Nomenclature Strain ID Strain/Stock Repository State Synonyms Type Allele ID Allele Symbol Allele Name Gene ID Gene Symbol Gene Name URL ? EM:11902 ZranG11Del EMMA sperm mutant strain MGI:106441 Zranb1 zinc finger, RAN-binding domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:11902 ? EM:13084 Zic1Gln389* EMMA sperm mutant strain Zic1 Zic1 MGI:106683 Zic1 zinc finger protein of the cerebellum 1 https://www.infrafrontier.eu/search?keyword=EM:13084 ? EM:08917 Zfp507V26AMhda EMMA sperm mutant strain 77T->C 77T->C MGI:1916378 Zfp507 zinc finger protein 507 https://www.infrafrontier.eu/search?keyword=EM:08917 ? EM:13226 Wistar Kyoto rat NOX4KO EMMA embryo mutant strain Deletion in the NOX4 gene Deletion in the NOX4 gene MGI:1354184 Nox4 NADPH oxidase 4 https://www.infrafrontier.eu/search?keyword=EM:13226 ? EM:13250 Vps34-kinase dead EMMA embryo mutant strain PIK3C3 PIK3C3 MGI:2445019 Pik3c3 phosphatidylinositol 3-kinase catalytic subunit type 3 https://www.infrafrontier.eu/search?keyword=EM:13250 - EM:13251 Vps34-flox EMMA embryo mutant strain PIK3C3 PIK3C3 MGI:2445019 Pik3c3 phosphatidylinositol 3-kinase catalytic subunit type 3 https://www.infrafrontier.eu/search?keyword=EM:13251 ? EM:13792 Twitch, Tbx1 EMMA archived mutant strain MGI:4842449 Arpc3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928375 Arpc3 actin related protein 2/3 complex, subunit 3 https://www.infrafrontier.eu/search?keyword=EM:13792 ? EM:13792 Twitch, Tbx1 EMMA archived mutant strain Kmt2d Kmt2d MGI:2682319 Kmt2d lysine (K)-specific methyltransferase 2D https://www.infrafrontier.eu/search?keyword=EM:13792 ? EM:13792 Twitch, Tbx1 EMMA archived mutant strain Tbx1 Tbx1 MGI:98493 Tbx1 T-box 1 https://www.infrafrontier.eu/search?keyword=EM:13792 ? EM:13792 Twitch, Tbx1 EMMA archived mutant strain Muc3 Muc3 MGI:1203527 Muc3 mucin 3, intestinal https://www.infrafrontier.eu/search?keyword=EM:13792 ? EM:05504 Twist1 KO cond EMMA embryo mutant strain Twist1 Twist1 MGI:98872 Twist1 twist basic helix-loop-helix transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:05504 ? EM:13067 Trp73fl/fl (Trp73 flox/flox) EMMA sperm mutant strain Trp73 exon 13 Trp73 exon 13 MGI:1336991 Trp73 transformation related protein 73 https://www.infrafrontier.eu/search?keyword=EM:13067 ? EM:13068 Trp73D13/D13 (Trp73delta13) EMMA sperm mutant strain Trp73 exon 13 Trp73 exon 13 MGI:1336991 Trp73 transformation related protein 73 https://www.infrafrontier.eu/search?keyword=EM:13068 - EM:13118 Trp53flR245W-GFP/wt EMMA sperm mutant strain Trp53 Trp53 MGI:98834 Trp53 transformation related protein 53 https://www.infrafrontier.eu/search?keyword=EM:13118 ? EM:14792 TREX1 T303P EMMA sperm mutant strain D18N D18N MGI:1328317 Trex1 three prime repair exonuclease 1 https://www.infrafrontier.eu/search?keyword=EM:14792 ? EM:05502 Traf7 KO conv EMMA embryo mutant strain Traf7 Traf7 MGI:3042141 Traf7 TNF receptor-associated factor 7 https://www.infrafrontier.eu/search?keyword=EM:05502 ? EM:05503 TRAF7 KO cond EMMA embryo mutant strain Traf7 Traf7 MGI:3042141 Traf7 TNF receptor-associated factor 7 https://www.infrafrontier.eu/search?keyword=EM:05503 ? EM:05501 TNFSF13b KO cond EMMA embryo mutant strain Tnfsf13b Tnfsf13b MGI:1344376 Tnfsf13b tumor necrosis factor (ligand) superfamily, member 13b https://www.infrafrontier.eu/search?keyword=EM:05501 - EM:13001 Tmx1 EMMA sperm mutant strain MGI:6751621 Tmx1 targeted mutation 1, University of Reading MGI:1919986 Tmx1 thioredoxin-related transmembrane protein 1 https://www.infrafrontier.eu/search?keyword=EM:13001 ? EM:05498 TMEM45B KO conv EMMA embryo mutant strain Tmem45b Tmem45b MGI:2384574 Tmem45b transmembrane protein 45b https://www.infrafrontier.eu/search?keyword=EM:05498 ? EM:05499 TMEM45B KO cond EMMA sperm mutant strain Tmem45b Tmem45b MGI:2384574 Tmem45b transmembrane protein 45b https://www.infrafrontier.eu/search?keyword=EM:05499 - EM:02167 TM/60 EMMA sperm C3H;B6-Tm60/H mutant strain MGI:5646558 Tm60 mutant Tm60 MGI:5646413 Tm60 mutant Tm60 https://www.infrafrontier.eu/search?keyword=EM:02167 - EM:02166 TM/59 EMMA sperm C3H;B6-Tm59/H mutant strain MGI:5646555 Tm59 mutation Tm59 MGI:5646412 Tm59 mutant Tm59 https://www.infrafrontier.eu/search?keyword=EM:02166 - EM:02165 TM/45 EMMA sperm C3H;B6-Tm45/H mutant strain MGI:5646550 Tm45 mutation Tm45 MGI:5646410 Tm45 mutant Tm45 https://www.infrafrontier.eu/search?keyword=EM:02165 ? EM:05496 Tlr9 KO conv EMMA embryo mutant strain Tlr9 Tlr9 MGI:1932389 Tlr9 toll-like receptor 9 https://www.infrafrontier.eu/search?keyword=EM:05496 ? EM:05497 Tlr9 KO cond EMMA embryo mutant strain Tlr9 Tlr9 MGI:1932389 Tlr9 toll-like receptor 9 https://www.infrafrontier.eu/search?keyword=EM:05497 ? EM:05500 Tlr7 KO cond EMMA embryo mutant strain Tlr7 Tlr7 MGI:2176882 Tlr7 toll-like receptor 7 https://www.infrafrontier.eu/search?keyword=EM:05500 ? EM:13790 Tikho, Atp2b2 EMMA sperm mutant strain Rasal2 Rasal2 MGI:2443881 Rasal2 RAS protein activator like 2 https://www.infrafrontier.eu/search?keyword=EM:13790 ? EM:13790 Tikho, Atp2b2 EMMA sperm mutant strain Atp2b2 Atp2b2 MGI:105368 Atp2b2 ATPase, Ca++ transporting, plasma membrane 2 https://www.infrafrontier.eu/search?keyword=EM:13790 ? EM:11920 tidflox/KD-UMCM line 5 EMMA sperm unclassified tid-floxed tid-floxed genomic tid locus https://www.infrafrontier.eu/search?keyword=EM:11920 ? EM:11922 tidflox-neo/KD-UMCM/tid+ line 7 EMMA sperm unclassified tid-floxed + neo-cassette frt flanked tid-floxed + neo-cassette frt flanked genomic tid locus https://www.infrafrontier.eu/search?keyword=EM:11922 ? EM:13465 TgVegfr3 EMMA embryo mutant strain Tg(Vegfr3) Tg(Vegfr3) Tg(Vegfr3) Tg(Vegfr3) https://www.infrafrontier.eu/search?keyword=EM:13465 ? EM:13465 TgVegfr3 EMMA sperm mutant strain Tg(Vegfr3) Tg(Vegfr3) Tg(Vegfr3) Tg(Vegfr3) https://www.infrafrontier.eu/search?keyword=EM:13465 ? EM:13463 TgSHANK2A(R462X) EMMA sperm mutant strain Tg(tet0nlacZ-SHANK2A(R462X))Rsp Tg(tet0nlacZ-SHANK2A(R462X))Rsp Tg(tet0nlacZ-SHANK2A(R462X))Rsp Tg(tet0nlacZ-SHANK2A(R462X))Rsp https://www.infrafrontier.eu/search?keyword=EM:13463 ? EM:13462 TgSHANK2A EMMA sperm mutant strain Tg(tet0nlacZ-SHANK2A_WT)Rsp Tg(tet0nlacZ-SHANK2A_WT)Rsp Tg(tet0nlacZ-SHANK2A_WT)Rsp Tg(tet0nlacZ-SHANK2A_WT)Rsp https://www.infrafrontier.eu/search?keyword=EM:13462 ? EM:14973 Tg(Zp3-creERT2)76.12.Ics EMMA embryo unclassified Tg(Zp3-creERT2)76.12.Ics Tg(Zp3-creERT2)76.12.Ics Tg(Zp3-creERT2)76.12.Ics https://www.infrafrontier.eu/search?keyword=EM:14973 ? EM:14972 Tg(UCP1-creERT2)56.11.Ics EMMA embryo unclassified Tg(UCP1-creERT2)56.11.Ics Tg(UCP1-creERT2)56.11.Ics Tg(UCP1-creERT2)56.11.Ics https://www.infrafrontier.eu/search?keyword=EM:14972 ? EM:14971 Tg(Tnni2-creERT2)42.16.Ics EMMA embryo unclassified Tg(Tnni2-creERT2)42.16.Ics Tg(Tnni2-creERT2)42.16.Ics Tg(Tnni2-creERT2)42.16.Ics https://www.infrafrontier.eu/search?keyword=EM:14971 ? EM:12397 Tg(T-cre)1Gos/Biat EMMA sperm mutant strain MGI:3811072 Tg(T-cre)1Gos transgene insertion 1, Achim Gossler MGI:3811067 Tg(T-cre)1Gos transgene insertion 1, Achim Gossler https://www.infrafrontier.eu/search?keyword=EM:12397 ? EM:14970 Tg(Sox2-CreERT2)194.34.Ics EMMA embryo unclassified Tg(Sox2-CreERT2)194.34.Ics Tg(Sox2-CreERT2)194.34.Ics Tg(Sox2-CreERT2)194.34.Ics https://www.infrafrontier.eu/search?keyword=EM:14970 ? EM:14969 Tg(Slc6a3-creERT2)69.41.Ics EMMA embryo unclassified Tg(Slc6a3-creERT2)69.41.Ics Tg(Slc6a3-creERT2)69.41.Ics Tg(Slc6a3-creERT2)69.41.Ics https://www.infrafrontier.eu/search?keyword=EM:14969 - EM:12659 Tg(ROSA26-LSL-SyGCaMP-WPRE)L4 EMMA sperm mutant strain MGI:6414618 Gt(ROSA)26Sor targeted mutation 1, Kate Hampden-Smith MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:12659 ? EM:14968 Tg(Ppm1a CreERT2)43.3.Ics EMMA embryo unclassified Tg(Ppm1a CreERT2)43.3.Ics Tg(Ppm1a CreERT2)43.3.Ics Tg(Ppm1a CreERT2)43.3.Ics https://www.infrafrontier.eu/search?keyword=EM:14968 ? EM:14967 Tg(Pgk2-creERT2)35.12.Ics EMMA embryo unclassified Tg(Pgk2-creERT2)35.12.Ics Tg(Pgk2-creERT2)35.12.Ics Tg(Pgk2-creERT2)35.12.Ics https://www.infrafrontier.eu/search?keyword=EM:14967 ? EM:14966 Tg(Pf4-creERT2)3.21.Ics EMMA embryo unclassified Tg(Pf4-creERT2)3.21.Ics Tg(Pf4-creERT2)3.21.Ics Tg(Pf4-creERT2)3.21.Ics https://www.infrafrontier.eu/search?keyword=EM:14966 ? EM:14965 Tg(Pet1-creERT2)21.4.Ics EMMA embryo unclassified Tg(Pet1-creERT2)21.4.Ics Tg(Pet1-creERT2)21.4.Ics Tg(Pet1-creERT2)21.4.Ics https://www.infrafrontier.eu/search?keyword=EM:14965 ? EM:14964 Tg(Pcp2-creERT2)17.8.Ics EMMA embryo unclassified Tg(Pcp2-creERT2)17.8.Ics Tg(Pcp2-creERT2)17.8.Ics Tg(Pcp2-creERT2)17.8.Ics https://www.infrafrontier.eu/search?keyword=EM:14964 ? EM:14963 Tg(Nes-creERT2)62.33.Ics EMMA embryo unclassified Tg(Nes-creERT2)62.33.Ics Tg(Nes-creERT2)62.33.Ics Tg(Nes-creERT2)62.33.Ics https://www.infrafrontier.eu/search?keyword=EM:14963 ? EM:14962 Tg(Nefl-creERT2)45.3.Ics EMMA embryo unclassified Tg(Nefl-creERT2)45.3.Ics Tg(Nefl-creERT2)45.3.Ics Tg(Nefl-creERT2)45.3.Ics https://www.infrafrontier.eu/search?keyword=EM:14962 ? EM:14961 Tg(Myh6-creERT2)12.8.Ics EMMA embryo unclassified Tg(Myh6-creERT2)12.8.Ics Tg(Myh6-creERT2)12.8.Ics Tg(Myh6-creERT2)12.8.Ics https://www.infrafrontier.eu/search?keyword=EM:14961 ? EM:14960 Tg(Lyzs-creERT2)26.19.Ics EMMA embryo unclassified Tg(Lyzs-creERT2)26.19.Ics Tg(Lyzs-creERT2)26.19.Ics Tg(Lyzs-creERT2)26.19.Ics https://www.infrafrontier.eu/search?keyword=EM:14960 ? EM:14959 Tg(Lck-creERT2)51.17.Ics EMMA embryo unclassified Tg(Lck-creERT2)51.17.Ics Tg(Lck-creERT2)51.17.Ics Tg(Lck-creERT2)51.17.Ics https://www.infrafrontier.eu/search?keyword=EM:14959 ? EM:14958 Tg(KRT5-creERT2)43.10.Ics EMMA embryo unclassified Tg(KRT5-creERT2)43.10.Ics Tg(KRT5-creERT2)43.10.Ics Tg(KRT5-creERT2)43.10.Ics https://www.infrafrontier.eu/search?keyword=EM:14958 ? EM:14957 Tg(Krt14-creERT2)2.11.Ics EMMA embryo unclassified Tg(Krt14-creERT2)2.11.Ics Tg(Krt14-creERT2)2.11.Ics Tg(Krt14-creERT2)2.11.Ics https://www.infrafrontier.eu/search?keyword=EM:14957 ? EM:14956 Tg(Krt10-creERT2)39.28.Ics EMMA embryo unclassified Tg(Krt10-creERT2)39.28.Ics Tg(Krt10-creERT2)39.28.Ics Tg(Krt10-creERT2)39.28.Ics https://www.infrafrontier.eu/search?keyword=EM:14956 ? EM:14955 Tg(Kap-CreERT2)64.9.Ics EMMA embryo unclassified Tg(Kap-CreERT2)64.9.Ics Tg(Kap-CreERT2)64.9.Ics Tg(Kap-CreERT2)64.9.Ics https://www.infrafrontier.eu/search?keyword=EM:14955 ? EM:14954 Tg(Ins1-CreERT2)16.7.Ics EMMA embryo unclassified Tg(Ins1-CreERT2)16.7.Ics Tg(Ins1-CreERT2)16.7.Ics Tg(Ins1-CreERT2)16.7.Ics https://www.infrafrontier.eu/search?keyword=EM:14954 ? EM:14953 Tg(Gp1ba-creERT2)28.21.Ics EMMA embryo unclassified Tg(Gp1ba-creERT2)28.21.Ics Tg(Gp1ba-creERT2)28.21.Ics Tg(Gp1ba-creERT2)28.21.Ics https://www.infrafrontier.eu/search?keyword=EM:14953 ? EM:14952 Tg(Ghrl-creERT2)107.2.Ics EMMA embryo unclassified Tg(Ghrl-creERT2)107.2.Ics Tg(Ghrl-creERT2)107.2.Ics Tg(Ghrl-creERT2)107.2.Ics https://www.infrafrontier.eu/search?keyword=EM:14952 ? EM:14951 Tg(Gcg-creERT2)151.3.Ics EMMA embryo unclassified Tg(Gcg-creERT2)151.3.Ics Tg(Gcg-creERT2)151.3.Ics Tg(Gcg-creERT2)151.3.Ics https://www.infrafrontier.eu/search?keyword=EM:14951 ? EM:14950 Tg(FABP4-creERT2)24.12/13.Ics EMMA embryo unclassified Tg(FABP4-creERT2)24.12/13.Ics Tg(FABP4-creERT2)24.12/13.Ics Tg(FABP4-creERT2)24.12/13.Ics https://www.infrafrontier.eu/search?keyword=EM:14950 ? EM:14949 Tg(Eno2-creERT2)122.19.Ics EMMA embryo unclassified Tg(Eno2-creERT2)122.19.Ics Tg(Eno2-creERT2)122.19.Ics Tg(Eno2-creERT2)122.19.Ics https://www.infrafrontier.eu/search?keyword=EM:14949 ? EM:14948 Tg(Dlk1-creERT2)26.10.Ics EMMA embryo unclassified Tg(Dlk1-creERT2)26.10.Ics Tg(Dlk1-creERT2)26.10.Ics Tg(Dlk1-creERT2)26.10.Ics https://www.infrafrontier.eu/search?keyword=EM:14948 ? EM:14947 Tg(Col1a1-creERT2)6.1.Ics EMMA embryo unclassified Tg(Col1a1-creERT2)6.1.Ics Tg(Col1a1-creERT2)6.1.Ics Tg(Col1a1-creERT2)6.1.Ics https://www.infrafrontier.eu/search?keyword=EM:14947 ? EM:14946 Tg(Cela1-creERT2)28.3.Ics EMMA embryo unclassified Tg(Cela1-creERT2)28.3.Ics Tg(Cela1-creERT2)28.3.Ics Tg(Cela1-creERT2)28.3.Ics https://www.infrafrontier.eu/search?keyword=EM:14946 ? EM:14945 Tg(Cd68-creERT2)31.11.Ics EMMA embryo unclassified Tg(Cd68-creERT2)31.11.Ics Tg(Cd68-creERT2)31.11.Ics Tg(Cd68-creERT2)31.11.Ics https://www.infrafrontier.eu/search?keyword=EM:14945 ? EM:14944 Tg(Cd4-creERT2)6.3/5.Ics EMMA embryo unclassified Tg(Cd4-creERT2)6.3/5.Ics Tg(Cd4-creERT2)6.3/5.Ics Tg(Cd4-creERT2)6.3/5.Ics https://www.infrafrontier.eu/search?keyword=EM:14944 ? EM:14943 Tg(CD19-creERT2)61.2.Ics EMMA embryo unclassified Tg(CD19-creERT2)61.2.Ics Tg(CD19-creERT2)61.2.Ics Tg(CD19-creERT2)61.2.Ics https://www.infrafrontier.eu/search?keyword=EM:14943 ? EM:14942 TG(CAMKIIa-creERT2)130.38.Ics EMMA embryo unclassified TG(CAMKIIa-creERT2)130.38.Ics TG(CAMKIIa-creERT2)130.38.Ics TG(CAMKIIa-creERT2)130.38.Ics https://www.infrafrontier.eu/search?keyword=EM:14942 ? EM:14941 Tg(CamkIIa-creERT2)127.29.Ics EMMA embryo unclassified Tg(CamkIIa-creERT2)127.29.Ics Tg(CamkIIa-creERT2)127.29.Ics Tg(CamkIIa-creERT2)127.29.Ics https://www.infrafrontier.eu/search?keyword=EM:14941 ? EM:14940 Tg(Bglap1-creERT2)26.3.Ics EMMA embryo unclassified Tg(Bglap1-creERT2)26.3.Ics Tg(Bglap1-creERT2)26.3.Ics Tg(Bglap1-creERT2)26.3.Ics https://www.infrafrontier.eu/search?keyword=EM:14940 ? EM:14939 Tg(ADIPOQ-creERT2)5.1.Ics EMMA embryo unclassified Tg(ADIPOQ-creERT2)5.1.Ics Tg(ADIPOQ-creERT2)5.1.Ics Tg(ADIPOQ-creERT2)5.1.Ics https://www.infrafrontier.eu/search?keyword=EM:14939 ? EM:14938 Tg(Acp5-creERT2)11.40.Ics EMMA embryo unclassified Tg(Acp5-creERT2)11.40.Ics Tg(Acp5-creERT2)11.40.Ics Tg(Acp5-creERT2)11.40.Ics https://www.infrafrontier.eu/search?keyword=EM:14938 + EM:02207 TFH/H EMMA embryo mutant strain MGI:1856184 T brachyury MGI:98472 T brachyury, T-box transcription factor T https://www.infrafrontier.eu/search?keyword=EM:02207 + EM:02207 TFH/H EMMA embryo mutant strain MGI:1857070 Itpr3 tufted MGI:96624 Itpr3 inositol 1,4,5-triphosphate receptor 3 https://www.infrafrontier.eu/search?keyword=EM:02207 ? EM:11139 TetohBCL-2 in FVB/N EMMA sperm mutant strain Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 https://www.infrafrontier.eu/search?keyword=EM:11139 ? EM:11140 TetohBCL-2 in C57BL/6 EMMA sperm mutant strain Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 Tg(tetO-BCL2)2.1 https://www.infrafrontier.eu/search?keyword=EM:11140 ? EM:13736 Tbx5 K339R cKI EMMA archived mutant strain TBX5 K339R (AAG to AGG) TBX5 K339R (AAG to AGG) MGI:102541 Tbx5 T-box 5 https://www.infrafrontier.eu/search?keyword=EM:13736 ? EM:12616 Tardbp RRM2mut (F210I) DBA EMMA sperm mutant strain MGI:6355454 Tardbp Riken Genomic Sciences Center 2268 MGI:2387629 Tardbp TAR DNA binding protein https://www.infrafrontier.eu/search?keyword=EM:12616 - EM:12615 Tardbp RRM2mut (F210I) B6 EMMA sperm B6J(D2)-Tardbp/RgscH mutant strain MGI:6355454 Tardbp Riken Genomic Sciences Center 2268 MGI:2387629 Tardbp TAR DNA binding protein https://www.infrafrontier.eu/search?keyword=EM:12615 ? EM:12614 Tardbp LCDmut (M323K) DBA EMMA sperm mutant strain MGI:6355456 Tardbp Riken Genomic Sciences Center 2223 MGI:2387629 Tardbp TAR DNA binding protein https://www.infrafrontier.eu/search?keyword=EM:12614 ? EM:12613 Tardbp LCDmut (M323K) B6 EMMA sperm mutant strain MGI:6355456 Tardbp Riken Genomic Sciences Center 2223 MGI:2387629 Tardbp TAR DNA binding protein https://www.infrafrontier.eu/search?keyword=EM:12613 ? EM:13074 Talin1 C-mutant EMMA embryo mutant strain Talin1 Talin1 MGI:1099832 Tln1 talin 1 https://www.infrafrontier.eu/search?keyword=EM:13074 + EM:01332 SY/HgIeg EMMA embryo Hertwig's syndactylism mutant strain MGI:1856182 sy shaker with syndactylism MGI:98457 sy shaker-with-syndactylism deletion region https://www.infrafrontier.eu/search?keyword=EM:01332 - EM:05790 STOCK Zkscan14/WtsiOrl EMMA sperm mutant strain MGI:4432778 Zkscan14 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914485 Zkscan14 zinc finger with KRAB and SCAN domains 14 https://www.infrafrontier.eu/search?keyword=EM:05790 ? EM:14065 STOCK Zfp382/WtsiOulu EMMA embryo mutant strain MGI:4362785 Zfp382 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3588204 Zfp382 zinc finger protein 382 https://www.infrafrontier.eu/search?keyword=EM:14065 ? EM:14065 STOCK Zfp382/WtsiOulu EMMA sperm mutant strain MGI:4362785 Zfp382 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3588204 Zfp382 zinc finger protein 382 https://www.infrafrontier.eu/search?keyword=EM:14065 + EM:11112 STOCK Yod1/H EMMA sperm mutant strain MGI:6473480 Yod1 targeted mutation 1a, National Laboratory Animal Center MGI:2442596 Yod1 YOD1 deubiquitinase https://www.infrafrontier.eu/search?keyword=EM:11112 + EM:02468 STOCK Xpo4/H EMMA sperm 3E, Xpo4 mutant strain MGI:5490885 Xpo4 gene trap mutation 3E, Katherine A Vallis MGI:1888526 Xpo4 exportin 4 https://www.infrafrontier.eu/search?keyword=EM:02468 + EM:01296 STOCK Whrn/H EMMA embryo wi mutant strain MGI:1857090 Whrn whirler MGI:2682003 Whrn whirlin https://www.infrafrontier.eu/search?keyword=EM:01296 + EM:01296 STOCK Whrn/H EMMA sperm wi mutant strain MGI:1857090 Whrn whirler MGI:2682003 Whrn whirlin https://www.infrafrontier.eu/search?keyword=EM:01296 + EM:05505 STOCK Vmp1/Ieg EMMA sperm STOCK Vmp1/Hmgu, VMP1 KO conv mutant strain MGI:6386775 Vmp1 targeted mutation 1.1, TaconicArtemis MGI:1923159 Vmp1 vacuole membrane protein 1 https://www.infrafrontier.eu/search?keyword=EM:05505 + EM:05506 STOCK Vmp1/Ieg EMMA embryo STOCK Vmp1/Hmgu, VMP1 KO cond mutant strain MGI:6386774 Vmp1 targeted mutation 1.1, TaconicArtemis MGI:1923159 Vmp1 vacuole membrane protein 1 https://www.infrafrontier.eu/search?keyword=EM:05506 + EM:04326 STOCK Vezt/Vezt/Orl EMMA embryo bi-loxP/null, Vezatin flox5/null mutant strain MGI:5749802 Vezt targeted mutation 1.2, Marie C Simmler MGI:2143698 Vezt vezatin, adherens junctions transmembrane protein https://www.infrafrontier.eu/search?keyword=EM:04326 + EM:04326 STOCK Vezt/Vezt/Orl EMMA embryo bi-loxP/null, Vezatin flox5/null mutant strain MGI:3618234 Vezt targeted mutation 1.1, Marie C Simmler MGI:2143698 Vezt vezatin, adherens junctions transmembrane protein https://www.infrafrontier.eu/search?keyword=EM:04326 + EM:10734 STOCK Vegfc/Oulu EMMA embryo CD1.Cg-Vegfc/Oulu mutant strain MGI:3026650 Vegfc targeted mutation 1, Kari Alitalo MGI:109124 Vegfc vascular endothelial growth factor C https://www.infrafrontier.eu/search?keyword=EM:10734 + EM:10734 STOCK Vegfc/Oulu EMMA sperm CD1.Cg-Vegfc/Oulu mutant strain MGI:3026650 Vegfc targeted mutation 1, Kari Alitalo MGI:109124 Vegfc vascular endothelial growth factor C https://www.infrafrontier.eu/search?keyword=EM:10734 + EM:08030 STOCK Vav2 Vav1/Cnbc EMMA embryo CD1;129-Vav2 Vav1/Cnbc mutant strain MGI:2387822 Vav2 targeted mutation 1, Klaus-Dieter Fischer MGI:102718 Vav2 vav 2 oncogene https://www.infrafrontier.eu/search?keyword=EM:08030 + EM:08030 STOCK Vav2 Vav1/Cnbc EMMA embryo CD1;129-Vav2 Vav1/Cnbc mutant strain MGI:2387840 Vav1 targeted mutation 2, Mariano Barbacid MGI:98923 Vav1 vav 1 oncogene https://www.infrafrontier.eu/search?keyword=EM:08030 + EM:00392 STOCK Utrn Dmd Tg(Ckm-Dmd*)11956Chmb/H EMMA sperm CVBA 3'/Utrophin+/-/mdx, CVBA mutant stock MGI:5140820 Tg(Ckm-Dmd*)11956Chmb transgene insertion 11956, Jeffrey S Chamberlain MGI:5140819 Tg(Ckm-Dmd*)11956Chmb transgene insertion 11956, Jeffrey S Chamberlain https://www.infrafrontier.eu/search?keyword=EM:00392 + EM:00392 STOCK Utrn Dmd Tg(Ckm-Dmd*)11956Chmb/H EMMA sperm CVBA 3'/Utrophin+/-/mdx, CVBA mutant stock MGI:2148589 Utrn targeted mutation 1, Kay E Davies MGI:104631 Utrn utrophin https://www.infrafrontier.eu/search?keyword=EM:00392 + EM:00392 STOCK Utrn Dmd Tg(Ckm-Dmd*)11956Chmb/H EMMA sperm CVBA 3'/Utrophin+/-/mdx, CVBA mutant stock MGI:1856328 Dmd X linked muscular dystrophy MGI:94909 Dmd dystrophin, muscular dystrophy https://www.infrafrontier.eu/search?keyword=EM:00392 ? EM:13683 STOCK Ulk1/H EMMA live mutant strain MGI:5006775 Ulk1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1270126 Ulk1 unc-51 like kinase 1 https://www.infrafrontier.eu/search?keyword=EM:13683 + EM:04767 STOCK Tyr/Tyr/Cnbc EMMA embryo albino Tyr NMR/Hsd mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:04767 + EM:04767 STOCK Tyr/Tyr/Cnbc EMMA embryo albino Tyr NMR/Hsd mutant strain MGI:2153771 Tyr albino deletion 32DSD, Oak Ridge MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:04767 + EM:04767 STOCK Tyr/Tyr/Cnbc EMMA sperm albino Tyr NMR/Hsd mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:04767 + EM:04767 STOCK Tyr/Tyr/Cnbc EMMA sperm albino Tyr NMR/Hsd mutant strain MGI:2153771 Tyr albino deletion 32DSD, Oak Ridge MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:04767 + EM:06054 STOCK Tyr Tg(Tyr)YRT3Lmon/Cnbc EMMA embryo Stock HsdWin:NMRI;B6CBA-Tg(Tyr)YRT3/Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06054 + EM:06054 STOCK Tyr Tg(Tyr)YRT3Lmon/Cnbc EMMA embryo Stock HsdWin:NMRI;B6CBA-Tg(Tyr)YRT3/Lmon mutant strain MGI:6202731 Tg(Tyr)YRT3Lmon transgene insertion YRT3, Lluis Montoliu MGI:6202729 Tg(Tyr)YRT3Lmon transgene insertion YRT3, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:06054 + EM:06085 STOCK Tyr Gpr143/Cnbc EMMA embryo HsdWin:NMRI;B6N.129-Gpr143/Cnbc mutant strain MGI:1931862 Gpr143 targeted mutation 1, Barbara Incerti MGI:107193 Gpr143 G protein-coupled receptor 143 https://www.infrafrontier.eu/search?keyword=EM:06085 + EM:06085 STOCK Tyr Gpr143/Cnbc EMMA embryo HsdWin:NMRI;B6N.129-Gpr143/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06085 + EM:06085 STOCK Tyr Gpr143/Cnbc EMMA sperm HsdWin:NMRI;B6N.129-Gpr143/Cnbc mutant strain MGI:1931862 Gpr143 targeted mutation 1, Barbara Incerti MGI:107193 Gpr143 G protein-coupled receptor 143 https://www.infrafrontier.eu/search?keyword=EM:06085 + EM:06085 STOCK Tyr Gpr143/Cnbc EMMA sperm HsdWin:NMRI;B6N.129-Gpr143/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06085 + EM:04764 STOCK Tyr/Cnbc EMMA embryo Tyr "chinchilla mottled":NMRI/Hsd mutant strain MGI:1855980 Tyr chinchilla mottled MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:04764 + EM:04764 STOCK Tyr/Cnbc EMMA embryo Tyr "chinchilla mottled":NMRI/Hsd mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:04764 + EM:04769 STOCK Tyr/Cnbc EMMA embryo Tyr "extreme dilution mottled":NMRI/Hsd mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:04769 + EM:04769 STOCK Tyr/Cnbc EMMA embryo Tyr "extreme dilution mottled":NMRI/Hsd mutant strain MGI:2683485 Tyr extreme dilution mottled MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:04769 - EM:10879 STOCK Tubb6/H EMMA sperm mutant strain MGI:4458679 Tubb6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915201 Tubb6 tubulin, beta 6 class V https://www.infrafrontier.eu/search?keyword=EM:10879 + EM:10543 STOCK Tubb5/Biat EMMA sperm STOCK Tubb5/Biat mutant strain MGI:6119464 Tubb5 targeted mutation 2.1, David A Keays MGI:107812 Tubb5 tubulin, beta 5 class I https://www.infrafrontier.eu/search?keyword=EM:10543 + EM:10542 STOCK Tubb5/Biat EMMA sperm STOCK Tubb5/Biat mutant strain MGI:6119463 Tubb5 targeted mutation 1.1, David A Keays MGI:107812 Tubb5 tubulin, beta 5 class I https://www.infrafrontier.eu/search?keyword=EM:10542 + EM:07317 STOCK Trpm1/H EMMA sperm mutant strain MGI:5287780 Trpm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1330305 Trpm1 transient receptor potential cation channel, subfamily M, member 1 https://www.infrafrontier.eu/search?keyword=EM:07317 + EM:01788 STOCK Trp53 Tg(Wap-HBx)1Gmn/Kctt EMMA embryo mutant stock MGI:1857590 Trp53 targeted mutation 1, Allan Bradley MGI:98834 Trp53 transformation related protein 53 https://www.infrafrontier.eu/search?keyword=EM:01788 + EM:01788 STOCK Trp53 Tg(Wap-HBx)1Gmn/Kctt EMMA embryo mutant stock MGI:5312872 Tg(Wap-HBx)1Gmn transgene insertion 1, Marianne Bruggemann MGI:5312861 Tg(Wap-HBx)1Gmn transgene insertion 1, Marianne Bruggemann https://www.infrafrontier.eu/search?keyword=EM:01788 + EM:10456 STOCK Trmt1/Ics EMMA sperm HEPD0743_6_A06, G4648 mutant strain MGI:5085360 Trmt1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1289155 Trmt1 tRNA methyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:10456 + EM:10456 STOCK Trmt1/Ics EMMA live HEPD0743_6_A06, G4648 mutant strain MGI:5085360 Trmt1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1289155 Trmt1 tRNA methyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:10456 + EM:05824 STOCK Tpm1/WtsiH EMMA embryo EPD0001_3_G07, 129S/SvEvBrd-Tpm1/WtsiH, 129-Tpm1/WtsiH mutant strain MGI:4842867 Tpm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98809 Tpm1 tropomyosin 1, alpha https://www.infrafrontier.eu/search?keyword=EM:05824 + EM:07457 STOCK Tox3/Orl EMMA sperm B6N.Cg-Tox3/Orl mutant strain MGI:6119413 Tox3 targeted mutation 1d, Mouse Biology Program, UCDavis MGI:3039593 Tox3 TOX high mobility group box family member 3 https://www.infrafrontier.eu/search?keyword=EM:07457 + EM:11023 STOCK Tnfrsf1a Tg(Tnf)6074Gkl/Flmg EMMA embryo mutant strain MGI:3766101 Tg(Tnf)6074Gkl transgene insertion 6074, George Kollias MGI:3766128 Tg(Tnf)6074Gkl transgene insertion 6074, George Kollias https://www.infrafrontier.eu/search?keyword=EM:11023 + EM:11023 STOCK Tnfrsf1a Tg(Tnf)6074Gkl/Flmg EMMA embryo mutant strain MGI:1861040 Tnfrsf1a targeted mutation 1, Horst Bluethmann MGI:1314884 Tnfrsf1a tumor necrosis factor receptor superfamily, member 1a https://www.infrafrontier.eu/search?keyword=EM:11023 + EM:08444 STOCK Tnfrsf1a Tg(Gfap-TNF*)K21Gkl/Flmg EMMA embryo CBA;B6-Tnfrsf1a Tg(Gfap-TNF*)K21Gkl/Flmg, TgK21 mutant strain MGI:1861040 Tnfrsf1a targeted mutation 1, Horst Bluethmann MGI:1314884 Tnfrsf1a tumor necrosis factor receptor superfamily, member 1a https://www.infrafrontier.eu/search?keyword=EM:08444 + EM:08444 STOCK Tnfrsf1a Tg(Gfap-TNF*)K21Gkl/Flmg EMMA embryo CBA;B6-Tnfrsf1a Tg(Gfap-TNF*)K21Gkl/Flmg, TgK21 mutant strain MGI:3766134 Tg(Gfap-TNF*)K21Gkl transgene insertion K21, George Kollias MGI:3766211 Tg(Gfap-TNF*)K21Gkl transgene insertion K21, George Kollias https://www.infrafrontier.eu/search?keyword=EM:08444 + EM:08448 STOCK Tnfrsf1a Tg(CD2/HBB-TNF*)5453Gkl/Flmg EMMA embryo Tg5453, CBA;B6-Tnfrsf1atm1Blt Tg(CD2/HBB-TNF*)5453Gkl /Flmg] mutant strain MGI:4818268 Tg(CD2/HBB-TNF*)5453Gkl transgene insertion 5453, George Kollias MGI:4818262 Tg(CD2/HBB-TNF*)5453Gkl transgene insertion 5453, George Kollias https://www.infrafrontier.eu/search?keyword=EM:08448 + EM:08448 STOCK Tnfrsf1a Tg(CD2/HBB-TNF*)5453Gkl/Flmg EMMA embryo Tg5453, CBA;B6-Tnfrsf1atm1Blt Tg(CD2/HBB-TNF*)5453Gkl /Flmg] mutant strain MGI:1861040 Tnfrsf1a targeted mutation 1, Horst Bluethmann MGI:1314884 Tnfrsf1a tumor necrosis factor receptor superfamily, member 1a https://www.infrafrontier.eu/search?keyword=EM:08448 ? EM:13831 STOCK Tnfrsf19/Ieg EMMA sperm mutant strain MGI:5613002 Tnfrsf19 targeted mutation 1.1, Hans Clevers MGI:1352474 Tnfrsf19 tumor necrosis factor receptor superfamily, member 19 https://www.infrafrontier.eu/search?keyword=EM:13831 + EM:09860 STOCK Tmprss4/Ph EMMA sperm mutant strain MGI:5806229 Tmprss4 targeted mutation 1.1, Edith Hummler MGI:2384877 Tmprss4 transmembrane protease, serine 4 https://www.infrafrontier.eu/search?keyword=EM:09860 + EM:01908 STOCK Tmem98/H EMMA embryo GENA246, Retinal White Spots, STOCK Rwhs/H, C3H;C-Rwhs/H mutant stock MGI:2178433 Tmem98 retinal white spots MGI:1923457 Tmem98 transmembrane protein 98 https://www.infrafrontier.eu/search?keyword=EM:01908 + EM:00386 STOCK Tmc1/WtsiH EMMA sperm Dn mutant strain MGI:1856845 Tmc1 deafness MGI:2151016 Tmc1 transmembrane channel-like gene family 1 https://www.infrafrontier.eu/search?keyword=EM:00386 + EM:01894 STOCK Tm26/H EMMA sperm TM/26 mutant strain MGI:5752830 Tm26 mutant Tm26 MGI:5752827 Tm26 mutant Tm26 https://www.infrafrontier.eu/search?keyword=EM:01894 ? EM:13685 STOCK Tll1/H EMMA live mutant strain MGI:4842415 Tll1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106923 Tll1 tolloid-like https://www.infrafrontier.eu/search?keyword=EM:13685 + EM:10790 STOCK Tie1/Oulu EMMA embryo Crl:CD1-Tie1/Oulu, Tie1/LacZ (CD1/ICR) mutant strain MGI:2159370 Tie1 targeted mutation 1, Juha Partanen MGI:99906 Tie1 tyrosine kinase with immunoglobulin-like and EGF-like domains 1 https://www.infrafrontier.eu/search?keyword=EM:10790 + EM:10790 STOCK Tie1/Oulu EMMA sperm Crl:CD1-Tie1/Oulu, Tie1/LacZ (CD1/ICR) mutant strain MGI:2159370 Tie1 targeted mutation 1, Juha Partanen MGI:99906 Tie1 tyrosine kinase with immunoglobulin-like and EGF-like domains 1 https://www.infrafrontier.eu/search?keyword=EM:10790 + EM:04369 STOCK Thra/Kctt EMMA embryo TRa1-GFP(ven), B6NCrl;129P2-Thra/Kctt mutant strain MGI:4847930 Thra targeted mutation 4.1, Bjorn Vennstrom MGI:98742 Thra thyroid hormone receptor alpha https://www.infrafrontier.eu/search?keyword=EM:04369 - EM:07517 STOCK Tgfb1i1/WtsiOrl EMMA sperm B6NTac;B6N-A Tgfb1i1/WtsiOrl mutant strain MGI:5050851 Tgfb1i1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102784 Tgfb1i1 transforming growth factor beta 1 induced transcript 1 https://www.infrafrontier.eu/search?keyword=EM:07517 ? EM:10544 STOCK Tg(Tubb5-EGFP)1Dak/Biat EMMA sperm mutant strain MGI:6330725 Tg(Tubb5-EGFP)1Dak transgene insertion 1, David A Keays MGI:6330724 Tg(Tubb5-EGFP)1Dak transgene insertion 1, David A Keays https://www.infrafrontier.eu/search?keyword=EM:10544 + EM:09494 STOCK Tg(Ttr-SMYD3)1Ital/Flmg EMMA embryo B6.CBA-Tg(Ttr-SMYD3)1Ital/Flmg mutant strain MGI:5749481 Tg(Ttr-SMYD3)1Ital transgene insertion 1, Iannis Talianidis MGI:5749480 Tg(Ttr-SMYD3)1Ital transgene insertion 1, Iannis Talianidis https://www.infrafrontier.eu/search?keyword=EM:09494 ? EM:09469 STOCK Tg(Ttr-SETD7*H297A)1Ital/Flmg EMMA embryo mutant strain Tg(Ttr-SETD7*H297A)1Ital Tg(Ttr-SETD7*H297A)1Ital Tg(Ttr-SETD7*H297A)1Ital Tg(Ttr-SETD7*H297A)1Ital https://www.infrafrontier.eu/search?keyword=EM:09469 ? EM:09468 STOCK Tg(Ttr-SETD7)1Ital/Flmg EMMA embryo mutant strain Tg(Ttr-SETD7)1Ital Tg(Ttr-SETD7)1Ital Tg(Ttr-SETD7)1Ital Tg(Ttr-SETD7)1Ital https://www.infrafrontier.eu/search?keyword=EM:09468 + EM:09491 STOCK Tg(Ttr-NR0B2)1Ital/Flmg EMMA embryo B6.CBA-Tg(Ttr-NR0B2)1Ital/Flmg mutant strain MGI:5645742 Tg(Ttr-NR0B2)1Ital transgene insertion 1, Iannis Talianidis MGI:5645741 Tg(Ttr-NR0B2)1Ital transgene insertion 1, Iannis Talianidis https://www.infrafrontier.eu/search?keyword=EM:09491 + EM:08377 STOCK Tg(TNFRSF1B)1334Gkl/Flmg EMMA sperm CBA.B6-Tg(TNFRSF1B)1334Gkl mutant strain MGI:5645560 Tg(TNFRSF1B)1334Gkl transgene insertion 1334, George Kollias MGI:5645558 Tg(TNFRSF1B)1334Gkl transgene insertion 1334, George Kollias https://www.infrafrontier.eu/search?keyword=EM:08377 + EM:08366 STOCK Tg(Tnf*)A86Gkl/Flmg EMMA sperm CBA.B6-Tg(Tnf*)A86Gkl/Flmg mutant strain MGI:3766228 Tg(Tnf*)A86Gkl transgene insertion A86, George Kollias MGI:3766240 Tg(Tnf*)A86Gkl transgene insertion A86, George Kollias https://www.infrafrontier.eu/search?keyword=EM:08366 + EM:10595 STOCK Tg(tetO-Pax4,-DsRed)/Cnbc EMMA embryo mutant strain Tg(tetO-Pax4,-DsRed) Tg(tetO-Pax4,-DsRed) Tg(tetO-Pax4,-DsRed) Tg(tetO-Pax4,-DsRed) https://www.infrafrontier.eu/search?keyword=EM:10595 + EM:10595 STOCK Tg(tetO-Pax4,-DsRed)/Cnbc EMMA sperm mutant strain Tg(tetO-Pax4,-DsRed) Tg(tetO-Pax4,-DsRed) Tg(tetO-Pax4,-DsRed) Tg(tetO-Pax4,-DsRed) https://www.infrafrontier.eu/search?keyword=EM:10595 ? EM:10596 STOCK Tg(tetO-Pax4*,-DsRed)/Cnbc EMMA sperm mutant strain Tg(tetO-Pax4*,-DsRed) Tg(tetO-Pax4*,-DsRed) Tg(tetO-Pax4*,-DsRed) Tg(tetO-Pax4*,-DsRed) https://www.infrafrontier.eu/search?keyword=EM:10596 + EM:04643 STOCK Tg(tetO-AGTR1,-lacZ)1Aco/Cnbc EMMA sperm ZhAT1Rwt1 mutant strain MGI:5648216 Tg(tetO-AGTR1,-lacZ)1Aco transgene insertion 1, Justin Ainscough MGI:5648215 Tg(tetO-AGTR1,-lacZ)1Aco transgene insertion 1, Justin Ainscough https://www.infrafrontier.eu/search?keyword=EM:04643 + EM:04761 STOCK Tg(tetO-AGTR1*N111G,-lacZ)1Aco/Cnbc EMMA embryo ZhAT1Rmut2 mutant strain MGI:5648211 Tg(tetO-AGTR1*N111G,-lacZ)1Aco transgene insertion 1, Justin Ainscough MGI:5648210 Tg(tetO-AGTR1*N111G,-lacZ)1Aco transgene insertion 1, Justin Ainscough https://www.infrafrontier.eu/search?keyword=EM:04761 + EM:04761 STOCK Tg(tetO-AGTR1*N111G,-lacZ)1Aco/Cnbc EMMA sperm ZhAT1Rmut2 mutant strain MGI:5648211 Tg(tetO-AGTR1*N111G,-lacZ)1Aco transgene insertion 1, Justin Ainscough MGI:5648210 Tg(tetO-AGTR1*N111G,-lacZ)1Aco transgene insertion 1, Justin Ainscough https://www.infrafrontier.eu/search?keyword=EM:04761 + EM:10853 STOCK Tg(Sox2-cre/ERT2)1Skn/Cnrm EMMA embryo mutant strain MGI:4397776 Tg(Sox2-cre/ERT2)1Skn transgene insertion 1, Silvia K Nicolis MGI:4397777 Tg(Sox2-cre/ERT2)1Skn transgene insertion 1, Silvia K Nicolis https://www.infrafrontier.eu/search?keyword=EM:10853 + EM:10853 STOCK Tg(Sox2-cre/ERT2)1Skn/Cnrm EMMA sperm mutant strain MGI:4397776 Tg(Sox2-cre/ERT2)1Skn transgene insertion 1, Silvia K Nicolis MGI:4397777 Tg(Sox2-cre/ERT2)1Skn transgene insertion 1, Silvia K Nicolis https://www.infrafrontier.eu/search?keyword=EM:10853 + EM:07154 STOCK Tg(Sox2-Bgeo)1Skn/Cnrm EMMA embryo Sox2 beta-geo telencephalic transgen mutant strain MGI:5700640 Tg(Sox2-Bgeo)1Skn transgene insertion 1, Silvia K Nicolis MGI:5700566 Tg(Sox2-Bgeo)1Skn transgene insertion 1, Silvia K Nicolis https://www.infrafrontier.eu/search?keyword=EM:07154 + EM:07154 STOCK Tg(Sox2-Bgeo)1Skn/Cnrm EMMA sperm Sox2 beta-geo telencephalic transgen mutant strain MGI:5700640 Tg(Sox2-Bgeo)1Skn transgene insertion 1, Silvia K Nicolis MGI:5700566 Tg(Sox2-Bgeo)1Skn transgene insertion 1, Silvia K Nicolis https://www.infrafrontier.eu/search?keyword=EM:07154 + EM:02604 STOCK Tg(Prnp/PRNP*ARR)FM18Pcg/H EMMA sperm Tg(OvPrP)FM18, STOCK Prnp Tg(Prnp/PRNP*ARR)FM18Pcg/H mutant strain MGI:5779521 Tg(Prnp/PRNP*ARR)FM18Pcg trangene insertion FM18, Peter Griffiths MGI:5779520 Tg(Prnp/PRNP*ARR)FM18Pcg trangene insertion FM18, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:02604 - EM:04337 STOCK Tg(Prnp/PRNP*ARR)FF8Pcg/H EMMA embryo mutant strain MGI:5779525 Tg(Prnp/PRNP*ARR)FF8Pcg transgene insertion FF8, Peter Griffiths MGI:5779524 Tg(Prnp/PRNP*ARR)FF8Pcg transgene insertion FF8, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:04337 - EM:02615 STOCK Tg(Prnp/PRNP*AHQ)EM52Pcg/H EMMA embryo mutant strain MGI:5776255 Tg(Prnp/PRNP*AHQ)EM52Pcg transgene insertion EM52, Peter Griffiths MGI:5776254 Tg(Prnp/PRNP*AHQ)EM52Pcg transgene insertion EM52, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:02615 - EM:04339 STOCK Tg(Prnp/PRNP*AHQ)EM16Pcg/H EMMA embryo mutant strain MGI:5776247 Tg(Prnp/PRNP*AHQ)EM16Pcg transgene insertion EM16, Peter Griffiths MGI:5776244 Tg(Prnp/PRNP*AHQ)EM16Pcg transgene insertion EM16, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:04339 - EM:04554 STOCK Tg(Prnp/PRNP*AHQ)EF50Pcg/H EMMA embryo mutant strain MGI:5776258 Tg(Prnp/PRNP*AHQ)EF50Pcg transgene insertion EM50, Peter Griffiths MGI:5776257 Tg(Prnp/PRNP*AHQ)EF50Pcg transgene insertion EM50, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:04554 + EM:02501 STOCK Tg(Prnp-SMN)92Ahmb/H EMMA sperm PrP : fl-SMN mutant strain MGI:3774945 Tg(Prnp-SMN)92Ahmb transgene insertion 92, Arthur H M Burghes MGI:3774942 Tg(Prnp-SMN)92Ahmb transgene insertion 92, Arthur H M Burghes https://www.infrafrontier.eu/search?keyword=EM:02501 + EM:02538 STOCK Tg(Prnp-PRNP*6OR)K6M6Pcg/H EMMA embryo STOCK Tg(PRNP*)K6M6Pcg/Pcg, Tg(KuPrP)K6M6 mutant strain MGI:5775412 Tg(Prnp-PRNP*6OR)K6M6Pcg transgene insertion K6M6, Peter Griffiths MGI:5775410 Tg(Prnp-PRNP*6OR)K6M6Pcg transgene insertion K6M6, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:02538 + EM:02504 STOCK Tg(Prnp-HSPB1)PPks/H EMMA archived HSP27 WT PrP Promoter line, PRP-HSP27-WT mutant strain MGI:5775105 Tg(Prnp-HSPB1)PPks transgene insertion P, Nick Parkinson MGI:5775104 Tg(Prnp-HSPB1)PPks transgene insertion P, Nick Parkinson https://www.infrafrontier.eu/search?keyword=EM:02504 - EM:02600 STOCK Tg(PRNP)2019Pcg/H EMMA embryo mutant strain MGI:5775986 Tg(PRNP)2019Pcg transgene insertion 2019, Peter Griffiths MGI:5775985 Tg(PRNP)2019Pcg transgene insertion 2019, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:02600 - EM:02588 STOCK Tg(PRNP)2010Pcg/H EMMA embryo mutant strain MGI:5775933 Tg(PRNP)2010Pcg transgene insertion 2010, Peter Griffiths MGI:5775932 Tg(PRNP)2010Pcg transgene insertion 2010, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:02588 - EM:02537 STOCK Tg(PRNP)1896Pcg/H EMMA embryo mutant strain MGI:5775352 Tg(PRNP)1896Pcg transgene insertion 1896, Peter Griffiths MGI:5775349 Tg(PRNP)1896Pcg transgene insertion 1896, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:02537 + EM:02517 STOCK Tg(Prm-cre)58Og/H EMMA embryo Pro Cre, STOCK Tg(Prm-cre)58Og, Pro-Cre mutant strain MGI:2176182 Tg(Prm-cre)58Og transgene insertion 58, Stephen O'Gorman MGI:2176181 Tg(Prm-cre)58Og transgene insertion 58, Stephen O'Gorman https://www.infrafrontier.eu/search?keyword=EM:02517 + EM:01344 STOCK Tg(PDGFRA-lacZ)2.2-07Nist/Kctt EMMA archived PDGFRAprom-2.2-lacZ-0.7, MNI-3 mutant strain MGI:5305726 Tg(PDGFRA-lacZ)2.2-07Nist transgene insertion 2.2-07, Monica Nister MGI:5305724 Tg(PDGFRA-lacZ)2.2-07Nist transgene insertion 2.2-07, Monica Nister https://www.infrafrontier.eu/search?keyword=EM:01344 + EM:04365 STOCK Tg(Myh6-tTA)6Smbf/Cnrm EMMA embryo alphaMHC-tTA, STOCK Tg(Myh6-tTA)6Smbf/Ibcm, FVB;B6CBF1-Tg(Myh6-tTA)6Smbf/Ibcm mutant strain MGI:2665551 Tg(Myh6-tTA)6Smbf transgene insertion 6, Section of Myocardial Biology - Fishman Lab MGI:2665552 Tg(Myh6-tTA)6Smbf transgene insertion 6, Section of Myocardial Biology - Fishman Lab https://www.infrafrontier.eu/search?keyword=EM:04365 + EM:04989 STOCK Tg(Myh6-tTA)6Smbf Tg(tetO-Hgf,-EGFP)24Tcre/Cnrm EMMA embryo Hgf-TetO-GFP x alphaMHC-tTA mutant strain MGI:2665551 Tg(Myh6-tTA)6Smbf transgene insertion 6, Section of Myocardial Biology - Fishman Lab MGI:2665552 Tg(Myh6-tTA)6Smbf transgene insertion 6, Section of Myocardial Biology - Fishman Lab https://www.infrafrontier.eu/search?keyword=EM:04989 + EM:04989 STOCK Tg(Myh6-tTA)6Smbf Tg(tetO-Hgf,-EGFP)24Tcre/Cnrm EMMA embryo Hgf-TetO-GFP x alphaMHC-tTA mutant strain MGI:5648118 Tg(tetO-Hgf,-EGFP)24Tcre transgene insertion 24, Tiziana Crepaldi MGI:5648117 Tg(tetO-Hgf,-EGFP)24Tcre transgene insertion 24, Tiziana Crepaldi https://www.infrafrontier.eu/search?keyword=EM:04989 + EM:02188 STOCK Tg(MSR1)3Winth/Cnrm EMMA embryo MSR1 mutant strain MGI:5648236 Tg(MSR1)3Winth transgene insertion 3, Menno de Winther MGI:5648235 Tg(MSR1)3Winth transgene insertion 3, Menno de Winther https://www.infrafrontier.eu/search?keyword=EM:02188 ? EM:11142 STOCK Tg(MMTVtTA)1Mam/Orl EMMA sperm mutant strain MGI:3053958 Tg(MMTVtTA)1Mam transgene insertion 1, Lothar Hennighausen MGI:3053971 Tg(MMTVtTA)1Mam transgene insertion 1, Lothar Hennighausen https://www.infrafrontier.eu/search?keyword=EM:11142 + EM:01362 STOCK Tg(MMTV-Prlr)3Eder/Orl EMMA embryo MMTV-F3 mutant strain MGI:5304928 Tg(MMTV-Prlr)3Eder transgene insertion 3, Marc Edery MGI:5304921 Tg(MMTV-Prlr)3Eder transgene insertion 3, Marc Edery https://www.infrafrontier.eu/search?keyword=EM:01362 + EM:00134 STOCK Tg(Mbp-PDGFB)90Ubc/Kieg EMMA embryo MBP-PDGF B, KFN-1, STOCK Tg(Mbp-PDGFB)90Ubc/Ubc mutant stock MGI:3044166 Tg(Mbp-PDGFB)90Ubc transgene insertion 90, Uppsala University MGI:3044165 Tg(Mbp-PDGFB)90Ubc transgene insertion 90, Uppsala University https://www.infrafrontier.eu/search?keyword=EM:00134 + EM:04971 STOCK Tg(LYZ-rtTA2S*M2,tetO-ELAVL1)632Dkon/Flmg EMMA embryo STOCK Tg(LYS2-rtTA2S*M2;tetO-ELAVL1)632Dkon/Flmg, TgLrT-HAHuRL.632 mutant strain MGI:5429340 Tg(LYZ-rtTA2S*M2,tetO-ELAVL1)632Dkon transgene insertion 632, Dimitris Kontoyiannis MGI:5429341 Tg(LYZ-rtTA2S*M2,tetO-ELAVL1)632Dkon transgene insertion 632, Dimitris Kontoyiannis https://www.infrafrontier.eu/search?keyword=EM:04971 + EM:04971 STOCK Tg(LYZ-rtTA2S*M2,tetO-ELAVL1)632Dkon/Flmg EMMA sperm STOCK Tg(LYS2-rtTA2S*M2;tetO-ELAVL1)632Dkon/Flmg, TgLrT-HAHuRL.632 mutant strain MGI:5429340 Tg(LYZ-rtTA2S*M2,tetO-ELAVL1)632Dkon transgene insertion 632, Dimitris Kontoyiannis MGI:5429341 Tg(LYZ-rtTA2S*M2,tetO-ELAVL1)632Dkon transgene insertion 632, Dimitris Kontoyiannis https://www.infrafrontier.eu/search?keyword=EM:04971 + EM:01916 STOCK Tg(Lck-AVEN)1Zrng/Ieg EMMA embryo Tg(Lck-Aven), lck Aven mutant stock MGI:5317419 Tg(Lck-AVEN)1Zrng transgene insertion 1, Martin Zoernig MGI:5317418 Tg(Lck-AVEN)1Zrng transgene insertion 1, Martin Zoernig https://www.infrafrontier.eu/search?keyword=EM:01916 + EM:02189 STOCK Tg(ITGAM-PLA2G2A)1Winth/Cnrm EMMA embryo sPLA2 mutant strain MGI:5648230 Tg(ITGAM-PLA2G2A)1Winth transgene insertion 1, Menno de Winther MGI:5648228 Tg(ITGAM-PLA2G2A)1Winth transgene insertion 1, Menno de Winther https://www.infrafrontier.eu/search?keyword=EM:02189 + EM:02113 STOCK Tg(HSE-EYFP)1Mklv/Kieg EMMA embryo HiShoMice mutant strain MGI:5573168 Tg(HSE-EYFP)1Mklv transgene insertion 1, Andrey Mikhailov MGI:5573167 Tg(HSE-EYFP)1Mklv transgene insertion 1, Andrey Mikhailov https://www.infrafrontier.eu/search?keyword=EM:02113 - EM:05282 STOCK Tg(H2K-lacZ)1Cba/Orl EMMA embryo B6CBA-Tg(H2K-lacZ)1Cba/Orl, H-2Z1 mutant strain MGI:5645898 Tg(H2K-lacZ)1Cba transgene insertion 1, Charles Babinet MGI:5645897 Tg(H2K-lacZ)1Cba transgene insertion 1, Charles Babinet https://www.infrafrontier.eu/search?keyword=EM:05282 + EM:07149 STOCK Tg(H2-K1-Ifnb1)10Seif Ifnar1/Orl EMMA embryo STOCK Ifnar1 Tg(H2-K1-Ifnb1)10Seif/Orl, Ifnar1tm1Agt/Ifnar1tm1Agt Tg(H2-K1-Ifnb1)10Seif/Tg(H2- K1-Ifnb1)10Seif mutant strain MGI:1930950 Ifnar1 targeted mutation 1, Michel Aguet MGI:107658 Ifnar1 interferon (alpha and beta) receptor 1 https://www.infrafrontier.eu/search?keyword=EM:07149 + EM:07149 STOCK Tg(H2-K1-Ifnb1)10Seif Ifnar1/Orl EMMA embryo STOCK Ifnar1 Tg(H2-K1-Ifnb1)10Seif/Orl, Ifnar1tm1Agt/Ifnar1tm1Agt Tg(H2-K1-Ifnb1)10Seif/Tg(H2- K1-Ifnb1)10Seif mutant strain MGI:5141611 Tg(H2-K1-Ifnb1)10Seif transgene insertion 10, Isabelle Seif MGI:5141625 Tg(H2-K1-Ifnb1)10Seif transgene insertion 10, Isabelle Seif https://www.infrafrontier.eu/search?keyword=EM:07149 + EM:05237 STOCK Tg(Gfap-Pten*)6Rpm/Cnbc EMMA embryo GL1 GFAP-Pten qma mutant strain MGI:5795663 Tg(Gfap-PTEN*)6Rpm transgene insertion 6, Rafael Pulido MGI:5795659 Tg(Gfap-PTEN*)6Rpm transgene insertion 6, Rafael Pulido https://www.infrafrontier.eu/search?keyword=EM:05237 + EM:05237 STOCK Tg(Gfap-Pten*)6Rpm/Cnbc EMMA sperm GL1 GFAP-Pten qma mutant strain MGI:5795663 Tg(Gfap-PTEN*)6Rpm transgene insertion 6, Rafael Pulido MGI:5795659 Tg(Gfap-PTEN*)6Rpm transgene insertion 6, Rafael Pulido https://www.infrafrontier.eu/search?keyword=EM:05237 + EM:01347 STOCK Tg(GFAP-lacZ)9Nist/Kctt EMMA embryo hGFAPprom-LacZ line9, MNI-4 mutant strain MGI:5305741 Tg(GFAP-lacZ)9Nist transgene insertion 9, Monica Nister MGI:5305740 Tg(GFAP-lacZ)9Nist transgene insertion 9, Monica Nister https://www.infrafrontier.eu/search?keyword=EM:01347 + EM:01347 STOCK Tg(GFAP-lacZ)9Nist/Kctt EMMA live hGFAPprom-LacZ line9, MNI-4 mutant strain MGI:5305741 Tg(GFAP-lacZ)9Nist transgene insertion 9, Monica Nister MGI:5305740 Tg(GFAP-lacZ)9Nist transgene insertion 9, Monica Nister https://www.infrafrontier.eu/search?keyword=EM:01347 + EM:05989 STOCK Tg(Frzb-cre)1Tylz/Orl EMMA embryo Tg(Frzb-cre)1Tylz mutant strain MGI:3527940 Tg(Frzb-cre)1Tylz transgene insertion 1, Przemko Tylzanowski MGI:3527938 Tg(Frzb-cre)1Tylz transgene insertion 1, Przemko Tylzanowski https://www.infrafrontier.eu/search?keyword=EM:05989 + EM:01133 STOCK Tg(Fabp1-cre)1Jig/JigCnrm EMMA embryo Fabp1-Cre, STOCK Tg(Fabp1-cre)1Jig, STOCK Tg(Fabp1-cre)1Jig/JigIbcm, Fabpl-Cre mutant stock MGI:2447212 Tg(Fabp1-cre)1Jig transgene insertion 1, Jeffrey I Gordon MGI:2447210 Tg(Fabp1-cre)1Jig transgene insertion 1, Jeffrey I Gordon https://www.infrafrontier.eu/search?keyword=EM:01133 ? EM:13164 STOCK Tg(Dct-lacZ)A12Jkn/H EMMA sperm mutant strain MGI:3783632 Tg(Dct-lacZ)A12Jkn transgene insertion A12, Ian Jackson MGI:3783630 Tg(Dct-lacZ)A12Jkn transgene insertion A12, Ian Jackson https://www.infrafrontier.eu/search?keyword=EM:13164 + EM:09527 STOCK Tg(CYP19A1-icre)3Fcrt/Biat EMMA embryo Aromatase-iCre mutant strain MGI:5807485 Tg(CYP19A1-icre)3Fcrt transgene insertion 3, Sophie Fouchecourt MGI:5807484 Tg(CYP19A1-icre)3Fcrt transgene insertion 3, Sophie Fouchecourt https://www.infrafrontier.eu/search?keyword=EM:09527 + EM:09527 STOCK Tg(CYP19A1-icre)3Fcrt/Biat EMMA sperm Aromatase-iCre mutant strain MGI:5807485 Tg(CYP19A1-icre)3Fcrt transgene insertion 3, Sophie Fouchecourt MGI:5807484 Tg(CYP19A1-icre)3Fcrt transgene insertion 3, Sophie Fouchecourt https://www.infrafrontier.eu/search?keyword=EM:09527 + EM:02518 STOCK Tg(Col2a1-cre)1Bhr/H EMMA embryo Col2-Cre, STOCK Tg(Col2a1-cre)1Bhr mutant strain MGI:2176070 Tg(Col2a1-cre)1Bhr transgene insertion 1, Richard R Behringer MGI:2176069 Tg(Col2a1-cre)1Bhr transgene insertion 1, Richard R Behringer https://www.infrafrontier.eu/search?keyword=EM:02518 + EM:09617 STOCK Tg(CMV-rtTA)4Bjd Tg(tetO-LINE1*,-lacZ)#Ggs/Ieg EMMA sperm STOCK Tg(CMV-rtTA)4Bjd Tg(TRE-ORFeus,-lacZ)/Ieg, ORFeus lacZ_CMVrtTA mutant strain MGI:3056891 Tg(CMV-rtTA)4Bjd transgene insertion 4, Hermann Bujard MGI:3056892 Tg(CMV-rtTA)4Bjd transgene insertion 4, Hermann Bujard https://www.infrafrontier.eu/search?keyword=EM:09617 + EM:09617 STOCK Tg(CMV-rtTA)4Bjd Tg(tetO-LINE1*,-lacZ)#Ggs/Ieg EMMA sperm STOCK Tg(CMV-rtTA)4Bjd Tg(TRE-ORFeus,-lacZ)/Ieg, ORFeus lacZ_CMVrtTA mutant strain MGI:6220704 Tg(tetO-LINE1*,-lacZ)#Ggs transgene insertion, Gerald G Schumann MGI:6220703 Tg(tetO-LINE1*,-lacZ)#Ggs transgene insertion, Gerald G Schumann https://www.infrafrontier.eu/search?keyword=EM:09617 - EM:02157 STOCK Tg(CMV-EYFP/DsRed2)1Mklv/Kieg EMMA embryo mutant strain MGI:5573173 Tg(CMV-EYFP/DsRed2)1Mklv transgene insertion 1, Andrey Mikhailov MGI:5573171 Tg(CMV-EYFP/DsRed2)1Mklv transgene insertion 1, Andrey Mikhailov https://www.infrafrontier.eu/search?keyword=EM:02157 + EM:06004 STOCK Tg(CAMK2A-KCNIP3*,-lacZ)1Cnbc/Cnbc EMMA sperm B6CBA-Tg(hCaMKIIalpha-hEFmDREAM-IRES-lacZ)JN1Cnbc mutant strain MGI:5646261 Tg(CAMK2A-KCNIP3*,-lacZ)1Cnbc transgene insertion 1, Centro Nacional de Biotecnologia MGI:5646259 Tg(CAMK2A-KCNIP3*,-lacZ)1Cnbc transgene insertion 1, Centro Nacional de Biotecnologia https://www.infrafrontier.eu/search?keyword=EM:06004 + EM:09256 STOCK Tg(Camk2a-Grin2c/itTA)12Rsp Tg(tetO-cre)LC1Bjd/Kctt EMMA sperm TgCN12+LC1 (lab name CN12) mutant strain MGI:2448952 Tg(tetO-cre)LC1Bjd transgene insertion LC1, Hermann Bujard MGI:2671943 Tg(tetO-cre)LC1Bjd transgene insertion LC1, Hermann Bujard https://www.infrafrontier.eu/search?keyword=EM:09256 + EM:09256 STOCK Tg(Camk2a-Grin2c/itTA)12Rsp Tg(tetO-cre)LC1Bjd/Kctt EMMA sperm TgCN12+LC1 (lab name CN12) mutant strain MGI:5432029 Tg(Camk2a-Grin2c/itTA)12Rsp transgene insertion 12, Rolf Sprengel MGI:5432028 Tg(Camk2a-Grin2c/itTA)12Rsp transgene insertion 12, Rolf Sprengel https://www.infrafrontier.eu/search?keyword=EM:09256 + EM:09255 STOCK Tg(Camk2a-Grin2c/itTA)10Rsp/Kctt EMMA sperm NMRI.Cg-Tg(Camk2a-Grin2c/itTA)10Rsp/Kctt, TgCN10 mutant strain MGI:5708649 Tg(Camk2a-Grin2c/itTA)10Rsp transgene insertion 10, Rolf Sprengel MGI:5708646 Tg(Camk2a-Grin2c/itTA)10Rsp transgene insertion 10, Rolf Sprengel https://www.infrafrontier.eu/search?keyword=EM:09255 + EM:05635 STOCK Tg(CAG-Otx2,-GFP)21Asim/Cnrm EMMA embryo CMV-bOtx2 mutant strain MGI:4887448 Tg(CAG-Otx2,-GFP)21Asim transgene insertion 21, Antonio Simeone MGI:4887463 Tg(CAG-Otx2,-GFP)21Asim transgene insertion 21, Antonio Simeone https://www.infrafrontier.eu/search?keyword=EM:05635 + EM:05635 STOCK Tg(CAG-Otx2,-GFP)21Asim/Cnrm EMMA sperm CMV-bOtx2 mutant strain MGI:4887448 Tg(CAG-Otx2,-GFP)21Asim transgene insertion 21, Antonio Simeone MGI:4887463 Tg(CAG-Otx2,-GFP)21Asim transgene insertion 21, Antonio Simeone https://www.infrafrontier.eu/search?keyword=EM:05635 ? EM:06790 STOCK Tg(CAG-Katushka)3Sgo/Cnbc EMMA embryo mutant strain Tg(CAG-KFP)3Sgo Tg(CAG-KFP)3Sgo Tg(CAG-KFP)3Sgo Tg(CAG-KFP)3Sgo https://www.infrafrontier.eu/search?keyword=EM:06790 ? EM:06790 STOCK Tg(CAG-Katushka)3Sgo/Cnbc EMMA sperm mutant strain Tg(CAG-KFP)3Sgo Tg(CAG-KFP)3Sgo Tg(CAG-KFP)3Sgo Tg(CAG-KFP)3Sgo https://www.infrafrontier.eu/search?keyword=EM:06790 + EM:01917 STOCK Tg(CAG-AVEN)1Zrng/Ieg EMMA embryo beta-actin-Aven, B6;CD1-Tg(ACTB-Aven)/Ieg mutant stock MGI:5317427 Tg(CAG-AVEN)1Zrng transgene insertion 1, Martin Zoernig MGI:5317426 Tg(CAG-AVEN)1Zrng transgene insertion 1, Martin Zoernig https://www.infrafrontier.eu/search?keyword=EM:01917 + EM:00026 STOCK Tg(APOA4)8022Feb/Cnrm EMMA embryo B6.(C57BL/6 x CBA)-Tg(APOA4)8022Feb/Ibcm, B6.Cg-Tg(APOA4)8022Feb/Ibcm, APOA4-Tg#8022, B6;CD1-Tg(APOA4)8022Feb/Ibcm mutant strain MGI:2652475 Tg(APOA4)8022Feb transgene insertion 8022, Francisco E Baralle MGI:2652470 Tg(APOA4)8022Feb transgene insertion 8022, Francisco E Baralle https://www.infrafrontier.eu/search?keyword=EM:00026 + EM:00025 STOCK Tg(APOA4)8021Feb/Cnrm EMMA embryo B6;CD1-Tg(APOA4)8021Feb, B6;CD1-Tg(APOA4)8021Feb/Ibcm, B6.Cg-Tg(APOA4)8021Feb/Ibcm, STOCK Tg(APOA4)8021Feb/Ibcm, B6.(C57BL/6 x CBA)-Tg(APOA4)8021Feb/Ibcm, APOA4-Tg#8021 mutant strain MGI:2652472 Tg(APOA4)8021Feb transgene insertion 8021, Francisco E Baralle MGI:2652467 Tg(APOA4)8021Feb transgene insertion 8021, Francisco E Baralle https://www.infrafrontier.eu/search?keyword=EM:00025 + EM:00603 STOCK Tg(Alb1-cre)7Gsc/Cnrm EMMA embryo tg alfpCre, STOCK Tg(Alb1-cre)7Gsc/Ibcm mutant strain MGI:2177602 Tg(Alb1-cre)7Gsc transgene insertion 7, Gunther Schutz MGI:2177601 Tg(Alb1-cre)7Gsc transgene insertion 7, Gunther Schutz https://www.infrafrontier.eu/search?keyword=EM:00603 + EM:00603 STOCK Tg(Alb1-cre)7Gsc/Cnrm EMMA sperm tg alfpCre, STOCK Tg(Alb1-cre)7Gsc/Ibcm mutant strain MGI:2177602 Tg(Alb1-cre)7Gsc transgene insertion 7, Gunther Schutz MGI:2177601 Tg(Alb1-cre)7Gsc transgene insertion 7, Gunther Schutz https://www.infrafrontier.eu/search?keyword=EM:00603 ? EM:11067 STOCK Tg(Alb1-cre) Tg(Alb1-HCVN)35Sml/Orl EMMA archived mutant strain MGI:3513779 Tg(Alb1-HCVN)35Sml transgene insertion 35, Stanley M Lemon MGI:3625827 Tg(Alb1-HCVN)35Sml transgene insertion 35, Stanley M Lemon https://www.infrafrontier.eu/search?keyword=EM:11067 ? EM:11067 STOCK Tg(Alb1-cre) Tg(Alb1-HCVN)35Sml/Orl EMMA archived mutant strain Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) https://www.infrafrontier.eu/search?keyword=EM:11067 ? EM:06347 STOCK Tg(Alb-luc/EGFP)7007Ciem/Cnbc EMMA sperm mutant strain Tg(Alb-luc/EGFP)7007Ciem Tg(Alb-luc/EGFP)7007Ciem Tg(Alb-luc/EGFP)7007Ciem Tg(Alb-luc/EGFP)7007Ciem https://www.infrafrontier.eu/search?keyword=EM:06347 ? EM:06345 STOCK Tg(Alb-luc/EGFP)5190Ciem/Cnbc EMMA sperm mutant strain Tg(Alb-luc/EGFP)5190Ciem Tg(Alb-luc/EGFP)5190Ciem Tg(Alb-luc/EGFP)5190Ciem Tg(Alb-luc/EGFP)5190Ciem https://www.infrafrontier.eu/search?keyword=EM:06345 ? EM:06344 STOCK Tg(Alb-luc/EGFP)5189Ciem/Cnbc EMMA embryo mutant strain Tg(Alb-luc/EGFP)5189Ciem Tg(Alb-luc/EGFP)5189Ciem Tg(Alb-luc/EGFP)5189Ciem Tg(Alb-luc/EGFP)5189Ciem https://www.infrafrontier.eu/search?keyword=EM:06344 ? EM:06344 STOCK Tg(Alb-luc/EGFP)5189Ciem/Cnbc EMMA sperm mutant strain Tg(Alb-luc/EGFP)5189Ciem Tg(Alb-luc/EGFP)5189Ciem Tg(Alb-luc/EGFP)5189Ciem Tg(Alb-luc/EGFP)5189Ciem https://www.infrafrontier.eu/search?keyword=EM:06344 ? EM:06346 STOCK Tg(Alb-luc/EGFP)5187Ciem/Cnbc EMMA embryo mutant strain Tg(Alb-luc/EGFP)5187Ciem Tg(Alb-luc/EGFP)5187Ciem Tg(Alb-luc/EGFP)5187Ciem Tg(Alb-luc/EGFP)5187Ciem https://www.infrafrontier.eu/search?keyword=EM:06346 ? EM:06346 STOCK Tg(Alb-luc/EGFP)5187Ciem/Cnbc EMMA sperm mutant strain Tg(Alb-luc/EGFP)5187Ciem Tg(Alb-luc/EGFP)5187Ciem Tg(Alb-luc/EGFP)5187Ciem Tg(Alb-luc/EGFP)5187Ciem https://www.infrafrontier.eu/search?keyword=EM:06346 + EM:01100 STOCK Tg(ACTB-Neurog3)1Bzal/Orl EMMA embryo B6;D2-Tg(ACTB-Ngn3)Bzal/Orl, beta-actin-floxed-ngn3, STOCK Tg(ACTB-Ngn3)1Bzal/Orl mutant strain MGI:5750091 Tg(ACTB-Neurog3)1Bzal transgene insertion 1, Bernard Zalc MGI:5750088 Tg(ACTB-Neurog3)1Bzal transgene insertion 1, Bernard Zalc https://www.infrafrontier.eu/search?keyword=EM:01100 + EM:01164 STOCK Tbce +/+ Gli3/PasOrl EMMA embryo XtP-Pasteur mutant strain MGI:1856275 Gli3 extra toes MGI:95729 Gli3 GLI-Kruppel family member GLI3 https://www.infrafrontier.eu/search?keyword=EM:01164 + EM:01164 STOCK Tbce +/+ Gli3/PasOrl EMMA embryo XtP-Pasteur mutant strain MGI:1856997 Tbce progressive motor neuronopathy MGI:1917680 Tbce tubulin-specific chaperone E https://www.infrafrontier.eu/search?keyword=EM:01164 + EM:01717 STOCK Tas6/H EMMA embryo TAS6 mutant strain MGI:5646497 Tas6 mutant Tas6 MGI:5646398 Tas6 mutant Tas6 https://www.infrafrontier.eu/search?keyword=EM:01717 + EM:01717 STOCK Tas6/H EMMA sperm TAS6 mutant strain MGI:5646497 Tas6 mutant Tas6 MGI:5646398 Tas6 mutant Tas6 https://www.infrafrontier.eu/search?keyword=EM:01717 + EM:02206 STOCK T<21H>/H EMMA embryo T<21H> mutant strain MGI:1859667 T<21H> brachyury 21 Harwell MGI:98472 T brachyury, T-box transcription factor T https://www.infrafrontier.eu/search?keyword=EM:02206 + EM:01845 STOCK T(7;19)145H/H EMMA embryo STOCK T(7;19)145H, T(7;19)145H, T145H mutant stock MGI:5316040 T(7;19)145H reciprocal translocation, Chr 7 and 19, Harwell 145 MGI:103979 T(7;19)145H reciprocal translocation, Chr 7 and 19, Harwell 145 https://www.infrafrontier.eu/search?keyword=EM:01845 + EM:02584 STOCK T(2;8)2Wa/H EMMA embryo T2Wa mutant strain T(2;8)2Wa reciprocal translocation, Chr 2 and 8, Wageningen 2 MGI:103706 T(2;8)2Wa reciprocal translocation, Chr 2 and 8, Wageningen 2 https://www.infrafrontier.eu/search?keyword=EM:02584 - EM:05521 STOCK Synj2/WtsiOulu EMMA embryo mutant strain MGI:4432435 Synj2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1201671 Synj2 synaptojanin 2 https://www.infrafrontier.eu/search?keyword=EM:05521 ? EM:13078 STOCK Svbp/Flmg EMMA embryo mutant strain Svbp Svbp MGI:1916466 Svbp small vasohibin binding protein https://www.infrafrontier.eu/search?keyword=EM:13078 ? EM:13078 STOCK Svbp/Flmg EMMA sperm mutant strain Svbp Svbp MGI:1916466 Svbp small vasohibin binding protein https://www.infrafrontier.eu/search?keyword=EM:13078 + EM:05570 STOCK Stmn4/Orl EMMA embryo STOCK Stmn4/Orl mutant strain MGI:6468487 Stmn4 targeted mutation 1.1, Mouse Clinical Institute MGI:1931224 Stmn4 stathmin-like 4 https://www.infrafrontier.eu/search?keyword=EM:05570 + EM:05571 STOCK Stmn3/Orl EMMA embryo STOCK Stmn3/Orl mutant strain MGI:6468488 Stmn3 targeted mutation 1.1, Mouse Clinical Institute MGI:1277137 Stmn3 stathmin-like 3 https://www.infrafrontier.eu/search?keyword=EM:05571 + EM:05571 STOCK Stmn3/Orl EMMA sperm STOCK Stmn3/Orl mutant strain MGI:6468488 Stmn3 targeted mutation 1.1, Mouse Clinical Institute MGI:1277137 Stmn3 stathmin-like 3 https://www.infrafrontier.eu/search?keyword=EM:05571 + EM:05572 STOCK Stmn2/Orl EMMA embryo STOCK Stmn2/Orl mutant strain MGI:6468489 Stmn2 targeted mutation 1.1, Mouse Clinical Institute MGI:98241 Stmn2 stathmin-like 2 https://www.infrafrontier.eu/search?keyword=EM:05572 - EM:11176 STOCK Stambp/H EMMA sperm mutant strain MGI:5521854 Stambp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917777 Stambp STAM binding protein https://www.infrafrontier.eu/search?keyword=EM:11176 + EM:01315 STOCK Srrm4/WtsiH EMMA embryo bv, bv (Bronx Waltzer), STOCK bv/H, STOCK bv/WtsiH, Bronx Waltzer mutant stock MGI:1856676 Srrm4 Bronx waltzer MGI:1916205 Srrm4 serine/arginine repetitive matrix 4 https://www.infrafrontier.eu/search?keyword=EM:01315 + EM:01315 STOCK Srrm4/WtsiH EMMA sperm bv, bv (Bronx Waltzer), STOCK bv/H, STOCK bv/WtsiH, Bronx Waltzer mutant stock MGI:1856676 Srrm4 Bronx waltzer MGI:1916205 Srrm4 serine/arginine repetitive matrix 4 https://www.infrafrontier.eu/search?keyword=EM:01315 - EM:01859 STOCK Sox4 Foxq1/+ +/H EMMA embryo STOCK Sox4 Foxq1/+ +/H, M91B mutant stock MGI:3819793 Sox4 mutation 91, Ruth M Arkell MGI:98366 Sox4 SRY (sex determining region Y)-box 4 https://www.infrafrontier.eu/search?keyword=EM:01859 - EM:01859 STOCK Sox4 Foxq1/+ +/H EMMA embryo STOCK Sox4 Foxq1/+ +/H, M91B mutant stock MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01859 + EM:05015 STOCK Sox2/WtsiCnbc[cc] EMMA embryo Yellow submarine mutant strain MGI:2447996 Sox2 yellow submarine MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:05015 + EM:07995 STOCK Sox2/Cnrm EMMA embryo Sox2flox mutant strain MGI:4397705 Sox2 targeted mutation 4.1, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:07995 + EM:07995 STOCK Sox2/Cnrm EMMA sperm Sox2flox mutant strain MGI:4397705 Sox2 targeted mutation 4.1, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:07995 + EM:07114 STOCK Sox2/Cnrm EMMA embryo Sox2 deltaENH mutant strain MGI:3052123 Sox2 targeted mutation 3, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:07114 + EM:07114 STOCK Sox2/Cnrm EMMA sperm Sox2 deltaENH mutant strain MGI:3052123 Sox2 targeted mutation 3, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:07114 + EM:07153 STOCK Sox2/Cnrm EMMA embryo Sox2 beta-geo knock-in mutant strain MGI:2181440 Sox2 targeted mutation 2, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:07153 + EM:07153 STOCK Sox2/Cnrm EMMA sperm Sox2 beta-geo knock-in mutant strain MGI:2181440 Sox2 targeted mutation 2, Silvia K Nicolis MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:07153 + EM:10000 STOCK Snx29/IcsOrl EMMA sperm E254-HEPD0532_2_B10, HEPD0532_2_B10 mutant strain MGI:4434822 Snx29 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921728 Snx29 sorting nexin 29 https://www.infrafrontier.eu/search?keyword=EM:10000 + EM:10367 STOCK Smyd3/Flmg EMMA embryo mutant strain MGI:4346714 Smyd3 gene trap AS0527, Wellcome Trust Sanger Institute MGI:1916976 Smyd3 SET and MYND domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:10367 + EM:02416 STOCK Smg6/H EMMA embryo FVB.Cg-Tg(SMN1*delta5-Smg6)1Pks, SMNDelta5 mutant strain MGI:5493450 Smg6 transgene insertion 1, Nick Parkinson MGI:2144117 Smg6 SMG6 nonsense mediated mRNA decay factor https://www.infrafrontier.eu/search?keyword=EM:02416 + EM:02524 STOCK Smad9/H EMMA sperm Smad8 conditional mutant strain MGI:5514164 Smad9 targeted mutation 2, Elizabeth J Robertson MGI:1859993 Smad9 SMAD family member 9 https://www.infrafrontier.eu/search?keyword=EM:02524 + EM:02507 STOCK Smad9/H EMMA embryo Smad8 LacZ mutant strain MGI:3701868 Smad9 targeted mutation 1, Elizabeth J Robertson MGI:1859993 Smad9 SMAD family member 9 https://www.infrafrontier.eu/search?keyword=EM:02507 + EM:02511 STOCK Smad2/H EMMA embryo Smad2 SF, Smad 2 SF mutant strain MGI:5775212 Smad2 targeted mutation 6, Elizabeth Robertson MGI:108051 Smad2 SMAD family member 2 https://www.infrafrontier.eu/search?keyword=EM:02511 + EM:02512 STOCK Smad2/H EMMA embryo Smad2 FL, Smad 2 FL mutant strain MGI:5775197 Smad2 targeted mutation 5, Elizabeth Robertson MGI:108051 Smad2 SMAD family member 2 https://www.infrafrontier.eu/search?keyword=EM:02512 + EM:02508 STOCK Smad2/H EMMA embryo Smad 2 T3, Smad2 T3 mutant strain MGI:3527156 Smad2 targeted mutation 4, Elizabeth J Robertson MGI:108051 Smad2 SMAD family member 2 https://www.infrafrontier.eu/search?keyword=EM:02508 + EM:02509 STOCK Smad2/H EMMA embryo Smad 2 D2, 129-Smad2/H, Smad2 D2 mutant strain MGI:3527155 Smad2 targeted mutation 3, Elizabeth J Robertson MGI:108051 Smad2 SMAD family member 2 https://www.infrafrontier.eu/search?keyword=EM:02509 ? EM:13218 STOCK Slc7a11/IcsOrl EMMA sperm mutant strain MGI:6390578 Slc7a11 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1347355 Slc7a11 solute carrier family 7 (cationic amino acid transporter, y+ system), member 11 https://www.infrafrontier.eu/search?keyword=EM:13218 + EM:10001 STOCK Slc7a11/IcsOrl