ics mutant strain MGI:4434616 Ccdc189 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2685012 Ccdc189 coiled-coil domain containing 189 https://www.infrafrontier.eu/search?keyword=EM:06206 + EM:06206 C57BL/6NTac-Ccdc189/Ics EMMA sperm C57BL/6NTac-Gm166/Ics mutant strain MGI:4434616 Ccdc189 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2685012 Ccdc189 coiled-coil domain containing 189 https://www.infrafrontier.eu/search?keyword=EM:06206 + EM:05869 C57BL/6NTac-Ccdc106/WtsiH EMMA sperm MDDT, EPD0177_4_C08 mutant strain MGI:4433912 Ccdc106 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385900 Ccdc106 coiled-coil domain containing 106 https://www.infrafrontier.eu/search?keyword=EM:05869 - EM:08047 C57BL/6NTac-Catip/WtsiBiat EMMA sperm mutant strain MGI:4362227 Catip targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685062 Catip ciliogenesis associated TTC17 interacting protein https://www.infrafrontier.eu/search?keyword=EM:08047 + EM:09985 C57BL/6NTac-Casq1/IcsOrl EMMA sperm mutant strain MGI:4431740 Casq1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1309468 Casq1 calsequestrin 1 https://www.infrafrontier.eu/search?keyword=EM:09985 + EM:05347 C57BL/6NTac-Car4/Ieg EMMA embryo mutant strain MGI:4433993 Car4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1096574 Car4 carbonic anhydrase 4 https://www.infrafrontier.eu/search?keyword=EM:05347 + EM:05381 C57BL/6NTac-Caprin2/WtsiCnbc EMMA embryo mutant strain MGI:4434168 Caprin2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2448541 Caprin2 caprin family member 2 https://www.infrafrontier.eu/search?keyword=EM:05381 - EM:09325 C57BL/6NTac-Capn8/Wtsi EMMA embryo mutant strain MGI:5632390 Capn8 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2181366 Capn8 calpain 8 https://www.infrafrontier.eu/search?keyword=EM:09325 - EM:09325 C57BL/6NTac-Capn8/Wtsi EMMA sperm mutant strain MGI:5632390 Capn8 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2181366 Capn8 calpain 8 https://www.infrafrontier.eu/search?keyword=EM:09325 + EM:04707 C57BL/6NTac-Capn5/H EMMA sperm HEPD0525_1_C12 mutant strain MGI:4436604 Capn5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1100859 Capn5 calpain 5 https://www.infrafrontier.eu/search?keyword=EM:04707 + EM:05552 C57BL/6NTac-Cap2/Ieg EMMA embryo mutant strain MGI:4431970 Cap2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914502 Cap2 CAP, adenylate cyclase-associated protein, 2 (yeast) https://www.infrafrontier.eu/search?keyword=EM:05552 + EM:06091 C57BL/6NTac-Cand2/WtsiCnbc EMMA sperm mutant strain MGI:4432020 Cand2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914338 Cand2 cullin-associated and neddylation-dissociated 2 (putative) https://www.infrafrontier.eu/search?keyword=EM:06091 + EM:07656 C57BL/6NTac-Cacnb4/IcsOrl EMMA sperm mutant strain MGI:4435787 Cacnb4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103301 Cacnb4 calcium channel, voltage-dependent, beta 4 subunit https://www.infrafrontier.eu/search?keyword=EM:07656 + EM:10874 C57BL/6NTac-C4b/H EMMA sperm mutant strain MGI:6144264 C4b endonuclease mediated mutation 1, Harwell MGI:88228 C4b complement component 4B (Chido blood group) https://www.infrafrontier.eu/search?keyword=EM:10874 + EM:11313 C57BL/6NTac-C2cd4a/H EMMA sperm mutant strain MGI:6144266 C2cd4a endonuclease mediated mutation 2, Harwell MGI:3645763 C2cd4a C2 calcium-dependent domain containing 4A https://www.infrafrontier.eu/search?keyword=EM:11313 + EM:10777 C57BL/6NTac-C2cd4a/H EMMA sperm C57BL/6N-C2cd4a/H mutant strain MGI:6144265 C2cd4a endonuclease mediated mutation 1, Harwell MGI:3645763 C2cd4a C2 calcium-dependent domain containing 4A https://www.infrafrontier.eu/search?keyword=EM:10777 + EM:06295 C57BL/6NTac-C1rl/H EMMA sperm mutant strain MGI:4435790 C1rl targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2660692 C1rl complement component 1, r subcomponent-like https://www.infrafrontier.eu/search?keyword=EM:06295 + EM:07819 C57BL/6NTac-C1qbp/IcsOrl EMMA sperm mutant strain MGI:4432129 C1qbp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1194505 C1qbp complement component 1, q subcomponent binding protein https://www.infrafrontier.eu/search?keyword=EM:07819 + EM:12364 C57BL/6NTac-Bud23/H EMMA sperm mutant strain MGI:6153866 Bud23 endonuclease-mediated mutation 2, Harwell MGI:1913388 Bud23 BUD23, rRNA methyltransferase and ribosome maturation factor https://www.infrafrontier.eu/search?keyword=EM:12364 + EM:11730 C57BL/6NTac-Bud23/H EMMA live mutant strain MGI:6149189 Bud23 endonuclease mediated mutation 1, Harwell MGI:1913388 Bud23 BUD23, rRNA methyltransferase and ribosome maturation factor https://www.infrafrontier.eu/search?keyword=EM:11730 + EM:07682 C57BL/6NTac-Btk/IcsOrl EMMA sperm mutant strain MGI:4434935 Btk targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88216 Btk Bruton agammaglobulinemia tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:07682 + EM:07629 C57BL/6NTac-Bspry/IcsOrl EMMA archived mutant strain MGI:4432968 Bspry targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2177191 Bspry B-box and SPRY domain containing https://www.infrafrontier.eu/search?keyword=EM:07629 + EM:11506 C57BL/6NTac-Bscl2/H EMMA sperm mutant strain MGI:6153776 Bscl2 endonuclease-mediated mutation 1, Harwell MGI:1298392 Bscl2 Berardinelli-Seip congenital lipodystrophy 2 (seipin) https://www.infrafrontier.eu/search?keyword=EM:11506 + EM:11506 C57BL/6NTac-Bscl2/H EMMA live mutant strain MGI:6153776 Bscl2 endonuclease-mediated mutation 1, Harwell MGI:1298392 Bscl2 Berardinelli-Seip congenital lipodystrophy 2 (seipin) https://www.infrafrontier.eu/search?keyword=EM:11506 + EM:10179 C57BL/6NTac-Bphl/IcsOrl EMMA sperm mutant strain MGI:4436026 Bphl targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915271 Bphl biphenyl hydrolase-like (serine hydrolase, breast epithelial mucin-associated antigen) https://www.infrafrontier.eu/search?keyword=EM:10179 + EM:10701 C57BL/6NTac-Bpgm/WtsiIeg EMMA archived mutant strain MGI:4363424 Bpgm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098242 Bpgm 2,3-bisphosphoglycerate mutase https://www.infrafrontier.eu/search?keyword=EM:10701 + EM:06075 C57BL/6NTac-Boc/H EMMA sperm mutant strain MGI:4364249 Boc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2151153 Boc biregional cell adhesion molecule-related/down-regulated by oncogenes (Cdon) binding protein https://www.infrafrontier.eu/search?keyword=EM:06075 + EM:07672 C57BL/6NTac-Bmx/IcsOrl EMMA sperm mutant strain MGI:4433142 Bmx targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1101778 Bmx BMX non-receptor tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:07672 + EM:04863 C57BL/6NTac-Bmp7/H EMMA sperm mutant strain MGI:4436150 Bmp7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103302 Bmp7 bone morphogenetic protein 7 https://www.infrafrontier.eu/search?keyword=EM:04863 + EM:08484 C57BL/6NTac-Bivm/WtsiFlmg EMMA sperm mutant strain MGI:5296109 Bivm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2179809 Bivm basic, immunoglobulin-like variable motif containing https://www.infrafrontier.eu/search?keyword=EM:08484 + EM:09819 C57BL/6NTac-Bhlhe40/WtsiPh EMMA sperm mutant strain MGI:4362482 Bhlhe40 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1097714 Bhlhe40 basic helix-loop-helix family, member e40 https://www.infrafrontier.eu/search?keyword=EM:09819 + EM:05360 C57BL/6NTac-Becn1/Cnrm EMMA embryo mutant strain MGI:4362198 Becn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891828 Becn1 beclin 1, autophagy related https://www.infrafrontier.eu/search?keyword=EM:05360 - EM:10772 C57BL/6NTac-Bdkrb1/H EMMA sperm B6N;B6NTac-Bdkrb1/H, C57BL/6N;C57BL/6NTac-Bdkrb1/H mutant strain MGI:6140144 Bdkrb1 endonuclease mediated mutation 1, Harwell MGI:88144 Bdkrb1 bradykinin receptor, beta 1 https://www.infrafrontier.eu/search?keyword=EM:10772 + EM:05866 C57BL/6NTac-Bdh2/WtsiH EMMA sperm EPD0143_2_E05 mutant strain MGI:4433163 Bdh2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917022 Bdh2 3-hydroxybutyrate dehydrogenase, type 2 https://www.infrafrontier.eu/search?keyword=EM:05866 + EM:06028 C57BL/6NTac-Bbs5/H EMMA sperm EPD0227_3_C06 mutant strain MGI:4433255 Bbs5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919819 Bbs5 Bardet-Biedl syndrome 5 (human) https://www.infrafrontier.eu/search?keyword=EM:06028 + EM:11884 C57BL/6NTac-Batf3/WtsiH EMMA sperm mutant strain MGI:6406676 Batf3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1925491 Batf3 basic leucine zipper transcription factor, ATF-like 3 https://www.infrafrontier.eu/search?keyword=EM:11884 - EM:08856 C57BL/6NTac-Barhl1/WtsiH EMMA sperm mutant strain MGI:5632389 Barhl1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1859288 Barhl1 BarH like homeobox 1 https://www.infrafrontier.eu/search?keyword=EM:08856 + EM:08891 C57BL/6NTac-Bap1/WtsiIeg EMMA sperm mutant strain MGI:4436674 Bap1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1206586 Bap1 Brca1 associated protein 1 https://www.infrafrontier.eu/search?keyword=EM:08891 + EM:07678 C57BL/6NTac-Baiap2l2/IcsOrl EMMA archived mutant strain MGI:4435406 Baiap2l2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2652819 Baiap2l2 BAI1-associated protein 2-like 2 https://www.infrafrontier.eu/search?keyword=EM:07678 + EM:07720 C57BL/6NTac-B9d1/IcsOrl EMMA archived mutant strain MGI:4432284 B9d1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1351471 B9d1 B9 protein domain 1 https://www.infrafrontier.eu/search?keyword=EM:07720 + EM:07727 C57BL/6NTac-B4galnt3/IcsOrl EMMA sperm mutant strain MGI:4434237 B4galnt3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3041155 B4galnt3 beta-1,4-N-acetyl-galactosaminyl transferase 3 https://www.infrafrontier.eu/search?keyword=EM:07727 - EM:07103 C57BL/6NTac-B430306N03Rik/Wtsi EMMA embryo mutant strain MGI:4363728 B430306N03Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443478 B430306N03Rik RIKEN cDNA B430306N03 gene https://www.infrafrontier.eu/search?keyword=EM:07103 - EM:07103 C57BL/6NTac-B430306N03Rik/Wtsi EMMA sperm mutant strain MGI:4363728 B430306N03Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443478 B430306N03Rik RIKEN cDNA B430306N03 gene https://www.infrafrontier.eu/search?keyword=EM:07103 + EM:08898 C57BL/6NTac-Atxn3/WtsiPh EMMA sperm mutant strain MGI:4363482 Atxn3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1099442 Atxn3 ataxin 3 https://www.infrafrontier.eu/search?keyword=EM:08898 + EM:05233 C57BL/6NTac-Atpif1/WtsiCnbc EMMA embryo mutant strain MGI:4433166 Atpif1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1196457 Atpif1 ATPase inhibitory factor 1 https://www.infrafrontier.eu/search?keyword=EM:05233 + EM:10675 C57BL/6NTac-Atp9a/Ieg EMMA sperm mutant strain MGI:4460384 Atp9a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1330826 Atp9a ATPase, class II, type 9A https://www.infrafrontier.eu/search?keyword=EM:10675 + EM:12296 C57BL/6NTac-Atp6v1g2/Ics EMMA sperm mutant strain Atp6v1g2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1913487 Atp6v1g2 ATPase, H+ transporting, lysosomal V1 subunit G2 https://www.infrafrontier.eu/search?keyword=EM:12296 + EM:07641 C57BL/6NTac-Atp6v1d/IcsOrl EMMA archived mutant strain MGI:4434885 Atp6v1d targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921084 Atp6v1d ATPase, H+ transporting, lysosomal V1 subunit D https://www.infrafrontier.eu/search?keyword=EM:07641 + EM:10054 C57BL/6NTac-Atp4b/WtsiIeg EMMA archived mutant strain MGI:5632388 Atp4b targeted mutation 2, Wellcome Trust Sanger Institute MGI:88114 Atp4b ATPase, H+/K+ exchanging, beta polypeptide https://www.infrafrontier.eu/search?keyword=EM:10054 + EM:09026 C57BL/6NTac-Atp1a3/H EMMA sperm mutant strain MGI:5438364 Atp1a3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88107 Atp1a3 ATPase, Na+/K+ transporting, alpha 3 polypeptide https://www.infrafrontier.eu/search?keyword=EM:09026 ? EM:13034 C57BL/6NTac-Atp1a3/H EMMA sperm unclassified MGI:6450024 Atp1a3 endonuclease-mediated mutation 3, Harwell MGI:88107 Atp1a3 ATPase, Na+/K+ transporting, alpha 3 polypeptide https://www.infrafrontier.eu/search?keyword=EM:13034 ? EM:13025 C57BL/6NTac-Atp1a3/H EMMA sperm unclassified MGI:6450018 Atp1a3 endonuclease-mediated mutation 1, Harwell MGI:88107 Atp1a3 ATPase, Na+/K+ transporting, alpha 3 polypeptide https://www.infrafrontier.eu/search?keyword=EM:13025 - EM:07362 C57BL/6NTac-Atp11a/Wtsi EMMA embryo mutant strain MGI:4363953 Atp11a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354735 Atp11a ATPase, class VI, type 11A https://www.infrafrontier.eu/search?keyword=EM:07362 - EM:07362 C57BL/6NTac-Atp11a/Wtsi EMMA sperm mutant strain MGI:4363953 Atp11a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354735 Atp11a ATPase, class VI, type 11A https://www.infrafrontier.eu/search?keyword=EM:07362 - EM:04961 C57BL/6NTac-Atg3/Cnrm EMMA sperm mutant strain MGI:4436012 Atg3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915091 Atg3 autophagy related 3 https://www.infrafrontier.eu/search?keyword=EM:04961 + EM:05376 C57BL/6NTac-Atg16l1/WtsiCnbc EMMA embryo mutant strain MGI:4432181 Atg16l1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924290 Atg16l1 autophagy related 16-like 1 (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:05376 + EM:10711 C57BL/6NTac-Atf4/WtsiIeg EMMA archived mutant strain MGI:5659996 Atf4 targeted mutation 1, Wellcome Trust Sanger Institute MGI:88096 Atf4 activating transcription factor 4 https://www.infrafrontier.eu/search?keyword=EM:10711 + EM:09817 C57BL/6NTac-Atad3a/WtsiPh EMMA sperm mutant strain MGI:4364878 Atad3a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919214 Atad3a ATPase family, AAA domain containing 3A https://www.infrafrontier.eu/search?keyword=EM:09817 - EM:03996 C57BL/6NTac-Asxl1/Cnrm EMMA embryo mutant strain MGI:6272013 Asxl1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2684063 Asxl1 ASXL transcriptional regulator 1 https://www.infrafrontier.eu/search?keyword=EM:03996 - EM:03996 C57BL/6NTac-Asxl1/Cnrm EMMA sperm mutant strain MGI:6272013 Asxl1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2684063 Asxl1 ASXL transcriptional regulator 1 https://www.infrafrontier.eu/search?keyword=EM:03996 + EM:07647 C57BL/6NTac-Ascc3/IcsOrl EMMA archived mutant strain MGI:4436301 Ascc3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1925237 Ascc3 activating signal cointegrator 1 complex subunit 3 https://www.infrafrontier.eu/search?keyword=EM:07647 - EM:04548 C57BL/6NTac-Arvcf/Ieg EMMA sperm mutant strain MGI:4432634 Arvcf targeted mutation 1e, Wellcome Trust Sanger Institute MGI:109620 Arvcf armadillo repeat gene deleted in velocardiofacial syndrome https://www.infrafrontier.eu/search?keyword=EM:04548 + EM:09472 C57BL/6NTac-Art4/WtsiH EMMA sperm mutant strain MGI:4363180 Art4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202710 Art4 ADP-ribosyltransferase 4 https://www.infrafrontier.eu/search?keyword=EM:09472 + EM:07635 C57BL/6NTac-Armt1/IcsOrl EMMA archived C57BL/6NTac-1700052N19Rik/IcsOrl mutant strain MGI:4433265 Armt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920669 Armt1 acidic residue methyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:07635 + EM:10792 C57BL/6NTac-Armh4/H EMMA archived 3632451O06RIK-DEL1869-EM2-B6N, C57BL/6NTac-3632451O06Rik/H, C57BL/6NTac-3632451O06Rik/H mutant strain MGI:5749843 Armh4 endonuclease-mediated mutation 2, Harwell MGI:1914669 Armh4 armadillo-like helical domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:10792 + EM:10762 C57BL/6NTac-Armh4/H EMMA archived C57BL/6NTac-3632451O06Rik/H, 3632451O06RIK-DEL1851-EM1-B6N, C57BL/6N-3632451O06Rik/H mutant strain MGI:5749842 Armh4 endonuclease-mediated mutation 1, Harwell MGI:1914669 Armh4 armadillo-like helical domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:10762 + EM:10785 C57BL/6NTac-Arl15/H EMMA live mutant strain MGI:6149188 Arl15 endonuclease mediated mutation 1, Harwell MGI:2442308 Arl15 ADP-ribosylation factor-like 15 https://www.infrafrontier.eu/search?keyword=EM:10785 + EM:11521 C57BL/6NTac-Arhgef9/H EMMA sperm mutant strain MGI:6153845 Arhgef9 endonuclease mediated mutation 1, Harwell MGI:2442233 Arhgef9 CDC42 guanine nucleotide exchange factor (GEF) 9 https://www.infrafrontier.eu/search?keyword=EM:11521 + EM:11521 C57BL/6NTac-Arhgef9/H EMMA live mutant strain MGI:6153845 Arhgef9 endonuclease mediated mutation 1, Harwell MGI:2442233 Arhgef9 CDC42 guanine nucleotide exchange factor (GEF) 9 https://www.infrafrontier.eu/search?keyword=EM:11521 + EM:12046 C57BL/6NTac-Arhgef4/Wtsi EMMA embryo mutant strain MGI:4364388 Arhgef4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442507 Arhgef4 Rho guanine nucleotide exchange factor (GEF) 4 https://www.infrafrontier.eu/search?keyword=EM:12046 + EM:09891 C57BL/6NTac-Arhgef1/WtsiPh EMMA sperm mutant strain MGI:4434048 Arhgef1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353510 Arhgef1 Rho guanine nucleotide exchange factor (GEF) 1 https://www.infrafrontier.eu/search?keyword=EM:09891 + EM:12004 C57BL/6NTac-Arhgap25/Wtsi EMMA embryo mutant strain MGI:4362243 Arhgap25 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443687 Arhgap25 Rho GTPase activating protein 25 https://www.infrafrontier.eu/search?keyword=EM:12004 + EM:12004 C57BL/6NTac-Arhgap25/Wtsi EMMA sperm mutant strain MGI:4362243 Arhgap25 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443687 Arhgap25 Rho GTPase activating protein 25 https://www.infrafrontier.eu/search?keyword=EM:12004 + EM:07808 C57BL/6NTac-Arhgap22/WtsiOrl EMMA archived mutant strain MGI:4363166 Arhgap22 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443418 Arhgap22 Rho GTPase activating protein 22 https://www.infrafrontier.eu/search?keyword=EM:07808 + EM:07675 C57BL/6NTac-Arcn1/IcsOrl EMMA archived mutant strain MGI:4435514 Arcn1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2387591 Arcn1 archain 1 https://www.infrafrontier.eu/search?keyword=EM:07675 - EM:08972 C57BL/6NTac-Aqp3/Cnrm EMMA sperm mutant strain MGI:5632387 Aqp3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1333777 Aqp3 aquaporin 3 https://www.infrafrontier.eu/search?keyword=EM:08972 + EM:09371 C57BL/6NTac-Aqp1/H EMMA sperm mutant strain MGI:4441703 Aqp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:103201 Aqp1 aquaporin 1 https://www.infrafrontier.eu/search?keyword=EM:09371 + EM:06498 C57BL/6NTac-Apool/Wtsi EMMA embryo mutant strain MGI:4364721 Apool targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915367 Apool apolipoprotein O-like https://www.infrafrontier.eu/search?keyword=EM:06498 + EM:06498 C57BL/6NTac-Apool/Wtsi EMMA sperm mutant strain MGI:4364721 Apool targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915367 Apool apolipoprotein O-like https://www.infrafrontier.eu/search?keyword=EM:06498 + EM:07378 C57BL/6NTac-Apip/WtsiH EMMA sperm mutant strain MGI:4441695 Apip targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926788 Apip APAF1 interacting protein https://www.infrafrontier.eu/search?keyword=EM:07378 + EM:10756 C57BL/6NTac-Ap3m2/H EMMA live mutant strain MGI:6149217 Ap3m2 endonuclease mediated mutation 2, Harwell MGI:1923308 Ap3m2 adaptor-related protein complex 3, mu 2 subunit https://www.infrafrontier.eu/search?keyword=EM:10756 - EM:04711 C57BL/6NTac-Ap3m1/Cnrm EMMA embryo mutant strain MGI:4436527 Ap3m1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1929212 Ap3m1 adaptor-related protein complex 3, mu 1 subunit https://www.infrafrontier.eu/search?keyword=EM:04711 - EM:04711 C57BL/6NTac-Ap3m1/Cnrm EMMA sperm mutant strain MGI:4436527 Ap3m1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1929212 Ap3m1 adaptor-related protein complex 3, mu 1 subunit https://www.infrafrontier.eu/search?keyword=EM:04711 + EM:12105 C57BL/6NTac-Anp32e/Wtsi EMMA embryo mutant strain MGI:4451429 Anp32e targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1913721 Anp32e acidic (leucine-rich) nuclear phosphoprotein 32 family, member E https://www.infrafrontier.eu/search?keyword=EM:12105 + EM:08234 C57BL/6NTac-Anks6/WtsiPh EMMA sperm mutant strain MGI:4363754 Anks6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922941 Anks6 ankyrin repeat and sterile alpha motif domain containing 6 https://www.infrafrontier.eu/search?keyword=EM:08234 + EM:06843 C57BL/6NTac-Anapc4/WtsiCnrm EMMA sperm mutant strain MGI:4434153 Anapc4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098673 Anapc4 anaphase promoting complex subunit 4 https://www.infrafrontier.eu/search?keyword=EM:06843 + EM:05895 C57BL/6NTac-Amotl1/WtsiIeg EMMA sperm mutant strain MGI:4433551 Amotl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922973 Amotl1 angiomotin-like 1 https://www.infrafrontier.eu/search?keyword=EM:05895 + EM:12322 C57BL/6NTac-Amhr2/Ics EMMA sperm mutant strain Amhr2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:105062 Amhr2 anti-Mullerian hormone type 2 receptor https://www.infrafrontier.eu/search?keyword=EM:12322 + EM:07351 C57BL/6NTac-Alms1/H EMMA sperm mutant strain MGI:6324160 Alms1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1934606 Alms1 ALMS1, centrosome and basal body associated https://www.infrafrontier.eu/search?keyword=EM:07351 + EM:09931 C57BL/6NTac-Alms1/H EMMA sperm mutant strain MGI:4434567 Alms1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1934606 Alms1 ALMS1, centrosome and basal body associated https://www.infrafrontier.eu/search?keyword=EM:09931 + EM:06670 C57BL/6NTac-Alg13/Wtsi EMMA embryo mutant strain MGI:4841293 Alg13 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914824 Alg13 asparagine-linked glycosylation 13 https://www.infrafrontier.eu/search?keyword=EM:06670 + EM:06670 C57BL/6NTac-Alg13/Wtsi EMMA sperm mutant strain MGI:4841293 Alg13 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914824 Alg13 asparagine-linked glycosylation 13 https://www.infrafrontier.eu/search?keyword=EM:06670 + EM:12327 C57BL/6NTac-Aldoc/Ics EMMA sperm mutant strain Aldoc EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:101863 Aldoc aldolase C, fructose-bisphosphate https://www.infrafrontier.eu/search?keyword=EM:12327 - EM:09506 C57BL/6NTac-Aldh8a1/Cnrm EMMA sperm mutant strain MGI:5632386 Aldh8a1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2653900 Aldh8a1 aldehyde dehydrogenase 8 family, member A1 https://www.infrafrontier.eu/search?keyword=EM:09506 - EM:09117 C57BL/6NTac-Aldh3a2/Cnrm EMMA sperm mutant strain MGI:5632385 Aldh3a2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1353452 Aldh3a2 aldehyde dehydrogenase family 3, subfamily A2 https://www.infrafrontier.eu/search?keyword=EM:09117 + EM:07734 C57BL/6NTac-Aldh3a2/IcsOrl EMMA sperm mutant strain MGI:4432633 Aldh3a2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353452 Aldh3a2 aldehyde dehydrogenase family 3, subfamily A2 https://www.infrafrontier.eu/search?keyword=EM:07734 + EM:08719 C57BL/6NTac-Aldh1l1/Ieg EMMA sperm mutant strain MGI:4364886 Aldh1l1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1340024 Aldh1l1 aldehyde dehydrogenase 1 family, member L1 https://www.infrafrontier.eu/search?keyword=EM:08719 + EM:12025 C57BL/6NTac-Aldh18a1/Wtsi EMMA embryo mutant strain MGI:4363671 Aldh18a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1888908 Aldh18a1 aldehyde dehydrogenase 18 family, member A1 https://www.infrafrontier.eu/search?keyword=EM:12025 + EM:05864 C57BL/6NTac-Aldh16a1/WtsiH EMMA sperm EPD0091_2_D04, MBWA mutant strain MGI:4432547 Aldh16a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916998 Aldh16a1 aldehyde dehydrogenase 16 family, member A1 https://www.infrafrontier.eu/search?keyword=EM:05864 + EM:09874 C57BL/6NTac-Alb/Cnrm EMMA sperm mutant strain MGI:5811675 Alb targeted mutation 2, Wellcome Trust Sanger Institute MGI:87991 Alb albumin https://www.infrafrontier.eu/search?keyword=EM:09874 + EM:07186 C57BL/6NTac-Akt1s1/WtsiH EMMA sperm MEVA, EPD0156_2_A06 mutant strain MGI:4431959 Akt1s1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914855 Akt1s1 AKT1 substrate 1 (proline-rich) https://www.infrafrontier.eu/search?keyword=EM:07186 + EM:12324 C57BL/6NTac-Akr1b7/Ics EMMA sperm mutant strain Akr1b7 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:101918 Akr1b7 aldo-keto reductase family 1, member B7 https://www.infrafrontier.eu/search?keyword=EM:12324 - EM:09556 C57BL/6NTac-Aif1/WtsiIeg EMMA archived mutant strain MGI:5632384 Aif1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1343098 Aif1 allograft inflammatory factor 1 https://www.infrafrontier.eu/search?keyword=EM:09556 - EM:09775 C57BL/6NTac-Afp/WtsiH EMMA sperm mutant strain MGI:5632383 Afp targeted mutation 1, Wellcome Trust Sanger Institute MGI:87951 Afp alpha fetoprotein https://www.infrafrontier.eu/search?keyword=EM:09775 + EM:05099 C57BL/6NTac-Afmid/H EMMA sperm EPD0155_6_A07 mutant strain MGI:4432070 Afmid targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2448704 Afmid arylformamidase https://www.infrafrontier.eu/search?keyword=EM:05099 - EM:07631 C57BL/6NTac-Afm/IcsOrl EMMA sperm mutant strain MGI:4455621 Afm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2429409 Afm afamin https://www.infrafrontier.eu/search?keyword=EM:07631 + EM:05880 C57BL/6NTac-Aff3/WtsiIeg EMMA sperm mutant strain MGI:4434291 Aff3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106927 Aff3 AF4/FMR2 family, member 3 https://www.infrafrontier.eu/search?keyword=EM:05880 + EM:11312 C57BL/6NTac-Adprhl1/H EMMA archived mutant strain MGI:6140150 Adprhl1 endonuclease mediated mutation 2, Harwell MGI:2442168 Adprhl1 ADP-ribosylhydrolase like 1 https://www.infrafrontier.eu/search?keyword=EM:11312 + EM:10875 C57BL/6NTac-Adprhl1/H EMMA live mutant strain MGI:6140149 Adprhl1 endonuclease mediated mutation 1, Harwell MGI:2442168 Adprhl1 ADP-ribosylhydrolase like 1 https://www.infrafrontier.eu/search?keyword=EM:10875 - EM:09507 C57BL/6NTac-Adora2a/Cnrm EMMA sperm mutant strain MGI:5632382 Adora2a targeted mutation 1, Wellcome Trust Sanger Institute MGI:99402 Adora2a adenosine A2a receptor https://www.infrafrontier.eu/search?keyword=EM:09507 + EM:12303 C57BL/6NTac-Adipoq/Ics EMMA sperm mutant strain Adipoq EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:106675 Adipoq adiponectin, C1Q and collagen domain containing https://www.infrafrontier.eu/search?keyword=EM:12303 + EM:07190 C57BL/6NTac-Adgrd1/WtsiCnrm EMMA sperm C57BL/6NTac-Gpr133/WtsiCnrm mutant strain MGI:4432831 Adgrd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3041203 Adgrd1 adhesion G protein-coupled receptor D1 https://www.infrafrontier.eu/search?keyword=EM:07190 + EM:09384 C57BL/6NTac-Adamtsl5/H EMMA sperm mutant strain MGI:5430118 Adamtsl5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913798 Adamtsl5 ADAMTS-like 5 https://www.infrafrontier.eu/search?keyword=EM:09384 + EM:10803 C57BL/6NTac-Adamts16/H EMMA sperm mutant strain MGI:6140145 Adamts16 endonuclease mediated mutation 2, Harwell MGI:2429637 Adamts16 a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 16 https://www.infrafrontier.eu/search?keyword=EM:10803 + EM:10776 C57BL/6NTac-Adamts16/H EMMA sperm mutant strain MGI:6140148 Adamts16 endonuclease mediated mutation 1, Harwell MGI:2429637 Adamts16 a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 16 https://www.infrafrontier.eu/search?keyword=EM:10776 + EM:12297 C57BL/6NTac-Acsm4/Ics EMMA sperm mutant strain Acsm4 EUCOMM targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2681844 Acsm4 acyl-CoA synthetase medium-chain family member 4 https://www.infrafrontier.eu/search?keyword=EM:12297 + EM:09875 C57BL/6NTac-Acox2/Cnrm EMMA sperm mutant strain MGI:5811647 Acox2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1934852 Acox2 acyl-Coenzyme A oxidase 2, branched chain https://www.infrafrontier.eu/search?keyword=EM:09875 + EM:08149 C57BL/6NTac-Acot5/WtsiCnrm EMMA sperm mutant strain MGI:4364061 Acot5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384969 Acot5 acyl-CoA thioesterase 5 https://www.infrafrontier.eu/search?keyword=EM:08149 + EM:07627 C57BL/6NTac-Acap3/IcsOrl EMMA archived mutant strain MGI:4436565 Acap3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2153589 Acap3 ArfGAP with coiled-coil, ankyrin repeat and PH domains 3 https://www.infrafrontier.eu/search?keyword=EM:07627 - EM:08959 C57BL/6NTac-Acan/Cnrm EMMA sperm mutant strain MGI:5632381 Acan targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:99602 Acan aggrecan https://www.infrafrontier.eu/search?keyword=EM:08959 + EM:11311 C57BL/6NTac-Abcc5/H EMMA archived mutant strain MGI:5749846 Abcc5 endonuclease-mediated mutation 2, Harwell MGI:2146379 Abcc5 ATP-binding cassette, sub-family C (CFTR/MRP), member 5 https://www.infrafrontier.eu/search?keyword=EM:11311 + EM:10761 C57BL/6NTac-Abcc5/H EMMA sperm mutant strain MGI:5749845 Abcc5 endonuclease-mediated mutation 1, Harwell MGI:2146379 Abcc5 ATP-binding cassette, sub-family C (CFTR/MRP), member 5 https://www.infrafrontier.eu/search?keyword=EM:10761 + EM:05200 C57BL/6NTac-Abcb11/Ieg EMMA embryo mutant strain MGI:4434682 Abcb11 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1351619 Abcb11 ATP-binding cassette, sub-family B (MDR/TAP), member 11 https://www.infrafrontier.eu/search?keyword=EM:05200 - EM:09555 C57BL/6NTac-A4galt/WtsiIeg EMMA archived mutant strain MGI:5632380 A4galt targeted mutation 1, Wellcome Trust Sanger Institute MGI:3512453 A4galt alpha 1,4-galactosyltransferase https://www.infrafrontier.eu/search?keyword=EM:09555 + EM:07653 C57BL/6NTac-4933430I17Rik/IcsOrl EMMA sperm mutant strain MGI:4432117 4933430I17Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3045314 4933430I17Rik RIKEN cDNA 4933430I17 gene https://www.infrafrontier.eu/search?keyword=EM:07653 + EM:12008 C57BL/6NTac-4932414N04Rik/Wtsi EMMA embryo mutant strain MGI:4364741 4932414N04Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922971 4932414N04Rik RIKEN cDNA 4932414N04 gene https://www.infrafrontier.eu/search?keyword=EM:12008 + EM:12008 C57BL/6NTac-4932414N04Rik/Wtsi EMMA sperm mutant strain MGI:4364741 4932414N04Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922971 4932414N04Rik RIKEN cDNA 4932414N04 gene https://www.infrafrontier.eu/search?keyword=EM:12008 + EM:06470 C57BL/6NTac-4921536K21Rik/Wtsi EMMA embryo mutant strain MGI:4363036 4921536K21Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914680 4921536K21Rik RIKEN cDNA 4921536K21 gene https://www.infrafrontier.eu/search?keyword=EM:06470 + EM:06470 C57BL/6NTac-4921536K21Rik/Wtsi EMMA sperm mutant strain MGI:4363036 4921536K21Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914680 4921536K21Rik RIKEN cDNA 4921536K21 gene https://www.infrafrontier.eu/search?keyword=EM:06470 + EM:05713 C57BL/6NTac-3110001I22Rik/WtsiBiat EMMA embryo mutant strain MGI:4434304 3110001I22Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913848 3110001I22Rik RIKEN cDNA 3110001I22 gene https://www.infrafrontier.eu/search?keyword=EM:05713 + EM:07724 C57BL/6NTac-2900026A02Rik/IcsOrl EMMA archived mutant strain MGI:4435426 2900026A02Rik targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920194 2900026A02Rik RIKEN cDNA 2900026A02 gene https://www.infrafrontier.eu/search?keyword=EM:07724 + EM:04559 C57BL/6NTac-2810408A11Rik/H EMMA sperm EPD0175_1_E10 mutant strain MGI:4431683 2810408A11Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917669 2810408A11Rik RIKEN cDNA 2810408A11 gene https://www.infrafrontier.eu/search?keyword=EM:04559 + EM:12136 C57BL/6NTac-2310057J18Rik/Wtsi EMMA embryo mutant strain MGI:4364593 2310057J18Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914969 2310057J18Rik RIKEN cDNA 2310057J18 gene https://www.infrafrontier.eu/search?keyword=EM:12136 + EM:08745 C57BL/6NTac-1700067K01Rik/WtsiOrl EMMA archived mutant strain MGI:5289829 1700067K01Rik targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1920703 1700067K01Rik RIKEN cDNA 1700067K01 gene https://www.infrafrontier.eu/search?keyword=EM:08745 - EM:08478 C57BL/6NTac-1700001C02Rik/WtsiFlmg EMMA sperm C57BL/6NTac-Fam166c/WtsiFlmg mutant strain MGI:4432273 Fam166c targeted mutation 1a, Wellcome Trust Sanger Institute 1700001C02 1700001C02Rik https://www.infrafrontier.eu/search?keyword=EM:08478 + EM:10873 C57BL/6NTac-1110017D15Rik/H EMMA sperm mutant strain MGI:5749859 1110017D15Rik endonuclease-mediated mutation 2, Harwell MGI:1920971 1110017D15Rik RIKEN cDNA 1110017D15 gene https://www.infrafrontier.eu/search?keyword=EM:10873 + EM:10768 C57BL/6NTac-1110017D15Rik/H EMMA live mutant strain MGI:5749856 1110017D15Rik endonuclease-mediated mutation 1, Harwell MGI:1920971 1110017D15Rik RIKEN cDNA 1110017D15 gene https://www.infrafrontier.eu/search?keyword=EM:10768 + EM:12239 C57BL/6NCrl-Zfp644/Ph EMMA sperm mutant strain MGI:6341848 Zfp644 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1277212 Zfp644 zinc finger protein 644 https://www.infrafrontier.eu/search?keyword=EM:12239 + EM:11532 C57BL/6NCrl-Zfp61/Ieg EMMA sperm mutant strain MGI:6120826 Zfp61 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:99663 Zfp61 zinc finger protein 61 https://www.infrafrontier.eu/search?keyword=EM:11532 + EM:11531 C57BL/6NCrl-Zdhhc5/Ieg EMMA sperm C57BL/6N-Zdhhc5/Ieg mutant strain MGI:6317366 Zdhhc5 targeted mutation 1e.1, Helmholtz Zentrum Muenchen GmbH MGI:1923573 Zdhhc5 zinc finger, DHHC domain containing 5 https://www.infrafrontier.eu/search?keyword=EM:11531 + EM:12543 C57BL/6NCrl-Zc3h12a/Ieg EMMA sperm mutant strain MGI:6220866 Zc3h12a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2385891 Zc3h12a zinc finger CCCH type containing 12A https://www.infrafrontier.eu/search?keyword=EM:12543 + EM:11787 C57BL/6NCrl-Wiz/Ph EMMA sperm mutant strain MGI:6316145 Wiz endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1332638 Wiz widely-interspaced zinc finger motifs https://www.infrafrontier.eu/search?keyword=EM:11787 + EM:09053 C57BL/6NCrl-Wdsub1/Ph EMMA archived mutant strain MGI:5588281 Wdsub1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919387 Wdsub1 WD repeat, SAM and U-box domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:09053 + EM:11684 C57BL/6NCrl-Vgll4/Ieg EMMA sperm mutant strain MGI:6120802 Vgll4 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2652840 Vgll4 vestigial like family member 4 https://www.infrafrontier.eu/search?keyword=EM:11684 + EM:11770 C57BL/6NCrl-Uchl4/Ph EMMA sperm C57BL/6NCrl-Uchl4/Ph mutant strain MGI:6152712 Uchl4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1890440 Uchl4 ubiquitin carboxyl-terminal esterase L4 https://www.infrafrontier.eu/search?keyword=EM:11770 + EM:12280 C57BL/6NCrl-Ubl4b/Ph EMMA sperm mutant strain MGI:6341871 Ubl4b endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1914841 Ubl4b ubiquitin-like 4B https://www.infrafrontier.eu/search?keyword=EM:12280 + EM:12283 C57BL/6NCrl-Ube2n/Ph EMMA live mutant strain MGI:6341889 Ube2n endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1934835 Ube2n ubiquitin-conjugating enzyme E2N https://www.infrafrontier.eu/search?keyword=EM:12283 + EM:11332 C57BL/6NCrl-Ubd/Ph EMMA sperm mutant strain MGI:6120710 Ubd targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1344410 Ubd ubiquitin D https://www.infrafrontier.eu/search?keyword=EM:11332 + EM:11332 C57BL/6NCrl-Ubd/Ph EMMA live mutant strain MGI:6120710 Ubd targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1344410 Ubd ubiquitin D https://www.infrafrontier.eu/search?keyword=EM:11332 + EM:11614 C57BL/6NCrl-Ubd/Ph EMMA sperm mutant strain MGI:5810734 Ubd targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1344410 Ubd ubiquitin D https://www.infrafrontier.eu/search?keyword=EM:11614 + EM:12290 C57BL/6NCrl-Ubac2/Ieg EMMA sperm mutant strain Ubac2 EUCOMM targeted mutation 1e.1, Helmholtz Zentrum Muenchen GmbH MGI:2145838 Ubac2 ubiquitin associated domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:12290 + EM:11687 C57BL/6NCrl-Tyk2/Ieg EMMA sperm mutant strain MGI:6120762 Tyk2 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1929470 Tyk2 tyrosine kinase 2 https://www.infrafrontier.eu/search?keyword=EM:11687 + EM:11666 C57BL/6NCrl-Ttll12/Ieg EMMA sperm C57BL/6N-Ttll12/Ieg mutant strain MGI:6317367 Ttll12 targeted mutation 1e.1, Wellcome Trust Sanger Institute MGI:3039573 Ttll12 tubulin tyrosine ligase-like family, member 12 https://www.infrafrontier.eu/search?keyword=EM:11666 + EM:11303 C57BL/6NCrl-Trim9/Ph EMMA sperm mutant strain MGI:6147539 Trim9 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2137354 Trim9 tripartite motif-containing 9 https://www.infrafrontier.eu/search?keyword=EM:11303 + EM:09055 C57BL/6NCrl-Trim15/Ph EMMA archived mutant strain MGI:5588277 Trim15 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1916347 Trim15 tripartite motif-containing 15 https://www.infrafrontier.eu/search?keyword=EM:09055 + EM:11338 C57BL/6NCrl-Trabd2b/Ph EMMA sperm C57BL/6NCrl-Trabd2b/Ph mutant strain MGI:6152711 Trabd2b endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:3650152 Trabd2b TraB domain containing 2B https://www.infrafrontier.eu/search?keyword=EM:11338 + EM:11913 C57BL/6NCrl-Tmem62/Ph EMMA sperm mutant strain MGI:6341890 Tmem62 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2139461 Tmem62 transmembrane protein 62 https://www.infrafrontier.eu/search?keyword=EM:11913 + EM:11682 C57BL/6NCrl-Tmem60/Ph EMMA live C57BL/6NCrl-Tmem60/Ph mutant strain MGI:6152710 Tmem60 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2673965 Tmem60 transmembrane protein 60 https://www.infrafrontier.eu/search?keyword=EM:11682 + EM:11874 C57BL/6NCrl-Tmem47/Ph EMMA sperm mutant strain MGI:6341870 Tmem47 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2177570 Tmem47 transmembrane protein 47 https://www.infrafrontier.eu/search?keyword=EM:11874 + EM:11876 C57BL/6NCrl-Tmem273/Ph EMMA sperm mutant strain MGI:6341882 Tmem273 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1916319 Tmem273 transmembrane protein 273 https://www.infrafrontier.eu/search?keyword=EM:11876 + EM:12176 C57BL/6NCrl-Tmem240/Ph EMMA sperm mutant strain MGI:6341826 Tmem240 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3648074 Tmem240 transmembrane protein 240 https://www.infrafrontier.eu/search?keyword=EM:12176 + EM:11771 C57BL/6NCrl-Tmem150b/Ph EMMA sperm C57BL/6NCrl-Tmem150b/Ph mutant strain MGI:6152708 Tmem150b endonuclease mediated mutation 1, Institute of Molecular Genetics MGI:2679718 Tmem150b transmembrane protein 150B https://www.infrafrontier.eu/search?keyword=EM:11771 + EM:11772 C57BL/6NCrl-Tmem132b/Ph EMMA sperm C57BL/6NCrl-Tmem132b/Ph mutant strain MGI:6152707 Tmem132b endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3609245 Tmem132b transmembrane protein 132B https://www.infrafrontier.eu/search?keyword=EM:11772 + EM:11538 C57BL/6NCrl-Thg1l/Ieg EMMA sperm mutant strain MGI:6120731 Thg1l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1920871 Thg1l tRNA-histidine guanylyltransferase 1-like (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:11538 + EM:12476 C57BL/6NCrl-Tg(Vav1-STAT5B)731Biat/Biat EMMA sperm B6N-Tg(STAT5B)731Biat mutant strain MGI:6164041 Tg(Vav1-STAT5B)731Biat transgene insertion 731, Biomodels Austria MGI:6164040 Tg(Vav1-STAT5B)731Biat transgene insertion 731, Biomodels Austria https://www.infrafrontier.eu/search?keyword=EM:12476 + EM:02120 C57BL/6NCrl-Tg(Bglap-Omd)1Kieg/Kieg EMMA embryo OSAD, C57BL/6NCrlOSAD mutant strain MGI:5516352 Tg(Bglap-Omd)1Kieg transgene insertion 1, Karolinska Institute Unit for Embryology and Genetics MGI:5516351 Tg(Bglap-Omd)1Kieg transgene insertion 1, Karolinska Institute Unit for Embryology and Genetics https://www.infrafrontier.eu/search?keyword=EM:02120 + EM:11774 C57BL/6NCrl-Tent5a/Ph EMMA sperm C57BL/6NCrl-Fam46a/Ph mutant strain MGI:6152705 Tent5a endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2670964 Tent5a terminal nucleotidyltransferase 5A https://www.infrafrontier.eu/search?keyword=EM:11774 + EM:11700 C57BL/6NCrl-Tent4a/Ph EMMA sperm C57BL/6NCrl-Papd7/Ph mutant strain MGI:6120803 Tent4a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2682295 Tent4a terminal nucleotidyltransferase 4A https://www.infrafrontier.eu/search?keyword=EM:11700 + EM:12192 C57BL/6NCrl-Tbl1xr1/Ieg EMMA sperm mutant strain MGI:6199116 Tbl1xr1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2444715 Tbl1xr1 transducin (beta)-like 1X-linked receptor 1 https://www.infrafrontier.eu/search?keyword=EM:12192 + EM:11962 C57BL/6NCrl-Tasor/Ph EMMA sperm mutant strain MGI:6341945 Tasor endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1921694 Tasor transcription activation suppressor https://www.infrafrontier.eu/search?keyword=EM:11962 + EM:11534 C57BL/6NCrl-Syncrip/Ieg EMMA sperm mutant strain MGI:6120727 Syncrip targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1891690 Syncrip synaptotagmin binding, cytoplasmic RNA interacting protein https://www.infrafrontier.eu/search?keyword=EM:11534 - EM:10366 C57BL/6NCrl-Syde1/Ieg EMMA sperm mutant strain MGI:5704518 Syde1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1918959 Syde1 synapse defective 1, Rho GTPase, homolog 1 (C. elegans) https://www.infrafrontier.eu/search?keyword=EM:10366 + EM:11908 C57BL/6NCrl-Sulf1/Ieg EMMA sperm mutant strain MGI:6160170 Sulf1 targeted mutation 1b, Mouse Biology Program, UCDavis MGI:2138563 Sulf1 sulfatase 1 https://www.infrafrontier.eu/search?keyword=EM:11908 + EM:10138 C57BL/6NCrl-Stx5a/Ieg EMMA sperm mutant strain MGI:5692753 Stx5a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1928483 Stx5a syntaxin 5A https://www.infrafrontier.eu/search?keyword=EM:10138 + EM:11702 C57BL/6NCrl-Strn4/Ph EMMA sperm C57BL/6N-Strn4/Ph mutant strain MGI:6317368 Strn4 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2142346 Strn4 striatin, calmodulin binding protein 4 https://www.infrafrontier.eu/search?keyword=EM:11702 + EM:12184 C57BL/6NCrl-Strip2/Ph EMMA sperm mutant strain MGI:6341827 Strip2 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2444363 Strip2 striatin interacting protein 2 https://www.infrafrontier.eu/search?keyword=EM:12184 + EM:12248 C57BL/6NCrl-Stk26/Ph EMMA sperm mutant strain MGI:6159329 Stk26 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1917665 Stk26 serine/threonine kinase 26 https://www.infrafrontier.eu/search?keyword=EM:12248 + EM:11985 C57BL/6NCrl-Spryd4/Ph EMMA sperm mutant strain MGI:6341853 Spryd4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1913951 Spryd4 SPRY domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:11985 + EM:11773 C57BL/6NCrl-Spink6/Ph EMMA sperm C57BL/6NCrl-Spink6/Ph mutant strain MGI:6152706 Spink6 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3648654 Spink6 serine peptidase inhibitor, Kazal type 6 https://www.infrafrontier.eu/search?keyword=EM:11773 ? EM:12420 C57BL/6NCrl-Spink13/Ph EMMA sperm mutant strain MGI:6341936 Spink13 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3642511 Spink13 serine peptidase inhibitor, Kazal type 13 https://www.infrafrontier.eu/search?keyword=EM:12420 + EM:10113 C57BL/6NCrl-Smim6/Ieg EMMA sperm mutant strain MGI:5692688 Smim6 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915778 Smim6 small integral membrane protein 6 https://www.infrafrontier.eu/search?keyword=EM:10113 - EM:11872 C57BL/6NCrl-Slc25a32/Orl EMMA archived mutant strain MGI:6406920 Slc25a32 endonuclease-mediated mutation 1, Orleans MGI:1917156 Slc25a32 solute carrier family 25, member 32 https://www.infrafrontier.eu/search?keyword=EM:11872 + EM:12252 C57BL/6NCrl-Slc25a10/Ieg EMMA sperm mutant strain MGI:6120716 Slc25a10 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1353497 Slc25a10 solute carrier family 25 (mitochondrial carrier, dicarboxylate transporter), member 10 https://www.infrafrontier.eu/search?keyword=EM:12252 + EM:11535 C57BL/6NCrl-Slc12a9/Ieg EMMA sperm mutant strain MGI:6120766 Slc12a9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1933532 Slc12a9 solute carrier family 12 (potassium/chloride transporters), member 9 https://www.infrafrontier.eu/search?keyword=EM:11535 + EM:12170 C57BL/6NCrl-Sinhcaf/Ph EMMA sperm mutant strain MGI:6341898 Sinhcaf endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1929091 Sinhcaf SIN3-HDAC complex associated factor https://www.infrafrontier.eu/search?keyword=EM:12170 + EM:12835 C57BL/6NCrl-Shisal2a/Ieg EMMA sperm mutant strain MGI:6279892 Shisal2a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3651644 Shisal2a shisa like 2A https://www.infrafrontier.eu/search?keyword=EM:12835 + EM:12276 C57BL/6NCrl-Shisal1/Ph EMMA sperm mutant strain MGI:6341918 Shisal1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1919551 Shisal1 shisa like 1 https://www.infrafrontier.eu/search?keyword=EM:12276 + EM:10169 C57BL/6NCrl-Sec11c/Ieg EMMA sperm mutant strain MGI:5696903 Sec11c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913536 Sec11c SEC11 homolog C, signal peptidase complex subunit https://www.infrafrontier.eu/search?keyword=EM:10169 + EM:11909 C57BL/6NCrl-Scmh1/Ieg EMMA sperm mutant strain MGI:6324158 Scmh1 targeted mutation 1e.1, Helmholtz Zentrum Muenchen GmbH MGI:2140390 Scmh1 sex comb on midleg homolog 1 https://www.infrafrontier.eu/search?keyword=EM:11909 + EM:11304 C57BL/6NCrl-Sbspon/Ph EMMA sperm mutant strain MGI:6147538 Sbspon endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2684952 Sbspon somatomedin B and thrombospondin, type 1 domain containing https://www.infrafrontier.eu/search?keyword=EM:11304 + EM:12286 C57BL/6NCrl-Sbsn/Ph EMMA sperm mutant strain MGI:6341905 Sbsn endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2446326 Sbsn suprabasin https://www.infrafrontier.eu/search?keyword=EM:12286 + EM:11366 C57BL/6NCrl-Rnls/Ieg EMMA sperm mutant strain MGI:6120734 Rnls targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915045 Rnls renalase, FAD-dependent amine oxidase https://www.infrafrontier.eu/search?keyword=EM:11366 + EM:12752 C57BL/6NCrl-Rnf5/Ph EMMA sperm mutant strain MGI:6361211 Rnf5 targeted mutation 1.1, Velocigene MGI:1860076 Rnf5 ring finger protein 5 https://www.infrafrontier.eu/search?keyword=EM:12752 + EM:12180 C57BL/6NCrl-Rnf4/Ph EMMA sperm mutant strain MGI:6341902 Rnf4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1201691 Rnf4 ring finger protein 4 https://www.infrafrontier.eu/search?keyword=EM:12180 + EM:12413 C57BL/6NCrl-Rnf19b/Ph EMMA live mutant strain MGI:6341934 Rnf19b endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1922484 Rnf19b ring finger protein 19B https://www.infrafrontier.eu/search?keyword=EM:12413 + EM:10161 C57BL/6NCrl-Rnf186/Ph EMMA sperm mutant strain MGI:5695912 Rnf186 targeted mutation 1.1, Velocigene MGI:1914075 Rnf186 ring finger protein 186 https://www.infrafrontier.eu/search?keyword=EM:10161 ? EM:13197 C57BL/6NCrl-Rnf168/Ph EMMA live mutant strain MGI:6433991 Rnf168 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1917488 Rnf168 ring finger protein 168 https://www.infrafrontier.eu/search?keyword=EM:13197 ? EM:12419 C57BL/6NCrl-Rnf14/Ph EMMA sperm mutant strain MGI:6341897 Rnf14 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1929668 Rnf14 ring finger protein 14 https://www.infrafrontier.eu/search?keyword=EM:12419 + EM:12656 C57BL/6NCrl-Rnf121/Ph EMMA sperm mutant strain MGI:5609353 Rnf121 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1922462 Rnf121 ring finger protein 121 https://www.infrafrontier.eu/search?keyword=EM:12656 + EM:11339 C57BL/6NCrl-Rhobtb1/Ph EMMA sperm mutant strain MGI:6147537 Rhobtb1 endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:1916538 Rhobtb1 Rho-related BTB domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:11339 + EM:11464 C57BL/6NCrl-Retreg2/Ph EMMA sperm mutant strain MGI:6147536 Retreg2 endonucleas-mediated mutation 2, Institute of Molecular Genetics MGI:2388278 Retreg2 reticulophagy regulator family member 2 https://www.infrafrontier.eu/search?keyword=EM:11464 + EM:12284 C57BL/6NCrl-Pstpip1/Ph EMMA sperm mutant strain MGI:6341846 Pstpip1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1321396 Pstpip1 proline-serine-threonine phosphatase-interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:12284 + EM:10140 C57BL/6NCrl-Psmc2/Ieg EMMA sperm mutant strain MGI:5692582 Psmc2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:109555 Psmc2 proteasome (prosome, macropain) 26S subunit, ATPase 2 https://www.infrafrontier.eu/search?keyword=EM:10140 + EM:11370 C57BL/6NCrl-Ppp4r3b/Ieg EMMA sperm mutant strain MGI:6120774 Ppp4r3b targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2144578 Ppp4r3b protein phosphatase 4 regulatory subunit 3B https://www.infrafrontier.eu/search?keyword=EM:11370 + EM:12539 C57BL/6NCrl-Plekha1/Ieg EMMA sperm mutant strain MGI:6256795 Plekha1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2442213 Plekha1 pleckstrin homology domain containing, family A (phosphoinositide binding specific) member 1 https://www.infrafrontier.eu/search?keyword=EM:12539 + EM:11866 C57BL/6NCrl-Pknox2/Ph EMMA sperm mutant strain MGI:6341886 Pknox2 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2445415 Pknox2 Pbx/knotted 1 homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:11866 + EM:11740 