EMMA sperm EPD0508_3_E02, E252-EPD0508_3_E02 mutant strain MGI:4441748 Slc7a11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1347355 Slc7a11 solute carrier family 7 (cationic amino acid transporter, y+ system), member 11 https://www.infrafrontier.eu/search?keyword=EM:10001 ? EM:13042 STOCK Slc25a17/Orl EMMA sperm mutant strain MGI:4124412 Slc25a17 gene trap XB686, BayGenomics MGI:1342248 Slc25a17 solute carrier family 25 (mitochondrial carrier, peroxisomal membrane protein), member 17 https://www.infrafrontier.eu/search?keyword=EM:13042 ? EM:12807 STOCK Slamf1 Ifnar1/Biat EMMA embryo mutant strain MGI:3776761 Slamf1 targeted mutation 1, Shinji Ohno MGI:1351314 Slamf1 signaling lymphocytic activation molecule family member 1 https://www.infrafrontier.eu/search?keyword=EM:12807 ? EM:12807 STOCK Slamf1 Ifnar1/Biat EMMA embryo mutant strain MGI:1930950 Ifnar1 targeted mutation 1, Michel Aguet MGI:107658 Ifnar1 interferon (alpha and beta) receptor 1 https://www.infrafrontier.eu/search?keyword=EM:12807 + EM:06779 STOCK Sirt3/WtsiH EMMA sperm B6NTac;B6N-A Sirt3/WtsiH mutant strain MGI:4441628 Sirt3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927665 Sirt3 sirtuin 3 https://www.infrafrontier.eu/search?keyword=EM:06779 + EM:09786 STOCK Shb/Oulu EMMA embryo HEPD0613_4_G08 mutant strain MGI:4451783 Shb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98294 Shb src homology 2 domain-containing transforming protein B https://www.infrafrontier.eu/search?keyword=EM:09786 + EM:09786 STOCK Shb/Oulu EMMA sperm HEPD0613_4_G08 mutant strain MGI:4451783 Shb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98294 Shb src homology 2 domain-containing transforming protein B https://www.infrafrontier.eu/search?keyword=EM:09786 + EM:09467 STOCK Setd7/Flmg EMMA embryo mutant strain MGI:5828599 Setd7 targeted mutation 1.1, Iannis Talianidis MGI:1920501 Setd7 SET domain containing (lysine methyltransferase) 7 https://www.infrafrontier.eu/search?keyword=EM:09467 + EM:09993 STOCK Setbp1/IcsOrl EMMA sperm EPD0445_3_E05, G6-EPD0445_3_E05 mutant strain MGI:4442011 Setbp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933199 Setbp1 SET binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:09993 + EM:02138 STOCK Selenon/Orl EMMA sperm SEPN1 -/- (K51-326 L-), STOCK Sepn1/Orl mutant strain MGI:4946396 Selenon targeted mutation 1.2, Mathieu Rederstorff MGI:2151208 Selenon selenoprotein N https://www.infrafrontier.eu/search?keyword=EM:02138 + EM:11938 STOCK Selenon Gulo/Cnrm EMMA embryo mutant strain MGI:4946396 Selenon targeted mutation 1.2, Mathieu Rederstorff MGI:2151208 Selenon selenoprotein N https://www.infrafrontier.eu/search?keyword=EM:11938 + EM:11938 STOCK Selenon Gulo/Cnrm EMMA embryo mutant strain MGI:2158350 Gulo targeted mutation 1, Nobuyo Maeda MGI:1353434 Gulo gulonolactone (L-) oxidase https://www.infrafrontier.eu/search?keyword=EM:11938 + EM:11938 STOCK Selenon Gulo/Cnrm EMMA sperm mutant strain MGI:4946396 Selenon targeted mutation 1.2, Mathieu Rederstorff MGI:2151208 Selenon selenoprotein N https://www.infrafrontier.eu/search?keyword=EM:11938 + EM:11938 STOCK Selenon Gulo/Cnrm EMMA sperm mutant strain MGI:2158350 Gulo targeted mutation 1, Nobuyo Maeda MGI:1353434 Gulo gulonolactone (L-) oxidase https://www.infrafrontier.eu/search?keyword=EM:11938 + EM:04400 STOCK Scnn1g/Orl EMMA embryo B6N;129-Scnn1g/Orl, Scnn1g lox/lox mutant strain MGI:3832674 Scnn1g targeted mutation 1.1, Edith Hummer MGI:104695 Scnn1g sodium channel, nonvoltage-gated 1 gamma https://www.infrafrontier.eu/search?keyword=EM:04400 + EM:04397 STOCK Scnn1b/Orl EMMA embryo Liddle, B6;129P2-Scnn1b/Orl mutant strain MGI:2448620 Scnn1b targeted mutation 1.1, Edith Hummler MGI:104696 Scnn1b sodium channel, nonvoltage-gated 1 beta https://www.infrafrontier.eu/search?keyword=EM:04397 + EM:04397 STOCK Scnn1b/Orl EMMA sperm Liddle, B6;129P2-Scnn1b/Orl mutant strain MGI:2448620 Scnn1b targeted mutation 1.1, Edith Hummler MGI:104696 Scnn1b sodium channel, nonvoltage-gated 1 beta https://www.infrafrontier.eu/search?keyword=EM:04397 + EM:04399 STOCK Scnn1b/Orl EMMA embryo B6;129P2-Scnn1b/Orl, Scnn1b lox/lox mutant strain MGI:3832670 Scnn1b targeted mutation 1.1, Edith Hummler MGI:104696 Scnn1b sodium channel, nonvoltage-gated 1 beta https://www.infrafrontier.eu/search?keyword=EM:04399 + EM:10603 STOCK Scaper/Ics EMMA sperm HEPD0654_7_D07, G4647 mutant strain MGI:4455688 Scaper targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1925976 Scaper S phase cyclin A-associated protein in the ER https://www.infrafrontier.eu/search?keyword=EM:10603 + EM:10603 STOCK Scaper/Ics EMMA live HEPD0654_7_D07, G4647 mutant strain MGI:4455688 Scaper targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1925976 Scaper S phase cyclin A-associated protein in the ER https://www.infrafrontier.eu/search?keyword=EM:10603 + EM:01876 STOCK sau Foxq1/sau<+> Foxq1<+>/H EMMA embryo M1239B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01876 + EM:01876 STOCK sau Foxq1/sau<+> Foxq1<+>/H EMMA embryo M1239B mutant strain MGI:3607721 sau sauron MGI:3607718 sau sauron https://www.infrafrontier.eu/search?keyword=EM:01876 + EM:01876 STOCK sau Foxq1/sau<+> Foxq1<+>/H EMMA sperm M1239B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01876 + EM:01876 STOCK sau Foxq1/sau<+> Foxq1<+>/H EMMA sperm M1239B mutant strain MGI:3607721 sau sauron MGI:3607718 sau sauron https://www.infrafrontier.eu/search?keyword=EM:01876 + EM:09173 STOCK Samd8/Cnrm EMMA embryo B6N;129P2-Samd8/Cnrm mutant strain MGI:5707963 Samd8 targeted mutation 2.1, Klaus Willecke MGI:1914880 Samd8 sterile alpha motif domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:09173 + EM:09173 STOCK Samd8/Cnrm EMMA sperm B6N;129P2-Samd8/Cnrm mutant strain MGI:5707963 Samd8 targeted mutation 2.1, Klaus Willecke MGI:1914880 Samd8 sterile alpha motif domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:09173 + EM:09172 STOCK Samd8/Cnrm EMMA embryo B6N;129P2-SMSr/Cnrm mutant strain MGI:5707954 Samd8 targeted mutation 1.1, Klaus Willecke MGI:1914880 Samd8 sterile alpha motif domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:09172 + EM:09172 STOCK Samd8/Cnrm EMMA sperm B6N;129P2-SMSr/Cnrm mutant strain MGI:5707954 Samd8 targeted mutation 1.1, Klaus Willecke MGI:1914880 Samd8 sterile alpha motif domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:09172 + EM:01691 STOCK Rvm/H EMMA embryo GENA333, C3H;C-Rvm/H mutant stock MGI:1934625 Rvm retinal vascular mass MGI:1934624 Rvm retinal vascular mass https://www.infrafrontier.eu/search?keyword=EM:01691 ? EM:13253 STOCK Rora/Cnrm EMMA archived mutant strain MGI:5000017 Rora targeted mutation 1, Dennis D M O'Leary MGI:104661 Rora RAR-related orphan receptor alpha https://www.infrafrontier.eu/search?keyword=EM:13253 - EM:05802 STOCK Ripply3/WtsiCnbc EMMA embryo mutant strain MGI:4433779 Ripply3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2181192 Ripply3 ripply transcriptional repressor 3 https://www.infrafrontier.eu/search?keyword=EM:05802 - EM:05802 STOCK Ripply3/WtsiCnbc EMMA sperm mutant strain MGI:4433779 Ripply3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2181192 Ripply3 ripply transcriptional repressor 3 https://www.infrafrontier.eu/search?keyword=EM:05802 + EM:01388 STOCK Rgs4/Orl EMMA embryo B6;129P2-Rgs4/Orl, Rgs4lacZ mutant strain MGI:3580388 Rgs4 targeted mutation 1, Jean-Francois Brunet MGI:108409 Rgs4 regulator of G-protein signaling 4 https://www.infrafrontier.eu/search?keyword=EM:01388 + EM:05207 STOCK Rffl/Orl EMMA embryo Rffltbetageo mutant strain MGI:3846097 Rffl targeted mutation 1, Michel Cohen-Tannoudji MGI:1914588 Rffl ring finger and FYVE like domain containing protein https://www.infrafrontier.eu/search?keyword=EM:05207 + EM:11959 STOCK Ret/H EMMA sperm mutant strain MGI:3662623 Ret targeted mutation 1, Rudiger Klein MGI:97902 Ret ret proto-oncogene https://www.infrafrontier.eu/search?keyword=EM:11959 + EM:02081 STOCK Ret/Kctt EMMA embryo Ret KO, Cg-Ret/Kctt mutant strain MGI:2136894 Ret targeted mutation 1, Frank Costantini MGI:97902 Ret ret proto-oncogene https://www.infrafrontier.eu/search?keyword=EM:02081 + EM:02080 STOCK Ret/Kctt EMMA embryo B6;129P2-Ret/Kctt, Ret flox mutant strain MGI:4440475 Ret targeted mutation 1.1, Patrik Ernfors MGI:97902 Ret ret proto-oncogene https://www.infrafrontier.eu/search?keyword=EM:02080 - EM:11111 STOCK Rasgrf1/H EMMA sperm WCW_1413_003, C57BL/6N-Rasgrf1/H mutant strain MGI:6460115 Rasgrf1 targeted mutation 1a, National Laboratory Animal Center MGI:99694 Rasgrf1 RAS protein-specific guanine nucleotide-releasing factor 1 https://www.infrafrontier.eu/search?keyword=EM:11111 + EM:09839 STOCK Rasal3/CipheOrl EMMA sperm HEPD0529_2_H07 mutant strain MGI:4436426 Rasal3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444128 Rasal3 RAS protein activator like 3 https://www.infrafrontier.eu/search?keyword=EM:09839 + EM:10003 STOCK Ralb/H EMMA sperm B6.Cg-Ralb/H mutant strain MGI:5505280 Ralb targeted mutation 1.2, Christopher J Marshall MGI:1927244 Ralb v-ral simian leukemia viral oncogene B https://www.infrafrontier.eu/search?keyword=EM:10003 + EM:10002 STOCK Rala/H EMMA sperm RalA, B6.Cg-Rala/H, C57BL/6-Rala/CjmH mutant strain MGI:5505279 Rala targeted mutation 1.2, Christopher J Marshall MGI:1927243 Rala v-ral simian leukemia viral oncogene A (ras related) https://www.infrafrontier.eu/search?keyword=EM:10002 + EM:00161 STOCK Rag2/Orl EMMA embryo STOCK Rag2/Ciml, STOCK Rag2, Rag2<0> mutant stock MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:00161 + EM:00161 STOCK Rag2/Orl EMMA sperm STOCK Rag2/Ciml, STOCK Rag2, Rag2<0> mutant stock MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:00161 + EM:07459 STOCK Rag2 Thy1 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA embryo Rag2-/- Tg HY +/+ Thy1.1 mutant strain MGI:3579311 Thy1 a variant MGI:98747 Thy1 thymus cell antigen 1, theta https://www.infrafrontier.eu/search?keyword=EM:07459 + EM:07459 STOCK Rag2 Thy1 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA embryo Rag2-/- Tg HY +/+ Thy1.1 mutant strain MGI:3044562 Tg(TcraH-Y,TcrbH-Y)71Vbo transgene insertion 71, Harald von Boehmer MGI:3044559 Tg(TcraH-Y,TcrbH-Y)71Vbo transgene insertion 71, Harald von Boehmer https://www.infrafrontier.eu/search?keyword=EM:07459 + EM:07459 STOCK Rag2 Thy1 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA embryo Rag2-/- Tg HY +/+ Thy1.1 mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:07459 - EM:07003 STOCK Rag2 Ifnar1 Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:07003 - EM:07003 STOCK Rag2 Ifnar1 Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain Ifnar1 - Ifnar1 - MGI:107658 Ifnar1 interferon (alpha and beta) receptor 1 https://www.infrafrontier.eu/search?keyword=EM:07003 - EM:07003 STOCK Rag2 Ifnar1 Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain MGI:2665105 Tg(TcrLCMV)327Sdz transgene insertion 327, Birgit Ledermann MGI:2665109 Tg(TcrLCMV)327Sdz transgene insertion 327, Birgit Ledermann https://www.infrafrontier.eu/search?keyword=EM:07003 + EM:07463 STOCK Rag2 Cd40 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA archived mutant strain MGI:1857457 Cd40 targeted mutation 1, Hitoshi Kikutani MGI:88336 Cd40 CD40 antigen https://www.infrafrontier.eu/search?keyword=EM:07463 + EM:07463 STOCK Rag2 Cd40 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA archived mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:07463 + EM:07463 STOCK Rag2 Cd40 Tg(TcraH-Y,TcrbH-Y)71Vbo/Orl EMMA archived mutant strain MGI:3044562 Tg(TcraH-Y,TcrbH-Y)71Vbo transgene insertion 71, Harald von Boehmer MGI:3044559 Tg(TcraH-Y,TcrbH-Y)71Vbo transgene insertion 71, Harald von Boehmer https://www.infrafrontier.eu/search?keyword=EM:07463 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:06943 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1857235 Prf1 targeted mutation 1, Sandoz Pharmaceuticals MGI:97551 Prf1 perforin 1 (pore forming protein) https://www.infrafrontier.eu/search?keyword=EM:06943 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:06943 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/search?keyword=EM:06943 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:06943 + EM:06943 STOCK Rag2 B2m Prf1 H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/search?keyword=EM:06943 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/° mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:06327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/° mutant strain MGI:2429736 Il2rg targeted mutation 1, Kazuo Sugamura MGI:96551 Il2rg interleukin 2 receptor, gamma chain https://www.infrafrontier.eu/search?keyword=EM:06327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/° mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:06327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/° mutant strain MGI:1857235 Prf1 targeted mutation 1, Sandoz Pharmaceuticals MGI:97551 Prf1 perforin 1 (pore forming protein) https://www.infrafrontier.eu/search?keyword=EM:06327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/° mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:06327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/° mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/search?keyword=EM:06327 + EM:06327 STOCK Rag2 B2m Prf1 H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo SURE-L1/Rag2°/°GammaC°/°Prf°/° mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/search?keyword=EM:06327 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:06326 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/search?keyword=EM:06326 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:06326 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:2429736 Il2rg targeted mutation 1, Kazuo Sugamura MGI:96551 Il2rg interleukin 2 receptor, gamma chain https://www.infrafrontier.eu/search?keyword=EM:06326 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/search?keyword=EM:06326 + EM:06326 STOCK Rag2 B2m H2-Ab1 Il2rg Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived SURE-L1/Rag2°/°GammaC°/° mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:06326 - EM:05517 STOCK Rab29/WtsiOulu EMMA embryo mutant strain MGI:4432353 Rab29 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385107 Rab29 RAB29, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:05517 + EM:07825 STOCK Rab27b/SeabH EMMA sperm B6;129-Rab27b/SeabH, Rab27B knock-out mutant strain MGI:3706986 Rab27b targeted mutation 1.2, Miguel C Seabra MGI:1931295 Rab27b RAB27B, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:07825 + EM:09994 STOCK Rab19/IcsOrl EMMA sperm HEPD0535_2_C06, E255-HEPD0535_2_C06 mutant strain MGI:4434870 Rab19 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103292 Rab19 RAB19, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:09994 - EM:11491 STOCK Ptprc Rag2 Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain MGI:4819849 Ptprc a variant MGI:97810 Ptprc protein tyrosine phosphatase, receptor type, C https://www.infrafrontier.eu/search?keyword=EM:11491 - EM:11491 STOCK Ptprc Rag2 Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain MGI:2665105 Tg(TcrLCMV)327Sdz transgene insertion 327, Birgit Ledermann MGI:2665109 Tg(TcrLCMV)327Sdz transgene insertion 327, Birgit Ledermann https://www.infrafrontier.eu/search?keyword=EM:11491 - EM:11491 STOCK Ptprc Rag2 Tg(TcrLCMV)327Sdz/Orl EMMA embryo mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:11491 + EM:09841 STOCK Ptpra/CipheOrl EMMA sperm HEPD0511_4_G01 mutant strain MGI:4434690 Ptpra targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97808 Ptpra protein tyrosine phosphatase, receptor type, A https://www.infrafrontier.eu/search?keyword=EM:09841 - EM:05723 STOCK Ptpn2/WtsiBiat EMMA sperm mutant strain MGI:4441737 Ptpn2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97806 Ptpn2 protein tyrosine phosphatase, non-receptor type 2 https://www.infrafrontier.eu/search?keyword=EM:05723 ? EM:12902 STOCK Ptk2b/Orl EMMA sperm mutant strain MGI:6164156 Ptk2b targeted mutation 1.2, Genoway MGI:104908 Ptk2b PTK2 protein tyrosine kinase 2 beta https://www.infrafrontier.eu/search?keyword=EM:12902 - EM:05527 STOCK Ptges2/WtsiOulu EMMA embryo mutant strain MGI:4432215 Ptges2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917592 Ptges2 prostaglandin E synthase 2 https://www.infrafrontier.eu/search?keyword=EM:05527 + EM:10358 STOCK Ptgdr2/Biat EMMA sperm mutant strain MGI:4843032 Ptgdr2 targeted mutation 1, Velocigene MGI:1330275 Ptgdr2 prostaglandin D2 receptor 2 https://www.infrafrontier.eu/search?keyword=EM:10358 ? EM:11052 STOCK Pten Tg(Alb1-cre) Tg(Alb1-HCVN)35Sml/Orl EMMA archived mutant strain Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) https://www.infrafrontier.eu/search?keyword=EM:11052 ? EM:11052 STOCK Pten Tg(Alb1-cre) Tg(Alb1-HCVN)35Sml/Orl EMMA archived mutant strain MGI:109583 Pten phosphatase and tensin homolog https://www.infrafrontier.eu/search?keyword=EM:11052 ? EM:11052 STOCK Pten Tg(Alb1-cre) Tg(Alb1-HCVN)35Sml/Orl EMMA archived mutant strain MGI:3513779 Tg(Alb1-HCVN)35Sml transgene insertion 35, Stanley M Lemon MGI:3625827 Tg(Alb1-HCVN)35Sml transgene insertion 35, Stanley M Lemon https://www.infrafrontier.eu/search?keyword=EM:11052 + EM:09646 STOCK Prnp Tg(Prnp-PRNP)361Jmto/Cnbc EMMA embryo Prpn tm2Edin tg(moPrpn 129Val-HuPrP-361) Jmtorres, tgVal129/tg361 mutant strain MGI:2387688 Prnp targeted mutation 2, Edinburgh University MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:09646 + EM:09646 STOCK Prnp Tg(Prnp-PRNP)361Jmto/Cnbc EMMA embryo Prpn tm2Edin tg(moPrpn 129Val-HuPrP-361) Jmtorres, tgVal129/tg361 mutant strain MGI:5803836 Tg(Prnp-PRNP)361Jmto transgene insertion 361, Juan Maria Torres MGI:5803835 Tg(Prnp-PRNP)361Jmto transgene insertion 361, Juan Maria Torres https://www.infrafrontier.eu/search?keyword=EM:09646 + EM:09644 STOCK Prnp Tg(Prnp-PRNP)340Jmto/Cnbc EMMA embryo Prpn tm2Edin tg(moPrpn 129Met-HuPrP-340) Jmtorres mutant strain MGI:2387688 Prnp targeted mutation 2, Edinburgh University MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:09644 + EM:09644 STOCK Prnp Tg(Prnp-PRNP)340Jmto/Cnbc EMMA embryo Prpn tm2Edin tg(moPrpn 129Met-HuPrP-340) Jmtorres mutant strain MGI:5803821 Tg(Prnp-PRNP)340Jmto transgene insertion 340, Juan Maria Torres MGI:5803814 Tg(Prnp-PRNP)340Jmto transgene insertion 340, Juan Maria Torres https://www.infrafrontier.eu/search?keyword=EM:09644 + EM:05415 STOCK Prnp Tg(Prnp-PRNP)110Jmto/Cnbc EMMA embryo STOCK Prnp Tg(moPrpn BoPrP)110Jmto/Cnbc, Prpn tm2Edin tg(moPrpn BoPrP)110 Jmto mutant strain MGI:5476799 Tg(Prnp-PRNP)110Jmto transgene insertion 110, Juan Maria Torres MGI:5476796 Tg(Prnp-PRNP)110Jmto transgene insertion 110, Juan Maria Torres https://www.infrafrontier.eu/search?keyword=EM:05415 + EM:05415 STOCK Prnp Tg(Prnp-PRNP)110Jmto/Cnbc EMMA embryo STOCK Prnp Tg(moPrpn BoPrP)110Jmto/Cnbc, Prpn tm2Edin tg(moPrpn BoPrP)110 Jmto mutant strain MGI:2387688 Prnp targeted mutation 2, Edinburgh University MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:05415 + EM:05415 STOCK Prnp Tg(Prnp-PRNP)110Jmto/Cnbc EMMA sperm STOCK Prnp Tg(moPrpn BoPrP)110Jmto/Cnbc, Prpn tm2Edin tg(moPrpn BoPrP)110 Jmto mutant strain MGI:5476799 Tg(Prnp-PRNP)110Jmto transgene insertion 110, Juan Maria Torres MGI:5476796 Tg(Prnp-PRNP)110Jmto transgene insertion 110, Juan Maria Torres https://www.infrafrontier.eu/search?keyword=EM:05415 + EM:05415 STOCK Prnp Tg(Prnp-PRNP)110Jmto/Cnbc EMMA sperm STOCK Prnp Tg(moPrpn BoPrP)110Jmto/Cnbc, Prpn tm2Edin tg(moPrpn BoPrP)110 Jmto mutant strain MGI:2387688 Prnp targeted mutation 2, Edinburgh University MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:05415 + EM:05416 STOCK Prnp Tg(Prnp-PRNP)001Jmto/Cnbc EMMA embryo tg(moPrpn PoPrP)001 Jmto, STOCK Prnp Tg(moPrpn PoPrP)001Jmto/Cnb mutant strain MGI:2387688 Prnp targeted mutation 2, Edinburgh University MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:05416 + EM:05416 STOCK Prnp Tg(Prnp-PRNP)001Jmto/Cnbc EMMA embryo tg(moPrpn PoPrP)001 Jmto, STOCK Prnp Tg(moPrpn PoPrP)001Jmto/Cnb mutant strain MGI:5476823 Tg(Prnp-PRNP)001Jmto transgene insertion 001, Juan Maria Torres MGI:5476816 Tg(Prnp-PRNP)001Jmto transgene insertion 001, Juan Maria Torres https://www.infrafrontier.eu/search?keyword=EM:05416 + EM:05416 STOCK Prnp Tg(Prnp-PRNP)001Jmto/Cnbc EMMA sperm tg(moPrpn PoPrP)001 Jmto, STOCK Prnp Tg(moPrpn PoPrP)001Jmto/Cnb mutant strain MGI:2387688 Prnp targeted mutation 2, Edinburgh University MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:05416 + EM:05416 STOCK Prnp Tg(Prnp-PRNP)001Jmto/Cnbc EMMA sperm tg(moPrpn PoPrP)001 Jmto, STOCK Prnp Tg(moPrpn PoPrP)001Jmto/Cnb mutant strain MGI:5476823 Tg(Prnp-PRNP)001Jmto transgene insertion 001, Juan Maria Torres MGI:5476816 Tg(Prnp-PRNP)001Jmto transgene insertion 001, Juan Maria Torres https://www.infrafrontier.eu/search?keyword=EM:05416 + EM:04338 STOCK Prnp Tg(Prnp/PRNP*ARR)FM16Pcg/H EMMA embryo mutant strain MGI:5779528 Tg(Prnp/PRNP*ARR)FM16Pcg transgene insertion FM16, Peter Griffiths MGI:5779527 Tg(Prnp/PRNP*ARR)FM16Pcg transgene insertion FM16, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:04338 + EM:04338 STOCK Prnp Tg(Prnp/PRNP*ARR)FM16Pcg/H EMMA embryo mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:04338 + EM:02421 STOCK Prnp Tg(Prnp/PRNP)1Drb/H EMMA embryo mutant strain MGI:5762584 Tg(Prnp/PRNP)1Drb transgene insertion 1, David R Brown MGI:5762582 Tg(Prnp/PRNP)1Drb transgene insertion 1, David R Brown https://www.infrafrontier.eu/search?keyword=EM:02421 + EM:02421 STOCK Prnp Tg(Prnp/PRNP)1Drb/H EMMA embryo mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:02421 + EM:02539 STOCK Prnp Tg(Prnp-PRNP*6OR)K6M16Pcg/H EMMA embryo mutant strain MGI:5775417 Tg(Prnp-PRNP*6OR)K6M16Pcg transgene insertion K6M16, Peter Griffiths MGI:5775416 Tg(Prnp-PRNP*6OR)K6M16Pcg transgene insertion K6M16, Peter Griffiths https://www.infrafrontier.eu/search?keyword=EM:02539 + EM:02539 STOCK Prnp Tg(Prnp-PRNP*6OR)K6M16Pcg/H EMMA embryo mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:02539 + EM:06144 STOCK Prnp Tg(Prnp*D177N*M128V)G1Rchi/Cnrm EMMA embryo Tg(CJD-G1)/Prnp0/0 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:06144 + EM:06144 STOCK Prnp Tg(Prnp*D177N*M128V)G1Rchi/Cnrm EMMA embryo Tg(CJD-G1)/Prnp0/0 mutant strain MGI:5614760 Tg(Prnp*D177N*M128V)G1Rchi transgene insertion G1, Roberto Chiesa MGI:5614759 Tg(Prnp*D177N*M128V)G1Rchi transgene insertion G1, Roberto Chiesa https://www.infrafrontier.eu/search?keyword=EM:06144 + EM:06144 STOCK Prnp Tg(Prnp*D177N*M128V)G1Rchi/Cnrm EMMA sperm Tg(CJD-G1)/Prnp0/0 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:06144 + EM:06144 STOCK Prnp Tg(Prnp*D177N*M128V)G1Rchi/Cnrm EMMA sperm Tg(CJD-G1)/Prnp0/0 mutant strain MGI:5614760 Tg(Prnp*D177N*M128V)G1Rchi transgene insertion G1, Roberto Chiesa MGI:5614759 Tg(Prnp*D177N*M128V)G1Rchi transgene insertion G1, Roberto Chiesa https://www.infrafrontier.eu/search?keyword=EM:06144 + EM:06142 STOCK Prnp Tg(Prnp*)CDah/Cnrm EMMA embryo STOCK Prnp Tg(Prnp-PG14)1Dah/Cnrm, Tg(PG14-C)/Prnp0/0, STOCK Prnp Tg(Prnp-PG14)CDah/Cnrm mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:06142 + EM:06142 STOCK Prnp Tg(Prnp*)CDah/Cnrm EMMA embryo STOCK Prnp Tg(Prnp-PG14)1Dah/Cnrm, Tg(PG14-C)/Prnp0/0, STOCK Prnp Tg(Prnp-PG14)CDah/Cnrm mutant strain MGI:5563233 Tg(Prnp*)CDah transgene insertion C, David A Harris MGI:5563232 Tg(Prnp*)CDah transgene insertion C, David A Harris https://www.infrafrontier.eu/search?keyword=EM:06142 + EM:06141 STOCK Prnp Tg(Prnp)E1Rchi/Cnrm EMMA embryo Tg(WT-E1)/Prnp0/0 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:06141 + EM:06141 STOCK Prnp Tg(Prnp)E1Rchi/Cnrm EMMA embryo Tg(WT-E1)/Prnp0/0 mutant strain MGI:5563239 Tg(Prnp)E1Rchi transgene insertion E1, Roberto Chiesa MGI:5563236 Tg(Prnp)E1Rchi transgene insertion E1, Roberto Chiesa https://www.infrafrontier.eu/search?keyword=EM:06141 + EM:06141 STOCK Prnp Tg(Prnp)E1Rchi/Cnrm EMMA sperm Tg(WT-E1)/Prnp0/0 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:06141 + EM:06141 STOCK Prnp Tg(Prnp)E1Rchi/Cnrm EMMA sperm Tg(WT-E1)/Prnp0/0 mutant strain MGI:5563239 Tg(Prnp)E1Rchi transgene insertion E1, Roberto Chiesa MGI:5563236 Tg(Prnp)E1Rchi transgene insertion E1, Roberto Chiesa https://www.infrafrontier.eu/search?keyword=EM:06141 + EM:02028 STOCK Prnp Tg(Prnp)941Zbz/Cnrm EMMA embryo PrPmyc, B6,129Sv-Tg941(myc),PrnpZH1/zH1, B6;129/Sv-Tg941(myc),PrnpZH1/zH1, Tg941 PrPmyc mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:02028 + EM:02028 STOCK Prnp Tg(Prnp)941Zbz/Cnrm EMMA embryo PrPmyc, B6,129Sv-Tg941(myc),PrnpZH1/zH1, B6;129/Sv-Tg941(myc),PrnpZH1/zH1, Tg941 PrPmyc mutant strain MGI:5318499 Tg(Prnp)941Zbz transgene insertion 941, University Hospital Zurich MGI:5318498 Tg(Prnp)941Zbz transgene insertion 941, University Hospital Zurich https://www.infrafrontier.eu/search?keyword=EM:02028 + EM:02027 STOCK Prnp Tg(Prnp)940Zbz/Cnrm EMMA embryo PrPmyc, B6,129Sv-Tg940(myc),PrnpZH1/zH1, Tg940 PrPmyc mutant strain MGI:5318492 Tg(Prnp)940Zbz transgene insertion 940, University Hospital Zurich MGI:5318491 Tg(Prnp)940Zbz transgene insertion 940, University Hospital Zurich https://www.infrafrontier.eu/search?keyword=EM:02027 + EM:02027 STOCK Prnp Tg(Prnp)940Zbz/Cnrm EMMA embryo PrPmyc, B6,129Sv-Tg940(myc),PrnpZH1/zH1, Tg940 PrPmyc mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:02027 + EM:01828 STOCK Prnp Tg(Pcp2-Prnp)F332Zbz/Cnrm EMMA embryo Prnp-Tg(PrPdelta134)332Zbz, B6.Cg-Prnp Tg(L7-Prnp)F332/Cnrm, F332 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:01828 + EM:01828 STOCK Prnp Tg(Pcp2-Prnp)F332Zbz/Cnrm EMMA embryo Prnp-Tg(PrPdelta134)332Zbz, B6.Cg-Prnp Tg(L7-Prnp)F332/Cnrm, F332 mutant strain MGI:5014403 Tg(Pcp2-Prnp)F332Zbz transgene insertion F332, Zurich MGI:5014394 Tg(Pcp2-Prnp)F332Zbz transgene insertion F332, Zurich https://www.infrafrontier.eu/search?keyword=EM:01828 + EM:01836 STOCK Prnp Tg(Pcp2-Prnp)F13Zbz/Cnrm EMMA embryo TgF13/Prnp, F13, B6.Cg-Prnp Tg(L7-Prnp)F13/Cnrm mutant strain MGI:5014380 Tg(Pcp2-Prnp)F13Zbz transgene insertion F13, Zurich MGI:5014378 Tg(Pcp2-Prnp)F13Zbz transgene insertion F13, Zurich https://www.infrafrontier.eu/search?keyword=EM:01836 + EM:01836 STOCK Prnp Tg(Pcp2-Prnp)F13Zbz/Cnrm EMMA embryo TgF13/Prnp, F13, B6.Cg-Prnp Tg(L7-Prnp)F13/Cnrm mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:01836 + EM:01824 STOCK Prnp Tg(Pcp2-Prnp)E330Zbz/Cnrm EMMA embryo B6.Cg-Prnp Tg(L7-Prnp)E330, E330 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:01824 + EM:01824 STOCK Prnp Tg(Pcp2-Prnp)E330Zbz/Cnrm EMMA embryo B6.Cg-Prnp Tg(L7-Prnp)E330, E330 mutant strain MGI:5014494 Tg(Pcp2-Prnp)E330Zbz transgene insertion E330, Zurich MGI:5014493 Tg(Pcp2-Prnp)E330Zbz transgene insertion E330, Zurich https://www.infrafrontier.eu/search?keyword=EM:01824 + EM:01837 STOCK Prnp Tg(Eno2-Prnp)#Aag/Cnrm EMMA embryo NSE-PrP, STOCK-Prnp Tg(Eno-Prnp)/Cnrm, NSE-PrP Prnp, B6,129-TgN[NSE]Prnp ZH1/ZH1 mutant strain MGI:1888773 Prnp targeted mutation 1, Charles Weissmann MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:01837 + EM:01837 STOCK Prnp Tg(Eno2-Prnp)#Aag/Cnrm EMMA embryo NSE-PrP, STOCK-Prnp Tg(Eno-Prnp)/Cnrm, NSE-PrP Prnp, B6,129-TgN[NSE]Prnp ZH1/ZH1 mutant strain MGI:5013941 Tg(Eno2-Prnp)#Aag transgene insertion, Adriano Aguzzi MGI:5013940 Tg(Eno2-Prnp)#Aag transgene insertion, Adriano Aguzzi https://www.infrafrontier.eu/search?keyword=EM:01837 + EM:08437 STOCK Prdm6/Biat EMMA sperm B6.129Ola-Prdm6 tm1Gew mutant strain MGI:5576799 Prdm6 targeted mutation 1.1, Jurgen Ruland MGI:2684938 Prdm6 PR domain containing 6 https://www.infrafrontier.eu/search?keyword=EM:08437 + EM:06222 STOCK Pmel/Kctt EMMA embryo Pmel KO, B6;129-Pmel/Kctt mutant strain MGI:5294792 Pmel targeted mutation 1.1, Leif Andersson MGI:98301 Pmel premelanosome protein https://www.infrafrontier.eu/search?keyword=EM:06222 + EM:09990 STOCK Plekhg3/IcsOrl EMMA sperm E238-HEPD0530_4_D07, HEPD0530_4_D07 mutant strain MGI:4435115 Plekhg3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2388284 Plekhg3 pleckstrin homology domain containing, family G (with RhoGef domain) member 3 https://www.infrafrontier.eu/search?keyword=EM:09990 ? EM:13679 STOCK Plcg2/H EMMA live mutant strain MGI:4455703 Plcg2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97616 Plcg2 phospholipase C, gamma 2 https://www.infrafrontier.eu/search?keyword=EM:13679 - EM:10360 STOCK Plau/H EMMA sperm mutant strain MGI:4944525 Plau targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97611 Plau plasminogen activator, urokinase https://www.infrafrontier.eu/search?keyword=EM:10360 + EM:01947 STOCK Pk27053/Ieg EMMA sperm PK27506 mutant strain MGI:5752521 Pk27053 pyruvate kinase activity mutant 27053 MGI:5752518 Pk27053 pyruvate kinase activity mutant 27053 https://www.infrafrontier.eu/search?keyword=EM:01947 + EM:05454 STOCK Piwil4/Cnrm EMMA embryo Miwi2 null mutant strain MGI:5320638 Piwil4 targeted mutation 2.1, Donal O'Carroll MGI:3041167 Piwil4 piwi-like RNA-mediated gene silencing 4 https://www.infrafrontier.eu/search?keyword=EM:05454 - EM:05884 STOCK Pitpnm1/WtsiIeg EMMA sperm mutant strain MGI:4431584 Pitpnm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1197524 Pitpnm1 phosphatidylinositol transfer protein, membrane-associated 1 https://www.infrafrontier.eu/search?keyword=EM:05884 - EM:05431 STOCK Pik3cg/WtsiOulu EMMA embryo mutant strain MGI:4432229 Pik3cg targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353576 Pik3cg phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit gamma https://www.infrafrontier.eu/search?keyword=EM:05431 - EM:05431 STOCK Pik3cg/WtsiOulu EMMA sperm mutant strain MGI:4432229 Pik3cg targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353576 Pik3cg phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit gamma https://www.infrafrontier.eu/search?keyword=EM:05431 + EM:09618 STOCK Pik3ap1/CipheOrl EMMA sperm EPD0393_2_G04 mutant strain MGI:4419954 Pik3ap1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933177 Pik3ap1 phosphoinositide-3-kinase adaptor protein 1 https://www.infrafrontier.eu/search?keyword=EM:09618 + EM:07453 STOCK Phox2b/Orl EMMA sperm Phox2b27Alacki mutant strain MGI:4418298 Phox2b targeted mutation 4, Jean-Francois Brunet MGI:1100882 Phox2b paired-like homeobox 2b https://www.infrafrontier.eu/search?keyword=EM:07453 - EM:11098 STOCK Phox2b/H EMMA sperm mutant strain MGI:4418265 Phox2b targeted mutation 3.1, Jean-Francois Brunet MGI:1100882 Phox2b paired-like homeobox 2b https://www.infrafrontier.eu/search?keyword=EM:11098 + EM:04758 STOCK Phox2a/Orl EMMA embryo Phox2alox, B6D2.129S2-Phox2a/Orl mutant strain MGI:4438118 Phox2a targeted mutation 2.1, Jean-Francois Brunet MGI:106633 Phox2a paired-like homeobox 2a https://www.infrafrontier.eu/search?keyword=EM:04758 + EM:11939 STOCK Phf10/Ieg EMMA sperm mutant strain MGI:5497157 Phf10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1919307 Phf10 PHD finger protein 10 https://www.infrafrontier.eu/search?keyword=EM:11939 ? EM:14683 STOCK Pgd/IcsOrl EMMA archived mutant strain Pgd Pgd MGI:97553 Pgd phosphogluconate dehydrogenase https://www.infrafrontier.eu/search?keyword=EM:14683 + EM:09987 STOCK Pgd/IcsOrl EMMA sperm EPD0117_4_C03, ICS-EPD0117_4_C03-1 mutant strain MGI:4431737 Pgd targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97553 Pgd phosphogluconate dehydrogenase https://www.infrafrontier.eu/search?keyword=EM:09987 + EM:00142 STOCK Pde6b/H EMMA embryo GENA309, Pde6b, C3H.B6(Cg)-Pde6b/H, C3.Cg-Pde6b/H, C3H.C-Pde6b/H, C3H;C-Pde6b/H mutant strain MGI:2178315 Pde6b atypical retinal degeneration 2 MGI:97525 Pde6b phosphodiesterase 6B, cGMP, rod receptor, beta polypeptide https://www.infrafrontier.eu/search?keyword=EM:00142 + EM:00142 STOCK Pde6b/H EMMA sperm GENA309, Pde6b, C3H.B6(Cg)-Pde6b/H, C3.Cg-Pde6b/H, C3H.C-Pde6b/H, C3H;C-Pde6b/H mutant strain MGI:2178315 Pde6b atypical retinal degeneration 2 MGI:97525 Pde6b phosphodiesterase 6B, cGMP, rod receptor, beta polypeptide https://www.infrafrontier.eu/search?keyword=EM:00142 + EM:09998 STOCK Pcsk1/IcsOrl EMMA sperm EPD0508_1_C08, E253-EPD0508_1_C08 mutant strain MGI:4441678 Pcsk1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97511 Pcsk1 proprotein convertase subtilisin/kexin type 1 https://www.infrafrontier.eu/search?keyword=EM:09998 + EM:11110 STOCK Pcdh10/H EMMA sperm mutant strain MGI:6473471 Pcdh10 targeted mutation 1a, National Laboratory Animal Center MGI:1338042 Pcdh10 protocadherin 10 https://www.infrafrontier.eu/search?keyword=EM:11110 + EM:09446 STOCK Pax7 Mapk14/JpellH EMMA sperm STOCK Mapk14 Pax7/JpellH mutant strain MGI:3715522 Mapk14 targeted mutation 14, Angel R Nebreda MGI:1346865 Mapk14 mitogen-activated protein kinase 14 https://www.infrafrontier.eu/search?keyword=EM:09446 + EM:09446 STOCK Pax7 Mapk14/JpellH EMMA sperm STOCK Mapk14 Pax7/JpellH mutant strain MGI:3497712 Pax7 targeted mutation 1, Mario R Capecchi MGI:97491 Pax7 paired box 7 https://www.infrafrontier.eu/search?keyword=EM:09446 + EM:00998 STOCK Pax6/Cnrm EMMA embryo B6;Cg-Pax6/Ibcm, RLA (Retinal enhancer-LAcZ), STOCK Pax6/Ibcm mutant strain MGI:1934347 Pax6 targeted mutation 1, Peter Gruss MGI:97490 Pax6 paired box 6 https://www.infrafrontier.eu/search?keyword=EM:00998 + EM:09958 STOCK Pax4/IcsOrl EMMA sperm HEPD0670_7_A04 mutant strain MGI:4841624 Pax4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97488 Pax4 paired box 4 https://www.infrafrontier.eu/search?keyword=EM:09958 + EM:01942 STOCK Pax2/H EMMA embryo GENA380, C3H;C-Pax2/H, Opdc(GENA380), C3H;C-Opdc/H, STOCK Opdc/H mutant stock MGI:1934620 Pax2 optic disc coloboma MGI:97486 Pax2 paired box 2 https://www.infrafrontier.eu/search?keyword=EM:01942 + EM:06218 STOCK Pawr/Cnbc EMMA embryo CD1;129-Pawr/Cnbc mutant strain MGI:2678021 Pawr targeted mutation 1, Jorge Moscat MGI:2149961 Pawr PRKC, apoptosis, WT1, regulator https://www.infrafrontier.eu/search?keyword=EM:06218 + EM:10037 STOCK Parp1/IcsOrl EMMA sperm G4786, HEPD0555_6_C04 mutant strain MGI:4435467 Parp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1340806 Parp1 poly (ADP-ribose) polymerase family, member 1 https://www.infrafrontier.eu/search?keyword=EM:10037 + EM:11256 STOCK Pafah1b1/Ics EMMA sperm G4878b, HEPD0602_6_E12 mutant strain MGI:6117756 Pafah1b1 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:109520 Pafah1b1 platelet-activating factor acetylhydrolase, isoform 1b, subunit 1 https://www.infrafrontier.eu/search?keyword=EM:11256 + EM:05628 STOCK Otx2/Cnrm EMMA embryo Otx2delta3SS mutant strain MGI:4365828 Otx2 targeted mutation 9, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05628 + EM:05626 STOCK Otx2/Cnrm EMMA embryo Otx2-Flox mutant strain MGI:2661065 Otx2 targeted mutation 6, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05626 + EM:05642 STOCK Otx2/Cnrm EMMA embryo STOCK Otx2/Cnrm mutant strain MGI:6468491 Otx1 targeted mutation 5.1, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05642 + EM:05633 STOCK Otx2/Cnrm EMMA embryo Otx2FL-Otd mutant strain MGI:2157779 Otx2 targeted mutation 4, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05633 + EM:05632 STOCK Otx2/Cnrm EMMA embryo Otx2-Otd mutant strain MGI:2157778 Otx2 targeted mutation 3, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05632 + EM:05630 STOCK Otx2/Cnrm EMMA embryo Otx2-lambda mutant strain MGI:2150146 Otx2 targeted mutation 2, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05630 + EM:05623 STOCK Otx2/Cnrm EMMA embryo Otx2-Lacz mutant strain MGI:1857510 Otx2 targeted mutation 1, Institut Pasteur MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05623 + EM:05645 STOCK Otx2/Cnrm EMMA embryo STOCK Otx2/Cnrm mutant strain MGI:6468506 Otx2 targeted mutation 17, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05645 + EM:05644 STOCK Otx2/2Cnrm EMMA embryo STOCK Otx2/Cnrm mutant strain MGI:6468499 Otx2 targeted mutation 16, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05644 + EM:05643 STOCK Otx2/Cnrm EMMA embryo STOCK Otx2/Cnrm mutant strain MGI:6468505 Otx2 targeted mutation 15, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05643 + EM:05647 STOCK Otx2/Cnrm EMMA embryo mutant strain MGI:6468504 Otx2 targeted mutation 14, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05647 + EM:05647 STOCK Otx2/Cnrm EMMA sperm mutant strain MGI:6468504 Otx2 targeted mutation 14, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05647 + EM:05646 STOCK Otx2/Cnrm EMMA embryo mutant strain MGI:6468502 Otx2 targeted mutation 13, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05646 + EM:05646 STOCK Otx2/Cnrm EMMA sperm mutant strain MGI:6468502 Otx2 targeted mutation 13, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05646 + EM:05641 STOCK Otx2/Cnrm EMMA embryo STOCK Otx2/Cnrm, Otx2 RK-AA mutant strain MGI:5573195 Otx2 targeted mutation 12.1, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05641 + EM:05624 STOCK Otx2/Cnrm EMMA embryo Otx2-GFP mutant strain MGI:4365830 Otx2 targeted mutation 11, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05624 + EM:05629 STOCK Otx2/Cnrm EMMA embryo Otx2-deltaCD mutant strain MGI:4365829 Otx2 targeted mutation 10, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05629 + EM:05640 STOCK Otx2/Cnrm EMMA embryo Otx2-CreER mutant strain MGI:5473314 Otx2 targeted mutation 1.1, Magdalena Goetz MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05640 + EM:05640 STOCK Otx2/Cnrm EMMA sperm Otx2-CreER mutant strain MGI:5473314 Otx2 targeted mutation 1.1, Magdalena Goetz MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05640 + EM:05631 STOCK Otx2/Cnrm EMMA embryo Otx2-hOtx1 mutant strain MGI:2153202 Otx2 targeted mutation 1, Antonio Simeone MGI:97451 Otx2 orthodenticle homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:05631 + EM:05639 STOCK Otx1/Cnrm EMMA embryo mutant strain MGI:6468494 Otx1 targeted mutation 6, Antonio Simeone MGI:97450 Otx1 orthodenticle homeobox 1 https://www.infrafrontier.eu/search?keyword=EM:05639 + EM:05638 STOCK Otx1/Cnrm EMMA embryo mutant strain MGI:6468490 Otx1 targeted mutation 5, Antonio Simeone MGI:97450 Otx1 orthodenticle homeobox 1 https://www.infrafrontier.eu/search?keyword=EM:05638 + EM:05622 STOCK Otx1/Cnrm EMMA embryo Otx1-Cre mutant strain MGI:2661060 Otx1 targeted mutation 4, Antonio Simeone MGI:97450 Otx1 orthodenticle homeobox 1 https://www.infrafrontier.eu/search?keyword=EM:05622 + EM:05621 STOCK Otx1/Cnrm EMMA embryo mutant strain MGI:2153199 Otx1 targeted mutation 2, Antonio Simeone MGI:97450 Otx1 orthodenticle homeobox 1 https://www.infrafrontier.eu/search?keyword=EM:05621 + EM:05620 STOCK Otx1/Cnrm EMMA embryo Otx1-LacZ mutant strain MGI:2136272 Otx1 targeted mutation 1, Antonio Simeone MGI:97450 Otx1 orthodenticle homeobox 1 https://www.infrafrontier.eu/search?keyword=EM:05620 + EM:05636 STOCK Otp/Cnrm EMMA embryo Otp-LacZ mutant strain MGI:2180541 Otp targeted mutation 1, Antonio Simeone MGI:99835 Otp orthopedia homeobox https://www.infrafrontier.eu/search?keyword=EM:05636 + EM:00187 STOCK Ostes/H EMMA embryo Ost, T667, trembly, C3H101H-Ostes/H mutant strain MGI:3689329 Ostes ostes MGI:3688249 Ostes ostes https://www.infrafrontier.eu/search?keyword=EM:00187 + EM:00187 STOCK Ostes/H EMMA sperm Ost, T667, trembly, C3H101H-Ostes/H mutant strain MGI:3689329 Ostes ostes MGI:3688249 Ostes ostes https://www.infrafrontier.eu/search?keyword=EM:00187 + EM:09373 STOCK Nub1/Ph EMMA archived HEPD0664_6_C08 mutant strain MGI:4841553 Nub1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1889001 Nub1 negative regulator of ubiquitin-like proteins 1 https://www.infrafrontier.eu/search?keyword=EM:09373 - EM:07818 STOCK Ntf5/IcsOrl EMMA sperm mutant strain MGI:4436129 Ntf5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97381 Ntf5 neurotrophin 5 https://www.infrafrontier.eu/search?keyword=EM:07818 - EM:11552 STOCK Nox4 Tg(Tek-cre)1Ywa/Orl EMMA embryo mutant strain MGI:5896730 Nox4 targeted mutation 1.2, Harald H H W Schmidt MGI:1354184 Nox4 NADPH oxidase 4 https://www.infrafrontier.eu/search?keyword=EM:11552 - EM:11552 STOCK Nox4 Tg(Tek-cre)1Ywa/Orl EMMA embryo mutant strain MGI:2450311 Tg(Tek-cre)1Ywa transgene insertion 1, Masashi Yanagisawa MGI:2450309 Tg(Tek-cre)1Ywa transgene insertion 1, Masashi Yanagisawa https://www.infrafrontier.eu/search?keyword=EM:11552 - EM:11553 STOCK Nox4 Tg(Myh11-icre/ERT2)1Soff/Orl EMMA embryo mutant strain MGI:3819270 Tg(Myh11-icre/ERT2)1Soff transgene insertion 1, Stefan Offermanns Tg(Myh11-cre/ERT2)1Soff transgene insertion 1, Stefan Offermanns https://www.infrafrontier.eu/search?keyword=EM:11553 - EM:11553 STOCK Nox4 Tg(Myh11-icre/ERT2)1Soff/Orl EMMA embryo mutant strain MGI:5896730 Nox4 targeted mutation 1.2, Harald H H W Schmidt MGI:1354184 Nox4 NADPH oxidase 4 https://www.infrafrontier.eu/search?keyword=EM:11553 - EM:11554 STOCK Nox4 Tg(Camk2a-cre)2Gsc/Orl EMMA embryo mutant strain MGI:5896730 Nox4 targeted mutation 1.2, Harald H H W Schmidt MGI:1354184 Nox4 NADPH oxidase 4 https://www.infrafrontier.eu/search?keyword=EM:11554 - EM:11554 STOCK Nox4 Tg(Camk2a-cre)2Gsc/Orl EMMA embryo mutant strain MGI:2181426 Tg(Camk2a-cre)2Gsc transgene insertion 2, Gunther Schutz MGI:2181425 Tg(Camk2a-cre)2Gsc transgene insertion 2, Gunther Schutz https://www.infrafrontier.eu/search?keyword=EM:11554 + EM:10414 STOCK Noto/Kctt EMMA sperm mutant strain MGI:5317920 Noto targeted mutation 2.1, Achim Gossler MGI:3053002 Noto notochord homeobox https://www.infrafrontier.eu/search?keyword=EM:10414 + EM:10371 STOCK Noto/Kctt EMMA sperm mutant strain MGI:3053092 Noto targeted mutation 1, Achim Gossler MGI:3053002 Noto notochord homeobox https://www.infrafrontier.eu/search?keyword=EM:10371 + EM:06271 STOCK Nfkbia Tg(KRT14-cre)1Cgn/Ieg EMMA embryo K14cre Ikba mutant strain MGI:3577709 Nfkbia targeted mutation 1, Klaus Pfeffer MGI:104741 Nfkbia nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, alpha https://www.infrafrontier.eu/search?keyword=EM:06271 + EM:06271 STOCK Nfkbia Tg(KRT14-cre)1Cgn/Ieg EMMA embryo K14cre Ikba mutant strain MGI:2652655 Tg(KRT14-cre)1Cgn transgene insertion 1, University of Cologne MGI:2652653 Tg(KRT14-cre)1Cgn transgene insertion 1, University of Cologne https://www.infrafrontier.eu/search?keyword=EM:06271 + EM:07146 STOCK Nebl/Cnrm EMMA embryo Nebulette knockout mouse mutant strain MGI:7277813 Nebl targeted mutation 1, Ju Chen MGI:1921353 Nebl nebulette https://www.infrafrontier.eu/search?keyword=EM:07146 + EM:07146 STOCK Nebl/Cnrm EMMA sperm Nebulette knockout mouse mutant strain MGI:7277813 Nebl targeted mutation 1, Ju Chen MGI:1921353 Nebl nebulette https://www.infrafrontier.eu/search?keyword=EM:07146 + EM:07147 STOCK Neb/Cnrm EMMA embryo mutant strain MGI:5618471 Neb targeted mutation 2.1, Ju Chen MGI:97292 Neb nebulin https://www.infrafrontier.eu/search?keyword=EM:07147 + EM:07147 STOCK Neb/Cnrm EMMA sperm mutant strain MGI:5618471 Neb targeted mutation 2.1, Ju Chen MGI:97292 Neb nebulin https://www.infrafrontier.eu/search?keyword=EM:07147 ? EM:07145 STOCK Neb/Cnrm EMMA archived mutant strain MGI:3664092 Neb targeted mutation 1, Ju Chen MGI:97292 Neb nebulin https://www.infrafrontier.eu/search?keyword=EM:07145 + EM:06115 STOCK Nbr1/H EMMA sperm Nbr1D50R mutant strain MGI:6750916 Nbr1 targeted mutation 2, Caroline A Whitehouse MGI:108498 Nbr1 NBR1, autophagy cargo receptor https://www.infrafrontier.eu/search?keyword=EM:06115 - EM:11120 STOCK Nanog/Cnrm EMMA embryo mutant strain Nanog Nanog MGI:1919200 Nanog Nanog homeobox https://www.infrafrontier.eu/search?keyword=EM:11120 - EM:11120 STOCK Nanog/Cnrm EMMA sperm mutant strain Nanog Nanog MGI:1919200 Nanog Nanog homeobox https://www.infrafrontier.eu/search?keyword=EM:11120 + EM:05011 STOCK Myo7a/WtsiCnbc EMMA embryo Shaker1 mutant strain MGI:1856716 Myo7a shaker 1 MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:05011 + EM:05020 STOCK Myo7a/WtsiH EMMA embryo Moonwalker, Sanger Moonwalker mutant strain MGI:1860092 Myo7a shaker 1, 6 Jackson MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:05020 + EM:00428 STOCK Myo7a<816SB>/NihrH EMMA sperm Myo7a, Myo7a, CBBS-Myo7a<816SB>/NihrH mutant strain MGI:2155423 Myo7a<816SB> shaker 816SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:00428 + EM:04897 STOCK Myo7a<4626SB>/WtsiCnbc EMMA embryo Myo7a<4626SB> mutant strain MGI:2155422 Myo7a<4626SB> shaker 4626SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:04897 + EM:00442 STOCK Myo7a<4626SB>/NihrH EMMA embryo CBBS-Myo7a<4626SB>/NihrH, Myo7a, Myo7a mutant strain MGI:2155422 Myo7a<4626SB> shaker 4626SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:00442 + EM:00442 STOCK Myo7a<4626SB>/NihrH EMMA sperm CBBS-Myo7a<4626SB>/NihrH, Myo7a, Myo7a mutant strain MGI:2155422 Myo7a<4626SB> shaker 4626SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:00442 + EM:00436 STOCK Myo7a<4494SB>/NihrH EMMA sperm CBBS-Myo7a<4494SB>/NihrH, Myo7a, Myo7a mutant strain MGI:2155421 Myo7a<4494SB> shaker 4494SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:00436 + EM:00427 STOCK Myo7a<3336SB>/NihrH EMMA sperm CBBS-Myo7a<3336SB>/H, Myo7a, Myo7a<3336SB>/NihrH mutant strain MGI:2155420 Myo7a<3336SB> shaker 3336SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:00427 + EM:00441 STOCK Myo7a<26SB>/NihrH EMMA sperm Myo7a, Myo7a, CBBS-Myo7a<26SB>/NihrH mutant strain MGI:2155417 Myo7a<26SB> shaker 26SB MGI:104510 Myo7a myosin VIIA https://www.infrafrontier.eu/search?keyword=EM:00441 - EM:10988 STOCK Myh7b/WtsiPh EMMA sperm mutant strain MGI:5013737 Myh7b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3710243 Myh7b myosin, heavy chain 7B, cardiac muscle, beta https://www.infrafrontier.eu/search?keyword=EM:10988 - EM:05672 STOCK Mx1/WtsiH EMMA sperm mutant strain MGI:4431734 Mx1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97243 Mx1 MX dynamin-like GTPase 1 https://www.infrafrontier.eu/search?keyword=EM:05672 + EM:01952 STOCK Mut921/H EMMA embryo MUT/921, MUT921 mutant strain MGI:5430732 Mut921 Mut921 MGI:5430735 Mut921 Mut921 https://www.infrafrontier.eu/search?keyword=EM:01952 + EM:01951 STOCK Mut1602/H EMMA embryo MUT1602, MUT/1602 mutant strain MGI:5470123 Mut1602 Mut1602 MGI:5470121 Mut1602 Mut1602 https://www.infrafrontier.eu/search?keyword=EM:01951 + EM:01954 STOCK Mut1544/H EMMA embryo MUT1544, MUT/1544 mutant strain MGI:5442354 Mut1544 Mut1544 MGI:5442350 Mut1544 Mut1544 https://www.infrafrontier.eu/search?keyword=EM:01954 + EM:01977 STOCK Mut1488/H EMMA embryo MUT/1488, MUT1488 mutant strain MGI:5470112 Mut1488 Mut1488 MGI:5470110 Mut1488 Mut1488 https://www.infrafrontier.eu/search?keyword=EM:01977 + EM:01976 STOCK Mut1397/H EMMA embryo MUT/1397, MUT1397 mutant strain MGI:5428963 Mut1397 Mut1397 MGI:5428961 Mut1397 Mut1397 https://www.infrafrontier.eu/search?keyword=EM:01976 + EM:01948 STOCK Mut1305/H EMMA embryo MUT1305, MUT/1305 mutant strain MGI:5429756 Mut1305 Mut1305 MGI:5429751 Mut1305 Mut1305 https://www.infrafrontier.eu/search?keyword=EM:01948 + EM:01950 STOCK Mut1293/H EMMA embryo MUT1293, MUT/1293 mutant strain MGI:5427423 Mut1293 Mut1293 MGI:5427421 Mut1293 Mut1293 https://www.infrafrontier.eu/search?keyword=EM:01950 + EM:01949 STOCK Mut1264/H EMMA embryo MUT/1264, MUT1264 mutant strain MGI:5427414 Mut1264 Mut1264 MGI:5427412 Mut1264 Mut1264 https://www.infrafrontier.eu/search?keyword=EM:01949 + EM:01953 STOCK Mut1154/H EMMA embryo MUT/1154, MUT1154 mutant strain MGI:5427409 Mut1154 Mut1154 MGI:5427407 Mut1154 Mut1154 https://www.infrafrontier.eu/search?keyword=EM:01953 ? EM:14012 STOCK Mta3/WtsiOulu EMMA embryo mutant strain MGI:4419906 Mta3 targeted mutation 3a, Wellcome Trust Sanger Institute MGI:2151172 Mta3 metastasis associated 3 https://www.infrafrontier.eu/search?keyword=EM:14012 + EM:08236 STOCK Msh5/Cnrm EMMA embryo Msh5 mutant strain MGI:1858057 Msh5 targeted mutation 1, Raju Kucherlapati MGI:1329021 Msh5 mutS homolog 5 https://www.infrafrontier.eu/search?keyword=EM:08236 + EM:08236 STOCK Msh5/Cnrm EMMA sperm Msh5 mutant strain MGI:1858057 Msh5 targeted mutation 1, Raju Kucherlapati MGI:1329021 Msh5 mutS homolog 5 https://www.infrafrontier.eu/search?keyword=EM:08236 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:3664578 Mr1 targeted mutation 1, Susan Gilfillan MGI:1195463 Mr1 major histocompatibility complex, class I-related https://www.infrafrontier.eu/search?keyword=EM:04509 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:5829575 Tg(Tcra-V19-J33)#Lantz transgene insertion, Olivier Lantz MGI:5829571 Tg(Tcra-V19-J33)#Lantz transgene insertion, Olivier Lantz https://www.infrafrontier.eu/search?keyword=EM:04509 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:1857253 Tap1 targeted mutation 1, Philip Ashton-Rickardt MGI:98483 Tap1 transporter 1, ATP-binding cassette, sub-family B (MDR/TAP) https://www.infrafrontier.eu/search?keyword=EM:04509 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:2180883 Tcra targeted mutation 1, Michael J Owen MGI:98553 Tcra T cell receptor alpha chain https://www.infrafrontier.eu/search?keyword=EM:04509 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:1927205 Cd74 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:96534 Cd74 CD74 antigen (invariant polypeptide of major histocompatibility complex, class II antigen-associated) https://www.infrafrontier.eu/search?keyword=EM:04509 + EM:04509 STOCK Mr1 Tcra Tap1 Cd74 Tg(Tcra-V19-J33)#Lantz Tg(Tcrb-V6)#Lantz/Orl EMMA embryo iVa19/Vb6 Calpha ko TAP-/- ii -/- MR1+/- mutant strain MGI:5829578 Tg(Tcrb-V6)#Lantz transgene insertion, Olivier Lantz MGI:5829577 Tg(Tcrb-V6)#Lantz transgene insertion, Olivier Lantz https://www.infrafrontier.eu/search?keyword=EM:04509 + EM:09986 STOCK Mok/IcsOrl EMMA sperm HEPD0530_7_A11 mutant strain MGI:4841489 Mok targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1336881 Mok MOK protein kinase https://www.infrafrontier.eu/search?keyword=EM:09986 + EM:08367 STOCK Mog/Flmg EMMA sperm B6-Mog/Flmg mutant strain MGI:3689957 Mog targeted mutation 1, George Kollias MGI:97435 Mog myelin oligodendrocyte glycoprotein https://www.infrafrontier.eu/search?keyword=EM:08367 + EM:09960 STOCK Mmp9/IcsOrl EMMA sperm mutant strain MGI:5286404 Mmp9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97011 Mmp9 matrix metallopeptidase 9 https://www.infrafrontier.eu/search?keyword=EM:09960 + EM:05667 STOCK Mlana/Cnbc EMMA sperm Mlana mutant strain MGI:5476663 Mlana targeted mutation 1.2, Friedrich Beermann MGI:108454 Mlana melan-A https://www.infrafrontier.eu/search?keyword=EM:05667 + EM:05333 STOCK Mlana/Cnbc EMMA sperm Mlana, B6;129-Mlana/Cnbc mutant strain MGI:5476658 Mlana targeted mutation 1.1, Friedrich Beermann MGI:108454 Mlana melan-A https://www.infrafrontier.eu/search?keyword=EM:05333 + EM:10361 STOCK Mkrn1/Biat EMMA sperm mutant strain MGI:5430125 Mkrn1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1859353 Mkrn1 makorin, ring finger protein, 1 https://www.infrafrontier.eu/search?keyword=EM:10361 + EM:00439 STOCK Mitf/H EMMA embryo Mitf, GENA336, C3H;C-Mitf/H, Rorp mutant strain MGI:2178357 Mitf retinal orange patches MGI:104554 Mitf melanogenesis associated transcription factor https://www.infrafrontier.eu/search?keyword=EM:00439 + EM:00439 STOCK Mitf/H EMMA sperm Mitf, GENA336, C3H;C-Mitf/H, Rorp mutant strain MGI:2178357 Mitf retinal orange patches MGI:104554 Mitf melanogenesis associated transcription factor https://www.infrafrontier.eu/search?keyword=EM:00439 ? EM:12387 STOCK Mirc35/Kctt EMMA sperm mutant strain Mirc35 Mirc35 MGI:5475136 Mirc35 microRNA cluster 35, including Mir182 through Mir183 https://www.infrafrontier.eu/search?keyword=EM:12387 + EM:05330 STOCK Mir451a/Cnrm EMMA embryo STOCK Mir451/Cnrm mutant strain MGI:4829620 Mir451a targeted mutation 1.2, Donal O'Carroll MGI:3619412 Mir451a microRNA 451a https://www.infrafrontier.eu/search?keyword=EM:05330 + EM:05330 STOCK Mir451a/Cnrm EMMA sperm STOCK Mir451/Cnrm mutant strain MGI:4829620 Mir451a targeted mutation 1.2, Donal O'Carroll MGI:3619412 Mir451a microRNA 451a https://www.infrafrontier.eu/search?keyword=EM:05330 + EM:05328 STOCK Mir144/Mir451a/Cnrm EMMA embryo STOCK Mir144/Mir451/Cnrm mutant strain MGI:4829618 Mir144/Mir451a targeted mutation 1.2, Donal O'Carroll MGI:2676829 Mir144 microRNA 144 https://www.infrafrontier.eu/search?keyword=EM:05328 ? EM:11109 STOCK Micu1/H EMMA sperm mutant strain MGI:6473466 Micu1 targeted mutation 1a, National Laboratory Animal Center MGI:2384909 Micu1 mitochondrial calcium uptake 1 https://www.infrafrontier.eu/search?keyword=EM:11109 + EM:00262 STOCK Mgmt Tg(CRP-cre)1Iz/Cnrm EMMA embryo STOCK Tg(CRP-cre)1Iz Mgmt/Cnrm, STOCK Tg(CRP-cre)1Iz Agat, STOCK Tg(CRP-cre)1Iz Mgmt/Ibcm, floxed(mgmt)-Tg/hCRP-Cre mutant stock MGI:2652465 Tg(CRP-cre)1Iz transgene insertion 1, Manfred F Rajewsky MGI:2652463 Tg(CRP-cre)1Iz transgene insertion 1, Manfred F Rajewsky https://www.infrafrontier.eu/search?keyword=EM:00262 + EM:00262 STOCK Mgmt Tg(CRP-cre)1Iz/Cnrm EMMA embryo STOCK Tg(CRP-cre)1Iz Mgmt/Cnrm, STOCK Tg(CRP-cre)1Iz Agat, STOCK Tg(CRP-cre)1Iz Mgmt/Ibcm, floxed(mgmt)-Tg/hCRP-Cre mutant stock MGI:2652462 Mgmt targeted mutation 1, Manfred F Rajewsky MGI:96977 Mgmt O-6-methylguanine-DNA methyltransferase https://www.infrafrontier.eu/search?keyword=EM:00262 + EM:09502 STOCK Men1/Flmg EMMA embryo Men1floxed/floxed mutant strain MGI:2675250 Men1 targeted mutation 1, Zhao-Qi Wang MGI:1316736 Men1 multiple endocrine neoplasia 1 https://www.infrafrontier.eu/search?keyword=EM:09502 + EM:09755 STOCK Meis3/Cnrm EMMA sperm STOCK Meis3/Cnrm mutant strain MGI:5660020 Meis3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:108519 Meis3 Meis homeobox 3 https://www.infrafrontier.eu/search?keyword=EM:09755 + EM:10029 STOCK Mbd5/Ics EMMA sperm EPD0056_1_E03 mutant strain MGI:4434485 Mbd5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2138934 Mbd5 methyl-CpG binding domain protein 5 https://www.infrafrontier.eu/search?keyword=EM:10029 ? EM:08375 STOCK Mapkapk2/Flmg EMMA sperm mutant strain MGI:6357679 Mapkapk2 targeted mutation 1.2, George Kollias MGI:109298 Mapkapk2 MAP kinase-activated protein kinase 2 https://www.infrafrontier.eu/search?keyword=EM:08375 ? EM:08374 STOCK Mapkapk2/Flmg EMMA sperm mutant strain MGI:6357678 Mapkapk2 targeted mutation 1.1, George Kollias MGI:109298 Mapkapk2 MAP kinase-activated protein kinase 2 https://www.infrafrontier.eu/search?keyword=EM:08374 + EM:08371 STOCK Map3k8/Flmg EMMA sperm B6-Map3k8tm1.2Gkl/Flmg mutant strain MGI:5476711 Map3k8 targeted mutation 1.2, George Kollias MGI:1346878 Map3k8 mitogen-activated protein kinase kinase kinase 8 https://www.infrafrontier.eu/search?keyword=EM:08371 + EM:08428 STOCK Map3k7/Flmg EMMA sperm TAK1delta/+ [B6-Map3k7tm1.2Gkl/Flmg] mutant strain MGI:5576980 Map3k7 targeted mutation 1.2, George Kollias MGI:1346877 Map3k7 mitogen-activated protein kinase kinase kinase 7 https://www.infrafrontier.eu/search?keyword=EM:08428 + EM:08404 STOCK Map3k7/Flmg EMMA sperm TAK1FL/FL mutant strain MGI:5576979 Map3k7 targeted mutation 1.1, George Kollias MGI:1346877 Map3k7 mitogen-activated protein kinase kinase kinase 7 https://www.infrafrontier.eu/search?keyword=EM:08404 + EM:00423 STOCK Maf/H EMMA embryo OFL, C3H101H-Maf/H mutant strain MGI:2654153 Maf opaque flecks in lens MGI:96909 Maf avian musculoaponeurotic fibrosarcoma oncogene homolog https://www.infrafrontier.eu/search?keyword=EM:00423 + EM:00423 STOCK Maf/H EMMA sperm OFL, C3H101H-Maf/H mutant strain MGI:2654153 Maf opaque flecks in lens MGI:96909 Maf avian musculoaponeurotic fibrosarcoma oncogene homolog https://www.infrafrontier.eu/search?keyword=EM:00423 + EM:01877 STOCK M241b Foxq1/M241b<+> Foxq1<+>/H EMMA embryo M241B mutant strain MGI:5515441 M241b mutant 241b MGI:5515439 M241b mutant 241b https://www.infrafrontier.eu/search?keyword=EM:01877 + EM:01877 STOCK M241b Foxq1/M241b<+> Foxq1<+>/H EMMA embryo M241B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01877 + EM:01877 STOCK M241b Foxq1/M241b<+> Foxq1<+>/H EMMA sperm M241B mutant strain MGI:5515441 M241b mutant 241b MGI:5515439 M241b mutant 241b https://www.infrafrontier.eu/search?keyword=EM:01877 + EM:01877 STOCK M241b Foxq1/M241b<+> Foxq1<+>/H EMMA sperm M241B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01877 + EM:09826 STOCK Lsm14b/WtsiPh EMMA sperm DEPD00559_1_C05 mutant strain MGI:4950120 Lsm14b targeted mutation 1a, Mouse Biology Program, UCDavis MGI:3040677 Lsm14b LSM family member 14B https://www.infrafrontier.eu/search?keyword=EM:09826 + EM:02514 STOCK Lrig3/RobH EMMA embryo mutant strain MGI:6468484 Lrig3 targeted mutation 1, Elizabeth Robertson MGI:2443955 Lrig3 leucine-rich repeats and immunoglobulin-like domains 3 https://www.infrafrontier.eu/search?keyword=EM:02514 + EM:12882 STOCK Loxl2/Cnbc EMMA embryo mutant strain MGI:5750228 Loxl2 targeted mutation 1.2, Amparo Cano MGI:2137913 Loxl2 lysyl oxidase-like 2 https://www.infrafrontier.eu/search?keyword=EM:12882 ? EM:12916 STOCK Loxl2/2AcanCnbc EMMA embryo mutant strain MGI:5750228 Loxl2 targeted mutation 1.2, Amparo Cano MGI:2137913 Loxl2 lysyl oxidase-like 2 https://www.infrafrontier.eu/search?keyword=EM:12916 ? EM:13005 STOCK Loxl2/Cnbc EMMA embryo mutant strain MGI:5750226 Loxl2 targeted mutation 1.1, Amparo Cano MGI:2137913 Loxl2 lysyl oxidase-like 2 https://www.infrafrontier.eu/search?keyword=EM:13005 + EM:04898 STOCK Lmx1a/Cnbc EMMA embryo Mutanlallemande mutant strain MGI:5423987 Lmx1a mutanlallemand MGI:1888519 Lmx1a LIM homeobox transcription factor 1 alpha https://www.infrafrontier.eu/search?keyword=EM:04898 + EM:10357 STOCK Lipa/Biat EMMA sperm INFRA-HEPD0960_2_H11-1 mutant strain MGI:5428633 Lipa targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96789 Lipa lysosomal acid lipase A https://www.infrafrontier.eu/search?keyword=EM:10357 + EM:11119 STOCK Lin28b/Cnrm EMMA embryo Lin28bdeltaOBS mutant strain MGI:6468553 Lin28b targeted mutation 1, Antonio Simeone MGI:3584032 Lin28b lin-28 homolog B https://www.infrafrontier.eu/search?keyword=EM:11119 + EM:11119 STOCK Lin28b/Cnrm EMMA sperm Lin28bdeltaOBS mutant strain MGI:6468553 Lin28b targeted mutation 1, Antonio Simeone MGI:3584032 Lin28b lin-28 homolog B https://www.infrafrontier.eu/search?keyword=EM:11119 + EM:01706 STOCK Lim2/H EMMA embryo C3H101H-Lim2/H, To3 mutant strain MGI:1862040 Lim2 total opacity 3 MGI:104698 Lim2 lens intrinsic membrane protein 2 https://www.infrafrontier.eu/search?keyword=EM:01706 + EM:02183 STOCK Lig4/ApbH EMMA sperm C57BL/6JSfdAnu-Lig4/ApbH, C57BL/6Apb-Lig4/ApbH, Tiny, Lig4Y288C, C57BL/6JApb-Lig4/ApbH, C57BL/6Apb-Lig4/Apb, C57BL/6Apb-Lig4/Apb mutant strain MGI:3714783 Lig4 tiny MGI:1335098 Lig4 ligase IV, DNA, ATP-dependent https://www.infrafrontier.eu/search?keyword=EM:02183 + EM:02519 STOCK Lhx1/H EMMA embryo Lim-1 (Lhx-1) mutant strain MGI:1857848 Lhx1 targeted mutation 1, Richard R Behringer MGI:99783 Lhx1 LIM homeobox protein 1 https://www.infrafrontier.eu/search?keyword=EM:02519 + EM:07422 STOCK Lgals3/H EMMA sperm SJL;Cg-Lgals3/H, SJL/J Lgals3 mutant strain MGI:2183057 Lgals3 targeted mutation 1, Francoise Poirier MGI:96778 Lgals3 lectin, galactose binding, soluble 3 https://www.infrafrontier.eu/search?keyword=EM:07422 + EM:00129 STOCK Lcl/H EMMA embryo C3;CAnN-Lcl/H, C3.Cg-Lcl/H, C3H.C-Lcl/H, Lcl, C3N;CAnN-Lcl/H mutant strain MGI:2178627 Lcl lens cloudy MGI:2149028 Lcl lens cloudy https://www.infrafrontier.eu/search?keyword=EM:00129 + EM:00129 STOCK Lcl/H EMMA sperm C3;CAnN-Lcl/H, C3.Cg-Lcl/H, C3H.C-Lcl/H, Lcl, C3N;CAnN-Lcl/H mutant strain MGI:2178627 Lcl lens cloudy MGI:2149028 Lcl lens cloudy https://www.infrafrontier.eu/search?keyword=EM:00129 + EM:12384 STOCK Lama3/Ieg EMMA sperm mutant strain MGI:6121104 Lama3 targeted mutation 1, TaconicArtemis MGI:99909 Lama3 laminin, alpha 3 https://www.infrafrontier.eu/search?keyword=EM:12384 + EM:09157 STOCK L3mbtl2/WtsiPh EMMA sperm EPD0960_5_A06 mutant strain MGI:5472695 L3mbtl2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2443584 L3mbtl2 L3MBTL2 polycomb repressive complex 1 subunit https://www.infrafrontier.eu/search?keyword=EM:09157 + EM:10723 STOCK Klhl4/Oulu EMMA embryo mutant strain MGI:6317340 Klhl4 targeted mutation 1, Kari Alitalo MGI:2442829 Klhl4 kelch-like 4 https://www.infrafrontier.eu/search?keyword=EM:10723 + EM:02205 STOCK Kit/H EMMA embryo C3H101H-Kit/H mutant strain MGI:1856258 Kit banded MGI:96677 Kit KIT proto-oncogene receptor tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:02205 ? EM:11386 STOCK Kdm6b/Wtsi EMMA archived mutant strain MGI:6317387 Kdm6b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2448492 Kdm6b KDM1 lysine (K)-specific demethylase 6B https://www.infrafrontier.eu/search?keyword=EM:11386 + EM:10166 STOCK Kcnip3/Orl EMMA sperm P5370-HEPD0546_1_G09, HEPD0546_1_G09 mutant strain MGI:4436314 Kcnip3 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1929258 Kcnip3 Kv channel interacting protein 3, calsenilin https://www.infrafrontier.eu/search?keyword=EM:10166 + EM:02515 STOCK Invs/H EMMA embryo INV mutant strain MGI:1856915 Invs inversion of embryonic turning MGI:1335082 Invs inversin https://www.infrafrontier.eu/search?keyword=EM:02515 + EM:08502 STOCK Il10/Cnbc EMMA sperm EPD0158_4_D06 mutant strain MGI:4432290 Il10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96537 Il10 interleukin 10 https://www.infrafrontier.eu/search?keyword=EM:08502 + EM:02108 STOCK Ighm/Orl EMMA embryo pAp-mu mutant strain MGI:4950361 Ighm targeted mutation 1.1, Ahmed Khamlichi MGI:96448 Ighm immunoglobulin heavy constant mu https://www.infrafrontier.eu/search?keyword=EM:02108 + EM:02111 STOCK Ighg3/Orl EMMA embryo A150 mutant strain MGI:6241553 Ighg3 targeted mutation 1, Ahmed Khamlichi MGI:2144790 Ighg3 Immunoglobulin heavy constant gamma 3 https://www.infrafrontier.eu/search?keyword=EM:02111 + EM:11091 STOCK Igh/Orl EMMA sperm mutant strain MGI:6317346 Igh targeted mutation 9.1 Michel Cogne MGI:96442 Igh immunoglobulin heavy chain complex https://www.infrafrontier.eu/search?keyword=EM:11091 + EM:05659 STOCK Igh/Orl EMMA embryo IgH 3'RR-deficient mice mutant strain MGI:4836663 Igh targeted mutation 5.1, Michel Cogne MGI:96442 Igh immunoglobulin heavy chain complex https://www.infrafrontier.eu/search?keyword=EM:05659 + EM:11092 STOCK Igh/Orl EMMA sperm mutant strain MGI:6317347 Igh targeted mutation 10.1, Michel Cogne MGI:96442 Igh immunoglobulin heavy chain complex https://www.infrafrontier.eu/search?keyword=EM:11092 + EM:02109 STOCK Igh-8/Orl EMMA embryo pAp-gamma3 mutant strain MGI:4950363 Igh-8 targeted mutation 2.1, Ahmed Khamlichi MGI:96450 Igh-8 immunoglobulin heavy chain 8 (heavy chain of IgG3) https://www.infrafrontier.eu/search?keyword=EM:02109 + EM:02110 STOCK Igh-8/Orl EMMA embryo B6;129S2-Igh-8/Orl, Ig1/Ig3 mutant strain MGI:3774279 Igh-8 targeted mutation 2, Ahmed Amine Khamlichi MGI:96450 Igh-8 immunoglobulin heavy chain 8 (heavy chain of IgG3) https://www.infrafrontier.eu/search?keyword=EM:02110 + EM:01732 STOCK Igf2/H EMMA embryo S1.2Neo mutant stock MGI:5309176 Igf2 targeted mutation 4, Wolf Reik MGI:96434 Igf2 insulin-like growth factor 2 https://www.infrafrontier.eu/search?keyword=EM:01732 - EM:10974 STOCK Hspg2/Oulu EMMA embryo C57BL/6-Hspg2/Oulu mutant strain MGI:6468552 Hspg2 targeted mutation 3.1, Raija Soininen MGI:96257 Hspg2 perlecan (heparan sulfate proteoglycan 2) https://www.infrafrontier.eu/search?keyword=EM:10974 - EM:10974 STOCK Hspg2/Oulu EMMA sperm C57BL/6-Hspg2/Oulu mutant strain MGI:6468552 Hspg2 targeted mutation 3.1, Raija Soininen MGI:96257 Hspg2 perlecan (heparan sulfate proteoglycan 2) https://www.infrafrontier.eu/search?keyword=EM:10974 ? EM:13784 STOCK Hsd17b4/Orl EMMA sperm mutant strain MGI:5523923 Hsd17b4 targeted mutation 2, Myriam Baes MGI:105089 Hsd17b4 hydroxysteroid (17-beta) dehydrogenase 4 https://www.infrafrontier.eu/search?keyword=EM:13784 + EM:12344 STOCK Hsd17b4/Ph EMMA archived mutant strain MGI:2385822 Hsd17b4 targeted mutation 1, Myriam Baes MGI:105089 Hsd17b4 hydroxysteroid (17-beta) dehydrogenase 4 https://www.infrafrontier.eu/search?keyword=EM:12344 + EM:02506 STOCK Hnf4a/H EMMA embryo Is Cre, Hnf4 cre mutant strain MGI:3052820 Hnf4a targeted mutation 1, Stephane D Vincent MGI:109128 Hnf4a hepatic nuclear factor 4, alpha https://www.infrafrontier.eu/search?keyword=EM:02506 + EM:08992 STOCK Hmox1/Flmg EMMA embryo B6.129-Hmox1/Flmg mutant strain MGI:3846093 Hmox1 targeted mutation 1.2, George Kollias MGI:96163 Hmox1 heme oxygenase 1 https://www.infrafrontier.eu/search?keyword=EM:08992 ? EM:13167 STOCK Hint2 Hint1/Orl EMMA archived mutant strain MGI:5812015 Hint2 targeted mutation 1.1, Genoway MGI:1916167 Hint2 histidine triad nucleotide binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:13167 ? EM:13167 STOCK Hint2 Hint1/Orl EMMA archived mutant strain MGI:2674018 Hint1 targeted mutation 1, I Bernard Weinstein MGI:1321133 Hint1 histidine triad nucleotide binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:13167 + EM:01766 STOCK Hgd/Orl EMMA archived alkaptonuria mutant strain MGI:1856664 Hgd alkaptonuria MGI:96078 Hgd homogentisate 1, 2-dioxygenase https://www.infrafrontier.eu/search?keyword=EM:01766 + EM:05325 STOCK Hal/H EMMA embryo Histidinaemic mutant strain MGI:1856300 Hal histidinemia MGI:96010 Hal histidine ammonia lyase https://www.infrafrontier.eu/search?keyword=EM:05325 + EM:02252 STOCK H2 H2-T18 Anta/H EMMA sperm Antonia mutant strain MGI:5758945 Anta antonia MGI:5758943 Anta antonia https://www.infrafrontier.eu/search?keyword=EM:02252 - EM:12135 STOCK H2-M5/Wtsi EMMA embryo mutant strain MGI:4420089 H2-M5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95917 H2-M5 histocompatibility 2, M region locus 5 https://www.infrafrontier.eu/search?keyword=EM:12135 + EM:02617 STOCK Gtf2i/Cnbc EMMA archived CD1;129-Gtf2i/Cnbc, GTF2I-2loxP mutant strain MGI:5532204 Gtf2i targeted mutation 1, Victoria Campuzano MGI:1202722 Gtf2i general transcription factor II I https://www.infrafrontier.eu/search?keyword=EM:02617 + EM:09667 STOCK Gt(ROSA)26Sor/H EMMA sperm mutant strain MGI:2449039 Gt(ROSA)26Sor targeted mutation 2, Frank Costantini MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:09667 + EM:00410 STOCK Gt(ROSA)26Sor/Cnrm EMMA embryo RCM2, STOCK Gt(ROSA)26Sor/Ibmc mutant strain MGI:3764519 Gt(ROSA)26Sor targeted mutation 2, Anton Berns MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:00410 ? EM:11487 STOCK Gt(ROSA)26Sor/Kctt EMMA sperm mutant strain Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11487 + EM:10455 STOCK Gt(ROSA)26Sor Tg(Siglech-cre,-mCherry)#Spar/Ph EMMA sperm B6.Cg-Gt(ROSA)26Sor Tg(Siglech-cre,-mCherry)#Spar/Ph, pDCre x RFP reporter mutant strain MGI:3696099 Gt(ROSA)26Sor targeted mutation 1, Hans Jorg Fehling MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:10455 + EM:10455 STOCK Gt(ROSA)26Sor Tg(Siglech-cre,-mCherry)#Spar/Ph EMMA sperm B6.Cg-Gt(ROSA)26Sor Tg(Siglech-cre,-mCherry)#Spar/Ph, pDCre x RFP reporter mutant strain MGI:5615447 Tg(Siglech-cre,-mCherry)#Spar transgene insertion, Tim Sparwasser MGI:5615458 Tg(Siglech-cre,-mCherry)#Spar transgene insertion, Tim Sparwasser https://www.infrafrontier.eu/search?keyword=EM:10455 + EM:08181 STOCK Gt(ROSA)26Sor Tg(Ltf-icre)14Mmul/Biat EMMA sperm B6;129-R26tdRFPfl-Tg(Ltf-Cre)14 mutant strain MGI:3696099 Gt(ROSA)26Sor targeted mutation 1, Hans Jorg Fehling MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:08181 + EM:08181 STOCK Gt(ROSA)26Sor Tg(Ltf-icre)14Mmul/Biat EMMA sperm B6;129-R26tdRFPfl-Tg(Ltf-Cre)14 mutant strain MGI:5571915 Tg(Ltf-icre)14Mmul transgene insertion 14, Mathias Muller MGI:5571911 Tg(Ltf-icre)14Mmul transgene insertion 14, Mathias Muller https://www.infrafrontier.eu/search?keyword=EM:08181 ? EM:12917 STOCK Gt(ROSA)26Sor/Cncb EMMA embryo mutant strain MGI:5750303 Gt(ROSA)26Sor targeted mutation 1.1, Amparo Cano MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:12917 + EM:12186 STOCK Gt(ROSA)26Sor/H EMMA sperm mutant strain MGI:6193734 Gt(ROSA)26Sor targeted mutation 1.1, Richard Mort MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:12186 + EM:05648 STOCK Gt(ROSA)26Sor/Cnrm EMMA embryo mutant strain MGI:6468507 Gt(ROSA)26Sor targeted mutation 1, Antonio Simeone MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:05648 ? EM:13006 STOCK Gt(ROSA)26Sor/Cnbc EMMA embryo mutant strain MGI:5750301 Gt(ROSA)26Sor targeted mutation 1, Amparo Cano MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:13006 + EM:13120 STOCK Gt(ROSA)26Sor/H EMMA sperm mutant strain MGI:6150825 Gt(ROSA)26Sor targeted mutation 1, Erwin Pauws MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:13120 + EM:09668 STOCK Gt(ROSA)26Sor/H EMMA sperm STOCK Gt(ROSA)26Sor mutant strain MGI:2449038 Gt(ROSA)26Sor targeted mutation 1, Frank Costantini MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:09668 + EM:11361 STOCK Gt(ROSA)26Sor Tg(Col1a2-cre/ERT,-ALPP)7Cpd/H EMMA sperm Col1a2-Cre-ER(T);Rosa26-floxed stop eYFP mutant strain MGI:2449038 Gt(ROSA)26Sor targeted mutation 1, Frank Costantini MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11361 + EM:11361 STOCK Gt(ROSA)26Sor Tg(Col1a2-cre/ERT,-ALPP)7Cpd/H EMMA sperm Col1a2-Cre-ER(T);Rosa26-floxed stop eYFP mutant strain MGI:3785760 Tg(Col1a2-cre/ERT,-ALPP)7Cpd transgene insertion 7, Christopher P Denton MGI:3785759 Tg(Col1a2-cre/ERT,-ALPP)7Cpd transgene insertion 7, Christopher P Denton https://www.infrafrontier.eu/search?keyword=EM:11361 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA embryo mutant strain MGI:2183509 Gjb2 targeted mutation 1, Unite de Genetique des Deficits Sensoriels MGI:95720 Gjb2 gap junction protein, beta 2 https://www.infrafrontier.eu/search?keyword=EM:11488 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA embryo mutant strain MGI:2445311 Gt(ROSA)26Sor targeted mutation 1, Anton Berns MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11488 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA sperm mutant strain MGI:2183509 Gjb2 targeted mutation 1, Unite de Genetique des Deficits Sensoriels MGI:95720 Gjb2 gap junction protein, beta 2 https://www.infrafrontier.eu/search?keyword=EM:11488 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA sperm mutant strain MGI:2445311 Gt(ROSA)26Sor targeted mutation 1, Anton Berns MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11488 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA live mutant strain MGI:2183509 Gjb2 targeted mutation 1, Unite de Genetique des Deficits Sensoriels MGI:95720 Gjb2 gap junction protein, beta 2 https://www.infrafrontier.eu/search?keyword=EM:11488 + EM:11488 STOCK Gt(ROSA)26Sor Gjb2/Cnrm EMMA live mutant strain MGI:2445311 Gt(ROSA)26Sor targeted mutation 1, Anton Berns MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11488 + EM:07451 STOCK Gt(ROSA)26Sor/Kctt EMMA embryo Gt(ROSA)26Sor-mCherry-Rpl10a, mCherryTRAP mutant strain MGI:5569759 Gt(ROSA)26Sor targeted mutation 1, Jan M Stenman MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:07451 ? EM:11486 STOCK Gt(ROSA)26Sor/Kctt EMMA sperm mutant strain Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11486 + EM:12809 STOCK Gsk3a Gsk3b/H EMMA sperm mutant strain MGI:3578226 Gsk3b targeted mutation 1, Dario R Alessi MGI:1861437 Gsk3b glycogen synthase kinase 3 beta https://www.infrafrontier.eu/search?keyword=EM:12809 + EM:12809 STOCK Gsk3a Gsk3b/H EMMA sperm mutant strain MGI:3578225 Gsk3a targeted mutation 1, Dario R Alessi MGI:2152453 Gsk3a glycogen synthase kinase 3 alpha https://www.infrafrontier.eu/search?keyword=EM:12809 + EM:04895 STOCK Grxcr1/Cnbc EMMA embryo Tasmanian devil, Grxcr1, STOCK Grxcr1/WtsiCnbc[cc] mutant strain MGI:2681910 Grxcr1 tasmanian devil MGI:3577767 Grxcr1 glutaredoxin, cysteine rich 1 https://www.infrafrontier.eu/search?keyword=EM:04895 + EM:02397 STOCK Grm7 Smn1 Tg(SMN1*E134K)1Tlbt/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN*E134K)1Pks/H, STOCK Tg(SMN2)89Ahmb Smn1 Tg(SMN1*E134K)1Tlbt/H, SMN2 low/SMN E134K, STOCK Smn1 Tg(SMN1*E134K)1Tlbt Tg(SMN2)89Ahmb/H mutant strain MGI:2448989 Grm7 transgene insertion 89, Arthur H M Burghes MGI:1351344 Grm7 glutamate receptor, metabotropic 7 https://www.infrafrontier.eu/search?keyword=EM:02397 + EM:02397 STOCK Grm7 Smn1 Tg(SMN1*E134K)1Tlbt/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN*E134K)1Pks/H, STOCK Tg(SMN2)89Ahmb Smn1 Tg(SMN1*E134K)1Tlbt/H, SMN2 low/SMN E134K, STOCK Smn1 Tg(SMN1*E134K)1Tlbt Tg(SMN2)89Ahmb/H mutant strain MGI:5493441 Tg(SMN1*E134K)1Tlbt transgene insertion 1, Kevin Talbot MGI:5493438 Tg(SMN1*E134K)1Tlbt transgene insertion 1, Kevin Talbot https://www.infrafrontier.eu/search?keyword=EM:02397 + EM:02397 STOCK Grm7 Smn1 Tg(SMN1*E134K)1Tlbt/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN*E134K)1Pks/H, STOCK Tg(SMN2)89Ahmb Smn1 Tg(SMN1*E134K)1Tlbt/H, SMN2 low/SMN E134K, STOCK Smn1 Tg(SMN1*E134K)1Tlbt Tg(SMN2)89Ahmb/H mutant strain MGI:2183946 Smn1 targeted mutation 1, Michael Sendtner MGI:109257 Smn1 survival motor neuron 1 https://www.infrafrontier.eu/search?keyword=EM:02397 + EM:02500 STOCK Grm7 Smg6 Smn1/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN1*delta5-Smg6)1Pks/H, SMN Delta 5 /SMN2 low, STOCK Tg(SMN2)89Ahmb Smg6 Smn1/H, STOCK Smg6 Smn1 Tg(SMN2)89Ahmb/H mutant strain MGI:2183946 Smn1 targeted mutation 1, Michael Sendtner MGI:109257 Smn1 survival motor neuron 1 https://www.infrafrontier.eu/search?keyword=EM:02500 + EM:02500 STOCK Grm7 Smg6 Smn1/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN1*delta5-Smg6)1Pks/H, SMN Delta 5 /SMN2 low, STOCK Tg(SMN2)89Ahmb Smg6 Smn1/H, STOCK Smg6 Smn1 Tg(SMN2)89Ahmb/H mutant strain MGI:2448989 Grm7 transgene insertion 89, Arthur H M Burghes MGI:1351344 Grm7 glutamate receptor, metabotropic 7 https://www.infrafrontier.eu/search?keyword=EM:02500 + EM:02500 STOCK Grm7 Smg6 Smn1/H EMMA sperm STOCK Smn1 Tg(SMN2)89Ahmb Tg(SMN1*delta5-Smg6)1Pks/H, SMN Delta 5 /SMN2 low, STOCK Tg(SMN2)89Ahmb Smg6 Smn1/H, STOCK Smg6 Smn1 Tg(SMN2)89Ahmb/H mutant strain MGI:5493450 Smg6 transgene insertion 1, Nick Parkinson MGI:2144117 Smg6 SMG6 nonsense mediated mRNA decay factor https://www.infrafrontier.eu/search?keyword=EM:02500 - EM:05794 STOCK Grin1/WtsiOrl EMMA sperm mutant strain MGI:4432313 Grin1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95819 Grin1 glutamate receptor, ionotropic, NMDA1 (zeta 1) https://www.infrafrontier.eu/search?keyword=EM:05794 + EM:05216 STOCK Gjd4/Cnrm EMMA embryo Cx39KO mutant strain MGI:5009133 Gjd4 targeted mutation 1.1, Julia von Maltzahn MGI:2444990 Gjd4 gap junction protein, delta 4 https://www.infrafrontier.eu/search?keyword=EM:05216 + EM:01913 STOCK Gjc3/Cnrm EMMA embryo B6NCrl;129P2-Gjc3/Ibcm, STOCK Gjc3/Ibcm, Cx29 LacZ mutant strain MGI:4420945 Gjc3 targeted mutation 1.1, Klaus Willecke MGI:2153041 Gjc3 gap junction protein, gamma 3 https://www.infrafrontier.eu/search?keyword=EM:01913 + EM:07626 STOCK Gjb6/Cnrm EMMA embryo Cx30A88V, CD1;129P2-Gjb6/Cnrm mutant strain MGI:5607781 Gjb6 targeted mutation 2.2, Klaus Willecke MGI:107588 Gjb6 gap junction protein, beta 6 https://www.infrafrontier.eu/search?keyword=EM:07626 + EM:07626 STOCK Gjb6/Cnrm EMMA sperm Cx30A88V, CD1;129P2-Gjb6/Cnrm mutant strain MGI:5607781 Gjb6 targeted mutation 2.2, Klaus Willecke MGI:107588 Gjb6 gap junction protein, beta 6 https://www.infrafrontier.eu/search?keyword=EM:07626 - EM:02193 STOCK Gja8/H EMMA embryo mutant strain MGI:1857499 Gja8 nuclear opacity 2 MGI:99953 Gja8 gap junction protein, alpha 8 https://www.infrafrontier.eu/search?keyword=EM:02193 + EM:06035 STOCK Gja5/Cnrm EMMA embryo Cx40A96S mutant strain MGI:5544269 Gja5 targeted mutation 2.1, Klaus Willecke MGI:95716 Gja5 gap junction protein, alpha 5 https://www.infrafrontier.eu/search?keyword=EM:06035 + EM:01914 STOCK Gja1/Cnrm EMMA embryo Cx43KICx43floxCx31, B6NCrl;129P2-Gja1/Cnrm, B6NCrl;129P2-Gja1/Cnrm mutant strain MGI:5004864 Gja1 targeted mutation 6.2, Klaus Willecke MGI:95713 Gja1 gap junction protein, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:01914 + EM:09091 STOCK Gja1/Cnrm EMMA embryo B6N;129P2-Gja1tm79Kwi/Cnrm mutant strain MGI:5707851 Gja1 targeted mutation 11.1, Klaus Willecke MGI:95713 Gja1 gap junction protein, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:09091 + EM:09091 STOCK Gja1/Cnrm EMMA sperm B6N;129P2-Gja1tm79Kwi/Cnrm mutant strain MGI:5707851 Gja1 targeted mutation 11.1, Klaus Willecke MGI:95713 Gja1 gap junction protein, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:09091 + EM:08390 STOCK Gatad2b/Ics EMMA sperm HEPD0554_7_E03 mutant strain MGI:4434913 Gatad2b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443225 Gatad2b GATA zinc finger domain containing 2B https://www.infrafrontier.eu/search?keyword=EM:08390 + EM:00073 STOCK G6pdx/H EMMA embryo G6pd, glucose-6-phosphate, G6pdx, C3H.101H-G6pdx/H, C3H.Cg-G6pdx/H mutant strain MGI:2182739 G6pdx mutation 1, Neuherberg MGI:105979 G6pdx glucose-6-phosphate dehydrogenase X-linked https://www.infrafrontier.eu/search?keyword=EM:00073 + EM:06108 STOCK Fzr1/Cnbc EMMA embryo mutant strain MGI:3800718 Fzr1 targeted mutation 1, Marcos Malumbres MGI:1926790 Fzr1 fizzy and cell division cycle 20 related 1 https://www.infrafrontier.eu/search?keyword=EM:06108 + EM:06108 STOCK Fzr1/Cnbc EMMA sperm mutant strain MGI:3800718 Fzr1 targeted mutation 1, Marcos Malumbres MGI:1926790 Fzr1 fizzy and cell division cycle 20 related 1 https://www.infrafrontier.eu/search?keyword=EM:06108 ? EM:14602 STOCK Fzd9/Cnbc EMMA embryo mutant strain MGI:3586504 Fzd9 targeted mutation 1, Samuel J Pleasure MGI:1313278 Fzd9 frizzled class receptor 9 https://www.infrafrontier.eu/search?keyword=EM:14602 ? EM:14602 STOCK Fzd9/Cnbc EMMA sperm mutant strain MGI:3586504 Fzd9 targeted mutation 1, Samuel J Pleasure MGI:1313278 Fzd9 frizzled class receptor 9 https://www.infrafrontier.eu/search?keyword=EM:14602 + EM:00072 STOCK Fras1/PgrKieg EMMA embryo Fras-1, STOCK Fras1/Pgr, PGr-4, STOCK Fras1/PgrIeg mutant strain MGI:2667194 Fras1 targeted mutation 1, George Chalepakis MGI:2385368 Fras1 Fraser extracellular matrix complex subunit 1 https://www.infrafrontier.eu/search?keyword=EM:00072 + EM:06767 STOCK Fras1/H EMMA sperm B6;SJL-Fras1/H, Fras1 Conditional, Fras1, B6(SJL)-Fras1/H, Fras1 mutant strain MGI:5449386 Fras1 targeted mutation 1.1, Peter J Scambler MGI:2385368 Fras1 Fraser extracellular matrix complex subunit 1 https://www.infrafrontier.eu/search?keyword=EM:06767 + EM:01878 STOCK Foxq1 M876b/Foxq1<+> M876b<+>/H EMMA embryo M876B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01878 + EM:01878 STOCK Foxq1 M876b/Foxq1<+> M876b<+>/H EMMA embryo M876B mutant strain MGI:5515453 M876b mutant 876b MGI:5515451 M876b mutant 876b https://www.infrafrontier.eu/search?keyword=EM:01878 + EM:01868 STOCK Foxq1 M624b/Foxq1<+> M624b<+>/H EMMA embryo M624B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01868 + EM:01868 STOCK Foxq1 M624b/Foxq1<+> M624b<+>/H EMMA embryo M624B mutant strain MGI:5515450 M624b mutant 624b MGI:5515448 M624b mutant 624b https://www.infrafrontier.eu/search?keyword=EM:01868 + EM:01849 STOCK Foxq1 M54b/Foxq1<+> M54b<+>/H EMMA embryo M54B, STOCK M54B/H mutant strain MGI:5515438 M54b mutant 54b MGI:5515436 M54b mutant 54b https://www.infrafrontier.eu/search?keyword=EM:01849 + EM:01849 STOCK Foxq1 M54b/Foxq1<+> M54b<+>/H EMMA embryo M54B, STOCK M54B/H mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01849 + EM:01849 STOCK Foxq1 M54b/Foxq1<+> M54b<+>/H EMMA sperm M54B, STOCK M54B/H mutant strain MGI:5515438 M54b mutant 54b MGI:5515436 M54b mutant 54b https://www.infrafrontier.eu/search?keyword=EM:01849 + EM:01849 STOCK Foxq1 M54b/Foxq1<+> M54b<+>/H EMMA sperm M54B, STOCK M54B/H mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01849 + EM:01850 STOCK Foxq1 M412b/Foxq1<+> M412b<+>/H EMMA embryo M412B mutant strain MGI:5515447 M412b mutant 412b MGI:5515445 M412b mutant 412b https://www.infrafrontier.eu/search?keyword=EM:01850 + EM:01850 STOCK Foxq1 M412b/Foxq1<+> M412b<+>/H EMMA embryo M412B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01850 + EM:01850 STOCK Foxq1 M412b/Foxq1<+> M412b<+>/H EMMA sperm M412B mutant strain MGI:5515447 M412b mutant 412b MGI:5515445 M412b mutant 412b https://www.infrafrontier.eu/search?keyword=EM:01850 + EM:01850 STOCK Foxq1 M412b/Foxq1<+> M412b<+>/H EMMA sperm M412B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01850 + EM:01853 STOCK Foxq1 M369b/Foxq1<+> M369b<+>/H EMMA embryo M369B mutant strain MGI:5515444 M369b mutant 369b MGI:5515442 M369b mutant 369b https://www.infrafrontier.eu/search?keyword=EM:01853 + EM:01853 STOCK Foxq1 M369b/Foxq1<+> M369b<+>/H EMMA embryo M369B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01853 + EM:01853 STOCK Foxq1 M369b/Foxq1<+> M369b<+>/H EMMA sperm M369B mutant strain MGI:5515444 M369b mutant 369b MGI:5515442 M369b mutant 369b https://www.infrafrontier.eu/search?keyword=EM:01853 + EM:01853 STOCK Foxq1 M369b/Foxq1<+> M369b<+>/H EMMA sperm M369B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01853 + EM:01852 STOCK Foxq1 M1645b/Foxq1<+> M1645b<+>/H EMMA embryo M1645B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01852 + EM:01852 STOCK Foxq1 M1645b/Foxq1<+> M1645b<+>/H EMMA embryo M1645B mutant strain MGI:5515465 M1645b mutant 1645b MGI:5515463 M1645b mutant 1645b https://www.infrafrontier.eu/search?keyword=EM:01852 + EM:01852 STOCK Foxq1 M1645b/Foxq1<+> M1645b<+>/H EMMA sperm M1645B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01852 + EM:01852 STOCK Foxq1 M1645b/Foxq1<+> M1645b<+>/H EMMA sperm M1645B mutant strain MGI:5515465 M1645b mutant 1645b MGI:5515463 M1645b mutant 1645b https://www.infrafrontier.eu/search?keyword=EM:01852 + EM:01851 STOCK Foxq1 M1616b/ Foxq1<+> M1616b<+>/H EMMA embryo M1616B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01851 + EM:01851 STOCK Foxq1 M1616b/ Foxq1<+> M1616b<+>/H EMMA embryo M1616B mutant strain MGI:5515462 M1616b mutant 1616b MGI:5515460 M1616b mutant 1616b https://www.infrafrontier.eu/search?keyword=EM:01851 + EM:01858 STOCK Foxq1 M1185b/Foxq1<+> M1185b<+>/H EMMA embryo M1185B mutant strain MGI:5515459 M1185b mutant 1185b MGI:5515457 M1185b mutant 1185b https://www.infrafrontier.eu/search?keyword=EM:01858 + EM:01858 STOCK Foxq1 M1185b/Foxq1<+> M1185b<+>/H EMMA embryo M1185B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01858 + EM:01858 STOCK Foxq1 M1185b/Foxq1<+> M1185b<+>/H EMMA sperm M1185B mutant strain MGI:5515459 M1185b mutant 1185b MGI:5515457 M1185b mutant 1185b https://www.infrafrontier.eu/search?keyword=EM:01858 + EM:01858 STOCK Foxq1 M1185b/Foxq1<+> M1185b<+>/H EMMA sperm M1185B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01858 + EM:01857 STOCK Foxq1 M1073b/Foxq1<+> M1073b<+>/H EMMA embryo M1073B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01857 + EM:01857 STOCK Foxq1 M1073b/Foxq1<+> M1073b<+>/H EMMA embryo M1073B mutant strain MGI:5515456 M1073b mutant 1073b MGI:5515454 M1073b mutant 1073b https://www.infrafrontier.eu/search?keyword=EM:01857 + EM:01857 STOCK Foxq1 M1073b/Foxq1<+> M1073b<+>/H EMMA sperm M1073B mutant strain MGI:1857026 Foxq1 satin MGI:1298228 Foxq1 forkhead box Q1 https://www.infrafrontier.eu/search?keyword=EM:01857 + EM:01857 STOCK Foxq1 M1073b/Foxq1<+> M1073b<+>/H EMMA sperm M1073B mutant strain MGI:5515456 M1073b mutant 1073b MGI:5515454 M1073b mutant 1073b https://www.infrafrontier.eu/search?keyword=EM:01857 + EM:00038 STOCK Foxn1/Orl EMMA archived B6;albino-Foxn1/Orl, C57BL/6 - nu congenic strain MGI:1856108 Foxn1 nude MGI:102949 Foxn1 forkhead box N1 https://www.infrafrontier.eu/search?keyword=EM:00038 + EM:05943 STOCK Fntb/Cnbc EMMA sperm mutant strain MGI:3581447 Fntb targeted mutation 1, Mariano Barbacid MGI:1861305 Fntb farnesyltransferase, CAAX box, beta https://www.infrafrontier.eu/search?keyword=EM:05943 + EM:09463 STOCK Flt4/Oulu EMMA embryo Vegfr3flox/flox mutant strain MGI:3805195 Flt4 targeted mutation 2.1, Kari Alitalo MGI:95561 Flt4 FMS-like tyrosine kinase 4 https://www.infrafrontier.eu/search?keyword=EM:09463 + EM:05992 STOCK Fli1/Orl EMMA sperm mutant strain MGI:4878922 Fli1 targeted mutation 1.1, Francois Morle MGI:95554 Fli1 Friend leukemia integration 1 https://www.infrafrontier.eu/search?keyword=EM:05992 ? EM:10692 STOCK Fkrp/ScbrH EMMA sperm mutant strain MGI:4835411 Fkrp targeted mutation 1, S C Brown MGI:2447586 Fkrp fukutin related protein https://www.infrafrontier.eu/search?keyword=EM:10692 + EM:08500 STOCK Fkrp/H EMMA sperm C57BL/6;129-FKRP Tyr307Asn mutant strain MGI:4835412 Fkrp targeted mutation 1.1, S C Brown MGI:2447586 Fkrp fukutin related protein https://www.infrafrontier.eu/search?keyword=EM:08500 - EM:07684 STOCK Fgl1/IcsOrl EMMA archived mutant strain MGI:4436664 Fgl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:102795 Fgl1 fibrinogen-like protein 1 https://www.infrafrontier.eu/search?keyword=EM:07684 + EM:06912 STOCK Fgf7/H EMMA sperm mutant strain MGI:4455930 Fgf7 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:95521 Fgf7 fibroblast growth factor 7 https://www.infrafrontier.eu/search?keyword=EM:06912 + EM:02540 STOCK Fcgr1/Cnrm EMMA embryo STOCK Fcgr1/Cnrm, STOCK Fcgr1/Ibcm, CD64 KO on C57Bl6 mutant strain MGI:2664927 Fcgr1 targeted mutation 1, J Sjef Verbeek MGI:95498 Fcgr1 Fc receptor, IgG, high affinity I https://www.infrafrontier.eu/search?keyword=EM:02540 + EM:02540 STOCK Fcgr1/Cnrm EMMA sperm STOCK Fcgr1/Cnrm, STOCK Fcgr1/Ibcm, CD64 KO on C57Bl6 mutant strain MGI:2664927 Fcgr1 targeted mutation 1, J Sjef Verbeek MGI:95498 Fcgr1 Fc receptor, IgG, high affinity I https://www.infrafrontier.eu/search?keyword=EM:02540 + EM:04667 STOCK Fcamr/Cnbc EMMA embryo FcamR (4D6)- Null, STOCK Fcamr/Cnbc, FcamR-null mutant strain MGI:5882398 Fcamr targeted mutation 1.2, J Sjef Verbeek MGI:1927803 Fcamr Fc receptor, IgA, IgM, high affinity https://www.infrafrontier.eu/search?keyword=EM:04667 + EM:04667 STOCK Fcamr/Cnbc EMMA sperm FcamR (4D6)- Null, STOCK Fcamr/Cnbc, FcamR-null mutant strain MGI:5882398 Fcamr targeted mutation 1.2, J Sjef Verbeek MGI:1927803 Fcamr Fc receptor, IgA, IgM, high affinity https://www.infrafrontier.eu/search?keyword=EM:04667 + EM:04668 STOCK Fcamr/Cnbc EMMA embryo FcamR (4D6)- Floxed, STOCK Fcamr/Cnbc mutant strain MGI:5882402 Fcamr targeted mutation 1.1, J Sjef Verbeek MGI:1927803 Fcamr Fc receptor, IgA, IgM, high affinity https://www.infrafrontier.eu/search?keyword=EM:04668 + EM:12632 STOCK Fbxw7/H EMMA sperm mutant strain MGI:4867641 Fbxw7 targeted mutation 1.1, Axel Behrens MGI:1354695 Fbxw7 F-box and WD-40 domain protein 7 https://www.infrafrontier.eu/search?keyword=EM:12632 + EM:01885 STOCK Fasl/Ieg EMMA embryo B6;129-Fasl/Ieg, FasL delta intra k.o./k.i. mutant stock MGI:4888490 Fasl targeted mutation 1.1, Geert Michel MGI:99255 Fasl Fas ligand (TNF superfamily, member 6) https://www.infrafrontier.eu/search?keyword=EM:01885 + EM:09945 STOCK Exd1/CipheOrl EMMA sperm HEPD0647_4_B07 mutant strain MGI:4457525 Exd1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3045306 Exd1 exonuclease 3'-5' domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:09945 ? EM:13686 STOCK Erfe/H EMMA live mutant strain MGI:5050886 Erfe targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:3606476 Erfe erythroferrone https://www.infrafrontier.eu/search?keyword=EM:13686 - EM:02595 STOCK Epo/H EMMA embryo Epo, TgH(eposvT)1Pjr, STOCK Epo/H, Epo-Tag mutant strain MGI:3767166 Epo transgene insertion 134.3 LC, Peter J Ratcliffe MGI:95407 Epo erythropoietin https://www.infrafrontier.eu/search?keyword=EM:02595 + EM:07840 STOCK Eif6/Cnrm EMMA embryo eIF6 knockout mice mutant strain MGI:3817934 Eif6 targeted mutation 1, Stefano Biffo MGI:1196288 Eif6 eukaryotic translation initiation factor 6 https://www.infrafrontier.eu/search?keyword=EM:07840 + EM:07840 STOCK Eif6/Cnrm EMMA sperm eIF6 knockout mice mutant strain MGI:3817934 Eif6 targeted mutation 1, Stefano Biffo MGI:1196288 Eif6 eukaryotic translation initiation factor 6 https://www.infrafrontier.eu/search?keyword=EM:07840 + EM:09406 STOCK Eif2ak4/Cnbc EMMA embryo mutant strain MGI:3582154 Eif2ak4 targeted mutation 1.2, David Ron MGI:1353427 Eif2ak4 eukaryotic translation initiation factor 2 alpha kinase 4 https://www.infrafrontier.eu/search?keyword=EM:09406 + EM:09408 STOCK Eif2ak4 Eif2ak2/Cnbc EMMA embryo GCN2KO.PKRKO.DKO_PKR_GCN2 Mixed Background mutant strain MGI:3582154 Eif2ak4 targeted mutation 1.2, David Ron MGI:1353427 Eif2ak4 eukaryotic translation initiation factor 2 alpha kinase 4 https://www.infrafrontier.eu/search?keyword=EM:09408 + EM:09408 STOCK Eif2ak4 Eif2ak2/Cnbc EMMA embryo GCN2KO.PKRKO.DKO_PKR_GCN2 Mixed Background mutant strain MGI:2182590 Eif2ak2 targeted mutation 1, John C Bell MGI:1353449 Eif2ak2 eukaryotic translation initiation factor 2-alpha kinase 2 https://www.infrafrontier.eu/search?keyword=EM:09408 + EM:11834 STOCK Egr2/Orl EMMA archived unclassified MGI:3798483 Egr2 targeted mutation 4, Patrick Charney MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:11834 + EM:11828 STOCK Egr2/Orl EMMA archived unclassified MGI:2183227 Egr2 targeted mutation 3, Patrick Charnay MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:11828 + EM:04482 STOCK Egr2 Tg(CD2-icre)4Kio/H EMMA sperm STOCK Egr2 Tg(CD2-cre)4Kio/H, Egr-2-cKO mutant strain MGI:2449947 Tg(CD2-icre)4Kio transgene insertion 4, Dimitris Kioussis MGI:2449946 Tg(CD2-icre)4Kio transgene insertion 4, Dimitris Kioussis https://www.infrafrontier.eu/search?keyword=EM:04482 + EM:04482 STOCK Egr2 Tg(CD2-icre)4Kio/H EMMA sperm STOCK Egr2 Tg(CD2-cre)4Kio/H, Egr-2-cKO mutant strain MGI:2183227 Egr2 targeted mutation 3, Patrick Charnay MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:04482 + EM:11389 STOCK Egr2 Egr3 Tg(CD2-icre)4Kio/H EMMA sperm mutant strain MGI:2449947 Tg(CD2-icre)4Kio transgene insertion 4, Dimitris Kioussis MGI:2449946 Tg(CD2-icre)4Kio transgene insertion 4, Dimitris Kioussis https://www.infrafrontier.eu/search?keyword=EM:11389 + EM:11389 STOCK Egr2 Egr3 Tg(CD2-icre)4Kio/H EMMA sperm mutant strain MGI:2180063 Egr3 targeted mutation 1, Jeffrey Milbrandt MGI:1306780 Egr3 early growth response 3 https://www.infrafrontier.eu/search?keyword=EM:11389 + EM:11389 STOCK Egr2 Egr3 Tg(CD2-icre)4Kio/H EMMA sperm mutant strain MGI:2183227 Egr2 targeted mutation 3, Patrick Charnay MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:11389 + EM:11829 STOCK Egr2/Orl EMMA archived unclassified MGI:1931056 Egr2 targeted mutation 2, Patrick Charnay MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:11829 + EM:00438 STOCK Eda/H x C3H101HF1 EMMA sperm Tabby<43H> mutant strain MGI:5509473 Eda tabby 43 Harwell MGI:1195272 Eda ectodysplasin-A https://www.infrafrontier.eu/search?keyword=EM:00438 + EM:01847 STOCK Dync1h1/H EMMA embryo C3H101H-Dync1h1/H, C3H101H-Dnchc1/H, C3H;101H-Dync1h1/H, Legs at odd angles, Loa mutant strain MGI:2447991 Dync1h1 legs at odd angles MGI:103147 Dync1h1 dynein cytoplasmic 1 heavy chain 1 https://www.infrafrontier.eu/search?keyword=EM:01847 - EM:12065 STOCK Dusp1/Wtsi EMMA embryo mutant strain MGI:4364283 Dusp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:105120 Dusp1 dual specificity phosphatase 1 https://www.infrafrontier.eu/search?keyword=EM:12065 + EM:09991 STOCK Dusp11/IcsOrl EMMA sperm EPD0209_1_C08 mutant strain MGI:4434394 Dusp11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919352 Dusp11 dual specificity phosphatase 11 (RNA/RNP complex 1-interacting) https://www.infrafrontier.eu/search?keyword=EM:09991 + EM:01169 STOCK Dsg4/Orl EMMA embryo lanceolate hair mutant strain MGI:1856929 Dsg4 lanceolate hair MGI:2661061 Dsg4 desmoglein 4 https://www.infrafrontier.eu/search?keyword=EM:01169 + EM:01235 STOCK Dp(2Hoxd11)6Ddu/Orl EMMA embryo B6/129-HoxD, P11 Dup mutant strain MGI:5289967 Dp(2Hoxd11)6Ddu duplication, Chr 2, Denis Duboule 6 MGI:5288507 Dp(2Hoxd11)6Ddu duplication, Chr 2, Denis Duboule 6 https://www.infrafrontier.eu/search?keyword=EM:01235 + EM:05778 STOCK Dp(16App-Runx1)5Yah/Orl EMMA embryo Dp(16App-Runx1)5Yah mutant strain MGI:5789045 Dp(16App-Runx1)5Yah duplication, Chr 16, Yann Herault 5 MGI:5789044 Dp(16App-Runx1)5Yah duplication, Chr 16, Yann Herault 5 https://www.infrafrontier.eu/search?keyword=EM:05778 + EM:05778 STOCK Dp(16App-Runx1)5Yah/Orl EMMA sperm Dp(16App-Runx1)5Yah mutant strain MGI:5789045 Dp(16App-Runx1)5Yah duplication, Chr 16, Yann Herault 5 MGI:5789044 Dp(16App-Runx1)5Yah duplication, Chr 16, Yann Herault 5 https://www.infrafrontier.eu/search?keyword=EM:05778 + EM:09996 STOCK Dnajc5b/IcsOrl EMMA sperm HEPD0532_4_C06, E256-HEPD0532_4_C06 mutant strain MGI:4434677 Dnajc5b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913576 Dnajc5b DnaJ heat shock protein family (Hsp40) member C5 beta https://www.infrafrontier.eu/search?keyword=EM:09996 + EM:05255 STOCK Dnah5/Cnbc EMMA embryo SI-Dnahc5-spontaneous mutant mutant strain MGI:5904965 Dnah5 hydrocephalus with situs inversus or heterotaxy MGI:107718 Dnah5 dynein, axonemal, heavy chain 5 https://www.infrafrontier.eu/search?keyword=EM:05255 + EM:05255 STOCK Dnah5/Cnbc EMMA sperm SI-Dnahc5-spontaneous mutant mutant strain MGI:5904965 Dnah5 hydrocephalus with situs inversus or heterotaxy MGI:107718 Dnah5 dynein, axonemal, heavy chain 5 https://www.infrafrontier.eu/search?keyword=EM:05255 + EM:02531 STOCK Dnah11/H EMMA embryo iv, STOCK Dnahc11/H mutant strain MGI:1856917 Dnah11 situs inversus viscerum MGI:1100864 Dnah11 dynein, axonemal, heavy chain 11 https://www.infrafrontier.eu/search?keyword=EM:02531 + EM:00390 STOCK Dmd Tg(tetO-Utrn)1Ked/H EMMA sperm Tg(UTR-TET)Ked, UTR, UTR/mdx (TEX) mutant stock MGI:1856328 Dmd X linked muscular dystrophy MGI:94909 Dmd dystrophin, muscular dystrophy https://www.infrafrontier.eu/search?keyword=EM:00390 + EM:00390 STOCK Dmd Tg(tetO-Utrn)1Ked/H EMMA sperm Tg(UTR-TET)Ked, UTR, UTR/mdx (TEX) mutant stock MGI:2448084 Tg(tetO-Utrn)1Ked transgene insertion 1, Kay E Davies MGI:5140309 Tg(tetO-Utrn)1Ked transgene insertion 1, Kay E Davies https://www.infrafrontier.eu/search?keyword=EM:00390 + EM:00391 STOCK Dmd Tg(Ckm-Dmd_iDp71)MCA-1Chmb/H EMMA sperm MCA/mdx, MCA, Tg(MCA)Ked mutant stock MGI:1856328 Dmd X linked muscular dystrophy MGI:94909 Dmd dystrophin, muscular dystrophy https://www.infrafrontier.eu/search?keyword=EM:00391 + EM:00391 STOCK Dmd Tg(Ckm-Dmd_iDp71)MCA-1Chmb/H EMMA sperm MCA/mdx, MCA, Tg(MCA)Ked mutant stock MGI:5140740 Tg(Ckm-Dmd_iDp71)MCA-1Chmb transgene insertion MCA-1, Jeffrey S Chamberlain MGI:5140736 Tg(Ckm-Dmd_iDp71)MCA-1Chmb transgene insertion MCA-1, Jeffrey S Chamberlain https://www.infrafrontier.eu/search?keyword=EM:00391 + EM:02219 STOCK Dmd Tg(ACTA1-Utrn)3Ked/H EMMA sperm TgN(FLU)Ox, Tg(ACTA1-Utrn)3Ked, TgN(FLU)Ox(Freddie), Fre line, Freddie mutant strain MGI:1856328 Dmd X linked muscular dystrophy MGI:94909 Dmd dystrophin, muscular dystrophy https://www.infrafrontier.eu/search?keyword=EM:02219 + EM:02219 STOCK Dmd Tg(ACTA1-Utrn)3Ked/H EMMA sperm TgN(FLU)Ox, Tg(ACTA1-Utrn)3Ked, TgN(FLU)Ox(Freddie), Fre line, Freddie mutant strain MGI:5566891 Tg(ACTA1-Utrn)3Ked transgene insertion 3, Kay E Davies MGI:5566890 Tg(ACTA1-Utrn)3Ked transgene insertion 3, Kay E Davies https://www.infrafrontier.eu/search?keyword=EM:02219 + EM:05637 STOCK Dlx5/Cnrm EMMA embryo Dlx5-LacZ mutant strain MGI:2180474 Dlx5 targeted mutation 1, Giovanni Levi MGI:101926 Dlx5 distal-less homeobox 5 https://www.infrafrontier.eu/search?keyword=EM:05637 + EM:10388 STOCK Dll1/Biat EMMA sperm Dll1EGF1m, CD1;129-Dll1tm1(Dll1*)Gos/Biat mutant strain MGI:5805253 Dll1 targeted mutation 9.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:10388 + EM:10370 STOCK Dll1/Kctt EMMA sperm Dll1EGF8m, CD1;129-Dll1/Kctt mutant strain MGI:5805246 Dll1 targeted mutation 8.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:10370 - EM:12225 STOCK Dll1/Biat EMMA sperm mutant strain MGI:5790945 Dll1 targeted mutation 7.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:12225 - EM:12224 STOCK Dll1/Biat EMMA sperm mutant strain MGI:5779556 Dll1 targeted mutation 4.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:12224 + EM:10394 STOCK Dll1/Kctt EMMA sperm Dll1EGF7m, CD1;129-Dll1/Kctt mutant strain MGI:5805295 Dll1 targeted mutation 15.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:10394 + EM:10393 STOCK Dll1/Kctt EMMA sperm Dll1EGF6m, CD1;129-Dll1/Kctt mutant strain MGI:5805291 Dll1 targeted mutation 14.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:10393 + EM:10392 STOCK Dll1/Biat EMMA sperm Dll1EGF5m, CD1;129-Dll1/Biat mutant strain MGI:5805267 Dll1 targeted mutation 13.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:10392 + EM:10391 STOCK Dll1/Biat EMMA sperm CD1;129-Dll1/Biat, Dll1EGF4m mutant strain MGI:5805265 Dll1 targeted mutation 12.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:10391 + EM:10390 STOCK Dll1/Biat EMMA sperm Dll1EGF3m, CD1;129-Dll1/Biat mutant strain MGI:5805263 Dll1 targeted mutation 11.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:10390 + EM:10389 STOCK Dll1/Biat EMMA sperm CD1;129-Dll1/Biat, Dll1EGF2m mutant strain MGI:5805257 Dll1 targeted mutation 10.1, Achim Gossler MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:10389 + EM:02489 STOCK Dbp Hlf Tef/Cnrm EMMA embryo STOCK Dbp Hlf Tef/Ibmc, HLF-KO/DBP-KO/TEF-heterozygous mutant strain MGI:3045494 Tef targeted mutation 1, Ueli Schibler MGI:98663 Tef thyrotroph embryonic factor https://www.infrafrontier.eu/search?keyword=EM:02489 + EM:02489 STOCK Dbp Hlf Tef/Cnrm EMMA embryo STOCK Dbp Hlf Tef/Ibmc, HLF-KO/DBP-KO/TEF-heterozygous mutant strain MGI:2183196 Dbp targeted mutation 1, Ueli Schibler MGI:94866 Dbp D site albumin promoter binding protein https://www.infrafrontier.eu/search?keyword=EM:02489 + EM:02489 STOCK Dbp Hlf Tef/Cnrm EMMA embryo STOCK Dbp Hlf Tef/Ibmc, HLF-KO/DBP-KO/TEF-heterozygous mutant strain MGI:3045480 Hlf targeted mutation 1, Ueli Schibler MGI:96108 Hlf hepatic leukemia factor https://www.infrafrontier.eu/search?keyword=EM:02489 + EM:09624 STOCK Dbnl/CipheOrl EMMA sperm EPD0504_4_A04 mutant strain MGI:4451400 Dbnl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:700006 Dbnl drebrin-like https://www.infrafrontier.eu/search?keyword=EM:09624 + EM:02115 STOCK Dach1/Kctt EMMA embryo CBB6-Dach1/Kctt, CBB6;129P2-Dach1/Kctt, Dach1 KO mutant strain MGI:2448366 Dach1 targeted mutation 1, Stefan Krauss MGI:1277991 Dach1 dachshund family transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:02115 + EM:07405 STOCK Cyld/Flmg EMMA embryo Cyldtm1.1Gmos, Cylddelta9 mutant strain MGI:4819959 Cyld targeted mutation 1.1, George Mosialos MGI:1921506 Cyld CYLD lysine 63 deubiquitinase https://www.infrafrontier.eu/search?keyword=EM:07405 + EM:07405 STOCK Cyld/Flmg EMMA sperm Cyldtm1.1Gmos, Cylddelta9 mutant strain MGI:4819959 Cyld targeted mutation 1.1, George Mosialos MGI:1921506 Cyld CYLD lysine 63 deubiquitinase https://www.infrafrontier.eu/search?keyword=EM:07405 + EM:00136 STOCK Ctsl/Ieg EMMA embryo (house mouse)-Ctsl/Ieg, Nkt mutant strain MGI:1889860 Ctsl nackt MGI:88564 Ctsl cathepsin L https://www.infrafrontier.eu/search?keyword=EM:00136 + EM:09118 STOCK Csf2rb/CipheOrl EMMA sperm HEPD0596_1_D09 mutant strain MGI:4460364 Csf2rb targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1339759 Csf2rb colony stimulating factor 2 receptor, beta, low-affinity (granulocyte-macrophage) https://www.infrafrontier.eu/search?keyword=EM:09118 + EM:00612 STOCK Col4a1/H EMMA embryo Svc, C3H;C-Svc/H, GENA291, C3H;C-Col4a1/H mutant strain MGI:2178448 Col4a1 small with vacuolar cataract MGI:88454 Col4a1 collagen, type IV, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:00612 + EM:00612 STOCK Col4a1/H EMMA sperm Svc, C3H;C-Svc/H, GENA291, C3H;C-Col4a1/H mutant strain MGI:2178448 Col4a1 small with vacuolar cataract MGI:88454 Col4a1 collagen, type IV, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:00612 + EM:00379 STOCK Col4a1/H EMMA embryo GENA257, C3H;C-Raw/H, C3H;C-Col4a1/H mutant strain MGI:2178446 Col4a1 retinal arteriolar wiring MGI:88454 Col4a1 collagen, type IV, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:00379 + EM:00379 STOCK Col4a1/H EMMA sperm GENA257, C3H;C-Raw/H, C3H;C-Col4a1/H mutant strain MGI:2178446 Col4a1 retinal arteriolar wiring MGI:88454 Col4a1 collagen, type IV, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:00379 ? EM:13305 STOCK Cnn3/Ieg EMMA sperm mutant strain MGI:5825453 Cnn3 targeted mutation 1.1, Hassan Jumaa MGI:1919244 Cnn3 calponin 3, acidic https://www.infrafrontier.eu/search?keyword=EM:13305 ? EM:13945 STOCK Chia1/WtsiPh EMMA sperm mutant strain MGI:4363305 Chia1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1932052 Chia1 chitinase, acidic 1 https://www.infrafrontier.eu/search?keyword=EM:13945 ? EM:12825 STOCK Cfap43/Biat EMMA sperm mutant strain Cfap43 Cfap43 MGI:1289258 Cfap43 cilia and flagella associated protein 43 https://www.infrafrontier.eu/search?keyword=EM:12825 ? EM:12824 STOCK Cfap206/Biat EMMA sperm mutant strain MGI:6466698 Cfap206 targeted mutation 1.2, Achim Gossler MGI:1916579 Cfap206 cilia and flagella associated protein 206 https://www.infrafrontier.eu/search?keyword=EM:12824 ? EM:12822 STOCK Cfap206/Biat EMMA sperm mutant strain MGI:6466697 Cfap206 targeted mutation 1.1, Achim Gossler MGI:1916579 Cfap206 cilia and flagella associated protein 206 https://www.infrafrontier.eu/search?keyword=EM:12822 ? EM:12396 STOCK Cfap157/Biat EMMA sperm mutant strain MGI:5907283 Cfap157 targeted mutation 1d, Helmholtz Zentrum Muenchen GmbH MGI:2447809 Cfap157 cilia and flagella associated protein 157 https://www.infrafrontier.eu/search?keyword=EM:12396 - EM:08304 STOCK Cert1/Cnbc EMMA embryo mutant strain MGI:5301369 Cert1 targeted mutation 1, Juan Saus MGI:1915268 Cert1 ceramide transporter 1 https://www.infrafrontier.eu/search?keyword=EM:08304 + EM:07170 STOCK Cers6/Cnrm EMMA embryo CerS6KILacZ mutant strain MGI:5523623 Cers6 targeted mutation 1.1, Klaus Willecke MGI:2442564 Cers6 ceramide synthase 6 https://www.infrafrontier.eu/search?keyword=EM:07170 + EM:07170 STOCK Cers6/Cnrm EMMA sperm CerS6KILacZ mutant strain MGI:5523623 Cers6 targeted mutation 1.1, Klaus Willecke MGI:2442564 Cers6 ceramide synthase 6 https://www.infrafrontier.eu/search?keyword=EM:07170 + EM:07171 STOCK Cers4/Cnrm EMMA embryo CerS4KILacZ mutant strain MGI:5638668 Cers4 targeted mutation 1.1, Klaus Willecke MGI:1914510 Cers4 ceramide synthase 4 https://www.infrafrontier.eu/search?keyword=EM:07171 + EM:07171 STOCK Cers4/Cnrm EMMA sperm CerS4KILacZ mutant strain MGI:5638668 Cers4 targeted mutation 1.1, Klaus Willecke MGI:1914510 Cers4 ceramide synthase 4 https://www.infrafrontier.eu/search?keyword=EM:07171 + EM:07163 STOCK Cers1/Cnrm EMMA embryo CerS1KO mutant strain MGI:5475110 Cers1 targeted mutation 1.1, Klaus Willecke MGI:2136690 Cers1 ceramide synthase 1 https://www.infrafrontier.eu/search?keyword=EM:07163 + EM:07163 STOCK Cers1/Cnrm EMMA sperm CerS1KO mutant strain MGI:5475110 Cers1 targeted mutation 1.1, Klaus Willecke MGI:2136690 Cers1 ceramide synthase 1 https://www.infrafrontier.eu/search?keyword=EM:07163 + EM:04677 STOCK Cebpb/Kctt EMMA embryo Cebpbfl (ICER/129Sv/C57BL6), STOCK Cebpb/Kctt mutant strain MGI:6260173 Cebpb targeted mutation 1.1, Magnus Nord MGI:88373 Cebpb CCAAT/enhancer binding protein (C/EBP), beta https://www.infrafrontier.eu/search?keyword=EM:04677 + EM:04995 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a INK4a-/- mutant strain MGI:2384177 Cdkn2a targeted mutation 2.1, Ronald DePinho MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/search?keyword=EM:04995 + EM:04995 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a INK4a-/- mutant strain MGI:5648077 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University MGI:5648074 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University https://www.infrafrontier.eu/search?keyword=EM:04995 + EM:04997 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a Ink4a-Arf-/- mutant strain MGI:5648077 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University MGI:5648074 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University https://www.infrafrontier.eu/search?keyword=EM:04997 + EM:04997 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a Ink4a-Arf-/- mutant strain MGI:1857942 Cdkn2a targeted mutation 1, Ronald DePinho MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/search?keyword=EM:04997 + EM:04996 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a Arf-/- mutant strain MGI:5648077 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University MGI:5648074 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University https://www.infrafrontier.eu/search?keyword=EM:04996 + EM:04996 STOCK Cdkn2a Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a Arf-/- mutant strain MGI:1926877 Cdkn2a targeted mutation 1, Charles J Scherr MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/search?keyword=EM:04996 - EM:05879 STOCK Cdkn2a/WtsiIeg EMMA sperm mutant strain MGI:4460436 Cdkn2a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/search?keyword=EM:05879 - EM:07633 STOCK Cdk8/IcsOrl EMMA sperm mutant strain MGI:4842014 Cdk8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1196224 Cdk8 cyclin-dependent kinase 8 https://www.infrafrontier.eu/search?keyword=EM:07633 + EM:06841 STOCK Cdk7/Cnbc EMMA sperm Cdk7lox mutant strain MGI:5429213 Cdk7 gene trap D032B11, 1.1, German Gene Trap Consortium MGI:102956 Cdk7 cyclin-dependent kinase 7 https://www.infrafrontier.eu/search?keyword=EM:06841 + EM:06842 STOCK Cdk6 Cdk4/Cnbc EMMA sperm Cdk4tm1Bbd; Cdk6R31C, Cdk4R24C; Cdk6R31C mutant strain MGI:5141514 Cdk6 targeted mutation 2.1, Philip Hinds MGI:1277162 Cdk6 cyclin-dependent kinase 6 https://www.infrafrontier.eu/search?keyword=EM:06842 + EM:06842 STOCK Cdk6 Cdk4/Cnbc EMMA sperm Cdk4tm1Bbd; Cdk6R31C, Cdk4R24C; Cdk6R31C mutant strain MGI:2154520 Cdk4 targeted mutation 1, Mariano Barbacid MGI:88357 Cdk4 cyclin-dependent kinase 4 https://www.infrafrontier.eu/search?keyword=EM:06842 - EM:05702 STOCK Cdk5rap2/WtsiIeg EMMA sperm mutant strain MGI:4433427 Cdk5rap2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384875 Cdk5rap2 CDK5 regulatory subunit associated protein 2 https://www.infrafrontier.eu/search?keyword=EM:05702 + EM:00197 STOCK Cdk5rap2/Ieg EMMA embryo STOCK an/Ieg, (house mouse)-an/Ieg, an mutant strain MGI:1856646 Cdk5rap2 Hertwig's anemia MGI:2384875 Cdk5rap2 CDK5 regulatory subunit associated protein 2 https://www.infrafrontier.eu/search?keyword=EM:00197 + EM:08029 STOCK Cdk4/Cnbc EMMA embryo Cdk4, Cd4<->, Cdk4 KO mutant strain MGI:3759558 Cdk4 targeted mutation 2.1, Mariano Barbacid MGI:88357 Cdk4 cyclin-dependent kinase 4 https://www.infrafrontier.eu/search?keyword=EM:08029 + EM:08029 STOCK Cdk4/Cnbc EMMA sperm Cdk4, Cd4<->, Cdk4 KO mutant strain MGI:3759558 Cdk4 targeted mutation 2.1, Mariano Barbacid MGI:88357 Cdk4 cyclin-dependent kinase 4 https://www.infrafrontier.eu/search?keyword=EM:08029 + EM:05931 STOCK Cdk2/Cnbc EMMA sperm mutant strain MGI:3759555 Cdk2 targeted mutation 2, Sagrario Ortega MGI:104772 Cdk2 cyclin-dependent kinase 2 https://www.infrafrontier.eu/search?keyword=EM:05931 + EM:05941 STOCK Cdk2/Cnbc EMMA sperm mutant strain MGI:2675585 Cdk2 targeted mutation 1, Sagrario Ortega MGI:104772 Cdk2 cyclin-dependent kinase 2 https://www.infrafrontier.eu/search?keyword=EM:05941 + EM:04896 STOCK Cdh23/WtsiCnbc EMMA embryo Waltzer mutant strain MGI:1856228 Cdh23 waltzer MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/search?keyword=EM:04896 + EM:01316 STOCK Cdh23/WtsiH EMMA sperm v, v(ALB) mutant stock MGI:1857310 Cdh23 Albany waltzer MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/search?keyword=EM:01316 + EM:06117 STOCK Cdc20/Cnbc EMMA sperm mutant strain MGI:4887480 Cdc20 targeted mutation 1.1, Marcos Malumbres MGI:1859866 Cdc20 cell division cycle 20 https://www.infrafrontier.eu/search?keyword=EM:06117 + EM:09989 STOCK Ccdc189/IcsOrl EMMA sperm STOCK Gm166/IcsOrl, HEPD0530_3_B05 mutant strain MGI:4434616 Ccdc189 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2685012 Ccdc189 coiled-coil domain containing 189 https://www.infrafrontier.eu/search?keyword=EM:09989 + EM:08421 STOCK Cacna2d1/AschwAdlpnH EMMA sperm mutant strain MGI:4353680 Cacna2d1 targeted mutation 1, Arnold Schwartz MGI:88295 Cacna2d1 calcium channel, voltage-dependent, alpha2/delta subunit 1 https://www.infrafrontier.eu/search?keyword=EM:08421 + EM:05944 STOCK Braf/Cnbc EMMA sperm mutant strain MGI:4946645 Braf targeted mutation 1, Mariano Barbacid MGI:88190 Braf Braf transforming gene https://www.infrafrontier.eu/search?keyword=EM:05944 + EM:02513 STOCK Bmp7/H EMMA embryo Bmp7 LacZ mutant strain MGI:2136986 Bmp7 targeted mutation 2, Elizabeth J Robertson MGI:103302 Bmp7 bone morphogenetic protein 7 https://www.infrafrontier.eu/search?keyword=EM:02513 + EM:02198 STOCK Bmp7/H EMMA embryo BMP7 neo mutant strain MGI:1857654 Bmp7 targeted mutation 1, Elizabeth J Robertson MGI:103302 Bmp7 bone morphogenetic protein 7 https://www.infrafrontier.eu/search?keyword=EM:02198 + EM:02505 STOCK Bmp6/H EMMA embryo CD1;129-Bmp6/H mutant strain MGI:2136985 Bmp6 targeted mutation 1, Elizabeth J Robertson MGI:88182 Bmp6 bone morphogenetic protein 6 https://www.infrafrontier.eu/search?keyword=EM:02505 - EM:07660 STOCK Bloc1s1/IcsOrl EMMA embryo mutant strain MGI:4434990 Bloc1s1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1195276 Bloc1s1 biogenesis of lysosomal organelles complex-1, subunit 1 https://www.infrafrontier.eu/search?keyword=EM:07660 - EM:07660 STOCK Bloc1s1/IcsOrl EMMA sperm mutant strain MGI:4434990 Bloc1s1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1195276 Bloc1s1 biogenesis of lysosomal organelles complex-1, subunit 1 https://www.infrafrontier.eu/search?keyword=EM:07660 + EM:00381 STOCK Bhv26/H EMMA sperm BHV26 mutant strain MGI:5646243 Bhv26 behavioral mutation 26 MGI:5646241 Bhv26 behavioral mutation 26 https://www.infrafrontier.eu/search?keyword=EM:00381 + EM:01690 STOCK Bhv11/H EMMA embryo Wombat mouse, BHV11 mutant strain MGI:5646491 Bhv11 behavioral mutant Bhv11 MGI:5646394 Bhv11 behavioral mutant 11 https://www.infrafrontier.eu/search?keyword=EM:01690 + EM:09988 STOCK Bag1/IcsOrl EMMA sperm HEPD0505_2_B06, ICS-HEPD0505_2_B06-1 mutant strain MGI:4434714 Bag1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108047 Bag1 BCL2-associated athanogene 1 https://www.infrafrontier.eu/search?keyword=EM:09988 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/search?keyword=EM:01783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/search?keyword=EM:01783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:01783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:01783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA live STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/search?keyword=EM:01783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA live STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/search?keyword=EM:01783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA live STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:01783 + EM:01783 STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA live STOCK B2m H2-Ab1 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DR1)/Orl, HLA-A2+HLA-DR1+/IAbeta2m, Sure/L1 mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:01783 - EM:05922 STOCK B2m H2-Ab1 Tg(Cd4-EGFP)1Lt Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:05922 - EM:05922 STOCK B2m H2-Ab1 Tg(Cd4-EGFP)1Lt Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/search?keyword=EM:05922 - EM:05922 STOCK B2m H2-Ab1 Tg(Cd4-EGFP)1Lt Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived mutant strain MGI:3720219 Tg(Cd4-EGFP)1Lt transgene insertion 1, Edward Leiter MGI:3720218 Tg(Cd4-EGFP)1Lt transgene insertion 1, Edward Leiter https://www.infrafrontier.eu/search?keyword=EM:05922 - EM:05922 STOCK B2m H2-Ab1 Tg(Cd4-EGFP)1Lt Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:05922 - EM:05922 STOCK B2m H2-Ab1 Tg(Cd4-EGFP)1Lt Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA archived mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/search?keyword=EM:05922 ? EM:10977 STOCK B2m H2-Ab1 Foxp3 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain Foxp3 H2-Ab1 Foxp3 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/search?keyword=EM:10977 ? EM:10977 STOCK B2m H2-Ab1 Foxp3 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:10977 ? EM:10977 STOCK B2m H2-Ab1 Foxp3 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:10977 ? EM:10977 STOCK B2m H2-Ab1 Foxp3 Tg(HLA-A/H2-D/B2M)1Bpe Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma/Orl EMMA embryo mutant strain MGI:5312109 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann MGI:5312101 Tg(HLA-DRA*0101,HLA-DRB1*0101)1Dma transgene insertion 1, Daniel M Altmann https://www.infrafrontier.eu/search?keyword=EM:10977 - EM:06321 STOCK B2m Cd4 H2-Ab1 Tg(Cd4-CD4)2362Litt Tg(Cd4-EGFP) Tg(H2-Aa-HLA-DPA1)1Lone Tg(H2-Ab1-HLA-DPB1)1Lone Tg(HLA-A/H2-D/B2M)1Bpe/Orl EMMA archived mutant strain MGI:1857281 Cd4 targeted mutation 1, Dan R Littman MGI:88335 Cd4 CD4 antigen https://www.infrafrontier.eu/search?keyword=EM:06321 - EM:06321 STOCK B2m Cd4 H2-Ab1 Tg(Cd4-CD4)2362Litt Tg(Cd4-EGFP) Tg(H2-Aa-HLA-DPA1)1Lone Tg(H2-Ab1-HLA-DPB1)1Lone Tg(HLA-A/H2-D/B2M)1Bpe/Orl EMMA archived mutant strain MGI:5494677 Tg(H2-Ab1-HLA-DPB1)1Lone transgene insertion 1, Yu Chun Lone MGI:5494676 Tg(H2-Ab1-HLA-DPB1)1Lone transgene insertion 1, Yu Chun Lone https://www.infrafrontier.eu/search?keyword=EM:06321 - EM:06321 STOCK B2m Cd4 H2-Ab1 Tg(Cd4-CD4)2362Litt Tg(Cd4-EGFP) Tg(H2-Aa-HLA-DPA1)1Lone Tg(H2-Ab1-HLA-DPB1)1Lone Tg(HLA-A/H2-D/B2M)1Bpe/Orl EMMA archived mutant strain MGI:5494673 Tg(H2-Aa-HLA-DPA1)1Lone transgene insertion 1, Yu Chun Lone MGI:5494672 Tg(H2-Aa-HLA-DPA1)1Lone transgene insertion 1, Yu Chun Lone https://www.infrafrontier.eu/search?keyword=EM:06321 - EM:06321 STOCK B2m Cd4 H2-Ab1 Tg(Cd4-CD4)2362Litt Tg(Cd4-EGFP) Tg(H2-Aa-HLA-DPA1)1Lone Tg(H2-Ab1-HLA-DPB1)1Lone Tg(HLA-A/H2-D/B2M)1Bpe/Orl EMMA archived mutant strain MGI:3702083 Tg(Cd4-CD4)2362Litt transgene insertion 2362, Dan R Littman MGI:2673105 Tg(Cd4-CD4)2362Litt transgene insertion 2362, Dan R Littman https://www.infrafrontier.eu/search?keyword=EM:06321 - EM:06321 STOCK B2m Cd4 H2-Ab1 Tg(Cd4-CD4)2362Litt Tg(Cd4-EGFP) Tg(H2-Aa-HLA-DPA1)1Lone Tg(H2-Ab1-HLA-DPB1)1Lone Tg(HLA-A/H2-D/B2M)1Bpe/Orl EMMA archived mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:06321 - EM:06321 STOCK B2m Cd4 H2-Ab1 Tg(Cd4-CD4)2362Litt Tg(Cd4-EGFP) Tg(H2-Aa-HLA-DPA1)1Lone Tg(H2-Ab1-HLA-DPB1)1Lone Tg(HLA-A/H2-D/B2M)1Bpe/Orl EMMA archived mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:06321 - EM:06321 STOCK B2m Cd4 H2-Ab1 Tg(Cd4-CD4)2362Litt Tg(Cd4-EGFP) Tg(H2-Aa-HLA-DPA1)1Lone Tg(H2-Ab1-HLA-DPB1)1Lone Tg(HLA-A/H2-D/B2M)1Bpe/Orl EMMA archived mutant strain MGI:3720219 Tg(Cd4-EGFP)1Lt transgene insertion 1, Edward Leiter MGI:3720218 Tg(Cd4-EGFP)1Lt transgene insertion 1, Edward Leiter https://www.infrafrontier.eu/search?keyword=EM:06321 - EM:06321 STOCK B2m Cd4 H2-Ab1 Tg(Cd4-CD4)2362Litt Tg(Cd4-EGFP) Tg(H2-Aa-HLA-DPA1)1Lone Tg(H2-Ab1-HLA-DPB1)1Lone Tg(HLA-A/H2-D/B2M)1Bpe/Orl EMMA archived mutant strain MGI:3711164 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau MGI:3711152 Tg(HLA-A/H2-D/B2M)1Bpe transgene insertion 1, Beatrice Perarnau https://www.infrafrontier.eu/search?keyword=EM:06321 + EM:01789 STOCK Axin2/Ieg EMMA embryo CG;129P2-Axin2/Ieg, B6.129P2-Axin2/Ieg, Conductin (Axin2)-lacZ mutant strain MGI:3579503 Axin2 targeted mutation 1, Walter Birchmeier MGI:1270862 Axin2 axin 2 https://www.infrafrontier.eu/search?keyword=EM:01789 + EM:02424 STOCK Axd/Cnrm EMMA embryo C.Cg-Axd/Ibcm, BALB/c - Axial defects, C.Cg-Axd/Cnrm mutant strain MGI:1856670 Axd axial defects MGI:88125 Axd axial defects https://www.infrafrontier.eu/search?keyword=EM:02424 + EM:10409 STOCK Avil/Cnrm EMMA embryo Avil-iDTR, STOCK Avil/Cnrm mutant strain MGI:5805490 Avil targeted mutation 1, Paul A Heppenstall MGI:1333798 Avil advillin https://www.infrafrontier.eu/search?keyword=EM:10409 + EM:10409 STOCK Avil/Cnrm EMMA sperm Avil-iDTR, STOCK Avil/Cnrm mutant strain MGI:5805490 Avil targeted mutation 1, Paul A Heppenstall MGI:1333798 Avil advillin https://www.infrafrontier.eu/search?keyword=EM:10409 + EM:01886 STOCK Aven/Ieg EMMA embryo B6;129-Aven/Ieg, Aven knockout mutant stock MGI:5317759 Aven targeted mutation 1.1, Martin Zoernig MGI:1921518 Aven apoptosis, caspase activation inhibitor https://www.infrafrontier.eu/search?keyword=EM:01886 + EM:06109 STOCK Aurkb/Cnbc EMMA embryo mutant strain MGI:5056426 Aurkb targeted mutation 1.1, Marcos Malumbres MGI:107168 Aurkb aurora kinase B https://www.infrafrontier.eu/search?keyword=EM:06109 + EM:06109 STOCK Aurkb/Cnbc EMMA sperm mutant strain MGI:5056426 Aurkb targeted mutation 1.1, Marcos Malumbres MGI:107168 Aurkb aurora kinase B https://www.infrafrontier.eu/search?keyword=EM:06109 + EM:06220 STOCK Atr/Cnbc EMMA sperm mutant strain MGI:4355009 Atr targeted mutation 2, Oscar Fernandez-Capetillo MGI:108028 Atr ataxia telangiectasia and Rad3 related https://www.infrafrontier.eu/search?keyword=EM:06220 + EM:06221 STOCK Atr/Cnbc EMMA embryo mutant strain MGI:4355008 Atr targeted mutation 1, Oscar Fernandez-Capetillo MGI:108028 Atr ataxia telangiectasia and Rad3 related https://www.infrafrontier.eu/search?keyword=EM:06221 + EM:06221 STOCK Atr/Cnbc EMMA sperm mutant strain MGI:4355008 Atr targeted mutation 1, Oscar Fernandez-Capetillo MGI:108028 Atr ataxia telangiectasia and Rad3 related https://www.infrafrontier.eu/search?keyword=EM:06221 + EM:07148 STOCK Atat1/Cnrm EMMA embryo Atat1 Flx mutant strain MGI:5549959 Atat1 targeted mutation 1.1, Paul A Heppenstall MGI:1913869 Atat1 alpha tubulin acetyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:07148 + EM:07148 STOCK Atat1/Cnrm EMMA sperm Atat1 Flx mutant strain MGI:5549959 Atat1 targeted mutation 1.1, Paul A Heppenstall MGI:1913869 Atat1 alpha tubulin acetyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:07148 + EM:10742 STOCK Arpc2/WtsiBiat EMMA sperm B6Dnk;B6Brd;B6N-Tyr Arpc2/WtsiBiat mutant strain MGI:5819114 Arpc2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1923959 Arpc2 actin related protein 2/3 complex, subunit 2 https://www.infrafrontier.eu/search?keyword=EM:10742 + EM:02443 STOCK Arap2/H EMMA sperm PARX, A9 mutant strain MGI:5514159 Arap2 gene trap mutation 9A, Katherine A Vallis MGI:2684416 Arap2 ArfGAP with RhoGAP domain, ankyrin repeat and PH domain 2 https://www.infrafrontier.eu/search?keyword=EM:02443 + EM:05566 STOCK Apc/Orl EMMA embryo B6;129P2-Apc/Orl, Apc-lox-exon14 mutant strain MGI:3521822 Apc targeted mutation 2, Christine Perret MGI:88039 Apc APC, WNT signaling pathway regulator https://www.infrafrontier.eu/search?keyword=EM:05566 + EM:05566 STOCK Apc/Orl EMMA sperm B6;129P2-Apc/Orl, Apc-lox-exon14 mutant strain MGI:3521822 Apc targeted mutation 2, Christine Perret MGI:88039 Apc APC, WNT signaling pathway regulator https://www.infrafrontier.eu/search?keyword=EM:05566 - EM:07651 STOCK Ankrd11/IcsOrl EMMA archived mutant strain MGI:4842657 Ankrd11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924337 Ankrd11 ankyrin repeat domain 11 https://www.infrafrontier.eu/search?keyword=EM:07651 + EM:02255 STOCK andra/H EMMA sperm Andromeda mutant strain MGI:5568106 andra andromeda MGI:5568104 andra andromeda