C57BL/6NCrl-Pip4p1/Ph EMMA sperm C57BL/6NCrl-Tmem55b/Ph, C57BL/6NCrl-Tmem55b/Ph mutant strain MGI:6152709 Pip4p1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2448501 Pip4p1 phosphatidylinositol-4,5-bisphosphate 4-phosphatase 1 https://www.infrafrontier.eu/search?keyword=EM:11740 + EM:12435 C57BL/6NCrl-Phf10/Ieg EMMA sperm mutant strain MGI:6276833 Phf10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919307 Phf10 PHD finger protein 10 https://www.infrafrontier.eu/search?keyword=EM:12435 ? EM:11529 C57BL/6NCrl-Pex1/Ieg EMMA sperm mutant strain Pex1 EUCOMM targeted mutation 1e.1, Helmholtz Zentrum Muenchen GmbH MGI:1918632 Pex1 peroxisomal biogenesis factor 1 https://www.infrafrontier.eu/search?keyword=EM:11529 + EM:11911 C57BL/6NCrl-Pdgfc/Ieg EMMA sperm mutant strain MGI:6160167 Pdgfc targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1859631 Pdgfc platelet-derived growth factor, C polypeptide https://www.infrafrontier.eu/search?keyword=EM:11911 + EM:12341 C57BL/6NCrl-Pcp4l1/Ph EMMA sperm mutant strain MGI:6120730 Pcp4l1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913675 Pcp4l1 Purkinje cell protein 4-like 1 https://www.infrafrontier.eu/search?keyword=EM:12341 + EM:12831 C57BL/6NCrl-P2rx2/Ieg EMMA sperm mutant strain MGI:6279891 P2rx2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2665170 P2rx2 purinergic receptor P2X, ligand-gated ion channel, 2 https://www.infrafrontier.eu/search?keyword=EM:12831 + EM:12182 C57BL/6NCrl-Nwd2/Ph EMMA sperm mutant strain MGI:6341878 Nwd2 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1920464 Nwd2 NACHT and WD repeat domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:12182 + EM:11907 C57BL/6NCrl-Nup35/Ieg EMMA sperm mutant strain MGI:6160168 Nup35 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923922 Nup35 nucleoporin 35 https://www.infrafrontier.eu/search?keyword=EM:11907 + EM:11365 C57BL/6NCrl-Nucks1/Ieg EMMA sperm mutant strain MGI:6120767 Nucks1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1934811 Nucks1 nuclear casein kinase and cyclin-dependent kinase substrate 1 https://www.infrafrontier.eu/search?keyword=EM:11365 + EM:11613 C57BL/6NCrl-Nub1/Ph EMMA sperm mutant strain MGI:5766751 Nub1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1889001 Nub1 negative regulator of ubiquitin-like proteins 1 https://www.infrafrontier.eu/search?keyword=EM:11613 + EM:11528 C57BL/6NCrl-Napb/Ieg EMMA sperm mutant strain MGI:6120686 Napb targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:104562 Napb N-ethylmaleimide sensitive fusion protein attachment protein beta https://www.infrafrontier.eu/search?keyword=EM:11528 + EM:12175 C57BL/6NCrl-Naa38/Ph EMMA sperm mutant strain MGI:6341883 Naa38 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1925554 Naa38 N(alpha)-acetyltransferase 38, NatC auxiliary subunit https://www.infrafrontier.eu/search?keyword=EM:12175 + EM:11306 C57BL/6NCrl-Mzb1/Ph EMMA sperm mutant strain MGI:6147535 Mzb1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1917066 Mzb1 marginal zone B and B1 cell-specific protein 1 https://www.infrafrontier.eu/search?keyword=EM:11306 + EM:09512 C57BL/6NCrl-Myl2/Ieg EMMA sperm mutant strain MGI:5629324 Myl2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:97272 Myl2 myosin, light polypeptide 2, regulatory, cardiac, slow https://www.infrafrontier.eu/search?keyword=EM:09512 + EM:11612 C57BL/6NCrl-Mex3b/Ph EMMA sperm mutant strain MGI:5766754 Mex3b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1918252 Mex3b mex3 RNA binding family member B https://www.infrafrontier.eu/search?keyword=EM:11612 + EM:11612 C57BL/6NCrl-Mex3b/Ph EMMA live mutant strain MGI:5766754 Mex3b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1918252 Mex3b mex3 RNA binding family member B https://www.infrafrontier.eu/search?keyword=EM:11612 + EM:11867 C57BL/6NCrl-Mest/Ph EMMA sperm mutant strain MGI:6341841 Mest endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:96968 Mest mesoderm specific transcript https://www.infrafrontier.eu/search?keyword=EM:11867 + EM:11334 C57BL/6NCrl-Marchf8/Ph EMMA sperm C57BL/6NCrl-March8/Ph mutant strain MGI:6147531 Marchf8 endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:1919029 Marchf8 membrane associated ring-CH-type finger 8 https://www.infrafrontier.eu/search?keyword=EM:11334 + EM:12830 C57BL/6NCrl-Marchf3/Ph EMMA sperm mutant strain MGI:6358620 Marchf3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2443667 Marchf3 membrane associated ring-CH-type finger 3 https://www.infrafrontier.eu/search?keyword=EM:12830 + EM:11539 C57BL/6NCrl-Ly6g6d/Ieg EMMA sperm mutant strain MGI:6120778 Ly6g6d targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2442450 Ly6g6d lymphocyte antigen 6 complex, locus G6D https://www.infrafrontier.eu/search?keyword=EM:11539 + EM:12617 C57BL/6NCrl-Ltn1/Ph EMMA sperm mutant strain MGI:6304241 Ltn1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1926163 Ltn1 listerin E3 ubiquitin protein ligase 1 https://www.infrafrontier.eu/search?keyword=EM:12617 + EM:11786 C57BL/6NCrl-Lratd2/Ph EMMA sperm mutant strain MGI:6316150 Lratd2 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3026924 Lratd2 LRAT domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:11786 + EM:12477 C57BL/6NCrl-Lpp/Ph EMMA sperm mutant strain MGI:6120784 Lpp targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2146570 Lpp LIM domain containing preferred translocation partner in lipoma https://www.infrafrontier.eu/search?keyword=EM:12477 + EM:12815 C57BL/6NCrl-Lmo1/Ieg EMMA sperm mutant strain MGI:6382778 Lmo1 targeted mutation 1b, Mouse Biology Program, UCDavis MGI:102812 Lmo1 LIM domain only 1 https://www.infrafrontier.eu/search?keyword=EM:12815 + EM:10118 C57BL/6NCrl-Ldlr/Ieg EMMA sperm mutant strain MGI:5695977 Ldlr targeted mutation 1b, Wellcome Trust Sanger Institute MGI:96765 Ldlr low density lipoprotein receptor https://www.infrafrontier.eu/search?keyword=EM:10118 + EM:10369 C57BL/6NCrl-Lct/Ieg EMMA sperm mutant strain MGI:5704514 Lct targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104576 Lct lactase https://www.infrafrontier.eu/search?keyword=EM:10369 + EM:09357 C57BL/6NCrl-Lars/Wtsi EMMA embryo mutant strain MGI:5637014 Lars targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913808 Lars leucyl-tRNA synthetase https://www.infrafrontier.eu/search?keyword=EM:09357 + EM:09357 C57BL/6NCrl-Lars/Wtsi EMMA sperm mutant strain MGI:5637014 Lars targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913808 Lars leucyl-tRNA synthetase https://www.infrafrontier.eu/search?keyword=EM:09357 + EM:11869 C57BL/6NCrl-Lamtor4/Ph EMMA sperm mutant strain MGI:6341931 Lamtor4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1913346 Lamtor4 late endosomal/lysosomal adaptor, MAPK and MTOR activator 4 https://www.infrafrontier.eu/search?keyword=EM:11869 + EM:12177 C57BL/6NCrl-Klk8/Ph EMMA sperm mutant strain MGI:6341912 Klk8 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1343327 Klk8 kallikrein related-peptidase 8 https://www.infrafrontier.eu/search?keyword=EM:12177 + EM:09056 C57BL/6NCrl-Klk5/Ph EMMA archived mutant strain MGI:5604101 Klk5 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1915918 Klk5 kallikrein related-peptidase 5 https://www.infrafrontier.eu/search?keyword=EM:09056 - EM:12654 C57BL/6NCrl-Klk14/Ph EMMA sperm mutant strain MGI:5571350 Klk14 targeted mutation 1.1, Velocigene MGI:2447564 Klk14 kallikrein related-peptidase 14 https://www.infrafrontier.eu/search?keyword=EM:12654 + EM:11910 C57BL/6NCrl-Klk13/Ph EMMA sperm mutant strain MGI:6341887 Klk13 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3615275 Klk13 kallikrein related-peptidase 13 https://www.infrafrontier.eu/search?keyword=EM:11910 + EM:11989 C57BL/6NCrl-Klk12/Ph EMMA sperm mutant strain MGI:6341825 Klk12 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1916761 Klk12 kallikrein related-peptidase 12 https://www.infrafrontier.eu/search?keyword=EM:11989 + EM:11611 C57BL/6NCrl-Klhl5/Ph EMMA sperm mutant strain MGI:5692709 Klhl5 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919028 Klhl5 kelch-like 5 https://www.infrafrontier.eu/search?keyword=EM:11611 + EM:12810 C57BL/6NCrl-Kansl1l/Ieg EMMA sperm mutant strain MGI:6379553 Kansl1l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915941 Kansl1l KAT8 regulatory NSL complex subunit 1-like https://www.infrafrontier.eu/search?keyword=EM:12810 + EM:11914 C57BL/6NCrl-Insig1/Ph EMMA sperm mutant strain MGI:6341860 Insig1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1916289 Insig1 insulin induced gene 1 https://www.infrafrontier.eu/search?keyword=EM:11914 + EM:11533 C57BL/6NCrl-Il4i1/Ieg EMMA sperm mutant strain MGI:6120692 Il4i1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:109552 Il4i1 interleukin 4 induced 1 https://www.infrafrontier.eu/search?keyword=EM:11533 + EM:11527 C57BL/6NCrl-Il31/Ieg EMMA sperm mutant strain MGI:6120755 Il31 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923649 Il31 interleukin 31 https://www.infrafrontier.eu/search?keyword=EM:11527 + EM:11369 C57BL/6NCrl-Il13ra2/Ieg EMMA sperm mutant strain MGI:6120701 Il13ra2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1277954 Il13ra2 interleukin 13 receptor, alpha 2 https://www.infrafrontier.eu/search?keyword=EM:11369 + EM:10170 C57BL/6NCrl-Idi1/Ieg EMMA sperm mutant strain MGI:5696924 Idi1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2442264 Idi1 isopentenyl-diphosphate delta isomerase https://www.infrafrontier.eu/search?keyword=EM:10170 + EM:11540 C57BL/6NCrl-Ica1l/Ieg EMMA sperm mutant strain MGI:6120743 Ica1l targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:5648232 Ica1l islet cell autoantigen 1-like https://www.infrafrontier.eu/search?keyword=EM:11540 - EM:11940 C57BL/6NCrl-Hgs/Ieg EMMA sperm C57BL/6NCrl-Hgs/2Ieg mutant strain MGI:6163774 Hgs targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104681 Hgs HGF-regulated tyrosine kinase substrate https://www.infrafrontier.eu/search?keyword=EM:11940 + EM:10591 C57BL/6NCrl-Hepacam2/Ph EMMA sperm mutant strain MGI:5766759 Hepacam2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2141520 Hepacam2 HEPACAM family member 2 https://www.infrafrontier.eu/search?keyword=EM:10591 + EM:10591 C57BL/6NCrl-Hepacam2/Ph EMMA live mutant strain MGI:5766759 Hepacam2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2141520 Hepacam2 HEPACAM family member 2 https://www.infrafrontier.eu/search?keyword=EM:10591 + EM:12179 C57BL/6NCrl-Hdac4/Ph EMMA sperm mutant strain MGI:6341845 Hdac4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3036234 Hdac4 histone deacetylase 4 https://www.infrafrontier.eu/search?keyword=EM:12179 + EM:11536 C57BL/6NCrl-Gstt1/Ieg EMMA sperm mutant strain MGI:5695115 Gstt1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:107379 Gstt1 glutathione S-transferase, theta 1 https://www.infrafrontier.eu/search?keyword=EM:11536 + EM:11685 C57BL/6NCrl-Fut1/Ieg EMMA sperm mutant strain MGI:6120691 Fut1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:109375 Fut1 fucosyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:11685 + EM:12410 C57BL/6NCrl-Fgf14/Ph EMMA live mutant strain MGI:6341935 Fgf14 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:109189 Fgf14 fibroblast growth factor 14 https://www.infrafrontier.eu/search?keyword=EM:12410 + EM:12285 C57BL/6NCrl-Fbxo25/Ph EMMA live mutant strain MGI:6341913 Fbxo25 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1914072 Fbxo25 F-box protein 25 https://www.infrafrontier.eu/search?keyword=EM:12285 + EM:12171 C57BL/6NCrl-Fam83h/Ph EMMA sperm mutant strain MGI:6341855 Fam83h endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2145900 Fam83h family with sequence similarity 83, member H https://www.infrafrontier.eu/search?keyword=EM:12171 + EM:12282 C57BL/6NCrl-Fam71f1/Ph EMMA sperm mutant strain MGI:6341899 Fam71f1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3032524 Fam71f1 family with sequence similarity 71, member F1 https://www.infrafrontier.eu/search?keyword=EM:12282 + EM:11336 C57BL/6NCrl-Fam172a/Ph EMMA sperm mutant strain MGI:6147534 Fam172a endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:1915925 Fam172a family with sequence similarity 172, member A https://www.infrafrontier.eu/search?keyword=EM:11336 + EM:11877 C57BL/6NCrl-Fam126a/Ph EMMA sperm mutant strain MGI:6341927 Fam126a endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2149839 Fam126a family with sequence similarity 126, member A https://www.infrafrontier.eu/search?keyword=EM:11877 + EM:12200 C57BL/6NCrl-Fads6/Ieg EMMA sperm mutant strain MGI:6194112 Fads6 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3039592 Fads6 fatty acid desaturase domain family, member 6 https://www.infrafrontier.eu/search?keyword=EM:12200 + EM:11537 C57BL/6NCrl-Exph5/Ieg EMMA sperm mutant strain MGI:6120790 Exph5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2158493 Exph5 exophilin 5 https://www.infrafrontier.eu/search?keyword=EM:11537 + EM:12826 C57BL/6NCrl-Erbb2/Ieg EMMA sperm mutant strain MGI:6279893 Erbb2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:95410 Erbb2 erb-b2 receptor tyrosine kinase 2 https://www.infrafrontier.eu/search?keyword=EM:12826 + EM:12452 C57BL/6NCrl-Emsy/Ph EMMA sperm mutant strain MGI:6341933 Emsy endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1924203 Emsy EMSY, BRCA2-interacting transcriptional repressor https://www.infrafrontier.eu/search?keyword=EM:12452 + EM:11371 C57BL/6NCrl-Eea1/Ieg EMMA sperm mutant strain MGI:6120786 Eea1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2442192 Eea1 early endosome antigen 1 https://www.infrafrontier.eu/search?keyword=EM:11371 + EM:12415 C57BL/6NCrl-Dtx4/Ph EMMA sperm mutant strain MGI:6341925 Dtx4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2672905 Dtx4 deltex 4, E3 ubiquitin ligase https://www.infrafrontier.eu/search?keyword=EM:12415 + EM:11541 C57BL/6NCrl-Dnmt3l/Ieg EMMA sperm mutant strain MGI:6120722 Dnmt3l targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1098798 Dnmt3l DNA (cytosine-5-)-methyltransferase 3-like https://www.infrafrontier.eu/search?keyword=EM:11541 + EM:07575 C57BL/6NCrl-Dicer1/Ph EMMA sperm C57BL/6-Dicer1/Ph, DcrMTdel mutant strain MGI:5566698 Dicer1 endonuclease-mediated mutation 3, Petr Svoboda MGI:2177178 Dicer1 dicer 1, ribonuclease type III https://www.infrafrontier.eu/search?keyword=EM:07575 + EM:11704 C57BL/6NCrl-Ddi2/Ph EMMA sperm mutant strain MGI:6117798 Ddi2 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1916067 Ddi2 DNA-damage inducible protein 2 https://www.infrafrontier.eu/search?keyword=EM:11704 + EM:12340 C57BL/6NCrl-Ddi2/Ph EMMA sperm mutant strain MGI:5810736 Ddi2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1916067 Ddi2 DNA-damage inducible protein 2 https://www.infrafrontier.eu/search?keyword=EM:12340 + EM:12183 C57BL/6NCrl-Dcaf8/Ph EMMA sperm mutant strain MGI:6341909 Dcaf8 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:91860 Dcaf8 DDB1 and CUL4 associated factor 8 https://www.infrafrontier.eu/search?keyword=EM:12183 + EM:11994 C57BL/6NCrl-Dcaf12/Ph EMMA sperm mutant strain MGI:6341838 Dcaf12 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1916220 Dcaf12 DDB1 and CUL4 associated factor 12 https://www.infrafrontier.eu/search?keyword=EM:11994 + EM:12181 C57BL/6NCrl-Cyp39a1/Ph EMMA sperm mutant strain MGI:6341926 Cyp39a1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1927096 Cyp39a1 cytochrome P450, family 39, subfamily a, polypeptide 1 https://www.infrafrontier.eu/search?keyword=EM:12181 + EM:11686 C57BL/6NCrl-Ctrc/Ieg EMMA sperm mutant strain MGI:6120756 Ctrc targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1923951 Ctrc chymotrypsin C (caldecrin) https://www.infrafrontier.eu/search?keyword=EM:11686 ? EM:12278 C57BL/6NCrl-Crx/Ph EMMA sperm mutant strain MGI:6341903 Crx endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1194883 Crx cone-rod homeobox https://www.infrafrontier.eu/search?keyword=EM:12278 + EM:12173 C57BL/6NCrl-Coa6/Ph EMMA sperm mutant strain MGI:6341938 Coa6 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1915142 Coa6 cytochrome c oxidase assembly factor 6 https://www.infrafrontier.eu/search?keyword=EM:12173 + EM:10142 C57BL/6NCrl-Cmpk1/Ieg EMMA sperm mutant strain MGI:5692662 Cmpk1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913838 Cmpk1 cytidine monophosphate (UMP-CMP) kinase 1 https://www.infrafrontier.eu/search?keyword=EM:10142 + EM:11305 C57BL/6NCrl-Cluh/Ph EMMA sperm mutant strain MGI:6147533 Cluh endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1921398 Cluh clustered mitochondria (cluA/CLU1) homolog https://www.infrafrontier.eu/search?keyword=EM:11305 + EM:10452 C57BL/6NCrl-Chpf/Ieg EMMA sperm mutant strain MGI:5751153 Chpf targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:106576 Chpf chondroitin polymerizing factor https://www.infrafrontier.eu/search?keyword=EM:10452 + EM:12828 C57BL/6NCrl-Chaf1b/Ieg EMMA sperm mutant strain MGI:6279889 Chaf1b targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1314881 Chaf1b chromatin assembly factor 1, subunit B (p60) https://www.infrafrontier.eu/search?keyword=EM:12828 + EM:11768 C57BL/6NCrl-Cfap161/Ph EMMA sperm C57BL/6NCrl-Cfap161/Ph mutant strain MGI:6152704 Cfap161 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1922806 Cfap161 cilia and flagella associated protein 161 https://www.infrafrontier.eu/search?keyword=EM:11768 + EM:11688 C57BL/6NCrl-Cckar/Ieg EMMA sperm mutant strain MGI:6120823 Cckar targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2141151 Cckar cholecystokinin A receptor https://www.infrafrontier.eu/search?keyword=EM:11688 + EM:11368 C57BL/6NCrl-Car14/Ieg EMMA sperm mutant strain MGI:6120708 Car14 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1344341 Car14 carbonic anhydrase 14 https://www.infrafrontier.eu/search?keyword=EM:11368 + EM:11526 C57BL/6NCrl-Camk2b/Ieg EMMA sperm mutant strain MGI:6120813 Camk2b targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:88257 Camk2b calcium/calmodulin-dependent protein kinase II, beta https://www.infrafrontier.eu/search?keyword=EM:11526 + EM:12458 C57BL/6NCrl-Bysl/Ph EMMA sperm mutant strain MGI:6341843 Bysl endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1858419 Bysl bystin-like https://www.infrafrontier.eu/search?keyword=EM:12458 + EM:12174 C57BL/6NCrl-Btbd8/Ph EMMA sperm mutant strain MGI:6341849 Btbd8 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3646208 Btbd8 BTB (POZ) domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:12174 + EM:12342 C57BL/6NCrl-Btbd3/Ph EMMA sperm mutant strain MGI:5588286 Btbd3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2385155 Btbd3 BTB (POZ) domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:12342 + EM:11769 C57BL/6NCrl-Bmerb1/Ph EMMA sperm C57BL/6NCrl-2900011O08Rik/Ph mutant strain MGI:6152702 Bmerb1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1914504 Bmerb1 bMERB domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:11769 ? EM:12236 C57BL/6NCrl-Birc6/Ph EMMA sperm mutant strain MGI:6341866 Birc6 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1276108 Birc6 baculoviral IAP repeat-containing 6 https://www.infrafrontier.eu/search?keyword=EM:12236 + EM:10365 C57BL/6NCrl-Atp9a/Ieg EMMA sperm mutant strain MGI:5704515 Atp9a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1330826 Atp9a ATPase, class II, type 9A https://www.infrafrontier.eu/search?keyword=EM:10365 + EM:11458 C57BL/6NCrl-Atp6v0c/Ph EMMA sperm mutant strain MGI:6147532 Atp6v0c endonuclease mediated-mutation 2, Institute of Molecular Genetics MGI:88116 Atp6v0c ATPase, H+ transporting, lysosomal V0 subunit C https://www.infrafrontier.eu/search?keyword=EM:11458 ? EM:12172 C57BL/6NCrl-Atg7/Ph EMMA sperm mutant strain MGI:6341910 Atg7 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1921494 Atg7 autophagy related 7 https://www.infrafrontier.eu/search?keyword=EM:12172 + EM:12241 C57BL/6NCrl-Asb7/Ph EMMA sperm mutant strain MGI:6341901 Asb7 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2152835 Asb7 ankyrin repeat and SOCS box-containing 7 https://www.infrafrontier.eu/search?keyword=EM:12241 + EM:11871 C57BL/6NCrl-Asb4/Ph EMMA live mutant strain MGI:6341911 Asb4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1929751 Asb4 ankyrin repeat and SOCS box-containing 4 https://www.infrafrontier.eu/search?keyword=EM:11871 + EM:12193 C57BL/6NCrl-Arhgap26/Ieg EMMA sperm mutant strain MGI:6199115 Arhgap26 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1918552 Arhgap26 Rho GTPase activating protein 26 https://www.infrafrontier.eu/search?keyword=EM:12193 + EM:12256 C57BL/6NCrl-Aopep/Ph EMMA sperm mutant strain MGI:6209550 Aopep targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919311 Aopep aminopeptidase O https://www.infrafrontier.eu/search?keyword=EM:12256 + EM:11367 C57BL/6NCrl-Alkbh6/Ieg EMMA sperm mutant strain MGI:6120771 Alkbh6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2142037 Alkbh6 alkB homolog 6 https://www.infrafrontier.eu/search?keyword=EM:11367 + EM:12339 C57BL/6NCrl-Abcg8/Ph EMMA sperm mutant strain MGI:5810735 Abcg8 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914720 Abcg8 ATP binding cassette subfamily G member 8 https://www.infrafrontier.eu/search?keyword=EM:12339 + EM:11335 C57BL/6NCrl-3425401B19Rik/Ph EMMA sperm mutant strain MGI:6147530 3425401B19Rik endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:3588196 3425401B19Rik RIKEN cDNA 3425401B19 gene https://www.infrafrontier.eu/search?keyword=EM:11335 + EM:11302 C57BL/6NCrl-2510009E07Rik/Ph EMMA sperm C57BL/6NCrl-2510009E07Rik/Ph mutant strain MGI:6147529 2510009E07Rik endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1919440 2510009E07Rik RIKEN cDNA 2510009E07 gene https://www.infrafrontier.eu/search?keyword=EM:11302 + EM:09141 C57BL/6N;C57BL/6NTac-Zfp239/Wtsi EMMA embryo mutant strain MGI:5636945 Zfp239 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1306812 Zfp239 zinc finger protein 239 https://www.infrafrontier.eu/search?keyword=EM:09141 + EM:09141 C57BL/6N;C57BL/6NTac-Zfp239/Wtsi EMMA sperm mutant strain MGI:5636945 Zfp239 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1306812 Zfp239 zinc finger protein 239 https://www.infrafrontier.eu/search?keyword=EM:09141 + EM:09143 C57BL/6N;C57BL/6NTac-Vwa3a/Wtsi EMMA embryo mutant strain MGI:5637178 Vwa3a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3041229 Vwa3a von Willebrand factor A domain containing 3A https://www.infrafrontier.eu/search?keyword=EM:09143 + EM:09143 C57BL/6N;C57BL/6NTac-Vwa3a/Wtsi EMMA sperm mutant strain MGI:5637178 Vwa3a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3041229 Vwa3a von Willebrand factor A domain containing 3A https://www.infrafrontier.eu/search?keyword=EM:09143 + EM:09124 C57BL/6N;C57BL/6NTac-Ssr2/Wtsi EMMA embryo mutant strain MGI:5637009 Ssr2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913506 Ssr2 signal sequence receptor, beta https://www.infrafrontier.eu/search?keyword=EM:09124 + EM:09124 C57BL/6N;C57BL/6NTac-Ssr2/Wtsi EMMA sperm mutant strain MGI:5637009 Ssr2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913506 Ssr2 signal sequence receptor, beta https://www.infrafrontier.eu/search?keyword=EM:09124 + EM:09121 C57BL/6N;C57BL/6NTac-Kif13b/Wtsi EMMA embryo mutant strain MGI:5636925 Kif13b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1098265 Kif13b kinesin family member 13B https://www.infrafrontier.eu/search?keyword=EM:09121 + EM:09121 C57BL/6N;C57BL/6NTac-Kif13b/Wtsi EMMA sperm mutant strain MGI:5636925 Kif13b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1098265 Kif13b kinesin family member 13B https://www.infrafrontier.eu/search?keyword=EM:09121 + EM:09138 C57BL/6N;C57BL/6NTac-Galntl5/Wtsi EMMA embryo mutant strain MGI:5577268 Galntl5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915159 Galntl5 UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase-like 5 https://www.infrafrontier.eu/search?keyword=EM:09138 + EM:09138 C57BL/6N;C57BL/6NTac-Galntl5/Wtsi EMMA sperm mutant strain MGI:5577268 Galntl5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915159 Galntl5 UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase-like 5 https://www.infrafrontier.eu/search?keyword=EM:09138 + EM:09125 C57BL/6N;C57BL/6NTac-Exosc9/Wtsi EMMA embryo mutant strain MGI:5636988 Exosc9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1355319 Exosc9 exosome component 9 https://www.infrafrontier.eu/search?keyword=EM:09125 + EM:09125 C57BL/6N;C57BL/6NTac-Exosc9/Wtsi EMMA sperm mutant strain MGI:5636988 Exosc9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1355319 Exosc9 exosome component 9 https://www.infrafrontier.eu/search?keyword=EM:09125 + EM:09123 C57BL/6N;C57BL/6NTac-D6Wsu163e/Wtsi EMMA embryo mutant strain MGI:5636910 D6Wsu163e targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107893 D6Wsu163e DNA segment, Chr 6, Wayne State University 163, expressed https://www.infrafrontier.eu/search?keyword=EM:09123 + EM:09123 C57BL/6N;C57BL/6NTac-D6Wsu163e/Wtsi EMMA sperm mutant strain MGI:5636910 D6Wsu163e targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107893 D6Wsu163e DNA segment, Chr 6, Wayne State University 163, expressed https://www.infrafrontier.eu/search?keyword=EM:09123 + EM:09142 C57BL/6N;C57BL/6NTac-Cgrrf1/Wtsi EMMA embryo mutant strain MGI:5637038 Cgrrf1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916368 Cgrrf1 cell growth regulator with ring finger domain 1 https://www.infrafrontier.eu/search?keyword=EM:09142 + EM:09142 C57BL/6N;C57BL/6NTac-Cgrrf1/Wtsi EMMA sperm mutant strain MGI:5637038 Cgrrf1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916368 Cgrrf1 cell growth regulator with ring finger domain 1 https://www.infrafrontier.eu/search?keyword=EM:09142 + EM:09139 C57BL/6N;C57BL/6NTac-Bivm/Wtsi EMMA embryo mutant strain MGI:5637122 Bivm targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2179809 Bivm basic, immunoglobulin-like variable motif containing https://www.infrafrontier.eu/search?keyword=EM:09139 + EM:09139 C57BL/6N;C57BL/6NTac-Bivm/Wtsi EMMA sperm mutant strain MGI:5637122 Bivm targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2179809 Bivm basic, immunoglobulin-like variable motif containing https://www.infrafrontier.eu/search?keyword=EM:09139 + EM:11115 C57BL/6N-Zup1/Wtsi EMMA embryo mutant strain MGI:6153719 Zup1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919830 Zup1 zinc finger containing ubiquitin peptidase 1 https://www.infrafrontier.eu/search?keyword=EM:11115 + EM:11115 C57BL/6N-Zup1/Wtsi EMMA sperm mutant strain MGI:6153719 Zup1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919830 Zup1 zinc finger containing ubiquitin peptidase 1 https://www.infrafrontier.eu/search?keyword=EM:11115 + EM:12663 C57BL/6N-Zswim3/Wtsi EMMA embryo mutant strain MGI:6336067 Zswim3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914788 Zswim3 zinc finger SWIM-type containing 3 https://www.infrafrontier.eu/search?keyword=EM:12663 + EM:12663 C57BL/6N-Zswim3/Wtsi EMMA sperm mutant strain MGI:6336067 Zswim3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914788 Zswim3 zinc finger SWIM-type containing 3 https://www.infrafrontier.eu/search?keyword=EM:12663 + EM:12657 C57BL/6N-Zscan29/Orl EMMA sperm mutant strain MGI:6406851 Zscan29 endonuclease-mediated mutation 1, Centre d'ImmunoPhenomique MGI:2139317 Zscan29 zinc finger SCAN domains 29 https://www.infrafrontier.eu/search?keyword=EM:12657 + EM:11582 C57BL/6N-Zmynd11/WtsiIeg EMMA archived mutant strain MGI:6119402 Zmynd11 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1913755 Zmynd11 zinc finger, MYND domain containing 11 https://www.infrafrontier.eu/search?keyword=EM:11582 + EM:11435 C57BL/6N-Zmym4/Wtsi EMMA embryo mutant strain MGI:6153718 Zmym4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1915035 Zmym4 zinc finger, MYM-type 4 https://www.infrafrontier.eu/search?keyword=EM:11435 + EM:11435 C57BL/6N-Zmym4/Wtsi EMMA sperm mutant strain MGI:6153718 Zmym4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1915035 Zmym4 zinc finger, MYM-type 4 https://www.infrafrontier.eu/search?keyword=EM:11435 + EM:12827 C57BL/6N-Zmiz1/H EMMA live mutant strain MGI:6314264 Zmiz1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3040693 Zmiz1 zinc finger, MIZ-type containing 1 https://www.infrafrontier.eu/search?keyword=EM:12827 + EM:11504 C57BL/6N-Zmiz1/H EMMA sperm mutant strain MGI:4451804 Zmiz1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3040693 Zmiz1 zinc finger, MIZ-type containing 1 https://www.infrafrontier.eu/search?keyword=EM:11504 + EM:11504 C57BL/6N-Zmiz1/H EMMA live mutant strain MGI:4451804 Zmiz1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3040693 Zmiz1 zinc finger, MIZ-type containing 1 https://www.infrafrontier.eu/search?keyword=EM:11504 + EM:10354 C57BL/6N-Zkscan17/WtsiBiat EMMA sperm mutant strain MGI:5548856 Zkscan17 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2679270 Zkscan17 zinc finger with KRAB and SCAN domains 17 https://www.infrafrontier.eu/search?keyword=EM:10354 + EM:07568 C57BL/6N-Zfyve28/Wtsi EMMA embryo mutant strain MGI:5637169 Zfyve28 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2684992 Zfyve28 zinc finger, FYVE domain containing 28 https://www.infrafrontier.eu/search?keyword=EM:07568 + EM:07568 C57BL/6N-Zfyve28/Wtsi EMMA sperm mutant strain MGI:5637169 Zfyve28 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2684992 Zfyve28 zinc finger, FYVE domain containing 28 https://www.infrafrontier.eu/search?keyword=EM:07568 + EM:09596 C57BL/6N-Zfp879/Wtsi EMMA embryo mutant strain MGI:5637179 Zfp879 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:3053099 Zfp879 zinc finger protein 879 https://www.infrafrontier.eu/search?keyword=EM:09596 + EM:09596 C57BL/6N-Zfp879/Wtsi EMMA sperm mutant strain MGI:5637179 Zfp879 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:3053099 Zfp879 zinc finger protein 879 https://www.infrafrontier.eu/search?keyword=EM:09596 + EM:11238 C57BL/6N-Zfp870/Wtsi EMMA embryo mutant strain MGI:6153716 Zfp870 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3029586 Zfp870 zinc finger protein 870 https://www.infrafrontier.eu/search?keyword=EM:11238 + EM:11238 C57BL/6N-Zfp870/Wtsi EMMA sperm mutant strain MGI:6153716 Zfp870 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3029586 Zfp870 zinc finger protein 870 https://www.infrafrontier.eu/search?keyword=EM:11238 + EM:07619 C57BL/6N-Zfp84/Wtsi EMMA embryo mutant strain MGI:5636909 Zfp84 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107780 Zfp84 zinc finger protein 84 https://www.infrafrontier.eu/search?keyword=EM:07619 + EM:07619 C57BL/6N-Zfp84/Wtsi EMMA sperm mutant strain MGI:5636909 Zfp84 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107780 Zfp84 zinc finger protein 84 https://www.infrafrontier.eu/search?keyword=EM:07619 + EM:11161 C57BL/6N-Zfp763/WtsiH EMMA sperm mutant strain MGI:6153715 Zfp763 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2146928 Zfp763 zinc finger protein 763 https://www.infrafrontier.eu/search?keyword=EM:11161 + EM:04803 C57BL/6N-Zfp760/Ieg EMMA embryo B6NTac;B6N-Zfp760/Ieg mutant strain MGI:4436640 Zfp760 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2679257 Zfp760 zinc finger protein 760 https://www.infrafrontier.eu/search?keyword=EM:04803 + EM:10813 C57BL/6N-Zfp748/Wtsi EMMA embryo mutant strain MGI:6153713 Zfp748 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1916455 Zfp748 zinc finger protein 748 https://www.infrafrontier.eu/search?keyword=EM:10813 + EM:10813 C57BL/6N-Zfp748/Wtsi EMMA sperm mutant strain MGI:6153713 Zfp748 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1916455 Zfp748 zinc finger protein 748 https://www.infrafrontier.eu/search?keyword=EM:10813 + EM:08895 C57BL/6N-Zfp719/WtsiIeg EMMA archived mutant strain MGI:5548829 Zfp719 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2444708 Zfp719 zinc finger protein 719 https://www.infrafrontier.eu/search?keyword=EM:08895 + EM:09715 C57BL/6N-Zfp69/Ieg EMMA sperm mutant strain MGI:5692574 Zfp69 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:107794 Zfp69 zinc finger protein 69 https://www.infrafrontier.eu/search?keyword=EM:09715 + EM:08587 C57BL/6N-Zfp69/Ieg EMMA embryo mutant strain MGI:5286360 Zfp69 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107794 Zfp69 zinc finger protein 69 https://www.infrafrontier.eu/search?keyword=EM:08587 + EM:11233 C57BL/6N-Zfp672/Wtsi EMMA embryo mutant strain MGI:6153712 Zfp672 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2442105 Zfp672 zinc finger protein 672 https://www.infrafrontier.eu/search?keyword=EM:11233 + EM:11233 C57BL/6N-Zfp672/Wtsi EMMA sperm mutant strain MGI:6153712 Zfp672 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2442105 Zfp672 zinc finger protein 672 https://www.infrafrontier.eu/search?keyword=EM:11233 + EM:10607 C57BL/6N-Zfp664/Wtsi EMMA embryo mutant strain MGI:5708248 Zfp664 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442505 Zfp664 zinc finger protein 664 https://www.infrafrontier.eu/search?keyword=EM:10607 + EM:10607 C57BL/6N-Zfp664/Wtsi EMMA sperm mutant strain MGI:5708248 Zfp664 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442505 Zfp664 zinc finger protein 664 https://www.infrafrontier.eu/search?keyword=EM:10607 + EM:09364 C57BL/6N-Zfp658/Wtsi EMMA embryo mutant strain MGI:5637160 Zfp658 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2652821 Zfp658 zinc finger protein 658 https://www.infrafrontier.eu/search?keyword=EM:09364 + EM:09364 C57BL/6N-Zfp658/Wtsi EMMA sperm mutant strain MGI:5637160 Zfp658 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2652821 Zfp658 zinc finger protein 658 https://www.infrafrontier.eu/search?keyword=EM:09364 + EM:11616 C57BL/6N-Zfp637/Wtsi EMMA embryo mutant strain MGI:6153711 Zfp637 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2448537 Zfp637 zinc finger protein 637 https://www.infrafrontier.eu/search?keyword=EM:11616 + EM:11616 C57BL/6N-Zfp637/Wtsi EMMA sperm mutant strain MGI:6153711 Zfp637 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2448537 Zfp637 zinc finger protein 637 https://www.infrafrontier.eu/search?keyword=EM:11616 - EM:05805 C57BL/6N-Zfp61/Cnrm EMMA sperm mutant strain MGI:4436153 Zfp61 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99663 Zfp61 zinc finger protein 61 https://www.infrafrontier.eu/search?keyword=EM:05805 + EM:08570 C57BL/6N-Zfp616/WtsiH EMMA sperm mutant strain MGI:5548908 Zfp616 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3650906 Zfp616 zinc finger protein 616 https://www.infrafrontier.eu/search?keyword=EM:08570 + EM:11240 C57BL/6N-Zfp599/Wtsi EMMA embryo mutant strain MGI:6153710 Zfp599 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2679006 Zfp599 zinc finger protein 599 https://www.infrafrontier.eu/search?keyword=EM:11240 + EM:11240 C57BL/6N-Zfp599/Wtsi EMMA sperm mutant strain MGI:6153710 Zfp599 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2679006 Zfp599 zinc finger protein 599 https://www.infrafrontier.eu/search?keyword=EM:11240 + EM:11263 C57BL/6N-Zfp58/Wtsi EMMA embryo mutant strain MGI:6153709 Zfp58 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3040705 Zfp58 zinc finger protein 58 https://www.infrafrontier.eu/search?keyword=EM:11263 + EM:11263 C57BL/6N-Zfp58/Wtsi EMMA sperm mutant strain MGI:6153709 Zfp58 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3040705 Zfp58 zinc finger protein 58 https://www.infrafrontier.eu/search?keyword=EM:11263 + EM:10816 C57BL/6N-Zfp54/Wtsi EMMA embryo mutant strain MGI:6153708 Zfp54 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107774 Zfp54 zinc finger protein 54 https://www.infrafrontier.eu/search?keyword=EM:10816 + EM:10816 C57BL/6N-Zfp54/Wtsi EMMA sperm mutant strain MGI:6153708 Zfp54 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107774 Zfp54 zinc finger protein 54 https://www.infrafrontier.eu/search?keyword=EM:10816 + EM:11382 C57BL/6N-Zfp53/Wtsi EMMA embryo mutant strain MGI:6153707 Zfp53 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:99200 Zfp53 zinc finger protein 53 https://www.infrafrontier.eu/search?keyword=EM:11382 + EM:11382 C57BL/6N-Zfp53/Wtsi EMMA sperm mutant strain MGI:6153707 Zfp53 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:99200 Zfp53 zinc finger protein 53 https://www.infrafrontier.eu/search?keyword=EM:11382 + EM:09252 C57BL/6N-Zfp445/Ieg EMMA sperm mutant strain MGI:5613658 Zfp445 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2143340 Zfp445 zinc finger protein 445 https://www.infrafrontier.eu/search?keyword=EM:09252 + EM:08509 C57BL/6N-Zfp445/Ieg EMMA sperm mutant strain MGI:4849402 Zfp445 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2143340 Zfp445 zinc finger protein 445 https://www.infrafrontier.eu/search?keyword=EM:08509 + EM:07747 C57BL/6N-Zfp408/Wtsi EMMA embryo mutant strain MGI:5637174 Zfp408 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2685857 Zfp408 zinc finger protein 408 https://www.infrafrontier.eu/search?keyword=EM:07747 + EM:07747 C57BL/6N-Zfp408/Wtsi EMMA sperm mutant strain MGI:5637174 Zfp408 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2685857 Zfp408 zinc finger protein 408 https://www.infrafrontier.eu/search?keyword=EM:07747 + EM:11378 C57BL/6N-Zfp383/Wtsi EMMA embryo mutant strain MGI:6153705 Zfp383 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1920979 Zfp383 zinc finger protein 383 https://www.infrafrontier.eu/search?keyword=EM:11378 + EM:11378 C57BL/6N-Zfp383/Wtsi EMMA sperm mutant strain MGI:6153705 Zfp383 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1920979 Zfp383 zinc finger protein 383 https://www.infrafrontier.eu/search?keyword=EM:11378 + EM:11547 C57BL/6N-Zfp292/Wtsi EMMA live mutant strain MGI:6120714 Zfp292 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1924556 Zfp292 zinc finger protein 292 https://www.infrafrontier.eu/search?keyword=EM:11547 + EM:07536 C57BL/6N-Zfp287/Wtsi EMMA embryo mutant strain MGI:5548771 Zfp287 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2176561 Zfp287 zinc finger protein 287 https://www.infrafrontier.eu/search?keyword=EM:07536 + EM:07536 C57BL/6N-Zfp287/Wtsi EMMA sperm mutant strain MGI:5548771 Zfp287 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2176561 Zfp287 zinc finger protein 287 https://www.infrafrontier.eu/search?keyword=EM:07536 + EM:08920 C57BL/6N-Zfp266/Wtsi EMMA embryo mutant strain MGI:5637091 Zfp266 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924769 Zfp266 zinc finger protein 266 https://www.infrafrontier.eu/search?keyword=EM:08920 + EM:08920 C57BL/6N-Zfp266/Wtsi EMMA sperm mutant strain MGI:5637091 Zfp266 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924769 Zfp266 zinc finger protein 266 https://www.infrafrontier.eu/search?keyword=EM:08920 + EM:10844 C57BL/6N-Zfp219/Wtsi EMMA embryo mutant strain MGI:5796933 Zfp219 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1917140 Zfp219 zinc finger protein 219 https://www.infrafrontier.eu/search?keyword=EM:10844 + EM:10844 C57BL/6N-Zfp219/Wtsi EMMA sperm mutant strain MGI:5796933 Zfp219 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1917140 Zfp219 zinc finger protein 219 https://www.infrafrontier.eu/search?keyword=EM:10844 + EM:06803 C57BL/6N-Zfp207/H EMMA sperm B6NTac;B6N-Zfp207/H mutant strain MGI:4847731 Zfp207 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1340045 Zfp207 zinc finger protein 207 https://www.infrafrontier.eu/search?keyword=EM:06803 + EM:08250 C57BL/6N-Zfp182/WtsiPh EMMA sperm mutant strain MGI:5552020 Zfp182 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442220 Zfp182 zinc finger protein 182 https://www.infrafrontier.eu/search?keyword=EM:08250 + EM:08472 C57BL/6N-Zfp119a/Ieg EMMA sperm mutant strain MGI:5548456 Zfp119a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1345189 Zfp119a zinc finger protein 119a https://www.infrafrontier.eu/search?keyword=EM:08472 + EM:08462 C57BL/6N-Zfp119a/Ieg EMMA embryo mutant strain MGI:4458716 Zfp119a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1345189 Zfp119a zinc finger protein 119a https://www.infrafrontier.eu/search?keyword=EM:08462 - EM:05839 C57BL/6N-Zdhhc5/Cnrm EMMA sperm mutant strain MGI:4841863 Zdhhc5 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1923573 Zdhhc5 zinc finger, DHHC domain containing 5 https://www.infrafrontier.eu/search?keyword=EM:05839 + EM:05657 C57BL/6N-Zdhhc24/H EMMA sperm B6NTac;B6N-Zdhhc24/H mutant strain MGI:4435901 Zdhhc24 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917855 Zdhhc24 zinc finger, DHHC domain containing 24 https://www.infrafrontier.eu/search?keyword=EM:05657 + EM:08113 C57BL/6N-Zbtb24/Ieg EMMA sperm mutant strain MGI:5548888 Zbtb24 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3039618 Zbtb24 zinc finger and BTB domain containing 24 https://www.infrafrontier.eu/search?keyword=EM:08113 + EM:06925 C57BL/6N-Zbtb24/Ieg EMMA sperm mutant strain MGI:4458660 Zbtb24 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3039618 Zbtb24 zinc finger and BTB domain containing 24 https://www.infrafrontier.eu/search?keyword=EM:06925 - EM:06000 C57BL/6N-Zbtb1/Cnrm EMMA sperm mutant strain MGI:4441870 Zbtb1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2442326 Zbtb1 zinc finger and BTB domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:06000 + EM:08529 C57BL/6N-Zbed5/Wtsi EMMA embryo EPD0593_5_A08, C57BL/6N-Zbed5/Wtsi mutant strain MGI:5637059 Zbed5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919220 Zbed5 zinc finger, BED type containing 5 https://www.infrafrontier.eu/search?keyword=EM:08529 + EM:08529 C57BL/6N-Zbed5/Wtsi EMMA sperm EPD0593_5_A08, C57BL/6N-Zbed5/Wtsi mutant strain MGI:5637059 Zbed5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919220 Zbed5 zinc finger, BED type containing 5 https://www.infrafrontier.eu/search?keyword=EM:08529 + EM:08661 C57BL/6N-Yae1d1/Ieg EMMA sperm mutant strain MGI:5548529 Yae1d1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914258 Yae1d1 Yae1 domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:08661 + EM:08638 C57BL/6N-Yae1d1/Ieg EMMA embryo mutant strain MGI:4888902 Yae1d1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914258 Yae1d1 Yae1 domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:08638 + EM:10578 C57BL/6N-Xpr1/Ph EMMA archived mutant strain MGI:4362650 Xpr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97932 Xpr1 xenotropic and polytropic retrovirus receptor 1 https://www.infrafrontier.eu/search?keyword=EM:10578 + EM:09440 C57BL/6N-Xkrx/Wtsi EMMA embryo mutant strain MGI:5637183 Xkrx targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3584011 Xkrx X-linked Kx blood group related, X-linked https://www.infrafrontier.eu/search?keyword=EM:09440 + EM:09440 C57BL/6N-Xkrx/Wtsi EMMA sperm mutant strain MGI:5637183 Xkrx targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3584011 Xkrx X-linked Kx blood group related, X-linked https://www.infrafrontier.eu/search?keyword=EM:09440 + EM:09251 C57BL/6N-Xkr5/Ieg EMMA sperm mutant strain MGI:5613662 Xkr5 targeted mutation 1b, Mouse Biology Program, UCDavis MGI:2442327 Xkr5 X-linked Kx blood group related 5 https://www.infrafrontier.eu/search?keyword=EM:09251 + EM:08726 C57BL/6N-Xkr5/Ieg EMMA embryo mutant strain MGI:4840884 Xkr5 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:2442327 Xkr5 X-linked Kx blood group related 5 https://www.infrafrontier.eu/search?keyword=EM:08726 + EM:04978 C57BL/6N-Wtap/H EMMA sperm B6NTac;B6N-Wtap/H mutant strain MGI:4434984 Wtap targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1926395 Wtap Wilms tumour 1-associating protein https://www.infrafrontier.eu/search?keyword=EM:04978 + EM:08073 C57BL/6N-Wsb2/Ieg EMMA embryo mutant strain MGI:5548747 Wsb2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2144041 Wsb2 WD repeat and SOCS box-containing 2 https://www.infrafrontier.eu/search?keyword=EM:08073 + EM:09360 C57BL/6N-Wrap53/Wtsi EMMA embryo mutant strain MGI:5637129 Wrap53 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2384933 Wrap53 WD repeat containing, antisense to Trp53 https://www.infrafrontier.eu/search?keyword=EM:09360 + EM:09360 C57BL/6N-Wrap53/Wtsi EMMA sperm mutant strain MGI:5637129 Wrap53 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2384933 Wrap53 WD repeat containing, antisense to Trp53 https://www.infrafrontier.eu/search?keyword=EM:09360 + EM:10353 C57BL/6N-Wnt16/WtsiBiat EMMA sperm mutant strain MGI:5548733 Wnt16 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2136018 Wnt16 wingless-type MMTV integration site family, member 16 https://www.infrafrontier.eu/search?keyword=EM:10353 - EM:05953 C57BL/6N-Wls/Cnrm EMMA sperm mutant strain MGI:4455675 Wls targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915401 Wls wntless WNT ligand secretion mediator https://www.infrafrontier.eu/search?keyword=EM:05953 + EM:08696 C57BL/6N-Wfikkn2/Wtsi EMMA embryo mutant strain MGI:5637164 Wfikkn2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2669209 Wfikkn2 WAP, follistatin/kazal, immunoglobulin, kunitz and netrin domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:08696 + EM:08696 C57BL/6N-Wfikkn2/Wtsi EMMA sperm mutant strain MGI:5637164 Wfikkn2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2669209 Wfikkn2 WAP, follistatin/kazal, immunoglobulin, kunitz and netrin domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:08696 + EM:04722 C57BL/6N-Washc5/Ieg EMMA embryo B6NTac;B6N-E430025E21Rik/Ieg, C57BL/6N-E430025E21Rik/Ieg mutant strain MGI:4435153 Washc5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2146270 Washc5 WASH complex subunit 5 https://www.infrafrontier.eu/search?keyword=EM:04722 + EM:09835 C57BL/6N-Washc2/Wtsi EMMA embryo mutant strain MGI:5692563 Washc2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:106463 Washc2 WASH complex subunit 2` https://www.infrafrontier.eu/search?keyword=EM:09835 + EM:09835 C57BL/6N-Washc2/Wtsi EMMA sperm mutant strain MGI:5692563 Washc2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:106463 Washc2 WASH complex subunit 2` https://www.infrafrontier.eu/search?keyword=EM:09835 + EM:08360 C57BL/6N-Wars/Ieg EMMA sperm mutant strain MGI:5548346 Wars targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:104630 Wars tryptophanyl-tRNA synthetase https://www.infrafrontier.eu/search?keyword=EM:08360 + EM:08109 C57BL/6N-Wars/Ieg EMMA embryo B6NTac;B6N-Wars/Ieg mutant strain MGI:4435065 Wars targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104630 Wars tryptophanyl-tRNA synthetase https://www.infrafrontier.eu/search?keyword=EM:08109 + EM:12198 C57BL/6N-Wac/Wtsi EMMA embryo mutant strain MGI:5925355 Wac targeted mutation 2c, Wellcome Trust Sanger Institute MGI:2387357 Wac WW domain containing adaptor with coiled-coil https://www.infrafrontier.eu/search?keyword=EM:12198 + EM:12198 C57BL/6N-Wac/Wtsi EMMA sperm mutant strain MGI:5925355 Wac targeted mutation 2c, Wellcome Trust Sanger Institute MGI:2387357 Wac WW domain containing adaptor with coiled-coil https://www.infrafrontier.eu/search?keyword=EM:12198 + EM:09595 C57BL/6N-Wac/Wtsi EMMA embryo mutant strain MGI:5637134 Wac targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2387357 Wac WW domain containing adaptor with coiled-coil https://www.infrafrontier.eu/search?keyword=EM:09595 + EM:09595 C57BL/6N-Wac/Wtsi EMMA sperm mutant strain MGI:5637134 Wac targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2387357 Wac WW domain containing adaptor with coiled-coil https://www.infrafrontier.eu/search?keyword=EM:09595 + EM:07936 C57BL/6N-Vxn/WtsiCnrm EMMA sperm C57BL/6N-3110035E14Rik/WtsiCnrm mutant strain MGI:5548679 Vxn targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924232 Vxn vexin https://www.infrafrontier.eu/search?keyword=EM:07936 + EM:09346 C57BL/6N-Vwa8/Ieg EMMA sperm mutant strain MGI:5614704 Vwa8 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919008 Vwa8 von Willebrand factor A domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:09346 + EM:08643 C57BL/6N-Vwa8/Ieg EMMA sperm mutant strain MGI:4441772 Vwa8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919008 Vwa8 von Willebrand factor A domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:08643 + EM:11006 C57BL/6N-Vsig10/Wtsi EMMA embryo mutant strain MGI:6153703 Vsig10 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2448533 Vsig10 V-set and immunoglobulin domain containing 10 https://www.infrafrontier.eu/search?keyword=EM:11006 + EM:11006 C57BL/6N-Vsig10/Wtsi EMMA sperm mutant strain MGI:6153703 Vsig10 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2448533 Vsig10 V-set and immunoglobulin domain containing 10 https://www.infrafrontier.eu/search?keyword=EM:11006 + EM:11087 C57BL/6N-Vrk1/Wtsi EMMA embryo mutant strain MGI:6153762 Vrk1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1261847 Vrk1 vaccinia related kinase 1 https://www.infrafrontier.eu/search?keyword=EM:11087 + EM:11087 C57BL/6N-Vrk1/Wtsi EMMA sperm mutant strain MGI:6153762 Vrk1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1261847 