https://www.infrafrontier.eu/search?keyword=EM:02255 + EM:02254 STOCK anaya/H EMMA sperm Anaya mutant strain MGI:5568096 anaya anaya MGI:5568094 anaya anaya https://www.infrafrontier.eu/search?keyword=EM:02254 + EM:02253 STOCK anan/H EMMA sperm Ananisi mutant strain MGI:5568076 anan ananisi MGI:5568074 anan ananisi https://www.infrafrontier.eu/search?keyword=EM:02253 + EM:09992 STOCK Ahsa2/IcsOrl EMMA sperm EPD0209_2_C03 mutant strain MGI:4434221 Ahsa2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916133 Ahsa2 AHA1, activator of heat shock protein ATPase 2 https://www.infrafrontier.eu/search?keyword=EM:09992 + EM:05690 STOCK Actr3/Ieg EMMA archived Actr3 (ARP3 actin-related protein 3 homolog (yeast)) mutant strain MGI:3765916 Actr3 gene trap mutation A009F03, Franz Vauti MGI:1921367 Actr3 ARP3 actin-related protein 3 https://www.infrafrontier.eu/search?keyword=EM:05690 - EM:02102 STOCK Aby/Orl EMMA embryo mutant strain MGI:5752853 Aby mutant Aby MGI:5752851 Aby mutant Aby https://www.infrafrontier.eu/search?keyword=EM:02102 - EM:10718 STOCK A4galt/H EMMA sperm mutant strain MGI:4847810 A4galt targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3512453 A4galt alpha 1,4-galactosyltransferase https://www.infrafrontier.eu/search?keyword=EM:10718 + EM:05448 STOCK 2700049A03Rik/H EMMA sperm Talpid3 Floxed Mutant, 2700049A03Rik mutant strain MGI:5287574 2700049A03Rik targeted mutation 1.1, TaconicArtemis MGI:1924217 2700049A03Rik RIKEN cDNA 2700049A03 gene https://www.infrafrontier.eu/search?keyword=EM:05448 - EM:12096 STOCK 2210016L21Rik/Wtsi EMMA embryo mutant strain MGI:4419127 2210016L21Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919607 2210016L21Rik RIKEN cDNA 2210016L21 gene https://www.infrafrontier.eu/search?keyword=EM:12096 ? EM:09784 StarD10-F10 EMMA sperm mutant strain mouse StarD10 mouse StarD10 https://www.infrafrontier.eu/search?keyword=EM:09784 ? EM:13796 Spindizzy, Espn EMMA archived mutant strain Slc35f2 Slc35f2 MGI:1919272 Slc35f2 solute carrier family 35, member F2 https://www.infrafrontier.eu/search?keyword=EM:13796 ? EM:13796 Spindizzy, Espn EMMA archived mutant strain Espn Espn MGI:1861630 Espn espin https://www.infrafrontier.eu/search?keyword=EM:13796 ? EM:09724 SPC tetCre loxP VEGF (conditional inducible alveolar epithelial cell VEGF knockout mouse) EMMA sperm mutant strain Vegfa Vegfa MGI:103178 Vegfa vascular endothelial growth factor A https://www.infrafrontier.eu/search?keyword=EM:09724 ? EM:09724 SPC tetCre loxP VEGF (conditional inducible alveolar epithelial cell VEGF knockout mouse) EMMA sperm mutant strain Tg Sftpc-rtTA, tetO-cre Tg Sftpc-rtTA, tetO-cre Tg Sftpc-rtTA, tetO-cre Tg Sftpc-rtTA, tetO-cre https://www.infrafrontier.eu/search?keyword=EM:09724 ? EM:13090 Sox6GFPCreERT EMMA archived mutant strain Sox6 Sox6 MGI:98368 Sox6 SRY (sex determining region Y)-box 6 https://www.infrafrontier.eu/search?keyword=EM:13090 ? EM:11118 Sox2deltaOBS EMMA embryo mutant strain MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:11118 ? EM:11118 Sox2deltaOBS EMMA sperm mutant strain MGI:98364 Sox2 SRY (sex determining region Y)-box 2 https://www.infrafrontier.eu/search?keyword=EM:11118 ? EM:12462 SKH1.Cg-Alox12b Krt14/H EMMA archived mutant strain MGI:3795934 Alox12b targeted mutation 1, Peter Krieg MGI:1274782 Alox12b arachidonate 12-lipoxygenase, 12R type https://www.infrafrontier.eu/search?keyword=EM:12462 ? EM:12462 SKH1.Cg-Alox12b Krt14/H EMMA archived mutant strain MGI:5908393 Krt14 targeted mutation 1.1, Hermann-Josef Grone MGI:96688 Krt14 keratin 14 https://www.infrafrontier.eu/search?keyword=EM:12462 - EM:07421 SJLJ.129S-Lgals1/H EMMA sperm mutant strain MGI:2181809 Lgals1 targeted mutation 1, Elizabeth J Robertson MGI:96777 Lgals1 lectin, galactose binding, soluble 1 https://www.infrafrontier.eu/search?keyword=EM:07421 + EM:04546 SJL.129(B6)-Nr1i2/H EMMA sperm SJL/PXR-/-, SJL.Cg-Nr1i2/H mutant strain MGI:3609633 Nr1i2 targeted mutation 1, Steven A Kliewer MGI:1337040 Nr1i2 nuclear receptor subfamily 1, group I, member 2 https://www.infrafrontier.eu/search?keyword=EM:04546 - EM:12763 Siglec-F KO mouse EMMA sperm mutant strain SiglecF SiglecF MGI:2681107 Siglecf sialic acid binding Ig-like lectin F https://www.infrafrontier.eu/search?keyword=EM:12763 ? EM:12765 Siglec-1 (CD169) KO mouse EMMA sperm mutant strain MGI:3617694 Siglec1 targeted mutation 1, Paul R Crocker MGI:99668 Siglec1 sialic acid binding Ig-like lectin 1, sialoadhesin https://www.infrafrontier.eu/search?keyword=EM:12765 ? EM:11929 Rosa26-tidSind-naked/KD-UMCM/Rosa26+ line 14 EMMA sperm unclassified Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11929 ? EM:11918 Rosa26-tidSCKD-UMCM line 3 EMMA sperm unclassified tid-SC, Acc. Nr.: AF326358 tid-SC, Acc. Nr.: AF326358 MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11918 ? EM:11926 Rosa26-tidSC; tidflox/KD-UMCMline 11 EMMA embryo unclassified TG TG https://www.infrafrontier.eu/search?keyword=EM:11926 ? EM:11926 Rosa26-tidSC; tidflox/KD-UMCMline 11 EMMA embryo unclassified TG TG https://www.infrafrontier.eu/search?keyword=EM:11926 ? EM:11916 Rosa26-tidLCKD-UMCM line 1 EMMA sperm unclassified tid-LC, Acc.Nr.: AY009326 tid-LC, Acc.Nr.: AY009326 MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11916 ? EM:11924 Rosa26-tidLC; tidflox/KD-UMCM line 9 EMMA embryo unclassified TG TG TG https://www.infrafrontier.eu/search?keyword=EM:11924 ? EM:11924 Rosa26-tidLC; tidflox/KD-UMCM line 9 EMMA embryo unclassified TG TG https://www.infrafrontier.eu/search?keyword=EM:11924 ? EM:11917 Rosa26-tidICKD-UMCM line 2 EMMA sperm unclassified tid-IC, Acc.Nr.: AF325535 tid-IC, Acc.Nr.: AF325535 MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11917 ? EM:11925 Rosa26-tidIC; tidflox/KD-UMCM line 10 EMMA embryo unclassified TG TG https://www.infrafrontier.eu/search?keyword=EM:11925 ? EM:11925 Rosa26-tidIC; tidflox/KD-UMCM line 10 EMMA embryo unclassified TG TG https://www.infrafrontier.eu/search?keyword=EM:11925 - EM:12428 Rnf2 I53A (Ring1B I53A) EMMA sperm mutant strain MGI:6414568 Rnf2 targeted mutation 1.1, MRC Human Genetics Unit MGI:1101759 Rnf2 ring finger protein 2 https://www.infrafrontier.eu/search?keyword=EM:12428 - EM:06764 RIII EMMA embryo mutant strain RIII RIII RIII RIII https://www.infrafrontier.eu/search?keyword=EM:06764 - EM:06764 RIII EMMA sperm mutant strain RIII RIII RIII RIII https://www.infrafrontier.eu/search?keyword=EM:06764 ? EM:13794 Rhythm, Del(18Ctxn3-Ccdc192)1Kcl EMMA archived mutant strain Isg20 Isg20 MGI:1928895 Isg20 interferon-stimulated protein https://www.infrafrontier.eu/search?keyword=EM:13794 ? EM:13794 Rhythm, Del(18Ctxn3-Ccdc192)1Kcl EMMA archived mutant strain Del(18Ctxn3-Ccdc192) Del(18Ctxn3-Ccdc192) Del(18Ctxn3-Ccdc192) Del(18Ctxn3-Ccdc192) https://www.infrafrontier.eu/search?keyword=EM:13794 ? EM:13795 Rhyme, Del(10Map3k5-Map7)2Kcl EMMA archived mutant strain Rhox13 Rhox13 MGI:1920864 Rhox13 reproductive homeobox 13 https://www.infrafrontier.eu/search?keyword=EM:13795 ? EM:13795 Rhyme, Del(10Map3k5-Map7)2Kcl EMMA archived mutant strain Map3k5 and Map7 Map3k5 and Map7 Map3k5 and Map7 Map3k5 and Map7 https://www.infrafrontier.eu/search?keyword=EM:13795 ? EM:11359 Rb(8.12)5Bnr_BALB/c EMMA sperm mutant strain Rb(8.12)5Bnr Robertsonian translocation, Chr 8 and 12, Universitat Bonn/Rhein 5 MGI:103992 Rb(8.12)5Bnr Robertsonian translocation, Chr 8 and 12, Universitat Bonn/Rhein 5 https://www.infrafrontier.eu/search?keyword=EM:11359 ? EM:11358 Rb(8.12)5Bnr EMMA sperm mutant strain Rb(8.12)5Bnr Robertsonian translocation, Chr 8 and 12, Universitat Bonn/Rhein 5 MGI:103992 Rb(8.12)5Bnr Robertsonian translocation, Chr 8 and 12, Universitat Bonn/Rhein 5 https://www.infrafrontier.eu/search?keyword=EM:11358 ? EM:11357 Rb(6.12)3Sic EMMA sperm mutant strain Rb(6.12)3Sic Robertsonian translocation, Chr 6 and 12, Sicily 3 MGI:103896 Rb(6.12)3Sic Robertsonian translocation, Chr 6 and 12, Sicily 3 https://www.infrafrontier.eu/search?keyword=EM:11357 ? EM:11356 Rb(4.12)9Bnr EMMA sperm mutant strain Rb(4.12)9Bnr Robertsonian translocation, Chr 4 MGI:103796 Rb(4.12)9Bnr Robertsonian translocation, Chr 4 and 12, Universitat Bonn/Rhein 9 https://www.infrafrontier.eu/search?keyword=EM:11356 - EM:12461 RalGDS Floxed Mouse EMMA sperm FVB.129X1(Cg)-Ralgds/H, FVB;129X1(Cg)-Ralgds/H mutant strain MGI:6317416 Ralgds targeted mutation 2, Christopher J Marshall MGI:107485 Ralgds ral guanine nucleotide dissociation stimulator https://www.infrafrontier.eu/search?keyword=EM:12461 ? EM:13349 R26-rtTAtg/0:tetO-Cpt1atg/0 (R26rtTA-CPT1A) EMMA sperm mutant strain TRE-CPT1A TRE-CPT1A Tg(tetO-Cpt1a,-EGFP) Tg(tetO-Cpt1a,-EGFP) https://www.infrafrontier.eu/search?keyword=EM:13349 ? EM:13349 R26-rtTAtg/0:tetO-Cpt1atg/0 (R26rtTA-CPT1A) EMMA sperm mutant strain R26-rtTA R26-rtTA R26-rtTA R26-rtTA https://www.infrafrontier.eu/search?keyword=EM:13349 - EM:01285 PLAY19 EMMA sperm C3H;C-Play19/H, C3C-Play19/H mutant strain MGI:5496405 Play19 Play19 MGI:5495800 Play19 Play19 https://www.infrafrontier.eu/search?keyword=EM:01285 ? EM:13247 PI3K-C2a-kinase dead EMMA embryo mutant strain MGI:5779550 Pik3c2a targeted mutation 1, Bart Vanhaesebroeck MGI:1203729 Pik3c2a phosphatidylinositol-4-phosphate 3-kinase catalytic subunit type 2 alpha https://www.infrafrontier.eu/search?keyword=EM:13247 ? EM:13245 PI3K-C2a-flox EMMA embryo mutant strain PIK3C2A PIK3C2A MGI:1203729 Pik3c2a phosphatidylinositol-4-phosphate 3-kinase catalytic subunit type 2 alpha https://www.infrafrontier.eu/search?keyword=EM:13245 - EM:02197 PEDM/35 EMMA sperm C3H;B6-Pedm/35/H, C3H;B6-Pedm35/H mutant strain MGI:5499204 Pedm35 Pedm/35, Harwell MGI:5499187 Pedm35 Pedm35, Harwell https://www.infrafrontier.eu/search?keyword=EM:02197 - EM:02159 PEDM/14 EMMA sperm C3H;B6-Pedm14/H, C3H;B6-Pedm/14/H mutant strain MGI:5499202 Pedm14 Pedm/14, Harwell MGI:5499185 Pedm14 Pedm14, Harwell https://www.infrafrontier.eu/search?keyword=EM:02159 + EM:01165 PDT/Pas EMMA embryo polydactyly mutant strain MGI:2684436 Twist1 Pasteur MGI:98872 Twist1 twist basic helix-loop-helix transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:01165 ? EM:07263 pCAGGS-Arl13bGFP EMMA embryo mutant strain Tg(CAGGS-Arl13b-GFP) Tg(CAGGS-Arl13b-GFP) https://www.infrafrontier.eu/search?keyword=EM:07263 ? EM:11122 pCAG-Otx2ER EMMA embryo mutant strain https://www.infrafrontier.eu/search?keyword=EM:11122 ? EM:11122 pCAG-Otx2ER EMMA sperm mutant strain https://www.infrafrontier.eu/search?keyword=EM:11122 ? EM:13523 P62-2 EMMA archived mutant strain SQSTM1 (p62) SQSTM1 (p62) SQSTM1 (p62) SQSTM1 (p62) https://www.infrafrontier.eu/search?keyword=EM:13523 ? EM:11633 p110beta DEL (Sv129/J background) EMMA embryo unclassified MGI:3795850 Pik3cb targeted mutation 1.1, Bart Vanhaesebroeck MGI:1922019 Pik3cb phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit beta https://www.infrafrontier.eu/search?keyword=EM:11633 ? EM:11633 p110beta DEL (Sv129/J background) EMMA sperm unclassified MGI:3795850 Pik3cb targeted mutation 1.1, Bart Vanhaesebroeck MGI:1922019 Pik3cb phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit beta https://www.infrafrontier.eu/search?keyword=EM:11633 ? EM:11121 Otp-CreER EMMA embryo mutant strain Otp-creER Otp-creER MGI:99835 Otp orthopedia homeobox https://www.infrafrontier.eu/search?keyword=EM:11121 ? EM:11121 Otp-CreER EMMA sperm mutant strain Otp-creER Otp-creER MGI:99835 Otp orthopedia homeobox https://www.infrafrontier.eu/search?keyword=EM:11121 ? EM:05512 NYBR1 TG targ EMMA embryo mutant strain Gt(ROSA)26Sor Gt(ROSA)26Sor MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:05512 + EM:04931 NOD/NckOrl EMMA embryo mutant strain NOD NOD NOD NOD https://www.infrafrontier.eu/search?keyword=EM:04931 + EM:05139 NOD.FVB-Tg(Rip-RASA1*)1Wid/Orl EMMA embryo NOD-Tg(RIP::N)1Wid mutant strain MGI:5648069 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann MGI:5648068 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann https://www.infrafrontier.eu/search?keyword=EM:05139 + EM:05139 NOD.FVB-Tg(Rip-RASA1*)1Wid/Orl EMMA sperm NOD-Tg(RIP::N)1Wid mutant strain MGI:5648069 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann MGI:5648068 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann https://www.infrafrontier.eu/search?keyword=EM:05139 + EM:00726 NOD.Cg-Tg(TcraDN32D3)86Alhn Tg(Ins2-NP)25-3Olds/Orl EMMA embryo A14-86 RIP-NP NOD mutant strain MGI:3505887 Tg(TcraDN32D3)86Alhn transgene insertion 86, Agnes Lehuen MGI:3505886 Tg(TcraDN32D3)86Alhn transgene insertion 86, Agnes Lehuen https://www.infrafrontier.eu/search?keyword=EM:00726 + EM:00726 NOD.Cg-Tg(TcraDN32D3)86Alhn Tg(Ins2-NP)25-3Olds/Orl EMMA embryo A14-86 RIP-NP NOD mutant strain MGI:3573697 Tg(Ins2-NP)25-3Olds transgene insertion 25-3, Michael BA Oldstone, MD MGI:3531505 Tg(Ins2-NP)25-3Olds transgene insertion 25-3, Michael BA Oldstone, MD https://www.infrafrontier.eu/search?keyword=EM:00726 + EM:00215 NOD.Cg-Tcra Tg(TcraCDC35)1Alhn/Orl EMMA embryo A8 Ca-/- NOD, A8, NOD.Cg-Tcra Tg(TcraCDC35)1Alhn, Valpha8 Tg Calpha<-/-> NOD mutant strain MGI:2180883 Tcra targeted mutation 1, Michael J Owen MGI:98553 Tcra T cell receptor alpha chain https://www.infrafrontier.eu/search?keyword=EM:00215 + EM:00215 NOD.Cg-Tcra Tg(TcraCDC35)1Alhn/Orl EMMA embryo A8 Ca-/- NOD, A8, NOD.Cg-Tcra Tg(TcraCDC35)1Alhn, Valpha8 Tg Calpha<-/-> NOD mutant strain MGI:3528229 Tg(TcraCDC35)1Alhn transgene insertion 1, Agnes Lehuen MGI:3528227 Tg(TcraCDC35)1Alhn transgene insertion 1, Agnes Lehuen https://www.infrafrontier.eu/search?keyword=EM:00215 + EM:01648 NOD.Cg-(D1Mit15-D1Mit359) Cd1d1/Orl EMMA embryo NOD CD1d KO, NOD.B6-L2.Cd1d-/- mutant strain MGI:2154342 Stia1 C57BL/6J MGI:2151739 Stia1 serum transfer induced arthritis 1 https://www.infrafrontier.eu/search?keyword=EM:01648 + EM:01648 NOD.Cg-(D1Mit15-D1Mit359) Cd1d1/Orl EMMA embryo NOD CD1d KO, NOD.B6-L2.Cd1d-/- mutant strain MGI:2180711 Cd1d1 targeted mutation 1, Luc Van Kaer MGI:107674 Cd1d1 CD1d1 antigen https://www.infrafrontier.eu/search?keyword=EM:01648 + EM:01648 NOD.Cg-(D1Mit15-D1Mit359) Cd1d1/Orl EMMA embryo NOD CD1d KO, NOD.B6-L2.Cd1d-/- mutant strain MGI:2681149 Nktcn1 C57BL/6J MGI:2681136 Nktcn1 natural killer T cell numbers 1 https://www.infrafrontier.eu/search?keyword=EM:01648 + EM:01637 NOD.B6-Ptprc/Orl EMMA embryo NOD.CD45.2 mutant strain MGI:4819850 Ptprc b variant MGI:97810 Ptprc protein tyrosine phosphatase, receptor type, C https://www.infrafrontier.eu/search?keyword=EM:01637 + EM:00143 NOD.B6-Prf1/Cnrm EMMA embryo Pfp-KO, Prf-1(perforin)-KO, NOD-Prf1, B6.Cg-Prf1/Ibcm, B6.Cg-Prf1, NOD.B6-Prf1/Ibcm mutant strain MGI:1857235 Prf1 targeted mutation 1, Sandoz Pharmaceuticals MGI:97551 Prf1 perforin 1 (pore forming protein) https://www.infrafrontier.eu/search?keyword=EM:00143 + EM:01413 NOD.B6-Idd5(R33)/GhjOrl EMMA archived NOD.B6-Idd5-R33 mutant strain Ctla4 Ctla4 MGI:88556 Ctla4 cytotoxic T-lymphocyte-associated protein 4 https://www.infrafrontier.eu/search?keyword=EM:01413 + EM:01413 NOD.B6-Idd5(R33)/GhjOrl EMMA archived NOD.B6-Idd5-R33 mutant strain MGI:3037292 Idd5 C57BL/6 MGI:96407 Idd5 insulin dependent diabetes susceptibility 5 https://www.infrafrontier.eu/search?keyword=EM:01413 + EM:01414 NOD.B6-Idd5(R32)/GhjOrl EMMA archived NOD.B6-Idd5-R32 mutant strain MGI:3037292 Idd5 C57BL/6 MGI:96407 Idd5 insulin dependent diabetes susceptibility 5 https://www.infrafrontier.eu/search?keyword=EM:01414 + EM:01412 NOD.B6-Idd5(R198)/GhjOrl EMMA archived NOD.B6-Idd5-R198 mutant strain MGI:3037292 Idd5 C57BL/6 MGI:96407 Idd5 insulin dependent diabetes susceptibility 5 https://www.infrafrontier.eu/search?keyword=EM:01412 + EM:01390 NOD.B6-Hc<1>/Cnrm EMMA embryo NOD.B6-Hc, NOD.B6-Hc<1>/Ibcm mutant strain MGI:3044820 Hc<1> sufficient MGI:96031 Hc hemolytic complement https://www.infrafrontier.eu/search?keyword=EM:01390 + EM:01404 NOD.B6-(H2-Q4-D17Mit36)/GhjOrl EMMA archived R89, NOD.B6-C17(R289) mutant strain H2-Q4 histocompatibility 2, Q region locus 4 MGI:95933 H2-Q4 histocompatibility 2, Q region locus 4 https://www.infrafrontier.eu/search?keyword=EM:01404 + EM:01404 NOD.B6-(H2-Q4-D17Mit36)/GhjOrl EMMA archived R89, NOD.B6-C17(R289) mutant strain MGI:3525333 Idd16 C57BL/6J MGI:107544 Idd16 insulin dependent diabetes susceptibility 16 https://www.infrafrontier.eu/search?keyword=EM:01404 + EM:01711 NOD.B6-(D6Mit254-D6Mit14)/Orl EMMA embryo NOD.B6-Idd6 Klrb1c/CarOrl, NOD.B6-NK1.1 mutant strain MGI:2384434 Klrb1c antigen Nk-1.1 allele MGI:107538 Klrb1c killer cell lectin-like receptor subfamily B member 1C https://www.infrafrontier.eu/search?keyword=EM:01711 + EM:01711 NOD.B6-(D6Mit254-D6Mit14)/Orl EMMA embryo NOD.B6-Idd6 Klrb1c/CarOrl, NOD.B6-NK1.1 mutant strain MGI:3036668 Idd6 C57BL/6 MGI:96408 Idd6 insulin dependent diabetes susceptibility 6 https://www.infrafrontier.eu/search?keyword=EM:01711 + EM:01394 NOD.B6-(D1Mit359-D1Mit155)/GhjCnrm EMMA embryo NOD.B6-C1D(3), L3 mutant strain D1Mit155 DNA segment, Chr 1, Massachusetts Institute of Technology 155 MGI:91529 D1Mit155 DNA segment, Chr 1, Massachusetts Institute of Technology 155 https://www.infrafrontier.eu/search?keyword=EM:01394 + EM:01392 NOD.B6-(D1Mit302-D1Mit178)/GhjCnrm EMMA embryo R39, NOD.B6-Idd5-R39 congenic strain MGI:2158432 Idd5.1 C57BL/6J MGI:2158421 Idd5.1 insulin dependent diabetes susceptibility 5.1 https://www.infrafrontier.eu/search?keyword=EM:01392 + EM:01791 NOD.B6-(D1Mit19-D1Mit14)/GhjCnrm EMMA embryo NOD.B6-C1M mutant strain MGI:2385541 Ssial1 C57BL/6 MGI:2385531 Ssial1 susceptibility to sialadenitis 1 https://www.infrafrontier.eu/search?keyword=EM:01791 + EM:01791 NOD.B6-(D1Mit19-D1Mit14)/GhjCnrm EMMA embryo NOD.B6-C1M mutant strain Bcl2 Bcl2 MGI:88138 Bcl2 B cell leukemia/lymphoma 2 https://www.infrafrontier.eu/search?keyword=EM:01791 + EM:01396 NOD.B6-(D1Mit15-D1Mit359)/GhjCnrm EMMA embryo L2, NOD.C57BL/6-Nkt1(L2), NOD.B6-C1D(L2) mutant strain MGI:2430510 Fcgr2b<+> wild type MGI:95499 Fcgr2b Fc receptor, IgG, low affinity IIb https://www.infrafrontier.eu/search?keyword=EM:01396 + EM:01396 NOD.B6-(D1Mit15-D1Mit359)/GhjCnrm EMMA embryo L2, NOD.C57BL/6-Nkt1(L2), NOD.B6-C1D(L2) mutant strain MGI:2681149 Nktcn1 C57BL/6J MGI:2681136 Nktcn1 natural killer T cell numbers 1 https://www.infrafrontier.eu/search?keyword=EM:01396 + EM:01397 NOD.B6-(D1Mit113-D1Mit359)/GhjOrl EMMA archived NOD.B6-C1D(L6), L6 mutant strain MGI:2681149 Nktcn1 C57BL/6J MGI:2681136 Nktcn1 natural killer T cell numbers 1 https://www.infrafrontier.eu/search?keyword=EM:01397 + EM:01401 NOD.B6-(D17Mit260-D17Mit199)/GhjOrl EMMA archived R76, NOD.B6-C17(R76) mutant strain Idd16.1 C57BL/6J MGI:3579885 Idd16.1 insulin dependent diabetes susceptibility 16.1 https://www.infrafrontier.eu/search?keyword=EM:01401 + EM:01401 NOD.B6-(D17Mit260-D17Mit199)/GhjOrl EMMA archived R76, NOD.B6-C17(R76) mutant strain MGI:3525335 Idd23 C57BL/6J MGI:3525329 Idd23 insulin dependent diabetes susceptibility 23 https://www.infrafrontier.eu/search?keyword=EM:01401 + EM:01400 NOD.B6-(D17Mit248-D17Mit199)/GhjOrl EMMA archived R115, NOD.B6-C17(R115) mutant strain Idd16.1 C57BL/6J MGI:3579885 Idd16.1 insulin dependent diabetes susceptibility 16.1 https://www.infrafrontier.eu/search?keyword=EM:01400 + EM:01398 NOD.B6-(D17Mit16-D17Mit36)/GhjCnrm EMMA embryo R2, NOD.B6-C17(R2) mutant strain MGI:3037294 Idd1 C57BL/6 MGI:96400 Idd1 insulin dependent diabetes susceptibility 1 https://www.infrafrontier.eu/search?keyword=EM:01398 + EM:01398 NOD.B6-(D17Mit16-D17Mit36)/GhjCnrm EMMA embryo R2, NOD.B6-C17(R2) mutant strain MGI:3579319 H2 b variant MGI:95894 H2 histocompatibility-2, MHC https://www.infrafrontier.eu/search?keyword=EM:01398 + EM:01402 NOD.B6-(D17Mit114-D17Mit101)/Orl EMMA archived NOD.B6-C17(R76.22), NOD.B6-Idd16.1(R76.22)/Orl mutant strain Ceat1 chronic experimental autoimmune thyroiditis 1 MGI:3526118 Ceat1 chronic experimental autoimmune thyroiditis 1 https://www.infrafrontier.eu/search?keyword=EM:01402 + EM:01402 NOD.B6-(D17Mit114-D17Mit101)/Orl EMMA archived NOD.B6-C17(R76.22), NOD.B6-Idd16.1(R76.22)/Orl mutant strain Idd16.1 insulin dependent diabetes susceptibility 16.1 MGI:3579885 Idd16.1 insulin dependent diabetes susceptibility 16.1 https://www.infrafrontier.eu/search?keyword=EM:01402 + EM:01403 NOD.B6-(D17Mit113-D17Mit260)/GhjOrl EMMA archived R156, NOD.B6-C17(R156) mutant strain Ceat1 chronic experimental autoimmune thyroiditis 1 MGI:3526118 Ceat1 chronic experimental autoimmune thyroiditis 1 https://www.infrafrontier.eu/search?keyword=EM:01403 + EM:01403 NOD.B6-(D17Mit113-D17Mit260)/GhjOrl EMMA archived R156, NOD.B6-C17(R156) mutant strain Idd16.2 insulin dependent diabetes susceptibility 16.2 MGI:3579886 Idd16.2 insulin dependent diabetes susceptibility 16.2 https://www.infrafrontier.eu/search?keyword=EM:01403 + EM:01403 NOD.B6-(D17Mit113-D17Mit260)/GhjOrl EMMA archived R156, NOD.B6-C17(R156) mutant strain MGI:3525335 Idd23 C57BL/6J MGI:3525329 Idd23 insulin dependent diabetes susceptibility 23 https://www.infrafrontier.eu/search?keyword=EM:01403 + EM:01399 NOD.B6-(D17Mit113-D17Mit199)/GhjOrl EMMA archived R114, NOD.B6-C17(R114) mutant strain MGI:3525333 Idd16 C57BL/6J MGI:107544 Idd16 insulin dependent diabetes susceptibility 16 https://www.infrafrontier.eu/search?keyword=EM:01399 + EM:01399 NOD.B6-(D17Mit113-D17Mit199)/GhjOrl EMMA archived R114, NOD.B6-C17(R114) mutant strain Ceat1 C57BL/6J MGI:3526118 Ceat1 chronic experimental autoimmune thyroiditis 1 https://www.infrafrontier.eu/search?keyword=EM:01399 + EM:01399 NOD.B6-(D17Mit113-D17Mit199)/GhjOrl EMMA archived R114, NOD.B6-C17(R114) mutant strain MGI:3525335 Idd23 C57BL/6J MGI:3525329 Idd23 insulin dependent diabetes susceptibility 23 https://www.infrafrontier.eu/search?keyword=EM:01399 + EM:01803 NOD.129S6-Cd1d1/Orl EMMA embryo NOD CD1d KO mutant strain MGI:2180711 Cd1d1 targeted mutation 1, Luc Van Kaer MGI:107674 Cd1d1 CD1d1 antigen https://www.infrafrontier.eu/search?keyword=EM:01803 + EM:06909 NOD.129S2-Parp1/Ieg EMMA sperm NOD-Parp1tm1Zqw mutant strain MGI:1857862 Parp1 targeted mutation 1, Zhao-Qi Wang MGI:1340806 Parp1 poly (ADP-ribose) polymerase family, member 1 https://www.infrafrontier.eu/search?keyword=EM:06909 + EM:09914 NOD.129P2(B6)-Nos2/Ieg EMMA sperm NOD.B6;129P2-Nos2tm1Lau mutant strain MGI:1857228 Nos2 targeted mutation 1, Victor E Laubach MGI:97361 Nos2 nitric oxide synthase 2, inducible https://www.infrafrontier.eu/search?keyword=EM:09914 + EM:01638 NOD.129-Rag1 B2m H2-Ab1/Orl EMMA embryo NOD-IAbeta-beta2m-RAG1-/- mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:01638 + EM:01638 NOD.129-Rag1 B2m H2-Ab1/Orl EMMA embryo NOD-IAbeta-beta2m-RAG1-/- mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:01638 + EM:01638 NOD.129-Rag1 B2m H2-Ab1/Orl EMMA embryo NOD-IAbeta-beta2m-RAG1-/- mutant strain MGI:2448994 Rag1 targeted mutation 1, David Baltimore MGI:97848 Rag1 recombination activating 1 https://www.infrafrontier.eu/search?keyword=EM:01638 + EM:01422 NOD.129-Fasl/Orl EMMA embryo FasLfl/fl mutant strain MGI:3032852 Fasl targeted mutation 1, Matthieu Levi-Strauss MGI:99255 Fasl Fas ligand (TNF superfamily, member 6) https://www.infrafrontier.eu/search?keyword=EM:01422 + EM:00213 NOD.129(B6)-B2m H2-Ab1/DoiLpfOrl EMMA embryo NOD.129(B6)-B2m H2-Ab1/DimLpfOrl, Nod-beta2M-IAbeta, NOD.129(B6)-B2m H2-Ab1, NOD.129(B6)-B2m H2-Ab1/DimLpfCiml mutant strain MGI:1927483 H2-Ab1 targeted mutation 1, Christophe Benoist and Diane Mathis MGI:103070 H2-Ab1 histocompatibility 2, class II antigen A, beta 1 https://www.infrafrontier.eu/search?keyword=EM:00213 + EM:00213 NOD.129(B6)-B2m H2-Ab1/DoiLpfOrl EMMA embryo NOD.129(B6)-B2m H2-Ab1/DimLpfOrl, Nod-beta2M-IAbeta, NOD.129(B6)-B2m H2-Ab1, NOD.129(B6)-B2m H2-Ab1/DimLpfCiml mutant strain MGI:1857133 B2m targeted mutation 1, University of North Carolina MGI:88127 B2m beta-2 microglobulin https://www.infrafrontier.eu/search?keyword=EM:00213 + EM:00204 NOD-Tg(TcraDN32D3)78Alhn/Orl EMMA embryo NOD-Tg(TcraDN32D3)78Alhn/Ciml, NOD-Tg(TcraCD1d1)78Alhn, A14-78 NOD, NOD-Tg(TcraDN32D3)78Alhn mutant strain MGI:3526073 Tg(TcraDN32D3)78Alhn transgene insertion 78, Agnes Lehuen MGI:3526031 Tg(TcraDN32D3)78Alhn transgene insertion 78, Agnes Lehuen https://www.infrafrontier.eu/search?keyword=EM:00204 + EM:00214 NOD-Tg(TcraDN32D3)10Alhn/Orl EMMA embryo A14-10 NOD, NOD-Tg(TcraCD1d1)10Alhn, NOD-Tg(TcraDN32D3)10Alhn mutant strain MGI:3505746 Tg(TcraDN32D3)10Alhn transgene insertion 10, Agnes Lehuen MGI:3505713 Tg(TcraDN32D3)10Alhn transgene insertion 10, Agnes Lehuen https://www.infrafrontier.eu/search?keyword=EM:00214 + EM:01409 NOD-Chr 17/GhjCnrm EMMA embryo NOD-Chr 17/GhjCnrs, NOD.CBA-C17S mutant strain Chr 17 Chr 17 Chr 17 Chr 17 https://www.infrafrontier.eu/search?keyword=EM:01409 + EM:01408 NOD-Chr 17/GhjCnrm EMMA embryo NOD.B6-C17S consomic or chromosome substitution strain Chr 17 Chr 17 Chr 17 Chr 17 https://www.infrafrontier.eu/search?keyword=EM:01408 + EM:04372 NMRI.Cg-Tg(CMV-cre)1Nagy/Cnbc EMMA embryo CMV-cre mutant strain MGI:2178227 Tg(CMV-cre)1Nagy transgene insertion 1, Andras Nagy MGI:2178226 Tg(CMV-cre)1Nagy transgene insertion 1, Andras Nagy https://www.infrafrontier.eu/search?keyword=EM:04372 + EM:04372 NMRI.Cg-Tg(CMV-cre)1Nagy/Cnbc EMMA sperm CMV-cre mutant strain MGI:2178227 Tg(CMV-cre)1Nagy transgene insertion 1, Andras Nagy MGI:2178226 Tg(CMV-cre)1Nagy transgene insertion 1, Andras Nagy https://www.infrafrontier.eu/search?keyword=EM:04372 + EM:04371 NMRI.Cg-Tg(CAG-cre)1Nagy/Cnbc EMMA embryo pCX-NLS-cre mutant strain MGI:3586452 Tg(CAG-cre)1Nagy transgene insertion 1, Andras Nagy MGI:3586450 Tg(CAG-cre)1Nagy transgene insertion 1, Andras Nagy https://www.infrafrontier.eu/search?keyword=EM:04371 + EM:04371 NMRI.Cg-Tg(CAG-cre)1Nagy/Cnbc EMMA sperm pCX-NLS-cre mutant strain MGI:3586452 Tg(CAG-cre)1Nagy transgene insertion 1, Andras Nagy MGI:3586450 Tg(CAG-cre)1Nagy transgene insertion 1, Andras Nagy https://www.infrafrontier.eu/search?keyword=EM:04371 + EM:01017 NMRI.129-Apaf1/Cnrm EMMA embryo Apaf-1/XIX-18, NMRI.129-Apaf1/Ibcm mutant strain MGI:1857868 Apaf1 gene trap XIX18, Peter Gruss MGI:1306796 Apaf1 apoptotic peptidase activating factor 1 https://www.infrafrontier.eu/search?keyword=EM:01017 + EM:01785 NMRI-Tg(Wap-Tag)8Gmn/Kctt EMMA embryo WAP-SVT/t mutant strain MGI:3621350 Tg(Wap-Tag)8Gmn transgene insertion 8, A Graessmann MGI:3784787 Tg(Wap-Tag)8Gmn transgene insertion 8, A Graessmann https://www.infrafrontier.eu/search?keyword=EM:01785 + EM:01787 NMRI-Tg(WAP-tAg)1Gmn/Kctt EMMA embryo WAP-SVt/1, WAP-SVt mutant strain MGI:5313806 Tg(Wap-tAg)1Gmn transgene insertion 1, A Graessmann MGI:5313805 Tg(Wap-tAg)1Gmn transgene insertion 1, A Graessmann https://www.infrafrontier.eu/search?keyword=EM:01787 + EM:01786 NMRI-Tg(WAP-TAg)12Gmn/Kctt EMMA embryo WAP-SVT/12, WAP-SVT mutant strain MGI:5312328 Tg(Wap-TAg)12Gmn transgene insertion 12, A Graessmann MGI:5312327 Tg(Wap-TAg)12Gmn transgene insertion 12, A Graessmann https://www.infrafrontier.eu/search?keyword=EM:01786 + EM:02484 NMRI-Tg(Agt)123Uhg/Cnrm EMMA embryo TGM(rAOGEN)102, NMRI-Tg(Agt)123Uhg/Ibcm mutant strain MGI:4453970 Tg(Agt)123Uhg transgene insertion 123, University of Heidelberg MGI:4453973 Tg(Agt)123Uhg transgene insertion 123, University of Heidelberg https://www.infrafrontier.eu/search?keyword=EM:02484 ? EM:05494 Nexilin KO conv EMMA embryo mutant strain Nexn Nexn MGI:1916060 Nexn nexilin https://www.infrafrontier.eu/search?keyword=EM:05494 ? EM:05495 Nexilin KO cond EMMA embryo mutant strain Nexn Nexn MGI:1916060 Nexn nexilin https://www.infrafrontier.eu/search?keyword=EM:05495 ? EM:09080 Myo18aD850GMhda EMMA sperm mutant strain Myo18a<2549A-G> Myo18a<2549A-G> MGI:2667185 Myo18a myosin XVIIIA https://www.infrafrontier.eu/search?keyword=EM:09080 + EM:04845 MSOSLOW/Orl EMMA archived MSO "resistant", MSOS/CloixOrl, MSO-Slow, STOCK MSO-Slow mutant strain MSO-Slow MSO-Slow MSO-Slow MSO-Slow https://www.infrafrontier.eu/search?keyword=EM:04845 + EM:04844 MSOFAST/Orl EMMA archived STOCK MSO-Fast, MSO-Fast mutant strain MSO-Fast MSO-Fast MSO-Fast MSO-Fast https://www.infrafrontier.eu/search?keyword=EM:04844 - EM:11833 MSE Cre EMMA archived unclassified MSE-Cre MSE-Cre MSE-Cre MSE-Cre https://www.infrafrontier.eu/search?keyword=EM:11833 - EM:11832 MSE EMMA archived unclassified https://www.infrafrontier.eu/search?keyword=EM:11832 ? EM:11135 MRP8NRASD12 EMMA sperm mutant strain Tg(MRP8-Nras*)1 Tg(MRP8-Nras*)1 Tg(MRP8-Nras*)1 Tg(MRP8-Nras*)1 https://www.infrafrontier.eu/search?keyword=EM:11135 + EM:08424 MRL.Cg-Ccr5 Fas/Cnbc EMMA sperm 5-LM mutant strain MGI:3613371 Ccr5 targeted mutation 1, Bruno Luckow MGI:107182 Ccr5 chemokine (C-C motif) receptor 5 https://www.infrafrontier.eu/search?keyword=EM:08424 + EM:08424 MRL.Cg-Ccr5 Fas/Cnbc EMMA sperm 5-LM mutant strain MGI:1856334 Fas lymphoproliferation MGI:95484 Fas Fas (TNF receptor superfamily member 6) https://www.infrafrontier.eu/search?keyword=EM:08424 + EM:08423 MRL.Cg-Ccr2 Fas/Cnbc EMMA sperm 2L-M mutant strain MGI:3613374 Ccr2 targeted mutation 1, Bruno Luckow MGI:106185 Ccr2 chemokine (C-C motif) receptor 2 https://www.infrafrontier.eu/search?keyword=EM:08423 + EM:08423 MRL.Cg-Ccr2 Fas/Cnbc EMMA sperm 2L-M mutant strain MGI:1856334 Fas lymphoproliferation MGI:95484 Fas Fas (TNF receptor superfamily member 6) https://www.infrafrontier.eu/search?keyword=EM:08423 + EM:08422 MRL.Cg-Ccr1 Fas/Cnbc EMMA sperm `, MRL.129S4(B6)-Ccr1tm1Gao Faslpr/Cnbc, 1L-M mutant strain MGI:1931850 Ccr1 targeted mutation 1, Ji-Liang Gao MGI:104618 Ccr1 chemokine (C-C motif) receptor 1 https://www.infrafrontier.eu/search?keyword=EM:08422 + EM:08422 MRL.Cg-Ccr1 Fas/Cnbc EMMA sperm `, MRL.129S4(B6)-Ccr1tm1Gao Faslpr/Cnbc, 1L-M mutant strain MGI:1856334 Fas lymphoproliferation MGI:95484 Fas Fas (TNF receptor superfamily member 6) https://www.infrafrontier.eu/search?keyword=EM:08422 + EM:08425 MRL.Cg-Ccr1 Ccr5 Fas/Cnbc EMMA sperm 15L-M mutant strain MGI:1856334 Fas lymphoproliferation MGI:95484 Fas Fas (TNF receptor superfamily member 6) https://www.infrafrontier.eu/search?keyword=EM:08425 + EM:08425 MRL.Cg-Ccr1 Ccr5 Fas/Cnbc EMMA sperm 15L-M mutant strain MGI:3613371 Ccr5 targeted mutation 1, Bruno Luckow MGI:107182 Ccr5 chemokine (C-C motif) receptor 5 https://www.infrafrontier.eu/search?keyword=EM:08425 + EM:08425 MRL.Cg-Ccr1 Ccr5 Fas/Cnbc EMMA sperm 15L-M mutant strain MGI:1931850 Ccr1 targeted mutation 1, Ji-Liang Gao MGI:104618 Ccr1 chemokine (C-C motif) receptor 1 https://www.infrafrontier.eu/search?keyword=EM:08425 ? EM:08925 mPhl p 5 IRES GFP BALB/c EMMA sperm mutant strain allergen Phl p 5 allergen Phl p 5 https://www.infrafrontier.eu/search?keyword=EM:08925 + EM:00135 MP1/BiozOrl EMMA archived MP, L1 inbred strain Bioz:MP1 Bioz:MP1 Bioz:MP1 Bioz:MP1 https://www.infrafrontier.eu/search?keyword=EM:00135 + EM:00124 MP1.BP1-Im7/DnmOrl EMMA archived LcH18, MP1.BP1-Im7/DnmOrl congenic strain MGI:3033084 Im7 Bioz:BP1 MGI:3032863 Im7 immunoregulatory 7 https://www.infrafrontier.eu/search?keyword=EM:00124 + EM:00123 MP1.BP1-Im5/DnmOrl EMMA archived MP1.BP1-Im5/DnmOrl, LcH10 congenic strain MGI:3033076 Im5 Bioz:BP1 MGI:3032858 Im5 immunoregulatory 5 https://www.infrafrontier.eu/search?keyword=EM:00123 + EM:00126 MP1.BP1-Im4/DnmOrl EMMA archived LcH6, MP1.BP1-Im4/DnmOrl congenic strain MGI:3033074 Im4 Bioz:BP1 MGI:3032855 Im4 immunoregulatory 4 https://www.infrafrontier.eu/search?keyword=EM:00126 + EM:00127 MP1.BP1-Im3/DnmOrl EMMA archived LcH8-30, MP1.BP1-Im3/DnmOrl congenic strain MGI:3033072 Im3 Bioz:BP1 MGI:3032849 Im3 immunoregulatory 3 https://www.infrafrontier.eu/search?keyword=EM:00127 + EM:00125 MP1.BP1-Im2/DnmOrl EMMA archived LcH4, MP1.BP1-Im2/DnmOrl congenic strain MGI:2157092 Im2 Bioz:BP1 MGI:2149679 Im2 immunoregulatory 2 https://www.infrafrontier.eu/search?keyword=EM:00125 + EM:00128 MP1.BP1-Im1/DnmOrl EMMA archived LcH8-60, MP1.BP1-Im1/DnmOrl congenic strain MGI:2157088 Im1 Bioz:BP1 MGI:2148963 Im1 Immunoregulatory 1 https://www.infrafrontier.eu/search?keyword=EM:00128 - EM:05507 Mir 221 KO cond EMMA embryo B6;Cg-Mirc53/Hmgu mutant strain Mir221 Mir221 MGI:3619066 Mir221 microRNA 221 https://www.infrafrontier.eu/search?keyword=EM:05507 + EM:00198 MI/HgDstIeg EMMA embryo Hertwig's microphthalmia, MI/HgDst, STOCK Mitf/Hg, MI/HgDstNeu mutant strain MGI:1856085 Mitf microphthalmia MGI:104554 Mitf melanogenesis associated transcription factor https://www.infrafrontier.eu/search?keyword=EM:00198 + EM:12460 MF1;129X1-Ralgds/H EMMA sperm RalGDS KO Mouse mutant strain MGI:3574574 Ralgds targeted mutation 1, Christopher J Marshall MGI:107485 Ralgds ral guanine nucleotide dissociation stimulator https://www.infrafrontier.eu/search?keyword=EM:12460 ? EM:13142 Marco knockout mice EMMA sperm mutant strain MGI:3690644 Marco targeted mutation 1, Karl Tryggvason MGI:1309998 Marco macrophage receptor with collagenous structure https://www.infrafrontier.eu/search?keyword=EM:13142 - EM:11865 LSHOFF (TV2) EMMA sperm B6;129P-Hells/H mutant strain MGI:106209 Hells helicase, lymphoid specific https://www.infrafrontier.eu/search?keyword=EM:11865 - EM:12427 LifeAct-GFP EMMA sperm B6;129P2-Hprt/H mutant strain MGI:6459291 Hprt targeted mutation 1, Laura M Machesky MGI:96217 Hprt hypoxanthine guanine phosphoribosyl transferase https://www.infrafrontier.eu/search?keyword=EM:12427 ? EM:11835 Krox20 NA*A EMMA archived unclassified MGI:1857507 Egr2 targeted mutation 1, Patrick Charnay MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:11835 ? EM:11836 Krox20 C flox EMMA archived unclassified Egr2 Egr2 MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:11836 - EM:11827 Krox 20 gfp EMMA archived 129S2;B6-Egr2/Jchn unclassified Egr2 Egr2 MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:11827 + EM:01320 KREIS/HgIeg EMMA embryo kreisler mutant strain MGI:1856419 Mafb kreisler MGI:104555 Mafb v-maf musculoaponeurotic fibrosarcoma oncogene family, protein B (avian) https://www.infrafrontier.eu/search?keyword=EM:01320 ? EM:11997 K5-CXCL13-F3 EMMA sperm mutant strain MGI:6331225 Tg(KRT5-Cxcl13)F3Rlep transgene insertion F3, Rozen Le Panse MGI:6331222 Tg(KRT5-Cxcl13)F3Rlep transgene insertion F3, Rozen Le Panse https://www.infrafrontier.eu/search?keyword=EM:11997 ? EM:11996 K5-CXCL13-F12 EMMA sperm mutant strain MGI:6331227 Tg(KRT5-Cxcl13)F12Rlep transgene insertion F12, Rozen Le Panse MGI:6331226 Tg(KRT5-Cxcl13)F12Rlep transgene insertion F12, Rozen Le Panse https://www.infrafrontier.eu/search?keyword=EM:11996 ? EM:13793 Jiggle, Pcdh15 EMMA archived mutant strain Pcdh15 Pcdh15 MGI:1891428 Pcdh15 protocadherin 15 https://www.infrafrontier.eu/search?keyword=EM:13793 ? EM:13793 Jiggle, Pcdh15 EMMA archived mutant strain Ccdc122 Ccdc122 MGI:1918358 Ccdc122 coiled-coil domain containing 122 https://www.infrafrontier.eu/search?keyword=EM:13793 + EM:12213 ICR/H[cc] EMMA live mutant strain ICR/H[cc] ICR/H[cc] ICR/H[cc] ICR/H[cc] https://www.infrafrontier.eu/search?keyword=EM:12213 + EM:01166 HR2/PasOrl EMMA archived mutant strain MGI:5289957 Hr hairless 2 Institut Pasteur MGI:96223 Hr lysine demethylase and nuclear receptor corepressor https://www.infrafrontier.eu/search?keyword=EM:01166 ? EM:12228 HprtDll1ECD_Dll4ICD EMMA sperm mutant strain HprtDll1ECD_Dll4ICD HprtDll1ECD_Dll4ICD MGI:96217 Hprt hypoxanthine guanine phosphoribosyl transferase https://www.infrafrontier.eu/search?keyword=EM:12228 ? EM:12229 Hprt-Dll4ECD_Dll1ICD EMMA sperm mutant strain HprtDll4ECD_Dll1ICD HprtDll4ECD_Dll1ICD MGI:96217 Hprt hypoxanthine guanine phosphoribosyl transferase https://www.infrafrontier.eu/search?keyword=EM:12229 ? EM:11383 Hprt-CAG-LSL-ROCK2:ER EMMA sperm mutant strain MGI:96217 Hprt hypoxanthine guanine phosphoribosyl transferase https://www.infrafrontier.eu/search?keyword=EM:11383 - EM:11995 HM_Y139C EMMA sperm STOCK Vkorc1/sup>/H, STOCK Vkorc1/H mutant strain MGI:3605985 Vkorc1 Tyr139Cys MGI:106442 Vkorc1 vitamin K epoxide reductase complex, subunit 1 https://www.infrafrontier.eu/search?keyword=EM:11995 ? EM:11065 HLE-2/w x AlbCRE EMMA archived mutant strain NS5A weak transactivator NS5A weak transactivator NS5A weak transactivator NS5A weak transactivator https://www.infrafrontier.eu/search?keyword=EM:11065 ? EM:11065 HLE-2/w x AlbCRE EMMA archived mutant strain Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) Tg(Alb1-cre) https://www.infrafrontier.eu/search?keyword=EM:11065 ? EM:11064 HLE-1/S x AlbCRE EMMA archived mutant strain NS5A high transactivator NS5A high transactivator NS5A high transactivator NS5A high transactivator https://www.infrafrontier.eu/search?keyword=EM:11064 ? EM:11064 HLE-1/S x AlbCRE EMMA archived mutant strain MGI:3513779 Tg(Alb1-HCVN)35Sml transgene insertion 35, Stanley M Lemon MGI:3625827 Tg(Alb1-HCVN)35Sml transgene insertion 35, Stanley M Lemon https://www.infrafrontier.eu/search?keyword=EM:11064 ? EM:13166 Hint3 conditional KO EMMA archived mutant strain Hint3 Hint3 MGI:1914097 Hint3 histidine triad nucleotide binding protein 3 https://www.infrafrontier.eu/search?keyword=EM:13166 ? EM:13168 Hint1xHint2 WT EMMA archived mutant strain Hint1 wild-type Hint1 wild-type MGI:1321133 Hint1 histidine triad nucleotide binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:13168 ? EM:13168 Hint1xHint2 WT EMMA archived mutant strain Hint2 wild-type Hint2 wild-type MGI:1916167 Hint2 histidine triad nucleotide binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:13168 ? EM:13222 Hint1 KO C57BL/6J EMMA embryo mutant strain Hint1 Hint1 MGI:1321133 Hint1 histidine triad nucleotide binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:13222 ? EM:12761 hDMD/mdx mouse EMMA sperm mutant strain human DMD gene human DMD gene human DMD gene human DMD gene https://www.infrafrontier.eu/search?keyword=EM:12761 ? EM:13660 H2afjDel7 (NRj) EMMA sperm mutant strain H2afj H2afj MGI:6358818 H2afj withdrawn, = H2aj https://www.infrafrontier.eu/search?keyword=EM:13660 ? EM:13661 H2afjDel7 (JRj) EMMA sperm mutant strain H2afj H2afj MGI:6358818 H2afj withdrawn, = H2aj https://www.infrafrontier.eu/search?keyword=EM:13661 - EM:12167 Gt(ROSA)26Sor EMMA sperm mutant strain MGI:6193738 Gt(ROSA)26Sor targeted mutation 1.1, Ian J Jackson MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:12167 + EM:01368 GRS/ADkcsKieg EMMA embryo GRS/A, IFLa-3 mutant strain MGI:3579297 Mtv2 mammary tumor virus locus 2, present MGI:97188 Mtv2 mammary tumor virus locus 2 https://www.infrafrontier.eu/search?keyword=EM:01368 + EM:00397 GRS.Cg-Tg(MMTV-S100a4)463Oku/Kctt EMMA embryo GR.CBB6-Tg(MMTV-S100a4)463/Kctt, tg463 mutant strain MGI:3620787 Tg(MMTV-S100a4)463Oku transgene insertion 463, Olle Karlstrom MGI:5141468 Tg(MMTV-S100a4)463Oku transgene insertion 463, Olle Karlstrom https://www.infrafrontier.eu/search?keyword=EM:00397 + EM:00397 GRS.Cg-Tg(MMTV-S100a4)463Oku/Kctt EMMA live GR.CBB6-Tg(MMTV-S100a4)463/Kctt, tg463 mutant strain MGI:3620787 Tg(MMTV-S100a4)463Oku transgene insertion 463, Olle Karlstrom MGI:5141468 Tg(MMTV-S100a4)463Oku transgene insertion 463, Olle Karlstrom https://www.infrafrontier.eu/search?keyword=EM:00397 - EM:09367 Gnptab EMMA sperm mutant strain MGI:5616922 Gnptab Nymphe MGI:3643902 Gnptab N-acetylglucosamine-1-phosphate transferase, alpha and beta subunits https://www.infrafrontier.eu/search?keyword=EM:09367 ? EM:11503 Glau-IRFMN EMMA embryo mutant strain Mut-XDH cDNA Mut-XDH cDNA https://www.infrafrontier.eu/search?keyword=EM:11503 ? EM:11503 Glau-IRFMN EMMA sperm mutant strain Mut-XDH cDNA Mut-XDH cDNA https://www.infrafrontier.eu/search?keyword=EM:11503 - EM:11453 G3 EMMA embryo G3129-Prnp/H mutant strain MGI:3619125 Prnp targeted mutation 3, Enrico Cancellotti MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:11453 ? EM:11452 G2 EMMA embryo mutant strain MGI:3619124 Prnp targeted mutation 2, Enrico Cancellotti MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:11452 - EM:11451 G1 EMMA archived 129-Prnp/H mutant strain MGI:3619122 Prnp targeted mutation 1, Enrico Cancellotti MGI:97769 Prnp prion protein https://www.infrafrontier.eu/search?keyword=EM:11451 ? EM:05508 Fyco1 KO cond EMMA embryo mutant strain Fyco1 Fyco1 MGI:107277 Fyco1 FYVE and coiled-coil domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:05508 + EM:00432 FVB;129P2-Trp53/Cnrm EMMA embryo P53F, FVB;129P2-Trp53/Ibcm mutant strain MGI:1931011 Trp53 targeted mutation 1, Anton Berns MGI:98834 Trp53 transformation related protein 53 https://www.infrafrontier.eu/search?keyword=EM:00432 + EM:00433 FVB;129P2-Rb1/Cnrm EMMA embryo RbF, FVB;129P2-Rb1/Ibcm mutant strain MGI:1931018 Rb1 targeted mutation 2, Anton Berns MGI:97874 Rb1 RB transcriptional corepressor 1 https://www.infrafrontier.eu/search?keyword=EM:00433 + EM:00434 FVB;129P2-Rb1/Cnrm EMMA embryo FVB;129P2-Rb1/Ibcm, RbFR mutant strain MGI:1931015 Rb1 targeted mutation 1, Anton Berns MGI:97874 Rb1 RB transcriptional corepressor 1 https://www.infrafrontier.eu/search?keyword=EM:00434 + EM:00406 FVB;129P2-Pten/Cnrm EMMA embryo FVB;129P2-Pten/Ibcm, PtnF mutant strain MGI:2183284 Pten targeted mutation 1, Silvia Marino MGI:109583 Pten phosphatase and tensin homolog https://www.infrafrontier.eu/search?keyword=EM:00406 + EM:00408 FVB;129P2-Nf2/Cnrm EMMA embryo FVB;129P2-Nf2/Ibcm, Nf2F mutant strain MGI:1926955 Nf2 targeted mutation 2, Gilles Thomas MGI:97307 Nf2 neurofibromin 2 https://www.infrafrontier.eu/search?keyword=EM:00408 + EM:00407 FVB;129P2-Cdkn2a/Cnrm EMMA sperm I4aF, FVB;129P2-Cdkn2a/Ibcm mutant strain MGI:2384163 Cdkn2a targeted mutation 2, Anton Berns MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/search?keyword=EM:00407 + EM:00435 FVB;129P2-Cdkn2a/Cnrm EMMA embryo FVB;129P2-Cdkn2a/Ibcm, P16B or Cdkn2a, FVB;129P2-Cdkn2a/Ibcm mutant strain MGI:2384165 Cdkn2a targeted mutation 1.1, Anton Berns MGI:104738 Cdkn2a cyclin dependent kinase inhibitor 2A https://www.infrafrontier.eu/search?keyword=EM:00435 + EM:01642 FVB;129P2-Brca2/Cnrm EMMA embryo FVB;129P2-Brca2/Ibcm, Br2F mutant strain MGI:2156556 Brca2 targeted mutation 1, Anton Berns MGI:109337 Brca2 breast cancer 2, early onset https://www.infrafrontier.eu/search?keyword=EM:01642 + EM:01631 FVB/NPas-Tg(H2-D)2Bujf/Orl EMMA sperm FVB H2-Db2 mutant strain MGI:5306998 Tg(H2-D)2Bujf transgene insertion 2, Jean-Francois Bureau MGI:5306997 Tg(H2-D)2Bujf transgene insertion 2, Jean-Francois Bureau https://www.infrafrontier.eu/search?keyword=EM:01631 + EM:00120 FVB/NIco-Tg(Pcp2/Jun)18Dcrl/Cnrm EMMA embryo FVB/NIco-Tg(Pcp2/Jun)18Dcrl/Ibcm, L7-c-jun-Tg mutant strain MGI:3573864 Tg(Pcp2/Jun)18Dcrl transgene insertion 18, Daniella Carulli MGI:3573861 Tg(Pcp2/Jun)18Dcrl transgene insertion 18, Daniella Carulli https://www.infrafrontier.eu/search?keyword=EM:00120 + EM:01722 FVB/N-Tg(Wap-cre)1Gsc/Ieg EMMA sperm WAPiCre mutant strain MGI:3527260 Tg(Wap-cre)1Gsc transgene insertion 1, Gunther Schutz MGI:3527253 Tg(Wap-cre)1Gsc transgene insertion 1, Gunther Schutz https://www.infrafrontier.eu/search?keyword=EM:01722 + EM:02472 FVB/N-Tg(Tagln-Nppc)1Wlthr/Ieg EMMA embryo FVB/N SM22 CNP mutant strain MGI:5762679 Tg(Tagln-Nppc)1Wlthr transgene insertion 1, Thomas Walther MGI:5762675 Tg(Tagln-Nppc)1Wlthr transgene insertion 1, Thomas Walther https://www.infrafrontier.eu/search?keyword=EM:02472 + EM:01710 FVB/N-Tg(Slc6a3-icre)1Fto/Orl EMMA sperm FVB/N-Tg(Slc6a3-cre)1Fto/Orl, FVB/N-BAC-DATCre, FVB/N-Tg(Slc6a3-cre)1Fto mutant strain MGI:3852083 Tg(Slc6a3-icre)1Fto transgene insertion 1, Francois Tronche MGI:3852082 Tg(Slc6a3-icre)1Fto transgene insertion 1, Francois Tronche https://www.infrafrontier.eu/search?keyword=EM:01710 + EM:02376 FVB/N-Tg(SAA2)1Woo/H EMMA sperm SAA2 mutant strain MGI:5759854 Tg(SAA2)1Woo transgene insertion 1, Patricia Woo MGI:5759851 Tg(SAA2)1Woo transgene insertion 1, Patricia Woo https://www.infrafrontier.eu/search?keyword=EM:02376 ? EM:12211 FVB/N-Tg(S100A8-BCL2)1Lgs/Orl EMMA sperm mutant strain MGI:2448741 Tg(S100A8-BCL2)1Lgs transgene insertion 1, Eric Lagasse MGI:2676367 Tg(S100A8-BCL2)1Lgs transgene insertion 1, Eric Lagasse https://www.infrafrontier.eu/search?keyword=EM:12211 + EM:05367 FVB/N-Tg(Rnu6-RNAi:IE-PRV)SH30Gjo/Orl EMMA embryo SH30 mutant strain MGI:5645894 Tg(Rnu6-RNAi:IE-PRV)SH30Gjo transgene insertion SH30, Genevieve Jolivet MGI:5645891 Tg(Rnu6-RNAi:IE-PRV)SH30Gjo transgene insertion SH30, Genevieve Jolivet https://www.infrafrontier.eu/search?keyword=EM:05367 + EM:05365 FVB/N-Tg(Rnu6-RNAi:IE-PRV)SH05Gjo/Orl EMMA embryo SH05 mutant strain MGI:5645892 Tg(Rnu6-RNAi:IE-PRV)SH05Gjo transgene insertion SH05, Genevieve Jolivet MGI:5645889 Tg(Rnu6-RNAi:IE-PRV)SH05Gjo transgene insertion SH05, Genevieve Jolivet https://www.infrafrontier.eu/search?keyword=EM:05365 + EM:05366 FVB/N-Tg(Rnu6-RNAi:IE-PRV)SH03Gjo/Orl EMMA sperm SH03 mutant strain MGI:5645893 Tg(Rnu6-RNAi:IE-PRV)SH03Gjo transgene insertion SH03, Genevieve Jolivet MGI:5645890 Tg(Rnu6-RNAi:IE-PRV)SH03Gjo transgene insertion SH03, Genevieve Jolivet https://www.infrafrontier.eu/search?keyword=EM:05366 + EM:04569 FVB/N-Tg(Rip-RASA1*)1Wid/Orl EMMA archived FVB/N-Tg(RIP::N)1Wid mutant strain MGI:5648069 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann MGI:5648068 Tg(Rip-RASA1*)1Wid transgene insertion 1, Christian Widmann https://www.infrafrontier.eu/search?keyword=EM:04569 + EM:00250 FVB/N-Tg(Prm1-Tfam)4Lrsn/Kieg EMMA embryo FVB/N-Tg(Prm1-Tfam)4Lrsn, NGLa-1, Prm1-TFAM mutant strain MGI:3525701 Tg(Prm1-Tfam)4Lrsn transgene insertion 4, Nils-Goran Larsson MGI:3525692 Tg(Prm1-Tfam)4Lrsn transgene insertion 4, Nils-Goran Larsson https://www.infrafrontier.eu/search?keyword=EM:00250 + EM:01183 FVB/N-Tg(Nes-rtTA)306Rvs/Cnrm EMMA embryo FVB/N-Tg(Nes-rtTA)306Rvs/Ibcm, Nes-rtTA mutant strain MGI:3505574 Tg(Nes-rtTA)306Rvs transgene insertion 306, Steven A Reeves MGI:2136292 Tg(Nes-rtTA)306Rvs transgene insertion 306, Steven A Reeves https://www.infrafrontier.eu/search?keyword=EM:01183 + EM:01183 FVB/N-Tg(Nes-rtTA)306Rvs/Cnrm EMMA live FVB/N-Tg(Nes-rtTA)306Rvs/Ibcm, Nes-rtTA mutant strain MGI:3505574 Tg(Nes-rtTA)306Rvs transgene insertion 306, Steven A Reeves MGI:2136292 Tg(Nes-rtTA)306Rvs transgene insertion 306, Steven A Reeves https://www.infrafrontier.eu/search?keyword=EM:01183 + EM:07462 FVB/N-Tg(Krt14-Col18a1)J4Pih/Oulu EMMA embryo K14-endostatin (J4) FVB/N mutant strain MGI:5645734 Tg(Krt14-Col18a1)J4Pih transgene insertion J4, Taina Pihlajaniemi MGI:5645733 Tg(Krt14-Col18a1)J4Pih transgene insertion J4, Taina Pihlajaniemi https://www.infrafrontier.eu/search?keyword=EM:07462 + EM:07462 FVB/N-Tg(Krt14-Col18a1)J4Pih/Oulu EMMA sperm K14-endostatin (J4) FVB/N mutant strain MGI:5645734 Tg(Krt14-Col18a1)J4Pih transgene insertion J4, Taina Pihlajaniemi MGI:5645733 Tg(Krt14-Col18a1)J4Pih transgene insertion J4, Taina Pihlajaniemi https://www.infrafrontier.eu/search?keyword=EM:07462 + EM:00411 FVB/N-Tg(Gfap-cre)2Brn/Cnrm EMMA embryo FVB/N-Tg(Gfap-cre)2Brn/Ibcm mutant strain MGI:2663939 Tg(Gfap-cre)2Brn transgene insertion 2, Anton Berns MGI:2671944 Tg(Gfap-cre)2Brn transgene insertion 2, Anton Berns https://www.infrafrontier.eu/search?keyword=EM:00411 + EM:05364 FVB/N-Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo/Orl EMMA embryo mutant strain MGI:5645887 Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo transgene insertion miL15, Genevieve Jolivet MGI:5645819 Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo transgene insertion miL15, Genevieve Jolivet https://www.infrafrontier.eu/search?keyword=EM:05364 + EM:05364 FVB/N-Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo/Orl EMMA sperm mutant strain MGI:5645887 Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo transgene insertion miL15, Genevieve Jolivet MGI:5645819 Tg(EEF1A1-RNAi:IE-PRV)miL15Gjo transgene insertion miL15, Genevieve Jolivet https://www.infrafrontier.eu/search?keyword=EM:05364 + EM:04994 FVB/N-Tg(E2F1-luc)1Ech/Kctt EMMA embryo Ef-luc mutant strain MGI:5648123 Tg(E2F1-luc)1Ech transgene insertion 1, Eric C Holland MGI:5648121 Tg(E2F1-luc)1Ech transgene insertion 1, Eric C Holland https://www.infrafrontier.eu/search?keyword=EM:04994 + EM:00195 FVB/N-Tg(Cryaa-Six3)53Pgr/Ieg EMMA sperm FVB/N-Tg(Cryaa-Six3)53Pgr/Neu, FVB/N-Tg(Cryaa-Six3)53Pgr/PgrNeu, alphaASix3, FVB/N-Tg(Cryaa-Six3)53Pgr/Pgr, FVB-Tg(aAcryst-Six3)F53 mutant strain MGI:3057335 Tg(Cryaa-Six3)53Pgr transgene insertion 53, Peter Gruss MGI:3057330 Tg(Cryaa-Six3)53Pgr transgene insertion 53, Peter Gruss https://www.infrafrontier.eu/search?keyword=EM:00195 + EM:04993 FVB/N-Tg(Cnp-TVA,-lacZ)B8Ubc/Kctt EMMA embryo Ctv-a wild type mutant strain MGI:5648077 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University MGI:5648074 Tg(Cnp-TVA,-lacZ)B8Ubc transgene insertion B8, Uppsala University https://www.infrafrontier.eu/search?keyword=EM:04993 ? EM:10886 FVB/N-Tg(CAG-Itga11)1Dgul/Kctt EMMA sperm mutant strain Tg(CAG-Itga11)1Dgul Tg(CAG-Itga11)1Dgul Tg(CAG-Itga11)1Dgul Tg(CAG-Itga11)1Dgul https://www.infrafrontier.eu/search?keyword=EM:10886 + EM:07013 FVB.Cg-Tg(Wap-Shh)119Mig/Cnbc EMMA embryo Tg(WAP-Shh)119Mig-FVB mutant strain MGI:5645728 Tg(Wap-Shh)119Mig transgene insertion 119, Marta I Gallego MGI:5645727 Tg(Wap-Shh)119Mig transgene insertion 119, Marta I Gallego https://www.infrafrontier.eu/search?keyword=EM:07013 + EM:01804 FVB.Cg-Tg(Nfh/lacZ)44AApt/Orl EMMA sperm FVB.B6C3F2-Tg(Nfh/lacZ)44AApt/Orl, NFH-LacZ/FVB mutant strain MGI:2182128 Tg(Nfh/lacZ)44AApt transgene insertion 44A, Alan Peterson MGI:2388168 Tg(Nfh/lacZ)44AApt transgene insertion 44A, Alan Peterson https://www.infrafrontier.eu/search?keyword=EM:01804 + EM:06074 FVB.Cg-Tg(Kap)L49Msgr/Cnbc EMMA embryo KAP L49 (FVB background), FVB.Cg-Tg(Kap)L49/Cnbc mutant strain MGI:5792809 Tg(Kap)L49Msgr transgene insertion L49, Anna Meseguer MGI:5792808 Tg(Kap)L49Msgr transgene insertion L49, Anna Meseguer https://www.infrafrontier.eu/search?keyword=EM:06074 + EM:00412 FVB.Cg-Tg(IghMyc)186Brn/Cnrm EMMA sperm Emyc, FVB.Cg-Tg(IghMyc)186Brn/Ibcm mutant strain MGI:3039690 Tg(IghMyc)186Brn transgene insertion 186, Anton Berns MGI:3039691 Tg(IghMyc)186Brn transgene insertion 186, Anton Berns https://www.infrafrontier.eu/search?keyword=EM:00412 + EM:09628 FVB.Cg-Tg(Col13a1)2Pih/Oulu EMMA embryo FVB/NHanHsd-Tg(Col13a1)2Pih mutant strain MGI:5645740 Tg(Col13a1)2Pih transgene insertion 2, Taina Pihlajaniemi MGI:5645739 Tg(Col13a1)2Pih transgene insertion 2, Taina Pihlajaniemi https://www.infrafrontier.eu/search?keyword=EM:09628 + EM:09628 FVB.Cg-Tg(Col13a1)2Pih/Oulu EMMA sperm FVB/NHanHsd-Tg(Col13a1)2Pih mutant strain MGI:5645740 Tg(Col13a1)2Pih transgene insertion 2, Taina Pihlajaniemi MGI:5645739 Tg(Col13a1)2Pih transgene insertion 2, Taina Pihlajaniemi https://www.infrafrontier.eu/search?keyword=EM:09628 + EM:05565 FVB.Cg-Tg(Camk2a-Grik2)28Cmul/Orl EMMA embryo GluK2 -6 Myc FVB mutant strain MGI:5645814 Tg(Camk2a-Grik2)28Cmul transgene insertion 28, Christophe Mulle MGI:5645813 Tg(Camk2a-Grik2)28Cmul transgene insertion 28, Christophe Mulle https://www.infrafrontier.eu/search?keyword=EM:05565 + EM:02503 FVB.Cg-Tg(CAG-HSPB1)LPks/H EMMA sperm PCAGGS-HSP27-WT-LOW-COPY, HSP27 WT Low copy line mutant strain MGI:5775102 Tg(CAG-HSPB1)LPks transgene insertion L, Nick Parkinson MGI:5775101 Tg(CAG-HSPB1)LPks transgene insertion L, Nick Parkinson https://www.infrafrontier.eu/search?keyword=EM:02503 + EM:02502 FVB.Cg-Tg(CAG-HSPB1)HPks/H EMMA sperm PCAGGS-HSP27-WT-HIGH-COPY, HSP27 WT High copy line mutant strain MGI:5775094 Tg(CAG-HSPB1)HPks transgene insertion H, Nick Parkinson MGI:5775092 Tg(CAG-HSPB1)HPks transgene insertion H, Nick Parkinson https://www.infrafrontier.eu/search?keyword=EM:02502 ? EM:11431 FVB.Cg-Dnajc5 Tg(Thy1-GFP*)1Rfc/Cnbc EMMA embryo mutant strain MGI:3050763 Dnajc5 targeted mutation 1, Thomas C Sudhof MGI:892995 Dnajc5 DnaJ heat shock protein family (Hsp40) member C5 https://www.infrafrontier.eu/search?keyword=EM:11431 ? EM:11431 FVB.Cg-Dnajc5 Tg(Thy1-GFP*)1Rfc/Cnbc EMMA embryo mutant strain MGI:6343356 Tg(Thy1-GFP*)1Rfc transgene insertion 1, Rafael Fernandez-Chacon MGI:6343363 Tg(Thy1-GFP*)1Rfc transgene insertion 1, Rafael Fernandez-Chacon https://www.infrafrontier.eu/search?keyword=EM:11431 + EM:09898 FVB.AK(Cg)-Del(17)T/Biat EMMA sperm FVB.AK-Del(17)T/Biat mutant strain MGI:1856187 Del(17)T deletion, Chr 17, T, hairpin tail MGI:5427967 Del(17)T deletion, Chr 17, T, hairpin tail https://www.infrafrontier.eu/search?keyword=EM:09898 + EM:09913 FVB.129S6(B6)-Col13a1/Oulu EMMA embryo mutant strain MGI:6116692 Col13a1 targeted mutation 4.1, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:09913 + EM:09913 FVB.129S6(B6)-Col13a1/Oulu EMMA sperm mutant strain MGI:6116692 Col13a1 targeted mutation 4.1, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:09913 + EM:10425 FVB.129S6(B6)-Col13a1/Oulu EMMA embryo mutant strain MGI:4838408 Col13a1 targeted mutation 2, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:10425 + EM:10425 FVB.129S6(B6)-Col13a1/Oulu EMMA sperm mutant strain MGI:4838408 Col13a1 targeted mutation 2, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:10425 - EM:11029 FVB.129S4-Col18a1/Oulu EMMA embryo mutant strain MGI:2179134 Col18a1 targeted mutation 1, Harvard Medical School MGI:88451 Col18a1 collagen, type XVIII, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:11029 - EM:11029 FVB.129S4-Col18a1/Oulu EMMA sperm mutant strain MGI:2179134 Col18a1 targeted mutation 1, Harvard Medical School MGI:88451 Col18a1 collagen, type XVIII, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:11029 + EM:05562 FVB.129P2-Tiam1/Cnbc EMMA sperm FVB-Tiam1 KO mutant strain MGI:2183309 Tiam1 targeted mutation 1, John G Collard MGI:103306 Tiam1 T cell lymphoma invasion and metastasis 1 https://www.infrafrontier.eu/search?keyword=EM:05562 + EM:02142 FVB.129P2-Peg12/Cnrm EMMA embryo FVB.129P2-Peg12/Ibcm, F3H mutant strain MGI:3530465 Peg12 targeted mutation 1, Anton Berns MGI:1351637 Peg12 paternally expressed 12 https://www.infrafrontier.eu/search?keyword=EM:02142 - EM:09897 FVB.129P2-Igf2r/Biat EMMA sperm mutant strain MGI:2445841 Igf2r targeted mutation 2, Erwin F Wagner MGI:96435 Igf2r insulin-like growth factor 2 receptor https://www.infrafrontier.eu/search?keyword=EM:09897 ? EM:09896 FVB.129P2-Igf2r/Biat EMMA sperm mutant strain MGI:6317421 Igf2r targeted mutation 1, Denise P Barlow MGI:96435 Igf2r insulin-like growth factor 2 receptor https://www.infrafrontier.eu/search?keyword=EM:09896 + EM:02141 FVB.129P2-Frat2/Cnrm EMMA embryo FVB.129P2-Frat2/Ibcm, F2H mutant strain MGI:3530460 Frat2 targeted mutation 1, Anton Berns MGI:2673967 Frat2 frequently rearranged in advanced T cell lymphomas 2 https://www.infrafrontier.eu/search?keyword=EM:02141 + EM:02140 FVB.129P2-Frat1/Cnrm EMMA embryo FVB.129P2-Frat1/Ibcm, F1H mutant strain MGI:2384128 Frat1 targeted mutation 1, Anton Berns MGI:109450 Frat1 frequently rearranged in advanced T cell lymphomas https://www.infrafrontier.eu/search?keyword=EM:02140 + EM:02143 FVB.129P2-Frat1 Frat2/Cnrm EMMA embryo F1F2, FVB.129P2-Frat1 Frat2/Ibcm mutant strain MGI:2384128 Frat1 targeted mutation 1, Anton Berns MGI:109450 Frat1 frequently rearranged in advanced T cell lymphomas https://www.infrafrontier.eu/search?keyword=EM:02143 + EM:02143 FVB.129P2-Frat1 Frat2/Cnrm EMMA embryo F1F2, FVB.129P2-Frat1 Frat2/Ibcm mutant strain MGI:3530463 Frat2 targeted mutation 2, Anton Berns MGI:2673967 Frat2 frequently rearranged in advanced T cell lymphomas 2 https://www.infrafrontier.eu/search?keyword=EM:02143 + EM:00054 FVB.129P2-Csf3r/Cnrm EMMA embryo FVB.129P2-Csf3r/Ibcm, FVB.129P2-Csf3r, Csfgr-KO mutant strain MGI:2655452 Csf3r targeted mutation 2, Erasmus University Rotterdam MGI:1339755 Csf3r colony stimulating factor 3 receptor (granulocyte) https://www.infrafrontier.eu/search?keyword=EM:00054 + EM:00053 FVB.129P2-Csf3r/Cnrm EMMA embryo FVB.129P2-Csf3r/Ibcm, FVB.129P2-Csf3r, Csfgr-delta715 mutant strain MGI:2156882 Csf3r targeted mutation 1, Erasmus University Rotterdam MGI:1339755 Csf3r colony stimulating factor 3 receptor (granulocyte) https://www.infrafrontier.eu/search?keyword=EM:00053 + EM:01645 FVB.129P2-Brca1/Cnrm EMMA embryo FVB.Cg-Brca1/Ibcm, Br1F, FVB.129P2-Brca1/Ibcm mutant strain MGI:3696057 Brca1 targeted mutation 1, Anton Berns MGI:104537 Brca1 breast cancer 1, early onset https://www.infrafrontier.eu/search?keyword=EM:01645 - EM:09895 FVB.129P2-Airn/Biat EMMA sperm FVB.129P2(B6)-Airn/Biat mutant strain MGI:2677157 Airn targeted mutation 1, Denise P Barlow MGI:1353471 Airn antisense Igf2r RNA https://www.infrafrontier.eu/search?keyword=EM:09895 ? EM:09900 FVB.129P2-AIDup EMMA sperm mutant strain Airn to Igf2r Airn to Igf2r https://www.infrafrontier.eu/search?keyword=EM:09900 ? EM:09899 FVB.129P2-AIDel EMMA sperm mutant strain Airn and Igf2r Airn and Igf2r https://www.infrafrontier.eu/search?keyword=EM:09899 + EM:04424 FVB.129P2(B6)-Mfge8/Orl EMMA embryo MFGE8/TMbetageo FVB mutant strain MGI:3578644 Mfge8 gene trap KST227, BayGenomics MGI:102768 Mfge8 milk fat globule EGF and factor V/VIII domain containing https://www.infrafrontier.eu/search?keyword=EM:04424 + EM:09263 FVB.129-Col15a1/Oulu EMMA embryo Collagen XV knock-out mouse in FVB background mutant strain MGI:2386162 Col15a1 targeted mutation 1, Taina Pihlajaniemi MGI:88449 Col15a1 collagen, type XV, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:09263 + EM:09263 FVB.129-Col15a1/Oulu EMMA sperm Collagen XV knock-out mouse in FVB background mutant strain MGI:2386162 Col15a1 targeted mutation 1, Taina Pihlajaniemi MGI:88449 Col15a1 collagen, type XV, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:09263 + EM:09799 FVB.129(Cg)-Bmx/Oulu EMMA embryo Bmx KO, FVB.Cg-Bmx/Oulu mutant strain MGI:2660714 Bmx targeted mutation 1, Kari Alitalo MGI:1101778 Bmx BMX non-receptor tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:09799 + EM:09799 FVB.129(Cg)-Bmx/Oulu EMMA sperm Bmx KO, FVB.Cg-Bmx/Oulu mutant strain MGI:2660714 Bmx targeted mutation 1, Kari Alitalo MGI:1101778 Bmx BMX non-receptor tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:09799 + EM:10424 FVB.129(B6)-Col13a1/Oulu EMMA embryo mutant strain MGI:4838409 Col13a1 targeted mutation 3.1, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:10424 + EM:10424 FVB.129(B6)-Col13a1/Oulu EMMA sperm mutant strain MGI:4838409 Col13a1 targeted mutation 3.1, Taina Pihlajaniemi MGI:1277201 Col13a1 collagen, type XIII, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:10424 + EM:04774 FVB-Tg(Wap-Hgf)402Mig/Cnbc EMMA embryo mutant strain MGI:3036575 Tg(Wap-Hgf)402Mig transgene insertion 402, Marta I Gallego MGI:3037894 Tg(Wap-Hgf)402Mig transgene insertion 402, Marta I Gallego https://www.infrafrontier.eu/search?keyword=EM:04774 + EM:04774 FVB-Tg(Wap-Hgf)402Mig/Cnbc EMMA sperm mutant strain MGI:3036575 Tg(Wap-Hgf)402Mig transgene insertion 402, Marta I Gallego MGI:3037894 Tg(Wap-Hgf)402Mig transgene insertion 402, Marta I Gallego https://www.infrafrontier.eu/search?keyword=EM:04774 ? EM:11430 FVB-Tg(Thy1-GFP*)1Rfc/Cnbc EMMA embryo mutant strain MGI:6343356 Tg(Thy1-GFP*)1Rfc transgene insertion 1, Rafael Fernandez-Chacon MGI:6343363 Tg(Thy1-GFP*)1Rfc transgene insertion 1, Rafael Fernandez-Chacon https://www.infrafrontier.eu/search?keyword=EM:11430 + EM:04778 FVB-Tg(tetO-TPR/MET,-EGFP)12Tcre/Cnrm EMMA embryo Tpr-Met-TetO-GFP, FVB-Tg(TPRMET-tetO-GFP)Tcre/Ibcm, FVB-Tg(tetO-TPR/MET,-EGFP)12Tcre/Ibcm mutant strain MGI:4949465 Tg(tetO-TPR/MET,-EGFP)12Tcre transgene insertion 12, Tiziana Crepaldi MGI:4949460 Tg(tetO-TPR/MET,-EGFP)12Tcre transgene insertion 12, Tiziana Crepaldi https://www.infrafrontier.eu/search?keyword=EM:04778 + EM:04364 FVB-Tg(tetO-Hgf,-EGFP)24Tcre/Cnrm EMMA embryo Hgf-TetO-GFP mutant strain MGI:5648118 Tg(tetO-Hgf,-EGFP)24Tcre transgene insertion 24, Tiziana Crepaldi MGI:5648117 Tg(tetO-Hgf,-EGFP)24Tcre transgene insertion 24, Tiziana Crepaldi https://www.infrafrontier.eu/search?keyword=EM:04364 + EM:04322 FVB-Tg(tetO-Chrnb2*V287L)H5Gica/Cnrm EMMA embryo Tg(TRE-Chrnb2VL)/H5 mutant strain MGI:5014761 Tg(tetO-Chrnb2*V287L)H5Gica transgene insertion H5, Giorgio Casari MGI:5014756 Tg(tetO-Chrnb2*V287L)H5Gica transgene insertion H5, Giorgio Casari https://www.infrafrontier.eu/search?keyword=EM:04322 + EM:04321 FVB-Tg(tetO-Chrnb2*V287L)H3Gica/Cnrm EMMA embryo Tg(TRE-Chrnb2VL)/H3, FVB-Tg(tetO-Chrnb2*V287L)H3Gica/Ibcm mutant strain MGI:3843695 Tg(tetO-Chrnb2*V287L)H3Gica transgene insertion H3, Giorgio Casari MGI:3843694 Tg(tetO-Chrnb2*V287L)H3Gica transgene insertion H3, Giorgio Casari https://www.infrafrontier.eu/search?keyword=EM:04321 + EM:00121 FVB-Tg(Pcp2-Gap43)L1657Fro/Cnrm EMMA embryo FVB-Tg(Pcp2-Gap43)L1657Fro/Ibcm, FVB-Tg(Pcp2-Gap43)L1657Fro, L7promoter/GAP43-ORF mutant strain MGI:2652499 Tg(Pcp2-Gap43)L1657Fro transgene insertion L1657, Ferdinando Rossi MGI:2652497 Tg(Pcp2-Gap43)L1657Fro transgene insertion L1657, Ferdinando Rossi https://www.infrafrontier.eu/search?keyword=EM:00121 + EM:00756 FVB-Tg(Pax6-cre,GFP)2Pgr/PgrCnrm EMMA embryo FVB-Tg(Pax6-cre,GFP)2Pgr/PgrIbcm, ECG mutant strain MGI:3052661 Tg(Pax6-cre,GFP)2Pgr transgene insertion 2, Peter Gruss MGI:3052668 Tg(Pax6-cre,GFP)2Pgr transgene insertion 2, Peter Gruss https://www.infrafrontier.eu/search?keyword=EM:00756 + EM:00755 FVB-Tg(Pax6-cre,GFP)1Pgr/PgrCnrm EMMA embryo FVB-Tg(Pax6-cre,GFP)1Pgr/PgrIbcm, Lens-Cre, FVB-Tg(Pax6-cre,-GFP)1Pgr/PgrIbcm mutant strain MGI:3045749 Tg(Pax6-cre,GFP)1Pgr transgene insertion 1, Peter Gruss MGI:3045750 Tg(Pax6-cre,GFP)1Pgr transgene insertion 1, Peter Gruss https://www.infrafrontier.eu/search?keyword=EM:00755 + EM:00205 FVB-Tg(Pax4-lacZ)2Pgr/Ieg EMMA sperm FVB-Tg(Pax4 0.5Kb-LacZ)cb11, FVB-Tg(Pax4-lacZ)2Pgr/Pgr, FVB-Tg(Pax4-lacZ)2Pgr/Neu mutant strain MGI:3057320 Tg(Pax4-lacZ)2Pgr transgene insertion 2, Peter Gruss MGI:3057319 Tg(Pax4-lacZ)2Pgr transgene insertion 2, Peter Gruss https://www.infrafrontier.eu/search?keyword=EM:00205 + EM:00042 FVB-Tg(Pax4-lacZ)1Pgr/PgrIeg EMMA sperm CBII(Pax4-LacZ)Tg, CBIID, FVB-Tg(Pax4-lacZ)1Pgr/Pgr mutant strain MGI:3044158 Tg(Pax4-lacZ)1Pgr transgene insertion 1, Peter Gruss MGI:3044157 Tg(Pax4-lacZ)1Pgr transgene insertion 1, Peter Gruss https://www.infrafrontier.eu/search?keyword=EM:00042 + EM:01839 FVB-Tg(Nefh/EGFP)1Eyer/Orl EMMA archived NFH-GFP, FVB-Tg(Nefh-GFP)/Orl mutant strain MGI:5315129 Tg(Nefh/EGFP)1Eyer transgene insertion 1, Joel Eyer MGI:5315128 Tg(Nefh/EGFP)1Eyer transgene insertion 1, Joel Eyer https://www.infrafrontier.eu/search?keyword=EM:01839 + EM:00140 FVB-Tg(Mpz-cre)1Brn/Orl EMMA embryo P0 Cre-B mutant strain MGI:2445228 Tg(Mpz-cre)1Brn transgene insertion 1, Anton Berns MGI:2445223 Tg(Mpz-cre)1Brn transgene insertion 1, Anton Berns https://www.infrafrontier.eu/search?keyword=EM:00140 + EM:00314 FVB-Tg(Mpz*L106I)3Msch/Cnrm EMMA embryo FVB-Tg(P0)sub3Msch/Cnrm, P0sub3 mutant strain MGI:5003316 Tg(Mpz*L106I)3Msch transgene insertion 3, Melitta Schachner MGI:5003308 Tg(Mpz*L106I)3Msch transgene insertion 3, Melitta Schachner https://www.infrafrontier.eu/search?keyword=EM:00314 + EM:00313 FVB-Tg(Mpz*L106I)1Msch/Cnrm EMMA embryo FVB-Tg(P0)sub1Msch/Cnrm, P0sub1 mutant strain MGI:5003283 Tg(Mpz*L106I)1Msch transgene insertion 1, Melitta Schachner MGI:5003282 Tg(Mpz*L106I)1Msch transgene insertion 1, Melitta Schachner https://www.infrafrontier.eu/search?keyword=EM:00313 + EM:00315 FVB-Tg(Mpz*Ala221fs)4Msch/Cnrm EMMA embryo FVB-Tg(P0)ins4Msch/Cnrm, P0ins4 mutant strain MGI:5003323 Tg(Mpz*Ala221fs)4Msch transgene insertion 4, Melitta Schachner MGI:5003322 Tg(Mpz*Ala221fs)4Msch transgene insertion 4, Melitta Schachner https://www.infrafrontier.eu/search?keyword=EM:00315 ? EM:09937 FVB-Tg(MMTV-PRUNE)/Cnrm EMMA embryo mutant strain Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) https://www.infrafrontier.eu/search?keyword=EM:09937 ? EM:09937 FVB-Tg(MMTV-PRUNE)/Cnrm EMMA sperm mutant strain Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) Tg(MMTV-PRUNE) https://www.infrafrontier.eu/search?keyword=EM:09937 + EM:05152 FVB-Tg(MMTV-ERBB2*)#Arbs/Cnbc EMMA embryo FVB-Tg(MMTV-Erbb2*)#Arbs/Cnbc, FVB HER2M687, FVB-Tg(MMTV-Erbb2)/Cnbc mutant strain MGI:5883855 Tg(MMTV-ERBB2*)#Arbs transgene insertion, Joaquin Arribas MGI:5883853 Tg(MMTV-ERBB2*)#Arbs transgene insertion, Joaquin Arribas https://www.infrafrontier.eu/search?keyword=EM:05152 + EM:05152 FVB-Tg(MMTV-ERBB2*)#Arbs/Cnbc EMMA sperm FVB-Tg(MMTV-Erbb2*)#Arbs/Cnbc, FVB HER2M687, FVB-Tg(MMTV-Erbb2)/Cnbc mutant strain MGI:5883855 Tg(MMTV-ERBB2*)#Arbs transgene insertion, Joaquin Arribas MGI:5883853 Tg(MMTV-ERBB2*)#Arbs transgene insertion, Joaquin Arribas https://www.infrafrontier.eu/search?keyword=EM:05152 ? EM:10733 FVB-Tg(KRT14-VEGFC)1Ali/Oulu EMMA embryo mutant strain MGI:6273971 Tg(KRT14-VEGFC)1Ali transgene insertion 1, Kari Alitalo MGI:6273970 Tg(KRT14-VEGFC)1Ali transgene insertion 1, Kari Alitalo https://www.infrafrontier.eu/search?keyword=EM:10733 ? EM:10733 FVB-Tg(KRT14-VEGFC)1Ali/Oulu EMMA sperm mutant strain MGI:6273971 Tg(KRT14-VEGFC)1Ali transgene insertion 1, Kari Alitalo MGI:6273970 Tg(KRT14-VEGFC)1Ali transgene insertion 1, Kari Alitalo https://www.infrafrontier.eu/search?keyword=EM:10733 + EM:09798 FVB-Tg(KRT14-Figf)1Ali/Oulu EMMA embryo K14-mVEGF-D mutant strain MGI:3804466 Tg(KRT14-Figf)1Ali transgene insertion 1, Kari Alitalo MGI:3804465 Tg(KRT14-Figf)1Ali transgene insertion 1, Kari Alitalo https://www.infrafrontier.eu/search?keyword=EM:09798 + EM:09798 FVB-Tg(KRT14-Figf)1Ali/Oulu EMMA sperm K14-mVEGF-D mutant strain MGI:3804466 Tg(KRT14-Figf)1Ali transgene insertion 1, Kari Alitalo MGI:3804465 Tg(KRT14-Figf)1Ali transgene insertion 1, Kari Alitalo https://www.infrafrontier.eu/search?keyword=EM:09798 + EM:05159 FVB-Tg(Fabp2-Arg1)1Wla/Cnbc EMMA embryo FA/2 FVB mutant strain MGI:2446302 Tg(Fabp2-Arg1)1Wla transgene insertion 1, Wouters H Lamers MGI:2652048 Tg(Fabp2-Arg1)1Wla transgene insertion 1, Wouters H Lamers https://www.infrafrontier.eu/search?keyword=EM:05159 + EM:05159 FVB-Tg(Fabp2-Arg1)1Wla/Cnbc EMMA sperm FA/2 FVB mutant strain MGI:2446302 Tg(Fabp2-Arg1)1Wla transgene insertion 1, Wouters H Lamers MGI:2652048 Tg(Fabp2-Arg1)1Wla transgene insertion 1, Wouters H Lamers https://www.infrafrontier.eu/search?keyword=EM:05159 + EM:01657 FVB-Tg(Dll1-Dll3)3Gos/Ieg EMMA sperm Tg(Dll3)3Gos, FVB-Tg(Dll3)3Gos/Ieg mutant strain MGI:5501066 Tg(Dll1-Dll3)3Gos transgene insertion 3, Achim Gossler MGI:5501062 Tg(Dll1-Dll3)3Gos transgene insertion 3, Achim Gossler https://www.infrafrontier.eu/search?keyword=EM:01657 + EM:01237 FVB-Tg(CEPHY285E6)84Hgc/Orl EMMA embryo YAC Lg 84 mutant strain MGI:5293466 Tg(CEPHY285E6)84Hgc transgene insertion 84, Edward Rubin MGI:5293462 Tg(CEPHY285E6)84Hgc transgene insertion 84, Edward Rubin https://www.infrafrontier.eu/search?keyword=EM:01237 + EM:01748 FVB-Tg(CEPHY285E6)67Hgc/Orl EMMA embryo YAC Lg 67 mutant strain MGI:5293460 Tg(CEPHY285E6)67Hgc transgene insertion 67, Edward Rubin MGI:5293459 Tg(CEPHY285E6)67Hgc transgene insertion 67, Edward Rubin https://www.infrafrontier.eu/search?keyword=EM:01748 + EM:01245 FVB-Tg(CEPHY230E8)55Hgc/Orl EMMA embryo YAC Lg 55, FVB-Tg(YAC230E)55Hgc/Orl mutant strain MGI:5291627 Tg(CEPHY230E8)55Hgc transgene insertion 55, Edward M Rubin MGI:5291626 Tg(CEPHY230E8)55Hgc transgene insertion 55, Edward M Rubin https://www.infrafrontier.eu/search?keyword=EM:01245 + EM:01246 FVB-Tg(CEPHY230E8)50Hgc/Orl EMMA embryo YAC Lg 50, FVB-Tg(YAC230E)50Hgc/Orl mutant strain MGI:5291633 Tg(CEPHY230E8)50Hgc transgene insertion 50, Edward M Rubin MGI:5291632 Tg(CEPHY230E8)50Hgc transgene insertion 50, Edward M Rubin https://www.infrafrontier.eu/search?keyword=EM:01246 + EM:01238 FVB-Tg(CEPHY152F7)57Hgc/Orl EMMA embryo YAC Lg 57 mutant strain MGI:5293456 Tg(CEPHY152F7)57Hgc transgene insertion 57, Edward Rubin MGI:5293454 Tg(CEPHY152F7)57Hgc transgene insertion 57, Edward Rubin https://www.infrafrontier.eu/search?keyword=EM:01238 + EM:01238 FVB-Tg(CEPHY152F7)57Hgc/Orl EMMA sperm YAC Lg 57 mutant strain MGI:5293456 Tg(CEPHY152F7)57Hgc transgene insertion 57, Edward Rubin MGI:5293454 Tg(CEPHY152F7)57Hgc transgene insertion 57, Edward Rubin https://www.infrafrontier.eu/search?keyword=EM:01238 + EM:01303 FVB-Tg(CEPHY152F7)12Hgc/Orl EMMA embryo YAC Lg 12, FVB-Tg(YAC152F7)12Hgc/Orl mutant strain MGI:5293446 Tg(CEPHY152F7)12Hgc transgene insertion 12, Edward M Rubin MGI:5293445 Tg(CEPHY152F7)12Hgc transgene insertion 12, Edward M Rubin https://www.infrafrontier.eu/search?keyword=EM:01303 + EM:01304 FVB-Tg(CEPHY141G6)4Hgc/Orl EMMA embryo YAC Lg 4, FVB-Tg(YAC141G6)4Hgc/Orl mutant strain MGI:5293441 Tg(CEPHY141G6)4Hgc transgene insertion 4, Edward M Rubin MGI:5293440 Tg(CEPHY141G6)4Hgc transgene insertion 4, Edward M Rubin https://www.infrafrontier.eu/search?keyword=EM:01304 + EM:01302 FVB-Tg(CEPHY141G6)28Hgc/Orl EMMA embryo FVB-Tg(YAC141G6)28Hgc/Orl, YAC Lg 28 mutant strain MGI:5293437 Tg(CEPHY141G6)28Hgc transgene insertion 28, Edward M Rubin MGI:5293436 Tg(CEPHY141G6)28Hgc transgene insertion 28, Edward M Rubin https://www.infrafrontier.eu/search?keyword=EM:01302 ? EM:09109 FVB-Tg(CD19-Zap70)1Icgb/Cnrm EMMA embryo mutant strain Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb https://www.infrafrontier.eu/search?keyword=EM:09109 ? EM:09109 FVB-Tg(CD19-Zap70)1Icgb/Cnrm EMMA sperm mutant strain Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb Tg(CD19-Zap70)1Icgb https://www.infrafrontier.eu/search?keyword=EM:09109 + EM:00005 FVB-Tg(CAG-cat,-lacZ)1Brn/StmOrl EMMA embryo FVB-Tg(ACTB-cat-lacZ)1Brn/BrnStm, FVB-Tg(ACTB-cat-lacZ)1Brn/StmOrl, ACZL, FVB-Tg(CAG-cat-lacZ)1Brn/StmOrl mutant strain MGI:3044043 Tg(CAG-cat,-lacZ)1Brn transgene insertion 1, Anton Berns MGI:3044042 Tg(CAG-cat,-lacZ)1Brn transgene insertion 1, Anton Berns https://www.infrafrontier.eu/search?keyword=EM:00005 + EM:01415 FVB-Tg(ACTB-tTS)1Mllo/Cnrm EMMA embryo pAct-tTS, FVB-Tg(ACTB-tTS)1Mllo/Ibcm mutant strain MGI:3717162 Tg(ACTB-tTS)1Mllo transgene insertion 1, Moises Mallo MGI:3717161 Tg(ACTB-tTS)1Mllo transgene insertion 1, Moises Mallo https://www.infrafrontier.eu/search?keyword=EM:01415 + EM:11961 FVB-Il31ra/Cnrm EMMA embryo mutant strain MGI:6342541 Il31ra endonuclease-mediated mutation 2, Paul A Heppenstall MGI:2180511 Il31ra interleukin 31 receptor A https://www.infrafrontier.eu/search?keyword=EM:11961 + EM:11961 FVB-Il31ra/Cnrm EMMA sperm mutant strain MGI:6342541 Il31ra endonuclease-mediated mutation 2, Paul A Heppenstall MGI:2180511 Il31ra interleukin 31 receptor A https://www.infrafrontier.eu/search?keyword=EM:11961 ? EM:11960 FVB-Il31ra/Cnrm EMMA archived mutant strain MGI:6342540 Il31ra endonuclease-mediated mutation 1, Paul A Heppenstall MGI:2180511 Il31ra interleukin 31 receptor A https://www.infrafrontier.eu/search?keyword=EM:11960 ? EM:09147 Ftl1Ate007Mhda; internal lab code ATE007 EMMA sperm mutant strain Ftl1 Ftl1 MGI:95589 Ftl1 ferritin light polypeptide 1 https://www.infrafrontier.eu/search?keyword=EM:09147 - EM:01286 FNOS2 EMMA sperm STOCK Fnos2/H mutant strain MGI:6241419 Fnos2 FNOS2 MGI:6241416 Fnos2 FNOS2 https://www.infrafrontier.eu/search?keyword=EM:01286 ? EM:12162 flox miR-26 sponge EMMA sperm mutant strain Col1A1 Col1A1 MGI:88467 Col1a1 collagen, type I, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:12162 ? EM:05513 FLG KO conv EMMA embryo mutant strain Flg Flg MGI:95553 Flg filaggrin https://www.infrafrontier.eu/search?keyword=EM:05513 ? EM:13083 FDUP EMMA sperm mutant strain Tandem duplication of 13.7 kb at mouse chr4 Tandem duplication of 13.7 kb at mouse chr4 Tandem duplication of 13.7 kb at mouse chr4 Tandem duplication of 13.7 kb at mouse chr4 https://www.infrafrontier.eu/search?keyword=EM:13083 ? EM:12222 Fam183b EMMA sperm mutant strain Fam183b Fam183b MGI:1922679 Fam183b family with sequence similarity 183, member B https://www.infrafrontier.eu/search?keyword=EM:12222 ? EM:11953 erGAP3 EMMA sperm mutant strain erGAP3 erGAP3 https://www.infrafrontier.eu/search?keyword=EM:11953 ? EM:11141 EmuTEL-AML1 EMMA sperm mutant strain Tg(Emu-TEL/AML1) Tg(Emu-TEL/AML1) Tg(Emu-TEL/AML1) Tg(Emu-TEL/AML1) https://www.infrafrontier.eu/search?keyword=EM:11141 ? EM:05492 Emp3 KO conv EMMA embryo mutant strain Emp3 Emp3 MGI:1098729 Emp3 epithelial membrane protein 3 https://www.infrafrontier.eu/search?keyword=EM:05492 ? EM:05493 Emp3 KO cond EMMA embryo mutant strain Emp3 Emp3 MGI:1098729 Emp3 epithelial membrane protein 3 https://www.infrafrontier.eu/search?keyword=EM:05493 - EM:11391 Egr2-GFP knock-in mouse EMMA sperm B6.Cg-Egr2/H mutant strain MGI:95296 Egr2 early growth response 2 https://www.infrafrontier.eu/search?keyword=EM:11391 ? EM:11831 Ebf3 EMMA archived unclassified MGI:894289 Ebf3 early B cell factor 3 https://www.infrafrontier.eu/search?keyword=EM:11831 + EM:01167 DW-Lepr/Orl EMMA archived diabete-Pasteur mutant strain MGI:1856013 Lepr diabetes Institut Pasteur MGI:104993 Lepr leptin receptor https://www.infrafrontier.eu/search?keyword=EM:01167 ? EM:11372 DUSP1flox EMMA embryo mutant strain Dusp1 Dusp1 MGI:105120 Dusp1 dual specificity phosphatase 1 https://www.infrafrontier.eu/search?keyword=EM:11372 ? EM:13832 Dll1SF EMMA sperm mutant strain Dll1 Dll1 MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:13832 ? EM:12226 Dll1D1N-E3_D4ki EMMA sperm mutant strain Dll1D1N-E3_D4ki Dll1D1N-E3_D4ki MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:12226 ? EM:12227 Dll1D1contD4ki EMMA sperm mutant strain Dll1D1contD4ki Dll1D1contD4ki MGI:104659 Dll1 delta like canonical Notch ligand 1 https://www.infrafrontier.eu/search?keyword=EM:12227 ? EM:12762 del52 hDMD/mdx mouse EMMA sperm mutant strain human DMD gene carrying a deletion of exon 52 human DMD gene carrying a deletion of exon 52 human DMD gene carrying a deletion of exon 52 human DMD gene carrying a deletion of exon 52 https://www.infrafrontier.eu/search?keyword=EM:12762 + EM:02026 DBA/1UguOrl EMMA archived DBA/1 CD44WT mutant strain MGI:2430266 Cd44<+> wild type MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02026 + EM:11300 DBA.129S2(Cg)-Synb/Orl EMMA embryo DBA.Cg-Synb/Orl mutant strain MGI:5308859 Synb targeted mutation 1.2, Mouse Clinical Institute MGI:3045308 Synb syncytin b https://www.infrafrontier.eu/search?keyword=EM:11300 + EM:07011 D2.Cg-Tg(Wap-Shh)186Mig/Cnbc EMMA embryo Tg(WAP-Shh)186Mig-DBA2 mutant strain MGI:5645729 Tg(Wap-Shh)186Mig transgene insertion 186, Marta I Gallego MGI:5645725 Tg(Wap-Shh)186Mig transgene insertion 186, Marta I Gallego https://www.infrafrontier.eu/search?keyword=EM:07011 + EM:07011 D2.Cg-Tg(Wap-Shh)186Mig/Cnbc EMMA sperm Tg(WAP-Shh)186Mig-DBA2 mutant strain MGI:5645729 Tg(Wap-Shh)186Mig transgene insertion 186, Marta I Gallego MGI:5645725 Tg(Wap-Shh)186Mig transgene insertion 186, Marta I Gallego https://www.infrafrontier.eu/search?keyword=EM:07011 + EM:01721 D2.Cg-Tg(TG-Gnas*R201H)1Rho/Orl EMMA embryo gsp mice, gsp transgenic mice, 2211D mutant strain MGI:5308857 Tg(TG-Gnas*R201H)1Rho transgene insertion 1, Rhone-Poulenc Sante MGI:5308854 Tg(TG-Gnas*R201H)1Rho transgene insertion 1, Rhone-Poulenc Sante https://www.infrafrontier.eu/search?keyword=EM:01721 - EM:11814 D1OlaHsd.D1LacJ-Tg(Tcra172,Tcrb172)1Wcl/MmmhOrl EMMA sperm D1OlaHsd.Cg-Tg(Tcra172,Tcrb172)1Wcl/MmmhOrl mutant strain MGI:3699517 Tg(Tcra172,Tcrb172)1Wcl transgene insertion 1, Warren C Ladiges MGI:3767797 Tg(Tcra172,Tcrb172)1Wcl transgene insertion 1, Warren C Ladiges https://www.infrafrontier.eu/search?keyword=EM:11814 + EM:12679 D1OlaHsd.Cg-Thy1/Orl EMMA sperm D1.Cg-Thy1/Orl mutant strain MGI:3579311 Thy1 a variant MGI:98747 Thy1 thymus cell antigen 1, theta https://www.infrafrontier.eu/search?keyword=EM:12679 ? EM:11813 D1.B6-Tg(CAG-EGFP)1Osb/JOrl EMMA sperm mutant strain MGI:2686773 Tg(CAG-EGFP)1Osb transgene insertion 1, Research Institute for Microbial Diseases, Osaka University MGI:2686899 Tg(CAG-EGFP)1Osb transgene insertion 1, Research Institute for Microbial Diseases, Osaka University https://www.infrafrontier.eu/search?keyword=EM:11813 + EM:11812 D1.129P2(B6)-Il10/JOrl EMMA sperm D1.B6(129P2)-Il10/JOrl mutant strain MGI:1857199 Il10 targeted mutation 1, University of Cologne MGI:96537 Il10 interleukin 10 https://www.infrafrontier.eu/search?keyword=EM:11812 + EM:02025 D1.129-Cd44/Orl EMMA archived mutant strain MGI:2679704 Cd44 targeted mutation 1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02025 + EM:02024 D1.129-Cd44/Orl EMMA archived DBA/1 CD44v6v7-/- mutant strain MGI:2679706 Cd44 targeted mutation 1.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02024 ? EM:05509 Csemp1 KO conv EMMA embryo mutant strain Fyco1 Fyco1 MGI:107277 Fyco1 FYVE and coiled-coil domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:05509 ? EM:12608 COTRIND [Gad2-NCreERT2 x Slc6a5-ERT2CCre x Ai14] EMMA embryo mutant strain BAC[Gad2-NCreERT2-IRES- ?Galactosidase-SV40pA] BAC[Gad2-NCreERT2-IRES- ?Galactosidase-SV40pA] BAC[Gad2-NCreERT2-IRES- ?Galactosidase-SV40pA] BAC[Gad2-NCreERT2-IRES- ?Galactosidase-SV40pA] https://www.infrafrontier.eu/search?keyword=EM:12608 ? EM:12608 COTRIND [Gad2-NCreERT2 x Slc6a5-ERT2CCre x Ai14] EMMA embryo mutant strain BAC[Slc6a5-ERT2CCre-IRES- alkaline phosphatase-SV40pA] BAC[Slc6a5-ERT2CCre-IRES- alkaline phosphatase-SV40pA] BAC[Slc6a5-ERT2CCre-IRES- alkaline phosphatase-SV40pA] BAC[Slc6a5-ERT2CCre-IRES- alkaline phosphatase-SV40pA] https://www.infrafrontier.eu/search?keyword=EM:12608 ? EM:12608 COTRIND [Gad2-NCreERT2 x Slc6a5-ERT2CCre x Ai14] EMMA embryo mutant strain MGI:3809524 Gt(ROSA)26Sor targeted mutation 14, Hongkui Zeng MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:12608 - EM:08317 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon Gnat2<+> EMMA embryo mutant strain MGI:2430747 Gnat2<+> wild type MGI:95779 Gnat2 G protein subunit alpha transducin 2 https://www.infrafrontier.eu/search?keyword=EM:08317 - EM:08317 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon Gnat2<+> EMMA embryo mutant strain MGI:4443331 Tg(Tyr-rtTA)4111Lmon transgene insertion 4111, Lluis Montoliu MGI:4443327 Tg(Tyr-rtTA)4111Lmon transgene insertion 4111, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:08317 - EM:08317 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon Gnat2<+> EMMA embryo mutant strain MGI:4443329 Tg(tetO-Tyr)1335Lmon transgene insertion 1335, Lluis Montoliu MGI:4443325 Tg(tetO-Tyr)1335Lmon transgene insertion 1335, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:08317 - EM:08317 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon Gnat2<+> EMMA embryo mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:08317 + EM:02611 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon EMMA embryo TRETyBS/HSTyrTET, HsdWin:NMRI.FVB/HanHsd-Tg(TRETyr,Tyr-rtTA)1335-4111Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:02611 + EM:02611 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon EMMA embryo TRETyBS/HSTyrTET, HsdWin:NMRI.FVB/HanHsd-Tg(TRETyr,Tyr-rtTA)1335-4111Lmon/Cnbc mutant strain MGI:4443331 Tg(Tyr-rtTA)4111Lmon transgene insertion 4111, Lluis Montoliu MGI:4443327 Tg(Tyr-rtTA)4111Lmon transgene insertion 4111, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:02611 + EM:02611 CnbcLmon:NMRI-Tg(tetO-Tyr)1335Lmon Tg(Tyr-rtTA)4111Lmon EMMA embryo TRETyBS/HSTyrTET, HsdWin:NMRI.FVB/HanHsd-Tg(TRETyr,Tyr-rtTA)1335-4111Lmon/Cnbc mutant strain MGI:4443329 Tg(tetO-Tyr)1335Lmon transgene insertion 1335, Lluis Montoliu MGI:4443325 Tg(tetO-Tyr)1335Lmon transgene insertion 1335, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:02611 - EM:02610 CnbcHsdWin:NMRI-Tg(Tyr-Th,-Gch1)6775Lmon EMMA embryo mutant strain MGI:4443311 Tg(Tyr-Th,-Gch1)6775Lmon transgene insertion 6775, Lluis Montoliu MGI:4443324 Tg(Tyr-Th,-Gch1)6775Lmon transgene insertion 6775, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:02610 - EM:02610 CnbcHsdWin:NMRI-Tg(Tyr-Th,-Gch1)6775Lmon EMMA embryo mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:02610 + EM:06056 Cnbc:NMRI-Tg(Wap-ALPP*)p1938Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)p1938Lmon mutant strain MGI:6202757 Tg(Wap-ALPP*)p1938Lmon transgene insertion p1938, Lluis Montoliu MGI:6202755 Tg(Wap-ALPP*)p1938Lmon transgene insertion p1938, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:06056 + EM:06056 Cnbc:NMRI-Tg(Wap-ALPP*)p1938Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)p1938Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06056 + EM:06055 Cnbc:NMRI-Tg(Wap-ALPP*)p1435Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)p1435Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06055 + EM:06055 Cnbc:NMRI-Tg(Wap-ALPP*)p1435Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)p1435Lmon mutant strain MGI:6202751 Tg(Wap-ALPP*)p1435Lmon transgene insertion p1435, Lluis Montoliu MGI:6202750 Tg(Wap-ALPP*)p1435Lmon transgene insertion p1435, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:06055 + EM:06059 Cnbc:NMRI-Tg(Wap-ALPP*)b6733Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6733Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06059 + EM:06059 Cnbc:NMRI-Tg(Wap-ALPP*)b6733Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6733Lmon mutant strain MGI:6202771 Tg(Wap-ALPP*)b6733Lmon transgene insertion b6733, Lluis Montoliu MGI:6202770 Tg(Wap-ALPP*)b6733Lmon transgene insertion b6733, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:06059 + EM:06058 Cnbc:NMRI-Tg(Wap-ALPP*)b6727Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6727Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06058 + EM:06058 Cnbc:NMRI-Tg(Wap-ALPP*)b6727Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6727Lmon mutant strain MGI:6202768 Tg(Wap-ALPP*)b6727Lmon transgene insertion b6727, Lluis Montoliu MGI:6202767 Tg(Wap-ALPP*)b6727Lmon transgene insertion b6727, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:06058 + EM:06057 Cnbc:NMRI-Tg(Wap-ALPP*)b6725Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6725Lmon mutant strain MGI:6202764 Tg(Wap-ALPP*)b6725Lmon transgene insertion b6725, Lluis Montoliu MGI:6202763 Tg(Wap-ALPP*)b6725Lmon transgene insertion b6725, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:06057 + EM:06057 Cnbc:NMRI-Tg(Wap-ALPP*)b6725Lmon EMMA sperm stock HsdWin:NMRI-Tg(Wap-hSEAP)b6725Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06057 + EM:05261 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2017Lmon EMMA embryo Hsd:NMRI-Tg(Tyr,aEHS1.4)2017Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2017Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05261 + EM:05261 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2017Lmon EMMA embryo Hsd:NMRI-Tg(Tyr,aEHS1.4)2017Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2017Lmon mutant strain MGI:5645903 Tg(Tyr,aEHS1.4)2017Lmon transgene insertion 2017, Lluis Montoliu MGI:5645900 Tg(Tyr,aEHS1.4)2017Lmon transgene insertion 2017, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05261 + EM:05261 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2017Lmon EMMA sperm Hsd:NMRI-Tg(Tyr,aEHS1.4)2017Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2017Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05261 + EM:05261 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2017Lmon EMMA sperm Hsd:NMRI-Tg(Tyr,aEHS1.4)2017Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2017Lmon mutant strain MGI:5645903 Tg(Tyr,aEHS1.4)2017Lmon transgene insertion 2017, Lluis Montoliu MGI:5645900 Tg(Tyr,aEHS1.4)2017Lmon transgene insertion 2017, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05261 + EM:05262 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2005Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2005Lmon, Hsd:NMRI-Tg(Tyr,aEHS1.4)2005Lmon/Cnbc mutant strain MGI:5645904 Tg(Tyr,aEHS1.4)2005Lmon transgene insertion 2005, Lluis Montoliu MGI:5645901 Tg(Tyr,aEHS1.4)2005Lmon transgene insertion 2005, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05262 + EM:05262 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2005Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2005Lmon, Hsd:NMRI-Tg(Tyr,aEHS1.4)2005Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05262 + EM:05262 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2005Lmon EMMA sperm Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2005Lmon, Hsd:NMRI-Tg(Tyr,aEHS1.4)2005Lmon/Cnbc mutant strain MGI:5645904 Tg(Tyr,aEHS1.4)2005Lmon transgene insertion 2005, Lluis Montoliu MGI:5645901 Tg(Tyr,aEHS1.4)2005Lmon transgene insertion 2005, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05262 + EM:05262 Cnbc:NMRI-Tg(Tyr,aEHS1.4)2005Lmon EMMA sperm Hsd:NMRI-Tg(Tyr-Tyr-aEHS1.4)2005Lmon, Hsd:NMRI-Tg(Tyr,aEHS1.4)2005Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05262 + EM:03109 Cnbc:NMRI-Tg(Tyr*)8749Lmon EMMA embryo YRT2deltaAB line 8749, YRT2deltaAB, NMRI-Tg(Tyr*)8749Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:03109 + EM:03109 Cnbc:NMRI-Tg(Tyr*)8749Lmon EMMA embryo YRT2deltaAB line 8749, YRT2deltaAB, NMRI-Tg(Tyr*)8749Lmon/Cnbc mutant strain MGI:5788264 Tg(Tyr*)8749Lmon transgene insertion 8749, Lluis Montoliu MGI:5788263 Tg(Tyr*)8749Lmon transgene insertion 8749, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:03109 + EM:03109 Cnbc:NMRI-Tg(Tyr*)8749Lmon EMMA sperm YRT2deltaAB line 8749, YRT2deltaAB, NMRI-Tg(Tyr*)8749Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:03109 + EM:03109 Cnbc:NMRI-Tg(Tyr*)8749Lmon EMMA sperm YRT2deltaAB line 8749, YRT2deltaAB, NMRI-Tg(Tyr*)8749Lmon/Cnbc mutant strain MGI:5788264 Tg(Tyr*)8749Lmon transgene insertion 8749, Lluis Montoliu MGI:5788263 Tg(Tyr*)8749Lmon transgene insertion 8749, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:03109 + EM:03104 Cnbc:NMRI-Tg(Tyr*)8748Lmon EMMA embryo YRT2deltaAB line 8748, NMRI-Tg(Tyr*)8748Lmon/Cnbc, YRT2deltaAB mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:03104 + EM:03104 Cnbc:NMRI-Tg(Tyr*)8748Lmon EMMA embryo YRT2deltaAB line 8748, NMRI-Tg(Tyr*)8748Lmon/Cnbc, YRT2deltaAB mutant strain MGI:5787964 Tg(Tyr*)8748Lmon transgene insertion 8748, Lluis Montoliu MGI:5787963 Tg(Tyr*)8748Lmon transgene insertion 8748, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:03104 + EM:03103 Cnbc:NMRI-Tg(Tyr*)6968Lmon EMMA embryo YRT2deltaA, YRT2deltaA line 6968, NMRI-Tg(Tyr*)6968Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:03103 + EM:03103 Cnbc:NMRI-Tg(Tyr*)6968Lmon EMMA embryo YRT2deltaA, YRT2deltaA line 6968, NMRI-Tg(Tyr*)6968Lmon/Cnbc mutant strain MGI:5787961 Tg(Tyr*)6968Lmon transgene insertion 6968, Lluis Montoliu MGI:5787960 Tg(Tyr*)6968Lmon transgene insertion 6968, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:03103 - EM:03105 Cnbc:NMRI-Tg(Tyr*)4794Lmon EMMA embryo mutant strain MGI:5787978 Tg(Tyr*)4794Lmon transgene insertion 4794, Lluis Montoliu MGI:5787970 Tg(Tyr*)4794Lmon transgene insertion 4794, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:03105 - EM:03105 Cnbc:NMRI-Tg(Tyr*)4794Lmon EMMA embryo mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:03105 - EM:03105 Cnbc:NMRI-Tg(Tyr*)4794Lmon EMMA sperm mutant strain MGI:5787978 Tg(Tyr*)4794Lmon transgene insertion 4794, Lluis Montoliu MGI:5787970 Tg(Tyr*)4794Lmon transgene insertion 4794, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:03105 - EM:03105 Cnbc:NMRI-Tg(Tyr*)4794Lmon EMMA sperm mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:03105 + EM:03102 Cnbc:NMRI-Tg(Tyr*)2138Lmon EMMA embryo YRT4 mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:03102 + EM:03102 Cnbc:NMRI-Tg(Tyr*)2138Lmon EMMA embryo YRT4 mutant strain MGI:5787956 Tg(Tyr*)2138Lmon transgene insertion 2138, Lluis Montoliu MGI:5787955 Tg(Tyr*)2138Lmon transgene insertion 2138, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:03102 + EM:03102 Cnbc:NMRI-Tg(Tyr*)2138Lmon EMMA sperm YRT4 mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:03102 + EM:03102 Cnbc:NMRI-Tg(Tyr*)2138Lmon EMMA sperm YRT4 mutant strain MGI:5787956 Tg(Tyr*)2138Lmon transgene insertion 2138, Lluis Montoliu MGI:5787955 Tg(Tyr*)2138Lmon transgene insertion 2138, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:03102 + EM:05257 Cnbc:NMRI-Tg(Tyr)2331Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr)2331Lmon, Hsd:NMRI-Tg(Tyr)2331Lmon/Cnbc mutant strain MGI:5645916 Tg(Tyr)2331Lmon transgene insertion 2331, Lluis Montoliu MGI:5645909 Tg(Tyr)2331Lmon transgene insertion 2331, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05257 + EM:05257 Cnbc:NMRI-Tg(Tyr)2331Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr)2331Lmon, Hsd:NMRI-Tg(Tyr)2331Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05257 + EM:05257 Cnbc:NMRI-Tg(Tyr)2331Lmon EMMA sperm Hsd:NMRI-Tg(Tyr-Tyr)2331Lmon, Hsd:NMRI-Tg(Tyr)2331Lmon/Cnbc mutant strain MGI:5645916 Tg(Tyr)2331Lmon transgene insertion 2331, Lluis Montoliu MGI:5645909 Tg(Tyr)2331Lmon transgene insertion 2331, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05257 + EM:05257 Cnbc:NMRI-Tg(Tyr)2331Lmon EMMA sperm Hsd:NMRI-Tg(Tyr-Tyr)2331Lmon, Hsd:NMRI-Tg(Tyr)2331Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05257 + EM:05259 Cnbc:NMRI-Tg(Tyr)2231Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2231Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2231Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05259 + EM:05259 Cnbc:NMRI-Tg(Tyr)2231Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2231Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2231Lmon mutant strain MGI:5645920 Tg(Tyr)2231Lmon transgene insertion 2231, Lluis Montoliu MGI:5645912 Tg(Tyr)2231Lmon transgene insertion 2231, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05259 + EM:05259 Cnbc:NMRI-Tg(Tyr)2231Lmon EMMA sperm Hsd:NMRI-Tg(Tyr)2231Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2231Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05259 + EM:05259 Cnbc:NMRI-Tg(Tyr)2231Lmon EMMA sperm Hsd:NMRI-Tg(Tyr)2231Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2231Lmon mutant strain MGI:5645920 Tg(Tyr)2231Lmon transgene insertion 2231, Lluis Montoliu MGI:5645912 Tg(Tyr)2231Lmon transgene insertion 2231, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05259 + EM:05256 Cnbc:NMRI-Tg(Tyr)2222Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr)2222Lmon/Cnbc, Hsd:NMRI-Tg(Tyr)2222Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05256 + EM:05256 Cnbc:NMRI-Tg(Tyr)2222Lmon EMMA embryo Hsd:NMRI-Tg(Tyr-Tyr)2222Lmon/Cnbc, Hsd:NMRI-Tg(Tyr)2222Lmon/Cnbc mutant strain MGI:5645915 Tg(Tyr)2222Lmon transgene insertion 2222, Lluis Montoliu MGI:5645908 Tg(Tyr)2222Lmon transgene insertion 2222, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05256 + EM:05256 Cnbc:NMRI-Tg(Tyr)2222Lmon EMMA sperm Hsd:NMRI-Tg(Tyr-Tyr)2222Lmon/Cnbc, Hsd:NMRI-Tg(Tyr)2222Lmon/Cnbc mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05256 + EM:05256 Cnbc:NMRI-Tg(Tyr)2222Lmon EMMA sperm Hsd:NMRI-Tg(Tyr-Tyr)2222Lmon/Cnbc, Hsd:NMRI-Tg(Tyr)2222Lmon/Cnbc mutant strain MGI:5645915 Tg(Tyr)2222Lmon transgene insertion 2222, Lluis Montoliu MGI:5645908 Tg(Tyr)2222Lmon transgene insertion 2222, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05256 + EM:05260 Cnbc:NMRI-Tg(Tyr)2131Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2131Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2131Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05260 + EM:05260 Cnbc:NMRI-Tg(Tyr)2131Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2131Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2131Lmon mutant strain MGI:5645925 Tg(Tyr)2131Lmon transgene insertion 2131, Lluis Montoliu MGI:5645913 Tg(Tyr)2131Lmon transgene insertion 2131, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05260 + EM:05260 Cnbc:NMRI-Tg(Tyr)2131Lmon EMMA sperm Hsd:NMRI-Tg(Tyr)2131Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2131Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05260 + EM:05260 Cnbc:NMRI-Tg(Tyr)2131Lmon EMMA sperm Hsd:NMRI-Tg(Tyr)2131Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2131Lmon mutant strain MGI:5645925 Tg(Tyr)2131Lmon transgene insertion 2131, Lluis Montoliu MGI:5645913 Tg(Tyr)2131Lmon transgene insertion 2131, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05260 + EM:05258 Cnbc:NMRI-Tg(Tyr)2028Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2028Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2028Lmon mutant strain MGI:5645918 Tg(Tyr)2028Lmon transgene insertion 2028, Lluis Montoliu MGI:5645911 Tg(Tyr)2028Lmon transgene insertion 2028, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:05258 + EM:05258 Cnbc:NMRI-Tg(Tyr)2028Lmon EMMA embryo Hsd:NMRI-Tg(Tyr)2028Lmon/Cnbc, Hsd:NMRI-Tg(Tyr-Tyr)2028Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:05258 + EM:03096 Cnbc:NMRI-Tg(Tyr)1999Lmon EMMA embryo NMRI-Tg(Tyr)1999Lmon/Cnbc, YRT2 mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:03096 + EM:03096 Cnbc:NMRI-Tg(Tyr)1999Lmon EMMA embryo NMRI-Tg(Tyr)1999Lmon/Cnbc, YRT2 mutant strain MGI:5787939 Tg(Tyr)1999Lmon transgene insertion 1999, Lluis Montoliu MGI:5787936 Tg(Tyr)1999Lmon transgene insertion 1999, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:03096 + EM:03096 Cnbc:NMRI-Tg(Tyr)1999Lmon EMMA sperm NMRI-Tg(Tyr)1999Lmon/Cnbc, YRT2 mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:03096 + EM:03096 Cnbc:NMRI-Tg(Tyr)1999Lmon EMMA sperm NMRI-Tg(Tyr)1999Lmon/Cnbc, YRT2 mutant strain MGI:5787939 Tg(Tyr)1999Lmon transgene insertion 1999, Lluis Montoliu MGI:5787936 Tg(Tyr)1999Lmon transgene insertion 1999, Lluis Montoliu https://www.infrafrontier.eu/search?keyword=EM:03096 + EM:06053 Cnbc:NMRI-conls<+> EMMA embryo stock Hsd:NMRI-coneless+/Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06053 + EM:06053 Cnbc:NMRI-conls<+> EMMA embryo stock Hsd:NMRI-coneless+/Lmon mutant strain MGI:6198563 conls<+> wild type MGI:6198564 conls coneless https://www.infrafrontier.eu/search?keyword=EM:06053 + EM:06052 Cnbc:NMRI-conls EMMA embryo stock HsdWin:NMRI-coneless/Lmon mutant strain MGI:1855976 Tyr albino MGI:98880 Tyr tyrosinase https://www.infrafrontier.eu/search?keyword=EM:06052 + EM:06052 Cnbc:NMRI-conls EMMA embryo stock HsdWin:NMRI-coneless/Lmon mutant strain MGI:6198566 conls coneless MGI:6198564 conls coneless https://www.infrafrontier.eu/search?keyword=EM:06052 ? EM:05489 Cited 4 KO conv EMMA embryo mutant strain Cited4 Cited4 MGI:1861694 Cited4 Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 https://www.infrafrontier.eu/search?keyword=EM:05489 ? EM:05491 Cited 4 KO cond EMMA embryo mutant strain Cited4 Cited4 MGI:1861694 Cited4 Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 https://www.infrafrontier.eu/search?keyword=EM:05491 ? EM:14676 Chd8tm1.2Mabn B6(Cg)-Chd8/H EMMA sperm unclassified MGI:6115344 Chd8 targeted mutaiton 1.2, Michiel A Bassoon MGI:1915022 Chd8 chromodomain helicase DNA binding protein 8 https://www.infrafrontier.eu/search?keyword=EM:14676 + EM:12506 CFW-Em/JG EMMA sperm mutant strain MGI:1861119 Em Emory cataract MGI:95319 Em Emory cataract https://www.infrafrontier.eu/search?keyword=EM:12506 + EM:00220 CD2-Tg(HK2-luc)279Uku/Orl EMMA embryo Uku279, CD2-Tg(HK2-luc)279Uku/Ciml, CD2-Tg(HK2-luc)279Uku mutant strain MGI:3522710 Tg(HK2-luc)279Uku transgene insertion 279, University of Kuopio MGI:3522709 Tg(HK2-luc)279Uku transgene insertion 279, University of Kuopio https://www.infrafrontier.eu/search?keyword=EM:00220 + EM:00219 CD2-Tg(HK2-luc)253Uku/Orl EMMA embryo CD2-Tg(HK2-luc)253Uku, CD2-Tg(HK2-luc)253Uku/Ciml mutant strain MGI:3522707 Tg(HK2-luc)253Uku transgene insertion 253, University of Kuopio MGI:3522705 Tg(HK2-luc)253Uku transgene insertion 253, University of Kuopio https://www.infrafrontier.eu/search?keyword=EM:00219 + EM:00218 CD2-Tg(HK2-luc)242Uku/Orl EMMA embryo CD2-Tg(HK2-luc)242Uku, CD2-Tg(HK2-luc)242Uku/Ciml mutant strain MGI:3522703 Tg(HK2-luc)242Uku transgene insertion 242, University of Kuopio MGI:3522701 Tg(HK2-luc)242Uku transgene insertion 242, University of Kuopio https://www.infrafrontier.eu/search?keyword=EM:00218 + EM:00217 CD2-Tg(HK2-luc)231Uku/Orl EMMA embryo CD2-Tg(HK2-luc)231Uku/Ciml, CD2-Tg(HK2-luc)231Uku mutant strain MGI:3522676 Tg(HK2-luc)231Uku transgene insertion 231, University of Kuopio MGI:3522674 Tg(HK2-luc)231Uku transgene insertion 231, University of Kuopio https://www.infrafrontier.eu/search?keyword=EM:00217 + EM:02073 CD2-Hk2/Kctt EMMA embryo Ukko1; Hk2+/-, CD2.129P2-Hk2/Kctt mutant strain MGI:3624862 Hk2 targeted mutation 1, Markku Laakso MGI:1315197 Hk2 hexokinase 2 https://www.infrafrontier.eu/search?keyword=EM:02073 ? EM:11390 CD2-Egr2 transgenic (Tg) mouse EMMA sperm mutant strain CD2-Egr2-Tg CD2-Egr2-Tg https://www.infrafrontier.eu/search?keyword=EM:11390 ? EM:14701 CD1;B6N-MADM-TG; Igs32; MADM-9-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14701 ? EM:14699 CD1;B6N-MADM-TG; Igs31; MADM-8-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14699 ? EM:14697 CD1;B6N-MADM-TG; Igs5; MADM-7-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat MGI:5470322 Igs5 intergenic site 5 https://www.infrafrontier.eu/search?keyword=EM:14697 ? EM:14695 CD1;B6N-MADM-TG; Igs30; MADM-6-TG EMMA archived unclassified MGI:6715987 Igs30 targeted mutation 2, Biomodels Austria MGI:6715918 Igs30 intergenic site 30 https://www.infrafrontier.eu/search?keyword=EM:14695 ? EM:14693 CD1;B6N-MADM-TG; Igs29; MADM-5-TG EMMA archived unclassified MGI:6715985 Igs29 targeted mutation 2, Biomodels Austria MGI:6715917 Igs29 intergenic site 29 https://www.infrafrontier.eu/search?keyword=EM:14693 ? EM:14691 CD1;B6N-MADM-TG; Igs28; MADM-4-TG EMMA archived unclassified MGI:6715982 Igs28 targeted mutation 2, Biomodels Austria MGI:6715914 Igs28 intergenic site 28 https://www.infrafrontier.eu/search?keyword=EM:14691 ? EM:14687 CD1;B6N-MADM-TG; Igs26; MADM-2-TG EMMA archived unclassified MGI:6715934 Igs26 targeted mutation 2, Biomodels Austria MGI:6715912 Igs26 intergenic site 26 https://www.infrafrontier.eu/search?keyword=EM:14687 ? EM:14721 CD1;B6N-MADM-TG; Igs40; MADM-19-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14721 ? EM:14719 CD1;B6N-MADM-TG; Igs39; MADM-18-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14719 ? EM:14717 CD1;B6N-MADM-TG; Igs38; MADM-17-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14717 ? EM:14715 CD1;B6N-MADM-TG; Igs37; MADM-16-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14715 ? EM:14713 CD1;B6N-MADM-TG; Igs36; MADM-15-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14713 ? EM:14711 CD1;B6N-MADM-TG; Igs35; MADM-14-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14711 ? EM:14709 CD1;B6N-MADM-TG; Igs34; MADM-13-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14709 ? EM:14707 CD1;B6N-MADM-TG; Igs6; MADM-12-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14707 ? EM:14705 CD1;B6N-MADM-TG; Igs2; MADM-11-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14705 ? EM:14703 CD1;B6N-MADM-TG; Igs33; MADM-10-TG EMMA archived unclassified tm2(ACTB-tdTomato,-EGFP)Biat tm2(ACTB-tdTomato,-EGFP)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14703 ? EM:14700 CD1;B6N-MADM-GT; Igs32; MADM-9-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14700 ? EM:14698 CD1;B6N-MADM-GT; Igs31; MADM-8-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14698 ? EM:14696 CD1;B6N-MADM-GT; Igs5; MADM-7-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat MGI:5470322 Igs5 intergenic site 5 https://www.infrafrontier.eu/search?keyword=EM:14696 ? EM:14694 CD1;B6N-MADM-GT; Igs30; MADM-6-GT EMMA archived unclassified MGI:6715986 Igs30 targeted mutation 1, Biomodels Austria MGI:6715918 Igs30 intergenic site 30 https://www.infrafrontier.eu/search?keyword=EM:14694 ? EM:14692 CD1;B6N-MADM-GT; Igs29; MADM-5-GT EMMA archived unclassified MGI:6715984 Igs29 targeted mutation 1, Biomodels Austria MGI:6715917 Igs29 intergenic site 29 https://www.infrafrontier.eu/search?keyword=EM:14692 ? EM:14690 CD1;B6N-MADM-GT; Igs28; MADM-4-GT EMMA archived unclassified MGI:6715981 Igs28 targeted mutation 1, Biomodels Austria MGI:6715914 Igs28 intergenic site 28 https://www.infrafrontier.eu/search?keyword=EM:14690 ? EM:14688 CD1;B6N-MADM-GT; Igs27; MADM-3-GT EMMA archived unclassified MGI:6715935 Igs27 targeted mutation 1, Biomodels Austria MGI:6715913 Igs27 intergenic site 27 https://www.infrafrontier.eu/search?keyword=EM:14688 ? EM:14686 CD1;B6N-MADM-GT; Igs26; MADM-2-GT EMMA archived unclassified MGI:6715933 Igs26 targeted mutation 1, Biomodels Austria MGI:6715912 Igs26 intergenic site 26 https://www.infrafrontier.eu/search?keyword=EM:14686 ? EM:14720 CD1;B6N-MADM-GT; Igs40; MADM-19-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14720 ? EM:14718 CD1;B6N-MADM-GT; Igs39; MADM-18-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14718 ? EM:14716 CD1;B6N-MADM-GT; Igs38; MADM-17-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14716 ? EM:14714 CD1;B6N-MADM-GT; Igs37; MADM-16-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14714 ? EM:14712 CD1;B6N-MADM-GT; Igs36; MADM-15-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14712 ? EM:14710 CD1;B6N-MADM-GT; Igs35; MADM-14-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14710 ? EM:14708 CD1;B6N-MADM-GT; Igs34; MADM-13-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14708 ? EM:14706 CD1;B6N-MADM-GT; Igs6; MADM-12-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14706 ? EM:14704 CD1;B6N-MADM-GT; Igs2; MADM-11-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14704 ? EM:14702 CD1;B6N-MADM-GT; Igs33; MADM-10-GT EMMA archived unclassified tm1(ACTB-EGFP,-tdTomato)Biat tm1(ACTB-EGFP,-tdTomato)Biat none (intergenic region) https://www.infrafrontier.eu/search?keyword=EM:14702 ? EM:14689 CD1;B6N-Igs27/Biat EMMA archived unclassified MGI:6715936 Igs27 targeted mutation 2, Biomodels Austria MGI:6715913 Igs27 intergenic site 27 https://www.infrafrontier.eu/search?keyword=EM:14689 ? EM:14685 CD1;B6N-Igs25/Biat EMMA archived unclassified MGI:6715932 Igs25 targeted mutation 2, Biomodels Austria MGI:6715911 Igs25 intergenic site 25 https://www.infrafrontier.eu/search?keyword=EM:14685 ? EM:14684 CD1;B6N-Igs25/Biat EMMA archived unclassified MGI:6715931 Igs25 targeted mutation 1, Biomodels Austria MGI:6715911 Igs25 intergenic site 25 https://www.infrafrontier.eu/search?keyword=EM:14684 ? EM:12821 CD1;129-Cfap43/Biat EMMA sperm mutant strain MGI:6431400 Cfap43 endonuclease-mediated mutation 1.1, Achim Gossler MGI:1289258 Cfap43 cilia and flagella associated protein 43 https://www.infrafrontier.eu/search?keyword=EM:12821 - EM:12388 CD1;129(B6)-Csn1s1/H EMMA sperm mutant strain MGI:6715302 Csn1s1 targeted mutation 2, Andreas F Kolb MGI:88540 Csn1s1 casein alpha s1 https://www.infrafrontier.eu/search?keyword=EM:12388 - EM:12662 CD1; B6D2-Tg(Prm1EGFP, CAG-mRFP1, HS4i-TyrC)85Ltku EMMA embryo mutant strain Tg(Prm1-EGFP)85Ltku transgene insertion 85, Pawel Pelczar Tg(Prm1-EGFP)85Ltku transgene insertion 85, Pawel Pelczar https://www.infrafrontier.eu/search?keyword=EM:12662 - EM:12662 CD1; B6D2-Tg(Prm1EGFP, CAG-mRFP1, HS4i-TyrC)85Ltku EMMA live mutant strain Tg(Prm1-EGFP)85Ltku transgene insertion 85, Pawel Pelczar Tg(Prm1-EGFP)85Ltku transgene insertion 85, Pawel Pelczar https://www.infrafrontier.eu/search?keyword=EM:12662 + EM:06065 CD1.Cg-Stat1/Cnbc EMMA embryo CD1.129-Stat1/Dlv-Tg(APN)270<-/->/Cnbc mutant strain MGI:1930947 Stat1 targeted mutation 1, David E Levy MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/search?keyword=EM:06065 + EM:06061 CD1.Cg-Stat1 Tg(ANPEP)861Mmul/Cnbc EMMA embryo CD1.129-Stat1 Tg(ANPEP)861Mmul/Cnbc, CD1.129-Stat1/Dlv-Tg(APN)861<+/+>/Cnbc mutant strain MGI:1930947 Stat1 targeted mutation 1, David E Levy MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/search?keyword=EM:06061 + EM:06061 CD1.Cg-Stat1 Tg(ANPEP)861Mmul/Cnbc EMMA embryo CD1.129-Stat1 Tg(ANPEP)861Mmul/Cnbc, CD1.129-Stat1/Dlv-Tg(APN)861<+/+>/Cnbc mutant strain MGI:5645779 Tg(ANPEP)861Mmul transgene insertion 861, Mathias Muller MGI:5645777 Tg(ANPEP)861Mmul transgene insertion 861, Mathias Muller https://www.infrafrontier.eu/search?keyword=EM:06061 + EM:06060 CD1.Cg-Stat1 Tg(ANPEP)270Mmul/Cnbc EMMA embryo mutant strain MGI:5645778 Tg(ANPEP)270Mmul transgene insertion 270, Mathias Muller MGI:5645776 Tg(ANPEP)270Mmul transgene insertion 270, Mathias Muller https://www.infrafrontier.eu/search?keyword=EM:06060 + EM:06060 CD1.Cg-Stat1 Tg(ANPEP)270Mmul/Cnbc EMMA embryo mutant strain MGI:1930947 Stat1 targeted mutation 1, David E Levy MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/search?keyword=EM:06060 + EM:02488 CD1.Cg-Fgfr2/H EMMA sperm CD1-FGFR2c342y, CD1.Cg-Fgfr2 mutant strain MGI:3053095 Fgfr2 targeted mutation 4, Peter Lonai MGI:95523 Fgfr2 fibroblast growth factor receptor 2 https://www.infrafrontier.eu/search?keyword=EM:02488 + EM:05990 CD1.A-Gdf5/Orl EMMA embryo Gdf5bp-J mutant strain MGI:1855974 Gdf5 brachypodism Jackson MGI:95688 Gdf5 growth differentiation factor 5 https://www.infrafrontier.eu/search?keyword=EM:05990 + EM:04663 CD1.192P2-Zfp647/H EMMA sperm CD1.192P2-Zfp647/H, Zfp647Gt(betageo)1Hgs CD1 mutant strain MGI:4353070 Zfp647 gene trap ES492, Heidi Sutherland MGI:3052806 Zfp647 zinc finger protein 647 https://www.infrafrontier.eu/search?keyword=EM:04663 + EM:05397 CD1.129X1-Kat2b/Orl EMMA embryo PCAF -/- CD1 mutant strain MGI:2386307 Kat2b targeted mutation 1, Yoshihiro Nakatani MGI:1343094 Kat2b K(lysine) acetyltransferase 2B https://www.infrafrontier.eu/search?keyword=EM:05397 + EM:06064 CD1.129S-Stat1<+>/Cnbc EMMA embryo CD1.129-Stat1<+/+>-Tg(APN)270<-/->/Cnbc mutant strain MGI:2433148 Stat1<+> wild type MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/search?keyword=EM:06064 + EM:02389 CD1.129P2-Afp/Cnrm EMMA embryo CD1.129P2-Afp/Ibcm, CD1-Afptm1Ibmm (AFP KO1) mutant strain MGI:2388722 Afp targeted mutation 1, Claude Szpirer MGI:87951 Afp alpha fetoprotein https://www.infrafrontier.eu/search?keyword=EM:02389 + EM:02450 CD1.129P2(Cg)-Sp6/Cnrm EMMA embryo STOCK Sp6/Ibcm, CD1.129P2(Cg)-Sp6/Ibcm, CD1-Sp6 tm1Ibmm, CD1.129P2-Sp6/Ibcm mutant strain MGI:3778294 Sp6 targeted mutation 1.1, Claude Szpirer MGI:1932575 Sp6 trans-acting transcription factor 6 https://www.infrafrontier.eu/search?keyword=EM:02450 + EM:02450 CD1.129P2(Cg)-Sp6/Cnrm EMMA sperm STOCK Sp6/Ibcm, CD1.129P2(Cg)-Sp6/Ibcm, CD1-Sp6 tm1Ibmm, CD1.129P2-Sp6/Ibcm mutant strain MGI:3778294 Sp6 targeted mutation 1.1, Claude Szpirer MGI:1932575 Sp6 trans-acting transcription factor 6 https://www.infrafrontier.eu/search?keyword=EM:02450 + EM:05335 CD1.129P2(B6)-Sox9/H EMMA sperm Sox9-neo mutant strain MGI:3817218 Sox9 targeted mutation 2, Gerd Scherer MGI:98371 Sox9 SRY (sex determining region Y)-box 9 https://www.infrafrontier.eu/search?keyword=EM:05335 + EM:02449 CD1.129-Sp6/Cnrm EMMA embryo CD1.129P2-Sp6/Ibcm, CD1.129-Sp6/Ibcm, Sp6.loxp-tm1Ibmm/CD1 mutant strain MGI:3778292 Sp6 targeted mutation 1, Claude Szpirer MGI:1932575 Sp6 trans-acting transcription factor 6 https://www.infrafrontier.eu/search?keyword=EM:02449 + EM:07742 CD1.129-Sigmar1/Cnbc EMMA embryo STOCK CD1 Sigmar1 mutant strain MGI:3044771 Sigmar1 targeted mutation 1, Lluis Montoliu MGI:1195268 Sigmar1 sigma non-opioid intracellular receptor 1 https://www.infrafrontier.eu/search?keyword=EM:07742 + EM:00160 CD1.129-Ptch1/Cnrm EMMA embryo CD1-Ptc-KO, CD1.129-Ptch, CD1.129-Ptch1/Ibcm, CD-1.129-Ptch, Ptc-CD1 KO mutant strain MGI:1857935 Ptch1 targeted mutation 1, Andreas Zimmer MGI:105373 Ptch1 patched 1 https://www.infrafrontier.eu/search?keyword=EM:00160 + EM:05988 CD1.129-Nog/Orl EMMA archived Nogtm1Amc mutant strain MGI:1862000 Nog targeted mutation 1, Andrew P McMahon MGI:104327 Nog noggin https://www.infrafrontier.eu/search?keyword=EM:05988 + EM:04858 CD1.129-Nodal/Orl EMMA embryo 129 Nodal-LacZ (KO) mutant strain MGI:2180793 Nodal targeted mutation 1, Elizabeth J Robertson MGI:97359 Nodal nodal https://www.infrafrontier.eu/search?keyword=EM:04858 + EM:10583 CD1.129-Cnr1/Cnbc EMMA embryo mutant strain MGI:1857736 Cnr1 targeted mutation 1, Marc Parmentier MGI:104615 Cnr1 cannabinoid receptor 1 (brain) https://www.infrafrontier.eu/search?keyword=EM:10583 + EM:10583 CD1.129-Cnr1/Cnbc EMMA sperm mutant strain MGI:1857736 Cnr1 targeted mutation 1, Marc Parmentier MGI:104615 Cnr1 cannabinoid receptor 1 (brain) https://www.infrafrontier.eu/search?keyword=EM:10583 + EM:06068 CD1.129-Ccr6/Cnbc EMMA embryo mutant strain MGI:2179613 Ccr6 targeted mutation 1, Gabriel Marquez MGI:1333797 Ccr6 chemokine (C-C motif) receptor 6 https://www.infrafrontier.eu/search?keyword=EM:06068 + EM:06068 CD1.129-Ccr6/Cnbc EMMA sperm mutant strain MGI:2179613 Ccr6 targeted mutation 1, Gabriel Marquez MGI:1333797 Ccr6 chemokine (C-C motif) receptor 6 https://www.infrafrontier.eu/search?keyword=EM:06068 + EM:10582 CD1.129-Adora2a/Cnbc EMMA embryo mutant strain MGI:2152583 Adora2a targeted mutation 1, Marc Parmentier MGI:99402 Adora2a adenosine A2a receptor https://www.infrafrontier.eu/search?keyword=EM:10582 + EM:10582 CD1.129-Adora2a/Cnbc EMMA sperm mutant strain MGI:2152583 Adora2a targeted mutation 1, Marc Parmentier MGI:99402 Adora2a adenosine A2a receptor https://www.infrafrontier.eu/search?keyword=EM:10582 ? EM:04678 CD1-Rce1/Cnbc EMMA embryo mutant strain MGI:1336895 Rce1 Ras converting CAAX endopeptidase 1 https://www.infrafrontier.eu/search?keyword=EM:04678 ? EM:04678 CD1-Rce1/Cnbc EMMA sperm mutant strain MGI:1336895 Rce1 Ras converting CAAX endopeptidase 1 https://www.infrafrontier.eu/search?keyword=EM:04678 - EM:01796 CD1(B6)-Tg(Hoxb1-cre)r4Mist/Cnrm EMMA embryo mutant strain MGI:5006714 Tg(Hoxb1-cre)r4Mist transgene insertion r4, Michele Studer MGI:5006713 Tg(Hoxb1-cre)r4Mist transgene insertion r4, Michele Studer https://www.infrafrontier.eu/search?keyword=EM:01796 - EM:01796 CD1(B6)-Tg(Hoxb1-cre)r4Mist/Cnrm EMMA sperm mutant strain MGI:5006714 Tg(Hoxb1-cre)r4Mist transgene insertion r4, Michele Studer MGI:5006713 Tg(Hoxb1-cre)r4Mist transgene insertion r4, Michele Studer https://www.infrafrontier.eu/search?keyword=EM:01796 + EM:06063 CD1(129S)-Tg(ANPEP)861Mmul/Cnbc EMMA embryo CD1.129-Stat1<+/+>-Tg(APN)861<+/+>/Cnbc mutant strain MGI:5645779 Tg(ANPEP)861Mmul transgene insertion 861, Mathias Muller MGI:5645777 Tg(ANPEP)861Mmul transgene insertion 861, Mathias Muller https://www.infrafrontier.eu/search?keyword=EM:06063 + EM:06063 CD1(129S)-Tg(ANPEP)861Mmul/Cnbc EMMA embryo CD1.129-Stat1<+/+>-Tg(APN)861<+/+>/Cnbc mutant strain MGI:2433148 Stat1<+> wild type MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/search?keyword=EM:06063 + EM:06062 CD1(129S)-Tg(ANPEP)270Mmul/Cnbc EMMA embryo CD1.129-Stat1<+/+>-Tg(APN)270<+/+>/Cnbc mutant strain MGI:5645778 Tg(ANPEP)270Mmul transgene insertion 270, Mathias Muller MGI:5645776 Tg(ANPEP)270Mmul transgene insertion 270, Mathias Muller https://www.infrafrontier.eu/search?keyword=EM:06062 + EM:06062 CD1(129S)-Tg(ANPEP)270Mmul/Cnbc EMMA embryo CD1.129-Stat1<+/+>-Tg(APN)270<+/+>/Cnbc mutant strain MGI:2433148 Stat1<+> wild type MGI:103063 Stat1 signal transducer and activator of transcription 1 https://www.infrafrontier.eu/search?keyword=EM:06062 + EM:01382 CD-1 x B6.129S1-Pax1/Ieg EMMA sperm Pax1 mutant strain MGI:1857741 Pax1 targeted mutation 2, Neuherberg MGI:97485 Pax1 paired box 1 https://www.infrafrontier.eu/search?keyword=EM:01382 + EM:02105 CByIco.Cg-Tg(DO11.10)10Dlo/Cnrm EMMA embryo BALB/cByJIco DO11.10, CBy.Cg-Tg(DO11.10)10Dlo/Ibcm, CByIco.Cg-Tg(DO11.10)10Dlo/Ibcm mutant strain MGI:2664398 Tg(DO11.10)10Dlo transgene insertion 10, Dennis Y Loh MGI:2664401 Tg(DO11.10)10Dlo transgene insertion 10, Dennis Y Loh https://www.infrafrontier.eu/search?keyword=EM:02105 + EM:02106 CByIco.129S7-Ifng/Cnrm EMMA embryo BALB/cByJIco IFNg-/-, CByIco.129S7-Ifng/Ibcm, CBy.129S7-Ifng/Ibcm mutant strain MGI:1857184 Ifng targeted mutation 1, Timothy Stewart MGI:107656 Ifng interferon gamma https://www.infrafrontier.eu/search?keyword=EM:02106 + EM:02106 CByIco.129S7-Ifng/Cnrm EMMA sperm BALB/cByJIco IFNg-/-, CByIco.129S7-Ifng/Ibcm, CBy.129S7-Ifng/Ibcm mutant strain MGI:1857184 Ifng targeted mutation 1, Timothy Stewart MGI:107656 Ifng interferon gamma https://www.infrafrontier.eu/search?keyword=EM:02106 + EM:02017 CByIco.129S-Rag2/H EMMA embryo Rag2-/- CD44WT, CBy.129-Rag2/H, BALB/cByJIco Rag2-/- CD44WT mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:02017 + EM:02021 CByIco.129-Rag2 Cd44/H EMMA embryo CBy.129-Cd44 Rag2/H, BALB/cByJIco Rag2-/- CD44v10-/- mutant strain MGI:4835490 Cd44 targeted mutation 2.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02021 + EM:02021 CByIco.129-Rag2 Cd44/H EMMA embryo CBy.129-Cd44 Rag2/H, BALB/cByJIco Rag2-/- CD44v10-/- mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:02021 + EM:02020 CByIco.129-Rag2 Cd44/H EMMA embryo BALB/cByJIco Rag2-/- CD44v7-/-, Rag2-/-CD44v7-/-, CBy.129-Rag2 Cd44/H mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:02020 + EM:02020 CByIco.129-Rag2 Cd44/H EMMA embryo BALB/cByJIco Rag2-/- CD44v7-/-, Rag2-/-CD44v7-/-, CBy.129-Rag2 Cd44/H mutant strain MGI:2679704 Cd44 targeted mutation 1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02020 + EM:02022 CByIco.129-Rag2 Cd44/H EMMA embryo CBy.129-Cd44 Rag2/H, CBy.129-Rag2 Cd44/H, BALB/cByJIco Rag2-/- CD44v6v7-/- mutant strain MGI:1858556 Rag2 targeted mutation 1, Frederick W Alt MGI:97849 Rag2 recombination activating gene 2 https://www.infrafrontier.eu/search?keyword=EM:02022 + EM:02022 CByIco.129-Rag2 Cd44/H EMMA embryo CBy.129-Cd44 Rag2/H, CBy.129-Rag2 Cd44/H, BALB/cByJIco Rag2-/- CD44v6v7-/- mutant strain MGI:2679706 Cd44 targeted mutation 1.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02022 + EM:02018 CByIco.129-Cd44/Ieg EMMA archived CBy.129-Cd44/Ieg, BALB/cByJIco CD44v7-/- mutant strain MGI:2679704 Cd44 targeted mutation 1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02018 + EM:02019 CByIco.129-Cd44/Ieg EMMA archived BALB/cByJIco CD44v6v7-/- mutant strain MGI:2679706 Cd44 targeted mutation 1.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02019 + EM:02079 CByIco.129(Cg)-Cd44/Ieg EMMA archived BALB/cByJIco CD44v10-/-, CBy.129X1-Cd44/Ieg mutant strain MGI:4835490 Cd44 targeted mutation 2.