Vrk1 vaccinia related kinase 1 https://www.infrafrontier.eu/search?keyword=EM:11087 + EM:08097 C57BL/6N-Vps13c/Ieg EMMA sperm mutant strain MGI:5548822 Vps13c targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2444207 Vps13c vacuolar protein sorting 13C https://www.infrafrontier.eu/search?keyword=EM:08097 + EM:09150 C57BL/6N-Vps13c/Ieg EMMA sperm mutant strain MGI:4460376 Vps13c targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444207 Vps13c vacuolar protein sorting 13C https://www.infrafrontier.eu/search?keyword=EM:09150 + EM:07559 C57BL/6N-Vps13a/Wtsi EMMA embryo mutant strain MGI:5637150 Vps13a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2444304 Vps13a vacuolar protein sorting 13A https://www.infrafrontier.eu/search?keyword=EM:07559 + EM:07559 C57BL/6N-Vps13a/Wtsi EMMA sperm mutant strain MGI:5637150 Vps13a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2444304 Vps13a vacuolar protein sorting 13A https://www.infrafrontier.eu/search?keyword=EM:07559 + EM:10380 C57BL/6N-Vpreb3/Wtsi EMMA embryo mutant strain MGI:6153702 Vpreb3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2143638 Vpreb3 pre-B lymphocyte gene 3 https://www.infrafrontier.eu/search?keyword=EM:10380 + EM:10380 C57BL/6N-Vpreb3/Wtsi EMMA sperm mutant strain MGI:6153702 Vpreb3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2143638 Vpreb3 pre-B lymphocyte gene 3 https://www.infrafrontier.eu/search?keyword=EM:10380 + EM:10731 C57BL/6N-Vmn2r27/Wtsi EMMA embryo mutant strain MGI:6153701 Vmn2r27 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3644484 Vmn2r27 vomeronasal 2, receptor27 https://www.infrafrontier.eu/search?keyword=EM:10731 + EM:10731 C57BL/6N-Vmn2r27/Wtsi EMMA sperm mutant strain MGI:6153701 Vmn2r27 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3644484 Vmn2r27 vomeronasal 2, receptor27 https://www.infrafrontier.eu/search?keyword=EM:10731 + EM:11434 C57BL/6N-Vil1/Wtsi EMMA embryo mutant strain MGI:6153700 Vil1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:98930 Vil1 villin 1 https://www.infrafrontier.eu/search?keyword=EM:11434 + EM:11434 C57BL/6N-Vil1/Wtsi EMMA sperm mutant strain MGI:6153700 Vil1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:98930 Vil1 villin 1 https://www.infrafrontier.eu/search?keyword=EM:11434 + EM:11130 C57BL/6N-Vgll4/Ieg EMMA sperm mutant strain MGI:4841645 Vgll4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2652840 Vgll4 vestigial like family member 4 https://www.infrafrontier.eu/search?keyword=EM:11130 + EM:11492 C57BL/6N-Vgf/Wtsi EMMA embryo mutant strain MGI:6153761 Vgf endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2685898 Vgf VGF nerve growth factor inducible https://www.infrafrontier.eu/search?keyword=EM:11492 + EM:11492 C57BL/6N-Vgf/Wtsi EMMA sperm mutant strain MGI:6153761 Vgf endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2685898 Vgf VGF nerve growth factor inducible https://www.infrafrontier.eu/search?keyword=EM:11492 + EM:10235 C57BL/6N-Vdac1/Ieg EMMA sperm mutant strain MGI:5701719 Vdac1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106919 Vdac1 voltage-dependent anion channel 1 https://www.infrafrontier.eu/search?keyword=EM:10235 + EM:08577 C57BL/6N-Vdac1/Ieg EMMA sperm mutant strain MGI:4432270 Vdac1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106919 Vdac1 voltage-dependent anion channel 1 https://www.infrafrontier.eu/search?keyword=EM:08577 + EM:09918 C57BL/6N-Vamp3/Wtsi EMMA embryo mutant strain MGI:5692605 Vamp3 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1321389 Vamp3 vesicle-associated membrane protein 3 https://www.infrafrontier.eu/search?keyword=EM:09918 + EM:09918 C57BL/6N-Vamp3/Wtsi EMMA sperm mutant strain MGI:5692605 Vamp3 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1321389 Vamp3 vesicle-associated membrane protein 3 https://www.infrafrontier.eu/search?keyword=EM:09918 + EM:08285 C57BL/6N-Usp54/H EMMA sperm mutant strain MGI:5286230 Usp54 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926037 Usp54 ubiquitin specific peptidase 54 https://www.infrafrontier.eu/search?keyword=EM:08285 + EM:10433 C57BL/6N-Usp51/Wtsi EMMA embryo mutant strain MGI:6153699 Usp51 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3034959 Usp51 ubiquitin specific protease 51 https://www.infrafrontier.eu/search?keyword=EM:10433 + EM:10433 C57BL/6N-Usp51/Wtsi EMMA sperm mutant strain MGI:6153699 Usp51 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3034959 Usp51 ubiquitin specific protease 51 https://www.infrafrontier.eu/search?keyword=EM:10433 + EM:10610 C57BL/6N-Usp44/Wtsi EMMA embryo mutant strain MGI:5708261 Usp44 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3045318 Usp44 ubiquitin specific peptidase 44 https://www.infrafrontier.eu/search?keyword=EM:10610 + EM:10610 C57BL/6N-Usp44/Wtsi EMMA sperm mutant strain MGI:5708261 Usp44 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3045318 Usp44 ubiquitin specific peptidase 44 https://www.infrafrontier.eu/search?keyword=EM:10610 + EM:05481 C57BL/6N-Usp38/H EMMA sperm B6NTac;B6N-Usp38/H mutant strain MGI:4455680 Usp38 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922091 Usp38 ubiquitin specific peptidase 38 https://www.infrafrontier.eu/search?keyword=EM:05481 + EM:11162 C57BL/6N-Usp37/WtsiH EMMA sperm mutant strain MGI:6153697 Usp37 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2442483 Usp37 ubiquitin specific peptidase 37 https://www.infrafrontier.eu/search?keyword=EM:11162 + EM:10743 C57BL/6N-Usp30/H EMMA archived C57BL/6N-Usp30/WtsiH mutant strain MGI:5790643 Usp30 targeted mutation 2c, Helmholtz Zentrum Muenchen GmbH MGI:2140991 Usp30 ubiquitin specific peptidase 30 https://www.infrafrontier.eu/search?keyword=EM:10743 - EM:09833 C57BL/6N-Usp30/Wtsi EMMA embryo C57BL/6N-Usp30/WtsiH mutant strain MGI:5692776 Usp30 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2140991 Usp30 ubiquitin specific peptidase 30 https://www.infrafrontier.eu/search?keyword=EM:09833 - EM:09833 C57BL/6N-Usp30/Wtsi EMMA sperm C57BL/6N-Usp30/WtsiH mutant strain MGI:5692776 Usp30 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2140991 Usp30 ubiquitin specific peptidase 30 https://www.infrafrontier.eu/search?keyword=EM:09833 + EM:08280 C57BL/6N-Usp2/H EMMA sperm mutant strain MGI:5286393 Usp2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858178 Usp2 ubiquitin specific peptidase 2 https://www.infrafrontier.eu/search?keyword=EM:08280 + EM:11104 C57BL/6N-Usp1/Wtsi EMMA embryo mutant strain MGI:5823224 Usp1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2385198 Usp1 ubiquitin specific peptidase 1 https://www.infrafrontier.eu/search?keyword=EM:11104 + EM:11104 C57BL/6N-Usp1/Wtsi EMMA sperm mutant strain MGI:5823224 Usp1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2385198 Usp1 ubiquitin specific peptidase 1 https://www.infrafrontier.eu/search?keyword=EM:11104 + EM:10845 C57BL/6N-Usp19/Wtsi EMMA embryo mutant strain MGI:5796934 Usp19 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1918722 Usp19 ubiquitin specific peptidase 19 https://www.infrafrontier.eu/search?keyword=EM:10845 + EM:10845 C57BL/6N-Usp19/Wtsi EMMA sperm mutant strain MGI:5796934 Usp19 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1918722 Usp19 ubiquitin specific peptidase 19 https://www.infrafrontier.eu/search?keyword=EM:10845 ? EM:13193 C57BL/6N-Usp15/WtsiH EMMA live mutant strain MGI:5708164 Usp15 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:101857 Usp15 ubiquitin specific peptidase 15 https://www.infrafrontier.eu/search?keyword=EM:13193 + EM:07787 C57BL/6N-Usp14/H EMMA sperm B6NTac;B6N-Usp14/H mutant strain MGI:4460420 Usp14 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1928898 Usp14 ubiquitin specific peptidase 14 https://www.infrafrontier.eu/search?keyword=EM:07787 + EM:12707 C57BL/6N-Usp13/WtsiH EMMA live mutant strain MGI:5701723 Usp13 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919857 Usp13 ubiquitin specific peptidase 13 (isopeptidase T-3) https://www.infrafrontier.eu/search?keyword=EM:12707 + EM:08062 C57BL/6N-Usp12/Ieg EMMA embryo mutant strain MGI:5548414 Usp12 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1270128 Usp12 ubiquitin specific peptidase 12 https://www.infrafrontier.eu/search?keyword=EM:08062 + EM:11543 C57BL/6N-Usf1/Wtsi EMMA embryo mutant strain MGI:6120824 Usf1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:99542 Usf1 upstream transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:11543 + EM:11543 C57BL/6N-Usf1/Wtsi EMMA sperm mutant strain MGI:6120824 Usf1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:99542 Usf1 upstream transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:11543 + EM:10141 C57BL/6N-Uqcrh/Ieg EMMA sperm mutant strain MGI:5692661 Uqcrh targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913826 Uqcrh ubiquinol-cytochrome c reductase hinge protein https://www.infrafrontier.eu/search?keyword=EM:10141 + EM:10079 C57BL/6N-Uqcrh/Ieg EMMA sperm mutant strain MGI:4431969 Uqcrh targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913826 Uqcrh ubiquinol-cytochrome c reductase hinge protein https://www.infrafrontier.eu/search?keyword=EM:10079 + EM:08081 C57BL/6N-Uqcrb/Ieg EMMA sperm mutant strain MGI:5548543 Uqcrb targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914780 Uqcrb ubiquinol-cytochrome c reductase binding protein https://www.infrafrontier.eu/search?keyword=EM:08081 + EM:06277 C57BL/6N-Uqcrb/Ieg EMMA embryo B6NTac;B6N-Uqcrb/Ieg mutant strain MGI:5006762 Uqcrb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914780 Uqcrb ubiquinol-cytochrome c reductase binding protein https://www.infrafrontier.eu/search?keyword=EM:06277 + EM:06277 C57BL/6N-Uqcrb/Ieg EMMA sperm B6NTac;B6N-Uqcrb/Ieg mutant strain MGI:5006762 Uqcrb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914780 Uqcrb ubiquinol-cytochrome c reductase binding protein https://www.infrafrontier.eu/search?keyword=EM:06277 + EM:10612 C57BL/6N-Upk1b/Wtsi EMMA embryo mutant strain MGI:5708286 Upk1b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:98912 Upk1b uroplakin 1B https://www.infrafrontier.eu/search?keyword=EM:10612 + EM:10612 C57BL/6N-Upk1b/Wtsi EMMA sperm mutant strain MGI:5708286 Upk1b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:98912 Upk1b uroplakin 1B https://www.infrafrontier.eu/search?keyword=EM:10612 + EM:08419 C57BL/6N-Unc45a/Ieg EMMA sperm mutant strain MGI:5759982 Unc45a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2142246 Unc45a unc-45 myosin chaperone A https://www.infrafrontier.eu/search?keyword=EM:08419 + EM:12755 C57BL/6N-Uggt2/Ieg EMMA sperm mutant strain MGI:4451533 Uggt2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913685 Uggt2 UDP-glucose glycoprotein glucosyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:12755 + EM:08087 C57BL/6N-Ucp1/Ieg EMMA sperm mutant strain MGI:5692920 Ucp1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:98894 Ucp1 uncoupling protein 1 (mitochondrial, proton carrier) https://www.infrafrontier.eu/search?keyword=EM:08087 + EM:05767 C57BL/6N-Ucp1/Ieg EMMA sperm mutant strain MGI:4841543 Ucp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98894 Ucp1 uncoupling protein 1 (mitochondrial, proton carrier) https://www.infrafrontier.eu/search?keyword=EM:05767 + EM:09187 C57BL/6N-Uchl1/H EMMA sperm mutant strain MGI:4451787 Uchl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103149 Uchl1 ubiquitin carboxy-terminal hydrolase L1 https://www.infrafrontier.eu/search?keyword=EM:09187 + EM:08560 C57BL/6N-Ubxn10/Wtsi EMMA embryo mutant strain MGI:5637146 Ubxn10 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443123 Ubxn10 UBX domain protein 10 https://www.infrafrontier.eu/search?keyword=EM:08560 + EM:08560 C57BL/6N-Ubxn10/Wtsi EMMA sperm mutant strain MGI:5637146 Ubxn10 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443123 Ubxn10 UBX domain protein 10 https://www.infrafrontier.eu/search?keyword=EM:08560 + EM:09927 C57BL/6N-Ube2t/Wtsi EMMA embryo mutant strain MGI:5692669 Ube2t targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914446 Ube2t ubiquitin-conjugating enzyme E2T https://www.infrafrontier.eu/search?keyword=EM:09927 + EM:09927 C57BL/6N-Ube2t/Wtsi EMMA sperm mutant strain MGI:5692669 Ube2t targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914446 Ube2t ubiquitin-conjugating enzyme E2T https://www.infrafrontier.eu/search?keyword=EM:09927 + EM:09106 C57BL/6N-Ubash3a/Ieg EMMA sperm mutant strain MGI:5605803 Ubash3a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1926074 Ubash3a ubiquitin associated and SH3 domain containing, A https://www.infrafrontier.eu/search?keyword=EM:09106 + EM:11090 C57BL/6N-Ubac2/Ieg EMMA sperm mutant strain MGI:4453674 Ubac2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2145838 Ubac2 ubiquitin associated domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:11090 ? EM:12719 C57BL/6N-Tyr Styk1/Biat EMMA sperm mutant strain MGI:5428590 Styk1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2141396 Styk1 serine/threonine/tyrosine kinase 1 https://www.infrafrontier.eu/search?keyword=EM:12719 + EM:11178 C57BL/6N-Tyk2/Ieg EMMA sperm mutant strain MGI:5511690 Tyk2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1929470 Tyk2 tyrosine kinase 2 https://www.infrafrontier.eu/search?keyword=EM:11178 + EM:07875 C57BL/6N-Txnip/H EMMA sperm C57BL/6NTac-Txnip/H, B6NTac;B6N-Txnip/H mutant strain MGI:5008885 Txnip targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1889549 Txnip thioredoxin interacting protein https://www.infrafrontier.eu/search?keyword=EM:07875 + EM:10165 C57BL/6N-Txlna/H EMMA sperm mutant strain MGI:4436006 Txlna targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:105968 Txlna taxilin alpha https://www.infrafrontier.eu/search?keyword=EM:10165 + EM:10971 C57BL/6N-Tulp4/Biat EMMA sperm mutant strain MGI:4365109 Tulp4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916092 Tulp4 tubby like protein 4 https://www.infrafrontier.eu/search?keyword=EM:10971 + EM:10464 C57BL/6N-Tulp3/H EMMA sperm C57BL/6NTac-Tulp3/H mutant strain MGI:5752546 Tulp3 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1329045 Tulp3 tubby-like protein 3 https://www.infrafrontier.eu/search?keyword=EM:10464 + EM:10879 C57BL/6N-Tubb6/H EMMA sperm mutant strain MGI:4458679 Tubb6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915201 Tubb6 tubulin, beta 6 class V https://www.infrafrontier.eu/search?keyword=EM:10879 + EM:11512 C57BL/6N-Tuba4a/Wtsi EMMA embryo mutant strain MGI:6153696 Tuba4a endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1095410 Tuba4a tubulin, alpha 4A https://www.infrafrontier.eu/search?keyword=EM:11512 + EM:11512 C57BL/6N-Tuba4a/Wtsi EMMA sperm mutant strain MGI:6153696 Tuba4a endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1095410 Tuba4a tubulin, alpha 4A https://www.infrafrontier.eu/search?keyword=EM:11512 + EM:08430 C57BL/6N-Tuba3a/Wtsi EMMA embryo mutant strain MGI:5636920 Tuba3a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1095406 Tuba3a tubulin, alpha 3A https://www.infrafrontier.eu/search?keyword=EM:08430 + EM:08430 C57BL/6N-Tuba3a/Wtsi EMMA sperm mutant strain MGI:5636920 Tuba3a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1095406 Tuba3a tubulin, alpha 3A https://www.infrafrontier.eu/search?keyword=EM:08430 + EM:10639 C57BL/6N-Ttll10/Wtsi EMMA embryo mutant strain MGI:5775002 Ttll10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1921855 Ttll10 tubulin tyrosine ligase-like family, member 10 https://www.infrafrontier.eu/search?keyword=EM:10639 + EM:10639 C57BL/6N-Ttll10/Wtsi EMMA sperm mutant strain MGI:5775002 Ttll10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1921855 Ttll10 tubulin tyrosine ligase-like family, member 10 https://www.infrafrontier.eu/search?keyword=EM:10639 + EM:11798 C57BL/6N-Ttc14/Wtsi EMMA embryo mutant strain MGI:6257718 Ttc14 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914370 Ttc14 tetratricopeptide repeat domain 14 https://www.infrafrontier.eu/search?keyword=EM:11798 + EM:11798 C57BL/6N-Ttc14/Wtsi EMMA sperm mutant strain MGI:6257718 Ttc14 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914370 Ttc14 tetratricopeptide repeat domain 14 https://www.infrafrontier.eu/search?keyword=EM:11798 + EM:09345 C57BL/6N-Tspo/Ieg EMMA sperm mutant strain MGI:5614711 Tspo targeted mutation 1b, Wellcome Trust Sanger Institute MGI:88222 Tspo translocator protein https://www.infrafrontier.eu/search?keyword=EM:09345 + EM:08606 C57BL/6N-Tspo/Ieg EMMA embryo mutant strain MGI:5009653 Tspo targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88222 Tspo translocator protein https://www.infrafrontier.eu/search?keyword=EM:08606 + EM:11466 C57BL/6N-Tspan33/Wtsi EMMA embryo mutant strain MGI:6153695 Tspan33 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919012 Tspan33 tetraspanin 33 https://www.infrafrontier.eu/search?keyword=EM:11466 + EM:11466 C57BL/6N-Tspan33/Wtsi EMMA sperm mutant strain MGI:6153695 Tspan33 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919012 Tspan33 tetraspanin 33 https://www.infrafrontier.eu/search?keyword=EM:11466 + EM:11760 C57BL/6N-Tsks/WtsiCnrm EMMA sperm mutant strain MGI:6152743 Tsks endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1347560 Tsks testis-specific serine kinase substrate https://www.infrafrontier.eu/search?keyword=EM:11760 + EM:10324 C57BL/6N-Trps1/Wtsi EMMA embryo mutant strain MGI:6153694 Trps1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2146008 Trps1 transcriptional repressor GATA binding 1 https://www.infrafrontier.eu/search?keyword=EM:10324 + EM:10324 C57BL/6N-Trps1/Wtsi EMMA sperm mutant strain MGI:6153694 Trps1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2146008 Trps1 transcriptional repressor GATA binding 1 https://www.infrafrontier.eu/search?keyword=EM:10324 + EM:11113 C57BL/6N-Trpm7/H EMMA live mutant strain MGI:4841295 Trpm7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923209 Trpm7 transient receptor potential cation channel, subfamily M, member 7 https://www.infrafrontier.eu/search?keyword=EM:11113 + EM:10641 C57BL/6N-Trp53bp2/H EMMA sperm mutant strain MGI:4881993 Trp53bp2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2138319 Trp53bp2 transformation related protein 53 binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:10641 + EM:11741 C57BL/6N-Trp53/H EMMA live mutant strain MGI:4451930 Trp53 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98834 Trp53 transformation related protein 53 https://www.infrafrontier.eu/search?keyword=EM:11741 + EM:11239 C57BL/6N-Troap/Wtsi EMMA embryo mutant strain MGI:6153693 Troap endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2146217 Troap trophinin associated protein https://www.infrafrontier.eu/search?keyword=EM:11239 + EM:11239 C57BL/6N-Troap/Wtsi EMMA sperm mutant strain MGI:6153693 Troap endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2146217 Troap trophinin associated protein https://www.infrafrontier.eu/search?keyword=EM:11239 + EM:07548 C57BL/6N-Trmt2a/Wtsi EMMA embryo mutant strain MGI:5548943 Trmt2a targeted mutation 2b, Wellcome Trust Sanger Institute MGI:96270 Trmt2a TRM2 tRNA methyltransferase 2A https://www.infrafrontier.eu/search?keyword=EM:07548 + EM:07548 C57BL/6N-Trmt2a/Wtsi EMMA sperm mutant strain MGI:5548943 Trmt2a targeted mutation 2b, Wellcome Trust Sanger Institute MGI:96270 Trmt2a TRM2 tRNA methyltransferase 2A https://www.infrafrontier.eu/search?keyword=EM:07548 + EM:11038 C57BL/6N-Trmt2a/Ieg EMMA sperm mutant strain MGI:5811627 Trmt2a targeted mutation 1.1, Velocigene MGI:96270 Trmt2a TRM2 tRNA methyltransferase 2A https://www.infrafrontier.eu/search?keyword=EM:11038 + EM:10630 C57BL/6N-Trim6/Wtsi EMMA embryo mutant strain MGI:6153691 Trim6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1289200 Trim6 tripartite motif-containing 6 https://www.infrafrontier.eu/search?keyword=EM:10630 + EM:10630 C57BL/6N-Trim6/Wtsi EMMA sperm mutant strain MGI:6153691 Trim6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1289200 Trim6 tripartite motif-containing 6 https://www.infrafrontier.eu/search?keyword=EM:10630 + EM:08429 C57BL/6N-Trim65/Wtsi EMMA embryo mutant strain MGI:5637142 Trim65 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442815 Trim65 tripartite motif-containing 65 https://www.infrafrontier.eu/search?keyword=EM:08429 + EM:08429 C57BL/6N-Trim65/Wtsi EMMA sperm mutant strain MGI:5637142 Trim65 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442815 Trim65 tripartite motif-containing 65 https://www.infrafrontier.eu/search?keyword=EM:08429 + EM:09687 C57BL/6N-Trim39/H EMMA sperm mutant strain MGI:4434684 Trim39 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1890659 Trim39 tripartite motif-containing 39 https://www.infrafrontier.eu/search?keyword=EM:09687 + EM:07620 C57BL/6N-Trim29/WtsiCnrm EMMA sperm mutant strain MGI:5548617 Trim29 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919419 Trim29 tripartite motif-containing 29 https://www.infrafrontier.eu/search?keyword=EM:07620 + EM:09925 C57BL/6N-Trim25/Wtsi EMMA embryo mutant strain MGI:5692539 Trim25 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:102749 Trim25 tripartite motif-containing 25 https://www.infrafrontier.eu/search?keyword=EM:09925 + EM:09925 C57BL/6N-Trim25/Wtsi EMMA sperm mutant strain MGI:5692539 Trim25 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:102749 Trim25 tripartite motif-containing 25 https://www.infrafrontier.eu/search?keyword=EM:09925 + EM:11571 C57BL/6N-Trim21/WtsiIeg EMMA archived mutant strain MGI:6140225 Trim21 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:106657 Trim21 tripartite motif-containing 21 https://www.infrafrontier.eu/search?keyword=EM:11571 + EM:11236 C57BL/6N-Trerf1/Wtsi EMMA embryo mutant strain MGI:6153688 Trerf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2442086 Trerf1 transcriptional regulating factor 1 https://www.infrafrontier.eu/search?keyword=EM:11236 + EM:11236 C57BL/6N-Trerf1/Wtsi EMMA sperm mutant strain MGI:6153688 Trerf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2442086 Trerf1 transcriptional regulating factor 1 https://www.infrafrontier.eu/search?keyword=EM:11236 + EM:08667 C57BL/6N-Treml1/H EMMA sperm mutant strain MGI:4436002 Treml1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918576 Treml1 triggering receptor expressed on myeloid cells-like 1 https://www.infrafrontier.eu/search?keyword=EM:08667 + EM:11363 C57BL/6N-Trdmt1/H EMMA archived mutant strain MGI:5286348 Trdmt1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1274787 Trdmt1 tRNA aspartic acid methyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:11363 + EM:10660 C57BL/6N-Trbv19/Wtsi EMMA embryo mutant strain MGI:6153687 Trbv19 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:4439704 Trbv19 T cell receptor beta, variable 19 https://www.infrafrontier.eu/search?keyword=EM:10660 + EM:10660 C57BL/6N-Trbv19/Wtsi EMMA sperm mutant strain MGI:6153687 Trbv19 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:4439704 Trbv19 T cell receptor beta, variable 19 https://www.infrafrontier.eu/search?keyword=EM:10660 + EM:11001 C57BL/6N-Trappc9/WtsiPh EMMA sperm mutant strain MGI:5692743 Trappc9 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1923760 Trappc9 trafficking protein particle complex 9 https://www.infrafrontier.eu/search?keyword=EM:11001 + EM:10214 C57BL/6N-Trappc14/H EMMA sperm C57BL/6N-BC037034/H, C57BL/6N-Map11/H mutant strain MGI:5511727 Trappc14 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2385896 Trappc14 trafficking protein particle complex 14 https://www.infrafrontier.eu/search?keyword=EM:10214 + EM:07558 C57BL/6N-Trappc10/Wtsi EMMA embryo mutant strain MGI:5636961 Trappc10 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336209 Trappc10 trafficking protein particle complex 10 https://www.infrafrontier.eu/search?keyword=EM:07558 + EM:07558 C57BL/6N-Trappc10/Wtsi EMMA sperm mutant strain MGI:5636961 Trappc10 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336209 Trappc10 trafficking protein particle complex 10 https://www.infrafrontier.eu/search?keyword=EM:07558 + EM:09049 C57BL/6N-Tpcn2/H EMMA sperm mutant strain MGI:5692810 Tpcn2 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:2385297 Tpcn2 two pore segment channel 2 https://www.infrafrontier.eu/search?keyword=EM:09049 + EM:05903 C57BL/6N-Tpcn2/H EMMA sperm HEPD0665_2_C10, B6NTac;B6N-Tpcn2/H mutant strain MGI:4842149 Tpcn2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385297 Tpcn2 two pore segment channel 2 https://www.infrafrontier.eu/search?keyword=EM:05903 - EM:07456 C57BL/6N-Tox3/Orl EMMA sperm B6(SJL)-Tox3/Orl mutant strain MGI:6119412 Tox3 targeted mutation 1c, Mouse Biology Program, UCDavis MGI:3039593 Tox3 TOX high mobility group box family member 3 https://www.infrafrontier.eu/search?keyword=EM:07456 + EM:08142 C57BL/6N-Tomm20l/WtsiCnrm EMMA sperm mutant strain MGI:5548653 Tomm20l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922516 Tomm20l translocase of outer mitochondrial membrane 20-like https://www.infrafrontier.eu/search?keyword=EM:08142 + EM:09414 C57BL/6N-Tnxb/H EMMA sperm mutant strain MGI:4451866 Tnxb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1932137 Tnxb tenascin XB https://www.infrafrontier.eu/search?keyword=EM:09414 + EM:10846 C57BL/6N-Tnfsf18/Wtsi EMMA embryo mutant strain MGI:5796938 Tnfsf18 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2673064 Tnfsf18 tumor necrosis factor (ligand) superfamily, member 18 https://www.infrafrontier.eu/search?keyword=EM:10846 + EM:10846 C57BL/6N-Tnfsf18/Wtsi EMMA sperm mutant strain MGI:5796938 Tnfsf18 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2673064 Tnfsf18 tumor necrosis factor (ligand) superfamily, member 18 https://www.infrafrontier.eu/search?keyword=EM:10846 - EM:13136 C57BL/6N-Tnfrsf9/IcsOrl EMMA archived mutant strain MGI:6363081 Tnfrsf9 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1101059 Tnfrsf9 tumor necrosis factor receptor superfamily, member 9 https://www.infrafrontier.eu/search?keyword=EM:13136 + EM:09866 C57BL/6N-Tnfrsf1a/H EMMA sperm mutant strain MGI:5473067 Tnfrsf1a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1314884 Tnfrsf1a tumor necrosis factor receptor superfamily, member 1a https://www.infrafrontier.eu/search?keyword=EM:09866 + EM:10614 C57BL/6N-Tmprss11c/Wtsi EMMA embryo mutant strain MGI:5708263 Tmprss11c targeted mutation 2b, Wellcome Trust Sanger Institute MGI:3521861 Tmprss11c transmembrane protease, serine 11c https://www.infrafrontier.eu/search?keyword=EM:10614 + EM:10614 C57BL/6N-Tmprss11c/Wtsi EMMA sperm mutant strain MGI:5708263 Tmprss11c targeted mutation 2b, Wellcome Trust Sanger Institute MGI:3521861 Tmprss11c transmembrane protease, serine 11c https://www.infrafrontier.eu/search?keyword=EM:10614 + EM:09685 C57BL/6N-Tmem51/H EMMA sperm mutant strain MGI:4951020 Tmem51 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384874 Tmem51 transmembrane protein 51 https://www.infrafrontier.eu/search?keyword=EM:09685 + EM:09723 C57BL/6N-Tmem42/Wtsi EMMA embryo mutant strain MGI:5636939 Tmem42 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1277176 Tmem42 transmembrane protein 42 https://www.infrafrontier.eu/search?keyword=EM:09723 + EM:09723 C57BL/6N-Tmem42/Wtsi EMMA sperm mutant strain MGI:5636939 Tmem42 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1277176 Tmem42 transmembrane protein 42 https://www.infrafrontier.eu/search?keyword=EM:09723 + EM:09361 C57BL/6N-Tmem241/Wtsi EMMA embryo mutant strain MGI:5637138 Tmem241 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442435 Tmem241 transmembrane protein 241 https://www.infrafrontier.eu/search?keyword=EM:09361 + EM:09361 C57BL/6N-Tmem241/Wtsi EMMA sperm mutant strain MGI:5637138 Tmem241 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442435 Tmem241 transmembrane protein 241 https://www.infrafrontier.eu/search?keyword=EM:09361 + EM:11847 C57BL/6N-Tmem211/Wtsi EMMA embryo mutant strain MGI:5812930 Tmem211 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2685700 Tmem211 transmembrane protein 211 https://www.infrafrontier.eu/search?keyword=EM:11847 + EM:11847 C57BL/6N-Tmem211/Wtsi EMMA sperm mutant strain MGI:5812930 Tmem211 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2685700 Tmem211 transmembrane protein 211 https://www.infrafrontier.eu/search?keyword=EM:11847 + EM:09597 C57BL/6N-Tmem18/Wtsi EMMA embryo mutant strain MGI:5637133 Tmem18 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2387176 Tmem18 transmembrane protein 18 https://www.infrafrontier.eu/search?keyword=EM:09597 + EM:09597 C57BL/6N-Tmem18/Wtsi EMMA sperm mutant strain MGI:5637133 Tmem18 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2387176 Tmem18 transmembrane protein 18 https://www.infrafrontier.eu/search?keyword=EM:09597 + EM:10830 C57BL/6N-Tmem167/H EMMA sperm mutant strain MGI:4435969 Tmem167 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913324 Tmem167 transmembrane protein 167 https://www.infrafrontier.eu/search?keyword=EM:10830 + EM:11265 C57BL/6N-Tmem14c/Wtsi EMMA embryo mutant strain MGI:6153686 Tmem14c endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2145355 Tmem14c transmembrane protein 14C https://www.infrafrontier.eu/search?keyword=EM:11265 + EM:11265 C57BL/6N-Tmem14c/Wtsi EMMA sperm mutant strain MGI:6153686 Tmem14c endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2145355 Tmem14c transmembrane protein 14C https://www.infrafrontier.eu/search?keyword=EM:11265 + EM:10130 C57BL/6N-Tmem116/Ieg EMMA sperm mutant strain MGI:5695121 Tmem116 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1924712 Tmem116 transmembrane protein 116 https://www.infrafrontier.eu/search?keyword=EM:10130 + EM:09480 C57BL/6N-Tmem116/Ieg EMMA embryo mutant strain MGI:5085387 Tmem116 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924712 Tmem116 transmembrane protein 116 https://www.infrafrontier.eu/search?keyword=EM:09480 + EM:08567 C57BL/6N-Tmc3/WtsiH EMMA sperm mutant strain MGI:5548850 Tmc3 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2669033 Tmc3 transmembrane channel-like gene family 3 https://www.infrafrontier.eu/search?keyword=EM:08567 + EM:11853 C57BL/6N-Tm4sf1/Wtsi EMMA embryo mutant strain MGI:6120688 Tm4sf1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104678 Tm4sf1 transmembrane 4 superfamily member 1 https://www.infrafrontier.eu/search?keyword=EM:11853 + EM:11853 C57BL/6N-Tm4sf1/Wtsi EMMA sperm mutant strain MGI:6120688 Tm4sf1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104678 Tm4sf1 transmembrane 4 superfamily member 1 https://www.infrafrontier.eu/search?keyword=EM:11853 + EM:10052 C57BL/6N-Tlr13/Ieg EMMA sperm mutant strain MGI:5692860 Tlr13 targeted mutation 1.1, Velocigene MGI:3045213 Tlr13 toll-like receptor 13 https://www.infrafrontier.eu/search?keyword=EM:10052 + EM:11759 C57BL/6N-Tlr12/WtsiCnrm EMMA sperm mutant strain MGI:6152742 Tlr12 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3045221 Tlr12 toll-like receptor 12 https://www.infrafrontier.eu/search?keyword=EM:11759 + EM:11889 C57BL/6N-Tlr11/WtsiH EMMA sperm mutant strain MGI:6153685 Tlr11 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3045226 Tlr11 toll-like receptor 11 https://www.infrafrontier.eu/search?keyword=EM:11889 + EM:11511 C57BL/6N-Tle5/Wtsi EMMA embryo mutant strain MGI:6153271 Tle5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95806 Tle5 TLE family member 5, transcriptional modulator https://www.infrafrontier.eu/search?keyword=EM:11511 + EM:11511 C57BL/6N-Tle5/Wtsi EMMA sperm mutant strain MGI:6153271 Tle5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95806 Tle5 TLE family member 5, transcriptional modulator https://www.infrafrontier.eu/search?keyword=EM:11511 + EM:08490 C57BL/6N-Timp1/H EMMA sperm mutant strain MGI:4841598 Timp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98752 Timp1 tissue inhibitor of metalloproteinase 1 https://www.infrafrontier.eu/search?keyword=EM:08490 + EM:09592 C57BL/6N-Timmdc1/Wtsi EMMA embryo mutant strain MGI:5637083 Timmdc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922139 Timmdc1 translocase of inner mitochondrial membrane domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:09592 + EM:09592 C57BL/6N-Timmdc1/Wtsi EMMA sperm mutant strain MGI:5637083 Timmdc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922139 Timmdc1 translocase of inner mitochondrial membrane domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:09592 + EM:09834 C57BL/6N-Timeless/Wtsi EMMA embryo mutant strain MGI:5692606 Timeless targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1321393 Timeless timeless circadian clock 1 https://www.infrafrontier.eu/search?keyword=EM:09834 + EM:09834 C57BL/6N-Timeless/Wtsi EMMA sperm mutant strain MGI:5692606 Timeless targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1321393 Timeless timeless circadian clock 1 https://www.infrafrontier.eu/search?keyword=EM:09834 + EM:11857 C57BL/6N-Tigit/Wtsi EMMA embryo mutant strain MGI:6406775 Tigit targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:3642260 Tigit T cell immunoreceptor with Ig and ITIM domains https://www.infrafrontier.eu/search?keyword=EM:11857 + EM:11857 C57BL/6N-Tigit/Wtsi EMMA sperm mutant strain MGI:6406775 Tigit targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:3642260 Tigit T cell immunoreceptor with Ig and ITIM domains https://www.infrafrontier.eu/search?keyword=EM:11857 + EM:09836 C57BL/6N-Tigar/Wtsi EMMA embryo mutant strain MGI:5692824 Tigar targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442752 Tigar Trp53 induced glycolysis regulatory phosphatase https://www.infrafrontier.eu/search?keyword=EM:09836 + EM:09836 C57BL/6N-Tigar/Wtsi EMMA sperm mutant strain MGI:5692824 Tigar targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442752 Tigar Trp53 induced glycolysis regulatory phosphatase https://www.infrafrontier.eu/search?keyword=EM:09836 + EM:10415 C57BL/6N-Tial1/Wtsi EMMA embryo mutant strain MGI:5708174 Tial1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107913 Tial1 Tia1 cytotoxic granule-associated RNA binding protein-like 1 https://www.infrafrontier.eu/search?keyword=EM:10415 + EM:10415 C57BL/6N-Tial1/Wtsi EMMA sperm mutant strain MGI:5708174 Tial1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107913 Tial1 Tia1 cytotoxic granule-associated RNA binding protein-like 1 https://www.infrafrontier.eu/search?keyword=EM:10415 + EM:11068 C57BL/6N-Thg1l/Ieg EMMA sperm mutant strain MGI:4431657 Thg1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920871 Thg1l tRNA-histidine guanylyltransferase 1-like (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:11068 + EM:10643 C57BL/6N-Thada/Wtsi EMMA embryo mutant strain MGI:5548889 Thada targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3039623 Thada thyroid adenoma associated https://www.infrafrontier.eu/search?keyword=EM:10643 + EM:10643 C57BL/6N-Thada/Wtsi EMMA sperm mutant strain MGI:5548889 Thada targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3039623 Thada thyroid adenoma associated https://www.infrafrontier.eu/search?keyword=EM:10643 + EM:11896 C57BL/6N-Tgm3/WtsiH EMMA sperm mutant strain MGI:6153772 Tgm3 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:2139112 Tgm3 transglutaminase 3, E polypeptide https://www.infrafrontier.eu/search?keyword=EM:11896 + EM:12636 C57BL/6N-Tgm1/H EMMA live mutant strain MGI:4458787 Tgm1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98730 Tgm1 transglutaminase 1, K polypeptide https://www.infrafrontier.eu/search?keyword=EM:12636 + EM:07550 C57BL/6N-Tgfb1i1/Wtsi EMMA embryo mutant strain MGI:5636887 Tgfb1i1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:102784 Tgfb1i1 transforming growth factor beta 1 induced transcript 1 https://www.infrafrontier.eu/search?keyword=EM:07550 + EM:07550 C57BL/6N-Tgfb1i1/Wtsi EMMA sperm mutant strain MGI:5636887 Tgfb1i1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:102784 Tgfb1i1 transforming growth factor beta 1 induced transcript 1 https://www.infrafrontier.eu/search?keyword=EM:07550 - EM:12475 C57BL/6N-Tg(Vav1-STAT5B*N642H)726Biat/Biat EMMA archived mutant strain MGI:6164037 Tg(Vav1-STAT5B*N642H)726Biat transgene insertion 726, Biomodels Austria MGI:6164036 Tg(Vav1-STAT5B*N642H)726Biat transgene insertion 726, Biomodels Austria https://www.infrafrontier.eu/search?keyword=EM:12475 ? EM:11779 C57BL/6N-Tg(Vav-BFL1)686Biat/Biat EMMA sperm mutant strain Tg(Vav-BFL1)686Biat Tg(Vav-BFL1)686Biat Tg(Vav-BFL1)686Biat Tg(Vav-BFL1)686Biat https://www.infrafrontier.eu/search?keyword=EM:11779 ? EM:11778 C57BL/6N-Tg(Vav-BCLX)670Biat/Biat EMMA sperm mutant strain Tg(Vav-BCLX)670Biat Tg(Vav-BCLX)670Biat Tg(Vav-BCLX)670Biat Tg(Vav-BCLX)670Biat https://www.infrafrontier.eu/search?keyword=EM:11778 + EM:07327 C57BL/6N-Tg(Tnfrsf19-cre/ERT2)1Kori/Ph EMMA sperm TROY-CreERT2, C57BL/6-Tg(Tnfrsf19-cre/ERT2)1Kori/Ph mutant strain MGI:5575757 Tg(Tnfrsf19-cre/ERT2)1Kori transgene insertion 1, Vladimir Korinek MGI:5575756 Tg(Tnfrsf19-cre/ERT2)1Kori transgene insertion 1, Vladimir Korinek https://www.infrafrontier.eu/search?keyword=EM:07327 + EM:11673 C57BL/6N-Tg(Pdpn-icre)14Biat/Biat EMMA sperm Pdpn-Cre, C57BL/6N-Tg(Pdpn-Cre)408Biat mutant strain MGI:5526988 Tg(Pdpn-icre)14Biat transgene insertion 14, Biomodels Austria MGI:5526987 Tg(Pdpn-icre)14Biat transgene insertion 14, Biomodels Austria https://www.infrafrontier.eu/search?keyword=EM:11673 + EM:04887 C57BL/6N-Tg(NES/TK-PDGFB,-lacZ)312Kfn/Kctt EMMA embryo UB6n-Nestin-PDGF B-LacZ, nes/tk-Pdgfb-lacZ mutant strain MGI:5648209 Tg(NES/TK-PDGFB,-lacZ)312Kfn transgene insertion 312, Karin Forsberg-Nilsson MGI:5648207 Tg(NES/TK-PDGFB,-lacZ)312Kfn transgene insertion 312, Karin Forsberg-Nilsson https://www.infrafrontier.eu/search?keyword=EM:04887 + EM:05917 C57BL/6N-Tg(CRP-Cast)1Lbau/Orl EMMA embryo mutant strain MGI:5789386 Tg(CRP-Cast)1Lbau transgene insertion 1, Laurent Baud MGI:5789383 Tg(CRP-Cast)1Lbau transgene insertion 1, Laurent Baud https://www.infrafrontier.eu/search?keyword=EM:05917 + EM:09381 C57BL/6N-Tg(Ccl19-cre)489Biat/Biat EMMA sperm mutant strain MGI:5526991 Tg(Ccl19-cre)489Biat transgene insertion 489, Biomodels Austria MGI:5526990 Tg(Ccl19-cre)489Biat transgene insertion 489, Biomodels Austria https://www.infrafrontier.eu/search?keyword=EM:09381 ? EM:09498 C57BL/6N-Tg(CAG-mCherry)690Biat/Biat EMMA sperm mutant strain Tg(CAG-mCherry)690Biat Tg(CAG-mCherry)690Biat Tg(CAG-mCherry)690Biat Tg(CAG-mCherry)690Biat https://www.infrafrontier.eu/search?keyword=EM:09498 + EM:09626 C57BL/6N-Tfap2b/Ieg EMMA sperm mutant strain MGI:5635165 Tfap2b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104672 Tfap2b transcription factor AP-2 beta https://www.infrafrontier.eu/search?keyword=EM:09626 + EM:08633 C57BL/6N-Tfap2b/Ieg EMMA embryo mutant strain MGI:4948640 Tfap2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104672 Tfap2b transcription factor AP-2 beta https://www.infrafrontier.eu/search?keyword=EM:08633 + EM:11078 C57BL/6N-Tex261/Wtsi EMMA embryo mutant strain MGI:5812916 Tex261 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1096575 Tex261 testis expressed gene 261 https://www.infrafrontier.eu/search?keyword=EM:11078 + EM:11078 C57BL/6N-Tex261/Wtsi EMMA sperm mutant strain MGI:5812916 Tex261 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1096575 Tex261 testis expressed gene 261 https://www.infrafrontier.eu/search?keyword=EM:11078 + EM:08301 C57BL/6N-Tepsin/Wtsi EMMA embryo mutant strain MGI:5637095 Tepsin targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1926027 Tepsin TEPSIN, adaptor related protein complex 4 accessory protein https://www.infrafrontier.eu/search?keyword=EM:08301 + EM:08301 C57BL/6N-Tepsin/Wtsi EMMA sperm mutant strain MGI:5637095 Tepsin targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1926027 Tepsin TEPSIN, adaptor related protein complex 4 accessory protein https://www.infrafrontier.eu/search?keyword=EM:08301 + EM:08677 C57BL/6N-Tent5c/Wtsi EMMA embryo C57BL/6N-Fam46c/Wtsi mutant strain MGI:5637082 Tent5c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921895 Tent5c terminal nucleotidyltransferase 5C https://www.infrafrontier.eu/search?keyword=EM:08677 + EM:08677 C57BL/6N-Tent5c/Wtsi EMMA sperm C57BL/6N-Fam46c/Wtsi mutant strain MGI:5637082 Tent5c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921895 Tent5c terminal nucleotidyltransferase 5C https://www.infrafrontier.eu/search?keyword=EM:08677 + EM:11802 C57BL/6N-Tcl1b1/Wtsi EMMA embryo mutant strain MGI:6257730 Tcl1b1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1351601 Tcl1b1 T cell leukemia/lymphoma 1B, 1 https://www.infrafrontier.eu/search?keyword=EM:11802 + EM:11802 C57BL/6N-Tcl1b1/Wtsi EMMA sperm mutant strain MGI:6257730 Tcl1b1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1351601 Tcl1b1 T cell leukemia/lymphoma 1B, 1 https://www.infrafrontier.eu/search?keyword=EM:11802 + EM:12832 C57BL/6N-Tcf4/Wtsi EMMA live mutant strain MGI:6283398 Tcf4 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:98506 Tcf4 transcription factor 4 https://www.infrafrontier.eu/search?keyword=EM:12832 + EM:11890 C57BL/6N-Tcf20/WtsiH EMMA sperm mutant strain MGI:6153684 Tcf20 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1924331 Tcf20 transcription factor 20 https://www.infrafrontier.eu/search?keyword=EM:11890 + EM:07951 C57BL/6N-Tceal5/WtsiOulu EMMA embryo mutant strain MGI:5548883 Tceal5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3036236 Tceal5 transcription elongation factor A (SII)-like 5 https://www.infrafrontier.eu/search?keyword=EM:07951 + EM:07951 C57BL/6N-Tceal5/WtsiOulu EMMA sperm mutant strain MGI:5548883 Tceal5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3036236 Tceal5 transcription elongation factor A (SII)-like 5 https://www.infrafrontier.eu/search?keyword=EM:07951 + EM:08701 C57BL/6N-Tcaim/H EMMA sperm EPD0327_1_B11, B6NTac;B6N-Tcaim/H mutant strain MGI:4433698 Tcaim targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1196217 Tcaim T cell activation inhibitor, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:08701 + EM:11330 C57BL/6N-Tbl1xr1/Ieg EMMA sperm mutant strain MGI:5085358 Tbl1xr1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444715 Tbl1xr1 transducin (beta)-like 1X-linked receptor 1 https://www.infrafrontier.eu/search?keyword=EM:11330 + EM:07141 C57BL/6N-Tbkbp1/H EMMA sperm B6NTac;B6N-Tbkbp1/H mutant strain MGI:4842322 Tbkbp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920424 Tbkbp1 TBK1 binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:07141 + EM:09308 C57BL/6N-Tbce/Ieg EMMA sperm mutant strain MGI:5588279 Tbce targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1917680 Tbce tubulin-specific chaperone E https://www.infrafrontier.eu/search?keyword=EM:09308 + EM:08306 C57BL/6N-Tbce/Ieg EMMA sperm mutant strain MGI:5297130 Tbce targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1917680 Tbce tubulin-specific chaperone E https://www.infrafrontier.eu/search?keyword=EM:08306 + EM:08678 C57BL/6N-Tbc1d22a/Wtsi EMMA embryo mutant strain MGI:5636942 Tbc1d22a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1289265 Tbc1d22a TBC1 domain family, member 22a https://www.infrafrontier.eu/search?keyword=EM:08678 + EM:08678 C57BL/6N-Tbc1d22a/Wtsi EMMA sperm mutant strain MGI:5636942 Tbc1d22a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1289265 Tbc1d22a TBC1 domain family, member 22a https://www.infrafrontier.eu/search?keyword=EM:08678 + EM:10137 C57BL/6N-Tax1bp3/Ieg EMMA sperm mutant strain MGI:5692738 Tax1bp3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1923531 Tax1bp3 Tax1 (human T cell leukemia virus type I) binding protein 3 https://www.infrafrontier.eu/search?keyword=EM:10137 + EM:09585 C57BL/6N-Tax1bp3/Ieg EMMA sperm mutant strain MGI:4436221 Tax1bp3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923531 Tax1bp3 Tax1 (human T cell leukemia virus type I) binding protein 3 https://www.infrafrontier.eu/search?keyword=EM:09585 + EM:07861 C57BL/6N-Tatdn3/WtsiOulu EMMA embryo mutant strain MGI:5548575 Tatdn3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916222 Tatdn3 TatD DNase domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:07861 + EM:07861 C57BL/6N-Tatdn3/WtsiOulu EMMA sperm mutant strain MGI:5548575 Tatdn3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916222 Tatdn3 TatD DNase domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:07861 + EM:10277 C57BL/6N-Tars/Wtsi EMMA embryo mutant strain MGI:6153683 Tars endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:106314 Tars threonyl-tRNA synthetase https://www.infrafrontier.eu/search?keyword=EM:10277 + EM:10277 C57BL/6N-Tars/Wtsi EMMA sperm mutant strain MGI:6153683 Tars endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:106314 Tars threonyl-tRNA synthetase https://www.infrafrontier.eu/search?keyword=EM:10277 + EM:08625 C57BL/6N-Tardbp/H EMMA sperm mutant strain MGI:5140493 Tardbp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2387629 Tardbp TAR DNA binding protein https://www.infrafrontier.eu/search?keyword=EM:08625 + EM:10435 C57BL/6N-Tapbpl/Wtsi EMMA embryo mutant strain MGI:6153725 Tapbpl endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2384853 Tapbpl TAP binding protein-like https://www.infrafrontier.eu/search?keyword=EM:10435 + EM:10435 C57BL/6N-Tapbpl/Wtsi EMMA sperm mutant strain MGI:6153725 Tapbpl endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2384853 Tapbpl TAP binding protein-like https://www.infrafrontier.eu/search?keyword=EM:10435 + EM:10124 C57BL/6N-Tap1/Ieg EMMA sperm mutant strain MGI:5692917 Tap1 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:98483 Tap1 transporter 1, ATP-binding cassette, sub-family B (MDR/TAP) https://www.infrafrontier.eu/search?keyword=EM:10124 + EM:09400 C57BL/6N-Tap1/Ieg EMMA sperm mutant strain MGI:4868062 Tap1 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:98483 Tap1 transporter 1, ATP-binding cassette, sub-family B (MDR/TAP) https://www.infrafrontier.eu/search?keyword=EM:09400 + EM:05344 C57BL/6N-Tango6/Cnrm EMMA sperm C57BL/6N-Tmco7/Cnrm mutant strain MGI:4455865 Tango6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2142786 Tango6 transport and golgi organization 6 https://www.infrafrontier.eu/search?keyword=EM:05344 + EM:11800 C57BL/6N-Tafa2/Wtsi EMMA embryo mutant strain MGI:6257537 Tafa2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2143691 Tafa2 TAFA chemokine like family member 2 https://www.infrafrontier.eu/search?keyword=EM:11800 + EM:11800 C57BL/6N-Tafa2/Wtsi EMMA sperm mutant strain MGI:6257537 Tafa2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2143691 Tafa2 TAFA chemokine like family member 2 https://www.infrafrontier.eu/search?keyword=EM:11800 + EM:11467 C57BL/6N-Taf4b/Wtsi EMMA embryo mutant strain MGI:6153682 Taf4b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2152345 Taf4b TATA-box binding protein associated factor 4b https://www.infrafrontier.eu/search?keyword=EM:11467 + EM:11467 C57BL/6N-Taf4b/Wtsi EMMA sperm mutant strain MGI:6153682 Taf4b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2152345 Taf4b TATA-box binding protein associated factor 4b https://www.infrafrontier.eu/search?keyword=EM:11467 + EM:10749 C57BL/6N-Tada2a/Wtsi EMMA embryo mutant strain MGI:6153681 Tada2a endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2144471 Tada2a transcriptional adaptor 2A https://www.infrafrontier.eu/search?keyword=EM:10749 + EM:10749 C57BL/6N-Tada2a/Wtsi EMMA sperm mutant strain MGI:6153681 Tada2a endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2144471 Tada2a transcriptional adaptor 2A https://www.infrafrontier.eu/search?keyword=EM:10749 + EM:08402 C57BL/6N-Tacr1/Cnrm EMMA sperm mutant strain MGI:5569967 Tacr1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:98475 Tacr1 tachykinin receptor 1 https://www.infrafrontier.eu/search?keyword=EM:08402 + EM:08399 C57BL/6N-Tacr1/Cnrm EMMA embryo mutant strain MGI:5008936 Tacr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98475 Tacr1 tachykinin receptor 1 https://www.infrafrontier.eu/search?keyword=EM:08399 + EM:08399 C57BL/6N-Tacr1/Cnrm EMMA sperm mutant strain MGI:5008936 Tacr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98475 Tacr1 tachykinin receptor 1 https://www.infrafrontier.eu/search?keyword=EM:08399 + EM:06184 C57BL/6N-Synpo2/Ics EMMA embryo mutant strain MGI:4441661 Synpo2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153070 Synpo2 synaptopodin 2 https://www.infrafrontier.eu/search?keyword=EM:06184 + EM:08690 C57BL/6N-Synj1/H EMMA sperm mutant strain MGI:4432121 Synj1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354961 Synj1 synaptojanin 1 https://www.infrafrontier.eu/search?keyword=EM:08690 + EM:10362 C57BL/6N-Syncrip/Ieg EMMA sperm mutant strain MGI:4950166 Syncrip targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1891690 Syncrip synaptotagmin binding, cytoplasmic RNA interacting protein https://www.infrafrontier.eu/search?keyword=EM:10362 + EM:09307 C57BL/6N-Syk/Ieg EMMA sperm mutant