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02079 + EM:02427 CBy.Cg-Cd44 Tg(DO11.10)10Dlo/Cnrm EMMA embryo CBy.Cg-Cd44 Tg(DO11.10)10Dlo/Ibcm, BALB/cByJIco DO11.10 CD44v6v7-/-, CBy.129X1-Tg(DO11.10)10Dlo Cd44/Ibcm mutant strain MGI:2679706 Cd44 targeted mutation 1.1, Ursula Gunthert MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:02427 + EM:02427 CBy.Cg-Cd44 Tg(DO11.10)10Dlo/Cnrm EMMA embryo CBy.Cg-Cd44 Tg(DO11.10)10Dlo/Ibcm, BALB/cByJIco DO11.10 CD44v6v7-/-, CBy.129X1-Tg(DO11.10)10Dlo Cd44/Ibcm mutant strain MGI:2664398 Tg(DO11.10)10Dlo transgene insertion 10, Dennis Y Loh MGI:2664401 Tg(DO11.10)10Dlo transgene insertion 10, Dennis Y Loh https://www.infrafrontier.eu/search?keyword=EM:02427 + EM:06070 CBy.129-Ccr8/Cnbc EMMA embryo C.129-Ccr8/Cnbc, C.129-Ccr8 mutant strain MGI:2450726 Ccr8 targeted mutation 1, Gabriel Marquez MGI:1201402 Ccr8 chemokine (C-C motif) receptor 8 https://www.infrafrontier.eu/search?keyword=EM:06070 + EM:04575 CBB10-Tg(myl2-cre)1118Tmhn/H EMMA sperm XMLC2.CRE, CBB10F1-Tg(myl2-cre)1118Tmhn/H mutant strain MGI:3712342 Tg(myl2-cre)1118Tmhn transgene insertion 1118, Tim Mohun MGI:3712335 Tg(myl2-cre)1118Tmhn transgene insertion 1118, Tim Mohun https://www.infrafrontier.eu/search?keyword=EM:04575 + EM:04922 CBACa;129P2-Ube3b/WtsiCnbc EMMA embryo CBA;129P2-Ube3b/WtsiCnbc, Ube3b genetrap mutant strain MGI:4129255 Ube3b gene trap RRJ142, BayGenomics MGI:1891295 Ube3b ubiquitin protein ligase E3B https://www.infrafrontier.eu/search?keyword=EM:04922 + EM:05013 CBACa;129P2-Prkab1/WtsiCnbc EMMA embryo Prkab1 genetrap, CBA;129P2-Prkab1/WtsiCnbc mutant strain MGI:3838355 Prkab1 gene trap RRR454, BayGenomics MGI:1336167 Prkab1 protein kinase, AMP-activated, beta 1 non-catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:05013 + EM:05012 CBACa;129P2-Kctd10/WtsiCnbc EMMA embryo CBA;129P2-Kctd10/WtsiCnbc, Kctd10 genetrap, CBA;129P2-Kctd10/WtsiCnbc mutant strain MGI:4128950 Kctd10 gene trap RRG305, BayGenomics MGI:2141207 Kctd10 potassium channel tetramerisation domain containing 10 https://www.infrafrontier.eu/search?keyword=EM:05012 + EM:05019 CBACa;129P2-Git2/WtsiCnbc EMMA embryo Git2 genetrap, CBA;129P2-Git2/WtsiCnbc mutant strain MGI:3762635 Git2 gene trap XG510, BayGenomics MGI:1347053 Git2 GIT ArfGAP 2 https://www.infrafrontier.eu/search?keyword=EM:05019 + EM:05014 CBACa;129P2-Ankrd13a/WtsiCnbc EMMA embryo Ankrd13a genetrap, CBA;129P2-Ankrd13a/WtsiCnbc mutant strain MGI:4128768 Ankrd13a gene trap RRH308, BayGenomics MGI:1915670 Ankrd13a ankyrin repeat domain 13a https://www.infrafrontier.eu/search?keyword=EM:05014 + EM:08993 CBAB6-Tg(tetO-HMOX1)57Gkl/Flmg EMMA embryo STOCK Tg(tetO-Hmox1)57Gkl/Flmg, B6.CBA-Tg(tetO-Hmox1)57Gkl/Flmg mutant strain MGI:5707757 Tg(tetO-HMOX1)57Gkl transgene insertion 57, George Kollias MGI:5707755 Tg(tetO-HMOX1)57Gkl transgene insertion 57, George Kollias https://www.infrafrontier.eu/search?keyword=EM:08993 + EM:07265 CBAB6-Tg(Tek-Nfkbia*S32A*S36A)1Gkl/Flmg EMMA sperm Tie2DNIkappaBalpha transgenic mice, CBA.B6-Tg(Tie2-IkB)1Gkl/Flmg, B6CBA-Tg(Tek-Nfkbia*S32A*S36A)1Gkl/Flmg mutant strain MGI:5575645 Tg(Tek-Nfkbia*S32A*S36A)1Gkl transgene insertion 1, George Kollias MGI:5575644 Tg(Tek-Nfkbia*S32A*S36A)1Gkl transgene insertion 1, George Kollias https://www.infrafrontier.eu/search?keyword=EM:07265 ? EM:14680 CBA;B6-Mtm1/Flmg EMMA archived mutant strain Mtm1 Mtm1 MGI:1099452 Mtm1 X-linked myotubular myopathy gene 1 https://www.infrafrontier.eu/search?keyword=EM:14680 + EM:01406 CBA/J-Chr 17/GhjCnrm EMMA embryo CBA.NOD-C17S consomic or chromosome substitution strain Chr 17 Chr 17 Chr 17 Chr 17 https://www.infrafrontier.eu/search?keyword=EM:01406 + EM:04614 CBA/Ca-Tg(TcraBM3.3,TcrbBM3.3)1Alm/Orl EMMA embryo BM3.3 TCR Tg mutant strain MGI:3793487 Tg(TcraBM3.3,TcrbBM3.3)1Alm transgene insertion 1, Andrew L Mellor MGI:3793488 Tg(TcraBM3.3,TcrbBM3.3)1Alm transgene insertion 1, Andrew L Mellor https://www.infrafrontier.eu/search?keyword=EM:04614 ? EM:13763 CBA/Ca-H2-Eb2/WtsiIeg EMMA sperm mutant strain MGI:6336054 H2-Eb2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95902 H2-Eb2 histocompatibility 2, class II antigen E beta2 https://www.infrafrontier.eu/search?keyword=EM:13763 + EM:00248 CBA.Cg-Tg(Ins1-Frk-Y504F)1Ubc/Kieg EMMA embryo CBA-Tg(Ins1-Frk-Y504F)1Ubc, RIP-GTK mutant strain MGI:3487260 Tg(Ins1-Frk-Y504F)1Ubc transgene insertion 1, Uppsala University MGI:3487259 Tg(Ins1-Frk-Y504F)1Ubc transgene insertion 1, Uppsala University https://www.infrafrontier.eu/search?keyword=EM:00248 + EM:05123 CBA.Cg-Bnc2/Orl EMMA embryo CBA(B6)-Bnc2/Orl, CBA.Ayu21-18 mutant strain MGI:3639337 Bnc2 gene trap 18, Institute of Molecular Embryology and Genetics MGI:2443805 Bnc2 basonuclin 2 https://www.infrafrontier.eu/search?keyword=EM:05123 ? EM:11021 CBA.B6-Tnfrsf1a Tg(CD2-TNF/HBB)211Gkl/Flmg EMMA embryo mutant strain Tg(CD2-TNF/HBB)211Gkl Tg(CD2-TNF/HBB)211Gkl Tg(CD2-TNF/HBB)211Gkl Tg(CD2-TNF/HBB)211Gkl https://www.infrafrontier.eu/search?keyword=EM:11021 ? EM:11021 CBA.B6-Tnfrsf1a Tg(CD2-TNF/HBB)211Gkl/Flmg EMMA embryo mutant strain MGI:1861040 Tnfrsf1a targeted mutation 1, Horst Bluethmann MGI:1314884 Tnfrsf1a tumor necrosis factor receptor superfamily, member 1a https://www.infrafrontier.eu/search?keyword=EM:11021 ? EM:11020 CBA.B6-Tg(CD2-TNF)7Gkl/Flmg EMMA sperm mutant strain Tg(CD2-TNF)7Gkl Tg(CD2-TNF)7Gkl Tg(CD2-TNF)7Gkl Tg(CD2-TNF)7Gkl https://www.infrafrontier.eu/search?keyword=EM:11020 + EM:11299 CBA.129S2(Cg)-Synb/Orl EMMA sperm mutant strain MGI:5308859 Synb targeted mutation 1.2, Mouse Clinical Institute MGI:3045308 Synb syncytin b https://www.infrafrontier.eu/search?keyword=EM:11299 + EM:11297 CBA.129S2(B6)-Synb/Orl EMMA sperm mutant strain MGI:6406921 Synb targeted mutation 2.1, Mouse Clinical Institute MGI:3045308 Synb syncytin b https://www.infrafrontier.eu/search?keyword=EM:11297 + EM:05541 CBA.129S(B6)-Tectb/H EMMA sperm CBA/Tectbtm1Gpr mutant strain MGI:3711698 Tectb targeted mutation 1, Guy P Richardson MGI:109574 Tectb tectorin beta https://www.infrafrontier.eu/search?keyword=EM:05541 + EM:05544 CBA.129S(B6)-Tecta/H EMMA sperm CBA/Tectatm2Gpr mutant strain MGI:3605485 Tecta targeted mutation 2, Guy P Richardson MGI:109575 Tecta tectorin alpha https://www.infrafrontier.eu/search?keyword=EM:05544 + EM:05539 CBA.129S(B6)-Tecta/H EMMA sperm CBA/Tectatm1Gpr mutant strain MGI:2183148 Tecta targeted mutation 1, Guy P Richardson MGI:109575 Tecta tectorin alpha https://www.infrafrontier.eu/search?keyword=EM:05539 + EM:05546 CBA.129S(B6)-Otoa/H EMMA sperm CBA/OtoaEGFP mutant strain MGI:5469411 Otoa targeted mutation 1, Guy P Richardson MGI:2149209 Otoa otoancorin https://www.infrafrontier.eu/search?keyword=EM:05546 + EM:05097 CBA.129P2(B6)-Efnb1/RhaH EMMA sperm CBA.129P2-Efnb1/Rha, Efnb1LoxP mutant strain MGI:3653699 Efnb1 targeted mutation 1, Ralf H Adams MGI:102708 Efnb1 ephrin B1 https://www.infrafrontier.eu/search?keyword=EM:05097 ? EM:10943 CB;B6-Tg(Ttr-USP22)1Ital/Flmg EMMA sperm mutant strain Tg(Ttr-USP22)1Ital Tg(Ttr-USP22)1Ital Tg(Ttr-USP22)1Ital Tg(Ttr-USP22)1Ital https://www.infrafrontier.eu/search?keyword=EM:10943 ? EM:13038 CaV2.2_HA Knockin EMMA sperm mutant strain MGI:2388140 Cacna1b targeted mutation 1, Hee-Sup Shin MGI:88296 Cacna1b calcium channel, voltage-dependent, N type, alpha 1B subunit https://www.infrafrontier.eu/search?keyword=EM:13038 ? EM:12547 Cat3vl EMMA sperm unclassified MGI:1855998 Cat3 dominant cataract 3, vacuolated lens and microphthalmia MGI:88273 Cat3 dominant cataract 3 https://www.infrafrontier.eu/search?keyword=EM:12547 ? EM:12522 Cat3vao EMMA sperm mutant strain MGI:1855997 Cat3 dominant cataract 3, vaculoes, axial opacity and microphthal MGI:88273 Cat3 dominant cataract 3 https://www.infrafrontier.eu/search?keyword=EM:12522 ? EM:12546 Cat2t EMMA sperm unclassified MGI:1857598 Cryge total opacity and microphthalmia MGI:88525 Cryge crystallin, gamma E https://www.infrafrontier.eu/search?keyword=EM:12546 ? EM:12545 Cat2ro EMMA sperm unclassified MGI:1855996 Crygf dominant cataract 2, radial opacity MGI:88526 Crygf crystallin, gamma F https://www.infrafrontier.eu/search?keyword=EM:12545 ? EM:12544 Cat2nz EMMA sperm unclassified MGI:1855995 Cryge dominant cataract 2, nuclear and zonular opacity MGI:88525 Cryge crystallin, gamma E https://www.infrafrontier.eu/search?keyword=EM:12544 ? EM:12560 Cat2ns EMMA sperm unclassified MGI:1855994 Cryge dominant cataract 2, nuclear and anterior suture opacity MGI:88525 Cryge crystallin, gamma E https://www.infrafrontier.eu/search?keyword=EM:12560 + EM:02425 CAnNCrl.GFF(CB)-Grhl3/Cnrm EMMA embryo STOCK ct/Ibcm, STOCK Grhl3/Ibcm, CAnNCrl.GFF(CB)-Grhl3/Ibcm mutant strain MGI:1856837 Grhl3 curly tail MGI:2655333 Grhl3 grainyhead like transcription factor 3 https://www.infrafrontier.eu/search?keyword=EM:02425 + EM:02496 CAnN.129S7(B6)-Il1r1/NickH EMMA sperm C.Cg-Il1r1/Nick, BALB/cAnNHsd Il1r1Tm1Imx mutant strain MGI:1861112 Il1r1 targeted mutation 1, Immunex Research and Development Corporation MGI:96545 Il1r1 interleukin 1 receptor, type I https://www.infrafrontier.eu/search?keyword=EM:02496 + EM:02497 CAnN.129P2(MF1)-Il1rn/NickH EMMA sperm C.Cg-Il1rn/Nick, BALB/cAnNHsd Il1rn mutant strain MGI:3038876 Il1rn targeted mutation 1, Martin J H Nicklin MGI:96547 Il1rn interleukin 1 receptor antagonist https://www.infrafrontier.eu/search?keyword=EM:02497 - EM:02162 Candy4 EMMA sperm C3H;B6-Candy4/H mutant strain MGI:5499492 Candy4 Candy4 MGI:5499477 Candy4 Candy4 https://www.infrafrontier.eu/search?keyword=EM:02162 - EM:02161 Candy3 EMMA sperm C3H;B6-Candy3/H mutant strain MGI:5499491 Candy3 Candy3 MGI:5499475 Candy3 Candy3 https://www.infrafrontier.eu/search?keyword=EM:02161 - EM:02160 Candy2 EMMA sperm C3H;B6-Candy2/H mutant strain MGI:5499481 Candy2 Candy2 MGI:5499473 Candy2 Candy2 https://www.infrafrontier.eu/search?keyword=EM:02160 - EM:02164 Candy EMMA sperm C3H;B6-Candy/H mutant strain MGI:5499480 Candy Candy MGI:5499471 Candy Candy https://www.infrafrontier.eu/search?keyword=EM:02164 ? EM:05510 CAMP1 KO conv EMMA embryo mutant strain Fam40b Fam40b MGI:2444363 Strip2 striatin interacting protein 2 https://www.infrafrontier.eu/search?keyword=EM:05510 ? EM:05511 CAMP1 KO cond EMMA embryo mutant strain Fam40b Fam40b MGI:2444363 Strip2 striatin interacting protein 2 https://www.infrafrontier.eu/search?keyword=EM:05511 + EM:04560 C;129P2-Thra/Kctt EMMA embryo Thra-tm2Ven mutant strain MGI:2654864 Thra targeted mutation 2, Bjorn Vennstrom MGI:98742 Thra thyroid hormone receptor alpha https://www.infrafrontier.eu/search?keyword=EM:04560 + EM:05103 C;129P2-Pomt1/Cnbc EMMA embryo mutant strain MGI:3497739 Pomt1 targeted mutation 1, Jesus Cruces MGI:2138994 Pomt1 protein-O-mannosyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:05103 + EM:05103 C;129P2-Pomt1/Cnbc EMMA sperm mutant strain MGI:3497739 Pomt1 targeted mutation 1, Jesus Cruces MGI:2138994 Pomt1 protein-O-mannosyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:05103 + EM:11736 C;129P2-Pi4k2a/H EMMA sperm Pi4k2aGt(AK0094)Wtsi Balb/c mutant strain MGI:4345401 Pi4k2a gene trap AK0094, Wellcome Trust Sanger Institute MGI:1934031 Pi4k2a phosphatidylinositol 4-kinase type 2 alpha https://www.infrafrontier.eu/search?keyword=EM:11736 + EM:00122 C;129P2-Lbp/Orl EMMA embryo C;129P2-Lbp/Orl, LBP mutant strain MGI:1857976 Lbp targeted mutation 1, Robert S Jack MGI:1098776 Lbp lipopolysaccharide binding protein https://www.infrafrontier.eu/search?keyword=EM:00122 + EM:01999 C57BL/6RccCnrm EMMA embryo C57BL/6RccIbcm, C57BL/6Rcc mutant strain MGI:2430266 Cd44<+> wild type MGI:88338 Cd44 CD44 antigen https://www.infrafrontier.eu/search?keyword=EM:01999 ? EM:14357 C57BL/6NTac-Zscan2/WtsiOulu EMMA embryo mutant strain MGI:4363795 Zscan2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99176 Zscan2 zinc finger and SCAN domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:14357 ? EM:14357 C57BL/6NTac-Zscan2/WtsiOulu EMMA sperm mutant strain MGI:4363795 Zscan2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99176 Zscan2 zinc finger and SCAN domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:14357 + EM:06375 C57BL/6NTac-Zscan10/WtsiCnrm EMMA sperm mutant strain MGI:4431612 Zscan10 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:3040700 Zscan10 zinc finger and SCAN domain containing 10 https://www.infrafrontier.eu/search?keyword=EM:06375 + EM:06858 C57BL/6NTac-Zkscan17/WtsiBiat EMMA sperm mutant strain MGI:4431816 Zkscan17 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2679270 Zkscan17 zinc finger with KRAB and SCAN domains 17 https://www.infrafrontier.eu/search?keyword=EM:06858 - EM:08860 C57BL/6NTac-Zfp819/WtsiH EMMA sperm mutant strain MGI:5633874 Zfp819 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1921650 Zfp819 zinc finger protein 819 https://www.infrafrontier.eu/search?keyword=EM:08860 + EM:04480 C57BL/6NTac-Zfp715/H EMMA sperm HEPD0520_1_F11 mutant strain MGI:4435328 Zfp715 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917180 Zfp715 zinc finger protein 715 https://www.infrafrontier.eu/search?keyword=EM:04480 - EM:09561 C57BL/6NTac-Zfp629/WtsiIeg EMMA sperm mutant strain MGI:5633873 Zfp629 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2444524 Zfp629 zinc finger protein 629 https://www.infrafrontier.eu/search?keyword=EM:09561 ? EM:13680 C57BL/6NTac-Zfp57/H EMMA live mutant strain MGI:5501557 Zfp57 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99204 Zfp57 zinc finger protein 57 https://www.infrafrontier.eu/search?keyword=EM:13680 + EM:08383 C57BL/6NTac-Zfp365/WtsiOrl EMMA sperm mutant strain MGI:4364171 Zfp365 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2143676 Zfp365 zinc finger protein 365 https://www.infrafrontier.eu/search?keyword=EM:08383 + EM:11563 C57BL/6NTac-Zfp341/WtsiIeg EMMA sperm mutant strain MGI:4362726 Zfp341 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2682937 Zfp341 zinc finger protein 341 https://www.infrafrontier.eu/search?keyword=EM:11563 + EM:10982 C57BL/6NTac-Zfp287/WtsiIeg EMMA sperm mutant strain MGI:4433358 Zfp287 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2176561 Zfp287 zinc finger protein 287 https://www.infrafrontier.eu/search?keyword=EM:10982 + EM:10994 C57BL/6NTac-Zfp219/WtsiPh EMMA sperm mutant strain MGI:5514579 Zfp219 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917140 Zfp219 zinc finger protein 219 https://www.infrafrontier.eu/search?keyword=EM:10994 + EM:07709 C57BL/6NTac-Zfp13/IcsOrl EMMA archived mutant strain MGI:4435325 Zfp13 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99159 Zfp13 zinc finger protein 13 https://www.infrafrontier.eu/search?keyword=EM:07709 ? EM:13682 C57BL/6NTac-Zdhhc16/H EMMA live mutant strain MGI:4434731 Zdhhc16 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921418 Zdhhc16 zinc finger, DHHC domain containing 16 https://www.infrafrontier.eu/search?keyword=EM:13682 + EM:07806 C57BL/6NTac-Zcchc14/WtsiOrl EMMA sperm mutant strain MGI:4362839 Zcchc14 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2159407 Zcchc14 zinc finger, CCHC domain containing 14 https://www.infrafrontier.eu/search?keyword=EM:07806 + EM:11756 C57BL/6NTac-Zc3h12a/Ieg EMMA sperm mutant strain MGI:4434879 Zc3h12a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385891 Zc3h12a zinc finger CCCH type containing 12A https://www.infrafrontier.eu/search?keyword=EM:11756 - EM:08958 C57BL/6NTac-Zbtb32/Cnrm EMMA sperm mutant strain MGI:5633872 Zbtb32 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1891838 Zbtb32 zinc finger and BTB domain containing 32 https://www.infrafrontier.eu/search?keyword=EM:08958 - EM:05170 C57BL/6NTac-Ywhab/Cnrm EMMA sperm mutant strain MGI:4435431 Ywhab targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1891917 Ywhab tyrosine 3-monooxygenase/tryptophan 5-monooxygenase activation protein, beta polypeptide https://www.infrafrontier.eu/search?keyword=EM:05170 + EM:07718 C57BL/6NTac-Xiap/IcsOrl EMMA sperm mutant strain MGI:4435758 Xiap targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107572 Xiap X-linked inhibitor of apoptosis https://www.infrafrontier.eu/search?keyword=EM:07718 + EM:13138 C57BL/6NTac-Xbp1/IcsOrl EMMA sperm mutant strain MGI:6468279 Xbp1 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:98970 Xbp1 X-box binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:13138 + EM:07516 C57BL/6NTac-Xbp1/IcsOrl EMMA archived mutant strain MGI:4432347 Xbp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98970 Xbp1 X-box binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:07516 - EM:11412 C57BL/6NTac-Wwp1/H EMMA sperm mutant strain MGI:6149154 Wwp1 endonuclease mediated mutation 1, Harwell MGI:1861728 Wwp1 WW domain containing E3 ubiquitin protein ligase 1 https://www.infrafrontier.eu/search?keyword=EM:11412 - EM:05171 C57BL/6NTac-Wsb2/Cnrm EMMA sperm mutant strain MGI:4434956 Wsb2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2144041 Wsb2 WD repeat and SOCS box-containing 2 https://www.infrafrontier.eu/search?keyword=EM:05171 - EM:03971 C57BL/6NTac-Wrnip1/Cnrm EMMA embryo B6NDen;B6N-Wrnip1/Cnrm, B6Dnk;B6N-Wrnip1/Cnrm mutant strain MGI:4432335 Wrnip1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926153 Wrnip1 Werner helicase interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:03971 - EM:03971 C57BL/6NTac-Wrnip1/Cnrm EMMA sperm B6NDen;B6N-Wrnip1/Cnrm, B6Dnk;B6N-Wrnip1/Cnrm mutant strain MGI:4432335 Wrnip1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926153 Wrnip1 Werner helicase interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:03971 - EM:09731 C57BL/6NTac-Wnt9a/WtsiH EMMA sperm mutant strain MGI:5633871 Wnt9a targeted mutation 1, Wellcome Trust Sanger Institute MGI:2446084 Wnt9a wingless-type MMTV integration site family, member 9A https://www.infrafrontier.eu/search?keyword=EM:09731 + EM:05873 C57BL/6NTac-Whrn/WtsiH EMMA sperm MCJH, EPD0200_4_C04 mutant strain MGI:4432119 Whrn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2682003 Whrn whirlin https://www.infrafrontier.eu/search?keyword=EM:05873 + EM:11407 C57BL/6NTac-Wfdc2/H EMMA live mutant strain MGI:6149155 Wfdc2 endonuclease mediated mutation 1, Harwell MGI:1914951 Wfdc2 WAP four-disulfide core domain 2 https://www.infrafrontier.eu/search?keyword=EM:11407 + EM:08232 C57BL/6NTac-Wdtc1/WtsiPh EMMA sperm mutant strain MGI:4362336 Wdtc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685541 Wdtc1 WD and tetratricopeptide repeats 1 https://www.infrafrontier.eu/search?keyword=EM:08232 ? EM:11074 C57BL/6NTac-Wdr62/Ics EMMA sperm mutant strain Wdr62 Wdr62 MGI:1923696 Wdr62 WD repeat domain 62 https://www.infrafrontier.eu/search?keyword=EM:11074 + EM:05860 C57BL/6NTac-Wbp2/WtsiH EMMA sperm EPD0037_2_D06, MBYF mutant strain MGI:4847848 Wbp2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:104709 Wbp2 WW domain binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:05860 - EM:04409 C57BL/6NTac-Wbp2/Cnrm EMMA embryo mutant strain MGI:4847848 Wbp2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:104709 Wbp2 WW domain binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:04409 - EM:04409 C57BL/6NTac-Wbp2/Cnrm EMMA sperm mutant strain MGI:4847848 Wbp2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:104709 Wbp2 WW domain binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:04409 + EM:12311 C57BL/6NTac-Vwf/Ics EMMA sperm mutant strain Vwf EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:98941 Vwf Von Willebrand factor https://www.infrafrontier.eu/search?keyword=EM:12311 + EM:09168 C57BL/6NTac-Vwa3a/WtsiPh EMMA sperm mutant strain MGI:4363306 Vwa3a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3041229 Vwa3a von Willebrand factor A domain containing 3A https://www.infrafrontier.eu/search?keyword=EM:09168 + EM:12409 C57BL/6NTac-Vps35/H EMMA sperm mutant strain MGI:6153830 Vps35 endonuclease-mediated mutation 1, Harwell MGI:1890467 Vps35 VPS35 retromer complex component https://www.infrafrontier.eu/search?keyword=EM:12409 + EM:11409 C57BL/6NTac-Vgll3/H EMMA sperm mutant strain MGI:6149157 Vgll3 endonuclease mediated mutation 2, Harwell MGI:1920819 Vgll3 vestigial like family member 3 https://www.infrafrontier.eu/search?keyword=EM:11409 + EM:11403 C57BL/6NTac-Vgll3/H EMMA live mutant strain MGI:6149156 Vgll3 endonuclease mediated mutation 1, Harwell MGI:1920819 Vgll3 vestigial like family member 3 https://www.infrafrontier.eu/search?keyword=EM:11403 + EM:10784 C57BL/6NTac-Vgf/H EMMA sperm mutant strain MGI:6144255 Vgf endonuclease mediated mutation 1, Harwell MGI:1343180 Vgf VGF nerve growth factor inducible https://www.infrafrontier.eu/search?keyword=EM:10784 - EM:09737 C57BL/6NTac-Vav1/WtsiH EMMA sperm mutant strain MGI:5633870 Vav1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:98923 Vav1 vav 1 oncogene https://www.infrafrontier.eu/search?keyword=EM:09737 + EM:07673 C57BL/6NTac-Vat1l/IcsOrl EMMA sperm mutant strain MGI:4436304 Vat1l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2142534 Vat1l vesicle amine transport protein 1 like https://www.infrafrontier.eu/search?keyword=EM:07673 ? EM:14047 C57BL/6NTac-Vangl1/WtsiIeg EMMA sperm mutant strain MGI:4365105 Vangl1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2159344 Vangl1 VANGL planar cell polarity 1 https://www.infrafrontier.eu/search?keyword=EM:14047 + EM:10755 C57BL/6NTac-Usp45/H EMMA sperm mutant strain MGI:5693168 Usp45 endonuclease-mediated mutation 1, Harwell MGI:101850 Usp45 ubiquitin specific petidase 45 https://www.infrafrontier.eu/search?keyword=EM:10755 + EM:05826 C57BL/6NTac-Usp3/WtsiH EMMA embryo USP3(A11) mutant strain MGI:4432395 Usp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2152450 Usp3 ubiquitin specific peptidase 3 https://www.infrafrontier.eu/search?keyword=EM:05826 + EM:05384 C57BL/6NTac-Usp33/WtsiCnbc EMMA embryo mutant strain MGI:4433766 Usp33 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2159711 Usp33 ubiquitin specific peptidase 33 https://www.infrafrontier.eu/search?keyword=EM:05384 + EM:05384 C57BL/6NTac-Usp33/WtsiCnbc EMMA sperm mutant strain MGI:4433766 Usp33 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2159711 Usp33 ubiquitin specific peptidase 33 https://www.infrafrontier.eu/search?keyword=EM:05384 + EM:06392 C57BL/6NTac-Usp22/WtsiH EMMA sperm mutant strain MGI:4364127 Usp22 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144157 Usp22 ubiquitin specific peptidase 22 https://www.infrafrontier.eu/search?keyword=EM:06392 + EM:09477 C57BL/6NTac-Usp20/WtsiPh EMMA sperm mutant strain MGI:4434938 Usp20 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921520 Usp20 ubiquitin specific peptidase 20 https://www.infrafrontier.eu/search?keyword=EM:09477 + EM:11883 C57BL/6NTac-Usp1/WtsiH EMMA sperm mutant strain MGI:4363583 Usp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385198 Usp1 ubiquitin specific peptidase 1 https://www.infrafrontier.eu/search?keyword=EM:11883 ? EM:14364 C57BL/6NTac-Ush1c/WtsiOulu EMMA embryo mutant strain MGI:4363497 Ush1c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919338 Ush1c USH1 protein network component harmonin https://www.infrafrontier.eu/search?keyword=EM:14364 ? EM:14364 C57BL/6NTac-Ush1c/WtsiOulu EMMA sperm mutant strain MGI:4363497 Ush1c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919338 Ush1c USH1 protein network component harmonin https://www.infrafrontier.eu/search?keyword=EM:14364 + EM:04616 C57BL/6NTac-Uros/H EMMA sperm EPD0100_5_A01 mutant strain MGI:4433834 Uros targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98917 Uros uroporphyrinogen III synthase https://www.infrafrontier.eu/search?keyword=EM:04616 + EM:11346 C57BL/6NTac-Uqcrq/H EMMA live mutant strain MGI:5497330 Uqcrq targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107807 Uqcrq ubiquinol-cytochrome c reductase, complex III subunit VII https://www.infrafrontier.eu/search?keyword=EM:11346 - EM:08456 C57BL/6NTac-Unc45a/Ieg EMMA sperm mutant strain MGI:4434645 Unc45a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2142246 Unc45a unc-45 myosin chaperone A https://www.infrafrontier.eu/search?keyword=EM:08456 + EM:12447 C57BL/6NTac-Unc13c/H EMMA sperm mutant strain MGI:6153829 Unc13c endonuclease-mediated mutation 1, Harwell MGI:2149021 Unc13c unc-13 homolog C https://www.infrafrontier.eu/search?keyword=EM:12447 ? EM:14370 C57BL/6NTac-Ugt2b5/WtsiOrl EMMA sperm mutant strain MGI:4362467 Ugt2b5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98900 Ugt2b5 UDP glucuronosyltransferase 2 family, polypeptide B5 https://www.infrafrontier.eu/search?keyword=EM:14370 + EM:05791 C57BL/6NTac-Ufl1/WtsiOrl EMMA sperm mutant strain MGI:4432479 Ufl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914740 Ufl1 UFM1 specific ligase 1 https://www.infrafrontier.eu/search?keyword=EM:05791 + EM:07850 C57BL/6NTac-Uevld/WtsiOulu EMMA embryo mutant strain MGI:4434449 Uevld targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1860490 Uevld UEV and lactate/malate dehyrogenase domains https://www.infrafrontier.eu/search?keyword=EM:07850 + EM:07850 C57BL/6NTac-Uevld/WtsiOulu EMMA sperm mutant strain MGI:4434449 Uevld targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1860490 Uevld UEV and lactate/malate dehyrogenase domains https://www.infrafrontier.eu/search?keyword=EM:07850 - EM:08947 C57BL/6NTac-Ucp1/WtsiH EMMA sperm mutant strain MGI:5633869 Ucp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:98894 Ucp1 uncoupling protein 1 (mitochondrial, proton carrier) https://www.infrafrontier.eu/search?keyword=EM:08947 ? EM:14058 C57BL/6NTac-Uck1/WtsiPh EMMA sperm mutant strain MGI:4362314 Uck1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:98904 Uck1 uridine-cytidine kinase 1 https://www.infrafrontier.eu/search?keyword=EM:14058 - EM:07015 C57BL/6NTac-Ube2u/H EMMA sperm mutant strain MGI:4363149 Ube2u targeted mutation 1e, Wellcome Trust Sanger Institute MGI:3588216 Ube2u ubiquitin-conjugating enzyme E2U (putative) https://www.infrafrontier.eu/search?keyword=EM:07015 + EM:07693 C57BL/6NTac-Ube2b/IcsOrl EMMA sperm mutant strain MGI:4431903 Ube2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102944 Ube2b ubiquitin-conjugating enzyme E2B https://www.infrafrontier.eu/search?keyword=EM:07693 + EM:05232 C57BL/6NTac-Twf1/WtsiCnbc EMMA embryo mutant strain MGI:4434218 Twf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1100520 Twf1 twinfilin actin binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:05232 + EM:05232 C57BL/6NTac-Twf1/WtsiCnbc EMMA sperm mutant strain MGI:4434218 Twf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1100520 Twf1 twinfilin actin binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:05232 + EM:06981 C57BL/6NTac-Tulp3/H EMMA sperm mutant strain MGI:4435073 Tulp3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1329045 Tulp3 tubby-like protein 3 https://www.infrafrontier.eu/search?keyword=EM:06981 - EM:09763 C57BL/6NTac-Ttr/WtsiH EMMA sperm mutant strain MGI:5633868 Ttr targeted mutation 1, Wellcome Trust Sanger Institute MGI:98865 Ttr transthyretin https://www.infrafrontier.eu/search?keyword=EM:09763 - EM:08966 C57BL/6NTac-Ttll5/Cnrm EMMA sperm mutant strain MGI:5633867 Ttll5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2443657 Ttll5 tubulin tyrosine ligase-like family, member 5 https://www.infrafrontier.eu/search?keyword=EM:08966 + EM:07712 C57BL/6NTac-Ttll1/IcsOrl EMMA archived mutant strain MGI:4432051 Ttll1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443047 Ttll1 tubulin tyrosine ligase-like 1 https://www.infrafrontier.eu/search?keyword=EM:07712 + EM:05838 C57BL/6NTac-Ttll12/Cnrm EMMA sperm mutant strain MGI:4433627 Ttll12 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:3039573 Ttll12 tubulin tyrosine ligase-like family, member 12 https://www.infrafrontier.eu/search?keyword=EM:05838 - EM:09546 C57BL/6NTac-Ttc21a/WtsiIeg EMMA sperm mutant strain MGI:5633866 Ttc21a targeted mutation 1, Wellcome Trust Sanger Institute MGI:1921302 Ttc21a tetratricopeptide repeat domain 21A https://www.infrafrontier.eu/search?keyword=EM:09546 + EM:12444 C57BL/6NTac-Tspoap1/H EMMA sperm mutant strain MGI:6153864 Tspoap1 endonuclease-mediated mutation 1, Harwell MGI:2450877 Tspoap1 TSPO associated protein 1 https://www.infrafrontier.eu/search?keyword=EM:12444 + EM:11473 C57BL/6NTac-Tspan17/H EMMA live mutant strain MGI:6152699 Tspan17 endonuclease mediated mutation 2, Harwell MGI:1921507 Tspan17 tetraspanin 17 https://www.infrafrontier.eu/search?keyword=EM:11473 + EM:11472 C57BL/6NTac-Tspan17/H EMMA sperm mutant strain MGI:6153828 Tspan17 endonuclease-mediated mutation 1, Harwell MGI:1921507 Tspan17 tetraspanin 17 https://www.infrafrontier.eu/search?keyword=EM:11472 + EM:11472 C57BL/6NTac-Tspan17/H EMMA live mutant strain MGI:6153828 Tspan17 endonuclease-mediated mutation 1, Harwell MGI:1921507 Tspan17 tetraspanin 17 https://www.infrafrontier.eu/search?keyword=EM:11472 + EM:11427 C57BL/6NTac-Tspan14/H EMMA live mutant strain MGI:6149216 Tspan14 endonuclease mediated mutation 1, Harwell MGI:1196325 Tspan14 tetraspanin 14 https://www.infrafrontier.eu/search?keyword=EM:11427 - EM:08950 C57BL/6NTac-Tshb/WtsiH EMMA sperm mutant strain MGI:5633865 Tshb targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:98848 Tshb thyroid stimulating hormone, beta subunit https://www.infrafrontier.eu/search?keyword=EM:08950 + EM:06260 C57BL/6NTac-Tsfm/WtsiCnbc EMMA sperm mutant strain MGI:4432572 Tsfm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913649 Tsfm Ts translation elongation factor, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:06260 - EM:08859 C57BL/6NTac-Trpv1/WtsiH EMMA sperm mutant strain MGI:5633864 Trpv1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1341787 Trpv1 transient receptor potential cation channel, subfamily V, member 1 https://www.infrafrontier.eu/search?keyword=EM:08859 + EM:12316 C57BL/6NTac-Trpc1/Ics EMMA sperm mutant strain Trpc1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:109528 Trpc1 transient receptor potential cation channel, subfamily C, member 1 https://www.infrafrontier.eu/search?keyword=EM:12316 + EM:11422 C57BL/6NTac-Trp73/H EMMA sperm mutant strain MGI:6149215 Trp73 endonuclease mediated mutation 1, Harwell MGI:1336991 Trp73 transformation related protein 73 https://www.infrafrontier.eu/search?keyword=EM:11422 + EM:13022 C57BL/6NTac-Trmt9b/H EMMA sperm unclassified MGI:6451748 Trmt9b endonuclease-mediated mutation 2, Harwell MGI:2442328 Trmt9b tRNA methyltransferase 9B https://www.infrafrontier.eu/search?keyword=EM:13022 + EM:05441 C57BL/6NTac-Trmt10a/WtsiOulu EMMA embryo mutant strain MGI:4432852 Trmt10a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920421 Trmt10a tRNA methyltransferase 10A https://www.infrafrontier.eu/search?keyword=EM:05441 + EM:05893 C57BL/6NTac-Trim66/WtsiIeg EMMA sperm mutant strain MGI:4431799 Trim66 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2152406 Trim66 tripartite motif-containing 66 https://www.infrafrontier.eu/search?keyword=EM:05893 + EM:08871 C57BL/6NTac-Trim65/WtsiIeg EMMA sperm mutant strain MGI:4363168 Trim65 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442815 Trim65 tripartite motif-containing 65 https://www.infrafrontier.eu/search?keyword=EM:08871 + EM:07820 C57BL/6NTac-Trib3/IcsOrl EMMA sperm mutant strain MGI:4435061 Trib3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1345675 Trib3 tribbles pseudokinase 3 https://www.infrafrontier.eu/search?keyword=EM:07820 + EM:10857 C57BL/6NTac-Trex1/WtsiOulu EMMA embryo mutant strain MGI:4362876 Trex1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1328317 Trex1 three prime repair exonuclease 1 https://www.infrafrontier.eu/search?keyword=EM:10857 + EM:10857 C57BL/6NTac-Trex1/WtsiOulu EMMA sperm mutant strain MGI:4362876 Trex1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1328317 Trex1 three prime repair exonuclease 1 https://www.infrafrontier.eu/search?keyword=EM:10857 + EM:10839 C57BL/6NTac-Tox2/H EMMA live C57BL/6N-Tox2/H mutant strain MGI:5749960 Tox2 endonuclease-mediated mutation 2, Harwell MGI:3611233 Tox2 TOX high mobility group box family member 2 https://www.infrafrontier.eu/search?keyword=EM:10839 + EM:10767 C57BL/6NTac-Tox2/H EMMA archived C57BL/6N-Tox2/H mutant strain MGI:5749959 Tox2 endonuclease-mediated mutation 1, Harwell MGI:3611233 Tox2 TOX high mobility group box family member 2 https://www.infrafrontier.eu/search?keyword=EM:10767 + EM:09684 C57BL/6NTac-Tor1aip1/H EMMA sperm mutant strain MGI:5514583 Tor1aip1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3582693 Tor1aip1 torsin A interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:09684 + EM:12445 C57BL/6NTac-Tor1a/H EMMA sperm mutant strain MGI:6153827 Tor1a endonuclease-mediated mutation 1, Harwell MGI:1353568 Tor1a torsin family 1, member A (torsin A) https://www.infrafrontier.eu/search?keyword=EM:12445 - EM:08848 C57BL/6NTac-Tns1/WtsiH EMMA sperm mutant strain MGI:5633856 Tns1 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:104552 Tns1 tensin 1 https://www.infrafrontier.eu/search?keyword=EM:08848 + EM:11022 C57BL/6NTac-Tnip1/H EMMA sperm mutant strain MGI:4435909 Tnip1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1926194 Tnip1 TNFAIP3 interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:11022 + EM:13136 C57BL/6NTac-Tnfrsf9/IcsOrl EMMA archived mutant strain MGI:6363081 Tnfrsf9 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1101059 Tnfrsf9 tumor necrosis factor receptor superfamily, member 9 https://www.infrafrontier.eu/search?keyword=EM:13136 + EM:09976 C57BL/6NTac-Tnfrsf9/IcsOrl EMMA sperm mutant strain MGI:4432147 Tnfrsf9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1101059 Tnfrsf9 tumor necrosis factor receptor superfamily, member 9 https://www.infrafrontier.eu/search?keyword=EM:09976 + EM:07654 C57BL/6NTac-Tnfrsf1b/IcsOrl EMMA archived mutant strain MGI:4433096 Tnfrsf1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1314883 Tnfrsf1b tumor necrosis factor receptor superfamily, member 1b https://www.infrafrontier.eu/search?keyword=EM:07654 ? EM:13963 C57BL/6NTac-Tmprss15/WtsiPh EMMA sperm mutant strain MGI:4364308 Tmprss15 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1197523 Tmprss15 transmembrane protease, serine 15 https://www.infrafrontier.eu/search?keyword=EM:13963 + EM:07721 C57BL/6NTac-Tmod3/IcsOrl EMMA archived mutant strain MGI:4435232 Tmod3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1355315 Tmod3 tropomodulin 3 https://www.infrafrontier.eu/search?keyword=EM:07721 + EM:05865 C57BL/6NTac-Tmem9/WtsiH EMMA sperm MCXG, EPD0144_3_A09 mutant strain MGI:4433014 Tmem9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913491 Tmem9 transmembrane protein 9 https://www.infrafrontier.eu/search?keyword=EM:05865 + EM:07679 C57BL/6NTac-Tmem94/IcsOrl EMMA archived C57BL/6NTac-2310067B10Rik/IcsOrl, EPD0215_1_D09 mutant strain MGI:4432189 Tmem94 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919197 Tmem94 transmembrane protein 94 https://www.infrafrontier.eu/search?keyword=EM:07679 + EM:07707 C57BL/6NTac-Tmem68/IcsOrl EMMA archived mutant strain MGI:4431978 Tmem68 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919348 Tmem68 transmembrane protein 68 https://www.infrafrontier.eu/search?keyword=EM:07707 + EM:07650 C57BL/6NTac-Tmem63b/IcsOrl EMMA sperm mutant strain MGI:4433726 Tmem63b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2387609 Tmem63b transmembrane protein 63b https://www.infrafrontier.eu/search?keyword=EM:07650 ? EM:13947 C57BL/6NTac-Tmem54/WtsiPh EMMA sperm mutant strain MGI:4362446 Tmem54 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913510 Tmem54 transmembrane protein 54 https://www.infrafrontier.eu/search?keyword=EM:13947 ? EM:13684 C57BL/6NTac-Tmem40/H EMMA live mutant strain MGI:5430142 Tmem40 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2137870 Tmem40 transmembrane protein 40 https://www.infrafrontier.eu/search?keyword=EM:13684 + EM:11315 C57BL/6NTac-Tmem203/H EMMA sperm mutant strain MGI:6144257 Tmem203 endonuclease mediated mutation 2, Harwell MGI:2443597 Tmem203 transmembrane protein 203 https://www.infrafrontier.eu/search?keyword=EM:11315 + EM:10841 C57BL/6NTac-Tmem203/H EMMA sperm mutant strain MGI:6144256 Tmem203 endonuclease mediated mutation 1, Harwell MGI:2443597 Tmem203 transmembrane protein 203 https://www.infrafrontier.eu/search?keyword=EM:10841 + EM:09726 C57BL/6NTac-Tmem132a/WtsiH EMMA sperm mutant strain MGI:4362366 Tmem132a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2147810 Tmem132a transmembrane protein 132A https://www.infrafrontier.eu/search?keyword=EM:09726 + EM:09972 C57BL/6NTac-Tmem108/IcsOrl EMMA sperm mutant strain MGI:4441635 Tmem108 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1932411 Tmem108 transmembrane protein 108 https://www.infrafrontier.eu/search?keyword=EM:09972 + EM:07677 C57BL/6NTac-Tmc8/IcsOrl EMMA sperm mutant strain MGI:4432152 Tmc8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2669037 Tmc8 transmembrane channel-like gene family 8 https://www.infrafrontier.eu/search?keyword=EM:07677 + EM:05883 C57BL/6NTac-Tmc6/WtsiIeg EMMA sperm mutant strain MGI:4434247 Tmc6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098686 Tmc6 transmembrane channel-like gene family 6 https://www.infrafrontier.eu/search?keyword=EM:05883 + EM:12130 C57BL/6NTac-Tm9sf4/Wtsi EMMA embryo mutant strain MGI:4363779 Tm9sf4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2139220 Tm9sf4 transmembrane 9 superfamily member 4 https://www.infrafrontier.eu/search?keyword=EM:12130 + EM:11054 C57BL/6NTac-Tm6sf2/H EMMA sperm mutant strain MGI:4362886 Tm6sf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933210 Tm6sf2 transmembrane 6 superfamily member 2 https://www.infrafrontier.eu/search?keyword=EM:11054 + EM:11318 C57BL/6NTac-Tm6sf2/H EMMA sperm mutant strain MGI:6152701 Tm6sf2 endonuclease mediated mutation 4, Harwell MGI:1933210 Tm6sf2 transmembrane 6 superfamily member 2 https://www.infrafrontier.eu/search?keyword=EM:11318 - EM:04555 C57BL/6NTac-Tln1/Cnrm EMMA embryo mutant strain MGI:4433023 Tln1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1099832 Tln1 talin 1 https://www.infrafrontier.eu/search?keyword=EM:04555 - EM:04555 C57BL/6NTac-Tln1/Cnrm EMMA sperm mutant strain MGI:4433023 Tln1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1099832 Tln1 talin 1 https://www.infrafrontier.eu/search?keyword=EM:04555 - EM:08946 C57BL/6NTac-Tle6/WtsiH EMMA sperm mutant strain MGI:5633854 Tle6 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:2149593 Tle6 transducin-like enhancer of split 6 https://www.infrafrontier.eu/search?keyword=EM:08946 + EM:10028 C57BL/6NTac-Tlcd4/WtsiIeg EMMA sperm C57BL/6NTac-Tmem56/WtsiIeg mutant strain MGI:5633855 Tlcd4 targeted mutation 1, Tmem56 MGI:1923195 Tlcd4 TLC domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:10028 + EM:04437 C57BL/6NTac-Timm50/Ics EMMA sperm EPD0144_2_D04 mutant strain MGI:4433575 Timm50 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913775 Timm50 translocase of inner mitochondrial membrane 50 https://www.infrafrontier.eu/search?keyword=EM:04437 ? EM:14109 C57BL/6NTac-Tigit/WtsiPh EMMA sperm mutant strain Tigit undef targeted mutation , Wellcome Trust Sanger Institute MGI:3642260 Tigit T cell immunoreceptor with Ig and ITIM domains https://www.infrafrontier.eu/search?keyword=EM:14109 + EM:07187 C57BL/6NTac-Tigar/WtsiH EMMA sperm EPD0192_3_E06, C57BL/6NTac-9630033F20Rik/WtsiH, MFCG mutant strain MGI:4441746 Tigar targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442752 Tigar Trp53 induced glycolysis regulatory phosphatase https://www.infrafrontier.eu/search?keyword=EM:07187 - EM:09740 C57BL/6NTac-Tie1/WtsiH EMMA sperm mutant strain MGI:5633853 Tie1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:99906 Tie1 tyrosine kinase with immunoglobulin-like and EGF-like domains 1 https://www.infrafrontier.eu/search?keyword=EM:09740 + EM:10533 C57BL/6NTac-Tiam1/Ics EMMA sperm mutant strain MGI:5511857 Tiam1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103306 Tiam1 T cell lymphoma invasion and metastasis 1 https://www.infrafrontier.eu/search?keyword=EM:10533 ? EM:13986 C57BL/6NTac-Tia1/WtsiOrl EMMA sperm mutant strain Tia1 KOMP targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107914 Tia1 cytotoxic granule-associated RNA binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:13986 + EM:07613 C57BL/6NTac-Thra/Ics EMMA sperm mutant strain MGI:4455948 Thra targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98742 Thra thyroid hormone receptor alpha https://www.infrafrontier.eu/search?keyword=EM:07613 + EM:12361 C57BL/6NTac-Th/H EMMA sperm mutant strain MGI:6153826 Th endonuclease-mediated mutation 1, Harwell MGI:98735 Th tyrosine hydroxylase https://www.infrafrontier.eu/search?keyword=EM:12361 + EM:10178 C57BL/6NTac-Tgif2/IcsOrl EMMA sperm mutant strain MGI:4433717 Tgif2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915299 Tgif2 TGFB-induced factor homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:10178 + EM:06107 C57BL/6NTac-Tg(ACTB-cre)3Mrt/H EMMA embryo mutant strain MGI:5316983 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin MGI:5316982 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin https://www.infrafrontier.eu/search?keyword=EM:06107 + EM:06107 C57BL/6NTac-Tg(ACTB-cre)3Mrt/H EMMA sperm mutant strain MGI:5316983 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin MGI:5316982 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin https://www.infrafrontier.eu/search?keyword=EM:06107 + EM:06107 C57BL/6NTac-Tg(ACTB-cre)3Mrt/H EMMA live mutant strain MGI:5316983 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin MGI:5316982 Tg(ACTB-cre)3Mrt transgene insertion 3, Gail R Martin https://www.infrafrontier.eu/search?keyword=EM:06107 - EM:09773 C57BL/6NTac-Tff1/WtsiH EMMA sperm mutant strain MGI:5633852 Tff1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:88135 Tff1 trefoil factor 1 https://www.infrafrontier.eu/search?keyword=EM:09773 + EM:09846 C57BL/6NTac-Tex38/WtsiOrl EMMA sperm mutant strain MGI:4363110 Tex38 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922423 Tex38 testis expressed 38 https://www.infrafrontier.eu/search?keyword=EM:09846 + EM:10081 C57BL/6NTac-Tex101/WtsiIeg EMMA sperm mutant strain MGI:5633851 Tex101 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1930791 Tex101 testis expressed gene 101 https://www.infrafrontier.eu/search?keyword=EM:10081 - EM:09738 C57BL/6NTac-Tecta/WtsiH EMMA sperm mutant strain MGI:5633850 Tecta targeted mutation 1, Wellcome Trust Sanger Institute MGI:109575 Tecta tectorin alpha https://www.infrafrontier.eu/search?keyword=EM:09738 + EM:12302 C57BL/6NTac-Tcte2/Ics EMMA sperm mutant strain Tcte2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:98641 Tcte2 t-complex-associated testis expressed 2 https://www.infrafrontier.eu/search?keyword=EM:12302 + EM:07858 C57BL/6NTac-Tcf7l2/WtsiIeg EMMA sperm mutant strain MGI:4431951 Tcf7l2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202879 Tcf7l2 transcription factor 7 like 2, T cell specific, HMG box https://www.infrafrontier.eu/search?keyword=EM:07858 + EM:07661 C57BL/6NTac-Tcf7/IcsOrl EMMA sperm mutant strain MGI:4441645 Tcf7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98507 Tcf7 transcription factor 7, T cell specific https://www.infrafrontier.eu/search?keyword=EM:07661 + EM:06992 C57BL/6NTac-Tcf4/WtsiBiat EMMA archived mutant strain MGI:4432303 Tcf4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98506 Tcf4 transcription factor 4 https://www.infrafrontier.eu/search?keyword=EM:06992 - EM:09756 C57BL/6NTac-Tbx2/WtsiH EMMA sperm mutant strain MGI:5633849 Tbx2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:98494 Tbx2 T-box 2 https://www.infrafrontier.eu/search?keyword=EM:09756 - EM:04685 C57BL/6NTac-Tbc1d10a/Cnrm EMMA embryo mutant strain MGI:4432519 Tbc1d10a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2144164 Tbc1d10a TBC1 domain family, member 10a https://www.infrafrontier.eu/search?keyword=EM:04685 - EM:04685 C57BL/6NTac-Tbc1d10a/Cnrm EMMA sperm mutant strain MGI:4432519 Tbc1d10a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2144164 Tbc1d10a TBC1 domain family, member 10a https://www.infrafrontier.eu/search?keyword=EM:04685 + EM:14655 C57BL/6NTac-Tacr1/H EMMA sperm unclassified MGI:6741498 Tacr1 endonuclease-mediated mutation 2, Harwell MGI:98475 Tacr1 tachykinin receptor 1 https://www.infrafrontier.eu/search?keyword=EM:14655 + EM:14654 C57BL/6NTac-Tacr1/H EMMA sperm unclassified MGI:6790648 Tacr1 endonuclease-mediated mutation 1, Harwell MGI:98475 Tacr1 tachykinin receptor 1 https://www.infrafrontier.eu/search?keyword=EM:14654 + EM:12293 C57BL/6NTac-Tac2/Ics EMMA sperm mutant strain Tac2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:98476 Tac2 tachykinin 2 https://www.infrafrontier.eu/search?keyword=EM:12293 - EM:12375 C57BL/6NTac-Syt4/H EMMA sperm C57BL/6N-Syt4/H mutant strain MGI:6153886 Syt4 endonuclease-mediated mutation 2, Harwell MGI:101759 Syt4 synaptotagmin IV https://www.infrafrontier.eu/search?keyword=EM:12375 + EM:06829 C57BL/6NTac-Syt1/WtsiCnrm EMMA sperm mutant strain MGI:4433781 Syt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99667 Syt1 synaptotagmin I https://www.infrafrontier.eu/search?keyword=EM:06829 + EM:07636 C57BL/6NTac-Synpo2/IcsOrl EMMA sperm mutant strain MGI:4441661 Synpo2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153070 Synpo2 synaptopodin 2 https://www.infrafrontier.eu/search?keyword=EM:07636 - EM:09447 C57BL/6NTac-Syndig1l/Cnrm EMMA sperm mutant strain MGI:5633848 Syndig1l targeted mutation 1, Wellcome Trust Sanger Institute MGI:2685107 Syndig1l synapse differentiation inducing 1 like https://www.infrafrontier.eu/search?keyword=EM:09447 + EM:10085 C57BL/6NTac-Syce1/WtsiIeg EMMA sperm mutant strain MGI:5633847 Syce1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1921325 Syce1 synaptonemal complex central element protein 1 https://www.infrafrontier.eu/search?keyword=EM:10085 + EM:11459 C57BL/6NTac-Svop/H EMMA live mutant strain MGI:6152697 Svop endonuclease mediated mutation 2, Harwell MGI:1915916 Svop SV2 related protein https://www.infrafrontier.eu/search?keyword=EM:11459 + EM:11460 C57BL/6NTac-Svop/H EMMA sperm mutant strain MGI:6153863 Svop endonuclease-mediated mutation 1, Harwell MGI:1915916 Svop SV2 related protein https://www.infrafrontier.eu/search?keyword=EM:11460 + EM:11460 C57BL/6NTac-Svop/H EMMA live mutant strain MGI:6153863 Svop endonuclease-mediated mutation 1, Harwell MGI:1915916 Svop SV2 related protein https://www.infrafrontier.eu/search?keyword=EM:11460 + EM:05444 C57BL/6NTac-Supt7l/WtsiOulu EMMA embryo mutant strain MGI:4432224 Supt7l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919445 Supt7l SPT7-like, STAGA complex gamma subunit https://www.infrafrontier.eu/search?keyword=EM:05444 + EM:09848 C57BL/6NTac-Supt3/WtsiPh EMMA sperm mutant strain MGI:4435781 Supt3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923723 Supt3 SPT3, SAGA and STAGA complex component https://www.infrafrontier.eu/search?keyword=EM:09848 - EM:03992 C57BL/6NTac-Stx8/Cnrm EMMA sperm B6NDen;B6N-Stx8/Cnrm, B6Dnk;B6N-Stx8/Cnrm mutant strain MGI:4432376 Stx8 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1890156 Stx8 syntaxin 8 https://www.infrafrontier.eu/search?keyword=EM:03992 + EM:11421 C57BL/6NTac-Stk3/H EMMA sperm mutant strain MGI:6152695 Stk3 endonuclease mediated mutation 2, Harwell MGI:1928487 Stk3 serine/threonine kinase 3 https://www.infrafrontier.eu/search?keyword=EM:11421 + EM:11411 C57BL/6NTac-Stk3/H EMMA sperm mutant strain MGI:6149213 Stk3 endonuclease mediated mutation 1, Harwell MGI:1928487 Stk3 serine/threonine kinase 3 https://www.infrafrontier.eu/search?keyword=EM:11411 + EM:06040 C57BL/6NTac-Stk39/WtsiH EMMA sperm EPD0169_4_D02, MCJB mutant strain MGI:4433935 Stk39 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858416 Stk39 serine/threonine kinase 39 https://www.infrafrontier.eu/search?keyword=EM:06040 + EM:14652 C57BL/6NTac-Stat2/H EMMA sperm unclassified MGI:6741492 Stat2 endonuclease-mediated mutation 1, Harwell MGI:103039 Stat2 signal transducer and activator of transcription 2 https://www.infrafrontier.eu/search?keyword=EM:14652 + EM:07272 C57BL/6NTac-Stard7/WtsiOulu EMMA embryo mutant strain MGI:4433666 Stard7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2139090 Stard7 START domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:07272 + EM:07272 C57BL/6NTac-Stard7/WtsiOulu EMMA sperm mutant strain MGI:4433666 Stard7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2139090 Stard7 START domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:07272 + EM:11127 C57BL/6NTac-Star/WtsiH EMMA sperm mutant strain MGI:5660124 Star targeted mutation 1, Wellcome Trust Sanger Institute MGI:102760 Star steroidogenic acute regulatory protein https://www.infrafrontier.eu/search?keyword=EM:11127 + EM:11429 C57BL/6NTac-St6gal2/H EMMA live mutant strain MGI:6152694 St6gal2 endonuclease mediated mutation 2, Harwell MGI:2445190 St6gal2 beta galactoside alpha 2,6 sialyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:11429 + EM:11418 C57BL/6NTac-St6gal2/H EMMA sperm C57BL/6N-St6gal2/H mutant strain MGI:6149212 St6gal2 endonuclease mediated mutation 1, Harwell MGI:2445190 St6gal2 beta galactoside alpha 2,6 sialyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:11418 + EM:07637 C57BL/6NTac-Srsf4/IcsOrl EMMA archived mutant strain MGI:4431961 Srsf4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1890577 Srsf4 serine and arginine-rich splicing factor 4 https://www.infrafrontier.eu/search?keyword=EM:07637 + EM:14651 C57BL/6NTac-Sqstm1/H EMMA sperm unclassified MGI:6741489 Sqstm1 endonuclease-mediated mutation 2, Harwell MGI:107931 Sqstm1 sequestosome 1 https://www.infrafrontier.eu/search?keyword=EM:14651 + EM:14650 C57BL/6NTac-Sqstm1/H EMMA sperm unclassified MGI:6741486 Sqstm1 endonuclease-mediated mutation 1, Harwell MGI:107931 Sqstm1 sequestosome 1 https://www.infrafrontier.eu/search?keyword=EM:14650 + EM:14649 C57BL/6NTac-Sptlc1/H EMMA sperm unclassified MGI:6741483 Sptlc1 endonuclease-mediated mutation 2, Harwell MGI:1099431 Sptlc1 serine palmitoyltransferase, long chain base subunit 1 https://www.infrafrontier.eu/search?keyword=EM:14649 + EM:14648 C57BL/6NTac-Sptlc1/H EMMA sperm unclassified MGI:6741481 Sptlc1 endonuclease-mediated mutation 1, Harwell MGI:1099431 Sptlc1 serine palmitoyltransferase, long chain base subunit 1 https://www.infrafrontier.eu/search?keyword=EM:14648 - EM:09557 C57BL/6NTac-Spp2/WtsiIeg EMMA sperm mutant strain MGI:5633846 Spp2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1922646 Spp2 secreted phosphoprotein 2 https://www.infrafrontier.eu/search?keyword=EM:09557 + EM:06850 C57BL/6NTac-Spopl/WtsiCnrm EMMA embryo mutant strain MGI:4455963 Spopl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924107 Spopl speckle-type BTB/POZ protein-like https://www.infrafrontier.eu/search?keyword=EM:06850 + EM:06850 C57BL/6NTac-Spopl/WtsiCnrm EMMA sperm mutant strain MGI:4455963 Spopl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924107 Spopl speckle-type BTB/POZ protein-like https://www.infrafrontier.eu/search?keyword=EM:06850 + EM:12357 C57BL/6NTac-Spock1/H EMMA sperm mutant strain MGI:6153825 Spock1 endonuclease-mediated mutation 1, Harwell MGI:105371 Spock1 sparc/osteonectin, cwcv and kazal-like domains proteoglycan 1 https://www.infrafrontier.eu/search?keyword=EM:12357 + EM:07663 C57BL/6NTac-Spns1/IcsOrl EMMA archived mutant strain MGI:4434332 Spns1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1920908 Spns1 spinster homolog 1 https://www.infrafrontier.eu/search?keyword=EM:07663 - EM:09547 C57BL/6NTac-Spink8/WtsiIeg EMMA sperm mutant strain MGI:5633845 Spink8 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1925959 Spink8 serine peptidase inhibitor, Kazal type 8 https://www.infrafrontier.eu/search?keyword=EM:09547 - EM:08964 C57BL/6NTac-Spink8/Cnrm EMMA sperm mutant strain MGI:5633845 Spink8 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1925959 Spink8 serine peptidase inhibitor, Kazal type 8 https://www.infrafrontier.eu/search?keyword=EM:08964 - EM:08974 C57BL/6NTac-Spic/Cnrm EMMA sperm mutant strain MGI:5633844 Spic targeted mutation 1, Wellcome Trust Sanger Institute MGI:1341168 Spic Spi-C transcription factor (Spi-1/PU.1 related) https://www.infrafrontier.eu/search?keyword=EM:08974 - EM:05201 C57BL/6NTac-Spg20/Cnrm EMMA sperm mutant strain MGI:4436639 Spg20 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2139806 Spg20 spastic paraplegia 20, spartin (Troyer syndrome) homolog (human) https://www.infrafrontier.eu/search?keyword=EM:05201 + EM:09424 C57BL/6NTac-Spats1/H EMMA sperm mutant strain MGI:5436890 Spats1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918270 Spats1 spermatogenesis associated, serine-rich 1 https://www.infrafrontier.eu/search?keyword=EM:09424 + EM:12355 C57BL/6NTac-Spatc1l/H EMMA sperm mutant strain MGI:6153862 Spatc1l endonuclease-mediated mutation 1, Harwell MGI:1923823 Spatc1l spermatogenesis and centriole associated 1 like https://www.infrafrontier.eu/search?keyword=EM:12355 + EM:11414 C57BL/6NTac-Spata13/H EMMA sperm mutant strain MGI:6153824 Spata13 endonuclease-mediated mutation 1, Harwell MGI:104838 Spata13 spermatogenesis associated 13 https://www.infrafrontier.eu/search?keyword=EM:11414 + EM:11414 C57BL/6NTac-Spata13/H EMMA live mutant strain MGI:6153824 Spata13 endonuclease-mediated mutation 1, Harwell MGI:104838 Spata13 spermatogenesis associated 13 https://www.infrafrontier.eu/search?keyword=EM:11414 + EM:07671 C57BL/6NTac-Sox13/IcsOrl EMMA archived mutant strain MGI:4433017 Sox13 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98361 Sox13 SRY (sex determining region Y)-box 13 https://www.infrafrontier.eu/search?keyword=EM:07671 - EM:09221 C57BL/6NTac-Sost/Cnrm EMMA sperm mutant strain MGI:5633843 Sost targeted mutation 1, Wellcome Trust Sanger Institute MGI:1921749 Sost sclerostin https://www.infrafrontier.eu/search?keyword=EM:09221 + EM:08481 C57BL/6NTac-Snx31/WtsiFlmg EMMA sperm mutant strain MGI:5497029 Snx31 targeted mutation 1a, Mouse Biology Program, University of California, Davis MGI:1913946 Snx31 sorting nexin 31 https://www.infrafrontier.eu/search?keyword=EM:08481 + EM:12383 C57BL/6NTac-Snx14/H EMMA sperm C57BL/6N-Snx14/H mutant strain MGI:6153823 Snx14 endonuclease-mediated mutation 1, Harwell MGI:2155664 Snx14 sorting nexin 14 https://www.infrafrontier.eu/search?keyword=EM:12383 - EM:09542 C57BL/6NTac-Snhg11/WtsiIeg EMMA archived mutant strain MGI:5633842 Snhg11 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2441845 Snhg11 small nucleolar RNA host gene 11 https://www.infrafrontier.eu/search?keyword=EM:09542 + EM:11550 C57BL/6NTac-Snca/H EMMA live mutant strain MGI:6149211 Snca endonuclease mediated mutation 1, Harwell MGI:1277151 Snca synuclein, alpha https://www.infrafrontier.eu/search?keyword=EM:11550 + EM:06013 C57BL/6NTac-Snap47/WtsiBiat EMMA sperm mutant strain MGI:4433792 Snap47 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915076 Snap47 synaptosomal-associated protein, 47 https://www.infrafrontier.eu/search?keyword=EM:06013 + EM:05226 C57BL/6NTac-Snap29/WtsiCnbc EMMA embryo mutant strain MGI:4433565 Snap29 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914724 Snap29 synaptosomal-associated protein 29 https://www.infrafrontier.eu/search?keyword=EM:05226 + EM:05226 C57BL/6NTac-Snap29/WtsiCnbc EMMA sperm mutant strain MGI:4433565 Snap29 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914724 Snap29 synaptosomal-associated protein 29 https://www.infrafrontier.eu/search?keyword=EM:05226 - EM:08853 C57BL/6NTac-Snap29/WtsiH EMMA sperm mutant strain MGI:5633841 Snap29 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1914724 Snap29 synaptosomal-associated protein 29 https://www.infrafrontier.eu/search?keyword=EM:08853 + EM:06942 C57BL/6NTac-Smyd5/WtsiCnbc EMMA embryo mutant strain MGI:4431696 Smyd5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108048 Smyd5 SET and MYND domain containing 5 https://www.infrafrontier.eu/search?keyword=EM:06942 + EM:06942 C57BL/6NTac-Smyd5/WtsiCnbc EMMA sperm mutant strain MGI:4431696 Smyd5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108048 Smyd5 SET and MYND domain containing 5 https://www.infrafrontier.eu/search?keyword=EM:06942 + EM:12334 C57BL/6NTac-Smyd3/Ics EMMA sperm mutant strain Smyd3 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1916976 Smyd3 SET and MYND domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:12334 + EM:08345 C57BL/6NTac-Smurf1/H EMMA sperm mutant strain MGI:4433314 Smurf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923038 Smurf1 SMAD specific E3 ubiquitin protein ligase 1 https://www.infrafrontier.eu/search?keyword=EM:08345 + EM:10069 C57BL/6NTac-Smim6/Ieg EMMA sperm mutant strain MGI:4362996 Smim6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915778 Smim6 small integral membrane protein 6 https://www.infrafrontier.eu/search?keyword=EM:10069 - EM:05341 C57BL/6NTac-Smco4/Cnrm EMMA sperm mutant strain MGI:4433435 Smco4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3039636 Smco4 single-pass membrane protein with coiled-coil domains 4 https://www.infrafrontier.eu/search?keyword=EM:05341 + EM:08248 C57BL/6NTac-Smc6/Ieg EMMA embryo mutant strain MGI:4435686 Smc6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914491 Smc6 structural maintenance of chromosomes 6 https://www.infrafrontier.eu/search?keyword=EM:08248 + EM:05700 C57BL/6NTac-Smarcal1/WtsiIeg EMMA sperm mutant strain MGI:4433467 Smarcal1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859183 Smarcal1 SWI/SNF related matrix associated, actin dependent regulator of chromatin, subfamily a-like 1 https://www.infrafrontier.eu/search?keyword=EM:05700 + EM:09702 C57BL/6NTac-Slu7/WtsiPh EMMA sperm mutant strain MGI:4363740 Slu7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385598 Slu7 SLU7 splicing factor homolog (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:09702 - EM:07309 C57BL/6NTac-Slit1/H EMMA sperm mutant strain MGI:4363887 Slit1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1315203 Slit1 slit guidance ligand 1 https://www.infrafrontier.eu/search?keyword=EM:07309 + EM:08724 C57BL/6NTac-Slc6a20a/Ieg EMMA sperm mutant strain MGI:4362653 Slc6a20a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2143217 Slc6a20a solute carrier family 6 (neurotransmitter transporter), member 20A https://www.infrafrontier.eu/search?keyword=EM:08724 + EM:05389 C57BL/6NTac-Slc5a6/WtsiCnbc EMMA embryo mutant strain MGI:4432225 Slc5a6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2660847 Slc5a6 solute carrier family 5 (sodium-dependent vitamin transporter), member 6 https://www.infrafrontier.eu/search?keyword=EM:05389 + EM:05389 C57BL/6NTac-Slc5a6/WtsiCnbc EMMA sperm mutant strain MGI:4432225 Slc5a6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2660847 Slc5a6 solute carrier family 5 (sodium-dependent vitamin transporter), member 6 https://www.infrafrontier.eu/search?keyword=EM:05389 ? EM:13404 C57BL/6NTac-Slc44a5/WtsiCnrm EMMA live mutant strain MGI:4364041 Slc44a5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3035141 Slc44a5 solute carrier family 44, member 5 https://www.infrafrontier.eu/search?keyword=EM:13404 + EM:08703 C57BL/6NTac-Slc44a3/Ieg EMMA sperm mutant strain MGI:4434043 Slc44a3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384860 Slc44a3 solute carrier family 44, member 3 https://www.infrafrontier.eu/search?keyword=EM:08703 - EM:05285 C57BL/6NTac-Slc39a8/Cnrm EMMA sperm mutant strain MGI:4432011 Slc39a8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914797 Slc39a8 solute carrier family 39 (metal ion transporter), member 8 https://www.infrafrontier.eu/search?keyword=EM:05285 + EM:05442 C57BL/6NTac-Slc35f6/WtsiOulu EMMA embryo mutant strain MGI:4432047 Slc35f6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922169 Slc35f6 solute carrier family 35, member F6 https://www.infrafrontier.eu/search?keyword=EM:05442 ? EM:13411 C57BL/6NTac-Slc35b1/WtsiCnrm EMMA live mutant strain MGI:5306495 Slc35b1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1343133 Slc35b1 solute carrier family 35, member B1 https://www.infrafrontier.eu/search?keyword=EM:13411 - EM:08857 C57BL/6NTac-Slc32a1/WtsiH EMMA sperm mutant strain MGI:5633840 Slc32a1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1194488 Slc32a1 solute carrier family 32 (GABA vesicular transporter), member 1 https://www.infrafrontier.eu/search?keyword=EM:08857 + EM:12363 C57BL/6NTac-Slc28a3/H EMMA sperm mutant strain MGI:6153822 Slc28a3 endonuclease-mediated mutation 1, Harwell MGI:2137361 Slc28a3 solute carrier family 28 (sodium-coupled nucleoside transporter), member 3 https://www.infrafrontier.eu/search?keyword=EM:12363 - EM:09759 C57BL/6NTac-Slc26a5/WtsiH EMMA sperm mutant strain MGI:5633839 Slc26a5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1933154 Slc26a5 solute carrier family 26, member 5 https://www.infrafrontier.eu/search?keyword=EM:09759 - EM:09769 C57BL/6NTac-Slc26a4/WtsiH EMMA sperm mutant strain MGI:5633838 Slc26a4 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1346029 Slc26a4 solute carrier family 26, member 4 https://www.infrafrontier.eu/search?keyword=EM:09769 + EM:06198 C57BL/6NTac-Slc25a43/WtsiCnrm EMMA sperm mutant strain MGI:4431833 Slc25a43 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2684854 Slc25a43 solute carrier family 25, member 43 https://www.infrafrontier.eu/search?keyword=EM:06198 - EM:07667 C57BL/6NTac-Slc25a38/IcsOrl EMMA sperm mutant strain MGI:4431760 Slc25a38 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384782 Slc25a38 solute carrier family 25, member 38 https://www.infrafrontier.eu/search?keyword=EM:07667 ? EM:13330 C57BL/6NTac-Slc23a4/WtsiCnrm EMMA live mutant strain MGI:4363429 Slc23a4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917272 Slc23a4 solute carrier family 23 member 4 https://www.infrafrontier.eu/search?keyword=EM:13330 + EM:10783 C57BL/6NTac-Slc22a17/H EMMA sperm C57BL/6N-Slc22a17/H mutant strain MGI:6144258 Slc22a17 endonuclease mediated mutation 2, Harwell MGI:1926225 Slc22a17 solute carrier family 22 (organic cation transporter), member 17 https://www.infrafrontier.eu/search?keyword=EM:10783 + EM:07119 C57BL/6NTac-Slc20a2/WtsiBiat EMMA sperm mutant strain MGI:4431725 Slc20a2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97851 Slc20a2 solute carrier family 20, member 2 https://www.infrafrontier.eu/search?keyword=EM:07119 + EM:05549 C57BL/6NTac-Slc20a2/Ieg EMMA embryo mutant strain MGI:4431725 Slc20a2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97851 Slc20a2 solute carrier family 20, member 2 https://www.infrafrontier.eu/search?keyword=EM:05549 + EM:07736 C57BL/6NTac-Slc1a7/IcsOrl EMMA sperm mutant strain MGI:4436714 Slc1a7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444087 Slc1a7 solute carrier family 1 (glutamate transporter), member 7 https://www.infrafrontier.eu/search?keyword=EM:07736 ? EM:13390 C57BL/6NTac-Slc1a4/WtsiCnrm EMMA live mutant strain MGI:6256798 Slc1a4 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2135601 Slc1a4 solute carrier family 1 (glutamate/neutral amino acid transporter), member 4 https://www.infrafrontier.eu/search?keyword=EM:13390 + EM:12448 C57BL/6NTac-Slc17a7/H EMMA sperm mutant strain MGI:6153821 Slc17a7 endonuclease-mediated mutation 1, Harwell MGI:1920211 Slc17a7 solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 7 https://www.infrafrontier.eu/search?keyword=EM:12448 + EM:07340 C57BL/6NTac-Slc17a3/H EMMA sperm C57BL/6N-Slc17a3/H mutant strain MGI:4362759 Slc17a3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2389216 Slc17a3 solute carrier family 17 (sodium phosphate), member 3 https://www.infrafrontier.eu/search?keyword=EM:07340 + EM:06972 C57BL/6NTac-Slc16a6/WtsiIeg EMMA sperm mutant strain MGI:4431916 Slc16a6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144585 Slc16a6 solute carrier family 16 (monocarboxylic acid transporters), member 6 https://www.infrafrontier.eu/search?keyword=EM:06972 - EM:07873 C57BL/6NTac-Slc15a3/H EMMA sperm C57BL/6N-Slc15a3/H mutant strain MGI:4363498 Slc15a3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929691 Slc15a3 solute carrier family 15, member 3 https://www.infrafrontier.eu/search?keyword=EM:07873 + EM:11047 C57BL/6NTac-Slc12a9/Ieg EMMA sperm mutant strain MGI:4433292 Slc12a9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933532 Slc12a9 solute carrier family 12 (potassium/chloride transporters), member 9 https://www.infrafrontier.eu/search?keyword=EM:11047 - EM:09549 C57BL/6NTac-Slc12a3/WtsiIeg EMMA sperm mutant strain MGI:5633837 Slc12a3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:108114 Slc12a3 solute carrier family 12, member 3 https://www.infrafrontier.eu/search?keyword=EM:09549 + EM:05857 C57BL/6NTac-Sirt2/H EMMA sperm mutant strain MGI:4431586 Sirt2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927664 Sirt2 sirtuin 2 https://www.infrafrontier.eu/search?keyword=EM:05857 + EM:12466 C57BL/6NTac-Shisa9/H EMMA sperm mutant strain MGI:6257819 Shisa9 endonuclease-mediated mutation 1, Harwell MGI:1919805 Shisa9 shisa family member 9 https://www.infrafrontier.eu/search?keyword=EM:12466 + EM:11647 C57BL/6NTac-Shank3/H EMMA sperm mutant strain MGI:6153882 Shank3 endonuclease-mediated mutation 2, Harwell MGI:1930016 Shank3 SH3 and multiple ankyrin repeat domains 3 https://www.infrafrontier.eu/search?keyword=EM:11647 + EM:04609 C57BL/6NTac-Sgf29/Cnrm EMMA embryo B6Dnk;B6N-Ccdc101/Cnrm, B6Dnk;B6N-Sgf29/Cnrm, B6NDen;B6N-Ccdc101/Cnrm, HEPD0527_4_B10 mutant strain MGI:4434904 Sgf29 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922815 Sgf29 SAGA complex associated factor 29 https://www.infrafrontier.eu/search?keyword=EM:04609 + EM:04609 C57BL/6NTac-Sgf29/Cnrm EMMA sperm B6Dnk;B6N-Ccdc101/Cnrm, B6Dnk;B6N-Sgf29/Cnrm, B6NDen;B6N-Ccdc101/Cnrm, HEPD0527_4_B10 mutant strain MGI:4434904 Sgf29 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922815 Sgf29 SAGA complex associated factor 29 https://www.infrafrontier.eu/search?keyword=EM:04609 - EM:08957 C57BL/6NTac-Sgca/Cnrm EMMA sperm mutant strain MGI:5633836 Sgca targeted mutation 1, Wellcome Trust Sanger Institute MGI:894698 Sgca sarcoglycan, alpha (dystrophin-associated glycoprotein) https://www.infrafrontier.eu/search?keyword=EM:08957 - EM:09559 C57BL/6NTac-Sfrp1/WtsiIeg EMMA sperm mutant strain MGI:5633835 Sfrp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:892014 Sfrp1 secreted frizzled-related protein 1 https://www.infrafrontier.eu/search?keyword=EM:09559 + EM:12390 C57BL/6NTac-Sez6/H EMMA sperm mutant strain MGI:6153819 Sez6 endonuclease-mediated mutation 1, Harwell MGI:104745 Sez6 seizure related gene 6 https://www.infrafrontier.eu/search?keyword=EM:12390 + EM:05302 C57BL/6NTac-Setmar/WtsiCnbc EMMA embryo mutant strain MGI:4432061 Setmar targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921979 Setmar SET domain without mariner transposase fusion https://www.infrafrontier.eu/search?keyword=EM:05302 + EM:11199 C57BL/6NTac-Setd5/WtsiOulu EMMA embryo mutant strain MGI:4432631 Setd5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920145 Setd5 SET domain containing 5 https://www.infrafrontier.eu/search?keyword=EM:11199 + EM:11199 C57BL/6NTac-Setd5/WtsiOulu EMMA sperm mutant strain MGI:4432631 Setd5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920145 Setd5 SET domain containing 5 https://www.infrafrontier.eu/search?keyword=EM:11199 + EM:06857 C57BL/6NTac-Setd1a/WtsiCnrm EMMA sperm mutant strain MGI:4432882 Setd1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446244 Setd1a SET domain containing 1A https://www.infrafrontier.eu/search?keyword=EM:06857 + EM:05719 C57BL/6NTac-Sesn3/WtsiBiat EMMA embryo mutant strain MGI:4432370 Sesn3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922997 Sesn3 sestrin 3 https://www.infrafrontier.eu/search?keyword=EM:05719 + EM:12301 C57BL/6NTac-Serpinc1/Ics EMMA sperm mutant strain Serpinc1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:88095 Serpinc1 serine (or cysteine) peptidase inhibitor, clade C (antithrombin), member 1 https://www.infrafrontier.eu/search?keyword=EM:12301 + EM:09492 C57BL/6NTac-Serpinb12/H EMMA sperm mutant strain MGI:4362859 Serpinb12 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919119 Serpinb12 serine (or cysteine) peptidase inhibitor, clade B (ovalbumin), member 12 https://www.infrafrontier.eu/search?keyword=EM:09492 ? EM:14081 C57BL/6NTac-Serpina3c/WtsiPh EMMA sperm mutant strain MGI:4363850 Serpina3c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102848 Serpina3c serine (or cysteine) peptidase inhibitor, clade A, member 3C https://www.infrafrontier.eu/search?keyword=EM:14081 + EM:08482 C57BL/6NTac-Serinc3/WtsiFlmg EMMA sperm mutant strain MGI:4363849 Serinc3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1349457 Serinc3 serine incorporator 3 https://www.infrafrontier.eu/search?keyword=EM:08482 + EM:10640 C57BL/6NTac-Serf2/H EMMA sperm mutant strain MGI:5771993 Serf2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1337041 Serf2 small EDRK-rich factor 2 https://www.infrafrontier.eu/search?keyword=EM:10640 - EM:07630 C57BL/6NTac-Sept8/IcsOrl EMMA archived C57BL/6NTac-Septin8/IcsOrl mutant strain MGI:4433986 Septin8 targeted mutation 1a, Wellcome Trust Sanger Institute Sep-08 Sep-08 https://www.infrafrontier.eu/search?keyword=EM:07630 + EM:12469 C57BL/6NTac-Senp5/H EMMA sperm mutant strain MGI:6153818 Senp5 endonuclease-mediated mutation 1, Harwell MGI:2443596 Senp5 SUMO/sentrin specific peptidase 5 https://www.infrafrontier.eu/search?keyword=EM:12469 - EM:04003 C57BL/6NTac-Sema5b/Cnrm EMMA sperm mutant strain MGI:4432860 Sema5b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107555 Sema5b sema domain, seven thrombospondin repeats (type 1 and type 1-like), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 5B https://www.infrafrontier.eu/search?keyword=EM:04003 + EM:07987 C57BL/6NTac-Sema4d/H EMMA sperm mutant strain MGI:4433529 Sema4d targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109244 Sema4d sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4D https://www.infrafrontier.eu/search?keyword=EM:07987 - EM:09222 C57BL/6NTac-Sell/Cnrm EMMA sperm mutant strain MGI:5633834 Sell targeted mutation 2, Wellcome Trust Sanger Institute MGI:98279 Sell selectin, lymphocyte https://www.infrafrontier.eu/search?keyword=EM:09222 + EM:06095 C57BL/6NTac-Selenok/WtsiCnbc EMMA sperm C57BL/6NTac-Selk/WtsiCnbc mutant strain MGI:4431818 Selenok targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1931466 Selenok selenoprotein K https://www.infrafrontier.eu/search?keyword=EM:06095 ? EM:13676 C57BL/6NTac-Sec16b/WtsiOrl EMMA sperm mutant strain MGI:4365061 Sec16b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2148802 Sec16b SEC16 homolog B (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:13676 - EM:08973 C57BL/6NTac-Sds/Cnrm EMMA sperm mutant strain MGI:5633833 Sds targeted mutation 1, Wellcome Trust Sanger Institute MGI:98270 Sds serine dehydratase https://www.infrafrontier.eu/search?keyword=EM:08973 + EM:06193 C57BL/6NTac-Sdhc/WtsiCnrm EMMA sperm mutant strain MGI:4433079 Sdhc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913302 Sdhc succinate dehydrogenase complex, subunit C, integral membrane protein https://www.infrafrontier.eu/search?keyword=EM:06193 + EM:06284 C57BL/6NTac-Sdc2/Ieg EMMA embryo mutant strain MGI:4364777 Sdc2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1349165 Sdc2 syndecan 2 https://www.infrafrontier.eu/search?keyword=EM:06284 ? EM:14379 C57BL/6NTac-Sco1/WtsiOulu EMMA embryo mutant strain MGI:4363778 Sco1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106362 Sco1 SCO1 cytochrome c oxidase assembly protein https://www.infrafrontier.eu/search?keyword=EM:14379 ? EM:14379 C57BL/6NTac-Sco1/WtsiOulu EMMA sperm mutant strain MGI:4363778 Sco1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106362 Sco1 SCO1 cytochrome c oxidase assembly protein https://www.infrafrontier.eu/search?keyword=EM:14379 + EM:09694 C57BL/6NTac-Scgb1a1/Cnrm EMMA sperm C57BL/6NTac-Scgb1a1/Cnrm mutant strain MGI:5660121 Scgb1a1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:98919 Scgb1a1 secretoglobin, family 1A, member 1 https://www.infrafrontier.eu/search?keyword=EM:09694 + EM:08110 C57BL/6NTac-Sarnp/Ieg EMMA embryo mutant strain MGI:4434696 Sarnp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913368 Sarnp SAP domain containing ribonucleoprotein https://www.infrafrontier.eu/search?keyword=EM:08110 + EM:05863 C57BL/6NTac-Sar1b/WtsiH EMMA sperm MCSS, EPD0113_3_C11 mutant strain MGI:4432515 Sar1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913647 Sar1b secretion associated Ras related GTPase 1B https://www.infrafrontier.eu/search?keyword=EM:05863 + EM:05978 C57BL/6NTac-Sag/WtsiBiat EMMA sperm mutant strain MGI:4433619 Sag targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98227 Sag S-antigen, retina and pineal gland (arrestin) https://www.infrafrontier.eu/search?keyword=EM:05978 - EM:09768 C57BL/6NTac-S100a4/WtsiH EMMA sperm mutant strain MGI:5633831 S100a4 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1330282 S100a4 S100 calcium binding protein A4 https://www.infrafrontier.eu/search?keyword=EM:09768 + EM:04941 C57BL/6NTac-Rxfp2/Ieg EMMA embryo mutant strain MGI:4433327 Rxfp2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153463 Rxfp2 relaxin/insulin-like family peptide receptor 2 https://www.infrafrontier.eu/search?keyword=EM:04941 + EM:10535 C57BL/6NTac-Rwdd2b/Ics EMMA sperm mutant strain MGI:4433511 Rwdd2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858215 Rwdd2b RWD domain containing 2B https://www.infrafrontier.eu/search?keyword=EM:10535 + EM:07505 C57BL/6NTac-Rwdd1/WtsiOrl EMMA sperm mutant strain MGI:4362724 Rwdd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913771 Rwdd1 RWD domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:07505 + EM:07732 C57BL/6NTac-Ruvbl1/IcsOrl EMMA sperm mutant strain MGI:4432034 Ruvbl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928760 Ruvbl1 RuvB-like protein 1 https://www.infrafrontier.eu/search?keyword=EM:07732 + EM:07402 C57BL/6NTac-Rundc1/WtsiOulu EMMA embryo mutant strain MGI:4441618 Rundc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144506 Rundc1 RUN domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:07402 + EM:07402 C57BL/6NTac-Rundc1/WtsiOulu EMMA sperm mutant strain MGI:4441618 Rundc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144506 Rundc1 RUN domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:07402 + EM:06127 C57BL/6NTac-Rufy2/WtsiBiat EMMA sperm mutant strain MGI:4434385 Rufy2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917682 Rufy2 RUN and FYVE domain-containing 2 https://www.infrafrontier.eu/search?keyword=EM:06127 + EM:05977 C57BL/6NTac-Rtbdn/WtsiBiat EMMA sperm mutant strain MGI:4433926 Rtbdn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443686 Rtbdn retbindin https://www.infrafrontier.eu/search?keyword=EM:05977 + EM:09813 C57BL/6NTac-Rspo4/WtsiPh EMMA sperm mutant strain MGI:4364711 Rspo4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924467 Rspo4 R-spondin 4 https://www.infrafrontier.eu/search?keyword=EM:09813 + EM:10774 C57BL/6NTac-Rras/H EMMA sperm mutant strain MGI:6144259 Rras endonuclease mediated mutation 1, Harwell MGI:98179 Rras related RAS viral (r-ras) oncogene https://www.infrafrontier.eu/search?keyword=EM:10774 + EM:09394 C57BL/6NTac-Rpia/WtsiOrl EMMA sperm mutant strain MGI:4364474 Rpia targeted mutation 1a, Wellcome Trust Sanger Institute MGI:103254 Rpia ribose 5-phosphate isomerase A https://www.infrafrontier.eu/search?keyword=EM:09394 + EM:06273 C57BL/6NTac-Rora/Ieg EMMA embryo mutant strain MGI:4432489 Rora targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104661 Rora RAR-related orphan receptor alpha https://www.infrafrontier.eu/search?keyword=EM:06273 + EM:07377 C57BL/6NTac-Rnf157/WtsiH EMMA sperm mutant strain MGI:4432623 Rnf157 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442484 Rnf157 ring finger protein 157 https://www.infrafrontier.eu/search?keyword=EM:07377 - EM:07699 C57BL/6NTac-Rnf144b/IcsOrl EMMA archived mutant strain MGI:4435770 Rnf144b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384986 Rnf144b ring finger protein 144B https://www.infrafrontier.eu/search?keyword=EM:07699 + EM:11644 C57BL/6NTac-Rnf115/H EMMA sperm mutant strain MGI:6152692 Rnf115 endonuclease mediated mutation 2, Harwell MGI:1915095 Rnf115 ring finger protein 115 https://www.infrafrontier.eu/search?keyword=EM:11644 + EM:11424 C57BL/6NTac-Rnf115/H EMMA sperm mutant strain MGI:6153813 Rnf115 endonuclease-mediated mutation 1, Harwell MGI:1915095 Rnf115 ring finger protein 115 https://www.infrafrontier.eu/search?keyword=EM:11424 + EM:11424 C57BL/6NTac-Rnf115/H EMMA live mutant strain MGI:6153813 Rnf115 endonuclease-mediated mutation 1, Harwell MGI:1915095 Rnf115 ring finger protein 115 https://www.infrafrontier.eu/search?keyword=EM:11424 + EM:08040 C57BL/6NTac-Rnd3/H EMMA sperm mutant strain MGI:4434854 Rnd3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921444 Rnd3 Rho family GTPase 3 https://www.infrafrontier.eu/search?keyword=EM:08040 + EM:08943 C57BL/6NTac-Rnaset2b/H EMMA sperm mutant strain MGI:5497319 Rnaset2b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3702087 Rnaset2b ribonuclease T2B https://www.infrafrontier.eu/search?keyword=EM:08943 + EM:07690 C57BL/6NTac-Rnase10/IcsOrl EMMA sperm mutant strain MGI:4435923 Rnase10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922269 Rnase10 ribonuclease, RNase A family, 10 (non-active) https://www.infrafrontier.eu/search?keyword=EM:07690 + EM:10378 C57BL/6NTac-Rlbp1/Cnrm EMMA embryo mutant strain MGI:5812261 Rlbp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:97930 Rlbp1 retinaldehyde binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:10378 + EM:10378 C57BL/6NTac-Rlbp1/Cnrm EMMA sperm mutant strain MGI:5812261 Rlbp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:97930 Rlbp1 retinaldehyde binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:10378 ? EM:13674 C57BL/6NTac-Rhou/WtsiOrl EMMA sperm mutant strain MGI:4363423 Rhou targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916831 Rhou ras homolog family member U https://www.infrafrontier.eu/search?keyword=EM:13674 + EM:08733 C57BL/6NTac-Rhd/H EMMA sperm mutant strain MGI:4431572 Rhd targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202882 Rhd Rh blood group, D antigen https://www.infrafrontier.eu/search?keyword=EM:08733 + EM:12294 C57BL/6NTac-Rgs14/Ics EMMA sperm mutant strain Rgs14 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1859709 Rgs14 regulator of G-protein signaling 14 https://www.infrafrontier.eu/search?keyword=EM:12294 + EM:10771 C57BL/6NTac-Rgl3/H EMMA sperm C57BL/6N-Rgl3/H mutant strain MGI:6149210 Rgl3 endonuclease mediated mutation 1, Harwell MGI:1918996 Rgl3 ral guanine nucleotide dissociation stimulator-like 3 https://www.infrafrontier.eu/search?keyword=EM:10771 + EM:14645 C57BL/6NTac-Rfwd3/H EMMA sperm unclassified MGI:6791296 Rfwd3 targeted mutation 2, Harwell MGI:2384584 Rfwd3 ring finger and WD repeat domain 3 https://www.infrafrontier.eu/search?keyword=EM:14645 + EM:14646 C57BL/6NTac-Rfwd3/H EMMA sperm unclassified MGI:6791294 Rfwd3 targeted mutation 1, Harwell MGI:2384584 Rfwd3 ring finger and WD repeat domain 3 https://www.infrafrontier.eu/search?keyword=EM:14646 + EM:06286 C57BL/6NTac-Rftn2/WtsiBiat EMMA sperm mutant strain MGI:4433645 Rftn2 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1921263 Rftn2 raftlin family member 2 https://www.infrafrontier.eu/search?keyword=EM:06286 + EM:05438 C57BL/6NTac-Retreg3/WtsiOulu EMMA embryo C57BL/6NTac-Fam134c/WtsiOulu mutant strain MGI:4433416 Retreg3 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1915248 Retreg3 reticulophagy regulator family member 3 https://www.infrafrontier.eu/search?keyword=EM:05438 + EM:05762 C57BL/6NTac-Rest/Ieg EMMA embryo mutant strain MGI:4431796 Rest targeted mutation 2a, Wellcome Trust Sanger Institute MGI:104897 Rest RE1-silencing transcription factor https://www.infrafrontier.eu/search?keyword=EM:05762 + EM:12299 C57BL/6NTac-Ren1/Ics EMMA sperm mutant strain Ren1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97898 Ren1 renin 1 structural https://www.infrafrontier.eu/search?keyword=EM:12299 ? EM:14397 C57BL/6NTac-Rdh16f2/WtsiOulu EMMA embryo mutant strain MGI:4363554 Rdh16f2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3583955 Rdh16f2 RDH16 family member 2 https://www.infrafrontier.eu/search?keyword=EM:14397 ? EM:14397 C57BL/6NTac-Rdh16f2/WtsiOulu EMMA sperm mutant strain MGI:4363554 Rdh16f2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3583955 Rdh16f2 RDH16 family member 2 https://www.infrafrontier.eu/search?keyword=EM:14397 + EM:05885 C57BL/6NTac-Rcor2/WtsiIeg EMMA sperm mutant strain MGI:4431639 Rcor2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859854 Rcor2 REST corepressor 2 https://www.infrafrontier.eu/search?keyword=EM:05885 + EM:05357 C57BL/6NTac-Rc3h2/Ieg EMMA embryo mutant strain MGI:4364357 Rc3h2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442789 Rc3h2 ring finger and CCCH-type zinc finger domains 2 https://www.infrafrontier.eu/search?keyword=EM:05357 + EM:07733 C57BL/6NTac-Rc3h1/IcsOrl EMMA archived mutant strain MGI:4434899 Rc3h1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2685397 Rc3h1 RING CCCH (C3H) domains 1 https://www.infrafrontier.eu/search?keyword=EM:07733 + EM:08806 C57BL/6NTac-Rbpjl/H EMMA sperm mutant strain MGI:4364029 Rbpjl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1196616 Rbpjl recombination signal binding protein for immunoglobulin kappa J region-like https://www.infrafrontier.eu/search?keyword=EM:08806 + EM:12298 C57BL/6NTac-Rbpjl/Ics EMMA sperm mutant strain Rbpjl EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1196616 Rbpjl recombination signal binding protein for immunoglobulin kappa J region-like https://www.infrafrontier.eu/search?keyword=EM:12298 - EM:12527 C57BL/6NTac-Rbpj/H EMMA sperm unclassified MGI:6451740 Rbpj endonuclease-mediated mutation 2, Harwell MGI:96522 Rbpj recombination signal binding protein for immunoglobulin kappa J region https://www.infrafrontier.eu/search?keyword=EM:12527 + EM:07608 C57BL/6NTac-Rbmx/WtsiH EMMA sperm EPD0170_3_E04 mutant strain MGI:4363716 Rbmx targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1343044 Rbmx RNA binding motif protein, X chromosome https://www.infrafrontier.eu/search?keyword=EM:07608 - EM:04571 C57BL/6NTac-Rbm4/Cnrm EMMA embryo mutant strain MGI:4435180 Rbm4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1100865 Rbm4 RNA binding motif protein 4 https://www.infrafrontier.eu/search?keyword=EM:04571 - EM:04571 C57BL/6NTac-Rbm4/Cnrm EMMA sperm mutant strain MGI:4435180 Rbm4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1100865 Rbm4 RNA binding motif protein 4 https://www.infrafrontier.eu/search?keyword=EM:04571 + EM:09370 C57BL/6NTac-Rbl1/Ieg EMMA sperm mutant strain MGI:5497361 Rbl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103300 Rbl1 RB transcriptional corepressor like 1 https://www.infrafrontier.eu/search?keyword=EM:09370 + EM:12292 C57BL/6NTac-Rbfox3/Ics EMMA sperm mutant strain Rbfox3 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:106368 Rbfox3 RNA binding protein, fox-1 homolog (C. elegans) 3 https://www.infrafrontier.eu/search?keyword=EM:12292 + EM:08887 C57BL/6NTac-Rbak/WtsiIeg EMMA sperm mutant strain MGI:4364920 Rbak targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927369 Rbak RB-associated KRAB zinc finger https://www.infrafrontier.eu/search?keyword=EM:08887 + EM:05886 C57BL/6NTac-Rars/WtsiIeg EMMA sperm mutant strain MGI:4432394 Rars targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914297 Rars arginyl-tRNA synthetase https://www.infrafrontier.eu/search?keyword=EM:05886 + EM:11400 C57BL/6NTac-Rapgef5/H EMMA sperm mutant strain MGI:6153844 Rapgef5 endonuclease mediated mutation 1, Harwell MGI:2444365 Rapgef5 Rap guanine nucleotide exchange factor (GEF) 5 https://www.infrafrontier.eu/search?keyword=EM:11400 + EM:11400 C57BL/6NTac-Rapgef5/H EMMA live mutant strain MGI:6153844 Rapgef5 endonuclease mediated mutation 1, Harwell MGI:2444365 Rapgef5 Rap guanine nucleotide exchange factor (GEF) 5 https://www.infrafrontier.eu/search?keyword=EM:11400 + EM:06643 C57BL/6NTac-Ralgapb/Wtsi EMMA archived mutant strain MGI:4363602 Ralgapb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444531 Ralgapb Ral GTPase activating protein, beta subunit (non-catalytic) https://www.infrafrontier.eu/search?keyword=EM:06643 + EM:06781 C57BL/6NTac-Ralb/WtsiH EMMA sperm mutant strain MGI:4433898 Ralb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927244 Ralb v-ral simian leukemia viral oncogene B https://www.infrafrontier.eu/search?keyword=EM:06781 + EM:07652 C57BL/6NTac-Raf1/IcsOrl EMMA archived mutant strain MGI:4433410 Raf1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97847 Raf1 v-raf-leukemia viral oncogene 1 https://www.infrafrontier.eu/search?keyword=EM:07652 + EM:07127 C57BL/6NTac-Rab5c/WtsiOulu EMMA embryo mutant strain MGI:4432624 Rab5c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105306 Rab5c RAB5C, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:07127 + EM:07127 C57BL/6NTac-Rab5c/WtsiOulu EMMA sperm mutant strain MGI:4432624 Rab5c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105306 Rab5c RAB5C, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:07127 + EM:06276 C57BL/6NTac-Rab35/Ieg EMMA embryo mutant strain MGI:4436336 Rab35 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924657 Rab35 RAB35, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:06276 + EM:06612 C57BL/6NTac-Rab15/Wtsi EMMA archived mutant strain MGI:4363640 Rab15 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916865 Rab15 RAB15, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:06612 - EM:08970 C57BL/6NTac-Pyy/Cnrm EMMA sperm mutant strain MGI:5633829 Pyy targeted mutation 1, Wellcome Trust Sanger Institute MGI:99924 Pyy peptide YY https://www.infrafrontier.eu/search?keyword=EM:08970 + EM:09612 C57BL/6NTac-Pus10/WtsiOulu EMMA embryo mutant strain MGI:4434872 Pus10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921717 Pus10 pseudouridylate synthase 10 https://www.infrafrontier.eu/search?keyword=EM:09612 + EM:09612 C57BL/6NTac-Pus10/WtsiOulu EMMA sperm mutant strain MGI:4434872 Pus10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921717 Pus10 pseudouridylate synthase 10 https://www.infrafrontier.eu/search?keyword=EM:09612 + EM:11426 C57BL/6NTac-Pttg1ip/H EMMA sperm mutant strain MGI:6149209 Pttg1ip endonuclease mediated mutation 1, Harwell MGI:2652132 Pttg1ip pituitary tumor-transforming 1 interacting protein https://www.infrafrontier.eu/search?keyword=EM:11426 - EM:08858 C57BL/6NTac-Ptprcap/WtsiH EMMA sperm mutant strain MGI:5633828 Ptprcap targeted mutation 1, Wellcome Trust Sanger Institute MGI:97811 Ptprcap protein tyrosine phosphatase, receptor type, C polypeptide-associated protein https://www.infrafrontier.eu/search?keyword=EM:08858 - EM:06017 C57BL/6NTac-Ptpn22/Cnrm EMMA sperm mutant strain Ptpn22 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:107170 Ptpn22 protein tyrosine phosphatase, non-receptor type 22 (lymphoid) https://www.infrafrontier.eu/search?keyword=EM:06017 - EM:06015 C57BL/6NTac-Ptpn22/Cnrm EMMA sperm mutant strain Ptpn22 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:107170 Ptpn22 protein tyrosine phosphatase, non-receptor type 22 (lymphoid) https://www.infrafrontier.eu/search?keyword=EM:06015 + EM:12319 C57BL/6NTac-Pth/Ics EMMA sperm mutant strain Pth EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97799 Pth parathyroid hormone https://www.infrafrontier.eu/search?keyword=EM:12319 + EM:10858 C57BL/6NTac-Ptgr1/WtsiOulu EMMA embryo mutant strain MGI:4432266 Ptgr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914353 Ptgr1 prostaglandin reductase 1 https://www.infrafrontier.eu/search?keyword=EM:10858 + EM:10858 C57BL/6NTac-Ptgr1/WtsiOulu EMMA sperm mutant strain MGI:4432266 Ptgr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914353 Ptgr1 prostaglandin reductase 1 https://www.infrafrontier.eu/search?keyword=EM:10858 + EM:07687 C57BL/6NTac-Ptdss1/IcsOrl EMMA sperm mutant strain MGI:4434934 Ptdss1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1276575 Ptdss1 phosphatidylserine synthase 1 https://www.infrafrontier.eu/search?keyword=EM:07687 + EM:10546 C57BL/6NTac-Ptch1/IcsOrl EMMA sperm mutant strain MGI:4435107 Ptch1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:105373 Ptch1 patched 1 https://www.infrafrontier.eu/search?keyword=EM:10546 - EM:13030 C57BL/6NTac-Prune1/H EMMA sperm unclassified MGI:6451737 Prune1 endonuclease-mediated mutation 1, Harwell MGI:1925152 Prune1 prune exopolyphosphatase https://www.infrafrontier.eu/search?keyword=EM:13030 + EM:07638 C57BL/6NTac-Prpsap2/IcsOrl EMMA sperm mutant strain MGI:4432556 Prpsap2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384838 Prpsap2 phosphoribosyl pyrophosphate synthetase-associated protein 2 https://www.infrafrontier.eu/search?keyword=EM:07638 + EM:12331 C57BL/6NTac-Proc/Ics EMMA sperm mutant strain Proc EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97771 Proc protein C https://www.infrafrontier.eu/search?keyword=EM:12331 + EM:05699 C57BL/6NTac-Prmt2/WtsiIeg EMMA sperm mutant strain MGI:4433170 Prmt2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1316652 Prmt2 protein arginine N-methyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:05699 + EM:05070 C57BL/6NTac-Prmt1/H EMMA sperm mutant strain MGI:4432476 Prmt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107846 Prmt1 protein arginine N-methyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:05070 ? EM:13978 C57BL/6NTac-Prkab1/WtsiPh EMMA sperm mutant strain MGI:4362414 Prkab1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1336167 Prkab1 protein kinase, AMP-activated, beta 1 non-catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:13978 + EM:13023 C57BL/6NTac-Prdm8/H EMMA sperm unclassified MGI:6451733 Prdm8 endonuclease-mediated mutation 1, Harwell MGI:1924880 Prdm8 PR domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:13023 + EM:08951 C57BL/6NTac-Prdm16/WtsiH EMMA sperm mutant strain MGI:5633825 Prdm16 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1917923 Prdm16 PR domain containing 16 https://www.infrafrontier.eu/search?keyword=EM:08951 - EM:08850 C57BL/6NTac-Prdm16/WtsiH EMMA sperm mutant strain MGI:5633826 Prdm16 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1917923 Prdm16 PR domain containing 16 https://www.infrafrontier.eu/search?keyword=EM:08850 - EM:07644 C57BL/6NTac-Prdm10/IcsOrl EMMA sperm mutant strain MGI:4434635 Prdm10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2682952 Prdm10 PR domain containing 10 https://www.infrafrontier.eu/search?keyword=EM:07644 + EM:10164 C57BL/6NTac-Ppy/Ieg EMMA embryo mutant strain MGI:4362546 Ppy targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97753 Ppy pancreatic polypeptide https://www.infrafrontier.eu/search?keyword=EM:10164 - EM:07711 C57BL/6NTac-Ppp6c/IcsOrl EMMA archived mutant strain MGI:4435995 Ppp6c targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915107 Ppp6c protein phosphatase 6, catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:07711 + EM:09648 C57BL/6NTac-Ppp3cc/H EMMA sperm mutant strain MGI:4434809 Ppp3cc targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107162 Ppp3cc protein phosphatase 3, catalytic subunit, gamma isoform https://www.infrafrontier.eu/search?keyword=EM:09648 + EM:05704 C57BL/6NTac-Ppp3ca/WtsiBiat EMMA embryo mutant strain MGI:4432193 Ppp3ca targeted mutation 2e, Wellcome Trust Sanger Institute MGI:107164 Ppp3ca protein phosphatase 3, catalytic subunit, alpha isoform https://www.infrafrontier.eu/search?keyword=EM:05704 ? EM:14001 C57BL/6NTac-Ppp2r2b/WtsiOulu EMMA embryo mutant strain MGI:4364039 Ppp2r2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920180 Ppp2r2b protein phosphatase 2, regulatory subunit B, beta https://www.infrafrontier.eu/search?keyword=EM:14001 ? EM:14001 C57BL/6NTac-Ppp2r2b/WtsiOulu EMMA sperm mutant strain MGI:4364039 Ppp2r2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920180 Ppp2r2b protein phosphatase 2, regulatory subunit B, beta https://www.infrafrontier.eu/search?keyword=EM:14001 + EM:12305 C57BL/6NTac-Pou2f1/Ics EMMA sperm mutant strain Pou2f1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:101898 Pou2f1 POU domain, class 2, transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:12305 + EM:11880 C57BL/6NTac-Polr2f/WtsiH EMMA sperm mutant strain Polr2f EUCOMM targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1349393 Polr2f polymerase (RNA) II (DNA directed) polypeptide F https://www.infrafrontier.eu/search?keyword=EM:11880 - EM:08987 C57BL/6NTac-Polr2f/Cnrm EMMA sperm mutant strain MGI:5633824 Polr2f targeted mutation 1, Wellcome Trust Sanger Institute MGI:1349393 Polr2f polymerase (RNA) II (DNA directed) polypeptide F https://www.infrafrontier.eu/search?keyword=EM:08987 + EM:05889 C57BL/6NTac-Polg2/WtsiIeg EMMA sperm mutant strain MGI:4432134 Polg2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354947 Polg2 polymerase (DNA directed), gamma 2, accessory subunit https://www.infrafrontier.eu/search?keyword=EM:05889 + EM:11433 C57BL/6NTac-Podxl/H EMMA sperm mutant strain MGI:6153807 Podxl endonuclease-mediated mutation 1, Harwell MGI:1351317 Podxl podocalyxin-like https://www.infrafrontier.eu/search?keyword=EM:11433 + EM:11433 C57BL/6NTac-Podxl/H EMMA live mutant strain MGI:6153807 Podxl endonuclease-mediated mutation 1, Harwell MGI:1351317 Podxl podocalyxin-like https://www.infrafrontier.eu/search?keyword=EM:11433 + EM:12144 C57BL/6NTac-Pnpo/Wtsi EMMA archived mutant strain MGI:4363478 Pnpo targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144151 Pnpo pyridoxine 5'-phosphate oxidase https://www.infrafrontier.eu/search?keyword=EM:12144 + EM:05892 C57BL/6NTac-Plxnb2/WtsiIeg EMMA sperm mutant strain MGI:4433461 Plxnb2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2154239 Plxnb2 plexin B2 https://www.infrafrontier.eu/search?keyword=EM:05892 + EM:04074 C57BL/6NTac-Plxnb2/Ieg EMMA embryo EPD0051_2_D09 mutant strain MGI:4433461 Plxnb2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2154239 Plxnb2 plexin B2 https://www.infrafrontier.eu/search?keyword=EM:04074 + EM:08483 C57BL/6NTac-Plscr2/WtsiFlmg EMMA sperm mutant strain MGI:4363158 Plscr2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1270860 Plscr2 phospholipid scramblase 2 https://www.infrafrontier.eu/search?keyword=EM:08483 + EM:07824 C57BL/6NTac-Plscr1/IcsOrl EMMA archived mutant strain MGI:4435862 Plscr1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:893575 Plscr1 phospholipid scramblase 1 https://www.infrafrontier.eu/search?keyword=EM:07824 - EM:10506 C57BL/6NTac-Plpp1/IcsOrl EMMA archived C57BL/6N-Ppap2a/IcsOrl, C57BL/6NTac-Plpp1/IcsOrl, HEPD0531_4_G04 mutant strain MGI:4435089 Plpp1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:108412 Plpp1 phospholipid phosphatase 1 https://www.infrafrontier.eu/search?keyword=EM:10506 + EM:05522 C57BL/6NTac-Plin2/WtsiOulu EMMA embryo mutant strain MGI:4432810 Plin2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:87920 Plin2 perilipin 2 https://www.infrafrontier.eu/search?keyword=EM:05522 + EM:12313 C57BL/6NTac-Plin1/Ics EMMA sperm mutant strain Plin1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1890505 Plin1 perilipin 1 https://www.infrafrontier.eu/search?keyword=EM:12313 + EM:05894 C57BL/6NTac-Plekhg1/WtsiIeg EMMA sperm mutant strain MGI:4431598 Plekhg1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2676551 Plekhg1 pleckstrin homology domain containing, family G (with RhoGef domain) member 1 https://www.infrafrontier.eu/search?keyword=EM:05894 + EM:10759 C57BL/6NTac-Plcz1/H EMMA sperm mutant strain MGI:5749950 Plcz1 endonuclease-mediate mutation 1, Harwell MGI:2150308 Plcz1 phospholipase C, zeta 1 https://www.infrafrontier.eu/search?keyword=EM:10759 + EM:11642 C57BL/6NTac-Plaur/H EMMA sperm mutant strain MGI:6152691 Plaur endonuclease mediated mutation 2, Harwell MGI:97612 Plaur plasminogen activator, urokinase receptor https://www.infrafrontier.eu/search?keyword=EM:11642 + EM:11723 C57BL/6NTac-Plaur/H EMMA live mutant strain MGI:6149208 Plaur endonuclease mediated mutation 1, Harwell MGI:97612 Plaur plasminogen activator, urokinase receptor https://www.infrafrontier.eu/search?keyword=EM:11723 + EM:14640 C57BL/6NTac-Pla2g6/H EMMA sperm unclassified MGI:6741080 Pla2g6 endonuclease-mediated mutation 2, Harwell MGI:1859152 Pla2g6 phospholipase A2, group VI https://www.infrafrontier.eu/search?keyword=EM:14640 + EM:14639 C57BL/6NTac-Pla2g6/H EMMA sperm unclassified MGI:6741078 Pla2g6 endonuclease-mediated mutation 1, Harwell MGI:1859152 Pla2g6 phospholipase A2, group VI https://www.infrafrontier.eu/search?keyword=EM:14639 - EM:07628 C57BL/6NTac-Pla2g4f/IcsOrl EMMA archived mutant strain MGI:4435081 Pla2g4f targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2685493 Pla2g4f phospholipase A2, group IVF https://www.infrafrontier.eu/search?keyword=EM:07628 + EM:07196 C57BL/6NTac-Pla2g2c/WtsiH EMMA sperm MFDP, EPD0201_1_F03 mutant strain MGI:4455976 Pla2g2c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106638 Pla2g2c phospholipase A2, group IIC https://www.infrafrontier.eu/search?keyword=EM:07196 - EM:07366 C57BL/6NTac-Pkn1/H EMMA sperm C57BL/6N-Pkn1/H mutant strain MGI:4365010 Pkn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108022 Pkn1 protein kinase N1 https://www.infrafrontier.eu/search?keyword=EM:07366 - EM:11428 C57BL/6NTac-Pkhd1l1/H EMMA sperm mutant strain MGI:6149161 Pkhd1l1 endonuclease mediated mutation 1, Harwell MGI:2183153 Pkhd1l1 polycystic kidney and hepatic disease 1-like 1 https://www.infrafrontier.eu/search?keyword=EM:11428 + EM:12336 C57BL/6NTac-Pkd2l1/Ics EMMA sperm mutant strain Pkd2l1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1352448 Pkd2l1 polycystic kidney disease 2-like 1 https://www.infrafrontier.eu/search?keyword=EM:12336 - EM:06135 C57BL/6NTac-Pkd1l2/H EMMA sperm C57BL/6N-Pkd1l2/H mutant strain MGI:4455437 Pkd1l2 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:2664668 Pkd1l2 polycystic kidney disease 1 like 2 https://www.infrafrontier.eu/search?keyword=EM:06135 + EM:09774 C57BL/6NTac-Pkd1l2/WtsiH EMMA sperm C57BL/6NTac-Pkd1l2/WtsiH mutant strain MGI:5660024 Pkd1l2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2664668 Pkd1l2 polycystic kidney disease 1 like 2 https://www.infrafrontier.eu/search?keyword=EM:09774 + EM:05526 C57BL/6NTac-Pik3cb/WtsiOulu EMMA embryo mutant strain MGI:4434375 Pik3cb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922019 Pik3cb phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit beta https://www.infrafrontier.eu/search?keyword=EM:05526 + EM:07688 C57BL/6NTac-Pik3c3/IcsOrl EMMA sperm mutant strain MGI:4433098 Pik3c3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2445019 Pik3c3 phosphatidylinositol 3-kinase catalytic subunit type 3 https://www.infrafrontier.eu/search?keyword=EM:07688 + EM:07662 C57BL/6NTac-Pigu/IcsOrl EMMA sperm mutant strain MGI:4435661 Pigu targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3039607 Pigu phosphatidylinositol glycan anchor biosynthesis, class U https://www.infrafrontier.eu/search?keyword=EM:07662 + EM:09652 C57BL/6NTac-Pias3/Cnrm EMMA sperm C57BL/6NTac-Pias3/Cnrm mutant strain MGI:5660021 Pias3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1913126 Pias3 protein inhibitor of activated STAT 3 https://www.infrafrontier.eu/search?keyword=EM:09652 + EM:07722 C57BL/6NTac-Phykpl/IcsOrl EMMA embryo mutant strain MGI:4431628 Phykpl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920197 Phykpl 5-phosphohydroxy-L-lysine phospholyase https://www.infrafrontier.eu/search?keyword=EM:07722 + EM:07722 C57BL/6NTac-Phykpl/IcsOrl EMMA sperm mutant strain MGI:4431628 Phykpl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920197 Phykpl 5-phosphohydroxy-L-lysine phospholyase https://www.infrafrontier.eu/search?keyword=EM:07722 + EM:11416 C57BL/6NTac-Phldb2/H EMMA live mutant strain MGI:6149207 Phldb2 endonuclease mediated mutation 1, Harwell MGI:2444981 Phldb2 pleckstrin homology like domain, family B, member 2 https://www.infrafrontier.eu/search?keyword=EM:11416 + EM:05800 C57BL/6NTac-Phf6/Ics EMMA sperm mutant strain MGI:4432234 Phf6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918248 Phf6 PHD finger protein 6 https://www.infrafrontier.eu/search?keyword=EM:05800 - EM:09732 C57BL/6NTac-Phex/WtsiH EMMA sperm mutant strain MGI:5633823 Phex targeted mutation 1, Wellcome Trust Sanger Institute MGI:107489 Phex phosphate regulating endopeptidase homolog, X-linked https://www.infrafrontier.eu/search?keyword=EM:09732 + EM:09258 C57BL/6NTac-Pgam5/IcsOrl EMMA sperm mutant strain MGI:4432458 Pgam5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919792 Pgam5 phosphoglycerate mutase family member 5 https://www.infrafrontier.eu/search?keyword=EM:09258 - EM:07599 C57BL/6NTac-Pfkfb4/WtsiCnrm EMMA sperm mutant strain MGI:4362852 Pfkfb4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2687284 Pfkfb4 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 4 https://www.infrafrontier.eu/search?keyword=EM:07599 + EM:05793 C57BL/6NTac-Pex3/WtsiOrl EMMA sperm mutant strain MGI:4431895 Pex3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929646 Pex3 peroxisomal biogenesis factor 3 https://www.infrafrontier.eu/search?keyword=EM:05793 + EM:07735 C57BL/6NTac-Pex16/IcsOrl EMMA sperm mutant strain MGI:4434961 Pex16 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1338829 Pex16 peroxisomal biogenesis factor 16 https://www.infrafrontier.eu/search?keyword=EM:07735 + EM:08734 C57BL/6NTac-Pex10/H EMMA sperm mutant strain MGI:4432787 Pex10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2684988 Pex10 peroxisomal biogenesis factor 10 https://www.infrafrontier.eu/search?keyword=EM:08734 + EM:08458 C57BL/6NTac-Pef1/Ieg EMMA sperm mutant strain MGI:4434599 Pef1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915148 Pef1 penta-EF hand domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:08458 - EM:04556 C57BL/6NTac-Pebp4/Cnrm EMMA embryo mutant strain MGI:4436202 Pebp4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920773 Pebp4 phosphatidylethanolamine binding protein 4 https://www.infrafrontier.eu/search?keyword=EM:04556 - EM:04556 C57BL/6NTac-Pebp4/Cnrm EMMA sperm mutant strain MGI:4436202 Pebp4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920773 Pebp4 phosphatidylethanolamine binding protein 4 https://www.infrafrontier.eu/search?keyword=EM:04556 + EM:07386 C57BL/6NTac-Pear1/WtsiH EMMA sperm mutant strain MGI:4363617 Pear1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920432 Pear1 platelet endothelial aggregation receptor 1 https://www.infrafrontier.eu/search?keyword=EM:07386 + EM:10187 C57BL/6NTac-Pdzk1/WtsiCnrm EMMA sperm mutant strain MGI:5497391 Pdzk1 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1928901 Pdzk1 PDZ domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:10187 + EM:10350 C57BL/6NTac-Pdzd8/WtsiBiat EMMA sperm mutant strain MGI:4431887 Pdzd8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2677270 Pdzd8 PDZ domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:10350 + EM:06275 C57BL/6NTac-Pdia6/Ieg EMMA sperm mutant strain MGI:4435366 Pdia6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1919103 Pdia6 protein disulfide isomerase associated 6 https://www.infrafrontier.eu/search?keyword=EM:06275 + EM:09479 C57BL/6NTac-Pdhx/Ieg EMMA sperm mutant strain MGI:4435592 Pdhx targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1351627 Pdhx pyruvate dehydrogenase complex, component X https://www.infrafrontier.eu/search?keyword=EM:09479 + EM:12306 C57BL/6NTac-Pdgfrb/Ics EMMA sperm mutant strain Pdgfrb EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97531 Pdgfrb platelet derived growth factor receptor, beta polypeptide https://www.infrafrontier.eu/search?keyword=EM:12306 + EM:12318 C57BL/6NTac-Pdgfb/Ics EMMA sperm mutant strain Pdgfb EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97528 Pdgfb platelet derived growth factor, B polypeptide https://www.infrafrontier.eu/search?keyword=EM:12318 + EM:12326 C57BL/6NTac-Pde6c/Ics EMMA sperm mutant strain Pde6c EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:105956 Pde6c phosphodiesterase 6C, cGMP specific, cone, alpha prime https://www.infrafrontier.eu/search?keyword=EM:12326 - EM:13018 C57BL/6NTac-Pde2a/H EMMA sperm unclassified MGI:6451729 Pde2a endonuclease-mediated mutation 3, Harwell MGI:2446107 Pde2a phosphodiesterase 2A, cGMP-stimulated https://www.infrafrontier.eu/search?keyword=EM:13018 + EM:10090 C57BL/6NTac-Pde1b/WtsiIeg EMMA sperm mutant strain MGI:5633822 Pde1b targeted mutation 1, Wellcome Trust Sanger Institute MGI:97523 Pde1b phosphodiesterase 1B, Ca2+-calmodulin dependent https://www.infrafrontier.eu/search?keyword=EM:10090 + EM:06279 C57BL/6NTac-Pcx/Ieg EMMA sperm mutant strain MGI:4432994 Pcx targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97520 Pcx pyruvate carboxylase https://www.infrafrontier.eu/search?keyword=EM:06279 + EM:06114 C57BL/6NTac-Pcx/Cnrm EMMA sperm mutant strain MGI:4432994 Pcx targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97520 Pcx pyruvate carboxylase https://www.infrafrontier.eu/search?keyword=EM:06114 - EM:09772 C57BL/6NTac-Pbx3/WtsiH EMMA sperm mutant strain MGI:5633821 Pbx3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:97496 Pbx3 pre B cell leukemia homeobox 3 https://www.infrafrontier.eu/search?keyword=EM:09772 - EM:08967 C57BL/6NTac-Pbx2/Cnrm EMMA sperm mutant strain MGI:5633820 Pbx2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1341793 Pbx2 pre B cell leukemia homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:08967 + EM:08409 C57BL/6NTac-Pbrm1/Ieg EMMA embryo mutant strain MGI:4432389 Pbrm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923998 Pbrm1 polybromo 1 https://www.infrafrontier.eu/search?keyword=EM:08409 + EM:10075 C57BL/6NTac-Pax5/Ieg EMMA sperm mutant strain MGI:4433183 Pax5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97489 Pax5 paired box 5 https://www.infrafrontier.eu/search?keyword=EM:10075 + EM:13020 C57BL/6NTac-Pax2/H EMMA sperm unclassified MGI:6156350 Pax2 endonuclease mediated mutation 1, Harwell MGI:97486 Pax2 paired box 2 https://www.infrafrontier.eu/search?keyword=EM:13020 + EM:07706 C57BL/6NTac-Patl2/IcsOrl EMMA sperm mutant strain MGI:4435914 Patl2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914828 Patl2 protein associated with topoisomerase II homolog 2 (yeast) https://www.infrafrontier.eu/search?keyword=EM:07706 - EM:04410 C57BL/6NTac-Parvb/Cnrm EMMA embryo mutant strain MGI:4431642 Parvb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153063 Parvb parvin, beta https://www.infrafrontier.eu/search?keyword=EM:04410 - EM:04410 C57BL/6NTac-Parvb/Cnrm EMMA sperm mutant strain MGI:4431642 Parvb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153063 Parvb parvin, beta https://www.infrafrontier.eu/search?keyword=EM:04410 + EM:04692 C57BL/6NTac-Parl/H EMMA sperm HEPD0513_3_B04 mutant strain MGI:4435986 Parl targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1277152 Parl presenilin associated, rhomboid-like https://www.infrafrontier.eu/search?keyword=EM:04692 - EM:04600 C57BL/6NTac-Palm3/Cnrm EMMA embryo mutant strain MGI:4434121 Palm3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921587 Palm3 paralemmin 3 https://www.infrafrontier.eu/search?keyword=EM:04600 - EM:04600 C57BL/6NTac-Palm3/Cnrm EMMA sperm mutant strain MGI:4434121 Palm3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921587 Palm3 paralemmin 3 https://www.infrafrontier.eu/search?keyword=EM:04600 + EM:07655 C57BL/6NTac-Pacs2/IcsOrl EMMA sperm mutant strain MGI:4435377 Pacs2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924399 Pacs2 phosphofurin acidic cluster sorting protein 2 https://www.infrafrontier.eu/search?keyword=EM:07655 + EM:12030 C57BL/6NTac-Pabpc4/Wtsi EMMA embryo mutant strain MGI:4364130 Pabpc4 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2385206 Pabpc4 poly(A) binding protein, cytoplasmic 4 https://www.infrafrontier.eu/search?keyword=EM:12030 ? EM:13999 C57BL/6NTac-Pabpc4/WtsiOulu EMMA embryo mutant strain MGI:4364054 Pabpc4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385206 Pabpc4 poly(A) binding protein, cytoplasmic 4 https://www.infrafrontier.eu/search?keyword=EM:13999 ? EM:13999 C57BL/6NTac-Pabpc4/WtsiOulu EMMA sperm mutant strain MGI:4364054 Pabpc4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385206 Pabpc4 poly(A) binding protein, cytoplasmic 4 https://www.infrafrontier.eu/search?keyword=EM:13999 + EM:10766 C57BL/6NTac-P2ry14/H EMMA sperm P2RY14-DEL1176-EM1-B6N, C57BL/6NTac-P2ry14/H mutant strain MGI:5749947 P2ry14 endonuclease-mediated mutation 1, Harwell MGI:2155705 P2ry14 purinergic receptor P2Y, G-protein coupled, 14 https://www.infrafrontier.eu/search?keyword=EM:10766 + EM:12304 C57BL/6NTac-P2rx7/Ics EMMA sperm mutant strain P2rx7 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1339957 P2rx7 purinergic receptor P2X, ligand-gated ion channel, 7 https://www.infrafrontier.eu/search?keyword=EM:12304 + EM:12317 C57BL/6NTac-Ovgp1/Ics EMMA sperm mutant strain Ovgp1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:106661 Ovgp1 oviductal glycoprotein 1 https://www.infrafrontier.eu/search?keyword=EM:12317 + EM:07803 C57BL/6NTac-Ovgp1/H EMMA sperm C57BL/6N-Ovgp1/H mutant strain MGI:4362777 Ovgp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106661 Ovgp1 oviductal glycoprotein 1 https://www.infrafrontier.eu/search?keyword=EM:07803 + EM:06780 C57BL/6NTac-Otub2/WtsiH EMMA sperm MCWA, EPD0157_3_B05 mutant strain MGI:4433067 Otub2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915399 Otub2 OTU domain, ubiquitin aldehyde binding 2 https://www.infrafrontier.eu/search?keyword=EM:06780 + EM:07674 C57BL/6NTac-Otop3/IcsOrl EMMA sperm mutant strain MGI:4431640 Otop3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916852 Otop3 otopetrin 3 https://www.infrafrontier.eu/search?keyword=EM:07674 + EM:11419 C57BL/6NTac-Otop2/H EMMA sperm mutant strain MGI:6152690 Otop2 endonuclease mediated mutation 2, Harwell MGI:2388365 Otop2 otopetrin 2 https://www.infrafrontier.eu/search?keyword=EM:11419 + EM:11423 C57BL/6NTac-Otop2/H EMMA live mutant strain MGI:6149206 Otop2 endonuclease mediated mutation 1, Harwell MGI:2388365 Otop2 otopetrin 2 https://www.infrafrontier.eu/search?keyword=EM:11423 + EM:07634 C57BL/6NTac-Orc4/IcsOrl EMMA sperm mutant strain MGI:4433141 Orc4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1347043 Orc4 origin recognition complex, subunit 4 https://www.infrafrontier.eu/search?keyword=EM:07634 + EM:05525 C57BL/6NTac-Optn/WtsiOulu EMMA embryo mutant strain MGI:4432769 Optn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918898 Optn optineurin https://www.infrafrontier.eu/search?keyword=EM:05525 + EM:05346 C57BL/6NTac-Optn/Ieg EMMA embryo mutant strain MGI:4432769 Optn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918898 Optn optineurin https://www.infrafrontier.eu/search?keyword=EM:05346 - EM:07315 C57BL/6NTac-Oplah/Ieg EMMA embryo mutant strain MGI:4363400 Oplah targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922725 Oplah 5-oxoprolinase (ATP-hydrolysing) https://www.infrafrontier.eu/search?keyword=EM:07315 - EM:09777 C57BL/6NTac-Olfm1/WtsiH EMMA sperm mutant strain MGI:5633819 Olfm1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1860437 Olfm1 olfactomedin 1 https://www.infrafrontier.eu/search?keyword=EM:09777 + EM:05388 C57BL/6NTac-Oasl2/WtsiCnbc EMMA embryo mutant strain MGI:4431962 Oasl2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1344390 Oasl2 2'-5' oligoadenylate synthetase-like 2 https://www.infrafrontier.eu/search?keyword=EM:05388 + EM:05388 C57BL/6NTac-Oasl2/WtsiCnbc EMMA sperm mutant strain MGI:4431962 Oasl2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1344390 Oasl2 2'-5' oligoadenylate synthetase-like 2 https://www.infrafrontier.eu/search?keyword=EM:05388 + EM:05537 C57BL/6NTac-Nxn/Ieg EMMA embryo mutant strain MGI:4432925 Nxn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109331 Nxn nucleoredoxin https://www.infrafrontier.eu/search?keyword=EM:05537 ? EM:14043 C57BL/6NTac-Nutm1/WtsiOulu EMMA embryo mutant strain MGI:4363742 Nutm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2661384 Nutm1 NUT midline carcinoma, family member 1 https://www.infrafrontier.eu/search?keyword=EM:14043 ? EM:14043 C57BL/6NTac-Nutm1/WtsiOulu EMMA sperm mutant strain MGI:4363742 Nutm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2661384 Nutm1 NUT midline carcinoma, family member 1 https://www.infrafrontier.eu/search?keyword=EM:14043 ? EM:14076 C57BL/6NTac-Nubpl/WtsiPh EMMA sperm mutant strain MGI:4363128 Nubpl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924076 Nubpl nucleotide binding protein-like https://www.infrafrontier.eu/search?keyword=EM:14076 + EM:11733 C57BL/6NTac-Nrxn2/H EMMA live mutant strain MGI:6149205 Nrxn2 endonuclease mediated mutation 1, Harwell MGI:1096362 Nrxn2 neurexin II https://www.infrafrontier.eu/search?keyword=EM:11733 + EM:11124 C57BL/6NTac-Nrg4/WtsiH EMMA sperm mutant strain MGI:5633817 Nrg4 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1933833 Nrg4 neuregulin 4 https://www.infrafrontier.eu/search?keyword=EM:11124 + EM:10083 C57BL/6NTac-Nr5a1/WtsiIeg EMMA sperm mutant strain MGI:5633816 Nr5a1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1346833 Nr5a1 nuclear receptor subfamily 5, group A, member 1 https://www.infrafrontier.eu/search?keyword=EM:10083 + EM:10788 C57BL/6NTac-Nr2f6/H EMMA sperm mutant strain MGI:6153804 Nr2f6 endonuclease-mediated mutation 1, Harwell MGI:1352453 Nr2f6 nuclear receptor subfamily 2, group F, member 6 https://www.infrafrontier.eu/search?keyword=EM:10788 + EM:10788 C57BL/6NTac-Nr2f6/H EMMA live mutant strain MGI:6153804 Nr2f6 endonuclease-mediated mutation 1, Harwell MGI:1352453 Nr2f6 nuclear receptor subfamily 2, group F, member 6 https://www.infrafrontier.eu/search?keyword=EM:10788 + EM:10065 C57BL/6NTac-Nphs2/WtsiIeg EMMA sperm mutant strain MGI:5633815 Nphs2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:2157018 Nphs2 nephrosis 2, podocin https://www.infrafrontier.eu/search?keyword=EM:10065 + EM:09635 C57BL/6NTac-Nolc1/Ieg EMMA sperm mutant strain MGI:4432873 Nolc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918019 Nolc1 nucleolar and coiled-body phosphoprotein 1 https://www.infrafrontier.eu/search?keyword=EM:09635 - EM:07664 C57BL/6NTac-Nol8/IcsOrl EMMA sperm mutant strain MGI:4436496 Nol8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918180 Nol8 nucleolar protein 8 https://www.infrafrontier.eu/search?keyword=EM:07664 + EM:10453 C57BL/6NTac-Nodal/H EMMA sperm mutant strain MGI:4433629 Nodal targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97359 Nodal nodal https://www.infrafrontier.eu/search?keyword=EM:10453 + EM:12373 C57BL/6NTac-Nnt/H EMMA sperm mutant strain MGI:6257492 Nnt endonuclease-mediated mutation 1, Harwell MGI:109279 Nnt nicotinamide nucleotide transhydrogenase https://www.infrafrontier.eu/search?keyword=EM:12373 + EM:09639 C57BL/6NTac-Nmt2/Ieg EMMA sperm mutant strain MGI:4436550 Nmt2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1202298 Nmt2 N-myristoyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:09639 - EM:04346 C57BL/6NTac-Nmnat1/Cnrm EMMA embryo mutant strain MGI:4431754 Nmnat1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913704 Nmnat1 nicotinamide nucleotide adenylyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:04346 - EM:04346 C57BL/6NTac-Nmnat1/Cnrm EMMA sperm mutant strain MGI:4431754 Nmnat1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913704 Nmnat1 nicotinamide nucleotide adenylyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:04346 + EM:08624 C57BL/6NTac-Nme4/WtsiH EMMA sperm mutant strain MGI:4441641 Nme4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1931148 Nme4 NME/NM23 nucleoside diphosphate kinase 4 https://www.infrafrontier.eu/search?keyword=EM:08624 + EM:10706 C57BL/6NTac-Nkx2-6/WtsiIeg EMMA sperm mutant strain MGI:5633814 Nkx2-6 targeted mutation 2, Wellcome Trust Sanger Institute MGI:97351 Nkx2-6 NK2 homeobox 6 https://www.infrafrontier.eu/search?keyword=EM:10706 + EM:05386 C57BL/6NTac-Nkiras2/WtsiCnbc EMMA embryo mutant strain MGI:4432279 Nkiras2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919216 Nkiras2 NFKB inhibitor interacting Ras-like protein 2 https://www.infrafrontier.eu/search?keyword=EM:05386 + EM:05386 C57BL/6NTac-Nkiras2/WtsiCnbc EMMA sperm mutant strain MGI:4432279 Nkiras2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919216 Nkiras2 NFKB inhibitor interacting Ras-like protein 2 https://www.infrafrontier.eu/search?keyword=EM:05386 + EM:08150 C57BL/6NTac-Nhp2/WtsiH EMMA sperm EPD0134_3_B06 mutant strain MGI:4362251 Nhp2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098547 Nhp2 NHP2 ribonucleoprotein https://www.infrafrontier.eu/search?keyword=EM:08150 + EM:07691 C57BL/6NTac-Ngfr/IcsOrl EMMA archived mutant strain MGI:4432054 Ngfr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97323 Ngfr nerve growth factor receptor (TNFR superfamily, member 16) https://www.infrafrontier.eu/search?keyword=EM:07691 + EM:07657 C57BL/6NTac-Nfxl1/IcsOrl EMMA sperm mutant strain MGI:4432670 Nfxl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923646 Nfxl1 nuclear transcription factor, X-box binding-like 1 https://www.infrafrontier.eu/search?keyword=EM:07657 - EM:03982 C57BL/6NTac-Nfkbid/Cnrm EMMA embryo B6NTac;B6N-Nfkbid/Cnrm, EPD0100_4_A03 mutant strain MGI:4432464 Nfkbid targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3041243 Nfkbid nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, delta https://www.infrafrontier.eu/search?keyword=EM:03982 - EM:03982 C57BL/6NTac-Nfkbid/Cnrm EMMA sperm B6NTac;B6N-Nfkbid/Cnrm, EPD0100_4_A03 mutant strain MGI:4432464 Nfkbid targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3041243 Nfkbid nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, delta https://www.infrafrontier.eu/search?keyword=EM:03982 + EM:07668 C57BL/6NTac-Nfasc/IcsOrl EMMA archived mutant strain MGI:4435919 Nfasc targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104753 Nfasc neurofascin https://www.infrafrontier.eu/search?keyword=EM:07668 ? EM:13177 C57BL/6NTac-Nek10/WtsiFlmg EMMA sperm mutant strain MGI:4363663 Nek10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685128 Nek10 NIMA (never in mitosis gene a)- related kinase 10 https://www.infrafrontier.eu/search?keyword=EM:13177 + EM:12328 C57BL/6NTac-Nefh/Ics EMMA sperm mutant strain Nefh EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:97309 Nefh neurofilament, heavy polypeptide https://www.infrafrontier.eu/search?keyword=EM:12328 + EM:07730 C57BL/6NTac-Ndufs3/IcsOrl EMMA archived mutant strain MGI:4433795 Ndufs3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915599 Ndufs3 NADH:ubiquinone oxidoreductase core subunit S3 https://www.infrafrontier.eu/search?keyword=EM:07730 - EM:03968 C57BL/6NTac-Ndufaf6/Cnrm EMMA sperm B6Dnk;B6N-Ndufaf6/Cnrm, B6Dnk;B6N-2310030N02Rik/Cnrm, B6NDen;B6N-2310030N02Rik/Cnrm mutant strain MGI:4433125 Ndufaf6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924197 Ndufaf6 NADH:ubiquinone oxidoreductase complex assembly factor 6 https://www.infrafrontier.eu/search?keyword=EM:03968 + EM:05197 C57BL/6NTac-Ndufa8/Ieg EMMA embryo mutant strain MGI:4436517 Ndufa8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915625 Ndufa8 NADH:ubiquinone oxidoreductase subunit A8 https://www.infrafrontier.eu/search?keyword=EM:05197 ? EM:08723 C57BL/6NTac-Ndufa10/Ieg EMMA embryo mutant strain MGI:4434585 Ndufa10 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1914523 Ndufa10 NADH:ubiquinone oxidoreductase subunit A10 https://www.infrafrontier.eu/search?keyword=EM:08723 - EM:07789 C57BL/6NTac-Ndrg4/H EMMA sperm C57BL/6N-Ndrg4/H mutant strain MGI:4362496 Ndrg4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384590 Ndrg4 N-myc downstream regulated gene 4 https://www.infrafrontier.eu/search?keyword=EM:07789 + EM:07717 C57BL/6NTac-Ncs1/IcsOrl EMMA archived mutant strain MGI:4436379 Ncs1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109166 Ncs1 neuronal calcium sensor 1 https://www.infrafrontier.eu/search?keyword=EM:07717 + EM:07176 C57BL/6NTac-Ncf2/WtsiH EMMA sperm C57BL/6N-Ncf2/WtsiH mutant strain MGI:4432766 Ncf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97284 Ncf2 neutrophil cytosolic factor 2 https://www.infrafrontier.eu/search?keyword=EM:07176 + EM:07989 C57BL/6NTac-Ncbp3/H EMMA sperm EPD0046_2_C06, C57BL/6NTac-1200014J11Rik/H mutant strain MGI:4433298 Ncbp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914124 Ncbp3 nuclear cap binding subunit 3 https://www.infrafrontier.eu/search?keyword=EM:07989 + EM:05671 C57BL/6NTac-Ncaph/WtsiH EMMA sperm MCEE, EPD0156_5_B09 mutant strain MGI:4431609 Ncaph targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444777 Ncaph non-SMC condensin I complex, subunit H https://www.infrafrontier.eu/search?keyword=EM:05671 - EM:06960 C57BL/6NTac-Nbr1/H EMMA sperm C57BL/6N-Nbr1/H mutant strain MGI:4362162 Nbr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108498 Nbr1 NBR1, autophagy cargo receptor https://www.infrafrontier.eu/search?keyword=EM:06960 + EM:07021 C57BL/6NTac-Natd1/WtsiOulu EMMA embryo C57BL/6NTac-Gm16515/WtsiOulu mutant strain MGI:4432892 Natd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1344388 Natd1 N-acetyltransferase domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:07021 + EM:07021 C57BL/6NTac-Natd1/WtsiOulu EMMA sperm C57BL/6NTac-Gm16515/WtsiOulu mutant strain MGI:4432892 Natd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1344388 Natd1 N-acetyltransferase domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:07021 + EM:13026 C57BL/6NTac-Nars/H EMMA sperm unclassified MGI:6451612 Nars endonuclease-mediated mutation 1, Harwell MGI:1917473 Nars asparaginyl-tRNA synthetase https://www.infrafrontier.eu/search?keyword=EM:13026 + EM:05558 C57BL/6NTac-Napb/Cnrm EMMA sperm mutant strain MGI:4434916 Napb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104562 Napb N-ethylmaleimide sensitive fusion protein attachment protein beta https://www.infrafrontier.eu/search?keyword=EM:05558 + EM:10080 C57BL/6NTac-Nalcn/WtsiIeg EMMA sperm mutant strain MGI:5633812 Nalcn targeted mutation 2, Wellcome Trust Sanger Institute MGI:2444306 Nalcn sodium leak channel, non-selective https://www.infrafrontier.eu/search?keyword=EM:10080 + EM:10496 C57BL/6NTac-Nab2/IcsOrl EMMA archived mutant strain MGI:4435541 Nab2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107563 Nab2 Ngfi-A binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:10496 + EM:06322 C57BL/6NTac-Myo9a/WtsiCnbc EMMA embryo mutant strain MGI:4433267 Myo9a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107735 Myo9a myosin IXa https://www.infrafrontier.eu/search?keyword=EM:06322 + EM:06322 C57BL/6NTac-Myo9a/WtsiCnbc EMMA sperm mutant strain MGI:4433267 Myo9a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107735 Myo9a myosin IXa https://www.infrafrontier.eu/search?keyword=EM:06322 - EM:09558 C57BL/6NTac-Myo1a/WtsiIeg EMMA sperm mutant strain MGI:5633811 Myo1a targeted mutation 1, Wellcome Trust Sanger Institute MGI:107732 Myo1a myosin IA https://www.infrafrontier.eu/search?keyword=EM:09558 + EM:04445 C57BL/6NTac-Myl4/Ieg EMMA embryo EPD0155_1_D04 mutant strain MGI:4431641 Myl4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97267 Myl4 myosin, light polypeptide 4 https://www.infrafrontier.eu/search?keyword=EM:04445 + EM:10087 C57BL/6NTac-Myh7/WtsiIeg EMMA sperm mutant strain MGI:5633809 Myh7 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2155600 Myh7 myosin, heavy polypeptide 7, cardiac muscle, beta https://www.infrafrontier.eu/search?keyword=EM:10087 - EM:09116 C57BL/6NTac-Myh4/Cnrm EMMA sperm mutant strain MGI:5633807 Myh4 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1339713 Myh4 myosin, heavy polypeptide 4, skeletal muscle https://www.infrafrontier.eu/search?keyword=EM:09116 + EM:10086 C57BL/6NTac-Myh2/WtsiIeg EMMA sperm mutant strain MGI:5633801 Myh2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1339710 Myh2 myosin, heavy polypeptide 2, skeletal muscle, adult https://www.infrafrontier.eu/search?keyword=EM:10086 - EM:05518 C57BL/6NTac-Myd88/WtsiOulu EMMA embryo