strain MGI:5588292 Syk targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:99515 Syk spleen tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:09307 + EM:08239 C57BL/6N-Syk/Ieg EMMA embryo mutant strain MGI:4950230 Syk targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99515 Syk spleen tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:08239 + EM:10421 C57BL/6N-Syde1/Ieg EMMA sperm mutant strain MGI:4841821 Syde1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918959 Syde1 synapse defective 1, Rho GTPase, homolog 1 (C. elegans) https://www.infrafrontier.eu/search?keyword=EM:10421 + EM:12756 C57BL/6N-Sycp2/Ieg EMMA sperm mutant strain MGI:5516625 Sycp2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1933281 Sycp2 synaptonemal complex protein 2 https://www.infrafrontier.eu/search?keyword=EM:12756 + EM:12262 C57BL/6N-Sv2c/Wtsi EMMA embryo mutant strain MGI:6120752 Sv2c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922459 Sv2c synaptic vesicle glycoprotein 2c https://www.infrafrontier.eu/search?keyword=EM:12262 + EM:12262 C57BL/6N-Sv2c/Wtsi EMMA sperm mutant strain MGI:6120752 Sv2c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922459 Sv2c synaptic vesicle glycoprotein 2c https://www.infrafrontier.eu/search?keyword=EM:12262 + EM:08215 C57BL/6N-Sult1c1/Wtsi EMMA embryo mutant strain MGI:5636889 Sult1c1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:102928 Sult1c1 sulfotransferase family, cytosolic, 1C, member 1 https://www.infrafrontier.eu/search?keyword=EM:08215 + EM:08215 C57BL/6N-Sult1c1/Wtsi EMMA sperm mutant strain MGI:5636889 Sult1c1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:102928 Sult1c1 sulfotransferase family, cytosolic, 1C, member 1 https://www.infrafrontier.eu/search?keyword=EM:08215 + EM:11392 C57BL/6N-Sulf1/Ieg EMMA sperm mutant strain MGI:5141826 Sulf1 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:2138563 Sulf1 sulfatase 1 https://www.infrafrontier.eu/search?keyword=EM:11392 + EM:09698 C57BL/6N-Stx5a/Ieg EMMA sperm mutant strain MGI:5284918 Stx5a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1928483 Stx5a syntaxin 5A https://www.infrafrontier.eu/search?keyword=EM:09698 + EM:10805 C57BL/6N-Stom/Wtsi EMMA embryo mutant strain MGI:6153628 Stom endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95403 Stom stomatin https://www.infrafrontier.eu/search?keyword=EM:10805 + EM:10805 C57BL/6N-Stom/Wtsi EMMA sperm mutant strain MGI:6153628 Stom endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95403 Stom stomatin https://www.infrafrontier.eu/search?keyword=EM:10805 + EM:08356 C57BL/6N-Stimate/Wtsi EMMA embryo C57BL/6N-Tmem110/Wtsi mutant strain MGI:5637076 Stimate targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1921500 Stimate STIM activating enhancer https://www.infrafrontier.eu/search?keyword=EM:08356 + EM:08356 C57BL/6N-Stimate/Wtsi EMMA sperm C57BL/6N-Tmem110/Wtsi mutant strain MGI:5637076 Stimate targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1921500 Stimate STIM activating enhancer https://www.infrafrontier.eu/search?keyword=EM:08356 + EM:11485 C57BL/6N-Stat2/Wtsi EMMA embryo mutant strain MGI:6153759 Stat2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:103039 Stat2 signal transducer and activator of transcription 2 https://www.infrafrontier.eu/search?keyword=EM:11485 + EM:11485 C57BL/6N-Stat2/Wtsi EMMA sperm mutant strain MGI:6153759 Stat2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:103039 Stat2 signal transducer and activator of transcription 2 https://www.infrafrontier.eu/search?keyword=EM:11485 + EM:07546 C57BL/6N-Stard8/Wtsi EMMA embryo mutant strain MGI:5548840 Stard8 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2448556 Stard8 START domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:07546 + EM:07546 C57BL/6N-Stard8/Wtsi EMMA sperm mutant strain MGI:5548840 Stard8 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2448556 Stard8 START domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:07546 + EM:11696 C57BL/6N-Stard7/Wtsi EMMA embryo mutant strain MGI:6120770 Stard7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2139090 Stard7 START domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:11696 + EM:11696 C57BL/6N-Stard7/Wtsi EMMA sperm mutant strain MGI:6120770 Stard7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2139090 Stard7 START domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:11696 + EM:09048 C57BL/6N-Stard10/H EMMA sperm mutant strain MGI:5692642 Stard10 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1860093 Stard10 START domain containing 10 https://www.infrafrontier.eu/search?keyword=EM:09048 + EM:06202 C57BL/6N-Stard10/H EMMA sperm B6NTac;B6N-Stard10/H mutant strain MGI:4419294 Stard10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1860093 Stard10 START domain containing 10 https://www.infrafrontier.eu/search?keyword=EM:06202 + EM:11176 C57BL/6N-Stambp/H EMMA sperm mutant strain MGI:5521854 Stambp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2141643 Stambp STAM binding protein https://www.infrafrontier.eu/search?keyword=EM:11176 + EM:10123 C57BL/6N-Stac2/Ieg EMMA sperm mutant strain MGI:5692781 Stac2 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2144518 Stac2 SH3 and cysteine rich domain 2 https://www.infrafrontier.eu/search?keyword=EM:10123 + EM:10071 C57BL/6N-Stac2/Ieg EMMA sperm mutant strain MGI:4942095 Stac2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2144518 Stac2 SH3 and cysteine rich domain 2 https://www.infrafrontier.eu/search?keyword=EM:10071 + EM:09250 C57BL/6N-Sspn/Ieg EMMA sperm mutant strain MGI:5613642 Sspn targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1353511 Sspn sarcospan https://www.infrafrontier.eu/search?keyword=EM:09250 + EM:08732 C57BL/6N-Sspn/Ieg EMMA sperm mutant strain MGI:4436581 Sspn targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1353511 Sspn sarcospan https://www.infrafrontier.eu/search?keyword=EM:08732 + EM:10624 C57BL/6N-Ssc5d/Wtsi EMMA embryo mutant strain MGI:6153627 Ssc5d endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3606211 Ssc5d scavenger receptor cysteine rich family, 5 domains https://www.infrafrontier.eu/search?keyword=EM:10624 + EM:10624 C57BL/6N-Ssc5d/Wtsi EMMA sperm mutant strain MGI:6153627 Ssc5d endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3606211 Ssc5d scavenger receptor cysteine rich family, 5 domains https://www.infrafrontier.eu/search?keyword=EM:10624 + EM:12258 C57BL/6N-Srebf2/Wtsi EMMA embryo mutant strain MGI:6406767 Srebf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107585 Srebf2 sterol regulatory element binding factor 2 https://www.infrafrontier.eu/search?keyword=EM:12258 + EM:12258 C57BL/6N-Srebf2/Wtsi EMMA sperm mutant strain MGI:6406767 Srebf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107585 Srebf2 sterol regulatory element binding factor 2 https://www.infrafrontier.eu/search?keyword=EM:12258 + EM:10684 C57BL/6N-Srcap/Wtsi EMMA embryo mutant strain MGI:6153626 Srcap endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3603830 Srcap Snf2-related CREBBP activator protein https://www.infrafrontier.eu/search?keyword=EM:10684 + EM:10684 C57BL/6N-Srcap/Wtsi EMMA sperm mutant strain MGI:6153626 Srcap endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3603830 Srcap Snf2-related CREBBP activator protein https://www.infrafrontier.eu/search?keyword=EM:10684 + EM:07140 C57BL/6N-Sptbn2/H EMMA sperm B6NTac;B6N-Sptbn2/H mutant strain MGI:4841660 Sptbn2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1313261 Sptbn2 spectrin beta, non-erythrocytic 2 https://www.infrafrontier.eu/search?keyword=EM:07140 + EM:10031 C57BL/6N-Spryd3/Ieg EMMA sperm mutant strain MGI:5695128 Spryd3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2446175 Spryd3 SPRY domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:10031 + EM:04724 C57BL/6N-Spryd3/Ieg EMMA sperm B6NTac;B6N-Spryd3/Ieg mutant strain MGI:4434532 Spryd3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2446175 Spryd3 SPRY domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:04724 + EM:09683 C57BL/6N-Spice1/H EMMA sperm mutant strain MGI:5286323 Spice1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1196252 Spice1 spindle and centriole associated protein 1 https://www.infrafrontier.eu/search?keyword=EM:09683 + EM:11619 C57BL/6N-Spg21/Wtsi EMMA embryo mutant strain MGI:6153624 Spg21 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:106403 Spg21 SPG21, maspardin https://www.infrafrontier.eu/search?keyword=EM:11619 + EM:11619 C57BL/6N-Spg21/Wtsi EMMA sperm mutant strain MGI:6153624 Spg21 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:106403 Spg21 SPG21, maspardin https://www.infrafrontier.eu/search?keyword=EM:11619 + EM:08074 C57BL/6N-Spg20/Ieg EMMA sperm mutant strain MGI:5548741 Spg20 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2139806 Spg20 spastic paraplegia 20, spartin (Troyer syndrome) homolog (human) https://www.infrafrontier.eu/search?keyword=EM:08074 + EM:12191 C57BL/6N-Spats2l/Wtsi EMMA embryo mutant strain MGI:6281943 Spats2l endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914448 Spats2l spermatogenesis associated, serine-rich 2-like https://www.infrafrontier.eu/search?keyword=EM:12191 + EM:12191 C57BL/6N-Spats2l/Wtsi EMMA sperm mutant strain MGI:6281943 Spats2l endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914448 Spats2l spermatogenesis associated, serine-rich 2-like https://www.infrafrontier.eu/search?keyword=EM:12191 + EM:11570 C57BL/6N-Spaca9/WtsiIeg EMMA archived mutant strain MGI:6140224 Spaca9 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1917237 Spaca9 sperm acrosome associated 9 https://www.infrafrontier.eu/search?keyword=EM:11570 + EM:07872 C57BL/6N-Sort1/H EMMA sperm B6NTac;B6N-Sort1/H mutant strain MGI:4842306 Sort1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1338015 Sort1 sortilin 1 https://www.infrafrontier.eu/search?keyword=EM:07872 + EM:08449 C57BL/6N-Sorl1/Cnrm EMMA embryo mutant strain MGI:5569945 Sorl1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1202296 Sorl1 sortilin-related receptor, LDLR class A repeats-containing https://www.infrafrontier.eu/search?keyword=EM:08449 + EM:08449 C57BL/6N-Sorl1/Cnrm EMMA sperm mutant strain MGI:5569945 Sorl1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1202296 Sorl1 sortilin-related receptor, LDLR class A repeats-containing https://www.infrafrontier.eu/search?keyword=EM:08449 + EM:08401 C57BL/6N-Sorl1/Cnrm EMMA sperm mutant strain MGI:4451976 Sorl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202296 Sorl1 sortilin-related receptor, LDLR class A repeats-containing https://www.infrafrontier.eu/search?keyword=EM:08401 + EM:12759 C57BL/6N-Snx13/Ieg EMMA sperm mutant strain MGI:5295603 Snx13 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2661416 Snx13 sorting nexin 13 https://www.infrafrontier.eu/search?keyword=EM:12759 + EM:07007 C57BL/6N-Snrnp200/H EMMA sperm B6NTac;B6N-Snrnp200/H mutant strain MGI:4840806 Snrnp200 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:2444401 Snrnp200 small nuclear ribonucleoprotein 200 (U5) https://www.infrafrontier.eu/search?keyword=EM:07007 + EM:09934 C57BL/6N-Snorc/Oulu EMMA embryo C57BL/6N-3110079O15Rik/Oulu mutant strain MGI:5637067 Snorc targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1920484 Snorc secondary ossification center associated regulator of chondrocyte maturation https://www.infrafrontier.eu/search?keyword=EM:09934 + EM:09934 C57BL/6N-Snorc/Oulu EMMA sperm C57BL/6N-3110079O15Rik/Oulu mutant strain MGI:5637067 Snorc targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1920484 Snorc secondary ossification center associated regulator of chondrocyte maturation https://www.infrafrontier.eu/search?keyword=EM:09934 + EM:09933 C57BL/6N-Snorc/Oulu EMMA embryo C57BL/6N-3110079O15Rik/Oulu mutant strain MGI:4436063 Snorc targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920484 Snorc secondary ossification center associated regulator of chondrocyte maturation https://www.infrafrontier.eu/search?keyword=EM:09933 + EM:09933 C57BL/6N-Snorc/Oulu EMMA sperm C57BL/6N-3110079O15Rik/Oulu mutant strain MGI:4436063 Snorc targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920484 Snorc secondary ossification center associated regulator of chondrocyte maturation https://www.infrafrontier.eu/search?keyword=EM:09933 + EM:08988 C57BL/6N-Sncb/H EMMA sperm mutant strain MGI:4455731 Sncb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1889011 Sncb synuclein, beta https://www.infrafrontier.eu/search?keyword=EM:08988 + EM:08403 C57BL/6N-Sncaip/Cnrm EMMA sperm mutant strain MGI:5569950 Sncaip targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915097 Sncaip synuclein, alpha interacting protein (synphilin) https://www.infrafrontier.eu/search?keyword=EM:08403 + EM:08400 C57BL/6N-Sncaip/Cnrm EMMA sperm mutant strain MGI:4938575 Sncaip targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915097 Sncaip synuclein, alpha interacting protein (synphilin) https://www.infrafrontier.eu/search?keyword=EM:08400 + EM:09661 C57BL/6N-Snapc1/H EMMA sperm mutant strain MGI:4867920 Snapc1 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:1922877 Snapc1 small nuclear RNA activating complex, polypeptide 1 https://www.infrafrontier.eu/search?keyword=EM:09661 + EM:09868 C57BL/6N-Snap23/H EMMA sperm mutant strain MGI:4460454 Snap23 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109356 Snap23 synaptosomal-associated protein 23 https://www.infrafrontier.eu/search?keyword=EM:09868 + EM:07130 C57BL/6N-Smurf2/H EMMA sperm EPD0424_6_H08, B6NTac;B6N-Smurf2/H mutant strain MGI:4431726 Smurf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913563 Smurf2 SMAD specific E3 ubiquitin protein ligase 2 https://www.infrafrontier.eu/search?keyword=EM:07130 + EM:07888 C57BL/6N-Smpd4/WtsiCnrm EMMA sperm mutant strain MGI:5548688 Smpd4 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1924876 Smpd4 sphingomyelin phosphodiesterase 4 https://www.infrafrontier.eu/search?keyword=EM:07888 + EM:04902 C57BL/6N-Smoc1/H EMMA sperm B6NTac;B6N-Smoc1/H mutant strain MGI:4431709 Smoc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929878 Smoc1 SPARC related modular calcium binding 1 https://www.infrafrontier.eu/search?keyword=EM:04902 + EM:10634 C57BL/6N-Smim1/Wtsi EMMA embryo mutant strain MGI:6153773 Smim1 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:1918927 Smim1 small integral membrane protein 1 https://www.infrafrontier.eu/search?keyword=EM:10634 + EM:10634 C57BL/6N-Smim1/Wtsi EMMA sperm mutant strain MGI:6153773 Smim1 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:1918927 Smim1 small integral membrane protein 1 https://www.infrafrontier.eu/search?keyword=EM:10634 + EM:11219 C57BL/6N-Smim1/WtsiIeg EMMA archived mutant strain MGI:6140223 Smim1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1918927 Smim1 small integral membrane protein 1 https://www.infrafrontier.eu/search?keyword=EM:11219 + EM:09923 C57BL/6N-Smg9/Wtsi EMMA embryo mutant strain MGI:5692712 Smg9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919247 Smg9 smg-9 homolog, nonsense mediated mRNA decay factor (C. elegans) https://www.infrafrontier.eu/search?keyword=EM:09923 + EM:09923 C57BL/6N-Smg9/Wtsi EMMA sperm mutant strain MGI:5692712 Smg9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919247 Smg9 smg-9 homolog, nonsense mediated mRNA decay factor (C. elegans) https://www.infrafrontier.eu/search?keyword=EM:09923 + EM:09929 C57BL/6N-Smg1/Wtsi EMMA embryo mutant strain MGI:5692718 Smg1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919742 Smg1 SMG1 homolog, phosphatidylinositol 3-kinase-related kinase (C. elegans) https://www.infrafrontier.eu/search?keyword=EM:09929 + EM:09929 C57BL/6N-Smg1/Wtsi EMMA sperm mutant strain MGI:5692718 Smg1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919742 Smg1 SMG1 homolog, phosphatidylinositol 3-kinase-related kinase (C. elegans) https://www.infrafrontier.eu/search?keyword=EM:09929 + EM:10413 C57BL/6N-Smcr8/Cnbc EMMA sperm mutant strain MGI:4452950 Smcr8 targeted mutation 1, Velocigene MGI:2444720 Smcr8 Smith-Magenis syndrome chromosome region, candidate 8 homolog (human) https://www.infrafrontier.eu/search?keyword=EM:10413 + EM:09249 C57BL/6N-Smc6/Ieg EMMA sperm mutant strain MGI:5613644 Smc6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914491 Smc6 structural maintenance of chromosomes 6 https://www.infrafrontier.eu/search?keyword=EM:09249 + EM:08174 C57BL/6N-Slitrk4/WtsiOulu EMMA embryo mutant strain MGI:5548808 Slitrk4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442509 Slitrk4 SLIT and NTRK-like family, member 4 https://www.infrafrontier.eu/search?keyword=EM:08174 + EM:08174 C57BL/6N-Slitrk4/WtsiOulu EMMA sperm mutant strain MGI:5548808 Slitrk4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442509 Slitrk4 SLIT and NTRK-like family, member 4 https://www.infrafrontier.eu/search?keyword=EM:08174 + EM:12251 C57BL/6N-Slfnl1/Wtsi EMMA embryo mutant strain MGI:6149901 Slfnl1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3045330 Slfnl1 schlafen like 1 https://www.infrafrontier.eu/search?keyword=EM:12251 + EM:12251 C57BL/6N-Slfnl1/Wtsi EMMA sperm mutant strain MGI:6149901 Slfnl1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3045330 Slfnl1 schlafen like 1 https://www.infrafrontier.eu/search?keyword=EM:12251 + EM:07438 C57BL/6N-Slfn4/H EMMA sperm B6NTac;B6N-Slfn4/H mutant strain MGI:4944570 Slfn4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1329010 Slfn4 schlafen 4 https://www.infrafrontier.eu/search?keyword=EM:07438 + EM:11273 C57BL/6N-Slf2/Wtsi EMMA embryo mutant strain MGI:6153623 Slf2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1924968 Slf2 SMC5-SMC6 complex localization factor 2 https://www.infrafrontier.eu/search?keyword=EM:11273 + EM:11273 C57BL/6N-Slf2/Wtsi EMMA sperm mutant strain MGI:6153623 Slf2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1924968 Slf2 SMC5-SMC6 complex localization factor 2 https://www.infrafrontier.eu/search?keyword=EM:11273 + EM:07780 C57BL/6N-Slc9a4/H EMMA sperm B6NTac;B6N-Slc9a4/H mutant strain MGI:4842748 Slc9a4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105074 Slc9a4 solute carrier family 9 (sodium/hydrogen exchanger), member 4 https://www.infrafrontier.eu/search?keyword=EM:07780 + EM:09028 C57BL/6N-Slc6a2/Cnrm EMMA sperm mutant strain MGI:5588269 Slc6a2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1270850 Slc6a2 solute carrier family 6 (neurotransmitter transporter, noradrenalin), member 2 https://www.infrafrontier.eu/search?keyword=EM:09028 + EM:08398 C57BL/6N-Slc6a2/Cnrm EMMA sperm mutant strain MGI:4461511 Slc6a2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1270850 Slc6a2 solute carrier family 6 (neurotransmitter transporter, noradrenalin), member 2 https://www.infrafrontier.eu/search?keyword=EM:08398 + EM:09248 C57BL/6N-Slc6a20a/Ieg EMMA sperm mutant strain MGI:5613657 Slc6a20a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2143217 Slc6a20a solute carrier family 6 (neurotransmitter transporter), member 20A https://www.infrafrontier.eu/search?keyword=EM:09248 - EM:07866 C57BL/6N-Slc4a10/H EMMA sperm mutant strain MGI:4451535 Slc4a10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2150150 Slc4a10 solute carrier family 4, sodium bicarbonate cotransporter-like, member 10 https://www.infrafrontier.eu/search?keyword=EM:07866 + EM:08091 C57BL/6N-Slc47a1/Ieg EMMA embryo mutant strain MGI:5548541 Slc47a1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914723 Slc47a1 solute carrier family 47, member 1 https://www.infrafrontier.eu/search?keyword=EM:08091 + EM:05536 C57BL/6N-Slc47a1/Ieg EMMA embryo B6NTac;B6N-Slc47a1/Ieg mutant strain MGI:4432174 Slc47a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914723 Slc47a1 solute carrier family 47, member 1 https://www.infrafrontier.eu/search?keyword=EM:05536 + EM:10112 C57BL/6N-Slc44a4/Ieg EMMA sperm mutant strain MGI:5692698 Slc44a4 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1917379 Slc44a4 solute carrier family 44, member 4 https://www.infrafrontier.eu/search?keyword=EM:10112 + EM:09107 C57BL/6N-Slc44a4/Ieg EMMA sperm mutant strain MGI:4841742 Slc44a4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917379 Slc44a4 solute carrier family 44, member 4 https://www.infrafrontier.eu/search?keyword=EM:09107 + EM:09247 C57BL/6N-Slc44a3/Ieg EMMA sperm mutant strain MGI:5613661 Slc44a3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2384860 Slc44a3 solute carrier family 44, member 3 https://www.infrafrontier.eu/search?keyword=EM:09247 - EM:04833 C57BL/6N-Slc40a1/H EMMA sperm B6NTac;B6N-Slc40a1/H mutant strain MGI:4435780 Slc40a1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1315204 Slc40a1 solute carrier family 40 (iron-regulated transporter), member 1 https://www.infrafrontier.eu/search?keyword=EM:04833 + EM:09223 C57BL/6N-Slc2a5/Ieg EMMA sperm mutant strain MGI:5613655 Slc2a5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1928369 Slc2a5 solute carrier family 2 (facilitated glucose transporter), member 5 https://www.infrafrontier.eu/search?keyword=EM:09223 + EM:07602 C57BL/6N-Slc2a5/Ieg EMMA archived B6NTac;B6N-Slc2a5/Ieg mutant strain MGI:4842480 Slc2a5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928369 Slc2a5 solute carrier family 2 (facilitated glucose transporter), member 5 https://www.infrafrontier.eu/search?keyword=EM:07602 + EM:07531 C57BL/6N-Slc25a28/Wtsi EMMA embryo mutant strain MGI:5637123 Slc25a28 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2180509 Slc25a28 solute carrier family 25, member 28 https://www.infrafrontier.eu/search?keyword=EM:07531 + EM:07531 C57BL/6N-Slc25a28/Wtsi EMMA sperm mutant strain MGI:5637123 Slc25a28 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2180509 Slc25a28 solute carrier family 25, member 28 https://www.infrafrontier.eu/search?keyword=EM:07531 + EM:08415 C57BL/6N-Slc25a15/Ieg EMMA sperm mutant strain MGI:5636973 Slc25a15 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1342274 Slc25a15 solute carrier family 25 (mitochondrial carrier ornithine transporter), member 15 https://www.infrafrontier.eu/search?keyword=EM:08415 + EM:08408 C57BL/6N-Slc25a15/Ieg EMMA embryo mutant strain MGI:5085374 Slc25a15 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1342274 Slc25a15 solute carrier family 25 (mitochondrial carrier ornithine transporter), member 15 https://www.infrafrontier.eu/search?keyword=EM:08408 + EM:11107 C57BL/6N-Slc25a10/Ieg EMMA sperm mutant strain MGI:4460471 Slc25a10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353497 Slc25a10 solute carrier family 25 (mitochondrial carrier, dicarboxylate transporter), member 10 https://www.infrafrontier.eu/search?keyword=EM:11107 - EM:07801 C57BL/6N-Slc24a4/H EMMA sperm B6NTac;B6N-Slc24a4/H mutant strain MGI:4944392 Slc24a4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2447362 Slc24a4 solute carrier family 24 (sodium/potassium/calcium exchanger), member 4 https://www.infrafrontier.eu/search?keyword=EM:07801 + EM:07868 C57BL/6N-Slc22a8/H EMMA sperm B6NTac;B6N-Slc22a8/H mutant strain MGI:4419220 Slc22a8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1336187 Slc22a8 solute carrier family 22 (organic anion transporter), member 8 https://www.infrafrontier.eu/search?keyword=EM:07868 + EM:08067 C57BL/6N-Slc20a2/Ieg EMMA sperm mutant strain MGI:5548966 Slc20a2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:97851 Slc20a2 solute carrier family 20, member 2 https://www.infrafrontier.eu/search?keyword=EM:08067 + EM:05733 C57BL/6N-Slc17a8/Ics EMMA sperm VGluT3cKO mutant strain MGI:5645786 Slc17a8 targeted mutation 2, Salah El Mestikawy MGI:3039629 Slc17a8 solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 8 https://www.infrafrontier.eu/search?keyword=EM:05733 + EM:09570 C57BL/6N-Slc17a6/H EMMA sperm mutant strain MGI:4455898 Slc17a6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2156052 Slc17a6 solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 6 https://www.infrafrontier.eu/search?keyword=EM:09570 + EM:09352 C57BL/6N-Slc13a5/Ieg EMMA sperm mutant strain MGI:5614709 Slc13a5 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3037150 Slc13a5 solute carrier family 13 (sodium-dependent citrate transporter), member 5 https://www.infrafrontier.eu/search?keyword=EM:09352 + EM:08618 C57BL/6N-Slc13a5/Ieg EMMA sperm mutant strain MGI:4841523 Slc13a5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3037150 Slc13a5 solute carrier family 13 (sodium-dependent citrate transporter), member 5 https://www.infrafrontier.eu/search?keyword=EM:08618 + EM:09920 C57BL/6N-Slamf9/Wtsi EMMA embryo mutant strain MGI:5692740 Slamf9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923692 Slamf9 SLAM family member 9 https://www.infrafrontier.eu/search?keyword=EM:09920 + EM:09920 C57BL/6N-Slamf9/Wtsi EMMA sperm mutant strain MGI:5692740 Slamf9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923692 Slamf9 SLAM family member 9 https://www.infrafrontier.eu/search?keyword=EM:09920 + EM:10939 C57BL/6N-Skint7/Wtsi EMMA embryo mutant strain MGI:6153620 Skint7 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3041190 Skint7 selection and upkeep of intraepithelial T cells 7 https://www.infrafrontier.eu/search?keyword=EM:10939 + EM:10939 C57BL/6N-Skint7/Wtsi EMMA sperm mutant strain MGI:6153620 Skint7 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3041190 Skint7 selection and upkeep of intraepithelial T cells 7 https://www.infrafrontier.eu/search?keyword=EM:10939 + EM:09090 C57BL/6N-Siva1/Ieg EMMA sperm mutant strain MGI:5605765 Siva1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1353606 Siva1 SIVA1, apoptosis-inducing factor https://www.infrafrontier.eu/search?keyword=EM:09090 + EM:08127 C57BL/6N-Siva1/Ieg EMMA embryo B6NTac;B6N-Siva1/Ieg mutant strain MGI:4455701 Siva1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1353606 Siva1 SIVA1, apoptosis-inducing factor https://www.infrafrontier.eu/search?keyword=EM:08127 + EM:10067 C57BL/6N-Sirt6/H EMMA sperm mutant strain MGI:5692638 Sirt6 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1354161 Sirt6 sirtuin 6 https://www.infrafrontier.eu/search?keyword=EM:10067 + EM:05219 C57BL/6N-Sirt6/H EMMA sperm Sirt6(F08), B6NTac;B6N-Sirt6/H mutant strain MGI:4432093 Sirt6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354161 Sirt6 sirtuin 6 https://www.infrafrontier.eu/search?keyword=EM:05219 + EM:10236 C57BL/6N-Sirt5/Ieg EMMA sperm mutant strain MGI:5701722 Sirt5 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1915596 Sirt5 sirtuin 5 https://www.infrafrontier.eu/search?keyword=EM:10236 + EM:08621 C57BL/6N-Sirt5/Ieg EMMA embryo mutant strain MGI:5511642 Sirt5 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1915596 Sirt5 sirtuin 5 https://www.infrafrontier.eu/search?keyword=EM:08621 + EM:06825 C57BL/6N-Sirt4/H EMMA sperm B6NTac;B6N-Sirt4/H mutant strain MGI:4457551 Sirt4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922637 Sirt4 sirtuin 4 https://www.infrafrontier.eu/search?keyword=EM:06825 + EM:10146 C57BL/6N-Sirt1/H EMMA sperm mutant strain MGI:5692765 Sirt1 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:2135607 Sirt1 sirtuin 1 https://www.infrafrontier.eu/search?keyword=EM:10146 - EM:05484 C57BL/6N-Sirt1/H EMMA sperm B6NTac;B6N-Sirt1/H, EPD0428_2_B04 mutant strain MGI:4432175 Sirt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2135607 Sirt1 sirtuin 1 https://www.infrafrontier.eu/search?keyword=EM:05484 + EM:10809 C57BL/6N-Sirpb1c/Wtsi EMMA embryo mutant strain MGI:6153619 Sirpb1c endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3807521 Sirpb1c signal-regulatory protein beta 1C https://www.infrafrontier.eu/search?keyword=EM:10809 + EM:10809 C57BL/6N-Sirpb1c/Wtsi EMMA sperm mutant strain MGI:6153619 Sirpb1c endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3807521 Sirpb1c signal-regulatory protein beta 1C https://www.infrafrontier.eu/search?keyword=EM:10809 + EM:10814 C57BL/6N-Sirpb1b/Wtsi EMMA embryo mutant strain MGI:6153618 Sirpb1b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3779828 Sirpb1b signal-regulatory protein beta 1B https://www.infrafrontier.eu/search?keyword=EM:10814 + EM:10814 C57BL/6N-Sirpb1b/Wtsi EMMA sperm mutant strain MGI:6153618 Sirpb1b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3779828 Sirpb1b signal-regulatory protein beta 1B https://www.infrafrontier.eu/search?keyword=EM:10814 + EM:09622 C57BL/6N-Sipa1/H EMMA sperm mutant strain MGI:4847818 Sipa1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107576 Sipa1 signal-induced proliferation associated gene 1 https://www.infrafrontier.eu/search?keyword=EM:09622 + EM:11627 C57BL/6N-Sike1/Wtsi EMMA embryo mutant strain MGI:6153616 Sike1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1913891 Sike1 suppressor of IKBKE 1 https://www.infrafrontier.eu/search?keyword=EM:11627 + EM:11627 C57BL/6N-Sike1/Wtsi EMMA sperm mutant strain MGI:6153616 Sike1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1913891 Sike1 suppressor of IKBKE 1 https://www.infrafrontier.eu/search?keyword=EM:11627 + EM:08697 C57BL/6N-Shmt1/H EMMA sperm mutant strain MGI:4454114 Shmt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98299 Shmt1 serine hydroxymethyltransferase 1 (soluble) https://www.infrafrontier.eu/search?keyword=EM:08697 - EM:07782 C57BL/6N-Shh/H EMMA sperm B6NTac;B6N-Shh/H, EPD0339_3_A12 mutant strain MGI:4433366 Shh targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98297 Shh sonic hedgehog https://www.infrafrontier.eu/search?keyword=EM:07782 + EM:08550 C57BL/6N-Sh3pxd2a/Wtsi EMMA embryo mutant strain MGI:5636944 Sh3pxd2a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1298393 Sh3pxd2a SH3 and PX domains 2A https://www.infrafrontier.eu/search?keyword=EM:08550 + EM:08550 C57BL/6N-Sh3pxd2a/Wtsi EMMA sperm mutant strain MGI:5636944 Sh3pxd2a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1298393 Sh3pxd2a SH3 and PX domains 2A https://www.infrafrontier.eu/search?keyword=EM:08550 + EM:09145 C57BL/6N-Sh3bgrl3/Wtsi EMMA embryo mutant strain MGI:5637071 Sh3bgrl3 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1920973 Sh3bgrl3 SH3 domain binding glutamic acid-rich protein-like 3 https://www.infrafrontier.eu/search?keyword=EM:09145 + EM:09145 C57BL/6N-Sh3bgrl3/Wtsi EMMA sperm mutant strain MGI:5637071 Sh3bgrl3 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1920973 Sh3bgrl3 SH3 domain binding glutamic acid-rich protein-like 3 https://www.infrafrontier.eu/search?keyword=EM:09145 + EM:11604 C57BL/6N-Sh3bgrl2/Wtsi EMMA embryo mutant strain MGI:6153614 Sh3bgrl2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1915350 Sh3bgrl2 SH3 domain binding glutamic acid-rich protein like 2 https://www.infrafrontier.eu/search?keyword=EM:11604 + EM:11604 C57BL/6N-Sh3bgrl2/Wtsi EMMA sperm mutant strain MGI:6153614 Sh3bgrl2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1915350 Sh3bgrl2 SH3 domain binding glutamic acid-rich protein like 2 https://www.infrafrontier.eu/search?keyword=EM:11604 + EM:07621 C57BL/6N-Sgsm1/Wtsi EMMA embryo mutant strain MGI:5636905 Sgsm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107320 Sgsm1 small G protein signaling modulator 1 https://www.infrafrontier.eu/search?keyword=EM:07621 + EM:07621 C57BL/6N-Sgsm1/Wtsi EMMA sperm mutant strain MGI:5636905 Sgsm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107320 Sgsm1 small G protein signaling modulator 1 https://www.infrafrontier.eu/search?keyword=EM:07621 + EM:08418 C57BL/6N-Sgip1/Ieg EMMA sperm C57BL/6N-Sgip1/Hmgu mutant strain MGI:5548629 Sgip1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1920344 Sgip1 SH3-domain GRB2-like (endophilin) interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:08418 + EM:08411 C57BL/6N-Sgip1/Ieg EMMA sperm mutant strain MGI:4841887 Sgip1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920344 Sgip1 SH3-domain GRB2-like (endophilin) interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:08411 + EM:07902 C57BL/6N-Sfxn3/WtsiCnrm EMMA sperm mutant strain MGI:5548735 Sfxn3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2137679 Sfxn3 sideroflexin 3 https://www.infrafrontier.eu/search?keyword=EM:07902 + EM:08318 C57BL/6N-Sez6l/H EMMA sperm mutant strain MGI:4942074 Sez6l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1935121 Sez6l seizure related 6 homolog like https://www.infrafrontier.eu/search?keyword=EM:08318 + EM:11970 C57BL/6N-Setd1a/Wtsi EMMA embryo mutant strain MGI:6162235 Setd1a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2446244 Setd1a SET domain containing 1A https://www.infrafrontier.eu/search?keyword=EM:11970 + EM:11970 C57BL/6N-Setd1a/Wtsi EMMA sperm mutant strain MGI:6162235 Setd1a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2446244 Setd1a SET domain containing 1A https://www.infrafrontier.eu/search?keyword=EM:11970 + EM:10752 C57BL/6N-Serpinb9b/Wtsi EMMA embryo mutant strain MGI:6153613 Serpinb9b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:894668 Serpinb9b serine (or cysteine) peptidase inhibitor, clade B, member 9b https://www.infrafrontier.eu/search?keyword=EM:10752 + EM:10752 C57BL/6N-Serpinb9b/Wtsi EMMA sperm mutant strain MGI:6153613 Serpinb9b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:894668 Serpinb9b serine (or cysteine) peptidase inhibitor, clade B, member 9b https://www.infrafrontier.eu/search?keyword=EM:10752 + EM:10739 C57BL/6N-Serf2/H EMMA live Serf2 mutant strain MGI:6317359 Serf2 targeted mutation 1d, Helmholtz Zentrum Muenchen GmbH MGI:2139496 Serf2 small EDRK-rich factor 2 https://www.infrafrontier.eu/search?keyword=EM:10739 + EM:10831 C57BL/6N-Serf1/H EMMA sperm mutant strain MGI:4436313 Serf1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1337114 Serf1 small EDRK-rich factor 1 https://www.infrafrontier.eu/search?keyword=EM:10831 + EM:11245 C57BL/6N-Senp6/Wtsi EMMA embryo mutant strain MGI:6120751 Senp6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1922075 Senp6 SUMO/sentrin specific peptidase 6 https://www.infrafrontier.eu/search?keyword=EM:11245 + EM:11245 C57BL/6N-Senp6/Wtsi EMMA sperm mutant strain MGI:6120751 Senp6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1922075 Senp6 SUMO/sentrin specific peptidase 6 https://www.infrafrontier.eu/search?keyword=EM:11245 + EM:09031 C57BL/6N-Sema3f/H EMMA sperm mutant strain MGI:5692585 Sema3f targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1096347 Sema3f sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3F https://www.infrafrontier.eu/search?keyword=EM:09031 + EM:06945 C57BL/6N-Sema3f/H EMMA sperm B6NTac;B6N-Sema3f/H mutant strain MGI:4435144 Sema3f targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1096347 Sema3f sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3F https://www.infrafrontier.eu/search?keyword=EM:06945 + EM:08544 C57BL/6N-Sell/H EMMA sperm mutant strain MGI:4434581 Sell targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98279 Sell selectin, lymphocyte https://www.infrafrontier.eu/search?keyword=EM:08544 + EM:07981 C57BL/6N-Selk/WtsiH EMMA sperm C57BL/6N-Selenok/WtsiH mutant strain MGI:5548722 Selenok targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1931466 Selenok selenoprotein K https://www.infrafrontier.eu/search?keyword=EM:07981 + EM:08675 C57BL/6N-Selenow/Wtsi EMMA embryo C57BL/6N-Sepw1/Wtsi mutant strain MGI:5636930 Selenow targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1100878 Selenow selenoprotein W https://www.infrafrontier.eu/search?keyword=EM:08675 + EM:08675 C57BL/6N-Selenow/Wtsi EMMA sperm C57BL/6N-Sepw1/Wtsi mutant strain MGI:5636930 Selenow targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1100878 Selenow selenoprotein W https://www.infrafrontier.eu/search?keyword=EM:08675 + EM:09170 C57BL/6N-Selenok/WtsiH EMMA sperm C57BL/6N-Selk/WtsiH mutant strain MGI:5548722 Selenok targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1931466 Selenok selenoprotein K https://www.infrafrontier.eu/search?keyword=EM:09170 + EM:09227 C57BL/6N-Sec14l4/Ieg EMMA sperm mutant strain MGI:5613659 Sec14l4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2144095 Sec14l4 SEC14-like lipid binding 4 https://www.infrafrontier.eu/search?keyword=EM:09227 + EM:07612 C57BL/6N-Sec14l4/Ieg EMMA embryo B6NTac;B6N-Sec14l4/Ieg mutant strain MGI:4433028 Sec14l4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144095 Sec14l4 SEC14-like lipid binding 4 https://www.infrafrontier.eu/search?keyword=EM:07612 + EM:09697 C57BL/6N-Sec11c/Ieg EMMA sperm mutant strain MGI:4456039 Sec11c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913536 Sec11c SEC11 homolog C, signal peptidase complex subunit https://www.infrafrontier.eu/search?keyword=EM:09697 + EM:08116 C57BL/6N-Sdhb/Ieg EMMA sperm C57BL/6N-Sdhb/Hmgu mutant strain MGI:5548548 Sdhb targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914930 Sdhb succinate dehydrogenase complex, subunit B, iron sulfur (Ip) https://www.infrafrontier.eu/search?keyword=EM:08116 + EM:07615 C57BL/6N-Sdhb/Ieg EMMA embryo B6NTac;B6N-Sdhb/Ieg mutant strain MGI:5085385 Sdhb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914930 Sdhb succinate dehydrogenase complex, subunit B, iron sulfur (Ip) https://www.infrafrontier.eu/search?keyword=EM:07615 + EM:09383 C57BL/6N-Sdc4/H EMMA sperm mutant strain MGI:4451381 Sdc4 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1349164 Sdc4 syndecan 4 https://www.infrafrontier.eu/search?keyword=EM:09383 + EM:11493 C57BL/6N-Sdc3/Wtsi EMMA embryo mutant strain MGI:6153756 Sdc3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1349163 Sdc3 syndecan 3 https://www.infrafrontier.eu/search?keyword=EM:11493 + EM:11493 C57BL/6N-Sdc3/Wtsi EMMA sperm mutant strain MGI:6153756 Sdc3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1349163 Sdc3 syndecan 3 https://www.infrafrontier.eu/search?keyword=EM:11493 + EM:08059 C57BL/6N-Sdc2/Ieg EMMA sperm mutant strain MGI:5548470 Sdc2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1349165 Sdc2 syndecan 2 https://www.infrafrontier.eu/search?keyword=EM:08059 + EM:07574 C57BL/6N-Scnn1g/H EMMA sperm EPD0795_5_H04, B6NTac;B6N-Scnn1g/H mutant strain MGI:5299883 Scnn1g targeted mutation 1e, Wellcome Trust Sanger Institute MGI:104695 Scnn1g sodium channel, nonvoltage-gated 1 gamma https://www.infrafrontier.eu/search?keyword=EM:07574 - EM:04742 C57BL/6N-Scnn1b/Cnrm EMMA embryo mutant strain MGI:4435286 Scnn1b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104696 Scnn1b sodium channel, nonvoltage-gated 1 beta https://www.infrafrontier.eu/search?keyword=EM:04742 - EM:04742 C57BL/6N-Scnn1b/Cnrm EMMA sperm mutant strain MGI:4435286 Scnn1b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104696 Scnn1b sodium channel, nonvoltage-gated 1 beta https://www.infrafrontier.eu/search?keyword=EM:04742 + EM:10430 C57BL/6N-Scn4b/Wtsi EMMA embryo mutant strain MGI:6153611 Scn4b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2687406 Scn4b sodium channel, type IV, beta https://www.infrafrontier.eu/search?keyword=EM:10430 + EM:10430 C57BL/6N-Scn4b/Wtsi EMMA sperm mutant strain MGI:6153611 Scn4b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2687406 Scn4b sodium channel, type IV, beta https://www.infrafrontier.eu/search?keyword=EM:10430 - EM:06051 C57BL/6N-Scn4a/H EMMA sperm B6NTac;B6N-Scn4a/H mutant strain MGI:5284906 Scn4a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:98250 Scn4a sodium channel, voltage-gated, type IV, alpha https://www.infrafrontier.eu/search?keyword=EM:06051 + EM:11595 C57BL/6N-Scmh1/Ieg EMMA sperm mutant strain MGI:4458794 Scmh1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:2140390 Scmh1 sex comb on midleg homolog 1 https://www.infrafrontier.eu/search?keyword=EM:11595 - EM:08968 C57BL/6N-Scgb3a1/Cnrm EMMA sperm mutant strain MGI:5633832 Scgb3a1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1915912 Scgb3a1 secretoglobin, family 3A, member 1 https://www.infrafrontier.eu/search?keyword=EM:08968 + EM:11657 C57BL/6N-Scaf1/Wtsi EMMA embryo mutant strain MGI:6153610 Scaf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2141980 Scaf1 SR-related CTD-associated factor 1 https://www.infrafrontier.eu/search?keyword=EM:11657 + EM:11657 C57BL/6N-Scaf1/Wtsi EMMA sperm mutant strain MGI:6153610 Scaf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2141980 Scaf1 SR-related CTD-associated factor 1 https://www.infrafrontier.eu/search?keyword=EM:11657 + EM:11758 C57BL/6N-Scaf11/WtsiCnrm EMMA sperm mutant strain MGI:6152741 Scaf11 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1919443 Scaf11 SR-related CTD-associated factor 11 https://www.infrafrontier.eu/search?keyword=EM:11758 + EM:09856 C57BL/6N-Sbno1/H EMMA sperm mutant strain MGI:5294216 Sbno1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384298 Sbno1 strawberry notch 1 https://www.infrafrontier.eu/search?keyword=EM:09856 + EM:09462 C57BL/6N-Sarnp/Ieg EMMA sperm mutant strain MGI:5548511 Sarnp targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1913368 Sarnp SAP domain containing ribonucleoprotein https://www.infrafrontier.eu/search?keyword=EM:09462 + EM:11377 C57BL/6N-Samd7/H EMMA sperm mutant strain MGI:4455714 Samd7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923203 Samd7 sterile alpha motif domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:11377 + EM:10854 C57BL/6N-S1pr2/WtsiOulu EMMA embryo mutant strain MGI:5423977 S1pr2 stonedeaf MGI:99569 S1pr2 sphingosine-1-phosphate receptor 2 https://www.infrafrontier.eu/search?keyword=EM:10854 + EM:07322 C57BL/6N-Ryr2/H EMMA sperm mutant strain MGI:4458493 Ryr2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99685 Ryr2 ryanodine receptor 2, cardiac https://www.infrafrontier.eu/search?keyword=EM:07322 + EM:09656 C57BL/6N-Ryr1/H EMMA sperm mutant strain MGI:4951021 Ryr1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99659 Ryr1 ryanodine receptor 1, skeletal muscle https://www.infrafrontier.eu/search?keyword=EM:09656 + EM:07947 C57BL/6N-Rxfp2/Ieg EMMA embryo C57BL/6N-Rxfp2/Hmgu mutant strain MGI:5548762 Rxfp2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2153463 Rxfp2 relaxin/insulin-like family peptide receptor 2 https://www.infrafrontier.eu/search?keyword=EM:07947 + EM:07545 C57BL/6N-Rwdd1/Wtsi EMMA embryo mutant strain MGI:5637013 Rwdd1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913771 Rwdd1 RWD domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:07545 + EM:07545 C57BL/6N-Rwdd1/Wtsi EMMA sperm mutant strain MGI:5637013 Rwdd1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913771 Rwdd1 RWD domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:07545 + EM:11396 C57BL/6N-Runx1t1/H EMMA sperm mutant strain MGI:4881046 Runx1t1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104793 Runx1t1 RUNX1 translocation partner 1 https://www.infrafrontier.eu/search?keyword=EM:11396 + EM:08942 C57BL/6N-Rundc1/WtsiOulu EMMA embryo mutant strain MGI:5548750 Rundc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2144506 Rundc1 RUN domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:08942 + EM:08942 C57BL/6N-Rundc1/WtsiOulu EMMA sperm mutant strain MGI:5548750 Rundc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2144506 Rundc1 RUN domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:08942 + EM:09027 C57BL/6N-Rtraf/Cnrm EMMA sperm mutant strain MGI:5585725 Rtraf targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1915295 Rtraf RNA transcription, translation and transport factor https://www.infrafrontier.eu/search?keyword=EM:09027 + EM:08397 C57BL/6N-Rtraf/Cnrm EMMA sperm mutant strain MGI:4455868 Rtraf targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915295 Rtraf RNA transcription, translation and transport factor https://www.infrafrontier.eu/search?keyword=EM:08397 - EM:06920 C57BL/6N-Rtn1/H EMMA sperm B6NTac;B6N-Rtn1/H mutant strain MGI:4880888 Rtn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933947 Rtn1 reticulon 1 https://www.infrafrontier.eu/search?keyword=EM:06920 + EM:11188 C57BL/6N-Rsrc1/Wtsi EMMA embryo mutant strain MGI:6153607 Rsrc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914130 Rsrc1 arginine/serine-rich coiled-coil 1 https://www.infrafrontier.eu/search?keyword=EM:11188 + EM:11188 C57BL/6N-Rsrc1/Wtsi EMMA sperm mutant strain MGI:6153607 Rsrc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914130 Rsrc1 arginine/serine-rich coiled-coil 1 https://www.infrafrontier.eu/search?keyword=EM:11188 - EM:05125 C57BL/6N-Rsbn1/H EMMA sperm mutant strain MGI:4433850 Rsbn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444993 Rsbn1 rosbin, round spermatid basic protein 1 https://www.infrafrontier.eu/search?keyword=EM:05125 + EM:11084 C57BL/6N-Rreb1/Wtsi EMMA embryo mutant strain MGI:5816878 Rreb1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443664 Rreb1 ras responsive element binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:11084 + EM:11084 C57BL/6N-Rreb1/Wtsi EMMA sperm mutant strain MGI:5816878 Rreb1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443664 Rreb1 ras responsive element binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:11084 + EM:06932 C57BL/6N-Rptor/H EMMA sperm B6NTac;B6N-Rptor/H mutant strain MGI:4441657 Rptor targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1921620 Rptor regulatory associated protein of MTOR, complex 1 https://www.infrafrontier.eu/search?keyword=EM:06932 + EM:10136 C57BL/6N-Rps26/Ieg EMMA sperm mutant strain MGI:5692633 Rps26 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1351628 Rps26 ribosomal protein S26 https://www.infrafrontier.eu/search?keyword=EM:10136 + EM:10073 C57BL/6N-Rps26/Ieg EMMA sperm mutant strain MGI:5511742 Rps26 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1351628 Rps26 ribosomal protein S26 https://www.infrafrontier.eu/search?keyword=EM:10073 + EM:10062 C57BL/6N-Rps19/Ph EMMA sperm mutant strain Rps19 Rps19 MGI:1333780 Rps19 ribosomal protein S19 https://www.infrafrontier.eu/search?keyword=EM:10062 + EM:10062 C57BL/6N-Rps19/Ph EMMA live mutant strain Rps19 Rps19 MGI:1333780 Rps19 ribosomal protein S19 https://www.infrafrontier.eu/search?keyword=EM:10062 - EM:04953 C57BL/6N-Rprd1b/H EMMA sperm mutant strain MGI:4435125 Rprd1b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917720 Rprd1b regulation of nuclear pre-mRNA domain containing 1B https://www.infrafrontier.eu/search?keyword=EM:04953 + EM:10139 C57BL/6N-Rpl32/Ieg EMMA sperm mutant strain MGI:5692914 Rpl32 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:98038 Rpl32 ribosomal protein L32 https://www.infrafrontier.eu/search?keyword=EM:10139 + EM:10078 C57BL/6N-Rpl32/Ieg EMMA sperm mutant strain MGI:4842059 Rpl32 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98038 Rpl32 ribosomal protein L32 https://www.infrafrontier.eu/search?keyword=EM:10078 + EM:09509 C57BL/6N-Rph3a/Ieg EMMA sperm mutant strain MGI:5588265 Rph3a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:102788 Rph3a rabphilin 3A https://www.infrafrontier.eu/search?keyword=EM:09509 + EM:08307 C57BL/6N-Rph3a/Ieg EMMA embryo mutant strain MGI:4946758 Rph3a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:102788 Rph3a rabphilin 3A https://www.infrafrontier.eu/search?keyword=EM:08307 - EM:04900 C57BL/6N-Rpe65/H EMMA sperm mutant strain MGI:4436481 Rpe65 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98001 Rpe65 retinal pigment epithelium 65 https://www.infrafrontier.eu/search?keyword=EM:04900 + EM:08085 C57BL/6N-Rora/Ieg EMMA sperm mutant strain MGI:5548347 Rora targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104661 Rora RAR-related orphan receptor alpha https://www.infrafrontier.eu/search?keyword=EM:08085 + EM:07617 C57BL/6N-Ropn1l/WtsiCnrm EMMA sperm mutant strain MGI:5548780 Ropn1l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2182357 Ropn1l ropporin 1-like https://www.infrafrontier.eu/search?keyword=EM:07617 + EM:08622 C57BL/6N-Rnls/Ieg EMMA sperm mutant strain MGI:4847877 Rnls targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915045 Rnls renalase, FAD-dependent amine oxidase https://www.infrafrontier.eu/search?keyword=EM:08622 - EM:06917 C57BL/6N-Rnf183/H EMMA sperm B6NTac;B6N-Rnf183/H mutant strain MGI:4419200 Rnf183 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923322 Rnf183 ring finger protein 183 https://www.infrafrontier.eu/search?keyword=EM:06917 - EM:05310 C57BL/6N-Rnf169/H EMMA sperm B6NTac;B6N-Rnf169/H mutant strain MGI:4452734 Rnf169 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920257 Rnf169 ring finger protein 169 https://www.infrafrontier.eu/search?keyword=EM:05310 + EM:07554 C57BL/6N-Rnf157/Wtsi EMMA embryo mutant strain MGI:5637139 Rnf157 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442484 Rnf157 ring finger protein 157 https://www.infrafrontier.eu/search?keyword=EM:07554 + EM:07554 C57BL/6N-Rnf157/Wtsi EMMA sperm mutant strain MGI:5637139 Rnf157 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442484 Rnf157 ring finger protein 157 https://www.infrafrontier.eu/search?keyword=EM:07554 + EM:11520 C57BL/6N-Rnf145/Wtsi EMMA embryo mutant strain MGI:6153606 Rnf145 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921565 Rnf145 ring finger protein 145 https://www.infrafrontier.eu/search?keyword=EM:11520 + EM:11520 C57BL/6N-Rnf145/Wtsi EMMA sperm mutant strain MGI:6153606 Rnf145 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921565 Rnf145 ring finger protein 145 https://www.infrafrontier.eu/search?keyword=EM:11520 + EM:09928 C57BL/6N-Rnf138/Wtsi EMMA embryo mutant strain MGI:5692757 Rnf138 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1929211 Rnf138 ring finger protein 138 https://www.infrafrontier.eu/search?keyword=EM:09928 + EM:09928 C57BL/6N-Rnf138/Wtsi EMMA sperm mutant strain MGI:5692757 Rnf138 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1929211 Rnf138 ring finger protein 138 https://www.infrafrontier.eu/search?keyword=EM:09928 + EM:10264 C57BL/6N-Rnf114/Wtsi EMMA embryo mutant strain MGI:6153605 Rnf114 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2139384 Rnf114 ring finger protein 114 https://www.infrafrontier.eu/search?keyword=EM:10264 + EM:10264 C57BL/6N-Rnf114/Wtsi EMMA sperm mutant strain MGI:6153605 Rnf114 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2139384 Rnf114 ring finger protein 114 https://www.infrafrontier.eu/search?keyword=EM:10264 + EM:07881 C57BL/6N-Rnf10/Wtsi EMMA embryo mutant strain MGI:5548492 Rnf10 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1859162 Rnf10 ring finger protein 10 https://www.infrafrontier.eu/search?keyword=EM:07881 + EM:07881 C57BL/6N-Rnf10/Wtsi EMMA sperm mutant strain MGI:5548492 Rnf10 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1859162 Rnf10 ring finger protein 10 https://www.infrafrontier.eu/search?keyword=EM:07881 + EM:09019 C57BL/6N-Rnasek/Wtsi EMMA embryo mutant strain MGI:5636901 Rnasek targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106369 Rnasek ribonuclease, RNase K https://www.infrafrontier.eu/search?keyword=EM:09019 + EM:09019 C57BL/6N-Rnasek/Wtsi EMMA sperm mutant strain MGI:5636901 Rnasek targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106369 Rnasek ribonuclease, RNase K https://www.infrafrontier.eu/search?keyword=EM:09019 + EM:09880 C57BL/6N-Rnase10/Cnrm EMMA sperm mutant strain MGI:5812264 Rnase10 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1922269 Rnase10 ribonuclease, RNase A family, 10 (non-active) https://www.infrafrontier.eu/search?keyword=EM:09880 + EM:10938 C57BL/6N-Rmst/Wtsi EMMA embryo mutant strain MGI:6153604 Rmst endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3579574 Rmst rhabdomyosarcoma 2 associated transcript (non-coding RNA) https://www.infrafrontier.eu/search?keyword=EM:10938 + EM:10938 C57BL/6N-Rmst/Wtsi EMMA sperm mutant strain MGI:6153604 Rmst endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3579574 Rmst rhabdomyosarcoma 2 associated transcript (non-coding RNA) https://www.infrafrontier.eu/search?keyword=EM:10938 + EM:06799 C57BL/6N-Rlbp1/H EMMA sperm B6NTac;B6N-Rlbp1/H mutant strain MGI:4462637 Rlbp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97930 Rlbp1 retinaldehyde binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:06799 + EM:11153 C57BL/6N-Rimbp2/WtsiH EMMA sperm mutant strain MGI:6153603 Rimbp2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2443235 Rimbp2 RIMS binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:11153 + EM:08417 C57BL/6N-Rilpl1/Ieg EMMA sperm mutant strain MGI:5548660 Rilpl1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1922945 Rilpl1 Rab interacting lysosomal protein-like 1 https://www.infrafrontier.eu/search?keyword=EM:08417 + EM:08410 C57BL/6N-Rilpl1/Ieg EMMA embryo mutant strain MGI:4946743 Rilpl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922945 Rilpl1 Rab interacting lysosomal protein-like 1 https://www.infrafrontier.eu/search?keyword=EM:08410 - EM:05280 C57BL/6N-Ric8b/Cnrm EMMA embryo mutant strain MGI:4434606 Ric8b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2682307 Ric8b RIC8 guanine nucleotide exchange factor B https://www.infrafrontier.eu/search?keyword=EM:05280 - EM:05280 C57BL/6N-Ric8b/Cnrm EMMA sperm mutant strain MGI:4434606 Ric8b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2682307 Ric8b RIC8 guanine nucleotide exchange factor B https://www.infrafrontier.eu/search?keyword=EM:05280 + EM:04954 C57BL/6N-Ric1/H EMMA sperm B6NTac;B6N-Rica/H, B6NTac;B6N-Ric1/H, B6NTac;B6N-C030046E11Rik/H mutant strain MGI:4435468 Ric1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924893 Ric1 RAB6A GEF complex partner 1 https://www.infrafrontier.eu/search?keyword=EM:04954 + EM:07952 C57BL/6N-Rhox13/WtsiCnrm EMMA sperm mutant strain MGI:5548634 Rhox13 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1920864 Rhox13 reproductive homeobox 13 https://www.infrafrontier.eu/search?keyword=EM:07952 - EM:05008 C57BL/6N-Rhbdl3/H EMMA sperm mutant strain MGI:4433810 Rhbdl3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2179276 Rhbdl3 rhomboid like 3 https://www.infrafrontier.eu/search?keyword=EM:05008 + EM:10687 C57BL/6N-Rhbdf2/Wtsi EMMA embryo mutant strain MGI:6153755 Rhbdf2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1890800 Rhbdf2 rhomboid 5 homolog 2 https://www.infrafrontier.eu/search?keyword=EM:10687 + EM:10687 C57BL/6N-Rhbdf2/Wtsi EMMA sperm mutant strain MGI:6153755 Rhbdf2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1890800 Rhbdf2 rhomboid 5 homolog 2 https://www.infrafrontier.eu/search?keyword=EM:10687 + EM:06944 C57BL/6N-Rgs5/H EMMA sperm B6NTac;B6N-Rgs5/H mutant strain MGI:4432511 Rgs5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098434 Rgs5 regulator of G-protein signaling 5 https://www.infrafrontier.eu/search?keyword=EM:06944 + EM:12235 C57BL/6N-Rgs1/Wtsi EMMA embryo mutant strain Rgs1 EUCOMM targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354694 Rgs1 regulator of G-protein signaling 1 https://www.infrafrontier.eu/search?keyword=EM:12235 + EM:12235 C57BL/6N-Rgs1/Wtsi EMMA sperm mutant strain Rgs1 EUCOMM targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354694 Rgs1 regulator of G-protein signaling 1 https://www.infrafrontier.eu/search?keyword=EM:12235 + EM:10740 C57BL/6N-Rgs16/H EMMA archived mutant strain MGI:5790638 Rgs16 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:108407 Rgs16 regulator of G-protein signaling 16 https://www.infrafrontier.eu/search?keyword=EM:10740 + EM:09347 C57BL/6N-Rfxank/Ieg EMMA sperm mutant strain MGI:5614696 Rfxank targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1333865 Rfxank regulatory factor X-associated ankyrin-containing protein https://www.infrafrontier.eu/search?keyword=EM:09347 + EM:08465 C57BL/6N-Rfxank/Ieg EMMA embryo mutant strain MGI:5008000 Rfxank targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1333865 Rfxank regulatory factor X-associated ankyrin-containing protein https://www.infrafrontier.eu/search?keyword=EM:08465 + EM:09831 C57BL/6N-Rfx7/H EMMA sperm mutant strain MGI:5692823 Rfx7 targeted mutation 2c, Helmholtz Zentrum Muenchen GmbH MGI:2442675 Rfx7 regulatory factor X, 7 https://www.infrafrontier.eu/search?keyword=EM:09831 - EM:07804 C57BL/6N-Rfx7/H EMMA sperm mutant strain MGI:5511570 Rfx7 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2442675 Rfx7 regulatory factor X, 7 https://www.infrafrontier.eu/search?keyword=EM:07804 - EM:07596 C57BL/6N-Rexo2/H EMMA sperm mutant strain MGI:4433994 Rexo2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1888981 Rexo2 RNA exonuclease 2 https://www.infrafrontier.eu/search?keyword=EM:07596 + EM:08072 C57BL/6N-Rest/Ieg EMMA sperm mutant strain MGI:5692555 Rest targeted mutation 2b, Wellcome Trust Sanger Institute MGI:104897 Rest RE1-silencing transcription factor https://www.infrafrontier.eu/search?keyword=EM:08072 + EM:07990 C57BL/6N-Rel/H EMMA sperm B6NTac;B6N-Rel/H mutant strain MGI:4441649 Rel targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97897 Rel reticuloendotheliosis oncogene https://www.infrafrontier.eu/search?keyword=EM:07990 + EM:07763 C57BL/6N-Reg3d/Wtsi EMMA embryo mutant strain MGI:5636985 Reg3d targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1353426 Reg3d regenerating islet-derived 3 delta https://www.infrafrontier.eu/search?keyword=EM:07763 + EM:07763 C57BL/6N-Reg3d/Wtsi EMMA sperm mutant strain MGI:5636985 Reg3d targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1353426 Reg3d regenerating islet-derived 3 delta https://www.infrafrontier.eu/search?keyword=EM:07763 + EM:09246 C57BL/6N-Rcn1/Ieg EMMA sperm mutant strain MGI:5613634 Rcn1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:104559 Rcn1 reticulocalbin 1 https://www.infrafrontier.eu/search?keyword=EM:09246 + EM:08247 C57BL/6N-Rcn1/Ieg EMMA sperm mutant strain MGI:4841832 Rcn1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104559 Rcn1 reticulocalbin 1 https://www.infrafrontier.eu/search?keyword=EM:08247 - EM:07113 C57BL/6N-Rcc2/H EMMA sperm mutant strain MGI:4453694 Rcc2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919784 Rcc2 regulator of chromosome condensation 2 https://www.infrafrontier.eu/search?keyword=EM:07113 + EM:07752 C57BL/6N-Rbmx/Wtsi EMMA embryo mutant strain MGI:5558151 Rbmx targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1343044 Rbmx RNA binding motif protein, X chromosome https://www.infrafrontier.eu/search?keyword=EM:07752 + EM:07752 C57BL/6N-Rbmx/Wtsi EMMA sperm mutant strain MGI:5558151 Rbmx targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1343044 Rbmx RNA binding motif protein, X chromosome https://www.infrafrontier.eu/search?keyword=EM:07752 - EM:07797 C57BL/6N-Rbms1/H EMMA sperm mutant strain MGI:4433622 Rbms1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1861774 Rbms1 RNA binding motif, single stranded interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:07797 + EM:11862 C57BL/6N-Rbm7/Wtsi EMMA embryo mutant strain MGI:6257449 Rbm7 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914260 Rbm7 RNA binding motif protein 7 https://www.infrafrontier.eu/search?keyword=EM:11862 + EM:11862 C57BL/6N-Rbm7/Wtsi EMMA sperm mutant strain MGI:6257449 Rbm7 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914260 Rbm7 RNA binding motif protein 7 https://www.infrafrontier.eu/search?keyword=EM:11862 + EM:09439 C57BL/6N-Rbm33/Wtsi EMMA embryo mutant strain MGI:5637065 Rbm33 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919670 Rbm33 RNA binding motif protein 33 https://www.infrafrontier.eu/search?keyword=EM:09439 + EM:09439 C57BL/6N-Rbm33/Wtsi EMMA sperm mutant strain MGI:5637065 Rbm33 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919670 Rbm33 RNA binding motif protein 33 https://www.infrafrontier.eu/search?keyword=EM:09439 + EM:11322 C57BL/6N-Rbm24/Wtsi EMMA embryo mutant strain MGI:6153601 Rbm24 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3610364 Rbm24 RNA binding motif protein 24 https://www.infrafrontier.eu/search?keyword=EM:11322 + EM:11322 C57BL/6N-Rbm24/Wtsi EMMA sperm mutant strain MGI:6153601 Rbm24 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3610364 Rbm24 RNA binding motif protein 24 https://www.infrafrontier.eu/search?keyword=EM:11322 + EM:10108 C57BL/6N-Rbl1/Ieg EMMA sperm mutant strain MGI:5692547 Rbl1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:103300 Rbl1 RB transcriptional corepressor like 1 https://www.infrafrontier.eu/search?keyword=EM:10108 + EM:09021 C57BL/6N-Rbak/Wtsi EMMA embryo mutant strain MGI:5637097 Rbak targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1927369 Rbak RB-associated KRAB zinc finger https://www.infrafrontier.eu/search?keyword=EM:09021 + EM:09021 C57BL/6N-Rbak/Wtsi EMMA sperm mutant strain MGI:5637097 Rbak targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1927369 Rbak RB-associated KRAB zinc finger https://www.infrafrontier.eu/search?keyword=EM:09021 + EM:11482 C57BL/6N-Rasgrp3/Wtsi EMMA embryo mutant strain MGI:6153600 Rasgrp3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3028579 Rasgrp3 RAS, guanyl releasing protein 3 https://www.infrafrontier.eu/search?keyword=EM:11482 + EM:11482 C57BL/6N-Rasgrp3/Wtsi EMMA sperm mutant strain MGI:6153600 Rasgrp3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3028579 Rasgrp3 RAS, guanyl releasing protein 3 https://www.infrafrontier.eu/search?keyword=EM:11482 + EM:07839 C57BL/6N-Rapsn/H EMMA sperm B6NTac;B6N-Rapsn/H mutant strain MGI:4433819 Rapsn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99422 Rapsn receptor-associated protein of the synapse https://www.infrafrontier.eu/search?keyword=EM:07839 + EM:09354 C57BL/6N-Raph1/Wtsi EMMA embryo mutant strain MGI:5637089 Raph1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924550 Raph1 Ras association (RalGDS/AF-6) and pleckstrin homology domains 1 https://www.infrafrontier.eu/search?keyword=EM:09354 + EM:09354 C57BL/6N-Raph1/Wtsi EMMA sperm mutant strain MGI:5637089 Raph1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924550 Raph1 Ras association (RalGDS/AF-6) and pleckstrin homology domains 1 https://www.infrafrontier.eu/search?keyword=EM:09354 - EM:07401 C57BL/6N-Ramp1/H EMMA sperm B6NTac;B6N-Ramp1/H, EPD0843_4_B11 mutant strain MGI:5286381 Ramp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858418 Ramp1 receptor (calcitonin) activity modifying protein 1 https://www.infrafrontier.eu/search?keyword=EM:07401 + EM:09301 C57BL/6N-Raet1c/Ieg EMMA sperm mutant strain MGI:5548391 Raet1c targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:109431 Raet1c retinoic acid early transcript gamma https://www.infrafrontier.eu/search?keyword=EM:09301 + EM:08108 C57BL/6N-Raet1c/Ieg EMMA sperm B6NTac;B6N-Raet1c/Ieg mutant strain MGI:5008842 Raet1c targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109431 Raet1c retinoic acid early transcript gamma https://www.infrafrontier.eu/search?keyword=EM:08108 - EM:04743 C57BL/6N-Rabgap1/Cnrm EMMA embryo mutant strain MGI:4434702 Rabgap1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385139 Rabgap1 RAB GTPase activating protein 1 https://www.infrafrontier.eu/search?keyword=EM:04743 - EM:04743 C57BL/6N-Rabgap1/Cnrm EMMA sperm mutant strain MGI:4434702 Rabgap1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385139 Rabgap1 RAB GTPase activating protein 1 https://www.infrafrontier.eu/search?keyword=EM:04743 + EM:08094 C57BL/6N-Rab35/Ieg EMMA embryo mutant strain MGI:5548685 Rab35 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1924657 Rab35 RAB35, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:08094 + EM:11484 C57BL/6N-Rab30/Wtsi EMMA embryo mutant strain MGI:6153599 Rab30 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1923235 Rab30 RAB30, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:11484 + EM:11484 C57BL/6N-Rab30/Wtsi EMMA sperm mutant strain MGI:6153599 Rab30 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1923235 Rab30 RAB30, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:11484 + EM:08807 C57BL/6N-Rab23/H EMMA sperm mutant strain MGI:4460477 Rab23 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99833 Rab23 RAB23, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:08807 - EM:09673 C57BL/6N-Rab21/Wtsi EMMA embryo mutant strain MGI:5638577 Rab21 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:894308 Rab21 RAB21, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:09673 - EM:09673 C57BL/6N-Rab21/Wtsi EMMA sperm mutant strain MGI:5638577 Rab21 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:894308 Rab21 RAB21, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:09673 + EM:11258 C57BL/6N-Rab1a/H EMMA sperm mutant strain MGI:4363435 Rab1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97842 Rab1a RAB1A, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:11258 + EM:10629 C57BL/6N-Pvr/Wtsi EMMA embryo mutant strain MGI:6153598 Pvr endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1917954 Pvr poliovirus receptor https://www.infrafrontier.eu/search?keyword=EM:10629 + EM:10629 C57BL/6N-Pvr/Wtsi EMMA sperm mutant strain MGI:6153598 Pvr endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1917954 Pvr poliovirus receptor https://www.infrafrontier.eu/search?keyword=EM:10629 + EM:10228 C57BL/6N-Pus10/Wtsi EMMA embryo mutant strain MGI:5701724 Pus10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1921717 Pus10 pseudouridylate synthase 10 https://www.infrafrontier.eu/search?keyword=EM:10228 + EM:10228 C57BL/6N-Pus10/Wtsi EMMA sperm mutant strain MGI:5701724 Pus10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1921717 Pus10 pseudouridylate synthase 10 https://www.infrafrontier.eu/search?keyword=EM:10228 + EM:10888 C57BL/6N-Pts/H EMMA sperm mutant strain MGI:4944538 Pts targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1338783 Pts 6-pyruvoyl-tetrahydropterin synthase https://www.infrafrontier.eu/search?keyword=EM:10888 + EM:08359 C57BL/6N-Ptpn23/Ieg EMMA sperm mutant strain MGI:5567111 Ptpn23 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2144837 Ptpn23 protein tyrosine phosphatase, non-receptor type 23 https://www.infrafrontier.eu/search?keyword=EM:08359 + EM:08101 C57BL/6N-Ptpn23/Ieg EMMA sperm B6NTac;B6N-Ptpn23/Ieg mutant strain MGI:4434698 Ptpn23 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2144837 Ptpn23 protein tyrosine phosphatase, non-receptor type 23 https://www.infrafrontier.eu/search?keyword=EM:08101 + EM:10694 C57BL/6N-Ptk7/H EMMA sperm mutant strain MGI:5319349 Ptk7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918711 Ptk7 PTK7 protein tyrosine kinase 7 https://www.infrafrontier.eu/search?keyword=EM:10694 + EM:11624 C57BL/6N-Ptk2b/Wtsi EMMA embryo mutant strain MGI:6153597 Ptk2b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:104908 Ptk2b PTK2 protein tyrosine kinase 2 beta https://www.infrafrontier.eu/search?keyword=EM:11624 + EM:11624 C57BL/6N-Ptk2b/Wtsi EMMA sperm mutant strain MGI:6153597 Ptk2b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:104908 Ptk2b PTK2 protein tyrosine kinase 2 beta https://www.infrafrontier.eu/search?keyword=EM:11624 + EM:09696 C57BL/6N-Psmc2/Ieg EMMA sperm mutant strain MGI:4841895 Psmc2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109555 Psmc2 proteasome (prosome, macropain) 26S subunit, ATPase 2 https://www.infrafrontier.eu/search?keyword=EM:09696 + EM:10818 C57BL/6N-Psg29/Wtsi EMMA embryo mutant strain MGI:6153596 Psg29 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3028473 Psg29 pregnancy-specific glycoprotein 29 https://www.infrafrontier.eu/search?keyword=EM:10818 + EM:10818 C57BL/6N-Psg29/Wtsi EMMA sperm mutant strain MGI:6153596 Psg29 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3028473 Psg29 pregnancy-specific glycoprotein 29 https://www.infrafrontier.eu/search?keyword=EM:10818 + EM:10817 C57BL/6N-Psg27/Wtsi EMMA embryo mutant strain MGI:6153595 Psg27 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3649013 Psg27 pregnancy-specific glycoprotein 27 https://www.infrafrontier.eu/search?keyword=EM:10817 + EM:10817 C57BL/6N-Psg27/Wtsi EMMA sperm mutant strain MGI:6153595 Psg27 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3649013 Psg27 pregnancy-specific glycoprotein 27 https://www.infrafrontier.eu/search?keyword=EM:10817 + EM:10807 C57BL/6N-Psg26/Wtsi EMMA embryo mutant strain MGI:6153594 Psg26 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3643750 Psg26 pregnancy-specific glycoprotein 26 https://www.infrafrontier.eu/search?keyword=EM:10807 + EM:10807 C57BL/6N-Psg26/Wtsi EMMA sperm mutant strain MGI:6153594 Psg26 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3643750 Psg26 pregnancy-specific glycoprotein 26 https://www.infrafrontier.eu/search?keyword=EM:10807 + EM:11013 C57BL/6N-Psg25/Wtsi EMMA embryo mutant strain MGI:6153593 Psg25 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891357 Psg25 pregnancy-specific glycoprotein 25 https://www.infrafrontier.eu/search?keyword=EM:11013 + EM:11013 C57BL/6N-Psg25/Wtsi EMMA sperm mutant strain MGI:6153593 Psg25 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891357 Psg25 pregnancy-specific glycoprotein 25 https://www.infrafrontier.eu/search?keyword=EM:11013 + EM:11015 C57BL/6N-Psg22/Wtsi EMMA embryo mutant strain MGI:6153592 Psg22 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2681855 Psg22 pregnancy-specific glycoprotein 22 https://www.infrafrontier.eu/search?keyword=EM:11015 + EM:11015 C57BL/6N-Psg22/Wtsi EMMA sperm mutant strain MGI:6153592 Psg22 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2681855 Psg22 pregnancy-specific glycoprotein 22 https://www.infrafrontier.eu/search?keyword=EM:11015 + EM:11185 C57BL/6N-Psg21/Wtsi EMMA embryo mutant strain MGI:6153591 Psg21 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891353 Psg21 pregnancy-specific glycoprotein 21 https://www.infrafrontier.eu/search?keyword=EM:11185 + EM:11185 C57BL/6N-Psg21/Wtsi EMMA sperm mutant strain MGI:6153591 Psg21 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891353 Psg21 pregnancy-specific glycoprotein 21 https://www.infrafrontier.eu/search?keyword=EM:11185 + EM:10333 C57BL/6N-Psg20/Wtsi EMMA embryo mutant strain MGI:6153590 Psg20 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891352 Psg20 pregnancy-specific glycoprotein 20 https://www.infrafrontier.eu/search?keyword=EM:10333 + EM:10333 C57BL/6N-Psg20/Wtsi EMMA sperm mutant strain MGI:6153590 Psg20 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891352 Psg20 pregnancy-specific glycoprotein 20 https://www.infrafrontier.eu/search?keyword=EM:10333 + EM:11267 C57BL/6N-Psg19/Wtsi EMMA embryo mutant strain MGI:6153589 Psg19 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1347252 Psg19 pregnancy specific glycoprotein 19 https://www.infrafrontier.eu/search?keyword=EM:11267 + EM:11267 C57BL/6N-Psg19/Wtsi EMMA sperm mutant strain MGI:6153589 Psg19 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1347252 Psg19 pregnancy specific glycoprotein 19 https://www.infrafrontier.eu/search?keyword=EM:11267 + EM:11266 C57BL/6N-Psg18/Wtsi EMMA embryo mutant strain MGI:6153588 Psg18 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1347251 Psg18 pregnancy specific glycoprotein 18 https://www.infrafrontier.eu/search?keyword=EM:11266 + EM:11266 C57BL/6N-Psg18/Wtsi EMMA sperm mutant strain MGI:6153588 Psg18 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1347251 Psg18 pregnancy specific glycoprotein 18 https://www.infrafrontier.eu/search?keyword=EM:11266 + EM:11587 C57BL/6N-Psg17/WtsiIeg EMMA archived mutant strain MGI:6140222 Psg17 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1347250 Psg17 pregnancy specific glycoprotein 17 https://www.infrafrontier.eu/search?keyword=EM:11587 + EM:10673 C57BL/6N-Prxl2b/Wtsi EMMA embryo mutant strain MGI:5779678 Prxl2b targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1913719 Prxl2b peroxiredoxin like 2B https://www.infrafrontier.eu/search?keyword=EM:10673 + EM:10673 C57BL/6N-Prxl2b/Wtsi EMMA sperm mutant strain MGI:5779678 Prxl2b targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1913719 Prxl2b peroxiredoxin like 2B https://www.infrafrontier.eu/search?keyword=EM:10673 + EM:11580 C57BL/6N-Prss53/WtsiIeg EMMA archived mutant strain MGI:6147557 Prss53 endonuclease mediated mutation 2, Wellcome Trust Sanger Institute MGI:2652890 Prss53 protease, serine 53 https://www.infrafrontier.eu/search?keyword=EM:11580 + EM:11762 C57BL/6N-Prss53/WtsiCnrm EMMA sperm mutant strain MGI:6140219 Prss53 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2652890 Prss53 protease, serine 53 https://www.infrafrontier.eu/search?keyword=EM:11762 - EM:05604 C57BL/6N-Prss50/H EMMA sperm mutant strain MGI:4455807 Prss50 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2447303 Prss50 protease, serine 50 https://www.infrafrontier.eu/search?keyword=EM:05604 + EM:07527 C57BL/6N-Prrg2/Wtsi EMMA embryo mutant strain MGI:5548709 Prrg2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1929596 Prrg2 proline-rich Gla (G-carboxyglutamic acid) polypeptide 2 https://www.infrafrontier.eu/search?keyword=EM:07527 + EM:07527 C57BL/6N-Prrg2/Wtsi EMMA sperm mutant strain MGI:5548709 Prrg2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1929596 Prrg2 proline-rich Gla (G-carboxyglutamic acid) polypeptide 2 https://www.infrafrontier.eu/search?keyword=EM:07527 + EM:11625 C57BL/6N-Prr5l/Wtsi EMMA embryo mutant strain MGI:6153587 Prr5l endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919696 Prr5l proline rich 5 like https://www.infrafrontier.eu/search?keyword=EM:11625 + EM:11625 C57BL/6N-Prr5l/Wtsi EMMA sperm mutant strain MGI:6153587 Prr5l endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919696 Prr5l proline rich 5 like https://www.infrafrontier.eu/search?keyword=EM:11625 + EM:11660 C57BL/6N-Prr14l/Wtsi EMMA embryo mutant strain MGI:6153586 Prr14l endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2443658 Prr14l proline rich 14-like https://www.infrafrontier.eu/search?keyword=EM:11660 + EM:11660 C57BL/6N-Prr14l/Wtsi EMMA sperm mutant strain MGI:6153586 Prr14l endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2443658 Prr14l proline rich 14-like https://www.infrafrontier.eu/search?keyword=EM:11660 - EM:04943 C57BL/6N-Prph2/H EMMA sperm mutant strain MGI:4435174 Prph2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:102791 Prph2 peripherin 2 https://www.infrafrontier.eu/search?keyword=EM:04943 + EM:10735 C57BL/6N-Prmt1/H EMMA archived C57BL/6NTac-Prmt1/H mutant strain MGI:5587827 Prmt1 targeted mutation 1c, Welcome Trust Sanger Institute MGI:107846 Prmt1 protein arginine N-methyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:10735 - EM:09536 C57BL/6N-Prl4a1/Cnrm EMMA sperm mutant strain MGI:5633827 Prl4a1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1206587 Prl4a1 prolactin family 4, subfamily a, member 1 https://www.infrafrontier.eu/search?keyword=EM:09536 + EM:08524 C57BL/6N-Prkg1/H EMMA sperm mutant strain MGI:4454120 Prkg1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108174 Prkg1 protein kinase, cGMP-dependent, type I https://www.infrafrontier.eu/search?keyword=EM:08524 + EM:11965 C57BL/6N-Prkd3/Ieg EMMA sperm mutant strain MGI:4432250 Prkd3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922542 Prkd3 protein kinase D3 https://www.infrafrontier.eu/search?keyword=EM:11965 + EM:11337 C57BL/6N-Prkd1/Wtsi EMMA embryo mutant strain MGI:6153770 Prkd1 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:99879 Prkd1 protein kinase D1 https://www.infrafrontier.eu/search?keyword=EM:11337 + EM:11337 C57BL/6N-Prkd1/Wtsi EMMA sperm mutant strain MGI:6153770 Prkd1 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:99879 Prkd1 protein kinase D1 https://www.infrafrontier.eu/search?keyword=EM:11337 + EM:11016 C57BL/6N-Prkd1/Wtsi EMMA embryo mutant strain MGI:6153585 Prkd1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:99879 Prkd1 protein kinase D1 https://www.infrafrontier.eu/search?keyword=EM:11016 + EM:11016 C57BL/6N-Prkd1/Wtsi EMMA sperm mutant strain MGI:6153585 Prkd1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:99879 Prkd1 protein kinase D1 https://www.infrafrontier.eu/search?keyword=EM:11016 + EM:08365 C57BL/6N-Prkab2/H EMMA sperm mutant strain MGI:4946773 Prkab2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1336185 Prkab2 protein kinase, AMP-activated, beta 2 non-catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:08365 + EM:07879 C57BL/6N-Prkab1/Wtsi EMMA embryo mutant strain MGI:5501071 Prkab1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336167 Prkab1 protein kinase, AMP-activated, beta 1 non-catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:07879 + EM:07879 C57BL/6N-Prkab1/Wtsi EMMA sperm mutant strain MGI:5501071 Prkab1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336167 Prkab1 protein kinase, AMP-activated, beta 1 non-catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:07879 + EM:09105 C57BL/6N-Prkab1/Ieg EMMA sperm mutant strain MGI:5501071 Prkab1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336167 Prkab1 protein kinase, AMP-activated, beta 1 non-catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:09105 + EM:08673 C57BL/6N-Prkaa2/H EMMA sperm mutant strain MGI:5318770 Prkaa2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1336173 Prkaa2 protein kinase, AMP-activated, alpha 2 catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:08673 - EM:05832 C57BL/6N-Primpol/H EMMA sperm mutant strain MGI:4432243 Primpol targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3603756 Primpol primase and polymerase (DNA-directed) https://www.infrafrontier.eu/search?keyword=EM:05832 - EM:07869 C57BL/6N-Prelid2/H EMMA sperm EPD0656_6_A01, B6NTac;B6N-Prelid2/H mutant strain MGI:4842294 Prelid2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924869 Prelid2 PRELI domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:07869 + EM:11608 C57BL/6N-Prdm8/Wtsi EMMA embryo mutant strain MGI:6153584 Prdm8 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1924880 Prdm8 PR domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:11608 + EM:11608 C57BL/6N-Prdm8/Wtsi EMMA sperm mutant strain MGI:6153584 Prdm8 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1924880 Prdm8 PR domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:11608 + EM:10148 C57BL/6N-Prdm4/H EMMA sperm mutant strain MGI:5692724 Prdm4 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1920093 Prdm4 PR domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:10148 + EM:06967 C57BL/6N-Prdm4/H EMMA sperm B6NTac;B6N-Prdm4/2H mutant strain MGI:4435837 Prdm4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920093 Prdm4 PR domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:06967 + EM:11242 C57BL/6N-Prdm16/WtsiH EMMA sperm mutant strain MGI:5633825 Prdm16 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1917923 Prdm16 PR domain containing 16 https://www.infrafrontier.eu/search?keyword=EM:11242 + EM:09245 C57BL/6N-Prc1/Ieg EMMA sperm mutant strain MGI:5613643 Prc1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1858961 Prc1 protein regulator of cytokinesis 1 https://www.infrafrontier.eu/search?keyword=EM:09245 + EM:08513 C57BL/6N-Prc1/Ieg EMMA sperm mutant strain MGI:5294171 Prc1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1858961 Prc1 protein regulator of cytokinesis 1 https://www.infrafrontier.eu/search?keyword=EM:08513 + EM:09023 C57BL/6N-Pramel31/Wtsi EMMA embryo C57BL/6N-Gm13119/Wtsi mutant strain MGI:5637189 Pramel31 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:3651680 Pramel31 PRAME like 31 https://www.infrafrontier.eu/search?keyword=EM:09023 + EM:09023 C57BL/6N-Pramel31/Wtsi EMMA sperm C57BL/6N-Gm13119/Wtsi mutant strain MGI:5637189 Pramel31 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:3651680 Pramel31 PRAME like 31 https://www.infrafrontier.eu/search?keyword=EM:09023 + EM:07549 C57BL/6N-Pramel15/Wtsi EMMA embryo C57BL/6N-Pramef20/Wtsi, C57BL/6N-Gm13125/Wtsi mutant strain MGI:5637193 Pramel15 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3712553 Pramel15 PRAME like 15 https://www.infrafrontier.eu/search?keyword=EM:07549 + EM:07549 C57BL/6N-Pramel15/Wtsi EMMA sperm C57BL/6N-Pramef20/Wtsi, C57BL/6N-Gm13125/Wtsi mutant strain MGI:5637193 Pramel15 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3712553 Pramel15 PRAME like 15 https://www.infrafrontier.eu/search?keyword=EM:07549 + EM:07316 C57BL/6N-Pram1/H EMMA sperm B6NTac;B6N-Pram1/H mutant strain MGI:4461665 Pram1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3576625 Pram1 PML-RAR alpha-regulated adaptor molecule 1 https://www.infrafrontier.eu/search?keyword=EM:07316 + EM:10167 C57BL/6N-Ppy/Ieg EMMA sperm mutant strain MGI:5695979 Ppy targeted mutation 1b, Wellcome Trust Sanger Institute MGI:97753 Ppy pancreatic polypeptide https://www.infrafrontier.eu/search?keyword=EM:10167 - EM:07784 C57BL/6N-Ppt2/H EMMA sperm B6NTac;B6N-Ppt2/H mutant strain MGI:4841007 Ppt2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1860075 Ppt2 palmitoyl-protein thioesterase 2 https://www.infrafrontier.eu/search?keyword=EM:07784 + EM:11031 C57BL/6N-Ppp4r3b/Ieg EMMA sperm mutant strain MGI:4847838 Ppp4r3b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2144578 Ppp4r3b protein phosphatase 4 regulatory subunit 3B https://www.infrafrontier.eu/search?keyword=EM:11031 + EM:11577 C57BL/6N-Ppp1cc/WtsiOulu EMMA embryo mutant strain MGI:6140218 Ppp1cc endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:104872 Ppp1cc protein phosphatase 1 catalytic subunit gamma https://www.infrafrontier.eu/search?keyword=EM:11577 + EM:11577 C57BL/6N-Ppp1cc/WtsiOulu EMMA sperm mutant strain MGI:6140218 Ppp1cc endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:104872 Ppp1cc protein phosphatase 1 catalytic subunit gamma https://www.infrafrontier.eu/search?keyword=EM:11577 - EM:06976 C57BL/6N-Ppm1a/H EMMA sperm B6NTac;B6N-Ppm1a/H mutant strain MGI:4458753 Ppm1a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99878 Ppm1a protein phosphatase 1A, magnesium dependent, alpha isoform https://www.infrafrontier.eu/search?keyword=EM:06976 + EM:07755 C57BL/6N-Ppil3/Wtsi EMMA embryo mutant strain MGI:5637044 Ppil3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1917475 Ppil3 peptidylprolyl isomerase (cyclophilin)-like 3 https://www.infrafrontier.eu/search?keyword=EM:07755 + EM:07755 C57BL/6N-Ppil3/Wtsi EMMA sperm mutant strain MGI:5637044 Ppil3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1917475 Ppil3 peptidylprolyl isomerase (cyclophilin)-like 3 https://www.infrafrontier.eu/search?keyword=EM:07755 + EM:09631 C57BL/6N-Ppfia2/H EMMA sperm mutant strain MGI:4458715 Ppfia2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443834 Ppfia2 protein tyrosine phosphatase, receptor type, f polypeptide (PTPRF), interacting protein (liprin), alpha 2 https://www.infrafrontier.eu/search?keyword=EM:09631 + EM:10145 C57BL/6N-Pparg/H EMMA sperm mutant strain MGI:5692913 Pparg targeted mutation 1c, Wellcome Trust Sanger Institute MGI:97747 Pparg peroxisome proliferator activated receptor gamma https://www.infrafrontier.eu/search?keyword=EM:10145 - EM:07489 C57BL/6N-Pparg/H EMMA sperm B6NTac;B6N-Pparg/H mutant strain MGI:4419888 Pparg targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97747 Pparg peroxisome proliferator activated receptor gamma https://www.infrafrontier.eu/search?keyword=EM:07489 + EM:11677 C57BL/6N-Pou6f1/Wtsi EMMA embryo mutant strain MGI:6153583 Pou6f1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:102935 Pou6f1 POU domain, class 6, transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:11677 + EM:11677 C57BL/6N-Pou6f1/Wtsi EMMA sperm mutant strain MGI:6153583 Pou6f1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:102935 Pou6f1 POU domain, class 6, transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:11677 + EM:09662 C57BL/6N-Pon2/H EMMA sperm mutant strain MGI:4847743 Pon2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:106687 Pon2 paraoxonase 2 https://www.infrafrontier.eu/search?keyword=EM:09662 - EM:05202 C57BL/6N-Poln/Cnrm EMMA sperm mutant strain MGI:4435830 Poln targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2675617 Poln DNA polymerase N https://www.infrafrontier.eu/search?keyword=EM:05202 + EM:08551 C57BL/6N-Pold3/Wtsi EMMA embryo mutant strain MGI:5637026 Pold3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915217 Pold3 polymerase (DNA-directed), delta 3, accessory subunit https://www.infrafrontier.eu/search?keyword=EM:08551 + EM:08551 C57BL/6N-Pold3/Wtsi EMMA sperm mutant strain MGI:5637026 Pold3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915217 Pold3 polymerase (DNA-directed), delta 3, accessory subunit https://www.infrafrontier.eu/search?keyword=EM:08551 + EM:11184 C57BL/6N-Pogk/Wtsi EMMA embryo mutant strain MGI:6153582 Pogk endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1918842 Pogk pogo transposable element with KRAB domain https://www.infrafrontier.eu/search?keyword=EM:11184 + EM:11184 C57BL/6N-Pogk/Wtsi EMMA sperm mutant strain MGI:6153582 Pogk endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1918842 Pogk pogo transposable element with KRAB domain https://www.infrafrontier.eu/search?keyword=EM:11184 + EM:09640 C57BL/6N-Pmel/Ieg EMMA sperm mutant strain MGI:5637220 Pmel targeted mutation 1b, Wellcome Trust Sanger Institute MGI:98301 Pmel premelanosome protein https://www.infrafrontier.eu/search?keyword=EM:09640 + EM:09637 C57BL/6N-Pmel/Ieg EMMA sperm mutant strain MGI:4441778 Pmel targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98301 Pmel premelanosome protein https://www.infrafrontier.eu/search?keyword=EM:09637 + EM:11465 C57BL/6N-Plxdc1/Wtsi EMMA embryo mutant strain MGI:6153581 Plxdc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919574 Plxdc1 plexin domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:11465 + EM:11465 C57BL/6N-Plxdc1/Wtsi EMMA sperm mutant strain MGI:6153581 Plxdc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919574 Plxdc1 plexin domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:11465 + EM:08220 C57BL/6N-Plscr2/Wtsi EMMA embryo mutant strain MGI:5636936 Plscr2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1270860 Plscr2 phospholipid scramblase 2 https://www.infrafrontier.eu/search?keyword=EM:08220 + EM:08220 C57BL/6N-Plscr2/Wtsi EMMA sperm mutant strain MGI:5636936 Plscr2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1270860 Plscr2 phospholipid scramblase 2 https://www.infrafrontier.eu/search?keyword=EM:08220 + EM:05336 C57BL/6N-Plpp3/Cnrm EMMA sperm STOCK Plpp3/Cnrm, STOCK Ppap2b/Cnrm mutant strain MGI:4451775 Plpp3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915698 Plpp3 phospholipid phosphatase 3 https://www.infrafrontier.eu/search?keyword=EM:05336 + EM:11214 C57BL/6N-Plet1/WtsiIeg EMMA archived mutant strain MGI:6147556 Plet1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1923759 Plet1 placenta expressed transcript 1 https://www.infrafrontier.eu/search?keyword=EM:11214 + EM:10748 C57BL/6N-Plekhf1/Wtsi EMMA embryo mutant strain MGI:6153580 Plekhf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919537 Plekhf1 pleckstrin homology domain containing, family F (with FYVE domain) member 1 https://www.infrafrontier.eu/search?keyword=EM:10748 + EM:10748 C57BL/6N-Plekhf1/Wtsi EMMA sperm mutant strain MGI:6153580 Plekhf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919537 Plekhf1 pleckstrin homology domain containing, family F (with FYVE domain) member 1 https://www.infrafrontier.eu/search?keyword=EM:10748 + EM:11755 C57BL/6N-Plekha1/Ieg EMMA sperm mutant strain MGI:5501548 Plekha1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2442213 Plekha1 pleckstrin homology domain containing, family A (phosphoinositide binding specific) member 1 https://www.infrafrontier.eu/search?keyword=EM:11755 + EM:12242 C57BL/6N-Plek/Wtsi EMMA live mutant strain Plek EUCOMM targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1860485 Plek pleckstrin https://www.infrafrontier.eu/search?keyword=EM:12242 + EM:11442 C57BL/6N-Plcg2/Wtsi EMMA embryo mutant strain MGI:6153579 Plcg2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:97616 Plcg2 phospholipase C, gamma 2 https://www.infrafrontier.eu/search?keyword=EM:11442 + EM:11442 C57BL/6N-Plcg2/Wtsi EMMA sperm mutant strain MGI:6153579 Plcg2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:97616 Plcg2 phospholipase C, gamma 2 https://www.infrafrontier.eu/search?keyword=EM:11442 + EM:10360 C57BL/6N-Plau/H EMMA sperm mutant strain MGI:4944525 Plau targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97611 Plau plasminogen activator, urokinase https://www.infrafrontier.eu/search?keyword=EM:10360 - EM:07095 C57BL/6N-Plac9a/H EMMA sperm B6NTac;B6N-Plac9a/H mutant strain MGI:4946775 Plac9a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2663998 Plac9a placenta specific 9a https://www.infrafrontier.eu/search?keyword=EM:07095 + EM:09378 C57BL/6N-Plac8/Ieg EMMA sperm mutant strain MGI:5637155 Plac8 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2445289 Plac8 placenta-specific 8 https://www.infrafrontier.eu/search?keyword=EM:09378 + EM:09368 C57BL/6N-Plac8/Ieg EMMA sperm mutant strain MGI:4841670 Plac8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2445289 Plac8 placenta-specific 8 https://www.infrafrontier.eu/search?keyword=EM:09368 + EM:09779 C57BL/6N-Pla2g6/WtsiH EMMA sperm STOCK Pla2g6/WtsiH, Pla2g6-G04, MFZL mutant strain MGI:6209669 Pla2g6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859152 Pla2g6 phospholipase A2, group VI https://www.infrafrontier.eu/search?keyword=EM:09779 + EM:08473 C57BL/6N-Pla2g2e/Ieg EMMA sperm mutant strain MGI:5636980 Pla2g2e targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1349660 Pla2g2e phospholipase A2, group IIE https://www.infrafrontier.eu/search?keyword=EM:08473 + EM:08464 C57BL/6N-Pla2g2e/Ieg EMMA embryo mutant strain MGI:4432002 Pla2g2e targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1349660 Pla2g2e phospholipase A2, group IIE https://www.infrafrontier.eu/search?keyword=EM:08464 + EM:11085 C57BL/6N-Pla2g2c/Wtsi EMMA embryo mutant strain MGI:5816875 Pla2g2c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106638 Pla2g2c phospholipase A2, group IIC https://www.infrafrontier.eu/search?keyword=EM:11085 + EM:11085 C57BL/6N-Pla2g2c/Wtsi EMMA sperm mutant strain MGI:5816875 Pla2g2c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106638 Pla2g2c phospholipase A2, group IIC https://www.infrafrontier.eu/search?keyword=EM:11085 + EM:08414 C57BL/6N-Pla2g10/Ieg EMMA embryo mutant strain MGI:5548469 Pla2g10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1347522 Pla2g10 phospholipase A2, group X https://www.infrafrontier.eu/search?keyword=EM:08414 + EM:04720 C57BL/6N-Pla2g10/Ieg EMMA embryo B6NTac;B6N-Pla2g10/Ieg mutant strain MGI:4435080 Pla2g10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1347522 Pla2g10 phospholipase A2, group X https://www.infrafrontier.eu/search?keyword=EM:04720 + EM:09244 C57BL/6N-Pkn2/Ieg EMMA sperm mutant strain MGI:5613636 Pkn2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:109211 Pkn2 protein kinase N2 https://www.infrafrontier.eu/search?keyword=EM:09244 + EM:09415 C57BL/6N-Pkn2/Ieg EMMA sperm mutant strain MGI:4363870 Pkn2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109211 Pkn2 protein kinase N2 https://www.infrafrontier.eu/search?keyword=EM:09415 + EM:08420 C57BL/6N-Pkig/Ieg EMMA sperm mutant strain MGI:5636975 Pkig targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1343086 Pkig protein kinase inhibitor, gamma https://www.infrafrontier.eu/search?keyword=EM:08420 + EM:08457 C57BL/6N-Pkig/Ieg EMMA embryo mutant strain MGI:5014672 Pkig targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1343086 Pkig protein kinase inhibitor, gamma https://www.infrafrontier.eu/search?keyword=EM:08457 - EM:07006 C57BL/6N-Pkd2l2/H EMMA sperm B6NTac;B6N-Pkd2l2/H, C57BL/6N-Pkd2l2tm1a(EUCOMM)Wtsi/H, EPD0354_1_A07 mutant strain MGI:4432894 Pkd2l2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858231 Pkd2l2 polycystic kidney disease 2-like 2 https://www.infrafrontier.eu/search?keyword=EM:07006 + EM:11574 C57BL/6N-Pitx1/WtsiIeg EMMA archived mutant strain MGI:6140217 Pitx1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:107374 Pitx1 paired-like homeodomain transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:11574 + EM:10737 C57BL/6N-Pink1/H EMMA sperm mutant strain MGI:5637036 Pink1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916193 Pink1 PTEN induced putative kinase 1 https://www.infrafrontier.eu/search?keyword=EM:10737 - EM:07320 C57BL/6N-Pink1/H EMMA sperm mutant strain MGI:5008020 Pink1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916193 Pink1 PTEN induced putative kinase 1 https://www.infrafrontier.eu/search?keyword=EM:07320 + EM:11234 C57BL/6N-Pilrb2/Wtsi EMMA embryo mutant strain MGI:6153578 Pilrb2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2450535 Pilrb2 paired immunoglobin-like type 2 receptor beta 2 https://www.infrafrontier.eu/search?keyword=EM:11234 + EM:11234 C57BL/6N-Pilrb2/Wtsi EMMA sperm mutant strain MGI:6153578 Pilrb2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2450535 Pilrb2 paired immunoglobin-like type 2 receptor beta 2 https://www.infrafrontier.eu/search?keyword=EM:11234 + EM:11972 C57BL/6N-Pik3cg/Wtsi EMMA embryo mutant strain MGI:6149897 Pik3cg targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1353576 Pik3cg phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit gamma https://www.infrafrontier.eu/search?keyword=EM:11972 + EM:11972 C57BL/6N-Pik3cg/Wtsi EMMA sperm mutant strain MGI:6149897 Pik3cg targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1353576 Pik3cg phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit gamma https://www.infrafrontier.eu/search?keyword=EM:11972 + EM:07749 C57BL/6N-Pigl/Wtsi EMMA embryo mutant strain MGI:5637168 Pigl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2681271 Pigl phosphatidylinositol glycan anchor biosynthesis, class L https://www.infrafrontier.eu/search?keyword=EM:07749 + EM:07749 C57BL/6N-Pigl/Wtsi EMMA sperm mutant strain MGI:5637168 Pigl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2681271 Pigl phosphatidylinositol glycan anchor biosynthesis, class L https://www.infrafrontier.eu/search?keyword=EM:07749 + EM:11463 C57BL/6N-Phip/Wtsi EMMA embryo mutant strain MGI:6153577 Phip endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1932404 Phip pleckstrin homology domain interacting protein https://www.infrafrontier.eu/search?keyword=EM:11463 + EM:11463 C57BL/6N-Phip/Wtsi EMMA sperm mutant strain MGI:6153577 Phip endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1932404 Phip pleckstrin homology domain interacting protein https://www.infrafrontier.eu/search?keyword=EM:11463 + EM:11380 C57BL/6N-Phgdh/Wtsi EMMA embryo mutant strain MGI:6153576 Phgdh endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1355330 Phgdh 3-phosphoglycerate dehydrogenase https://www.infrafrontier.eu/search?keyword=EM:11380 + EM:11380 C57BL/6N-Phgdh/Wtsi EMMA sperm mutant strain MGI:6153576 Phgdh endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1355330 Phgdh 3-phosphoglycerate dehydrogenase https://www.infrafrontier.eu/search?keyword=EM:11380 + EM:10317 C57BL/6N-Phf7/Wtsi EMMA embryo mutant strain MGI:6153574 Phf7 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2145840 Phf7 PHD finger protein 7 https://www.infrafrontier.eu/search?keyword=EM:10317 + EM:10317 C57BL/6N-Phf7/Wtsi EMMA sperm mutant strain MGI:6153574 Phf7 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2145840 Phf7 PHD finger protein 7 https://www.infrafrontier.eu/search?keyword=EM:10317 + EM:08412 C57BL/6N-Pgs1/Ieg EMMA sperm mutant strain MGI:5637078 Pgs1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1921701 Pgs1 phosphatidylglycerophosphate synthase 1 https://www.infrafrontier.eu/search?keyword=EM:08412 + EM:08407 C57BL/6N-Pgs1/Ieg EMMA embryo mutant strain MGI:4451871 Pgs1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921701 Pgs1 phosphatidylglycerophosphate synthase 1 https://www.infrafrontier.eu/search?keyword=EM:08407 + EM:09442 C57BL/6N-Pgap2/Wtsi EMMA embryo mutant strain MGI:5637131 Pgap2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2385286 Pgap2 post-GPI attachment to proteins 2 https://www.infrafrontier.eu/search?keyword=EM:09442 + EM:09442 C57BL/6N-Pgap2/Wtsi EMMA sperm mutant strain MGI:5637131 Pgap2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2385286 Pgap2 post-GPI attachment to proteins 2 https://www.infrafrontier.eu/search?keyword=EM:09442 + EM:10135 C57BL/6N-Pfkfb3/Ieg EMMA sperm mutant strain MGI:5692802 Pfkfb3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2181202 Pfkfb3 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 3 https://www.infrafrontier.eu/search?keyword=EM:10135 + EM:09829 C57BL/6N-Pfkfb3/Ieg EMMA sperm mutant strain MGI:4441922 Pfkfb3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2181202 Pfkfb3 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 3 https://www.infrafrontier.eu/search?keyword=EM:09829 - EM:05837 C57BL/6N-Pex1/Cnrm EMMA sperm mutant strain MGI:4458786 Pex1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1918632 Pex1 peroxisomal biogenesis factor 1 https://www.infrafrontier.eu/search?keyword=EM:05837 + EM:10465 C57BL/6N-Per2/H EMMA sperm mutant strain MGI:5752545 Per2 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1195265 Per2 period circadian clock 2 https://www.infrafrontier.eu/search?keyword=EM:10465 + EM:04827 C57BL/6N-Per2/H EMMA sperm B6NTac;B6N-Per2/H mutant strain MGI:4436072 Per2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1195265 Per2 period circadian clock 2 https://www.infrafrontier.eu/search?keyword=EM:04827 + EM:08468 C57BL/6N-Pef1/Ieg EMMA sperm mutant strain MGI:5614701 Pef1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1915148 Pef1 penta-EF hand domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:08468 + EM:11819 C57BL/6N-Pdzrn4/Wtsi EMMA embryo mutant strain MGI:6257816 Pdzrn4 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:3056996 Pdzrn4 PDZ domain containing RING finger 4 https://www.infrafrontier.eu/search?keyword=EM:11819 + EM:11819 C57BL/6N-Pdzrn4/Wtsi EMMA sperm mutant strain MGI:6257816 Pdzrn4 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:3056996 Pdzrn4 PDZ domain containing RING finger 4 https://www.infrafrontier.eu/search?keyword=EM:11819 + EM:09746 C57BL/6N-Pdzk1/Wtsi EMMA embryo mutant strain MGI:5692756 Pdzk1 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1928901 Pdzk1 PDZ domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:09746 + EM:09746 C57BL/6N-Pdzk1/Wtsi EMMA sperm mutant strain MGI:5692756 Pdzk1 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1928901 Pdzk1 PDZ domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:09746 + EM:10428 C57BL/6N-Pdzd8/Wtsi EMMA embryo mutant strain MGI:5708255 Pdzd8 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2677270 Pdzd8 PDZ domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:10428 + EM:10428 C57BL/6N-Pdzd8/Wtsi EMMA sperm mutant strain MGI:5708255 Pdzd8 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2677270 Pdzd8 PDZ domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:10428 + EM:09324 C57BL/6N-Pdss2/H EMMA sperm mutant strain MGI:4946711 Pdss2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918615 Pdss2 prenyl (solanesyl) diphosphate synthase, subunit 2 https://www.infrafrontier.eu/search?keyword=EM:09324 + EM:09046 C57BL/6N-Pdpn/H EMMA sperm mutant strain MGI:5692543 Pdpn targeted mutation 1c, Wellcome Trust Sanger Institute MGI:103098 Pdpn podoplanin https://www.infrafrontier.eu/search?keyword=EM:09046 + EM:06983 C57BL/6N-Pdpn/H EMMA sperm B6NTac;B6N-Pdpn/H mutant strain MGI:4842558 Pdpn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:103098 Pdpn podoplanin https://www.infrafrontier.eu/search?keyword=EM:06983 + EM:11894 C57BL/6N-Pdlim1/WtsiH EMMA sperm mutant strain MGI:6153573 Pdlim1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1860611 Pdlim1 PDZ and LIM domain 1 (elfin) https://www.infrafrontier.eu/search?keyword=EM:11894 + EM:09298 C57BL/6N-Pdia6/Ieg EMMA sperm mutant strain MGI:5605786 Pdia6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919103 Pdia6 protein disulfide isomerase associated 6 https://www.infrafrontier.eu/search?keyword=EM:09298 + EM:07756 C57BL/6N-Pdia4/Wtsi EMMA embryo mutant strain MGI:5636896 Pdia4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104864 Pdia4 protein disulfide isomerase associated 4 https://www.infrafrontier.eu/search?keyword=EM:07756 + EM:07756 C57BL/6N-Pdia4/Wtsi EMMA sperm mutant strain MGI:5636896 Pdia4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104864 Pdia4 protein disulfide isomerase associated 4 https://www.infrafrontier.eu/search?keyword=EM:07756 + EM:09243 C57BL/6N-Pdhx/Ieg EMMA sperm mutant strain MGI:5613640 Pdhx targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1351627 Pdhx pyruvate dehydrogenase complex, component X https://www.infrafrontier.eu/search?keyword=EM:09243 + EM:08382 C57BL/6N-Pdgfrb/H EMMA sperm mutant strain MGI:4841570 Pdgfrb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97531 Pdgfrb platelet derived growth factor receptor, beta polypeptide https://www.infrafrontier.eu/search?keyword=EM:08382 + EM:11374 C57BL/6N-Pdgfc/Ieg EMMA sperm mutant strain MGI:4435567 Pdgfc targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1859631 Pdgfc platelet-derived growth factor, C polypeptide https://www.infrafrontier.eu/search?keyword=EM:11374 + EM:10833 C57BL/6N-Pde8a/H EMMA sperm mutant strain MGI:4941557 Pde8a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1277116 Pde8a phosphodiesterase 8A https://www.infrafrontier.eu/search?keyword=EM:10833 + EM:08956 C57BL/6N-Pdcd5/Biat EMMA sperm mutant strain MGI:4951313 Pdcd5 targeted mutation 1, Velocigene MGI:1913538 Pdcd5 programmed cell death 5 https://www.infrafrontier.eu/search?keyword=EM:08956 + EM:07547 C57BL/6N-Pdcd2/Wtsi EMMA embryo mutant strain MGI:5636894 Pdcd2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104643 Pdcd2 programmed cell death 2 https://www.infrafrontier.eu/search?keyword=EM:07547 + EM:07547 C57BL/6N-Pdcd2/Wtsi EMMA sperm mutant strain MGI:5636894 Pdcd2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104643 Pdcd2 programmed cell death 2 https://www.infrafrontier.eu/search?keyword=EM:07547 + EM:08090 C57BL/6N-Pcx/Ieg EMMA embryo C57BL/6N-Pcx/Hmgu mutant strain MGI:5548959 Pcx targeted mutation 1b, Wellcome Trust Sanger Institute MGI:97520 Pcx pyruvate carboxylase https://www.infrafrontier.eu/search?keyword=EM:08090 + EM:09641 C57BL/6N-Pcsk9/Ieg EMMA sperm mutant strain MGI:5637110 Pcsk9 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2140260 Pcsk9 proprotein convertase subtilisin/kexin type 9 https://www.infrafrontier.eu/search?keyword=EM:09641 + EM:09064 C57BL/6N-Pcsk9/Ieg EMMA sperm mutant strain MGI:5511776 Pcsk9 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2140260 Pcsk9 proprotein convertase subtilisin/kexin type 9 https://www.infrafrontier.eu/search?keyword=EM:09064 + EM:04708 C57BL/6N-Pcnx3/Cnrm EMMA embryo B6NDen;B6N-Pcnxl3/Cnrm, C57BL/6N-Pcnxl3/Cnrm, HEPD0534_9_H10, B6Dnk;B6N-Pcnxl3/Cnrm mutant strain MGI:4434701 Pcnx3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1861733 Pcnx3 pecanex homolog 3 https://www.infrafrontier.eu/search?keyword=EM:04708 + EM:04708 C57BL/6N-Pcnx3/Cnrm EMMA sperm B6NDen;B6N-Pcnxl3/Cnrm, C57BL/6N-Pcnxl3/Cnrm, HEPD0534_9_H10, B6Dnk;B6N-Pcnxl3/Cnrm mutant strain MGI:4434701 Pcnx3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1861733 Pcnx3 pecanex homolog 3 https://www.infrafrontier.eu/search?keyword=EM:04708 + EM:09398 C57BL/6N-Pced1a/WtsiOrl EMMA archived mutant strain MGI:5548804 Pced1a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442177 Pced1a PC-esterase domain containing 1A https://www.infrafrontier.eu/search?keyword=EM:09398 + EM:10751 C57BL/6N-Pcdh1/Wtsi EMMA embryo mutant strain MGI:6153572 Pcdh1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2147243 Pcdh1 protocadherin 1 https://www.infrafrontier.eu/search?keyword=EM:10751 + EM:10751 C57BL/6N-Pcdh1/Wtsi EMMA sperm mutant strain MGI:6153572 Pcdh1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2147243 Pcdh1 protocadherin 1 https://www.infrafrontier.eu/search?keyword=EM:10751 + EM:10441 C57BL/6N-Pcdh15/Wtsi EMMA embryo mutant strain MGI:6153753 Pcdh15 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3710651 Pcdh15 protocadherin 15 https://www.infrafrontier.eu/search?keyword=EM:10441 + EM:10441 C57BL/6N-Pcdh15/Wtsi EMMA sperm mutant strain MGI:6153753 Pcdh15 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3710651 Pcdh15 protocadherin 15 https://www.infrafrontier.eu/search?keyword=EM:10441 - EM:08416 C57BL/6N-Pbrm1/Ieg EMMA sperm mutant strain MGI:5548674 Pbrm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923998 Pbrm1 polybromo 1 https://www.infrafrontier.eu/search?keyword=EM:08416 + EM:10134 C57BL/6N-Pax5/Ieg EMMA sperm mutant strain MGI:5692910 Pax5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:97489 Pax5 paired box 5 https://www.infrafrontier.eu/search?keyword=EM:10134 - EM:07871 C57BL/6N-Pawr/H EMMA sperm B6NTac;B6N-Pawr/H mutant strain MGI:4888921 Pawr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2149961 Pawr PRKC, apoptosis, WT1, regulator https://www.infrafrontier.eu/search?keyword=EM:07871 - EM:10922 C57BL/6N-Paupar/Wtsi EMMA embryo mutant strain Paupar Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:5543919 Paupar Pax6 upstream antisense RNA https://www.infrafrontier.eu/search?keyword=EM:10922 - EM:10922 C57BL/6N-Paupar/Wtsi EMMA sperm mutant strain Paupar Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:5543919 Paupar Pax6 upstream antisense RNA https://www.infrafrontier.eu/search?keyword=EM:10922 + EM:10303 C57BL/6N-Parn/Wtsi EMMA embryo mutant strain MGI:6153570 Parn endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921358 Parn poly(A)-specific ribonuclease (deadenylation nuclease) https://www.infrafrontier.eu/search?keyword=EM:10303 + EM:10303 C57BL/6N-Parn/Wtsi EMMA sperm mutant strain MGI:6153570 Parn endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921358 Parn poly(A)-specific ribonuclease (deadenylation nuclease) https://www.infrafrontier.eu/search?keyword=EM:10303 + EM:09120 C57BL/6N-Pard3b/Ieg EMMA sperm mutant strain MGI:5588280 Pard3b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919301 Pard3b par-3 family cell polarity regulator beta https://www.infrafrontier.eu/search?keyword=EM:09120 + EM:08123 C57BL/6N-Pard3b/Ieg EMMA embryo B6NTac;B6N-Pard3b/Ieg mutant strain MGI:4441664 Pard3b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919301 Pard3b par-3 family cell polarity regulator beta https://www.infrafrontier.eu/search?keyword=EM:08123 - EM:07836 C57BL/6N-Pard3/H EMMA sperm B6NTac;B6N-Pard3/H mutant strain MGI:4364353 Pard3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2135608 Pard3 par-3 family cell polarity regulator https://www.infrafrontier.eu/search?keyword=EM:07836 + EM:08752 C57BL/6N-Paox/Ieg EMMA sperm mutant strain MGI:5548591 Paox targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1916983 Paox polyamine oxidase (exo-N4-amino) https://www.infrafrontier.eu/search?keyword=EM:08752 + EM:07761 C57BL/6N-Pam16/Wtsi EMMA embryo mutant strain MGI:5637011 Pam16 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913699 Pam16 presequence translocase-asssociated motor 16 homolog (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:07761 + EM:07761 C57BL/6N-Pam16/Wtsi EMMA sperm mutant strain MGI:5637011 Pam16 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913699 Pam16 presequence translocase-asssociated motor 16 homolog (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:07761 + EM:10804 C57BL/6N-Palm/Wtsi EMMA embryo mutant strain MGI:6153569 Palm endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1261814 Palm paralemmin https://www.infrafrontier.eu/search?keyword=EM:10804 + EM:10804 C57BL/6N-Palm/Wtsi EMMA sperm mutant strain MGI:6153569 Palm endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1261814 Palm paralemmin https://www.infrafrontier.eu/search?keyword=EM:10804 + EM:10463 C57BL/6N-Pak1/H EMMA sperm mutant strain MGI:5752547 Pak1 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1339975 Pak1 p21 (RAC1) activated kinase 1 https://www.infrafrontier.eu/search?keyword=EM:10463 - EM:07474 C57BL/6N-Pak1/H EMMA sperm B6NTac;B6N-Pak1/H mutant strain MGI:4842016 Pak1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1339975 Pak1 p21 (RAC1) activated kinase 1 https://www.infrafrontier.eu/search?keyword=EM:07474 + EM:07909 C57BL/6N-P2rx7/Ieg EMMA embryo C57BL/6N-P2rx7/Hmgu mutant strain MGI:5548444 P2rx7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1339957 P2rx7 purinergic receptor P2X, ligand-gated ion channel, 7 https://www.infrafrontier.eu/search?keyword=EM:07909 + EM:05116 C57BL/6N-P2rx7/Ieg EMMA sperm B6NTac;B6N-P2rx7/Ieg mutant strain MGI:4432150 P2rx7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1339957 P2rx7 purinergic receptor P2X, ligand-gated ion channel, 7 https://www.infrafrontier.eu/search?keyword=EM:05116 - EM:07066 C57BL/6N-P2rx6/H EMMA sperm B6NTac;B6N-P2rx6/H mutant strain MGI:5050912 P2rx6 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1337113 P2rx6 purinergic receptor P2X, ligand-gated ion channel, 6 https://www.infrafrontier.eu/search?keyword=EM:07066 + EM:10131 C57BL/6N-P2rx5/Ieg EMMA sperm mutant strain MGI:5692770 P2rx5 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2137026 P2rx5 purinergic receptor P2X, ligand-gated ion channel, 5 https://www.infrafrontier.eu/search?keyword=EM:10131 + EM:09185 C57BL/6N-P2rx5/Ieg EMMA embryo mutant strain MGI:4841555 P2rx5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2137026 P2rx5 purinergic receptor P2X, ligand-gated ion channel, 5 https://www.infrafrontier.eu/search?keyword=EM:09185 + EM:09045 C57BL/6N-P2rx4/H EMMA sperm mutant strain MGI:5708187 P2rx4 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1338859 P2rx4 purinergic receptor P2X, ligand-gated ion channel 4 https://www.infrafrontier.eu/search?keyword=EM:09045 + EM:07910 C57BL/6N-P2rx4/H EMMA live mutant strain MGI:5548440 P2rx4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1338859 P2rx4 purinergic receptor P2X, ligand-gated ion channel 4 https://www.infrafrontier.eu/search?keyword=EM:07910 - EM:06002 C57BL/6N-P2rx4/H EMMA sperm B6NTac;B6N-P2rx4/H mutant strain MGI:4944573 P2rx4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1338859 P2rx4 purinergic receptor P2X, ligand-gated ion channel 4 https://www.infrafrontier.eu/search?keyword=EM:06002 + EM:09365 C57BL/6N-Otud7b/Wtsi EMMA embryo mutant strain MGI:5637162 Otud7b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2654703 Otud7b OTU domain containing 7B https://www.infrafrontier.eu/search?keyword=EM:09365 + EM:09365 C57BL/6N-Otud7b/Wtsi EMMA sperm mutant strain MGI:5637162 Otud7b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2654703 Otud7b OTU domain containing 7B https://www.infrafrontier.eu/search?keyword=EM:09365 + EM:11053 C57BL/6N-Otud4/H EMMA sperm mutant strain MGI:5319342 Otud4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921195 Otud4 OTU domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:11053 + EM:12646 C57BL/6N-Otp/H EMMA sperm mutant strain MGI:5008941 Otp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99835 Otp orthopedia homeobox https://www.infrafrontier.eu/search?keyword=EM:12646 + EM:10628 C57BL/6N-Ostn/Wtsi EMMA embryo mutant strain MGI:6153568 Ostn endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2677164 Ostn osteocrin https://www.infrafrontier.eu/search?keyword=EM:10628 + EM:10628 C57BL/6N-Ostn/Wtsi EMMA sperm mutant strain MGI:6153568 Ostn endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2677164 Ostn osteocrin https://www.infrafrontier.eu/search?keyword=EM:10628 + EM:11035 C57BL/6N-Ostf1/Ieg EMMA sperm mutant strain MGI:5811626 Ostf1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:700012 Ostf1 osteoclast stimulating factor 1 https://www.infrafrontier.eu/search?keyword=EM:11035 + EM:09636 C57BL/6N-Ostf1/Ieg EMMA sperm mutant strain MGI:5052480 Ostf1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:700012 Ostf1 osteoclast stimulating factor 1 https://www.infrafrontier.eu/search?keyword=EM:09636 + EM:10122 C57BL/6N-Oscp1/Ieg EMMA sperm mutant strain MGI:5692692 Oscp1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1916308 Oscp1 organic solute carrier partner 1 https://www.infrafrontier.eu/search?keyword=EM:10122 + EM:09399 C57BL/6N-Oscp1/Ieg EMMA sperm mutant strain MGI:4881057 Oscp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916308 Oscp1 organic solute carrier partner 1 https://www.infrafrontier.eu/search?keyword=EM:09399 + EM:10133 C57BL/6N-Osbpl11/Ieg EMMA sperm mutant strain MGI:5692785 Osbpl11 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2146553 Osbpl11 oxysterol binding protein-like 11 https://www.infrafrontier.eu/search?keyword=EM:10133 + EM:10074 C57BL/6N-Osbpl11/Ieg EMMA sperm mutant strain MGI:4847796 Osbpl11 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2146553 Osbpl11 oxysterol binding protein-like 11 https://www.infrafrontier.eu/search?keyword=EM:10074 + EM:08075 C57BL/6N-Oplah/Ieg EMMA sperm C57BL/6N-Oplah/Hmgu mutant strain MGI:5548658 Oplah targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922725 Oplah 5-oxoprolinase (ATP-hydrolysing) https://www.infrafrontier.eu/search?keyword=EM:08075 + EM:08077 C57BL/6N-Odad3/Ieg EMMA sperm C57BL/6N-Ccdc151/Ieg mutant strain MGI:5548687 Odad3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1924859 Odad3 outer dynein arm docking complex subunit 3 https://www.infrafrontier.eu/search?keyword=EM:08077 + EM:12746 C57BL/6N-Odad3/Cnrm EMMA live C57BL/6N-Ccdc151/Cnrm mutant strain MGI:5548687 Odad3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1924859 Odad3 outer dynein arm docking complex subunit 3 https://www.infrafrontier.eu/search?keyword=EM:12746 + EM:05473 C57BL/6N-Odad3/Cnrm EMMA sperm C57BL/6N-Ccdc151/Cnrm mutant strain MGI:4455711 Odad3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924859 Odad3 outer dynein arm docking complex subunit 3 https://www.infrafrontier.eu/search?keyword=EM:05473 + EM:11765 C57BL/6N-Oard1/WtsiCnrm EMMA sperm mutant strain MGI:6152739 Oard1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2147094 Oard1 O-acyl-ADP-ribose deacylase 1 https://www.infrafrontier.eu/search?keyword=EM:11765 + EM:05127 C57BL/6N-Nxpe5/H EMMA sperm mutant strain MGI:4433447 Nxpe5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3584036 Nxpe5 neurexophilin and PC-esterase domain family, member 5 https://www.infrafrontier.eu/search?keyword=EM:05127 + EM:08100 C57BL/6N-Nxn/Ieg EMMA sperm C57BL/6N-Nxn/Hmgu mutant strain MGI:5548389 Nxn targeted mutation 1b, Wellcome Trust Sanger Institute MGI:109331 Nxn nucleoredoxin https://www.infrafrontier.eu/search?keyword=EM:08100 + EM:09018 C57BL/6N-Nutm2/Wtsi EMMA embryo mutant strain MGI:5637173 Nutm2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2685652 Nutm2 NUT family member 2 https://www.infrafrontier.eu/search?keyword=EM:09018 + EM:09018 C57BL/6N-Nutm2/Wtsi EMMA sperm mutant strain MGI:5637173 Nutm2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2685652 Nutm2 NUT family member 2 https://www.infrafrontier.eu/search?keyword=EM:09018 + EM:11848 C57BL/6N-Nutm1/Wtsi EMMA embryo mutant strain MGI:5812926 Nutm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2661384 Nutm1 NUT midline carcinoma, family member 1 https://www.infrafrontier.eu/search?keyword=EM:11848 + EM:11848 C57BL/6N-Nutm1/Wtsi EMMA sperm mutant strain MGI:5812926 Nutm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2661384 Nutm1 NUT midline carcinoma, family member 1 https://www.infrafrontier.eu/search?keyword=EM:11848 + EM:11375 C57BL/6N-Nup35/Ieg EMMA sperm mutant strain MGI:5008019 Nup35 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923922 Nup35 nucleoporin 35 https://www.infrafrontier.eu/search?keyword=EM:11375 + EM:11515 C57BL/6N-Nudcd3/Wtsi EMMA embryo mutant strain MGI:6153752 Nudcd3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2144158 Nudcd3 NudC domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:11515 + EM:11515 C57BL/6N-Nudcd3/Wtsi EMMA sperm mutant strain MGI:6153752 Nudcd3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2144158 Nudcd3 NudC domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:11515 + EM:11226 C57BL/6N-Nubpl/WtsiIeg EMMA archived mutant strain MGI:5775003 Nubpl targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1924076 Nubpl nucleotide binding protein-like https://www.infrafrontier.eu/search?keyword=EM:11226 + EM:07901 C57BL/6N-Nubpl/Wtsi EMMA embryo mutant strain MGI:5548675 Nubpl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924076 Nubpl nucleotide binding protein-like https://www.infrafrontier.eu/search?keyword=EM:07901 + EM:07901 C57BL/6N-Nubpl/Wtsi EMMA sperm mutant strain MGI:5548675 Nubpl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924076 Nubpl nucleotide binding protein-like https://www.infrafrontier.eu/search?keyword=EM:07901 + EM:09242 C57BL/6N-Nubp2/Ieg EMMA sperm mutant strain MGI:5613638 Nubp2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1347072 Nubp2 nucleotide binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:09242 + EM:08954 C57BL/6N-Nubp2/Ieg EMMA sperm mutant strain MGI:4460379 Nubp2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1347072 Nubp2 nucleotide binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:08954 - EM:07446 C57BL/6N-Ntrk2/H EMMA sperm mutant strain MGI:4460486 Ntrk2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97384 Ntrk2 neurotrophic tyrosine kinase, receptor, type 2 https://www.infrafrontier.eu/search?keyword=EM:07446 + EM:10147 C57BL/6N-Ntrk1/H EMMA sperm mutant strain MGI:5692907 Ntrk1 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:97383 Ntrk1 neurotrophic tyrosine kinase, receptor, type 1 https://www.infrafrontier.eu/search?keyword=EM:10147 - EM:07342 C57BL/6N-Ntrk1/H EMMA sperm B6NTac;B6N-Ntrk1/H mutant strain MGI:4887687 Ntrk1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97383 Ntrk1 neurotrophic tyrosine kinase, receptor, type 1 https://www.infrafrontier.eu/search?keyword=EM:07342 + EM:11650 C57BL/6N-Nsun2/WtsiOulu EMMA embryo mutant strain MGI:5310947 Nsun2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:107252 Nsun2 NOL1/NOP2/Sun domain family member 2 https://www.infrafrontier.eu/search?keyword=EM:11650 + EM:11650 C57BL/6N-Nsun2/WtsiOulu EMMA sperm mutant strain MGI:5310947 Nsun2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:107252 Nsun2 NOL1/NOP2/Sun domain family member 2 https://www.infrafrontier.eu/search?keyword=EM:11650 + EM:11601 C57BL/6N-Nsmce1/Wtsi EMMA embryo mutant strain MGI:6153567 Nsmce1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914961 Nsmce1 NSE1 homolog, SMC5-SMC6 complex component https://www.infrafrontier.eu/search?keyword=EM:11601 + EM:11601 C57BL/6N-Nsmce1/Wtsi EMMA sperm mutant strain MGI:6153567 Nsmce1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914961 Nsmce1 NSE1 homolog, SMC5-SMC6 complex component https://www.infrafrontier.eu/search?keyword=EM:11601 + EM:09010 C57BL/6N-Nsd3/H EMMA sperm C57BL/6N-Whsc1l1/H mutant strain MGI:4434820 Nsd3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2142581 Nsd3 nuclear receptor binding SET domain protein 3 https://www.infrafrontier.eu/search?keyword=EM:09010 + EM:09544 C57BL/6N-Nrxn1/H EMMA sperm mutant strain MGI:5008771 Nrxn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1096391 Nrxn1 neurexin I https://www.infrafrontier.eu/search?keyword=EM:09544 + EM:09598 C57BL/6N-Nrbp1/Wtsi EMMA embryo mutant strain MGI:5637124 Nrbp1 targeted mutation 3b, Wellcome Trust Sanger Institute MGI:2183436 Nrbp1 nuclear receptor binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:09598 + EM:09598 C57BL/6N-Nrbp1/Wtsi EMMA sperm mutant strain MGI:5637124 Nrbp1 targeted mutation 3b, Wellcome Trust Sanger Institute MGI:2183436 Nrbp1 nuclear receptor binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:09598 + EM:10426 C57BL/6N-Nras/H EMMA sperm mutant strain MGI:5002952 Nras targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97376 Nras neuroblastoma ras oncogene https://www.infrafrontier.eu/search?keyword=EM:10426 + EM:09780 C57BL/6N-Nr4a1/Biat EMMA sperm mutant strain MGI:4432935 Nr4a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1352454 Nr4a1 nuclear receptor subfamily 4, group A, member 1 https://www.infrafrontier.eu/search?keyword=EM:09780 + EM:11309 C57BL/6N-Nr0b1/Wtsi EMMA embryo mutant strain MGI:6153726 Nr0b1 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:1352460 Nr0b1 nuclear receptor subfamily 0, group B, member 1 https://www.infrafrontier.eu/search?keyword=EM:11309 + EM:06125 C57BL/6N-Nptn/H EMMA sperm B6NTac;B6N-Nptn/H mutant strain MGI:4455733 Nptn targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108077 Nptn neuroplastin https://www.infrafrontier.eu/search?keyword=EM:06125 - EM:04739 C57BL/6N-Npc1/H EMMA sperm B6NTac;B6N-Npc1/H mutant strain MGI:4436617 Npc1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1097712 Npc1 NPC intracellular cholesterol transporter 1 https://www.infrafrontier.eu/search?keyword=EM:04739 + EM:09438 C57BL/6N-Npat/Wtsi EMMA embryo mutant strain MGI:5636907 Npat targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107605 Npat nuclear protein in the AT region https://www.infrafrontier.eu/search?keyword=EM:09438 + EM:09438 C57BL/6N-Npat/Wtsi EMMA sperm mutant strain MGI:5636907 Npat targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107605 Npat nuclear protein in the AT region https://www.infrafrontier.eu/search?keyword=EM:09438 + EM:09421 C57BL/6N-Notch1/H EMMA sperm mutant strain MGI:4455755 Notch1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97363 Notch1 notch 1 https://www.infrafrontier.eu/search?keyword=EM:09421 + EM:10111 C57BL/6N-Nolc1/Ieg EMMA sperm mutant strain MGI:5692702 Nolc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1918019 Nolc1 nucleolar and coiled-body phosphoprotein 1 https://www.infrafrontier.eu/search?keyword=EM:10111 + EM:10121 C57BL/6N-Nmt2/Ieg EMMA sperm mutant strain MGI:5692594 Nmt2 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1202298 Nmt2 N-myristoyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:10121 - EM:07781 C57BL/6N-Nlrp9b/H EMMA sperm B6NTac;B6N-Nlrp9b/H mutant strain MGI:4841142 Nlrp9b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2675377 Nlrp9b NLR family, pyrin domain containing 9B https://www.infrafrontier.eu/search?keyword=EM:07781 + EM:08369 C57BL/6N-Nlrc4/H EMMA sperm mutant strain MGI:4841652 Nlrc4 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:3036243 Nlrc4 NLR family, CARD domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:08369 + EM:08808 C57BL/6N-Nisch/H EMMA sperm mutant strain MGI:5319353 Nisch targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1928323 Nisch nischarin https://www.infrafrontier.eu/search?keyword=EM:08808 + EM:09122 C57BL/6N-Nipsnap3a/Wtsi EMMA embryo mutant strain MGI:5637068 Nipsnap3a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1920648 Nipsnap3a nipsnap homolog 3A https://www.infrafrontier.eu/search?keyword=EM:09122 + EM:09122 C57BL/6N-Nipsnap3a/Wtsi EMMA sperm mutant strain MGI:5637068 Nipsnap3a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1920648 Nipsnap3a nipsnap homolog 3A https://www.infrafrontier.eu/search?keyword=EM:09122 + EM:10598 C57BL/6N-Ngfr/H EMMA archived mutant strain MGI:5637211 Ngfr targeted mutation 1b, Wellcome Trust Sanger Institute MGI:97323 Ngfr nerve growth factor receptor (TNFR superfamily, member 16) https://www.infrafrontier.eu/search?keyword=EM:10598 + EM:10120 C57BL/6N-Ngdn/Ieg EMMA sperm mutant strain MGI:5692691 Ngdn targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916216 Ngdn neuroguidin, EIF4E binding protein https://www.infrafrontier.eu/search?keyword=EM:10120 + EM:10064 C57BL/6N-Ngdn/Ieg EMMA sperm mutant strain MGI:5052489 Ngdn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916216 Ngdn neuroguidin, EIF4E binding protein https://www.infrafrontier.eu/search?keyword=EM:10064 + EM:08106 C57BL/6N-Nfatc3/Ieg EMMA sperm C57BL/6N-Nfatc3/Hmgu mutant strain MGI:5548344 Nfatc3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:103296 Nfatc3 nuclear factor of activated T cells, cytoplasmic, calcineurin dependent 3 https://www.infrafrontier.eu/search?keyword=EM:08106 + EM:08102 C57BL/6N-Nfatc3/Ieg EMMA embryo B6NTac;B6N-Nfatc3/Ieg mutant strain MGI:5000351 Nfatc3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103296 Nfatc3 nuclear factor of activated T cells, cytoplasmic, calcineurin dependent 3 https://www.infrafrontier.eu/search?keyword=EM:08102 + EM:09362 C57BL/6N-Nek3/Wtsi EMMA embryo mutant strain MGI:5636976 Nek3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1344371 Nek3 NIMA (never in mitosis gene a)-related expressed kinase 3 https://www.infrafrontier.eu/search?keyword=EM:09362 + EM:09362 C57BL/6N-Nek3/Wtsi EMMA sperm mutant strain MGI:5636976 Nek3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1344371 Nek3 NIMA (never in mitosis gene a)-related expressed kinase 3 https://www.infrafrontier.eu/search?keyword=EM:09362 + EM:07339 C57BL/6N-Nedd4l/H EMMA sperm B6NTac;B6N-Nedd4l/H mutant strain MGI:4363447 Nedd4l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933754 Nedd4l neural precursor cell expressed, developmentally down-regulated gene 4-like https://www.infrafrontier.eu/search?keyword=EM:07339 + EM:08459 C57BL/6N-Nedd4/H EMMA sperm mutant strain MGI:5511569 Nedd4 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:97297 Nedd4 neural precursor cell expressed, developmentally down-regulated 4 https://www.infrafrontier.eu/search?keyword=EM:08459 + EM:09926 C57BL/6N-Nebl/Wtsi EMMA embryo mutant strain MGI:5692728 Nebl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921353 Nebl nebulette https://www.infrafrontier.eu/search?keyword=EM:09926 + EM:09926 C57BL/6N-Nebl/Wtsi EMMA sperm mutant strain MGI:5692728 Nebl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921353 Nebl nebulette https://www.infrafrontier.eu/search?keyword=EM:09926 + EM:08470 C57BL/6N-Ndufs1/Ieg EMMA sperm mutant strain MGI:5548814 Ndufs1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2443241 Ndufs1 NADH:ubiquinone oxidoreductase core subunit S1 https://www.infrafrontier.eu/search?keyword=EM:08470 + EM:08460 C57BL/6N-Ndufs1/Ieg EMMA embryo mutant strain MGI:4843861 Ndufs1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443241 Ndufs1 NADH:ubiquinone oxidoreductase core subunit S1 https://www.infrafrontier.eu/search?keyword=EM:08460 + EM:09311 C57BL/6N-Ndufb9/Ieg EMMA sperm mutant strain MGI:5637008 Ndufb9 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1913468 Ndufb9 NADH:ubiquinone oxidoreductase subunit B9 https://www.infrafrontier.eu/search?keyword=EM:09311 + EM:09291 C57BL/6N-Ndufb9/Ieg EMMA embryo mutant strain MGI:4841556 Ndufb9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913468 Ndufb9 NADH:ubiquinone oxidoreductase subunit B9 https://www.infrafrontier.eu/search?keyword=EM:09291 + EM:09291 C57BL/6N-Ndufb9/Ieg EMMA sperm mutant strain MGI:4841556 Ndufb9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913468 Ndufb9 NADH:ubiquinone oxidoreductase subunit B9 https://www.infrafrontier.eu/search?keyword=EM:09291 + EM:08092 C57BL/6N-Ndufa8/Ieg EMMA embryo C57BL/6N-Ndufa8/Hmgu mutant strain MGI:5548563 Ndufa8 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1915625 Ndufa8 NADH:ubiquinone oxidoreductase subunit A8 https://www.infrafrontier.eu/search?keyword=EM:08092 + EM:10048 C57BL/6N-Ndufa10/Ieg EMMA sperm mutant strain MGI:6317360 Ndufa10 targeted mutation 1e.1, Helmholtz Zentrum Muenchen GmbH MGI:1914523 Ndufa10 NADH:ubiquinone oxidoreductase subunit A10 https://www.infrafrontier.eu/search?keyword=EM:10048 + EM:11437 C57BL/6N-Ndrg2/Wtsi EMMA embryo mutant strain MGI:6153561 Ndrg2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1352498 Ndrg2 N-myc downstream regulated gene 2 https://www.infrafrontier.eu/search?keyword=EM:11437 + EM:11437 C57BL/6N-Ndrg2/Wtsi EMMA sperm mutant strain MGI:6153561 Ndrg2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1352498 Ndrg2 N-myc downstream regulated gene 2 https://www.infrafrontier.eu/search?keyword=EM:11437 + EM:09864 C57BL/6N-Ndnf/Oulu EMMA embryo mutant strain MGI:4880569 Ndnf targeted mutation 1, Mammalian Functional Genomics Centre MGI:1915419 Ndnf neuron-derived neurotrophic factor https://www.infrafrontier.eu/search?keyword=EM:09864 + EM:09864 C57BL/6N-Ndnf/Oulu EMMA sperm mutant strain MGI:4880569 Ndnf targeted mutation 1, Mammalian Functional Genomics Centre MGI:1915419 Ndnf neuron-derived neurotrophic factor https://www.infrafrontier.eu/search?keyword=EM:09864 + EM:08069 C57BL/6N-Ndfip2/Ieg EMMA embryo C57BL/6N-Ndfip2/Hmgu mutant strain MGI:5548666 Ndfip2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1923523 Ndfip2 Nedd4 family interacting protein 2 https://www.infrafrontier.eu/search?keyword=EM:08069 + EM:05045 C57BL/6N-Ndfip2/Ieg EMMA embryo B6NTac;B6N-Ndfip2/Ieg mutant strain MGI:4436082 Ndfip2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923523 Ndfip2 Nedd4 family interacting protein 2 https://www.infrafrontier.eu/search?keyword=EM:05045 - EM:10925 C57BL/6N-Nctc1/Wtsi EMMA embryo mutant strain Nctc1 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:1306816 Nctc1 non-coding transcript 1 https://www.infrafrontier.eu/search?keyword=EM:10925 - EM:10925 C57BL/6N-Nctc1/Wtsi EMMA sperm mutant strain Nctc1 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:1306816 Nctc1 non-coding transcript 1 https://www.infrafrontier.eu/search?keyword=EM:10925 + EM:09372 C57BL/6N-Ncoa3/H EMMA sperm mutant strain MGI:5008021 Ncoa3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1276535 Ncoa3 nuclear receptor coactivator 3 https://www.infrafrontier.eu/search?keyword=EM:09372 - EM:08188 C57BL/6N-Ncf4/H EMMA sperm B6NTac;B6N-Ncf4/H mutant strain MGI:4841143 Ncf4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109186 Ncf4 neutrophil cytosolic factor 4 https://www.infrafrontier.eu/search?keyword=EM:08188 + EM:11979 C57BL/6N-Ncf2/Wtsi EMMA embryo mutant strain MGI:6149902 Ncf2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:97284 Ncf2 neutrophil cytosolic factor 2 https://www.infrafrontier.eu/search?keyword=EM:11979 + EM:11979 C57BL/6N-Ncf2/Wtsi EMMA sperm mutant strain MGI:6149902 Ncf2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:97284 Ncf2 neutrophil cytosolic factor 2 https://www.infrafrontier.eu/search?keyword=EM:11979 + EM:11443 C57BL/6N-Ncapd3/Wtsi EMMA embryo mutant strain MGI:6153560 Ncapd3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2142989 Ncapd3 non-SMC condensin II complex, subunit D3 https://www.infrafrontier.eu/search?keyword=EM:11443 + EM:11443 C57BL/6N-Ncapd3/Wtsi EMMA sperm mutant strain MGI:6153560 Ncapd3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2142989 Ncapd3 non-SMC condensin II complex, subunit D3 https://www.infrafrontier.eu/search?keyword=EM:11443 + EM:10747 C57BL/6N-Ncapd2/Wtsi EMMA embryo mutant strain MGI:6153559 Ncapd2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1920064 Ncapd2 non-SMC condensin I complex, subunit D2 https://www.infrafrontier.eu/search?keyword=EM:10747 + EM:10747 C57BL/6N-Ncapd2/Wtsi EMMA sperm mutant strain MGI:6153559 Ncapd2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1920064 Ncapd2 non-SMC condensin I complex, subunit D2 https://www.infrafrontier.eu/search?keyword=EM:10747 + EM:10717 C57BL/6N-Nbeal1/Wtsi EMMA embryo mutant strain MGI:5785044 Nbeal1 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2444343 Nbeal1 neurobeachin like 1 https://www.infrafrontier.eu/search?keyword=EM:10717 + EM:10717 C57BL/6N-Nbeal1/Wtsi EMMA sperm mutant strain MGI:5785044 Nbeal1 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2444343 Nbeal1 neurobeachin like 1 https://www.infrafrontier.eu/search?keyword=EM:10717 + EM:08754 C57BL/6N-Nbas/Ieg EMMA sperm mutant strain MGI:5548607 Nbas targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1918419 Nbas neuroblastoma amplified sequence https://www.infrafrontier.eu/search?keyword=EM:08754 + EM:07859 C57BL/6N-Natd1/WtsiOulu EMMA embryo C57BL/6N-Gm16515/WtsiOulu mutant strain MGI:5548455 Natd1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1344388 Natd1 N-acetyltransferase domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:07859 + EM:07859 C57BL/6N-Natd1/WtsiOulu EMMA sperm C57BL/6N-Gm16515/WtsiOulu mutant strain MGI:5548455 Natd1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1344388 Natd1 N-acetyltransferase domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:07859 + EM:08809 C57BL/6N-Nat8f5/H EMMA sperm mutant strain MGI:5141838 Nat8f5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916299 Nat8f5 N-acetyltransferase 8 (GCN5-related) family member 5 https://www.infrafrontier.eu/search?keyword=EM:08809 - EM:12338 C57BL/6N-Nap1l4/Orl EMMA sperm mutant strain MGI:6357884 Nap1l4 endonuclease-mediated mutation 1, Centre d'ImmunoPhenomique MGI:1316687 Nap1l4 nucleosome assembly protein 1-like 4 https://www.infrafrontier.eu/search?keyword=EM:12338 - EM:05309 C57BL/6N-Nagk/H EMMA sperm mutant strain MGI:4455634 Nagk targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1860418 Nagk N-acetylglucosamine kinase https://www.infrafrontier.eu/search?keyword=EM:05309 + EM:09366 C57BL/6N-Nadk2/Wtsi EMMA embryo mutant strain MGI:5637034 Nadk2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915896 Nadk2 NAD kinase 2, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:09366 + EM:09366 C57BL/6N-Nadk2/Wtsi EMMA sperm mutant strain MGI:5637034 Nadk2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915896 Nadk2 NAD kinase 2, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:09366 + EM:08219 C57BL/6N-Nacc2/Wtsi EMMA embryo mutant strain MGI:5637027 Nacc2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1915241 Nacc2 nucleus accumbens associated 2, BEN and BTB (POZ) domain containing https://www.infrafrontier.eu/search?keyword=EM:08219 + EM:08219 C57BL/6N-Nacc2/Wtsi EMMA sperm mutant strain MGI:5637027 Nacc2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1915241 Nacc2 nucleus accumbens associated 2, BEN and BTB (POZ) domain containing https://www.infrafrontier.eu/search?keyword=EM:08219 + EM:09096 C57BL/6N-Myoz1/Ieg EMMA embryo mutant strain MGI:5548708 Myoz1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1929471 Myoz1 myozenin 1 https://www.infrafrontier.eu/search?keyword=EM:09096 + EM:08558 C57BL/6N-Myo9a/Wtsi EMMA embryo mutant strain MGI:5636908 Myo9a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107735 Myo9a myosin IXa https://www.infrafrontier.eu/search?keyword=EM:08558 + EM:08558 C57BL/6N-Myo9a/Wtsi EMMA sperm mutant strain MGI:5636908 Myo9a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107735 Myo9a myosin IXa https://www.infrafrontier.eu/search?keyword=EM:08558 + EM:10329 C57BL/6N-Myo5b/Wtsi EMMA embryo mutant strain MGI:6153496 Myo5b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2147254 Myo5b myosin VB https://www.infrafrontier.eu/search?keyword=EM:10329 + EM:10329 C57BL/6N-Myo5b/Wtsi EMMA sperm mutant strain MGI:6153496 Myo5b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2147254 Myo5b myosin VB https://www.infrafrontier.eu/search?keyword=EM:10329 + EM:10656 C57BL/6N-Myl3/Wtsi EMMA embryo mutant strain MGI:6153495 Myl3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:97268 Myl3 myosin, light polypeptide 3 https://www.infrafrontier.eu/search?keyword=EM:10656 + EM:10656 C57BL/6N-Myl3/Wtsi EMMA sperm mutant strain MGI:6153495 Myl3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:97268 Myl3 myosin, light polypeptide 3 https://www.infrafrontier.eu/search?keyword=EM:10656 + EM:09487 C57BL/6N-Myl2/Ieg EMMA sperm mutant strain MGI:5425876 Myl2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97272 Myl2 myosin, light polypeptide 2, regulatory, cardiac, slow https://www.infrafrontier.eu/search?keyword=EM:09487 + EM:11897 C57BL/6N-Myl10/WtsiH EMMA sperm mutant strain MGI:6153494 Myl10 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1917247 Myl10 myosin, light chain 10, regulatory https://www.infrafrontier.eu/search?keyword=EM:11897 + EM:11384 C57BL/6N-Myh3/Wtsi EMMA embryo mutant strain MGI:6120706 Myh3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1339709 Myh3 myosin, heavy polypeptide 3, skeletal muscle, embryonic https://www.infrafrontier.eu/search?keyword=EM:11384 + EM:11384 C57BL/6N-Myh3/Wtsi EMMA sperm mutant strain MGI:6120706 Myh3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1339709 Myh3 myosin, heavy polypeptide 3, skeletal muscle, embryonic https://www.infrafrontier.eu/search?keyword=EM:11384 + EM:08157 C57BL/6N-Mybphl/WtsiBiat EMMA sperm mutant strain MGI:5548569 Mybphl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916003 Mybphl myosin binding protein H-like https://www.infrafrontier.eu/search?keyword=EM:08157 + EM:09100 C57BL/6N-Mybbp1a/Ieg EMMA sperm mutant strain MGI:5548364 Mybbp1a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:106181 Mybbp1a MYB binding protein (P160) 1a https://www.infrafrontier.eu/search?keyword=EM:09100 + EM:06278 C57BL/6N-Mybbp1a/Ieg EMMA embryo B6NTac;B6N-Mybbp1a/Ieg mutant strain MGI:4435114 Mybbp1a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:106181 Mybbp1a MYB binding protein (P160) 1a https://www.infrafrontier.eu/search?keyword=EM:06278 + EM:10608 C57BL/6N-Mtmr1/Wtsi EMMA embryo mutant strain MGI:5708190 Mtmr1 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1858271 Mtmr1 myotubularin related protein 1 https://www.infrafrontier.eu/search?keyword=EM:10608 + EM:10608 C57BL/6N-Mtmr1/Wtsi EMMA sperm mutant strain MGI:5708190 Mtmr1 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1858271 Mtmr1 myotubularin related protein 1 https://www.infrafrontier.eu/search?keyword=EM:10608 + EM:09253 C57BL/6N-Mtif3/Ieg EMMA sperm mutant strain MGI:5613653 Mtif3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923616 Mtif3 mitochondrial translational initiation factor 3 https://www.infrafrontier.eu/search?keyword=EM:09253 + EM:08245 C57BL/6N-Mtif3/Ieg EMMA embryo mutant strain MGI:4457571 Mtif3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923616 Mtif3 mitochondrial translational initiation factor 3 https://www.infrafrontier.eu/search?keyword=EM:08245 + EM:08654 C57BL/6N-Mthfsl/Ieg EMMA sperm mutant strain MGI:5548911 Mthfsl targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3780550 Mthfsl 5, 10-methenyltetrahydrofolate synthetase-like https://www.infrafrontier.eu/search?keyword=EM:08654 + EM:08626 C57BL/6N-Mthfsl/Ieg EMMA sperm mutant strain MGI:4434563 Mthfsl targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3780550 Mthfsl 5, 10-methenyltetrahydrofolate synthetase-like https://www.infrafrontier.eu/search?keyword=EM:08626 + EM:12648 C57BL/6N-Mthfr/H EMMA live mutant strain MGI:5521869 Mthfr targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:106639 Mthfr methylenetetrahydrofolate reductase https://www.infrafrontier.eu/search?keyword=EM:12648 + EM:09183 C57BL/6N-Mthfd2l/H EMMA sperm mutant strain MGI:5692689 Mthfd2l targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1915871 Mthfd2l methylenetetrahydrofolate dehydrogenase (NADP+ dependent) 2-like https://www.infrafrontier.eu/search?keyword=EM:09183 - EM:06362 C57BL/6N-Mthfd2l/H EMMA sperm mutant strain MGI:4431820 Mthfd2l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915871 Mthfd2l methylenetetrahydrofolate dehydrogenase (NADP+ dependent) 2-like https://www.infrafrontier.eu/search?keyword=EM:06362 + EM:10812 C57BL/6N-Msl1/Wtsi EMMA embryo mutant strain MGI:6153493 Msl1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1922153 Msl1 male specific lethal 1 https://www.infrafrontier.eu/search?keyword=EM:10812 + EM:10812 C57BL/6N-Msl1/Wtsi EMMA sperm mutant strain MGI:6153493 Msl1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1922153 Msl1 male specific lethal 1 https://www.infrafrontier.eu/search?keyword=EM:10812 + EM:09511 C57BL/6N-Msh5/Ieg EMMA sperm mutant strain MGI:5629311 Msh5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1329021 Msh5 mutS homolog 5 https://www.infrafrontier.eu/search?keyword=EM:09511 + EM:08955 C57BL/6N-Msh5/Ieg EMMA sperm mutant strain MGI:4842260 Msh5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1329021 Msh5 mutS homolog 5 https://www.infrafrontier.eu/search?keyword=EM:08955 + EM:07564 C57BL/6N-Mrps5/Wtsi EMMA embryo mutant strain MGI:5548689 Mrps5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924971 Mrps5 mitochondrial ribosomal protein S5 https://www.infrafrontier.eu/search?keyword=EM:07564 + EM:07564 C57BL/6N-Mrps5/Wtsi EMMA sperm mutant strain MGI:5548689 Mrps5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924971 Mrps5 mitochondrial ribosomal protein S5 https://www.infrafrontier.eu/search?keyword=EM:07564 + EM:10025 C57BL/6N-Mrpl23/Wtsi EMMA embryo mutant strain MGI:5694166 Mrpl23 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1196612 Mrpl23 mitochondrial ribosomal protein L23 https://www.infrafrontier.eu/search?keyword=EM:10025 + EM:10025 C57BL/6N-Mrpl23/Wtsi EMMA sperm mutant strain MGI:5694166 Mrpl23 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1196612 Mrpl23 mitochondrial ribosomal protein L23 https://www.infrafrontier.eu/search?keyword=EM:10025 + EM:11272 C57BL/6N-Mrpl20/Wtsi EMMA embryo mutant strain MGI:6153492 Mrpl20 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921200 Mrpl20 mitochondrial ribosomal protein L20 https://www.infrafrontier.eu/search?keyword=EM:11272 + EM:11272 C57BL/6N-Mrpl20/Wtsi EMMA sperm mutant strain MGI:6153492 Mrpl20 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921200 Mrpl20 mitochondrial ribosomal protein L20 https://www.infrafrontier.eu/search?keyword=EM:11272 + EM:07759 C57BL/6N-Mroh4/Wtsi EMMA embryo mutant strain MGI:5637041 Mroh4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916689 Mroh4 maestro heat-like repeat family member 4 https://www.infrafrontier.eu/search?keyword=EM:07759 + EM:07759 C57BL/6N-Mroh4/Wtsi EMMA sperm mutant strain MGI:5637041 Mroh4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916689 Mroh4 maestro heat-like repeat family member 4 https://www.infrafrontier.eu/search?keyword=EM:07759 + EM:10039 C57BL/6N-Mpst/Ieg EMMA sperm mutant strain MGI:5692799 Mpst targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2179733 Mpst mercaptopyruvate sulfurtransferase https://www.infrafrontier.eu/search?keyword=EM:10039 + EM:08601 C57BL/6N-Mpst/Ieg EMMA sperm mutant strain MGI:4841819 Mpst targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2179733 Mpst mercaptopyruvate sulfurtransferase https://www.infrafrontier.eu/search?keyword=EM:08601 - EM:06387 C57BL/6N-Mpo/H EMMA sperm B6NTac;B6N-Mpo/H mutant strain MGI:4362976 Mpo targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97137 Mpo myeloperoxidase https://www.infrafrontier.eu/search?keyword=EM:06387 + EM:11581 C57BL/6N-Morc2a/WtsiOulu EMMA embryo mutant strain MGI:6140214 Morc2a endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1921772 Morc2a microrchidia 2A https://www.infrafrontier.eu/search?keyword=EM:11581 + EM:11581 C57BL/6N-Morc2a/WtsiOulu EMMA sperm mutant strain MGI:6140214 Morc2a endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1921772 Morc2a microrchidia 2A https://www.infrafrontier.eu/search?keyword=EM:11581 + EM:09099 C57BL/6N-Mocs2/Ieg EMMA embryo mutant strain MGI:5548433 Mocs2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336894 Mocs2 molybdenum cofactor synthesis 2 https://www.infrafrontier.eu/search?keyword=EM:09099 + EM:09099 C57BL/6N-Mocs2/Ieg EMMA sperm mutant strain MGI:5548433 Mocs2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336894 Mocs2 molybdenum cofactor synthesis 2 https://www.infrafrontier.eu/search?keyword=EM:09099 + EM:06280 C57BL/6N-Mocs2/Ieg EMMA embryo B6NTac;B6N-Mocs2/Ieg mutant strain MGI:4456059 Mocs2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1336894 Mocs2 molybdenum cofactor synthesis 2 https://www.infrafrontier.eu/search?keyword=EM:06280 + EM:07319 C57BL/6N-Mob2/H EMMA sperm B6NTac;B6N-Mob2/H mutant strain MGI:5286243 Mob2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919891 Mob2 MOB kinase activator 2 https://www.infrafrontier.eu/search?keyword=EM:07319 - EM:05337 C57BL/6N-Mmrn1/Cnrm EMMA sperm mutant strain MGI:4451813 Mmrn1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918195 Mmrn1 multimerin 1 https://www.infrafrontier.eu/search?keyword=EM:05337 - EM:06744 C57BL/6N-Mmp16/H EMMA sperm B6NTac;B6N-Mmp16/H mutant strain MGI:5014693 Mmp16 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1276107 Mmp16 matrix metallopeptidase 16 https://www.infrafrontier.eu/search?keyword=EM:06744 - EM:05321 C57BL/6N-Mmp12/H EMMA sperm mutant strain MGI:4455797 Mmp12 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97005 Mmp12 matrix metallopeptidase 12 https://www.infrafrontier.eu/search?keyword=EM:05321 + EM:11978 C57BL/6N-Mmadhc/Wtsi EMMA embryo mutant strain MGI:6281099 Mmadhc endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1923786 Mmadhc methylmalonic aciduria (cobalamin deficiency) cblD type, with homocystinuria https://www.infrafrontier.eu/search?keyword=EM:11978 + EM:11978 C57BL/6N-Mmadhc/Wtsi EMMA sperm mutant strain MGI:6281099 Mmadhc endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1923786 Mmadhc methylmalonic aciduria (cobalamin deficiency) cblD type, with homocystinuria https://www.infrafrontier.eu/search?keyword=EM:11978 - EM:05287 C57BL/6N-Mllt3/Cnrm EMMA sperm mutant strain MGI:4434535 Mllt3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917372 Mllt3 myeloid/lymphoid or mixed-lineage leukemia; translocated to, 3 https://www.infrafrontier.eu/search?keyword=EM:05287 + EM:10680 C57BL/6N-Mkrn2/WtsiPh EMMA sperm mutant strain MGI:5548531 Mkrn2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914277 Mkrn2 makorin, ring finger protein, 2 https://www.infrafrontier.eu/search?keyword=EM:10680 + EM:11573 C57BL/6N-Mkrn2/WtsiOulu EMMA embryo mutant strain MGI:6140212 Mkrn2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914277 Mkrn2 makorin, ring finger protein, 2 https://www.infrafrontier.eu/search?keyword=EM:11573 + EM:11573 C57BL/6N-Mkrn2/WtsiOulu EMMA sperm mutant strain MGI:6140212 Mkrn2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914277 Mkrn2 makorin, ring finger protein, 2 https://www.infrafrontier.eu/search?keyword=EM:11573 + EM:11885 C57BL/6N-Mir96/WtsiH EMMA sperm mutant strain Mir96 undef targeted mutation , Wellcome Trust Sanger Institute MGI:3619440 Mir96 microRNA 96 https://www.infrafrontier.eu/search?keyword=EM:11885 + EM:11753 C57BL/6N-Mir96/Wtsi EMMA embryo mutant strain Mir96 undef targeted mutation , Wellcome Trust Sanger Institute MGI:3619440 Mir96 microRNA 96 https://www.infrafrontier.eu/search?keyword=EM:11753 + EM:11753 C57BL/6N-Mir96/Wtsi EMMA sperm mutant strain Mir96 undef targeted mutation , Wellcome Trust Sanger Institute MGI:3619440 Mir96 microRNA 96 https://www.infrafrontier.eu/search?keyword=EM:11753 ? EM:12223 C57BL/6N-Mir182/WtsiH EMMA sperm mutant strain Mir182 Mir182 MGI:2676846 Mir182 microRNA 182 https://www.infrafrontier.eu/search?keyword=EM:12223 + EM:09088 C57BL/6N-Mipol1/Ieg EMMA sperm mutant strain MGI:5605791 Mipol1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1920740 Mipol1 mirror-image polydactyly 1 https://www.infrafrontier.eu/search?keyword=EM:09088 + EM:08619 C57BL/6N-Mipol1/Ieg EMMA embryo mutant strain MGI:4843891 Mipol1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920740 Mipol1 mirror-image polydactyly 1 https://www.infrafrontier.eu/search?keyword=EM:08619 + EM:08018 C57BL/6N-Minar2/Wtsi EMMA embryo C57BL/6N-A730017C20Rik/Wtsi mutant strain MGI:5637144 Minar2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442934 Minar2 membrane integral NOTCH2 associated receptor 2 https://www.infrafrontier.eu/search?keyword=EM:08018 + EM:08018 C57BL/6N-Minar2/Wtsi EMMA sperm C57BL/6N-A730017C20Rik/Wtsi mutant strain MGI:5637144 Minar2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442934 Minar2 membrane integral NOTCH2 associated receptor 2 https://www.infrafrontier.eu/search?keyword=EM:08018 + EM:08650 C57BL/6N-Miga1/Ieg EMMA sperm C57BL/6N-Fam73a/Ieg, C57BL/6N-Mita1/Ieg mutant strain MGI:5567110 Miga1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924567 Miga1 mitoguardin 1 https://www.infrafrontier.eu/search?keyword=EM:08650 - EM:08607 C57BL/6N-Miga1/Ieg EMMA sperm mutant strain MGI:4461706 Miga1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924567 Miga1 mitoguardin 1 https://www.infrafrontier.eu/search?keyword=EM:08607 + EM:09241 C57BL/6N-Mgat1/Ieg EMMA sperm mutant strain MGI:5613671 Mgat1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:96973 Mgat1 mannoside acetylglucosaminyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:09241 + EM:08518 C57BL/6N-Mgat1/Ieg EMMA sperm mutant strain MGI:4842039 Mgat1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96973 Mgat1 mannoside acetylglucosaminyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:08518 + EM:11189 C57BL/6N-Mga/Wtsi EMMA embryo mutant strain MGI:6153491 Mga endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2441880 Mga MAX gene associated https://www.infrafrontier.eu/search?keyword=EM:11189 + EM:11189 C57BL/6N-Mga/Wtsi EMMA sperm mutant strain MGI:6153491 Mga endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2441880 Mga MAX gene associated https://www.infrafrontier.eu/search?keyword=EM:11189 - EM:05994 C57BL/6N-Mfsd8/Cnrm EMMA sperm mutant strain MGI:4456699 Mfsd8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1919425 Mfsd8 major facilitator superfamily domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:05994 + EM:10115 C57BL/6N-Mfn2/Ieg EMMA sperm mutant strain MGI:5692821 Mfn2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442230 Mfn2 mitofusin 2 https://www.infrafrontier.eu/search?keyword=EM:10115 + EM:09811 C57BL/6N-Mfn2/Ieg EMMA embryo mutant strain MGI:4434285 Mfn2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442230 Mfn2 mitofusin 2 https://www.infrafrontier.eu/search?keyword=EM:09811 + EM:09811 C57BL/6N-Mfn2/Ieg EMMA sperm mutant strain MGI:4434285 Mfn2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442230 Mfn2 mitofusin 2 https://www.infrafrontier.eu/search?keyword=EM:09811 + EM:10410 C57BL/6N-Mex3a/Cnbc EMMA sperm mutant strain MGI:5085513 Mex3a targeted mutation 1, Velocigene MGI:1919890 Mex3a mex3 RNA binding family member A https://www.infrafrontier.eu/search?keyword=EM:10410 + EM:07565 C57BL/6N-Metrnl/Wtsi EMMA embryo mutant strain MGI:5637126 Metrnl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2384806 Metrnl meteorin, glial cell differentiation regulator-like https://www.infrafrontier.eu/search?keyword=EM:07565 + EM:07565 C57BL/6N-Metrnl/Wtsi EMMA sperm mutant strain MGI:5637126 Metrnl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2384806 Metrnl meteorin, glial cell differentiation regulator-like https://www.infrafrontier.eu/search?keyword=EM:07565 + EM:07543 C57BL/6N-Medag/Wtsi EMMA embryo mutant strain MGI:5548602 Medag targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1917967 Medag mesenteric estrogen dependent adipogenesis https://www.infrafrontier.eu/search?keyword=EM:07543 + EM:07543 C57BL/6N-Medag/Wtsi EMMA sperm mutant strain MGI:5548602 Medag targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1917967 Medag mesenteric estrogen dependent adipogenesis https://www.infrafrontier.eu/search?keyword=EM:07543 + EM:11164 C57BL/6N-Med23/WtsiH EMMA sperm mutant strain MGI:6153490 Med23 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1917458 Med23 mediator complex subunit 23 https://www.infrafrontier.eu/search?keyword=EM:11164 + EM:09514 C57BL/6N-Me3/Ieg EMMA sperm mutant strain MGI:5629317 Me3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916679 Me3 malic enzyme 3, NADP(+)-dependent, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:09514 + EM:10107 C57BL/6N-Me2/Ieg EMMA sperm mutant strain MGI:5692786 Me2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2147351 Me2 malic enzyme 2, NAD(+)-dependent, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:10107 + EM:11327 C57BL/6N-Mdfic/Wtsi EMMA embryo mutant strain MGI:6153489 Mdfic endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:104611 Mdfic MyoD family inhibitor domain containing https://www.infrafrontier.eu/search?keyword=EM:11327 + EM:11327 C57BL/6N-Mdfic/Wtsi EMMA sperm mutant strain MGI:6153489 Mdfic endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:104611 Mdfic MyoD family inhibitor domain containing https://www.infrafrontier.eu/search?keyword=EM:11327 + EM:10143 C57BL/6N-Mcub/H EMMA sperm mutant strain MGI:5692665 Mcub targeted mutation 1c, Mouse Biology Program, UCDavis MGI:1914065 Mcub mitochondrial calcium uniporter dominant negative beta subunit https://www.infrafrontier.eu/search?keyword=EM:10143 + EM:07308 C57BL/6N-Mcub/H EMMA sperm C57BL/6N-Ccdc109b/H, B6NTac;B6N-Ccdc109b/H mutant strain MGI:4840771 Mcub targeted mutation 1a, Mouse Biology Program, UCDavis MGI:1914065 Mcub mitochondrial calcium uniporter dominant negative beta subunit https://www.infrafrontier.eu/search?keyword=EM:07308 + EM:10448 C57BL/6N-Mcu/H EMMA sperm mutant strain MGI:5692853 Mcu targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:3026965 Mcu mitochondrial calcium uniporter https://www.infrafrontier.eu/search?keyword=EM:10448 - EM:07445 C57BL/6N-Mcu/H EMMA sperm B6NTac;B6N-Mcu/H mutant strain MGI:5294185 Mcu targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3026965 Mcu mitochondrial calcium uniporter https://www.infrafrontier.eu/search?keyword=EM:07445 + EM:10462 C57BL/6N-Mboat7/H EMMA sperm C57BL/6NTac-Mboat7/H mutant strain MGI:5752550 Mboat7 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1924832 Mboat7 membrane bound O-acyltransferase domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:10462 + EM:11160 C57BL/6N-Mbl2/WtsiOulu EMMA embryo mutant strain MGI:6140211 Mbl2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:96924 Mbl2 mannose-binding lectin (protein C) 2 https://www.infrafrontier.eu/search?keyword=EM:11160 + EM:11160 C57BL/6N-Mbl2/WtsiOulu EMMA sperm mutant strain MGI:6140211 Mbl2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:96924 Mbl2 mannose-binding lectin (protein C) 2 https://www.infrafrontier.eu/search?keyword=EM:11160 + EM:11157 C57BL/6N-Mbd1/WtsiH EMMA sperm mutant strain MGI:6153488 Mbd1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1333811 Mbd1 methyl-CpG binding domain protein 1 https://www.infrafrontier.eu/search?keyword=EM:11157 + EM:08300 C57BL/6N-Mau2/Wtsi EMMA embryo mutant strain MGI:5637081 Mau2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921799 Mau2 MAU2 sister chromatid cohesion factor https://www.infrafrontier.eu/search?keyword=EM:08300 + EM:08300 C57BL/6N-Mau2/Wtsi EMMA sperm mutant strain MGI:5637081 Mau2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921799 Mau2 MAU2 sister chromatid cohesion factor https://www.infrafrontier.eu/search?keyword=EM:08300 + EM:10571 C57BL/6N-Matn4/Wtsi EMMA embryo mutant strain MGI:6153487 Matn4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1328314 Matn4 matrilin 4 https://www.infrafrontier.eu/search?keyword=EM:10571 + EM:10571 C57BL/6N-Matn4/Wtsi EMMA sperm mutant strain MGI:6153487 Matn4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1328314 Matn4 matrilin 4 https://www.infrafrontier.eu/search?keyword=EM:10571 - EM:07498 C57BL/6N-Marveld2/H EMMA sperm mutant strain MGI:4461651 Marveld2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446166 Marveld2 MARVEL (membrane-associating) domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:07498 + EM:10237 C57BL/6N-Marco/Ieg EMMA sperm mutant strain MGI:5701720 Marco targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1309998 Marco macrophage receptor with collagenous structure https://www.infrafrontier.eu/search?keyword=EM:10237 + EM:09486 C57BL/6N-Marco/Ieg EMMA sperm mutant strain Marco EUCOMM targeted mutation 2, Helmholtz Zentrum Muenchen GmbH MGI:1309998 Marco macrophage receptor with collagenous structure https://www.infrafrontier.eu/search?keyword=EM:09486 + EM:09039 C57BL/6N-Mapkbp1/H EMMA sperm mutant strain MGI:5692629 Mapkbp1 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1347004 Mapkbp1 mitogen-activated protein kinase binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:09039 + EM:10132 C57BL/6N-Mapkapk5/Ieg EMMA sperm mutant strain MGI:5692611 Mapkapk5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1333110 Mapkapk5 MAP kinase-activated protein kinase 5 https://www.infrafrontier.eu/search?keyword=EM:10132 - EM:05658 C57BL/6N-Mapkapk2/H EMMA sperm B6NTac;B6N-Mapkapk2/H mutant strain MGI:4842229 Mapkapk2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109298 Mapkapk2 MAP kinase-activated protein kinase 2 https://www.infrafrontier.eu/search?keyword=EM:05658 - EM:08187 C57BL/6N-Mapk11/H EMMA sperm B6NTac;B6N-Mapk11/H mutant strain MGI:4435746 Mapk11 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1338024 Mapk11 mitogen-activated protein kinase 11 https://www.infrafrontier.eu/search?keyword=EM:08187 + EM:06159 C57BL/6N-Map3k7/H EMMA sperm B6NTac;B6N-Map3k7/H mutant strain MGI:4947820 Map3k7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1346877 Map3k7 mitogen-activated protein kinase kinase kinase 7 https://www.infrafrontier.eu/search?keyword=EM:06159 + EM:08070 C57BL/6N-Map3k10/Ieg EMMA sperm mutant strain MGI:5548463 Map3k10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1346879 Map3k10 mitogen-activated protein kinase kinase kinase 10 https://www.infrafrontier.eu/search?keyword=EM:08070 - EM:05474 C57BL/6N-Map3k10/Cnrm EMMA sperm mutant strain MGI:4435860 Map3k10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1346879 Map3k10 mitogen-activated protein kinase kinase kinase 10 https://www.infrafrontier.eu/search?keyword=EM:05474 + EM:11856 C57BL/6N-Mansc4/Wtsi EMMA embryo mutant strain MGI:6120810 Mansc4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3645619 Mansc4 MANSC domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:11856 + EM:11856 C57BL/6N-Mansc4/Wtsi EMMA sperm mutant strain MGI:6120810 Mansc4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3645619 Mansc4 MANSC domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:11856 + EM:07943 C57BL/6N-Man2b2/WtsiCnrm EMMA sperm mutant strain MGI:5513801 Man2b2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1195262 Man2b2 mannosidase 2, alpha B2 https://www.infrafrontier.eu/search?keyword=EM:07943 + EM:08302 C57BL/6N-Mamstr/Wtsi EMMA embryo mutant strain MGI:5637079 Mamstr targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921740 Mamstr MEF2 activating motif and SAP domain containing transcriptional regulator https://www.infrafrontier.eu/search?keyword=EM:08302 + EM:08302 C57BL/6N-Mamstr/Wtsi EMMA sperm mutant strain MGI:5637079 Mamstr targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921740 Mamstr MEF2 activating motif and SAP domain containing transcriptional regulator https://www.infrafrontier.eu/search?keyword=EM:08302 + EM:11235 C57BL/6N-Magee2/Wtsi EMMA embryo mutant strain MGI:6153485 Magee2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3036244 Magee2 MAGE family member E2 https://www.infrafrontier.eu/search?keyword=EM:11235 + EM:11235 C57BL/6N-Magee2/Wtsi EMMA sperm mutant strain MGI:6153485 Magee2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3036244 Magee2 MAGE family member E2 https://www.infrafrontier.eu/search?keyword=EM:11235 + EM:09306 C57BL/6N-Maea/Ieg EMMA sperm mutant strain MGI:5588275 Maea targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1891748 Maea macrophage erythroblast attacher https://www.infrafrontier.eu/search?keyword=EM:09306 + EM:09288 C57BL/6N-Maea/Ieg EMMA sperm mutant strain MGI:4842478 Maea targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891748 Maea macrophage erythroblast attacher https://www.infrafrontier.eu/search?keyword=EM:09288 + EM:11156 C57BL/6N-Macrod1/WtsiPh EMMA sperm mutant strain MGI:6140210 Macrod1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2147759 Macrod1 mono-ADP ribosylhydrolase 1 https://www.infrafrontier.eu/search?keyword=EM:11156 + EM:11764 C57BL/6N-Lzts1/WtsiCnrm EMMA sperm mutant strain MGI:6152738 Lzts1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2684762 Lzts1 leucine zipper, putative tumor suppressor 1 https://www.infrafrontier.eu/search?keyword=EM:11764 + EM:08396 C57BL/6N-Lyn/H EMMA sperm mutant strain MGI:4888900 Lyn targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96892 Lyn LYN proto-oncogene, Src family tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:08396 + EM:11794 C57BL/6N-Ly6g/Wtsi EMMA embryo mutant strain MGI:6257598 Ly6g endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:109440 Ly6g lymphocyte antigen 6 complex, locus G https://www.infrafrontier.eu/search?keyword=EM:11794 + EM:11794 C57BL/6N-Ly6g/Wtsi EMMA sperm mutant strain MGI:6257598 Ly6g endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:109440 Ly6g lymphocyte antigen 6 complex, locus G https://www.infrafrontier.eu/search?keyword=EM:11794 + EM:11048 C57BL/6N-Ly6g6d/Ieg EMMA sperm mutant strain MGI:4436130 Ly6g6d targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2442450 Ly6g6d lymphocyte antigen 6 complex, locus G6D https://www.infrafrontier.eu/search?keyword=EM:11048 + EM:11083 C57BL/6N-Luc7l2/Wtsi EMMA embryo mutant strain MGI:5816877 Luc7l2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2183260 Luc7l2 LUC7-like 2 (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:11083 + EM:11083 C57BL/6N-Luc7l2/Wtsi EMMA sperm mutant strain MGI:5816877 Luc7l2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2183260 Luc7l2 LUC7-like 2 (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:11083 + EM:09416 C57BL/6N-Lta4h/H EMMA sperm mutant strain MGI:5692898 Lta4h targeted mutation 1c, Wellcome Trust Sanger Institute MGI:96836 Lta4h leukotriene A4 hydrolase https://www.infrafrontier.eu/search?keyword=EM:09416 + EM:08282 C57BL/6N-Lta4h/H EMMA sperm mutant strain MGI:4820073 Lta4h targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96836 Lta4h leukotriene A4 hydrolase https://www.infrafrontier.eu/search?keyword=EM:08282 + EM:11469 C57BL/6N-Lta4h/Wtsi EMMA embryo mutant strain MGI:6153774 Lta4h endonuclease mediated mutation 3, Wellcome Trust Sanger Insititute MGI:96836 Lta4h leukotriene A4 hydrolase https://www.infrafrontier.eu/search?keyword=EM:11469 + EM:11469 C57BL/6N-Lta4h/Wtsi EMMA sperm mutant strain MGI:6153774 Lta4h endonuclease mediated mutation 3, Wellcome Trust Sanger Insititute MGI:96836 Lta4h leukotriene A4 hydrolase https://www.infrafrontier.eu/search?keyword=EM:11469 + EM:09269 C57BL/6N-Lss/Ieg EMMA sperm mutant strain MGI:5561557 Lss targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336155 Lss lanosterol synthase https://www.infrafrontier.eu/search?keyword=EM:09269 + EM:08057 C57BL/6N-Lsm1/Ieg EMMA sperm C57BL/6N-Lsm1/Hmgu mutant strain MGI:5548536 Lsm1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914457 Lsm1 LSM1 homolog, mRNA degradation associated https://www.infrafrontier.eu/search?keyword=EM:08057 + EM:06274 C57BL/6N-Lsm1/Ieg EMMA embryo B6NTac;B6N-Lsm1/Ieg mutant strain MGI:4887646 Lsm1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914457 Lsm1 LSM1 homolog, mRNA degradation associated https://www.infrafrontier.eu/search?keyword=EM:06274 + EM:11840 C57BL/6N-Lsm14b/Wtsi EMMA embryo mutant strain MGI:5694186 Lsm14b targeted mutation 1b, Mouse Biology Program, UCDavis MGI:3040677 Lsm14b LSM family member 14B https://www.infrafrontier.eu/search?keyword=EM:11840 + EM:11840 C57BL/6N-Lsm14b/Wtsi EMMA sperm mutant strain MGI:5694186 Lsm14b targeted mutation 1b, Mouse Biology Program, UCDavis MGI:3040677 Lsm14b LSM family member 14B https://www.infrafrontier.eu/search?keyword=EM:11840 + EM:11102 C57BL/6N-Lrrk2/Wtsi EMMA embryo mutant strain MGI:5823221 Lrrk2 targeted mutation 1.1, Mouse Biology Program, UCDavis MGI:2685773 Lrrk2 leucine-rich repeat kinase 2 https://www.infrafrontier.eu/search?keyword=EM:11102 + EM:11102 C57BL/6N-Lrrk2/Wtsi EMMA sperm mutant strain MGI:5823221 Lrrk2 targeted mutation 1.1, Mouse Biology Program, UCDavis MGI:2685773 Lrrk2 leucine-rich repeat kinase 2 https://www.infrafrontier.eu/search?keyword=EM:11102 + EM:11381 C57BL/6N-Lrrc36/Wtsi EMMA embryo mutant strain MGI:6153483 Lrrc36 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2448585 Lrrc36 leucine rich repeat containing 36 https://www.infrafrontier.eu/search?keyword=EM:11381 + EM:11381 C57BL/6N-Lrrc36/Wtsi EMMA sperm mutant strain MGI:6153483 Lrrc36 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2448585 Lrrc36 leucine rich repeat containing 36 https://www.infrafrontier.eu/search?keyword=EM:11381 + EM:09748 C57BL/6N-Lrmp/Wtsi EMMA embryo mutant strain MGI:5692577 Lrmp targeted mutation 1b, Wellcome Trust Sanger Institute MGI:108424 Lrmp lymphoid-restricted membrane protein https://www.infrafrontier.eu/search?keyword=EM:09748 + EM:09748 C57BL/6N-Lrmp/Wtsi EMMA sperm mutant strain MGI:5692577 Lrmp targeted mutation 1b, Wellcome Trust Sanger Institute MGI:108424 Lrmp lymphoid-restricted membrane protein https://www.infrafrontier.eu/search?keyword=EM:09748 + EM:11387 C57BL/6N-Lrguk/Wtsi EMMA embryo mutant strain MGI:6153746 Lrguk endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921604 Lrguk leucine-rich repeats and guanylate kinase domain containing https://www.infrafrontier.eu/search?keyword=EM:11387 + EM:11387 C57BL/6N-Lrguk/Wtsi EMMA sperm mutant strain MGI:6153746 Lrguk endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921604 Lrguk leucine-rich repeats and guanylate kinase domain containing https://www.infrafrontier.eu/search?keyword=EM:11387 + EM:10627 C57BL/6N-Lrba/Wtsi EMMA embryo mutant strain MGI:6153482 Lrba endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2140073 Lrba LPS-responsive beige-like anchor https://www.infrafrontier.eu/search?keyword=EM:10627 + EM:10627 C57BL/6N-Lrba/Wtsi EMMA sperm mutant strain MGI:6153482 Lrba endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2140073 Lrba LPS-responsive beige-like anchor https://www.infrafrontier.eu/search?keyword=EM:10627 + EM:09745 C57BL/6N-Lpxn/Wtsi EMMA embryo mutant strain MGI:5692788 Lpxn targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2147677 Lpxn leupaxin https://www.infrafrontier.eu/search?keyword=EM:09745 + EM:09745 C57BL/6N-Lpxn/Wtsi EMMA sperm mutant strain MGI:5692788 Lpxn targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2147677 Lpxn leupaxin https://www.infrafrontier.eu/search?keyword=EM:09745 + EM:08071 C57BL/6N-Lpo/Ieg EMMA embryo mutant strain MGI:5548663 Lpo targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923363 Lpo lactoperoxidase https://www.infrafrontier.eu/search?keyword=EM:08071 + EM:10328 C57BL/6N-Lpcat3/Wtsi EMMA embryo mutant strain MGI:6153481 Lpcat3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1315211 Lpcat3 lysophosphatidylcholine acyltransferase 3 https://www.infrafrontier.eu/search?keyword=EM:10328 + EM:10328 C57BL/6N-Lpcat3/Wtsi EMMA sperm mutant strain MGI:6153481 Lpcat3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1315211 Lpcat3 lysophosphatidylcholine acyltransferase 3 https://www.infrafrontier.eu/search?keyword=EM:10328 + EM:10447 C57BL/6N-Lpcat1/H EMMA sperm mutant strain MGI:4458720 Lpcat1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384812 Lpcat1 lysophosphatidylcholine acyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:10447 + EM:07569 C57BL/6N-Lonrf3/Wtsi EMMA embryo mutant strain MGI:5548642 Lonrf3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921615 Lonrf3 LON peptidase N-terminal domain and ring finger 3 https://www.infrafrontier.eu/search?keyword=EM:07569 + EM:07569 C57BL/6N-Lonrf3/Wtsi EMMA sperm mutant strain MGI:5548642 Lonrf3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921615 Lonrf3 LON peptidase N-terminal domain and ring finger 3 https://www.infrafrontier.eu/search?keyword=EM:07569 + EM:09070 C57BL/6N-Lonp1/Ieg EMMA sperm mutant strain MGI:5521859 Lonp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921392 Lonp1 lon peptidase 1, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:09070 - EM:10926 C57BL/6N-Lncenc1/Wtsi EMMA embryo mutant strain Lncenc1 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:3780541 Lncenc1 long non-coding RNA, embryonic stem cells expressed 1 https://www.infrafrontier.eu/search?keyword=EM:10926 - EM:10926 C57BL/6N-Lncenc1/Wtsi EMMA sperm mutant strain Lncenc1 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:3780541 Lncenc1 long non-coding RNA, embryonic stem cells expressed 1 https://www.infrafrontier.eu/search?keyword=EM:10926 + EM:11329 C57BL/6N-Lmo1/Ieg EMMA sperm mutant strain MGI:4843686 Lmo1 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:102812 Lmo1 LIM domain only 1 https://www.infrafrontier.eu/search?keyword=EM:11329 + EM:10615 C57BL/6N-Lmnb1/WtsiH EMMA sperm mutant strain MGI:5767330 Lmnb1 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:96795 Lmnb1 lamin B1 https://www.infrafrontier.eu/search?keyword=EM:10615 + EM:09032 C57BL/6N-Lifr/H EMMA sperm mutant strain MGI:5692896 Lifr targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:96788 Lifr LIF receptor alpha https://www.infrafrontier.eu/search?keyword=EM:09032 - EM:06941 C57BL/6N-Lifr/H EMMA sperm B6NTac;B6N-Lifr/H mutant strain MGI:4841519 Lifr targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96788 Lifr LIF receptor alpha https://www.infrafrontier.eu/search?keyword=EM:06941 + EM:09084 C57BL/6N-Lhfpl2/H EMMA sperm mutant strain MGI:4462597 Lhfpl2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2145236 Lhfpl2 lipoma HMGIC fusion partner-like 2 https://www.infrafrontier.eu/search?keyword=EM:09084 + EM:08894 C57BL/6N-Lgals7/WtsiIeg EMMA archived mutant strain MGI:5548425 Lgals7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1316742 Lgals7 lectin, galactose binding, soluble 7 https://www.infrafrontier.eu/search?keyword=EM:08894 + EM:09044 C57BL/6N-Lgals3/H EMMA sperm mutant strain MGI:5692895 Lgals3 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:96778 Lgals3 lectin, galactose binding, soluble 3 https://www.infrafrontier.eu/search?keyword=EM:09044 - EM:06800 C57BL/6N-Lgals3/H EMMA sperm mutant strain MGI:4432481 Lgals3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96778 Lgals3 lectin, galactose binding, soluble 3 https://www.infrafrontier.eu/search?keyword=EM:06800 + EM:11462 C57BL/6N-Lfng/Wtsi EMMA embryo mutant strain MGI:6153723 Lfng endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1095413 Lfng LFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase https://www.infrafrontier.eu/search?keyword=EM:11462 + EM:11462 C57BL/6N-Lfng/Wtsi EMMA sperm mutant strain MGI:6153723 Lfng endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1095413 Lfng LFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase https://www.infrafrontier.eu/search?keyword=EM:11462 - EM:07837 C57BL/6N-Leprotl1/H EMMA sperm HEPD0576_6_H12, B6NTac;B6N-Leprotl1/H mutant strain MGI:4434583 Leprotl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915442 Leprotl1 leptin receptor overlapping transcript-like 1 https://www.infrafrontier.eu/search?keyword=EM:07837 + EM:08158 C57BL/6N-Leprot/WtsiBiat EMMA sperm mutant strain MGI:5548880 Leprot targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2687005 Leprot leptin receptor overlapping transcript https://www.infrafrontier.eu/search?keyword=EM:08158 + EM:07367 C57BL/6N-Lepr/H EMMA sperm B6NTac;B6N-Lepr/H mutant strain MGI:4453725 Lepr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104993 Lepr leptin receptor https://www.infrafrontier.eu/search?keyword=EM:07367 + EM:08355 C57BL/6N-Ldlrad4/Wtsi EMMA embryo mutant strain MGI:5636938 Ldlrad4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1277150 Ldlrad4 low density lipoprotein receptor class A domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:08355 + EM:08355 C57BL/6N-Ldlrad4/Wtsi EMMA sperm mutant strain MGI:5636938 Ldlrad4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1277150 Ldlrad4 low density lipoprotein receptor class A domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:08355 + EM:10076 C57BL/6N-Ldlr/Ieg EMMA sperm mutant strain MGI:4433768 Ldlr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96765 Ldlr low density lipoprotein receptor https://www.infrafrontier.eu/search?keyword=EM:10076 + EM:08676 C57BL/6N-Ldhb/Wtsi EMMA embryo mutant strain MGI:5637210 Ldhb targeted mutation 1b, Wellcome Trust Sanger Institute MGI:96763 Ldhb lactate dehydrogenase B https://www.infrafrontier.eu/search?keyword=EM:08676 + EM:08676 C57BL/6N-Ldhb/Wtsi EMMA sperm mutant strain MGI:5637210 Ldhb targeted mutation 1b, Wellcome Trust Sanger Institute MGI:96763 Ldhb lactate dehydrogenase B https://www.infrafrontier.eu/search?keyword=EM:08676 + EM:08651 C57BL/6N-Ldah/Ieg EMMA sperm mutant strain MGI:5637035 Ldah targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916082 Ldah lipid droplet associated hydrolase https://www.infrafrontier.eu/search?keyword=EM:08651 + EM:07442 C57BL/6N-Ldah/Ieg EMMA embryo B6NTac;B6N-Ldah/Ieg, B6NTac;B6N-1110057K04Rik/Ieg mutant strain MGI:4456805 Ldah targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916082 Ldah lipid droplet associated hydrolase https://www.infrafrontier.eu/search?keyword=EM:07442 + EM:08731 C57BL/6N-Lct/Ieg EMMA sperm mutant strain MGI:4841441 Lct targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104576 Lct lactase https://www.infrafrontier.eu/search?keyword=EM:08731 + EM:11628 C57BL/6N-Lce3e/Wtsi EMMA embryo mutant strain MGI:6153480 Lce3e endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1916764 Lce3e late cornified envelope 3E https://www.infrafrontier.eu/search?keyword=EM:11628 + EM:11628 C57BL/6N-Lce3e/Wtsi EMMA sperm mutant strain MGI:6153480 Lce3e endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1916764 Lce3e late cornified envelope 3E https://www.infrafrontier.eu/search?keyword=EM:11628 + EM:08530 C57BL/6N-Lce1m/Wtsi EMMA embryo mutant strain MGI:5637007 Lce1m targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913453 Lce1m late cornified envelope 1M https://www.infrafrontier.eu/search?keyword=EM:08530 + EM:08530 C57BL/6N-Lce1m/Wtsi EMMA sperm mutant strain MGI:5637007 Lce1m targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913453 Lce1m late cornified envelope 1M https://www.infrafrontier.eu/search?keyword=EM:08530 + EM:07311 C57BL/6N-Lce1f/H EMMA sperm B6NTac;B6N-Lce1f/H mutant strain MGI:4841178 Lce1f targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915078 Lce1f late cornified envelope 1F https://www.infrafrontier.eu/search?keyword=EM:07311 + EM:11264 C57BL/6N-Larp4b/Wtsi EMMA embryo mutant strain MGI:6153479 Larp4b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:106330 Larp4b La ribonucleoprotein domain family, member 4B https://www.infrafrontier.eu/search?keyword=EM:11264 + EM:11264 C57BL/6N-Larp4b/Wtsi EMMA sperm mutant strain MGI:6153479 Larp4b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:106330 Larp4b La ribonucleoprotein domain family, member 4B https://www.infrafrontier.eu/search?keyword=EM:11264 + EM:10467 C57BL/6N-Lamb3/H EMMA sperm mutant strain MGI:5752556 Lamb3 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:99915 Lamb3 laminin, beta 3 https://www.infrafrontier.eu/search?keyword=EM:10467 + EM:10466 C57BL/6N-Lama5/H EMMA sperm C57BL/6NTac-Lama5/H mutant strain MGI:5752544 Lama5 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:105382 Lama5 laminin, alpha 5 https://www.infrafrontier.eu/search?keyword=EM:10466 + EM:09240 C57BL/6N-Lama1/Ieg EMMA sperm mutant strain MGI:5613672 Lama1 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:99892 Lama1 laminin, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:09240 + EM:08512 C57BL/6N-Lama1/Ieg EMMA sperm mutant strain MGI:4436547 Lama1 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:99892 Lama1 laminin, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:08512 + EM:09239 C57BL/6N-Lactb/Ieg EMMA sperm mutant strain MGI:5613656 Lactb targeted mutation 1.1, Mouse Biology Program, UCDavis MGI:1933395 Lactb lactamase, beta https://www.infrafrontier.eu/search?keyword=EM:09239 + EM:08725 C57BL/6N-Lactb/Ieg EMMA sperm mutant strain MGI:4819984 Lactb targeted mutation 1, Mouse Biology Program, UCDavis MGI:1933395 Lactb lactamase, beta https://www.infrafrontier.eu/search?keyword=EM:08725 + EM:08141 C57BL/6N-Krt83/Wtsi EMMA embryo mutant strain MGI:5637191 Krt83 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3690448 Krt83 keratin 83 https://www.infrafrontier.eu/search?keyword=EM:08141 + EM:08141 C57BL/6N-Krt83/Wtsi EMMA sperm mutant strain MGI:5637191 Krt83 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3690448 Krt83 keratin 83 https://www.infrafrontier.eu/search?keyword=EM:08141 + EM:08573 C57BL/6N-Krt7/WtsiH EMMA sperm mutant strain MGI:5548947 Krt7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:96704 Krt7 keratin 7 https://www.infrafrontier.eu/search?keyword=EM:08573 + EM:10606 C57BL/6N-Krt79/Wtsi EMMA embryo mutant strain MGI:5708243 Krt79 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2385030 Krt79 keratin 79 https://www.infrafrontier.eu/search?keyword=EM:10606 + EM:10606 C57BL/6N-Krt79/Wtsi EMMA sperm mutant strain MGI:5708243 Krt79 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2385030 Krt79 keratin 79 https://www.infrafrontier.eu/search?keyword=EM:10606 - EM:07497 C57BL/6N-Krt74/H EMMA sperm B6NTac;B6N-Krt74/H mutant strain MGI:4461649 Krt74 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3629975 Krt74 keratin 74 https://www.infrafrontier.eu/search?keyword=EM:07497 + EM:11494 C57BL/6N-Krt5/Wtsi EMMA embryo mutant strain MGI:6153745 Krt5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:96702 Krt5 keratin 5 https://www.infrafrontier.eu/search?keyword=EM:11494 + EM:11494 C57BL/6N-Krt5/Wtsi EMMA sperm mutant strain MGI:6153745 Krt5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:96702 Krt5 keratin 5 https://www.infrafrontier.eu/search?keyword=EM:11494 - EM:09535 C57BL/6N-Krt12/Cnrm EMMA sperm mutant strain MGI:5633776 Krt12 targeted mutation 2, Wellcome Trust Sanger Institute MGI:96687 Krt12 keratin 12 https://www.infrafrontier.eu/search?keyword=EM:09535 + EM:10106 C57BL/6N-Knl1/Ieg EMMA sperm mutant strain MGI:5692741 Knl1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1923714 Knl1 kinetochore scaffold 1 https://www.infrafrontier.eu/search?keyword=EM:10106 + EM:08578 C57BL/6N-Knl1/Ieg EMMA sperm mutant strain MGI:4841642 Knl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923714 Knl1 kinetochore scaffold 1 https://www.infrafrontier.eu/search?keyword=EM:08578 + EM:11782 C57BL/6N-Kmt2b/Wtsi EMMA embryo mutant strain Kmt2b undef targeted mutation , Wellcome Trust Sanger Institute MGI:109565 Kmt2b lysine (K)-specific methyltransferase 2B https://www.infrafrontier.eu/search?keyword=EM:11782 + EM:11782 C57BL/6N-Kmt2b/Wtsi EMMA sperm mutant strain Kmt2b undef targeted mutation , Wellcome Trust Sanger Institute MGI:109565 Kmt2b lysine (K)-specific methyltransferase 2B https://www.infrafrontier.eu/search?keyword=EM:11782 + EM:11011 C57BL/6N-Klrc3/Wtsi EMMA embryo mutant strain MGI:6153384 Klrc3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1929720 Klrc3 killer cell lectin-like receptor subfamily C, member 3 https://www.infrafrontier.eu/search?keyword=EM:11011 + EM:11011 C57BL/6N-Klrc3/Wtsi EMMA sperm mutant strain MGI:6153384 Klrc3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1929720 Klrc3 killer cell lectin-like receptor subfamily C, member 3 https://www.infrafrontier.eu/search?keyword=EM:11011 + EM:11010 C57BL/6N-Klrc2/Wtsi EMMA embryo mutant strain MGI:6153383 Klrc2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1336162 Klrc2 killer cell lectin-like receptor subfamily C, member 2 https://www.infrafrontier.eu/search?keyword=EM:11010 + EM:11010 C57BL/6N-Klrc2/Wtsi EMMA sperm mutant strain MGI:6153383 Klrc2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1336162 Klrc2 killer cell lectin-like receptor subfamily C, member 2 https://www.infrafrontier.eu/search?keyword=EM:11010 + EM:11009 C57BL/6N-Klrc1/Wtsi EMMA embryo mutant strain MGI:6153382 Klrc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1336161 Klrc1 killer cell lectin-like receptor subfamily C, member 1 https://www.infrafrontier.eu/search?keyword=EM:11009 + EM:11009 C57BL/6N-Klrc1/Wtsi EMMA sperm mutant strain MGI:6153382 Klrc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1336161 Klrc1 killer cell lectin-like receptor subfamily C, member 1 https://www.infrafrontier.eu/search?keyword=EM:11009 + EM:09638 C57BL/6N-Klrb1/Ieg EMMA sperm mutant strain MGI:4453704 Klrb1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96877 Klrb1 killer cell lectin-like receptor subfamily B member 1 https://www.infrafrontier.eu/search?keyword=EM:09638 + EM:11116 C57BL/6N-Klra6/Wtsi EMMA embryo mutant strain MGI:6153381 Klra6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:101902 Klra6 killer cell lectin-like receptor, subfamily A, member 6 https://www.infrafrontier.eu/search?keyword=EM:11116 + EM:11116 C57BL/6N-Klra6/Wtsi EMMA sperm mutant strain MGI:6153381 Klra6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:101902 Klra6 killer cell lectin-like receptor, subfamily A, member 6 https://www.infrafrontier.eu/search?keyword=EM:11116 + EM:07921 C57BL/6N-Klkb1/Ieg EMMA embryo mutant strain MGI:5548334 Klkb1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:102849 Klkb1 kallikrein B, plasma 1 https://www.infrafrontier.eu/search?keyword=EM:07921 + EM:05553 C57BL/6N-Klkb1/Ieg EMMA embryo B6NTac;B6N-Klkb1/Ieg mutant strain MGI:4456034 Klkb1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102849 Klkb1 kallikrein B, plasma 1 https://www.infrafrontier.eu/search?keyword=EM:05553 + EM:11152 C57BL/6N-Klk6/WtsiH EMMA sperm mutant strain MGI:6153380 Klk6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1347349 Klk6 kallikrein related-peptidase 6 https://www.infrafrontier.eu/search?keyword=EM:11152 + EM:11192 C57BL/6N-Klhl42/Wtsi EMMA embryo mutant strain MGI:6120798 Klhl42 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2444786 Klhl42 kelch-like 42 https://www.infrafrontier.eu/search?keyword=EM:11192 + EM:11192 C57BL/6N-Klhl42/Wtsi EMMA sperm mutant strain MGI:6120798 Klhl42 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2444786 Klhl42 kelch-like 42 https://www.infrafrontier.eu/search?keyword=EM:11192 - EM:07572 C57BL/6N-Klhl3/H EMMA sperm B6NTac;B6N-Klhl3/H mutant strain MGI:4946685 Klhl3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2445185 Klhl3 kelch-like 3 https://www.infrafrontier.eu/search?keyword=EM:07572 + EM:10847 C57BL/6N-Klhl26/Wtsi EMMA embryo mutant strain MGI:5796937 Klhl26 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443079 Klhl26 kelch-like 26 https://www.infrafrontier.eu/search?keyword=EM:10847 + EM:10847 C57BL/6N-Klhl26/Wtsi EMMA sperm mutant strain MGI:5796937 Klhl26 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443079 Klhl26 kelch-like 26 https://www.infrafrontier.eu/search?keyword=EM:10847 - EM:05848 C57BL/6N-Klf7/H EMMA sperm B6NTac;B6N-Klf7/H mutant strain MGI:4434914 Klf7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1935151 Klf7 Kruppel-like factor 7 (ubiquitous) https://www.infrafrontier.eu/search?keyword=EM:05848 + EM:11720 C57BL/6N-Klf1/Wtsi EMMA embryo mutant strain MGI:6153379 Klf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1342771 Klf1 Kruppel-like factor 1 (erythroid) https://www.infrafrontier.eu/search?keyword=EM:11720 + EM:11720 C57BL/6N-Klf1/Wtsi EMMA sperm mutant strain MGI:6153379 Klf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1342771 Klf1 Kruppel-like factor 1 (erythroid) https://www.infrafrontier.eu/search?keyword=EM:11720 + EM:09397 C57BL/6N-Klf17/WtsiOrl EMMA archived mutant strain MGI:5548777 Klf17 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2181068 Klf17 Kruppel-like factor 17 https://www.infrafrontier.eu/search?keyword=EM:09397 + EM:07760 C57BL/6N-Kif3b/Wtsi EMMA embryo mutant strain MGI:5548376 Kif3b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107688 Kif3b kinesin family member 3B https://www.infrafrontier.eu/search?keyword=EM:07760 + EM:07760 C57BL/6N-Kif3b/Wtsi EMMA sperm mutant strain MGI:5548376 Kif3b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107688 Kif3b kinesin family member 3B https://www.infrafrontier.eu/search?keyword=EM:07760 + EM:07539 C57BL/6N-Kif24/Wtsi EMMA embryo mutant strain MGI:5637052 Kif24 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1918345 Kif24 kinesin family member 24 https://www.infrafrontier.eu/search?keyword=EM:07539 + EM:07539 C57BL/6N-Kif24/Wtsi EMMA sperm mutant strain MGI:5637052 Kif24 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1918345 Kif24 kinesin family member 24 https://www.infrafrontier.eu/search?keyword=EM:07539 + EM:11653 C57BL/6N-Kif23/Wtsi EMMA embryo mutant strain MGI:6153721 Kif23 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919069 Kif23 kinesin family member 23 https://www.infrafrontier.eu/search?keyword=EM:11653 + EM:11653 C57BL/6N-Kif23/Wtsi EMMA sperm mutant strain MGI:6153721 Kif23 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919069 Kif23 kinesin family member 23 https://www.infrafrontier.eu/search?keyword=EM:11653 + EM:08656 C57BL/6N-Kif20a/Ieg EMMA sperm mutant strain MGI:5636934 Kif20a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1201682 Kif20a kinesin family member 20A https://www.infrafrontier.eu/search?keyword=EM:08656 + EM:08632 C57BL/6N-Kif20a/Ieg EMMA embryo mutant strain MGI:4436572 Kif20a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1201682 Kif20a kinesin family member 20A https://www.infrafrontier.eu/search?keyword=EM:08632 + EM:08658 C57BL/6N-Khdrbs3/Ieg EMMA sperm mutant strain MGI:5636948 Khdrbs3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1313312 Khdrbs3 KH domain containing, RNA binding, signal transduction associated 3 https://www.infrafrontier.eu/search?keyword=EM:08658 + EM:08634 C57BL/6N-Khdrbs3/Ieg EMMA sperm mutant strain MGI:4847821 Khdrbs3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1313312 Khdrbs3 KH domain containing, RNA binding, signal transduction associated 3 https://www.infrafrontier.eu/search?keyword=EM:08634 + EM:11155 C57BL/6N-Kera/WtsiPh EMMA sperm mutant strain MGI:6140208 Kera endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1202398 Kera keratocan https://www.infrafrontier.eu/search?keyword=EM:11155 + EM:11852 C57BL/6N-Kdm6b/Wtsi EMMA live mutant strain MGI:6324163 Kdm6b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2448492 Kdm6b KDM1 lysine (K)-specific demethylase 6B https://www.infrafrontier.eu/search?keyword=EM:11852 + EM:10330 C57BL/6N-Kdm5b/Wtsi EMMA embryo mutant strain MGI:6153378 Kdm5b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1922855 Kdm5b lysine (K)-specific demethylase 5B https://www.infrafrontier.eu/search?keyword=EM:10330 + EM:10330 C57BL/6N-Kdm5b/Wtsi EMMA sperm mutant strain MGI:6153378 Kdm5b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1922855 Kdm5b lysine (K)-specific demethylase 5B https://www.infrafrontier.eu/search?keyword=EM:10330 + EM:09483 C57BL/6N-Kcnn1/H EMMA sperm mutant strain MGI:4419229 Kcnn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933993 Kcnn1 potassium intermediate/small conductance calcium-activated channel, subfamily N, member 1 https://www.infrafrontier.eu/search?keyword=EM:09483 - EM:05957 C57BL/6N-Kcnj9/H EMMA sperm B6NTac;B6N-Kcnj9/H mutant strain MGI:4436261 Kcnj9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108007 Kcnj9 potassium inwardly-rectifying channel, subfamily J, member 9 https://www.infrafrontier.eu/search?keyword=EM:05957 + EM:08990 C57BL/6N-Kcnj14/H EMMA sperm mutant strain MGI:5511630 Kcnj14 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2384820 Kcnj14 potassium inwardly-rectifying channel, subfamily J, member 14 https://www.infrafrontier.eu/search?keyword=EM:08990 + EM:10832 C57BL/6N-Kcnj12/H EMMA sperm mutant strain MGI:4432694 Kcnj12 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108495 Kcnj12 potassium inwardly-rectifying channel, subfamily J, member 12 https://www.infrafrontier.eu/search?keyword=EM:10832 + EM:10056 C57BL/6N-Kcnj11/H EMMA sperm mutant strain MGI:5692571 Kcnj11 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:107501 Kcnj11 potassium inwardly rectifying channel, subfamily J, member 11 https://www.infrafrontier.eu/search?keyword=EM:10056 + EM:08845 C57BL/6N-Kcnj11/H EMMA sperm mutant strain MGI:5473147 Kcnj11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107501 Kcnj11 potassium inwardly rectifying channel, subfamily J, member 11 https://www.infrafrontier.eu/search?keyword=EM:08845 + EM:09266 C57BL/6N-Kcnj10/H EMMA sperm mutant strain MGI:4451428 Kcnj10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1194504 Kcnj10 potassium inwardly-rectifying channel, subfamily J, member 10 https://www.infrafrontier.eu/search?keyword=EM:09266 + EM:08221 C57BL/6N-Kcnh4/Wtsi EMMA embryo mutant strain MGI:5637120 Kcnh4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2156184 Kcnh4 potassium voltage-gated channel, subfamily H (eag-related), member 4 https://www.infrafrontier.eu/search?keyword=EM:08221 + EM:08221 C57BL/6N-Kcnh4/Wtsi EMMA sperm mutant strain MGI:5637120 Kcnh4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2156184 Kcnh4 potassium voltage-gated channel, subfamily H (eag-related), member 4 https://www.infrafrontier.eu/search?keyword=EM:08221 + EM:08338 C57BL/6N-Kcnb1/H EMMA sperm mutant strain MGI:5002949 Kcnb1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96666 Kcnb1 potassium voltage gated channel, Shab-related subfamily, member 1 https://www.infrafrontier.eu/search?keyword=EM:08338 + EM:11658 C57BL/6N-Kbtbd11/Wtsi EMMA embryo mutant strain MGI:6153377 Kbtbd11 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1922151 Kbtbd11 kelch repeat and BTB (POZ) domain containing 11 https://www.infrafrontier.eu/search?keyword=EM:11658 + EM:11658 C57BL/6N-Kbtbd11/Wtsi EMMA sperm mutant strain MGI:6153377 Kbtbd11 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1922151 Kbtbd11 kelch repeat and BTB (POZ) domain containing 11 https://www.infrafrontier.eu/search?keyword=EM:11658 - EM:06113 C57BL/6N-Katnb1/Cnrm EMMA sperm mutant strain MGI:4436305 Katnb1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921437 Katnb1 katanin p80 (WD40-containing) subunit B 1 https://www.infrafrontier.eu/search?keyword=EM:06113 + EM:11211 C57BL/6N-Kat2b/WtsiIeg EMMA archived mutant strain MGI:6140207 Kat2b endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1343094 Kat2b K(lysine) acetyltransferase 2B https://www.infrafrontier.eu/search?keyword=EM:11211 + EM:12754 C57BL/6N-Kansl1l/Ieg EMMA sperm mutant strain MGI:4432674 Kansl1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915941 Kansl1l KAT8 regulatory NSL complex subunit 1-like https://www.infrafrontier.eu/search?keyword=EM:12754 + EM:11210 C57BL/6N-Josd1/WtsiIeg EMMA archived mutant strain MGI:6140206 Josd1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1921408 Josd1 Josephin domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:11210 + EM:10302 C57BL/6N-Jmjd7/Wtsi EMMA embryo mutant strain MGI:6153376 Jmjd7 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3845785 Jmjd7 jumonji domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:10302 + EM:10302 C57BL/6N-Jmjd7/Wtsi EMMA sperm mutant strain MGI:6153376 Jmjd7 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3845785 Jmjd7 jumonji domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:10302 + EM:08088 C57BL/6N-Jmjd6/Ieg EMMA sperm mutant strain MGI:5548491 Jmjd6 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1858910 Jmjd6 jumonji domain containing 6 https://www.infrafrontier.eu/search?keyword=EM:08088 + EM:10326 C57BL/6N-Jmjd4/Wtsi EMMA embryo mutant strain MGI:6153375 Jmjd4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2144404 Jmjd4 jumonji domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:10326 + EM:10326 C57BL/6N-Jmjd4/Wtsi EMMA sperm mutant strain MGI:6153375 Jmjd4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2144404 Jmjd4 jumonji domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:10326 + EM:10018 C57BL/6N-Jarid2/Cnrm EMMA embryo mutant strain MGI:5811911 Jarid2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:104813 Jarid2 jumonji, AT rich interactive domain 2 https://www.infrafrontier.eu/search?keyword=EM:10018 + EM:10018 C57BL/6N-Jarid2/Cnrm EMMA sperm mutant strain MGI:5811911 Jarid2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:104813 Jarid2 jumonji, AT rich interactive domain 2 https://www.infrafrontier.eu/search?keyword=EM:10018 + EM:07862 C57BL/6N-Jag2/H EMMA sperm B6NTac;B6N-Jag2/H mutant strain MGI:4880880 Jag2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098270 Jag2 jagged 2 https://www.infrafrontier.eu/search?keyword=EM:07862 + EM:08753 C57BL/6N-Ivd/Ieg EMMA sperm mutant strain MGI:5548705 Ivd targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1929242 Ivd isovaleryl coenzyme A dehydrogenase https://www.infrafrontier.eu/search?keyword=EM:08753 + EM:08117 C57BL/6N-Itm2c/Ieg EMMA sperm mutant strain MGI:5548700 Itm2c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1927594 Itm2c integral membrane protein 2C https://www.infrafrontier.eu/search?keyword=EM:08117 + EM:08103 C57BL/6N-Itm2c/Ieg EMMA sperm B6NTac;B6N-Itm2c/Ieg mutant strain MGI:4431661 Itm2c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927594 Itm2c integral membrane protein 2C https://www.infrafrontier.eu/search?keyword=EM:08103 + EM:11609 C57BL/6N-Itm2a/Wtsi EMMA embryo mutant strain MGI:6153374 Itm2a endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107706 Itm2a integral membrane protein 2A https://www.infrafrontier.eu/search?keyword=EM:11609 + EM:11609 C57BL/6N-Itm2a/Wtsi EMMA sperm mutant strain MGI:6153374 Itm2a endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107706 Itm2a integral membrane protein 2A https://www.infrafrontier.eu/search?keyword=EM:11609 + EM:11578 C57BL/6N-Itln1/WtsiIeg EMMA archived mutant strain MGI:6140205 Itln1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1333831 Itln1 intelectin 1 (galactofuranose binding) https://www.infrafrontier.eu/search?keyword=EM:11578 + EM:10685 C57BL/6N-Itgam/Wtsi EMMA embryo mutant strain MGI:6153373 Itgam endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2444489 Itgam integrin alpha M https://www.infrafrontier.eu/search?keyword=EM:10685 + EM:10685 C57BL/6N-Itgam/Wtsi EMMA sperm mutant strain MGI:6153373 Itgam endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2444489 Itgam integrin alpha M https://www.infrafrontier.eu/search?keyword=EM:10685 - EM:07783 C57BL/6N-Itgae/H EMMA sperm mutant strain MGI:4433992 Itgae targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1298377 Itgae integrin alpha E, epithelial-associated https://www.infrafrontier.eu/search?keyword=EM:07783 - EM:09538 C57BL/6N-Itga2/Cnrm EMMA sperm mutant strain MGI:5633770 Itga2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:96600 Itga2 integrin alpha 2 https://www.infrafrontier.eu/search?keyword=EM:09538 + EM:05766 C57BL/6N-Itga2/H EMMA sperm B6NTac;B6N-Itga2/H mutant strain MGI:4455765 Itga2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96600 Itga2 integrin alpha 2 https://www.infrafrontier.eu/search?keyword=EM:05766 + EM:09007 C57BL/6N-Itch/H EMMA sperm mutant strain MGI:4888905 Itch targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1202301 Itch itchy, E3 ubiquitin protein ligase https://www.infrafrontier.eu/search?keyword=EM:09007 + EM:10318 C57BL/6N-Irgm1/Wtsi EMMA embryo mutant strain MGI:6153372 Irgm1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107567 Irgm1 immunity-related GTPase family M member 1 https://www.infrafrontier.eu/search?keyword=EM:10318 + EM:10318 C57BL/6N-Irgm1/Wtsi EMMA sperm mutant strain MGI:6153372 Irgm1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107567 Irgm1 immunity-related GTPase family M member 1 https://www.infrafrontier.eu/search?keyword=EM:10318 + EM:11518 C57BL/6N-Irf6/Wtsi EMMA embryo mutant strain MGI:6153743 Irf6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1859211 Irf6 interferon regulatory factor 6 https://www.infrafrontier.eu/search?keyword=EM:11518 + EM:11518 C57BL/6N-Irf6/Wtsi EMMA sperm mutant strain MGI:6153743 Irf6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1859211 Irf6 interferon regulatory factor 6 https://www.infrafrontier.eu/search?keyword=EM:11518 + EM:07483 C57BL/6N-Irak2/H EMMA sperm B6NTac;B6N-Irak2/H mutant strain MGI:4431835 Irak2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2429603 Irak2 interleukin-1 receptor-associated kinase 2 https://www.infrafrontier.eu/search?keyword=EM:07483 + EM:09594 C57BL/6N-Irak1/Wtsi EMMA embryo mutant strain MGI:5636906 Irak1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:107420 Irak1 interleukin-1 receptor-associated kinase 1 https://www.infrafrontier.eu/search?keyword=EM:09594 + EM:09594 C57BL/6N-Irak1/Wtsi EMMA sperm mutant strain MGI:5636906 Irak1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:107420 Irak1 interleukin-1 receptor-associated kinase 1 https://www.infrafrontier.eu/search?keyword=EM:09594 + EM:11841 C57BL/6N-Ints9/Wtsi EMMA embryo mutant strain MGI:5796932 Ints9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1098533 Ints9 integrator complex subunit 9 https://www.infrafrontier.eu/search?keyword=EM:11841 + EM:11841 C57BL/6N-Ints9/Wtsi EMMA sperm mutant strain MGI:5796932 Ints9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1098533 Ints9 integrator complex subunit 9 https://www.infrafrontier.eu/search?keyword=EM:11841 + EM:10611 C57BL/6N-Ints11/Wtsi EMMA embryo mutant strain MGI:5708213 Ints11 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2140491 Ints11 integrator complex subunit 11 https://www.infrafrontier.eu/search?keyword=EM:10611 + EM:10611 C57BL/6N-Ints11/Wtsi EMMA sperm mutant strain MGI:5708213 Ints11 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2140491 Ints11 integrator complex subunit 11 https://www.infrafrontier.eu/search?keyword=EM:10611 + EM:11114 C57BL/6N-Insyn2b/Wtsi EMMA embryo mutant strain MGI:6153338 Insyn2b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3643491 Insyn2b inhibitory synaptic factor family member 2B https://www.infrafrontier.eu/search?keyword=EM:11114 + EM:11114 C57BL/6N-Insyn2b/Wtsi EMMA sperm mutant strain MGI:6153338 Insyn2b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3643491 Insyn2b inhibitory synaptic factor family member 2B https://www.infrafrontier.eu/search?keyword=EM:11114 + EM:10949 C57BL/6N-Ing3/Biat EMMA sperm mutant strain MGI:4432585 Ing3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919027 Ing3 inhibitor of growth family, member 3 https://www.infrafrontier.eu/search?keyword=EM:10949 + EM:10732 C57BL/6N-Il6ra/Wtsi EMMA embryo mutant strain MGI:6153742 Il6ra endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:105304 Il6ra interleukin 6 receptor, alpha https://www.infrafrontier.eu/search?keyword=EM:10732 + EM:10732 C57BL/6N-Il6ra/Wtsi EMMA sperm mutant strain MGI:6153742 Il6ra endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:105304 Il6ra interleukin 6 receptor, alpha https://www.infrafrontier.eu/search?keyword=EM:10732 + EM:11461 C57BL/6N-Il4ra/Wtsi EMMA embryo mutant strain MGI:6153371 Il4ra endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:105367 Il4ra interleukin 4 receptor, alpha https://www.infrafrontier.eu/search?keyword=EM:11461 + EM:11461 C57BL/6N-Il4ra/Wtsi EMMA sperm mutant strain MGI:6153371 Il4ra endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:105367 Il4ra interleukin 4 receptor, alpha https://www.infrafrontier.eu/search?keyword=EM:11461 + EM:09387 C57BL/6N-Il4i1/Ieg EMMA sperm mutant strain MGI:4432453 Il4i1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109552 Il4i1 interleukin 4 induced 1 https://www.infrafrontier.eu/search?keyword=EM:09387 - EM:05779 C57BL/6N-Il31/Cnrm EMMA sperm mutant strain MGI:4842595 Il31 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923649 Il31 interleukin 31 https://www.infrafrontier.eu/search?keyword=EM:05779 + EM:10026 C57BL/6N-Il27/Wtsi EMMA embryo mutant strain MGI:5694183 Il27 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2384409 Il27 interleukin 27 https://www.infrafrontier.eu/search?keyword=EM:10026 + EM:10026 C57BL/6N-Il27/Wtsi EMMA sperm mutant strain MGI:5694183 Il27 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2384409 Il27 interleukin 27 https://www.infrafrontier.eu/search?keyword=EM:10026 + EM:08953 C57BL/6N-Il19/H EMMA sperm mutant strain MGI:5511440 Il19 targeted mutation 2e, Helmholtz Zentrum Muenchen GmbH MGI:1890472 Il19 interleukin 19 https://www.infrafrontier.eu/search?keyword=EM:08953 + EM:11763 C57BL/6N-Il18rap/WtsiCnrm EMMA sperm mutant strain MGI:6152737 Il18rap endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1338888 Il18rap interleukin 18 receptor accessory protein https://www.infrafrontier.eu/search?keyword=EM:11763 + EM:11776 C57BL/6N-Il17re/Wtsi EMMA embryo mutant strain Il17re EUCOMM targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1889371 Il17re interleukin 17 receptor E https://www.infrafrontier.eu/search?keyword=EM:11776 + EM:11776 C57BL/6N-Il17re/Wtsi EMMA sperm mutant strain Il17re EUCOMM targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1889371 Il17re interleukin 17 receptor E https://www.infrafrontier.eu/search?keyword=EM:11776 + EM:11738 C57BL/6N-Il17re/Wtsi EMMA embryo mutant strain MGI:6157265 Il17re targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1889371 Il17re interleukin 17 receptor E https://www.infrafrontier.eu/search?keyword=EM:11738 + EM:11738 C57BL/6N-Il17re/Wtsi EMMA sperm mutant strain MGI:6157265 Il17re targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1889371 Il17re interleukin 17 receptor E https://www.infrafrontier.eu/search?keyword=EM:11738 + EM:10738 C57BL/6N-Il15/H EMMA archived mutant strain MGI:5790636 Il15 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:103014 Il15 interleukin 15 https://www.infrafrontier.eu/search?keyword=EM:10738 - EM:07964 C57BL/6N-Il15/H EMMA sperm B6NTac;B6N-Il15/H, HEPD0629_7_C06 mutant strain MGI:4455931 Il15 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103014 Il15 interleukin 15 https://www.infrafrontier.eu/search?keyword=EM:07964 + EM:09087 C57BL/6N-Il13ra2/Ieg EMMA sperm mutant strain MGI:4452745 Il13ra2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1277954 Il13ra2 interleukin 13 receptor, alpha 2 https://www.infrafrontier.eu/search?keyword=EM:09087 + EM:09493 C57BL/6N-Il12a/H EMMA sperm mutant strain MGI:4455775 Il12a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96539 Il12a interleukin 12a https://www.infrafrontier.eu/search?keyword=EM:09493 + EM:08503 C57BL/6N-Il10/Cnbc EMMA sperm mutant strain MGI:4432290 Il10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96537 Il10 interleukin 10 https://www.infrafrontier.eu/search?keyword=EM:08503 + EM:11975 C57BL/6N-Ikbke/Wtsi EMMA embryo mutant strain Ikbke EUCOMM targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2138621 Ikbke inhibitor of kappaB kinase epsilon https://www.infrafrontier.eu/search?keyword=EM:11975 + EM:11975 C57BL/6N-Ikbke/Wtsi EMMA sperm mutant strain Ikbke EUCOMM targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2138621 Ikbke inhibitor of kappaB kinase epsilon https://www.infrafrontier.eu/search?keyword=EM:11975 + EM:11218 C57BL/6N-Igsf8/WtsiIeg EMMA archived mutant strain MGI:6140202 Igsf8 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2138733 Igsf8 immunoglobulin superfamily, member 8 https://www.infrafrontier.eu/search?keyword=EM:11218 + EM:11891 C57BL/6N-Igsf6/WtsiH EMMA sperm mutant strain MGI:6153370 Igsf6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891393 Igsf6 immunoglobulin superfamily, member 6 https://www.infrafrontier.eu/search?keyword=EM:11891 + EM:08183 C57BL/6N-Igfbp3/H EMMA sperm mutant strain MGI:5548945 Igfbp3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:96438 Igfbp3 insulin-like growth factor binding protein 3 https://www.infrafrontier.eu/search?keyword=EM:08183 + EM:08649 C57BL/6N-Ift81/Ieg EMMA sperm mutant strain MGI:5636927 Ift81 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1098597 Ift81 intraflagellar transport 81 https://www.infrafrontier.eu/search?keyword=EM:08649 + EM:08602 C57BL/6N-Ift81/Ieg EMMA embryo mutant strain MGI:4433881 Ift81 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098597 Ift81 intraflagellar transport 81 https://www.infrafrontier.eu/search?keyword=EM:08602 + EM:09675 C57BL/6N-Ifitm6/Wtsi EMMA embryo mutant strain MGI:5638572 Ifitm6 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2686976 Ifitm6 interferon induced transmembrane protein 6 https://www.infrafrontier.eu/search?keyword=EM:09675 + EM:09675 C57BL/6N-Ifitm6/Wtsi EMMA sperm mutant strain MGI:5638572 Ifitm6 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2686976 Ifitm6 interferon induced transmembrane protein 6 https://www.infrafrontier.eu/search?keyword=EM:09675 + EM:10636 C57BL/6N-Ifitm1/Wtsi EMMA embryo mutant strain MGI:5775001 Ifitm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915963 Ifitm1 interferon induced transmembrane protein 1 https://www.infrafrontier.eu/search?keyword=EM:10636 + EM:10636 C57BL/6N-Ifitm1/Wtsi EMMA sperm mutant strain MGI:5775001 Ifitm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915963 Ifitm1 interferon induced transmembrane protein 1 https://www.infrafrontier.eu/search?keyword=EM:10636 + EM:10668 C57BL/6N-Ifitm1/H EMMA sperm mutant strain MGI:4432260 Ifitm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915963 Ifitm1 interferon induced transmembrane protein 1 https://www.infrafrontier.eu/search?keyword=EM:10668 + EM:11517 C57BL/6N-Ifih1/Wtsi EMMA embryo mutant strain MGI:6153741 Ifih1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1918836 Ifih1 interferon induced with helicase C domain 1 https://www.infrafrontier.eu/search?keyword=EM:11517 + EM:11517 C57BL/6N-Ifih1/Wtsi EMMA sperm mutant strain MGI:6153741 Ifih1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1918836 Ifih1 interferon induced with helicase C domain 1 https://www.infrafrontier.eu/search?keyword=EM:11517 + EM:11875 C57BL/6N-Ifi44l/Wtsi EMMA embryo mutant strain MGI:6257644 Ifi44l endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:95975 Ifi44l interferon-induced protein 44 like https://www.infrafrontier.eu/search?keyword=EM:11875 + EM:11875 C57BL/6N-Ifi44l/Wtsi EMMA sperm mutant strain MGI:6257644 Ifi44l endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:95975 Ifi44l interferon-induced protein 44 like https://www.infrafrontier.eu/search?keyword=EM:11875 + EM:10060 C57BL/6N-Ifi27l2a/Ieg EMMA sperm mutant strain MGI:5548678 Ifi27l2a targeted mutation 1.1, Velocigene MGI:1924183 Ifi27l2a interferon, alpha-inducible protein 27 like 2A https://www.infrafrontier.eu/search?keyword=EM:10060 + EM:09359 C57BL/6N-Ifi27/Wtsi EMMA embryo mutant strain MGI:5636940 Ifi27 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1277180 Ifi27 interferon, alpha-inducible protein 27 https://www.infrafrontier.eu/search?keyword=EM:09359 + EM:09359 C57BL/6N-Ifi27/Wtsi EMMA sperm mutant strain MGI:5636940 Ifi27 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1277180 Ifi27 interferon, alpha-inducible protein 27 https://www.infrafrontier.eu/search?keyword=EM:09359 + EM:11323 C57BL/6N-Ifi207/Wtsi EMMA embryo mutant strain MGI:6153369 Ifi207 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2138302 Ifi207 interferon activated gene 207 https://www.infrafrontier.eu/search?keyword=EM:11323 + EM:11323 C57BL/6N-Ifi207/Wtsi EMMA sperm mutant strain MGI:6153369 Ifi207 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2138302 Ifi207 interferon activated gene 207 https://www.infrafrontier.eu/search?keyword=EM:11323 + EM:09909 C57BL/6N-Idi1/Ieg EMMA sperm mutant strain MGI:4434753 Idi1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2442264 Idi1 isopentenyl-diphosphate delta isomerase https://www.infrafrontier.eu/search?keyword=EM:09909 + EM:10843 C57BL/6N-Id2/Wtsi EMMA embryo mutant strain MGI:5796939 Id2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:96397 Id2 inhibitor of DNA binding 2 https://www.infrafrontier.eu/search?keyword=EM:10843 + EM:10843 C57BL/6N-Id2/Wtsi EMMA sperm mutant strain MGI:5796939 Id2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:96397 Id2 inhibitor of DNA binding 2 https://www.infrafrontier.eu/search?keyword=EM:10843 + EM:11895 C57BL/6N-Icam5/WtsiH EMMA sperm mutant strain MGI:6153368 Icam5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:109430 Icam5 intercellular adhesion molecule 5, telencephalin https://www.infrafrontier.eu/search?keyword=EM:11895 + EM:11344 C57BL/6N-Ica1l/Ieg EMMA sperm mutant strain MGI:5294183 Ica1l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:5648232 Ica1l islet cell autoantigen 1-like https://www.infrafrontier.eu/search?keyword=EM:11344 + EM:11237 C57BL/6N-Iars/Wtsi EMMA embryo mutant strain MGI:6153367 Iars endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1917556 Iars isoleucine-tRNA synthetase https://www.infrafrontier.eu/search?keyword=EM:11237 + EM:11237 C57BL/6N-Iars/Wtsi EMMA sperm mutant strain MGI:6153367 Iars endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1917556 Iars isoleucine-tRNA synthetase https://www.infrafrontier.eu/search?keyword=EM:11237 + EM:09238 C57BL/6N-Hunk/Ieg EMMA sperm mutant strain MGI:5613639 Hunk targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1347352 Hunk hormonally upregulated Neu-associated kinase https://www.infrafrontier.eu/search?keyword=EM:09238 + EM:08246 C57BL/6N-Hunk/Ieg EMMA embryo mutant strain MGI:5050999 Hunk targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1347352 Hunk hormonally upregulated Neu-associated kinase https://www.infrafrontier.eu/search?keyword=EM:08246 + EM:11594 C57BL/6N-Htra3/WtsiOulu EMMA embryo mutant strain MGI:6140200 Htra3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1925808 Htra3 HtrA serine peptidase 3 https://www.infrafrontier.eu/search?keyword=EM:11594 + EM:11594 C57BL/6N-Htra3/WtsiOulu EMMA sperm mutant strain MGI:6140200 Htra3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1925808 Htra3 HtrA serine peptidase 3 https://www.infrafrontier.eu/search?keyword=EM:11594 + EM:10432 C57BL/6N-Hspa13/Wtsi EMMA embryo mutant strain MGI:6153366 Hspa13 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1309463 Hspa13 heat shock protein 70 family, member 13 https://www.infrafrontier.eu/search?keyword=EM:10432 + EM:10432 C57BL/6N-Hspa13/Wtsi EMMA sperm mutant strain MGI:6153366 Hspa13 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1309463 Hspa13 heat shock protein 70 family, member 13 https://www.infrafrontier.eu/search?keyword=EM:10432 + EM:08066 C57BL/6N-Hsf2bp/Ieg EMMA sperm mutant strain MGI:5548644 Hsf2bp targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1921627 Hsf2bp heat shock transcription factor 2 binding protein https://www.infrafrontier.eu/search?keyword=EM:08066 + EM:11216 C57BL/6N-Hrnr/WtsiIeg EMMA archived mutant strain MGI:6140199 Hrnr endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3046938 Hrnr hornerin https://www.infrafrontier.eu/search?keyword=EM:11216 + EM:04718 C57BL/6N-Hprt/Ieg EMMA embryo B6NTac;B6N-Hprt/Ieg mutant strain MGI:4435169 Hprt targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96217 Hprt hypoxanthine guanine phosphoribosyl transferase https://www.infrafrontier.eu/search?keyword=EM:04718 + EM:05414 C57BL/6N-Hprt/WtsiOulu EMMA embryo HPRT CMV Cre (CRET), C57BL/6N-Hprt/WtsiOulu mutant strain MGI:5496382 Hprt targeted mutation 1, Wellcome Trust Sanger Institute MGI:96217 Hprt hypoxanthine guanine phosphoribosyl transferase https://www.infrafrontier.eu/search?keyword=EM:05414 + EM:12647 C57BL/6N-Hpgd/H EMMA live mutant strain MGI:4946754 Hpgd targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108085 Hpgd hydroxyprostaglandin dehydrogenase 15 (NAD) https://www.infrafrontier.eu/search?keyword=EM:12647 + EM:11150 C57BL/6N-Hpf1/WtsiH EMMA sperm mutant strain MGI:6153365 Hpf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919862 Hpf1 histone PARylation factor 1 https://www.infrafrontier.eu/search?keyword=EM:11150 + EM:09237 C57BL/6N-Hoxa2/Ieg EMMA sperm mutant strain MGI:5613670 Hoxa2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:96174 Hoxa2 homeobox A2 https://www.infrafrontier.eu/search?keyword=EM:09237 + EM:11030 C57BL/6N-Hoxa2/Ieg EMMA sperm mutant strain MGI:4455974 Hoxa2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96174 Hoxa2 homeobox A2 https://www.infrafrontier.eu/search?keyword=EM:11030 + EM:09236 C57BL/6N-Hnf4a/Ieg EMMA sperm mutant strain MGI:5613635 Hnf4a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:109128 Hnf4a hepatic nuclear factor 4, alpha https://www.infrafrontier.eu/search?keyword=EM:09236 + EM:08243 C57BL/6N-Hnf4a/Ieg EMMA embryo mutant strain MGI:4455726 Hnf4a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109128 Hnf4a hepatic nuclear factor 4, alpha https://www.infrafrontier.eu/search?keyword=EM:08243 + EM:09305 C57BL/6N-Hipk3/Ieg EMMA embryo mutant strain MGI:5588270 Hipk3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1314882 Hipk3 homeodomain interacting protein kinase 3 https://www.infrafrontier.eu/search?keyword=EM:09305 + EM:09305 C57BL/6N-Hipk3/Ieg EMMA sperm mutant strain MGI:5588270 Hipk3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1314882 Hipk3 homeodomain interacting protein kinase 3 https://www.infrafrontier.eu/search?keyword=EM:09305 + EM:09294 C57BL/6N-Hipk3/Ieg EMMA embryo mutant strain MGI:5289889 Hipk3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1314882 Hipk3 homeodomain interacting protein kinase 3 https://www.infrafrontier.eu/search?keyword=EM:09294 + EM:09294 C57BL/6N-Hipk3/Ieg EMMA sperm mutant strain MGI:5289889 Hipk3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1314882 Hipk3 homeodomain interacting protein kinase 3 https://www.infrafrontier.eu/search?keyword=EM:09294 + EM:11639 C57BL/6N-Hipk3/Wtsi EMMA embryo mutant strain MGI:6153740 Hipk3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1314882 Hipk3 homeodomain interacting protein kinase 3 https://www.infrafrontier.eu/search?keyword=EM:11639 + EM:11639 C57BL/6N-Hipk3/Wtsi EMMA sperm mutant strain MGI:6153740 Hipk3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1314882 Hipk3 homeodomain interacting protein kinase 3 https://www.infrafrontier.eu/search?keyword=EM:11639 - EM:05220 C57BL/6N-Hint1/H EMMA sperm mutant strain MGI:4433692 Hint1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1321133 Hint1 histidine triad nucleotide binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:05220 + EM:07758 C57BL/6N-Hibadh/Wtsi EMMA embryo mutant strain MGI:5637002 Hibadh targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1889802 Hibadh 3-hydroxyisobutyrate dehydrogenase https://www.infrafrontier.eu/search?keyword=EM:07758 + EM:07758 C57BL/6N-Hibadh/Wtsi EMMA sperm mutant strain MGI:5637002 Hibadh targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1889802 Hibadh 3-hydroxyisobutyrate dehydrogenase https://www.infrafrontier.eu/search?keyword=EM:07758 - EM:07493 C57BL/6N-Hhipl1/H EMMA sperm B6NTac;B6N-Hhipl1/H mutant strain MGI:4451243 Hhipl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919265 Hhipl1 hedgehog interacting protein-like 1 https://www.infrafrontier.eu/search?keyword=EM:07493 + EM:10642 C57BL/6N-Hexb/H EMMA sperm mutant strain MGI:5050187 Hexb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96074 Hexb hexosaminidase B https://www.infrafrontier.eu/search?keyword=EM:10642 + EM:10257 C57BL/6N-Herc1/Wtsi EMMA embryo mutant strain MGI:6153732 Herc1 endonuclease mediated mutation 3, Wellcome Trust Sanger Insititute MGI:2384589 Herc1 HECT and RLD domain containing E3 ubiquitin protein ligase family member 1 https://www.infrafrontier.eu/search?keyword=EM:10257 + EM:10257 C57BL/6N-Herc1/Wtsi EMMA sperm mutant strain MGI:6153732 Herc1 endonuclease mediated mutation 3, Wellcome Trust Sanger Insititute MGI:2384589 Herc1 HECT and RLD domain containing E3 ubiquitin protein ligase family member 1 https://www.infrafrontier.eu/search?keyword=EM:10257 + EM:10246 C57BL/6N-Herc1/Wtsi EMMA embryo mutant strain MGI:6102914 Herc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2384589 Herc1 HECT and RLD domain containing E3 ubiquitin protein ligase family member 1 https://www.infrafrontier.eu/search?keyword=EM:10246 + EM:10246 C57BL/6N-Herc1/Wtsi EMMA sperm mutant strain MGI:6102914 Herc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2384589 Herc1 HECT and RLD domain containing E3 ubiquitin protein ligase family member 1 https://www.infrafrontier.eu/search?keyword=EM:10246 + EM:08093 C57BL/6N-Hells/Ieg EMMA sperm mutant strain MGI:5548365 Hells targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106209 Hells helicase, lymphoid specific https://www.infrafrontier.eu/search?keyword=EM:08093 + EM:10450 C57BL/6N-Hecw1/H EMMA sperm mutant strain MGI:5511718 Hecw1 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2137556 Hecw1 HECT, C2 and WW domain containing E3 ubiquitin protein ligase 1 https://www.infrafrontier.eu/search?keyword=EM:10450 + EM:10055 C57BL/6N-Hdac1/Ieg EMMA sperm mutant strain MGI:5548383 Hdac1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:108086 Hdac1 histone deacetylase 1 https://www.infrafrontier.eu/search?keyword=EM:10055 - EM:07870 C57BL/6N-Hcrtr2/H EMMA sperm mutant strain MGI:4456664 Hcrtr2 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2680765 Hcrtr2 hypocretin (orexin) receptor 2 https://www.infrafrontier.eu/search?keyword=EM:07870 + EM:08190 C57BL/6N-Has1/H EMMA sperm B6NTac;B6N-Has1/H mutant strain MGI:4419868 Has1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106590 Has1 hyaluronan synthase 1 https://www.infrafrontier.eu/search?keyword=EM:08190 + EM:10940 C57BL/6N-Hapln4/Wtsi EMMA embryo mutant strain MGI:6153361 Hapln4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2679531 Hapln4 hyaluronan and proteoglycan link protein 4 https://www.infrafrontier.eu/search?keyword=EM:10940 + EM:10940 C57BL/6N-Hapln4/Wtsi EMMA sperm mutant strain MGI:6153361 Hapln4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2679531 Hapln4 hyaluronan and proteoglycan link protein 4 https://www.infrafrontier.eu/search?keyword=EM:10940 + EM:11163 C57BL/6N-Hao2/WtsiH EMMA sperm mutant strain MGI:6153360 Hao2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2139681 Hao2 hydroxyacid oxidase 2 https://www.infrafrontier.eu/search?keyword=EM:11163 - EM:06138 C57BL/6N-Hace1/H EMMA sperm B6NTac;B6N-Hace1/H mutant strain MGI:4840984 Hace1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446110 Hace1 HECT domain and ankyrin repeat containing, E3 ubiquitin protein ligase 1 https://www.infrafrontier.eu/search?keyword=EM:06138 + EM:08559 C57BL/6N-H2bl1/Wtsi EMMA embryo C57BL/6N-1700024P04Rik/Wtsi mutant strain MGI:5637040 H2bl1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916632 H2bl1 H2B.L histone variant 1 https://www.infrafrontier.eu/search?keyword=EM:08559 + EM:08559 C57BL/6N-H2bl1/Wtsi EMMA sperm C57BL/6N-1700024P04Rik/Wtsi mutant strain MGI:5637040 H2bl1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916632 H2bl1 H2B.L histone variant 1 https://www.infrafrontier.eu/search?keyword=EM:08559 + EM:11584 C57BL/6N-H2ab3/WtsiOulu EMMA embryo C57BL/6N-H2afb3/WtsiOulu mutant strain MGI:6140198 H2ab3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3644875 H2ab3 H2A.B variant histone 3 https://www.infrafrontier.eu/search?keyword=EM:11584 + EM:11584 C57BL/6N-H2ab3/WtsiOulu EMMA sperm C57BL/6N-H2afb3/WtsiOulu mutant strain MGI:6140198 H2ab3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3644875 H2ab3 H2A.B variant histone 3 https://www.infrafrontier.eu/search?keyword=EM:11584 + EM:10387 C57BL/6N-H2-T24/Wtsi EMMA embryo mutant strain MGI:6153358 H2-T24 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95958 H2-T24 histocompatibility 2, T region locus 24 https://www.infrafrontier.eu/search?keyword=EM:10387 + EM:10387 C57BL/6N-H2-T24/Wtsi EMMA sperm mutant strain MGI:6153358 H2-T24 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95958 H2-T24 histocompatibility 2, T region locus 24 https://www.infrafrontier.eu/search?keyword=EM:10387 + EM:10022 C57BL/6N-H13/Wtsi EMMA embryo mutant strain MGI:5637209 H13 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:95886 H13 histocompatibility 13 https://www.infrafrontier.eu/search?keyword=EM:10022 + EM:10022 C57BL/6N-H13/Wtsi EMMA sperm mutant strain MGI:5637209 H13 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:95886 H13 histocompatibility 13 https://www.infrafrontier.eu/search?keyword=EM:10022 + EM:11678 C57BL/6N-Gzmf/Wtsi EMMA embryo mutant strain MGI:6153357 Gzmf endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:109254 Gzmf granzyme F https://www.infrafrontier.eu/search?keyword=EM:11678 + EM:11678 C57BL/6N-Gzmf/Wtsi EMMA sperm mutant strain MGI:6153357 Gzmf endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:109254 Gzmf granzyme F https://www.infrafrontier.eu/search?keyword=EM:11678 + EM:11103 C57BL/6N-Gzmd/Wtsi EMMA embryo mutant strain MGI:5823220 Gzmd targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:109255 Gzmd granzyme D https://www.infrafrontier.eu/search?keyword=EM:11103 + EM:11103 C57BL/6N-Gzmd/Wtsi EMMA sperm mutant strain MGI:5823220 Gzmd targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:109255 Gzmd granzyme D https://www.infrafrontier.eu/search?keyword=EM:11103 + EM:08810 C57BL/6N-Gtf2e2/H EMMA sperm mutant strain MGI:5008024 Gtf2e2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915403 Gtf2e2 general transcription factor II E, polypeptide 2 (beta subunit) https://www.infrafrontier.eu/search?keyword=EM:08810 + EM:04830 C57BL/6N-Gt(ROSA)26Sor/WtsiIeg EMMA embryo ROSA26 Fki, C57BL/6N-Gt(ROSA)26Sor/WtsiIeg mutant strain MGI:5496383 Gt(ROSA)26Sor targeted mutation 1, Wellcome Trust Sanger Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:04830 - EM:10234 C57BL/6N-Gstm6/Ieg EMMA sperm mutant strain MGI:6148222 Gstm6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1309467 Gstm6 glutathione S-transferase, mu 6 https://www.infrafrontier.eu/search?keyword=EM:10234 + EM:08620 C57BL/6N-Gstm6/Ieg EMMA embryo mutant strain MGI:5287849 Gstm6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1309467 Gstm6 glutathione S-transferase, mu 6 https://www.infrafrontier.eu/search?keyword=EM:08620 + EM:09516 C57BL/6N-Gsta4/Ieg EMMA sperm mutant strain MGI:5629310 Gsta4 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1309515 Gsta4 glutathione S-transferase, alpha 4 https://www.infrafrontier.eu/search?keyword=EM:09516 + EM:08599 C57BL/6N-Gsta4/Ieg EMMA embryo mutant strain MGI:5013788 Gsta4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1309515 Gsta4 glutathione S-transferase, alpha 4 https://www.infrafrontier.eu/search?keyword=EM:08599 - EM:11665 C57BL/6N-Gsk3a/Ieg EMMA sperm mutant strain MGI:5695125 Gsk3a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2152453 Gsk3a glycogen synthase kinase 3 alpha https://www.infrafrontier.eu/search?keyword=EM:11665 - EM:05306 C57BL/6N-Gse1/H EMMA sperm mutant strain MGI:4455973 Gse1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098275 Gse1 genetic suppressor element 1, coiled-coil protein https://www.infrafrontier.eu/search?keyword=EM:05306 + EM:09924 C57BL/6N-Gsdme/Wtsi EMMA embryo mutant strain MGI:5692646 Gsdme targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3703053 Gsdme gasdermin E https://www.infrafrontier.eu/search?keyword=EM:09924 + EM:09924 C57BL/6N-Gsdme/Wtsi EMMA sperm mutant strain MGI:5692646 Gsdme targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3703053 Gsdme gasdermin E https://www.infrafrontier.eu/search?keyword=EM:09924 + EM:09144 C57BL/6N-Grsf1/Wtsi EMMA embryo mutant strain MGI:5636902 Grsf1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106479 Grsf1 G-rich RNA sequence binding factor 1 https://www.infrafrontier.eu/search?keyword=EM:09144 + EM:09144 C57BL/6N-Grsf1/Wtsi EMMA sperm mutant strain MGI:5636902 Grsf1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106479 Grsf1 G-rich RNA sequence binding factor 1 https://www.infrafrontier.eu/search?keyword=EM:09144 + EM:11804 C57BL/6N-Grpel1/Oulu EMMA embryo mutant strain MGI:4432720 Grpel1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1334417 Grpel1 GrpE-like 1, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:11804 + EM:11804 C57BL/6N-Grpel1/Oulu EMMA sperm mutant strain MGI:4432720 Grpel1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1334417 Grpel1 GrpE-like 1, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:11804 - EM:10779 C57BL/6N-Grm7/H EMMA live mutant strain Grm7 CRISPR/CAS9 targeted mutation, MRC Harwell MGI:1351344 Grm7 glutamate receptor, metabotropic 7 https://www.infrafrontier.eu/search?keyword=EM:10779 - EM:05909 C57BL/6N-Grm6/H EMMA sperm mutant strain MGI:4431613 Grm6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1351343 Grm6 glutamate receptor, metabotropic 6 https://www.infrafrontier.eu/search?keyword=EM:05909 + EM:08283 C57BL/6N-Grm3/H EMMA sperm mutant strain MGI:4820049 Grm3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1351340 Grm3 glutamate receptor, metabotropic 3 https://www.infrafrontier.eu/search?keyword=EM:08283 + EM:10396 C57BL/6N-Grin3b/H EMMA sperm mutant strain MGI:4462594 Grin3b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2150393 Grin3b glutamate receptor, ionotropic, NMDA3B https://www.infrafrontier.eu/search?keyword=EM:10396 + EM:10461 C57BL/6N-Grin3a/H EMMA sperm mutant strain MGI:5752551 Grin3a targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1933206 Grin3a glutamate receptor ionotropic, NMDA3A https://www.infrafrontier.eu/search?keyword=EM:10461 + EM:09296 C57BL/6N-Grin3a/H EMMA sperm mutant strain MGI:4458762 Grin3a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1933206 Grin3a glutamate receptor ionotropic, NMDA3A https://www.infrafrontier.eu/search?keyword=EM:09296 + EM:12638 C57BL/6N-Grik2/H EMMA live mutant strain MGI:5052479 Grik2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:95815 Grik2 glutamate receptor, ionotropic, kainate 2 (beta 2) https://www.infrafrontier.eu/search?keyword=EM:12638 + EM:11259 C57BL/6N-Grik1/H EMMA sperm mutant strain MGI:4840802 Grik1 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:95814 Grik1 glutamate receptor, ionotropic, kainate 1 https://www.infrafrontier.eu/search?keyword=EM:11259 + EM:08354 C57BL/6N-Grb7/Wtsi EMMA embryo mutant strain MGI:5636886 Grb7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:102683 Grb7 growth factor receptor bound protein 7 https://www.infrafrontier.eu/search?keyword=EM:08354 + EM:08354 C57BL/6N-Grb7/Wtsi EMMA sperm mutant strain MGI:5636886 Grb7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:102683 Grb7 growth factor receptor bound protein 7 https://www.infrafrontier.eu/search?keyword=EM:08354 + EM:08713 C57BL/6N-Gpx3/H EMMA sperm mutant strain MGI:4841147 Gpx3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105102 Gpx3 glutathione peroxidase 3 https://www.infrafrontier.eu/search?keyword=EM:08713 + EM:08055 C57BL/6N-Gpsm2/Ieg EMMA sperm mutant strain MGI:5548664 Gpsm2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923373 Gpsm2 G-protein signalling modulator 2 (AGS3-like, C. elegans) https://www.infrafrontier.eu/search?keyword=EM:08055 + EM:05535 C57BL/6N-Gpsm2/Ieg EMMA embryo B6NTac;B6N-Gpsm2/Ieg mutant strain MGI:4441912 Gpsm2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923373 Gpsm2 G-protein signalling modulator 2 (AGS3-like, C. elegans) https://www.infrafrontier.eu/search?keyword=EM:05535 + EM:13039 C57BL/6N-Gpr35/WtsiH EMMA live mutant strain MGI:5638567 Gpr35 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1929509 Gpr35 G protein-coupled receptor 35 https://www.infrafrontier.eu/search?keyword=EM:13039 - EM:06174 C57BL/6N-Gpr22/H EMMA sperm B6NTac;B6N-Gpr22/H mutant strain MGI:4362775 Gpr22 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920260 Gpr22 G protein-coupled receptor 22 https://www.infrafrontier.eu/search?keyword=EM:06174 - EM:04737 C57BL/6N-Gpr1/Cnrm EMMA embryo mutant strain MGI:4434954 Gpr1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385324 Gpr1 G protein-coupled receptor 1 https://www.infrafrontier.eu/search?keyword=EM:04737 - EM:04737 C57BL/6N-Gpr1/Cnrm EMMA sperm mutant strain MGI:4434954 Gpr1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385324 Gpr1 G protein-coupled receptor 1 https://www.infrafrontier.eu/search?keyword=EM:04737 + EM:09877 C57BL/6N-Gpr176/H EMMA sperm mutant strain MGI:4843901 Gpr176 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2685858 Gpr176 G protein-coupled receptor 176 https://www.infrafrontier.eu/search?keyword=EM:09877 + EM:07533 C57BL/6N-Gpr152/Wtsi EMMA embryo mutant strain MGI:5548871 Gpr152 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2685519 Gpr152 G protein-coupled receptor 152 https://www.infrafrontier.eu/search?keyword=EM:07533 + EM:07533 C57BL/6N-Gpr152/Wtsi EMMA sperm mutant strain MGI:5548871 Gpr152 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2685519 Gpr152 G protein-coupled receptor 152 https://www.infrafrontier.eu/search?keyword=EM:07533 + EM:08388 C57BL/6N-Gpr137b/H EMMA sperm mutant strain MGI:4820052 Gpr137b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891463 Gpr137b G protein-coupled receptor 137B https://www.infrafrontier.eu/search?keyword=EM:08388 + EM:10110 C57BL/6N-Gpbp1/Ieg EMMA sperm mutant strain MGI:5692726 Gpbp1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1920524 Gpbp1 GC-rich promoter binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:10110 + EM:09177 C57BL/6N-Gpbp1/Ieg EMMA sperm mutant strain MGI:5006774 Gpbp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920524 Gpbp1 GC-rich promoter binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:09177 + EM:09510 C57BL/6N-Gpatch2l/Ieg EMMA sperm mutant strain MGI:5629318 Gpatch2l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1917623 Gpatch2l G patch domain containing 2 like https://www.infrafrontier.eu/search?keyword=EM:09510 + EM:09488 C57BL/6N-Gpatch2l/Ieg EMMA sperm mutant strain MGI:4362674 Gpatch2l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917623 Gpatch2l G patch domain containing 2 like https://www.infrafrontier.eu/search?keyword=EM:09488 + EM:10399 C57BL/6N-Got1/H EMMA sperm C57BL6/NTac-Got1/H mutant strain MGI:4950165 Got1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2147593 Got1 glutamic-oxaloacetic transaminase 1, soluble https://www.infrafrontier.eu/search?keyword=EM:10399 - EM:06828 C57BL/6N-Gosr2/H EMMA sperm mutant strain MGI:4849382 Gosr2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1927204 Gosr2 golgi SNAP receptor complex member 2 https://www.infrafrontier.eu/search?keyword=EM:06828 - EM:04736 C57BL/6N-Golt1b/Cnrm EMMA embryo mutant strain MGI:4432110 Golt1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914214 Golt1b golgi transport 1B https://www.infrafrontier.eu/search?keyword=EM:04736 - EM:04736 C57BL/6N-Golt1b/Cnrm EMMA sperm mutant strain MGI:4432110 Golt1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914214 Golt1b golgi transport 1B https://www.infrafrontier.eu/search?keyword=EM:04736 + EM:11086 C57BL/6N-Golt1a/Wtsi EMMA embryo mutant strain MGI:5816876 Golt1a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915588 Golt1a golgi transport 1A https://www.infrafrontier.eu/search?keyword=EM:11086 + EM:11086 C57BL/6N-Golt1a/Wtsi EMMA sperm mutant strain MGI:5816876 Golt1a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915588 Golt1a golgi transport 1A https://www.infrafrontier.eu/search?keyword=EM:11086 + EM:07757 C57BL/6N-Golm2/Wtsi EMMA embryo C57BL/6N-Casc4/Wtsi mutant strain MGI:5637147 Golm2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2443129 Golm2 golgi membrane protein 2 https://www.infrafrontier.eu/search?keyword=EM:07757 + EM:07757 C57BL/6N-Golm2/Wtsi EMMA sperm C57BL/6N-Casc4/Wtsi mutant strain MGI:5637147 Golm2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2443129 Golm2 golgi membrane protein 2 https://www.infrafrontier.eu/search?keyword=EM:07757 + EM:08286 C57BL/6N-Golga3/H EMMA sperm mutant strain MGI:4841643 Golga3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96958 Golga3 golgi autoantigen, golgin subfamily a, 3 https://www.infrafrontier.eu/search?keyword=EM:08286 + EM:11229 C57BL/6N-Gnl3/Wtsi EMMA embryo mutant strain Gnl3 Sanger Institute targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2387185 Gnl3 guanine nucleotide binding protein-like 3 (nucleolar) https://www.infrafrontier.eu/search?keyword=EM:11229 + EM:11229 C57BL/6N-Gnl3/Wtsi EMMA sperm mutant strain Gnl3 Sanger Institute targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2387185 Gnl3 guanine nucleotide binding protein-like 3 (nucleolar) https://www.infrafrontier.eu/search?keyword=EM:11229 + EM:08653 C57BL/6N-Gnb3/Wtsi EMMA embryo mutant strain MGI:5637208 Gnb3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:95785 Gnb3 guanine nucleotide binding protein (G protein), beta 3 https://www.infrafrontier.eu/search?keyword=EM:08653 + EM:08653 C57BL/6N-Gnb3/Wtsi EMMA sperm mutant strain MGI:5637208 Gnb3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:95785 Gnb3 guanine nucleotide binding protein (G protein), beta 3 https://www.infrafrontier.eu/search?keyword=EM:08653 - EM:07005 C57BL/6N-Gnao1/H EMMA sperm B6NTac;B6N-Gnao1/H mutant strain MGI:4456727 Gnao1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:95775 Gnao1 guanine nucleotide binding protein, alpha O https://www.infrafrontier.eu/search?keyword=EM:07005 + EM:07753 C57BL/6N-Gmnc/Wtsi EMMA embryo mutant strain MGI:5637172 Gmnc targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2685452 Gmnc geminin coiled-coil domain containing https://www.infrafrontier.eu/search?keyword=EM:07753 + EM:07753 C57BL/6N-Gmnc/Wtsi EMMA sperm mutant strain MGI:5637172 Gmnc targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2685452 Gmnc geminin coiled-coil domain containing https://www.infrafrontier.eu/search?keyword=EM:07753 + EM:11569 C57BL/6N-Gm5155/WtsiOulu EMMA embryo mutant strain MGI:6140197 Gm5155 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3647191 Gm5155 predicted gene 5155 https://www.infrafrontier.eu/search?keyword=EM:11569 + EM:11569 C57BL/6N-Gm5155/WtsiOulu EMMA sperm mutant strain MGI:6140197 Gm5155 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3647191 Gm5155 predicted gene 5155 https://www.infrafrontier.eu/search?keyword=EM:11569 - EM:10921 C57BL/6N-Gm28050/Wtsi EMMA embryo mutant strain Gm28050 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:5547786 Gm28050 predicted gene, 28050 https://www.infrafrontier.eu/search?keyword=EM:10921 - EM:10921 C57BL/6N-Gm28050/Wtsi EMMA sperm mutant strain Gm28050 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:5547786 Gm28050 predicted gene, 28050 https://www.infrafrontier.eu/search?keyword=EM:10921 + EM:10937 C57BL/6N-Gm2694/Wtsi EMMA embryo mutant strain MGI:6153353 Gm2694 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:4437736 Gm2694 predicted gene 2694 https://www.infrafrontier.eu/search?keyword=EM:10937 + EM:10937 C57BL/6N-Gm2694/Wtsi EMMA sperm mutant strain MGI:6153353 Gm2694 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:4437736 Gm2694 predicted gene 2694 https://www.infrafrontier.eu/search?keyword=EM:10937 + EM:10810 C57BL/6N-Gm20646/Wtsi EMMA embryo mutant strain MGI:6153352 Gm20646 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:5313093 Gm20646 predicted gene 20646 https://www.infrafrontier.eu/search?keyword=EM:10810 + EM:10810 C57BL/6N-Gm20646/Wtsi EMMA sperm mutant strain MGI:6153352 Gm20646 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:5313093 Gm20646 predicted gene 20646 https://www.infrafrontier.eu/search?keyword=EM:10810 + EM:10657 C57BL/6N-Gm17750/Wtsi EMMA embryo mutant strain MGI:6153351 Gm17750 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:5009828 Gm17750 predicted gene, 17750 https://www.infrafrontier.eu/search?keyword=EM:10657 + EM:10657 C57BL/6N-Gm17750/Wtsi EMMA sperm mutant strain MGI:6153351 Gm17750 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:5009828 Gm17750 predicted gene, 17750 https://www.infrafrontier.eu/search?keyword=EM:10657 + EM:09674 C57BL/6N-Gm16432/Wtsi EMMA embryo mutant strain MGI:5638574 Catspere2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3645414 Catspere2 cation channel sperm associated auxiliary subunit epsilon 2 https://www.infrafrontier.eu/search?keyword=EM:09674 + EM:09674 C57BL/6N-Gm16432/Wtsi EMMA sperm mutant strain MGI:5638574 Catspere2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3645414 Catspere2 cation channel sperm associated auxiliary subunit epsilon 2 https://www.infrafrontier.eu/search?keyword=EM:09674 + EM:11268 C57BL/6N-Gm12169/Wtsi EMMA embryo mutant strain MGI:6153350 Gm12169 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3650838 Gm12169 predicted gene 12169 https://www.infrafrontier.eu/search?keyword=EM:11268 + EM:11268 C57BL/6N-Gm12169/Wtsi EMMA sperm mutant strain MGI:6153350 Gm12169 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3650838 Gm12169 predicted gene 12169 https://www.infrafrontier.eu/search?keyword=EM:11268 + EM:10729 C57BL/6N-Glyatl3/Wtsi EMMA embryo mutant strain MGI:6153766 Glyatl3 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:3647683 Glyatl3 glycine-N-acyltransferase-like 3 https://www.infrafrontier.eu/search?keyword=EM:10729 + EM:10729 C57BL/6N-Glyatl3/Wtsi EMMA sperm mutant strain MGI:6153766 Glyatl3 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:3647683 Glyatl3 glycine-N-acyltransferase-like 3 https://www.infrafrontier.eu/search?keyword=EM:10729 + EM:11154 C57BL/6N-Glyatl3/WtsiOulu EMMA embryo mutant strain MGI:6140196 Glyatl3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3647683 Glyatl3 glycine-N-acyltransferase-like 3 https://www.infrafrontier.eu/search?keyword=EM:11154 + EM:11154 C57BL/6N-Glyatl3/WtsiOulu EMMA sperm mutant strain MGI:6140196 Glyatl3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3647683 Glyatl3 glycine-N-acyltransferase-like 3 https://www.infrafrontier.eu/search?keyword=EM:11154 + EM:08370 C57BL/6N-Glul/H EMMA sperm mutant strain MGI:4820105 Glul targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95739 Glul glutamate-ammonia ligase (glutamine synthetase) https://www.infrafrontier.eu/search?keyword=EM:08370 + EM:09379 C57BL/6N-Gltp/Ph EMMA archived mutant strain MGI:4434874 Gltp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1929253 Gltp glycolipid transfer protein https://www.infrafrontier.eu/search?keyword=EM:09379 + EM:11845 C57BL/6N-Glra4/Wtsi EMMA embryo mutant strain MGI:5775008 Glra4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:95750 Glra4 glycine receptor, alpha 4 subunit https://www.infrafrontier.eu/search?keyword=EM:11845 + EM:11845 C57BL/6N-Glra4/Wtsi EMMA sperm mutant strain MGI:5775008 Glra4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:95750 Glra4 glycine receptor, alpha 4 subunit https://www.infrafrontier.eu/search?keyword=EM:11845 - EM:07478 C57BL/6N-Glra2/H EMMA sperm B6NTac;B6N-Glra2/H mutant strain MGI:4364480 Glra2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95748 Glra2 glycine receptor, alpha 2 subunit https://www.infrafrontier.eu/search?keyword=EM:07478 + EM:09030 C57BL/6N-Glp1r/H EMMA sperm mutant strain MGI:5692922 Glp1r targeted mutation 1c, Mouse Biology Program, UCDavis MGI:99571 Glp1r glucagon-like peptide 1 receptor https://www.infrafrontier.eu/search?keyword=EM:09030 + EM:06808 C57BL/6N-Glp1r/H EMMA sperm B6NTac;B6N-Glp1r/H mutant strain MGI:4840757 Glp1r targeted mutation 1a, Mouse Biology Program, UCDavis MGI:99571 Glp1r glucagon-like peptide 1 receptor https://www.infrafrontier.eu/search?keyword=EM:06808 + EM:11438 C57BL/6N-Gldn/Wtsi EMMA embryo mutant strain MGI:6153349 Gldn endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2388361 Gldn gliomedin https://www.infrafrontier.eu/search?keyword=EM:11438 + EM:11438 C57BL/6N-Gldn/Wtsi EMMA sperm mutant strain MGI:6153349 Gldn endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2388361 Gldn gliomedin https://www.infrafrontier.eu/search?keyword=EM:11438 + EM:11190 C57BL/6N-Glcci1/Wtsi EMMA embryo mutant strain MGI:6153348 Glcci1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2442244 Glcci1 glucocorticoid induced transcript 1 https://www.infrafrontier.eu/search?keyword=EM:11190 + EM:11190 C57BL/6N-Glcci1/Wtsi EMMA sperm mutant strain MGI:6153348 Glcci1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2442244 Glcci1 glucocorticoid induced transcript 1 https://www.infrafrontier.eu/search?keyword=EM:11190 - EM:05129 C57BL/6N-Gja8/H EMMA sperm HEPD0555_6_G06, B6NTac;B6N-Gja8/H, STOCK Gja8/H mutant strain MGI:4435449 Gja8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99953 Gja8 gap junction protein, alpha 8 https://www.infrafrontier.eu/search?keyword=EM:05129 + EM:11605 C57BL/6N-Gimap4/Wtsi EMMA embryo mutant strain MGI:6153347 Gimap4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1349656 Gimap4 GTPase, IMAP family member 4 https://www.infrafrontier.eu/search?keyword=EM:11605 + EM:11605 C57BL/6N-Gimap4/Wtsi EMMA sperm mutant strain MGI:6153347 Gimap4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1349656 Gimap4 GTPase, IMAP family member 4 https://www.infrafrontier.eu/search?keyword=EM:11605 + EM:11680 C57BL/6N-Ghitm/Wtsi EMMA embryo mutant strain MGI:6153346 Ghitm endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1913342 Ghitm growth hormone inducible transmembrane protein https://www.infrafrontier.eu/search?keyword=EM:11680 + EM:11680 C57BL/6N-Ghitm/Wtsi EMMA sperm mutant strain MGI:6153346 Ghitm endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1913342 Ghitm growth hormone inducible transmembrane protein https://www.infrafrontier.eu/search?keyword=EM:11680 + EM:08098 C57BL/6N-Ggps1/Ieg EMMA embryo mutant strain MGI:5548447 Ggps1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1341724 Ggps1 geranylgeranyl diphosphate synthase 1 https://www.infrafrontier.eu/search?keyword=EM:08098 + EM:11806 C57BL/6N-Ggps1/Ieg EMMA sperm mutant strain MGI:5000392 Ggps1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1341724 Ggps1 geranylgeranyl diphosphate synthase 1 https://www.infrafrontier.eu/search?keyword=EM:11806 + EM:08662 C57BL/6N-Gfpt2/Ieg EMMA sperm mutant strain MGI:5636966 Gfpt2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1338883 Gfpt2 glutamine fructose-6-phosphate transaminase 2 https://www.infrafrontier.eu/search?keyword=EM:08662 + EM:08640 C57BL/6N-Gfpt2/Ieg EMMA embryo mutant strain MGI:4433591 Gfpt2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1338883 Gfpt2 glutamine fructose-6-phosphate transaminase 2 https://www.infrafrontier.eu/search?keyword=EM:08640 + EM:09182 C57BL/6N-Gfpt1/H EMMA sperm mutant strain MGI:5692888 Gfpt1 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:95698 Gfpt1 glutamine fructose-6-phosphate transaminase 1 https://www.infrafrontier.eu/search?keyword=EM:09182 - EM:05172 C57BL/6N-Gfod2/Cnrm EMMA sperm mutant strain MGI:4435083 Gfod2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917825 Gfod2 glucose-fructose oxidoreductase domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:05172 + EM:09304 C57BL/6N-Gdi2/Ieg EMMA sperm mutant strain MGI:5588293 Gdi2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:99845 Gdi2 guanosine diphosphate (GDP) dissociation inhibitor 2 https://www.infrafrontier.eu/search?keyword=EM:09304 + EM:08244 C57BL/6N-Gdi2/Ieg EMMA sperm mutant strain MGI:5286327 Gdi2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99845 Gdi2 guanosine diphosphate (GDP) dissociation inhibitor 2 https://www.infrafrontier.eu/search?keyword=EM:08244 + EM:10460 C57BL/6N-Gdf15/H EMMA sperm mutant strain MGI:5752548 Gdf15 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1346047 Gdf15 growth differentiation factor 15 https://www.infrafrontier.eu/search?keyword=EM:10460 - EM:06354 C57BL/6N-Gdf15/H EMMA sperm B6NTac;B6N-Gdf15/H mutant strain MGI:4362649 Gdf15 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1346047 Gdf15 growth differentiation factor 15 https://www.infrafrontier.eu/search?keyword=EM:06354 + EM:09300 C57BL/6N-Gde1/Ieg EMMA sperm mutant strain MGI:5548506 Gde1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1891827 Gde1 glycerophosphodiester phosphodiesterase 1 https://www.infrafrontier.eu/search?keyword=EM:09300 + EM:08126 C57BL/6N-Gde1/Ie