mutant strain MGI:4434029 Myd88 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108005 Myd88 myeloid differentiation primary response gene 88 https://www.infrafrontier.eu/search?keyword=EM:05518 + EM:05477 C57BL/6NTac-Mxra7/H EMMA sperm EPD0059_1_G06 mutant strain MGI:4433751 Mxra7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914872 Mxra7 matrix-remodelling associated 7 https://www.infrafrontier.eu/search?keyword=EM:05477 + EM:11649 C57BL/6NTac-Mul1/H EMMA sperm mutant strain MGI:6153802 Mul1 endonuclease-mediated mutation 1, Harwell MGI:1915600 Mul1 mitochondrial ubiquitin ligase activator of NFKB 1 https://www.infrafrontier.eu/search?keyword=EM:11649 + EM:12300 C57BL/6NTac-Muc5ac/Ics EMMA sperm mutant strain Muc5ac EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:104697 Muc5ac mucin 5, subtypes A and C, tracheobronchial/gastric https://www.infrafrontier.eu/search?keyword=EM:12300 + EM:07666 C57BL/6NTac-Mtrf1/IcsOrl EMMA archived mutant strain MGI:4434932 Mtrf1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384815 Mtrf1 mitochondrial translational release factor 1 https://www.infrafrontier.eu/search?keyword=EM:07666 + EM:05373 C57BL/6NTac-Mtor/WtsiCnbc EMMA embryo mutant strain MGI:4432158 Mtor targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928394 Mtor mechanistic target of rapamycin kinase https://www.infrafrontier.eu/search?keyword=EM:05373 + EM:05373 C57BL/6NTac-Mtor/WtsiCnbc EMMA sperm mutant strain MGI:4432158 Mtor targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928394 Mtor mechanistic target of rapamycin kinase https://www.infrafrontier.eu/search?keyword=EM:05373 + EM:07723 C57BL/6NTac-Mtmr14/IcsOrl EMMA archived mutant strain MGI:4362891 Mtmr14 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916075 Mtmr14 myotubularin related protein 14 https://www.infrafrontier.eu/search?keyword=EM:07723 - EM:04455 C57BL/6NTac-Mtch2/Cnrm EMMA embryo mutant strain MGI:4436614 Mtch2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1929260 Mtch2 mitochondrial carrier 2 https://www.infrafrontier.eu/search?keyword=EM:04455 - EM:04455 C57BL/6NTac-Mtch2/Cnrm EMMA sperm mutant strain MGI:4436614 Mtch2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1929260 Mtch2 mitochondrial carrier 2 https://www.infrafrontier.eu/search?keyword=EM:04455 - EM:07705 C57BL/6NTac-Mtarc2/IcsOrl EMMA sperm mutant strain MGI:4435988 Mtarc2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1914497 Mtarc2 mitochondrial amidoxime reducing component 2 https://www.infrafrontier.eu/search?keyword=EM:07705 - EM:09201 C57BL/6NTac-Msx2/Cnrm EMMA sperm mutant strain MGI:5633794 Msx2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:97169 Msx2 msh homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:09201 + EM:06037 C57BL/6NTac-Msmo1/WtsiBiat EMMA sperm C57BL/6NTac-Sc4mol/WtsiBiat mutant strain MGI:4432850 Msmo1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913484 Msmo1 methylsterol monoxygenase 1 https://www.infrafrontier.eu/search?keyword=EM:06037 + EM:12315 C57BL/6NTac-Msln/Ics EMMA sperm mutant strain Msln EUCOMM targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1888992 Msln mesothelin https://www.infrafrontier.eu/search?keyword=EM:12315 + EM:07698 C57BL/6NTac-Mrps35/IcsOrl EMMA archived mutant strain MGI:4433487 Mrps35 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385255 Mrps35 mitochondrial ribosomal protein S35 https://www.infrafrontier.eu/search?keyword=EM:07698 + EM:07738 C57BL/6NTac-Mrpl54/IcsOrl EMMA archived mutant strain MGI:4432901 Mrpl54 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913297 Mrpl54 mitochondrial ribosomal protein L54 https://www.infrafrontier.eu/search?keyword=EM:07738 + EM:10775 C57BL/6NTac-Mrpl23/H EMMA sperm C57BL/6NTac-Mrpl23/H mutant strain MGI:6144261 Mrpl23 endonuclease mediated mutation 1, Harwell MGI:1196612 Mrpl23 mitochondrial ribosomal protein L23 https://www.infrafrontier.eu/search?keyword=EM:10775 + EM:07697 C57BL/6NTac-Mrpl10/IcsOrl EMMA archived mutant strain MGI:4435617 Mrpl10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1333801 Mrpl10 mitochondrial ribosomal protein L10 https://www.infrafrontier.eu/search?keyword=EM:07697 + EM:05870 C57BL/6NTac-Mroh7/WtsiH EMMA sperm mutant strain MGI:4434135 Mroh7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685873 Mroh7 maestro heat-like repeat family member 7 https://www.infrafrontier.eu/search?keyword=EM:05870 - EM:08847 C57BL/6NTac-Mroh7/WtsiH EMMA sperm mutant strain MGI:5633793 Mroh7 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:2685873 Mroh7 maestro heat-like repeat family member 7 https://www.infrafrontier.eu/search?keyword=EM:08847 + EM:04617 C57BL/6NTac-Mpi/H EMMA sperm EPD0227_5_D08 mutant strain MGI:4432151 Mpi targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97075 Mpi mannose phosphate isomerase https://www.infrafrontier.eu/search?keyword=EM:04617 - EM:04738 C57BL/6NTac-Mphosph9/Cnrm EMMA embryo mutant strain MGI:6324154 Mphosph9 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:2443138 Mphosph9 M-phase phosphoprotein 9 https://www.infrafrontier.eu/search?keyword=EM:04738 - EM:04738 C57BL/6NTac-Mphosph9/Cnrm EMMA sperm mutant strain MGI:6324154 Mphosph9 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:2443138 Mphosph9 M-phase phosphoprotein 9 https://www.infrafrontier.eu/search?keyword=EM:04738 + EM:13019 C57BL/6NTac-Mpeg1/H EMMA sperm C57BL/6NTac-Mpeg1/H unclassified MGI:6451609 Mpeg1 endonuclease-mediated mutation 1, Harwell MGI:1333743 Mpeg1 macrophage expressed gene 1 https://www.infrafrontier.eu/search?keyword=EM:13019 + EM:09161 C57BL/6NTac-Mospd1/WtsiPh EMMA sperm mutant strain MGI:4362521 Mospd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917630 Mospd1 motile sperm domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:09161 - EM:09764 C57BL/6NTac-Mog/WtsiH EMMA sperm mutant strain MGI:5633791 Mog targeted mutation 1, Wellcome Trust Sanger Institute MGI:97435 Mog myelin oligodendrocyte glycoprotein https://www.infrafrontier.eu/search?keyword=EM:09764 + EM:10670 C57BL/6NTac-Mmp11/Ics EMMA sperm mutant strain MGI:4436340 Mmp11 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97008 Mmp11 matrix metallopeptidase 11 https://www.infrafrontier.eu/search?keyword=EM:10670 + EM:11230 C57BL/6NTac-Mlycd/H EMMA live mutant strain MGI:4362673 Mlycd targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928485 Mlycd malonyl-CoA decarboxylase https://www.infrafrontier.eu/search?keyword=EM:11230 - EM:04517 C57BL/6NTac-Mlh1/Cnrm EMMA embryo mutant strain MGI:4435839 Mlh1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:101938 Mlh1 mutL homolog 1 https://www.infrafrontier.eu/search?keyword=EM:04517 - EM:04517 C57BL/6NTac-Mlh1/Cnrm EMMA sperm mutant strain MGI:4435839 Mlh1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:101938 Mlh1 mutL homolog 1 https://www.infrafrontier.eu/search?keyword=EM:04517 + EM:10702 C57BL/6NTac-Mitf/WtsiIeg EMMA sperm mutant strain MGI:5633787 Mitf targeted mutation 2, Wellcome Trust Sanger Institute MGI:104554 Mitf melanogenesis associated transcription factor https://www.infrafrontier.eu/search?keyword=EM:10702 + EM:12321 C57BL/6NTac-Mip/Ics EMMA sperm mutant strain Mip EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:96990 Mip major intrinsic protein of lens fiber https://www.infrafrontier.eu/search?keyword=EM:12321 + EM:11417 C57BL/6NTac-Mindy4/H EMMA live mutant strain MGI:6149204 Mindy4 endonuclease mediated mutation 1, Harwell MGI:3583959 Mindy4 MINDY lysine 48 deubiquitinase 4 https://www.infrafrontier.eu/search?keyword=EM:11417 + EM:11405 C57BL/6NTac-Mindy3/H EMMA live mutant strain MGI:6149950 Mindy3 endonuclease mediated mutation 2, Harwell MGI:1914210 Mindy3 MINDY lysine 48 deubiquitinase 3 https://www.infrafrontier.eu/search?keyword=EM:11405 + EM:11415 C57BL/6NTac-Mindy3/H EMMA live mutant strain MGI:6149203 Mindy3 endonuclease mediated mutation 1, Harwell MGI:1914210 Mindy3 MINDY lysine 48 deubiquitinase 3 https://www.infrafrontier.eu/search?keyword=EM:11415 + EM:11447 C57BL/6NTac-Mindy2/H EMMA live C57BL/6N-Mindy2/H mutant strain MGI:6149160 Mindy2 endonuclease mediated mutation 1, Harwell MGI:2443086 Mindy2 MINDY lysine 48 deubiquitinase 2 https://www.infrafrontier.eu/search?keyword=EM:11447 + EM:07670 C57BL/6NTac-Mindy1/IcsOrl EMMA sperm C57BL/6NTac-Fam63a/IcsOrl mutant strain MGI:4433829 Mindy1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922257 Mindy1 MINDY lysine 48 deubiquitinase 1 https://www.infrafrontier.eu/search?keyword=EM:07670 + EM:07640 C57BL/6NTac-Mib2/IcsOrl EMMA archived mutant strain MGI:4431678 Mib2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2679684 Mib2 mindbomb E3 ubiquitin protein ligase 2 https://www.infrafrontier.eu/search?keyword=EM:07640 - EM:08962 C57BL/6NTac-Mia/Cnrm EMMA sperm mutant strain MGI:5633786 Mia targeted mutation 1, Wellcome Trust Sanger Institute MGI:109615 Mia MIA SH3 domain containing https://www.infrafrontier.eu/search?keyword=EM:08962 + EM:08593 C57BL/6NTac-Mettl24/WtsiH EMMA sperm mutant strain MGI:4363211 Mettl24 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3045338 Mettl24 methyltransferase like 24 https://www.infrafrontier.eu/search?keyword=EM:08593 - EM:07966 C57BL/6NTac-Metrnl/WtsiH EMMA sperm C57BL/6N-Metrnl/WtsiH mutant strain MGI:4362702 Metrnl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384806 Metrnl meteorin, glial cell differentiation regulator-like https://www.infrafrontier.eu/search?keyword=EM:07966 + EM:11557 C57BL/6NTac-Med19/WtsiOulu EMMA embryo mutant strain MGI:4432772 Med19 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914234 Med19 mediator complex subunit 19 https://www.infrafrontier.eu/search?keyword=EM:11557 + EM:11557 C57BL/6NTac-Med19/WtsiOulu EMMA sperm mutant strain MGI:4432772 Med19 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914234 Med19 mediator complex subunit 19 https://www.infrafrontier.eu/search?keyword=EM:11557 + EM:10828 C57BL/6NTac-Med18/H EMMA sperm mutant strain MGI:4432982 Med18 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914469 Med18 mediator complex subunit 18 https://www.infrafrontier.eu/search?keyword=EM:10828 + EM:08720 C57BL/6NTac-Me3/Ieg EMMA embryo mutant strain MGI:4362498 Me3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916679 Me3 malic enzyme 3, NADP(+)-dependent, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:08720 + EM:08646 C57BL/6NTac-Me2/Ieg EMMA sperm mutant strain MGI:4434603 Me2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2147351 Me2 malic enzyme 2, NAD(+)-dependent, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:08646 - EM:04413 C57BL/6NTac-Mcf2l/Cnrm EMMA embryo mutant strain MGI:4436065 Mcf2l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103263 Mcf2l mcf.2 transforming sequence-like https://www.infrafrontier.eu/search?keyword=EM:04413 - EM:04413 C57BL/6NTac-Mcf2l/Cnrm EMMA sperm mutant strain MGI:4436065 Mcf2l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103263 Mcf2l mcf.2 transforming sequence-like https://www.infrafrontier.eu/search?keyword=EM:04413 + EM:10705 C57BL/6NTac-Mbp/WtsiIeg EMMA sperm mutant strain MGI:5633783 Mbp targeted mutation 2, Wellcome Trust Sanger Institute MGI:96925 Mbp myelin basic protein https://www.infrafrontier.eu/search?keyword=EM:10705 + EM:08273 C57BL/6NTac-Mboat7/H EMMA sperm mutant strain MGI:4363399 Mboat7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924832 Mboat7 membrane bound O-acyltransferase domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:08273 - EM:08949 C57BL/6NTac-Mb/WtsiH EMMA sperm mutant strain MGI:5633782 Mb targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:96922 Mb myoglobin https://www.infrafrontier.eu/search?keyword=EM:08949 + EM:07685 C57BL/6NTac-Mat2a/IcsOrl EMMA sperm mutant strain MGI:4435877 Mat2a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443731 Mat2a methionine adenosyltransferase II, alpha https://www.infrafrontier.eu/search?keyword=EM:07685 - EM:05708 C57BL/6NTac-March5/WtsiBiat EMMA sperm C57BL/6NTac-Marchf5/WtsiBiat mutant strain MGI:4433802 Marchf5 targeted mutation 1a, Wellcome Trust Sanger Institute Mar-05 Mar-05 https://www.infrafrontier.eu/search?keyword=EM:05708 + EM:07740 C57BL/6NTac-Mapre3/IcsOrl EMMA sperm mutant strain MGI:4432919 Mapre3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2140967 Mapre3 microtubule-associated protein, RP/EB family, member 3 https://www.infrafrontier.eu/search?keyword=EM:07740 + EM:04557 C57BL/6NTac-Mapkbp1/H EMMA sperm mutant strain MGI:4436014 Mapkbp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1347004 Mapkbp1 mitogen-activated protein kinase binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:04557 + EM:10072 C57BL/6NTac-Mapkapk5/Ieg EMMA sperm mutant strain MGI:4432027 Mapkapk5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1333110 Mapkapk5 MAP kinase-activated protein kinase 5 https://www.infrafrontier.eu/search?keyword=EM:10072 - EM:04733 C57BL/6NTac-Mapk8ip2/Cnrm EMMA embryo mutant strain MGI:4433297 Mapk8ip2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926555 Mapk8ip2 mitogen-activated protein kinase 8 interacting protein 2 https://www.infrafrontier.eu/search?keyword=EM:04733 - EM:04733 C57BL/6NTac-Mapk8ip2/Cnrm EMMA sperm mutant strain MGI:4433297 Mapk8ip2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926555 Mapk8ip2 mitogen-activated protein kinase 8 interacting protein 2 https://www.infrafrontier.eu/search?keyword=EM:04733 ? EM:13176 C57BL/6NTac-Map3k1/WtsiFlmg EMMA sperm mutant strain MGI:4451248 Map3k1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1346872 Map3k1 mitogen-activated protein kinase kinase kinase 1 https://www.infrafrontier.eu/search?keyword=EM:13176 ? EM:14036 C57BL/6NTac-Maneal/WtsiPh EMMA sperm mutant strain MGI:4362994 Maneal targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2684896 Maneal mannosidase, endo-alpha-like https://www.infrafrontier.eu/search?keyword=EM:14036 ? EM:14092 C57BL/6NTac-Man2b2/WtsiOulu EMMA embryo mutant strain MGI:4362174 Man2b2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1195262 Man2b2 mannosidase 2, alpha B2 https://www.infrafrontier.eu/search?keyword=EM:14092 ? EM:14092 C57BL/6NTac-Man2b2/WtsiOulu EMMA sperm mutant strain MGI:4362174 Man2b2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1195262 Man2b2 mannosidase 2, alpha B2 https://www.infrafrontier.eu/search?keyword=EM:14092 + EM:05374 C57BL/6NTac-Mad2l2/WtsiCnbc EMMA embryo mutant strain MGI:4432091 Mad2l2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919140 Mad2l2 MAD2 mitotic arrest deficient-like 2 https://www.infrafrontier.eu/search?keyword=EM:05374 + EM:05374 C57BL/6NTac-Mad2l2/WtsiCnbc EMMA sperm mutant strain MGI:4432091 Mad2l2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919140 Mad2l2 MAD2 mitotic arrest deficient-like 2 https://www.infrafrontier.eu/search?keyword=EM:05374 ? EM:13672 C57BL/6NTac-Mab21l4/WtsiOrl EMMA sperm mutant strain MGI:4362992 Mab21l4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919124 Mab21l4 mab-21-like 4 https://www.infrafrontier.eu/search?keyword=EM:13672 + EM:06794 C57BL/6NTac-Lztr1/WtsiH EMMA sperm MDLF, EPD0140_5_E07 mutant strain MGI:4432946 Lztr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914113 Lztr1 leucine-zipper-like transcriptional regulator, 1 https://www.infrafrontier.eu/search?keyword=EM:06794 - EM:08969 C57BL/6NTac-Lztfl1/Cnrm EMMA sperm mutant strain MGI:5633781 Lztfl1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1934860 Lztfl1 leucine zipper transcription factor-like 1 https://www.infrafrontier.eu/search?keyword=EM:08969 + EM:08717 C57BL/6NTac-Lss/Ieg EMMA archived mutant strain MGI:4362667 Lss targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1336155 Lss lanosterol synthase https://www.infrafrontier.eu/search?keyword=EM:08717 + EM:12072 C57BL/6NTac-Lsm11/Wtsi EMMA embryo mutant strain MGI:4362146 Lsm11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919540 Lsm11 U7 snRNP-specific Sm-like protein LSM11 https://www.infrafrontier.eu/search?keyword=EM:12072 + EM:11425 C57BL/6NTac-Lrr1/H EMMA sperm C57BL/6NTac-Lrr1/H mutant strain MGI:6149202 Lrr1 endonuclease mediated mutation 1, Harwell MGI:1916956 Lrr1 leucine rich repeat protein 1 https://www.infrafrontier.eu/search?keyword=EM:11425 + EM:12143 C57BL/6NTac-Lrpprc/Wtsi EMMA embryo mutant strain MGI:4363281 Lrpprc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919666 Lrpprc leucine-rich PPR-motif containing https://www.infrafrontier.eu/search?keyword=EM:12143 + EM:05547 C57BL/6NTac-Lpo/Ieg EMMA embryo mutant strain MGI:4432905 Lpo targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923363 Lpo lactoperoxidase https://www.infrafrontier.eu/search?keyword=EM:05547 + EM:07485 C57BL/6NTac-Lonrf3/WtsiOulu EMMA embryo mutant strain MGI:4363930 Lonrf3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921615 Lonrf3 LON peptidase N-terminal domain and ring finger 3 https://www.infrafrontier.eu/search?keyword=EM:07485 + EM:07485 C57BL/6NTac-Lonrf3/WtsiOulu EMMA sperm mutant strain MGI:4363930 Lonrf3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921615 Lonrf3 LON peptidase N-terminal domain and ring finger 3 https://www.infrafrontier.eu/search?keyword=EM:07485 + EM:05714 C57BL/6NTac-Lnx2/WtsiBiat EMMA embryo mutant strain MGI:4433509 Lnx2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2155959 Lnx2 ligand of numb-protein X 2 https://www.infrafrontier.eu/search?keyword=EM:05714 + EM:07701 C57BL/6NTac-Limk2/IcsOrl EMMA archived mutant strain MGI:4431692 Limk2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1197517 Limk2 LIM motif-containing protein kinase 2 https://www.infrafrontier.eu/search?keyword=EM:07701 + EM:07692 C57BL/6NTac-Lhx1/IcsOrl EMMA archived mutant strain Lhx1 EUCOMM targeted mutation 1e, Wellcome Trust Sanger Institute MGI:99783 Lhx1 LIM homeobox protein 1 https://www.infrafrontier.eu/search?keyword=EM:07692 ? EM:13959 C57BL/6NTac-Leprot/WtsiPh EMMA sperm mutant strain MGI:4364337 Leprot targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2687005 Leprot leptin receptor overlapping transcript https://www.infrafrontier.eu/search?keyword=EM:13959 + EM:10707 C57BL/6NTac-Lef1/WtsiIeg EMMA sperm mutant strain MGI:5633779 Lef1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:96770 Lef1 lymphoid enhancer binding factor 1 https://www.infrafrontier.eu/search?keyword=EM:10707 + EM:08936 C57BL/6NTac-Ldhb/WtsiOulu EMMA embryo mutant strain MGI:5299501 Ldhb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96763 Ldhb lactate dehydrogenase B https://www.infrafrontier.eu/search?keyword=EM:08936 + EM:08936 C57BL/6NTac-Ldhb/WtsiOulu EMMA sperm mutant strain MGI:5299501 Ldhb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96763 Ldhb lactate dehydrogenase B https://www.infrafrontier.eu/search?keyword=EM:08936 + EM:07865 C57BL/6NTac-Lbp/H EMMA sperm mutant strain MGI:4436125 Lbp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1098776 Lbp lipopolysaccharide binding protein https://www.infrafrontier.eu/search?keyword=EM:07865 + EM:05705 C57BL/6NTac-Laptm5/WtsiBiat EMMA archived mutant strain MGI:4433224 Laptm5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108046 Laptm5 lysosomal-associated protein transmembrane 5 https://www.infrafrontier.eu/search?keyword=EM:05705 + EM:07646 C57BL/6NTac-Laptm4a/IcsOrl EMMA archived mutant strain MGI:4435176 Laptm4a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108017 Laptm4a lysosomal-associated protein transmembrane 4A https://www.infrafrontier.eu/search?keyword=EM:07646 + EM:06294 C57BL/6NTac-Lamb3/H EMMA sperm C57BL/6N-Lamb3/H mutant strain MGI:4364410 Lamb3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99915 Lamb3 laminin, beta 3 https://www.infrafrontier.eu/search?keyword=EM:06294 + EM:08811 C57BL/6NTac-Lama5/H EMMA sperm mutant strain MGI:4363608 Lama5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105382 Lama5 laminin, alpha 5 https://www.infrafrontier.eu/search?keyword=EM:08811 + EM:10043 C57BL/6NTac-Krt82/WtsiIeg EMMA sperm mutant strain MGI:5633778 Krt82 targeted mutation 2, Wellcome Trust Sanger Institute MGI:2149248 Krt82 keratin 82 https://www.infrafrontier.eu/search?keyword=EM:10043 + EM:10712 C57BL/6NTac-Krt79/WtsiIeg EMMA sperm mutant strain MGI:5297893 Krt79 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2385030 Krt79 keratin 79 https://www.infrafrontier.eu/search?keyword=EM:10712 - EM:08852 C57BL/6NTac-Krt17/WtsiH EMMA sperm mutant strain MGI:5633777 Krt17 targeted mutation 1, Wellcome Trust Sanger Institute MGI:96691 Krt17 keratin 17 https://www.infrafrontier.eu/search?keyword=EM:08852 - EM:07686 C57BL/6NTac-Knstrn/IcsOrl EMMA sperm mutant strain MGI:4362164 Knstrn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1289298 Knstrn kinetochore-localized astrin/SPAG5 binding https://www.infrafrontier.eu/search?keyword=EM:07686 + EM:10664 C57BL/6NTac-Klrb1a/WtsiBiat EMMA sperm mutant strain MGI:4364549 Klrb1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107540 Klrb1a killer cell lectin-like receptor subfamily B member 1A https://www.infrafrontier.eu/search?keyword=EM:10664 + EM:11262 C57BL/6NTac-Klk5/WtsiCnrm EMMA sperm mutant strain MGI:4364033 Klk5 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1915918 Klk5 kallikrein related-peptidase 5 https://www.infrafrontier.eu/search?keyword=EM:11262 - EM:09760 C57BL/6NTac-Klk5/WtsiH EMMA sperm mutant strain MGI:5633775 Klk5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1915918 Klk5 kallikrein related-peptidase 5 https://www.infrafrontier.eu/search?keyword=EM:09760 + EM:09948 C57BL/6NTac-Klk10/Cnrm EMMA sperm mutant strain MGI:5811913 Klk10 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1916790 Klk10 kallikrein related-peptidase 10 https://www.infrafrontier.eu/search?keyword=EM:09948 + EM:07649 C57BL/6NTac-Klhl29/IcsOrl EMMA archived mutant strain MGI:4435268 Klhl29 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2683857 Klhl29 kelch-like 29 https://www.infrafrontier.eu/search?keyword=EM:07649 + EM:07395 C57BL/6NTac-Klhl21/WtsiH EMMA sperm EPD0122_3_B03 mutant strain MGI:4363013 Klhl21 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919288 Klhl21 kelch-like 21 https://www.infrafrontier.eu/search?keyword=EM:07395 + EM:08742 C57BL/6NTac-Klhl18/WtsiH EMMA sperm mutant strain MGI:4362936 Klhl18 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2143315 Klhl18 kelch-like 18 https://www.infrafrontier.eu/search?keyword=EM:08742 + EM:04619 C57BL/6NTac-Klhdc2/H EMMA sperm HEPD0523_4_G08 mutant strain MGI:4436518 Klhdc2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916804 Klhdc2 kelch domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:04619 + EM:07508 C57BL/6NTac-Klf17/WtsiOrl EMMA sperm mutant strain MGI:4362369 Klf17 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2181068 Klf17 Kruppel-like factor 17 https://www.infrafrontier.eu/search?keyword=EM:07508 + EM:11404 C57BL/6NTac-Klf14/H EMMA sperm mutant strain MGI:5749946 Klf14 endonuclease-mediated mutation 2, Harwell MGI:3577024 Klf14 Kruppel-like factor 14 https://www.infrafrontier.eu/search?keyword=EM:11404 + EM:10760 C57BL/6NTac-Klf14/H EMMA live mutant strain MGI:5749945 Klf14 endonuclease-mediated mutation 1, Harwell MGI:3577024 Klf14 Kruppel-like factor 14 https://www.infrafrontier.eu/search?keyword=EM:10760 + EM:08515 C57BL/6NTac-Klc2/WtsiOrl EMMA sperm mutant strain MGI:4434042 Klc2 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:107953 Klc2 kinesin light chain 2 https://www.infrafrontier.eu/search?keyword=EM:08515 + EM:14632 C57BL/6NTac-Khdrbs1/H EMMA sperm unclassified MGI:6719258 Khdrbs1 endonuclease-mediated mutation 3, Harwell MGI:893579 Khdrbs1 KH domain containing, RNA binding, signal transduction associated 1 https://www.infrafrontier.eu/search?keyword=EM:14632 + EM:14631 C57BL/6NTac-Khdrbs1/H EMMA sperm unclassified MGI:6719257 Khdrbs1 endonuclease-mediated mutation 2, Harwell MGI:893579 Khdrbs1 KH domain containing, RNA binding, signal transduction associated 1 https://www.infrafrontier.eu/search?keyword=EM:14631 + EM:14630 C57BL/6NTac-Khdrbs1/H EMMA sperm unclassified MGI:6719254 Khdrbs1 endonuclease-mediated mutation 1, Harwell MGI:893579 Khdrbs1 KH domain containing, RNA binding, signal transduction associated 1 https://www.infrafrontier.eu/search?keyword=EM:14630 + EM:07659 C57BL/6NTac-Kdm8/IcsOrl EMMA archived mutant strain MGI:4431607 Kdm8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924285 Kdm8 lysine (K)-specific demethylase 8 https://www.infrafrontier.eu/search?keyword=EM:07659 ? EM:13668 C57BL/6NTac-Kdm4c/WtsiOrl EMMA archived mutant strain MGI:4362199 Kdm4c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924054 Kdm4c lysine (K)-specific demethylase 4C https://www.infrafrontier.eu/search?keyword=EM:13668 - EM:09733 C57BL/6NTac-Kdm4c/WtsiH EMMA sperm mutant strain MGI:5633774 Kdm4c targeted mutation 1, Wellcome Trust Sanger Institute MGI:1924054 Kdm4c lysine (K)-specific demethylase 4C https://www.infrafrontier.eu/search?keyword=EM:09733 + EM:11316 C57BL/6NTac-Kctd17/H EMMA sperm C57BL/6N-Kctd17/H mutant strain MGI:6149895 Kctd17 endonuclease mediated mutation 2, Harwell MGI:1920094 Kctd17 potassium channel tetramerisation domain containing 17 https://www.infrafrontier.eu/search?keyword=EM:11316 + EM:10781 C57BL/6NTac-Kctd17/H EMMA sperm mutant strain MGI:6144262 Kctd17 endonuclease mediated mutation 1, Harwell MGI:1920094 Kctd17 potassium channel tetramerisation domain containing 17 https://www.infrafrontier.eu/search?keyword=EM:10781 + EM:07689 C57BL/6NTac-Kctd15/IcsOrl EMMA archived mutant strain MGI:4432583 Kctd15 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385276 Kctd15 potassium channel tetramerisation domain containing 15 https://www.infrafrontier.eu/search?keyword=EM:07689 + EM:14629 C57BL/6NTac-Kcnt1/H EMMA sperm unclassified MGI:6790579 Kcnt1 endonuclease-mediated mutation 1, Harwell MGI:1924627 Kcnt1 potassium channel, subfamily T, member 1 https://www.infrafrontier.eu/search?keyword=EM:14629 + EM:08514 C57BL/6NTac-Kcnn3/H EMMA sperm mutant strain MGI:4433082 Kcnn3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2153183 Kcnn3 potassium intermediate/small conductance calcium-activated channel, subfamily N, member 3 https://www.infrafrontier.eu/search?keyword=EM:08514 + EM:14628 C57BL/6NTac-Kcnk13/H EMMA sperm unclassified MGI:6790577 Kcnk13 endonuclease-mediated mutation 3, Harwell MGI:2384976 Kcnk13 potassium channel, subfamily K, member 13 https://www.infrafrontier.eu/search?keyword=EM:14628 + EM:10764 C57BL/6NTac-Kcnk13/H EMMA sperm mutant strain MGI:5749943 Kcnk13 endonuclease-mediated mutation 1, Harwell MGI:2384976 Kcnk13 potassium channel, subfamily K, member 13 https://www.infrafrontier.eu/search?keyword=EM:10764 + EM:12523 C57BL/6NTac-Kcnj11/H EMMA sperm unclassified MGI:6156348 Kcnj11 endonuclease-mediated mutation 1, Harwell MGI:107501 Kcnj11 potassium inwardly rectifying channel, subfamily J, member 11 https://www.infrafrontier.eu/search?keyword=EM:12523 + EM:08235 C57BL/6NTac-Kcnh4/WtsiPh EMMA sperm mutant strain MGI:4460286 Kcnh4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2156184 Kcnh4 potassium voltage-gated channel, subfamily H (eag-related), member 4 https://www.infrafrontier.eu/search?keyword=EM:08235 + EM:05862 C57BL/6NTac-Kcne2/WtsiH EMMA sperm MCSJ, EPD0156_2_F10 mutant strain MGI:4431909 Kcne2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891123 Kcne2 potassium voltage-gated channel, Isk-related subfamily, gene 2 https://www.infrafrontier.eu/search?keyword=EM:05862 + EM:09508 C57BL/6NTac-Kbtbd2/H EMMA sperm mutant strain MGI:4436648 Kbtbd2 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:2384811 Kbtbd2 kelch repeat and BTB (POZ) domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:09508 + EM:04584 C57BL/6NTac-Jmjd6/Ieg EMMA embryo EPD0158_3_A11 mutant strain MGI:4432550 Jmjd6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858910 Jmjd6 jumonji domain containing 6 https://www.infrafrontier.eu/search?keyword=EM:04584 - EM:09767 C57BL/6NTac-Jchain/WtsiH EMMA sperm mutant strain MGI:5633773 Jchain targeted mutation 1, Wellcome Trust Sanger Institute MGI:96493 Jchain immunoglobulin joining chain https://www.infrafrontier.eu/search?keyword=EM:09767 + EM:07436 C57BL/6NTac-Ivd/Ieg EMMA embryo mutant strain MGI:4436446 Ivd targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1929242 Ivd isovaleryl coenzyme A dehydrogenase https://www.infrafrontier.eu/search?keyword=EM:07436 - EM:09545 C57BL/6NTac-Itih1/WtsiIeg EMMA sperm mutant strain MGI:5633771 Itih1 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:96618 Itih1 inter-alpha trypsin inhibitor, heavy chain 1 https://www.infrafrontier.eu/search?keyword=EM:09545 - EM:09550 C57BL/6NTac-Itih1/WtsiIeg EMMA sperm mutant strain MGI:5633772 Itih1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:96618 Itih1 inter-alpha trypsin inhibitor, heavy chain 1 https://www.infrafrontier.eu/search?keyword=EM:09550 + EM:07739 C57BL/6NTac-Itgb5/IcsOrl EMMA archived mutant strain MGI:4433020 Itgb5 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:96614 Itgb5 integrin beta 5 https://www.infrafrontier.eu/search?keyword=EM:07739 + EM:12320 C57BL/6NTac-Itgax/Ics EMMA sperm mutant strain Itgax EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:96609 Itgax integrin alpha X https://www.infrafrontier.eu/search?keyword=EM:12320 + EM:12446 C57BL/6NTac-Irx3/H EMMA sperm mutant strain MGI:6155634 Irx3 endonuclease-mediated mutation 2, Harwell MGI:1197522 Irx3 Iroquois related homeobox 3 https://www.infrafrontier.eu/search?keyword=EM:12446 + EM:06341 C57BL/6NTac-Iqce/Ics EMMA embryo mutant strain MGI:4435267 Iqce targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921489 Iqce IQ motif containing E https://www.infrafrontier.eu/search?keyword=EM:06341 + EM:07611 C57BL/6NTac-Ints2/WtsiH EMMA sperm EPD0205_3_C04 mutant strain MGI:4362455 Ints2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917672 Ints2 integrator complex subunit 2 https://www.infrafrontier.eu/search?keyword=EM:07611 + EM:12332 C57BL/6NTac-Insl3/Ics EMMA sperm mutant strain Insl3 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:108427 Insl3 insulin-like 3 https://www.infrafrontier.eu/search?keyword=EM:12332 + EM:10047 C57BL/6NTac-Ins1/WtsiIeg EMMA sperm mutant strain MGI:5633769 Ins1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:96572 Ins1 insulin I https://www.infrafrontier.eu/search?keyword=EM:10047 + EM:13024 C57BL/6NTac-Inpp5k/H EMMA sperm unclassified MGI:6451583 Inpp5k endonuclease-mediated mutation 3, Harwell MGI:1194899 Inpp5k inositol polyphosphate 5-phosphatase K https://www.infrafrontier.eu/search?keyword=EM:13024 + EM:10016 C57BL/6NTac-Inpp1/WtsiFlmg EMMA sperm mutant strain MGI:4363818 Inpp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104848 Inpp1 inositol polyphosphate-1-phosphatase https://www.infrafrontier.eu/search?keyword=EM:10016 - EM:04025 C57BL/6NTac-Ino80e/Cnrm EMMA embryo mutant strain MGI:4433084 Ino80e targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2141881 Ino80e INO80 complex subunit E https://www.infrafrontier.eu/search?keyword=EM:04025 - EM:04025 C57BL/6NTac-Ino80e/Cnrm EMMA sperm mutant strain MGI:4433084 Ino80e targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2141881 Ino80e INO80 complex subunit E https://www.infrafrontier.eu/search?keyword=EM:04025 + EM:07816 C57BL/6NTac-Ino80/IcsOrl EMMA archived mutant strain MGI:4436542 Ino80 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915392 Ino80 INO80 complex subunit https://www.infrafrontier.eu/search?keyword=EM:07816 + EM:10038 C57BL/6NTac-Il7/WtsiIeg EMMA sperm mutant strain MGI:5633768 Il7 targeted mutation 2, Wellcome Trust Sanger Institute MGI:96561 Il7 interleukin 7 https://www.infrafrontier.eu/search?keyword=EM:10038 + EM:05520 C57BL/6NTac-Il22ra1/WtsiOulu EMMA embryo mutant strain MGI:4431742 Il22ra1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2663588 Il22ra1 interleukin 22 receptor, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:05520 ? EM:14353 C57BL/6NTac-Ikbke/WtsiCnbc EMMA embryo mutant strain Ikbke Sanger Institute targeted mutation 1, Wellcome Trust Sanger Institute MGI:1929612 Ikbke inhibitor of kappaB kinase epsilon https://www.infrafrontier.eu/search?keyword=EM:14353 ? EM:14353 C57BL/6NTac-Ikbke/WtsiCnbc EMMA sperm mutant strain Ikbke Sanger Institute targeted mutation 1, Wellcome Trust Sanger Institute MGI:1929612 Ikbke inhibitor of kappaB kinase epsilon https://www.infrafrontier.eu/search?keyword=EM:14353 - EM:06359 C57BL/6NTac-Igfbp3/H EMMA sperm mutant strain MGI:4363852 Igfbp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96438 Igfbp3 insulin-like growth factor binding protein 3 https://www.infrafrontier.eu/search?keyword=EM:06359 + EM:07714 C57BL/6NTac-Ift20/IcsOrl EMMA archived mutant strain MGI:4431815 Ift20 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915585 Ift20 intraflagellar transport 20 https://www.infrafrontier.eu/search?keyword=EM:07714 + EM:09158 C57BL/6NTac-Ift140/WtsiPh EMMA archived mutant strain MGI:4363217 Ift140 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2146906 Ift140 intraflagellar transport 140 https://www.infrafrontier.eu/search?keyword=EM:09158 + EM:07822 C57BL/6NTac-Ift122/IcsOrl EMMA archived mutant strain MGI:4432086 Ift122 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1932386 Ift122 intraflagellar transport 122 https://www.infrafrontier.eu/search?keyword=EM:07822 + EM:05803 C57BL/6NTac-Ido1/WtsiCnbc EMMA embryo mutant strain MGI:4432044 Ido1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96416 Ido1 indoleamine 2,3-dioxygenase 1 https://www.infrafrontier.eu/search?keyword=EM:05803 + EM:05803 C57BL/6NTac-Ido1/WtsiCnbc EMMA sperm mutant strain MGI:4432044 Ido1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96416 Ido1 indoleamine 2,3-dioxygenase 1 https://www.infrafrontier.eu/search?keyword=EM:05803 - EM:04551 C57BL/6NTac-Ibsp/Cnrm EMMA embryo mutant strain MGI:4434523 Ibsp targeted mutation 1e, Wellcome Trust Sanger Institute MGI:96389 Ibsp integrin binding sialoprotein https://www.infrafrontier.eu/search?keyword=EM:04551 - EM:04551 C57BL/6NTac-Ibsp/Cnrm EMMA sperm mutant strain MGI:4434523 Ibsp targeted mutation 1e, Wellcome Trust Sanger Institute MGI:96389 Ibsp integrin binding sialoprotein https://www.infrafrontier.eu/search?keyword=EM:04551 - EM:07642 C57BL/6NTac-Iah1/IcsOrl EMMA archived mutant strain MGI:4435023 Iah1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914982 Iah1 isoamyl acetate-hydrolyzing esterase 1 homolog https://www.infrafrontier.eu/search?keyword=EM:07642 + EM:05264 C57BL/6NTac-Hsph1/Cnrm EMMA sperm mutant strain MGI:4431540 Hsph1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105053 Hsph1 heat shock 105kDa/110kDa protein 1 https://www.infrafrontier.eu/search?keyword=EM:05264 - EM:04414 C57BL/6NTac-Hsf2bp/Cnrm EMMA embryo mutant strain MGI:4435082 Hsf2bp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921627 Hsf2bp heat shock transcription factor 2 binding protein https://www.infrafrontier.eu/search?keyword=EM:04414 - EM:04414 C57BL/6NTac-Hsf2bp/Cnrm EMMA sperm mutant strain MGI:4435082 Hsf2bp targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921627 Hsf2bp heat shock transcription factor 2 binding protein https://www.infrafrontier.eu/search?keyword=EM:04414 + EM:10710 C57BL/6NTac-Hrg/WtsiIeg EMMA sperm mutant strain MGI:5633767 Hrg targeted mutation 1, Wellcome Trust Sanger Institute MGI:2146636 Hrg histidine-rich glycoprotein https://www.infrafrontier.eu/search?keyword=EM:10710 - EM:09448 C57BL/6NTac-Hoxa3/Cnrm EMMA sperm mutant strain MGI:5633766 Hoxa3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:96175 Hoxa3 homeobox A3 https://www.infrafrontier.eu/search?keyword=EM:09448 + EM:12333 C57BL/6NTac-Hoxa2/Ics EMMA sperm mutant strain Hoxa2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:96174 Hoxa2 homeobox A2 https://www.infrafrontier.eu/search?keyword=EM:12333 - EM:09551 C57BL/6NTac-Hnf4a/WtsiIeg EMMA sperm mutant strain MGI:5632505 Hnf4a targeted mutation 1, Wellcome Trust Sanger Institute MGI:109128 Hnf4a hepatic nuclear factor 4, alpha https://www.infrafrontier.eu/search?keyword=EM:09551 + EM:09688 C57BL/6NTac-Hmox2/H EMMA sperm mutant strain MGI:4434868 Hmox2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109373 Hmox2 heme oxygenase 2 https://www.infrafrontier.eu/search?keyword=EM:09688 + EM:05901 C57BL/6NTac-Hira/WtsiIeg EMMA sperm mutant strain MGI:4431679 Hira targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99430 Hira histone cell cycle regulator https://www.infrafrontier.eu/search?keyword=EM:05901 - EM:05113 C57BL/6NTac-Hipk2/Cnrm EMMA sperm mutant strain MGI:4435696 Hipk2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1314872 Hipk2 homeodomain interacting protein kinase 2 https://www.infrafrontier.eu/search?keyword=EM:05113 + EM:12335 C57BL/6NTac-Hhip/Ics EMMA sperm mutant strain Hhip EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1341847 Hhip Hedgehog-interacting protein https://www.infrafrontier.eu/search?keyword=EM:12335 - EM:08960 C57BL/6NTac-Hes5/Cnrm EMMA sperm mutant strain MGI:5632504 Hes5 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:104876 Hes5 hes family bHLH transcription factor 5 https://www.infrafrontier.eu/search?keyword=EM:08960 + EM:04583 C57BL/6NTac-Hells/Ieg EMMA embryo EPD0102_4_A04 mutant strain MGI:4431905 Hells targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106209 Hells helicase, lymphoid specific https://www.infrafrontier.eu/search?keyword=EM:04583 ? EM:14094 C57BL/6NTac-Heatr6/WtsiOulu EMMA embryo mutant strain MGI:4364452 Heatr6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919790 Heatr6 HEAT repeat containing 6 https://www.infrafrontier.eu/search?keyword=EM:14094 ? EM:14094 C57BL/6NTac-Heatr6/WtsiOulu EMMA sperm mutant strain MGI:4364452 Heatr6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919790 Heatr6 HEAT repeat containing 6 https://www.infrafrontier.eu/search?keyword=EM:14094 + EM:07726 C57BL/6NTac-Heatr3/IcsOrl EMMA archived mutant strain MGI:4435825 Heatr3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444491 Heatr3 HEAT repeat containing 3 https://www.infrafrontier.eu/search?keyword=EM:07726 + EM:10703 C57BL/6NTac-Hdc/WtsiIeg EMMA sperm mutant strain MGI:5632502 Hdc targeted mutation 2, Wellcome Trust Sanger Institute MGI:96062 Hdc histidine decarboxylase https://www.infrafrontier.eu/search?keyword=EM:10703 + EM:05717 C57BL/6NTac-Hdac8/WtsiBiat EMMA sperm mutant strain MGI:4432268 Hdac8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917565 Hdac8 histone deacetylase 8 https://www.infrafrontier.eu/search?keyword=EM:05717 + EM:07737 C57BL/6NTac-Hcn4/IcsOrl EMMA sperm mutant strain MGI:4435096 Hcn4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1298209 Hcn4 hyperpolarization-activated, cyclic nucleotide-gated K+ 4 https://www.infrafrontier.eu/search?keyword=EM:07737 + EM:11725 C57BL/6NTac-Hcn1/H EMMA live mutant strain MGI:6149894 Hcn1 endonuclease mediated mutation 2, Harwell MGI:1096392 Hcn1 hyperpolarization activated cyclic nucleotide gated potassium channel 1 https://www.infrafrontier.eu/search?keyword=EM:11725 + EM:11420 C57BL/6NTac-Hcn1/H EMMA sperm mutant strain MGI:6153798 Hcn1 endonuclease-mediated mutation 1, Harwell MGI:1096392 Hcn1 hyperpolarization activated cyclic nucleotide gated potassium channel 1 https://www.infrafrontier.eu/search?keyword=EM:11420 + EM:11420 C57BL/6NTac-Hcn1/H EMMA live mutant strain MGI:6153798 Hcn1 endonuclease-mediated mutation 1, Harwell MGI:1096392 Hcn1 hyperpolarization activated cyclic nucleotide gated potassium channel 1 https://www.infrafrontier.eu/search?keyword=EM:11420 ? EM:13678 C57BL/6NTac-Harbi1/H EMMA live mutant strain MGI:4435117 Harbi1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443194 Harbi1 harbinger transposase derived 1 https://www.infrafrontier.eu/search?keyword=EM:13678 ? EM:13980 C57BL/6NTac-Hacl1/WtsiOulu EMMA embryo mutant strain MGI:4362181 Hacl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929657 Hacl1 2-hydroxyacyl-CoA lyase 1 https://www.infrafrontier.eu/search?keyword=EM:13980 ? EM:13980 C57BL/6NTac-Hacl1/WtsiOulu EMMA sperm mutant strain MGI:4362181 Hacl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929657 Hacl1 2-hydroxyacyl-CoA lyase 1 https://www.infrafrontier.eu/search?keyword=EM:13980 + EM:07643 C57BL/6NTac-H6pd/IcsOrl EMMA archived mutant strain MGI:4432827 H6pd targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2140356 H6pd hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase) https://www.infrafrontier.eu/search?keyword=EM:07643 ? EM:13811 C57BL/6NTac-Gzmk/IcsOrl EMMA sperm mutant strain Gzmk Gzmk MGI:1298232 Gzmk granzyme K https://www.infrafrontier.eu/search?keyword=EM:13811 + EM:09981 C57BL/6NTac-Gzmk/IcsOrl EMMA sperm mutant strain MGI:4362377 Gzmk targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1298232 Gzmk granzyme K https://www.infrafrontier.eu/search?keyword=EM:09981 + EM:11261 C57BL/6NTac-Gtpbp3/WtsiPh EMMA sperm mutant strain MGI:4364401 Gtpbp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917609 Gtpbp3 GTP binding protein 3 https://www.infrafrontier.eu/search?keyword=EM:11261 + EM:10194 C57BL/6NTac-Gtf2h2/WtsiCnrm EMMA sperm mutant strain MGI:4432932 Gtf2h2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1345669 Gtf2h2 general transcription factor II H, polypeptide 2 https://www.infrafrontier.eu/search?keyword=EM:10194 + EM:05490 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA embryo C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285396 Gt(ROSA)26Sor targeted mutation 2, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:05490 + EM:05490 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA sperm C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285396 Gt(ROSA)26Sor targeted mutation 2, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:05490 + EM:05490 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA live C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285396 Gt(ROSA)26Sor targeted mutation 2, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:05490 + EM:11220 C57BL/6NTac-Gt(ROSA)26Sor/WtsiIeg EMMA sperm mutant strain Gt(ROSA)26Sor EUCOMM targeted mutation 1, Wellcome Trust Sanger Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:11220 + EM:05488 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA embryo C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285392 Gt(ROSA)26Sor targeted mutation 1, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:05488 + EM:05488 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA sperm C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285392 Gt(ROSA)26Sor targeted mutation 1, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:05488 + EM:05488 C57BL/6NTac-Gt(ROSA)26Sor/Ics EMMA live C57BL/6N-Gt(ROSA)26Sor mutant strain MGI:5285392 Gt(ROSA)26Sor targeted mutation 1, Mouse Clinical Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:05488 + EM:09604 C57BL/6NTac-Gsdme/WtsiOulu EMMA embryo mutant strain MGI:4363231 Gsdme targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1889850 Gsdme gasdermin E https://www.infrafrontier.eu/search?keyword=EM:09604 + EM:09604 C57BL/6NTac-Gsdme/WtsiOulu EMMA sperm mutant strain MGI:4363231 Gsdme targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1889850 Gsdme gasdermin E https://www.infrafrontier.eu/search?keyword=EM:09604 + EM:10838 C57BL/6NTac-Grp/H EMMA live Grp-DEL483INS5-EM2-B6N Grp-DEL483INS5-EM2-B6N, C57BL/6N-Grp/H, H-Grp-DEL483INS5-EM2-B6N (IMPC) mutant strain MGI:5749871 Grp endonuclease-mediated mutation 2, Harwell MGI:95833 Grp gastrin releasing peptide https://www.infrafrontier.eu/search?keyword=EM:10838 + EM:10765 C57BL/6NTac-Grp/H EMMA sperm C57BL/6N-Grp/H, Grp-DEL2DEL396-EM1-B6N mutant strain MGI:5749869 Grp endonuclease-mediated mutation 1, Harwell MGI:95833 Grp gastrin releasing peptide https://www.infrafrontier.eu/search?keyword=EM:10765 + EM:11317 C57BL/6NTac-Grm7/H EMMA sperm mutant strain MGI:6149200 Grm7 endonuclease mediated mutation 1, Harwell MGI:1351344 Grm7 glutamate receptor, metabotropic 7 https://www.infrafrontier.eu/search?keyword=EM:11317 + EM:12463 C57BL/6NTac-Grm1/H EMMA sperm mutant strain MGI:6266821 Grm1 endonuclease-mediated mutation 2, Harwell MGI:1351338 Grm1 glutamate receptor, metabotropic 1 https://www.infrafrontier.eu/search?keyword=EM:12463 + EM:12530 C57BL/6NTac-Grm1/H EMMA sperm unclassified MGI:6451428 Grm1 endonuclease-mediated mutation 1, Harwell MGI:1351338 Grm1 glutamate receptor, metabotropic 1 https://www.infrafrontier.eu/search?keyword=EM:12530 - EM:09776 C57BL/6NTac-Grin2c/WtsiH EMMA sperm mutant strain MGI:5632501 Grin2c targeted mutation 1, Wellcome Trust Sanger Institute MGI:95822 Grin2c glutamate receptor, ionotropic, NMDA2C (epsilon 3) https://www.infrafrontier.eu/search?keyword=EM:09776 + EM:07681 C57BL/6NTac-Grhl3/IcsOrl EMMA sperm mutant strain MGI:4433681 Grhl3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2655333 Grhl3 grainyhead like transcription factor 3 https://www.infrafrontier.eu/search?keyword=EM:07681 - EM:08948 C57BL/6NTac-Gpx3/WtsiH EMMA sperm mutant strain MGI:5632499 Gpx3 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:105102 Gpx3 glutathione peroxidase 3 https://www.infrafrontier.eu/search?keyword=EM:08948 - EM:08854 C57BL/6NTac-Gpx3/WtsiH EMMA sperm mutant strain MGI:5632500 Gpx3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:105102 Gpx3 glutathione peroxidase 3 https://www.infrafrontier.eu/search?keyword=EM:08854 + EM:12378 C57BL/6NTac-Gprin1/H EMMA sperm mutant strain MGI:6153795 Gprin1 endonuclease-mediated mutation 1, Harwell MGI:1349455 Gprin1 G protein-regulated inducer of neurite outgrowth 1 https://www.infrafrontier.eu/search?keyword=EM:12378 + EM:10175 C57BL/6NTac-Gpr88/Cnrm EMMA sperm mutant strain MGI:5811828 Gpr88 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1927653 Gpr88 G-protein coupled receptor 88 https://www.infrafrontier.eu/search?keyword=EM:10175 ? EM:11307 C57BL/6NTac-Gnl3/WtsiOrl EMMA sperm mutant strain Gnl3 Sanger Institute targeted mutation 1, Wellcome Trust Sanger Institute MGI:1353651 Gnl3 guanine nucleotide binding protein-like 3 (nucleolar) https://www.infrafrontier.eu/search?keyword=EM:11307 + EM:12308 C57BL/6NTac-Gngt2/Ics EMMA sperm mutant strain Gngt2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:893584 Gngt2 guanine nucleotide binding protein (G protein), gamma transducing activity polypeptide 2 https://www.infrafrontier.eu/search?keyword=EM:12308 - EM:09778 C57BL/6NTac-Gng7/WtsiH EMMA sperm mutant strain MGI:5632498 Gng7 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95787 Gng7 guanine nucleotide binding protein (G protein), gamma 7 https://www.infrafrontier.eu/search?keyword=EM:09778 + EM:10716 C57BL/6NTac-Gng4/WtsiIeg EMMA sperm mutant strain MGI:5660016 Gng4 targeted mutation 2, Wellcome Trust Sanger Institute MGI:102703 Gng4 guanine nucleotide binding protein (G protein), gamma 4 https://www.infrafrontier.eu/search?keyword=EM:10716 + EM:12372 C57BL/6NTac-Gng11/H EMMA sperm mutant strain MGI:6153855 Gng11 endonuclease-mediated mutation 1, Harwell MGI:1913316 Gng11 guanine nucleotide binding protein (G protein), gamma 11 https://www.infrafrontier.eu/search?keyword=EM:12372 + EM:10758 C57BL/6NTac-Gnb4/H EMMA sperm C57BL/6N-Gnb4/H, GNB4-DEL617-EM1-B6N, C57BL/6N-Gnb4/H mutant strain MGI:5755155 Gnb4 endonuclease-mediated mutation 1, Harwell MGI:104581 Gnb4 guanine nucleotide binding protein (G protein), beta 4 https://www.infrafrontier.eu/search?keyword=EM:10758 - EM:08855 C57BL/6NTac-Gnai2/WtsiH EMMA sperm mutant strain MGI:5632497 Gnai2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95772 Gnai2 guanine nucleotide binding protein (G protein), alpha inhibiting 2 https://www.infrafrontier.eu/search?keyword=EM:08855 + EM:10091 C57BL/6NTac-Gnai1/WtsiIeg EMMA sperm mutant strain MGI:5632496 Gnai1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:95771 Gnai1 guanine nucleotide binding protein (G protein), alpha inhibiting 1 https://www.infrafrontier.eu/search?keyword=EM:10091 - EM:04385 C57BL/6NTac-Gna11/Cnrm EMMA embryo mutant strain MGI:4432307 Gna11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95766 Gna11 guanine nucleotide binding protein, alpha 11 https://www.infrafrontier.eu/search?keyword=EM:04385 - EM:04385 C57BL/6NTac-Gna11/Cnrm EMMA sperm mutant strain MGI:4432307 Gna11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95766 Gna11 guanine nucleotide binding protein, alpha 11 https://www.infrafrontier.eu/search?keyword=EM:04385 + EM:07710 C57BL/6NTac-Gmfg/IcsOrl EMMA sperm mutant strain MGI:4434689 Gmfg targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1927135 Gmfg glia maturation factor, gamma https://www.infrafrontier.eu/search?keyword=EM:07710 + EM:09706 C57BL/6NTac-Gmds/WtsiIeg EMMA sperm mutant strain MGI:4363597 Gmds targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891112 Gmds GDP-mannose 4, 6-dehydratase https://www.infrafrontier.eu/search?keyword=EM:09706 + EM:08391 C57BL/6NTac-Gm5544/WtsiOrl EMMA sperm mutant strain MGI:4364386 Gm5544 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3648209 Gm5544 predicted gene 5544 https://www.infrafrontier.eu/search?keyword=EM:08391 + EM:04485 C57BL/6NTac-Gm5134/H EMMA sperm mutant strain MGI:4435240 Gm5134 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3646667 Gm5134 predicted gene 5134 https://www.infrafrontier.eu/search?keyword=EM:04485 - EM:08143 C57BL/6NTac-Gm16379/WtsiCnrm EMMA sperm C57BL/6NTac-Mif-ps6/WtsiCnrm mutant strain MGI:4364434 Mif-ps6 targeted mutation 1a, Wellcome Trust Sanger Institute Gm16379 withdrawn, = Mif-ps6 https://www.infrafrontier.eu/search?keyword=EM:08143 + EM:06207 C57BL/6NTac-Gm12258/Ics EMMA embryo mutant strain MGI:4436398 Gm12258 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3651534 Gm12258 predicted gene 12258 https://www.infrafrontier.eu/search?keyword=EM:06207 ? EM:13669 C57BL/6NTac-Glt8d2/WtsiOrl EMMA sperm mutant strain MGI:4364018 Glt8d2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922032 Glt8d2 glycosyltransferase 8 domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:13669 + EM:12534 C57BL/6NTac-Gldc/H EMMA sperm unclassified MGI:6451426 Gldc endonuclease-mediated mutation 1, Harwell MGI:1341155 Gldc glycine decarboxylase https://www.infrafrontier.eu/search?keyword=EM:12534 + EM:08261 C57BL/6NTac-Gimap6/WtsiPh EMMA sperm mutant strain MGI:4364125 Gimap6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918876 Gimap6 GTPase, IMAP family member 6 https://www.infrafrontier.eu/search?keyword=EM:08261 + EM:04434 C57BL/6NTac-Ggt1/H EMMA sperm EPD0183_3_C02, GGT1-B6N-USA mutant strain MGI:4432621 Ggt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95706 Ggt1 gamma-glutamyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:04434 + EM:07321 C57BL/6NTac-Gfpt1/H EMMA sperm mutant strain MGI:4431600 Gfpt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95698 Gfpt1 glutamine fructose-6-phosphate transaminase 1 https://www.infrafrontier.eu/search?keyword=EM:07321 + EM:05706 C57BL/6NTac-Gfm1/WtsiBiat EMMA archived mutant strain MGI:4432285 Gfm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107339 Gfm1 G elongation factor, mitochondrial 1 https://www.infrafrontier.eu/search?keyword=EM:05706 + EM:06985 C57BL/6NTac-Gfi1b/H EMMA sperm mutant strain MGI:4434882 Gfi1b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1276578 Gfi1b growth factor independent 1B https://www.infrafrontier.eu/search?keyword=EM:06985 + EM:12291 C57BL/6NTac-Gdf9/Ics EMMA sperm mutant strain Gdf9 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:95692 Gdf9 growth differentiation factor 9 https://www.infrafrontier.eu/search?keyword=EM:12291 + EM:10851 C57BL/6NTac-Gcsh/H EMMA sperm C57BL/6NTac-Gcsh mutant strain MGI:6153793 Gcsh endonuclease-mediated mutation 1, Harwell MGI:1915383 Gcsh glycine cleavage system protein H (aminomethyl carrier) https://www.infrafrontier.eu/search?keyword=EM:10851 + EM:05085 C57BL/6NTac-Gclc/WtsiCnbc EMMA embryo mutant strain MGI:4432329 Gclc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104990 Gclc glutamate-cysteine ligase, catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:05085 + EM:05085 C57BL/6NTac-Gclc/WtsiCnbc EMMA sperm mutant strain MGI:4432329 Gclc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104990 Gclc glutamate-cysteine ligase, catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:05085 - EM:11645 C57BL/6NTac-Gckr/H EMMA live mutant strain MGI:6149159 Gckr endonuclease mediated mutation 2, Harwell MGI:1096345 Gckr glucokinase regulatory protein https://www.infrafrontier.eu/search?keyword=EM:11645 + EM:11406 C57BL/6NTac-Gckr/H EMMA live C57BL/6N-Gckr/H mutant strain MGI:6149158 Gckr endonuclease mediated mutation 1, Harwell MGI:1096345 Gckr glucokinase regulatory protein https://www.infrafrontier.eu/search?keyword=EM:11406 + EM:11373 C57BL/6NTac-Gck/H EMMA sperm mutant strain MGI:6149199 Gck endonuclease mediated mutation 1, Harwell MGI:1270854 Gck glucokinase https://www.infrafrontier.eu/search?keyword=EM:11373 + EM:10030 C57BL/6NTac-Gchfr/WtsiIeg EMMA sperm mutant strain MGI:5632495 Gchfr targeted mutation 2, Wellcome Trust Sanger Institute MGI:2443977 Gchfr GTP cyclohydrolase I feedback regulator https://www.infrafrontier.eu/search?keyword=EM:10030 + EM:05385 C57BL/6NTac-Gba2/WtsiCnbc EMMA embryo mutant strain MGI:4433071 Gba2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2654325 Gba2 glucosidase beta 2 https://www.infrafrontier.eu/search?keyword=EM:05385 + EM:05385 C57BL/6NTac-Gba2/WtsiCnbc EMMA sperm mutant strain MGI:4433071 Gba2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2654325 Gba2 glucosidase beta 2 https://www.infrafrontier.eu/search?keyword=EM:05385 + EM:06283 C57BL/6NTac-Gatm/Ieg EMMA embryo mutant strain MGI:4362557 Gatm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914342 Gatm glycine amidinotransferase (L-arginine:glycine amidinotransferase) https://www.infrafrontier.eu/search?keyword=EM:06283 + EM:10059 C57BL/6NTac-Gata2/WtsiIeg EMMA sperm mutant strain MGI:5632494 Gata2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95662 Gata2 GATA binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:10059 - EM:09552 C57BL/6NTac-Gast/WtsiIeg EMMA sperm mutant strain MGI:5632493 Gast targeted mutation 1, Wellcome Trust Sanger Institute MGI:104768 Gast gastrin https://www.infrafrontier.eu/search?keyword=EM:09552 + EM:12329 C57BL/6NTac-Gas2/Ics EMMA sperm mutant strain Gas2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:95657 Gas2 growth arrest specific 2 https://www.infrafrontier.eu/search?keyword=EM:12329 + EM:07676 C57BL/6NTac-Gar1/IcsOrl EMMA archived mutant strain MGI:4432700 Gar1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1930948 Gar1 GAR1 ribonucleoprotein https://www.infrafrontier.eu/search?keyword=EM:07676 - EM:09770 C57BL/6NTac-Gap43/WtsiH EMMA sperm mutant strain MGI:5632492 Gap43 targeted mutation 2, Wellcome Trust Sanger Institute MGI:95639 Gap43 growth associated protein 43 https://www.infrafrontier.eu/search?keyword=EM:09770 + EM:08941 C57BL/6NTac-Galntl5/WtsiOulu EMMA embryo mutant strain MGI:4363889 Galntl5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915159 Galntl5 UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase-like 5 https://www.infrafrontier.eu/search?keyword=EM:08941 + EM:08941 C57BL/6NTac-Galntl5/WtsiOulu EMMA sperm mutant strain MGI:4363889 Galntl5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915159 Galntl5 UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase-like 5 https://www.infrafrontier.eu/search?keyword=EM:08941 + EM:08238 C57BL/6NTac-Galk2/Ieg EMMA sperm mutant strain MGI:4435970 Galk2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917226 Galk2 galactokinase 2 https://www.infrafrontier.eu/search?keyword=EM:08238 + EM:12467 C57BL/6NTac-Gabra2/H EMMA sperm mutant strain MGI:6149191 Gabra2 endonuclease mediated mutation 1, Harwell MGI:95614 Gabra2 gamma-aminobutyric acid (GABA) A receptor, subunit alpha 2 https://www.infrafrontier.eu/search?keyword=EM:12467 - EM:04412 C57BL/6NTac-Furin/Cnrm EMMA embryo mutant strain MGI:4434157 Furin targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97513 Furin furin (paired basic amino acid cleaving enzyme) https://www.infrafrontier.eu/search?keyword=EM:04412 - EM:04412 C57BL/6NTac-Furin/Cnrm EMMA sperm mutant strain MGI:4434157 Furin targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97513 Furin furin (paired basic amino acid cleaving enzyme) https://www.infrafrontier.eu/search?keyword=EM:04412 - EM:09765 C57BL/6NTac-Fto/WtsiH EMMA sperm mutant strain MGI:5632490 Fto targeted mutation 1, Wellcome Trust Sanger Institute MGI:1347093 Fto fat mass and obesity associated https://www.infrafrontier.eu/search?keyword=EM:09765 + EM:10770 C57BL/6NTac-Frmd6/H EMMA archived mutant strain MGI:6149190 Frmd6 endonuclease mediated mutation 1, Harwell MGI:2442579 Frmd6 FERM domain containing 6 https://www.infrafrontier.eu/search?keyword=EM:10770 + EM:07719 C57BL/6NTac-Fpgs/IcsOrl EMMA archived mutant strain MGI:4435288 Fpgs targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:95576 Fpgs folylpolyglutamyl synthetase https://www.infrafrontier.eu/search?keyword=EM:07719 + EM:07713 C57BL/6NTac-Flot2/IcsOrl EMMA archived mutant strain MGI:4433811 Flot2 targeted mutation 2e, Wellcome Trust Sanger Institute MGI:103309 Flot2 flotillin 2 https://www.infrafrontier.eu/search?keyword=EM:07713 - EM:07725 C57BL/6NTac-Fkbp9/IcsOrl EMMA archived mutant strain MGI:4435917 Fkbp9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1350921 Fkbp9 FK506 binding protein 9 https://www.infrafrontier.eu/search?keyword=EM:07725 + EM:07823 C57BL/6NTac-Fkbp10/IcsOrl EMMA archived mutant strain MGI:5432211 Fkbp10 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:104769 Fkbp10 FK506 binding protein 10 https://www.infrafrontier.eu/search?keyword=EM:07823 ? EM:14355 C57BL/6NTac-Filip1/WtsiCnbc EMMA sperm mutant strain Filip1 KOMP targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1917848 Filip1 filamin A interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:14355 - EM:07970 C57BL/6NTac-Fgf9/H EMMA sperm C57BL/6N-Fgf9/H mutant strain MGI:4364690 Fgf9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104723 Fgf9 fibroblast growth factor 9 https://www.infrafrontier.eu/search?keyword=EM:07970 - EM:08180 C57BL/6NTac-Fgf2/H EMMA sperm C57BL/6N-Fgf2/H mutant strain MGI:4433040 Fgf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95516 Fgf2 fibroblast growth factor 2 https://www.infrafrontier.eu/search?keyword=EM:08180 - EM:04411 C57BL/6NTac-Fgf11/Cnrm EMMA embryo mutant strain MGI:4432799 Fgf11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109167 Fgf11 fibroblast growth factor 11 https://www.infrafrontier.eu/search?keyword=EM:04411 - EM:04411 C57BL/6NTac-Fgf11/Cnrm EMMA sperm mutant strain MGI:4432799 Fgf11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109167 Fgf11 fibroblast growth factor 11 https://www.infrafrontier.eu/search?keyword=EM:04411 - EM:09735 C57BL/6NTac-Fga/WtsiH EMMA sperm mutant strain MGI:5632489 Fga targeted mutation 2, Wellcome Trust Sanger Institute MGI:1316726 Fga fibrinogen alpha chain https://www.infrafrontier.eu/search?keyword=EM:09735 + EM:11125 C57BL/6NTac-Fcgr1/WtsiH EMMA sperm C57BL/6NTac-Fcgr1/Wtsi, C57BL/6NTac-Fcgr1/Wtsi mutant strain MGI:5660015 Fcgr1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95498 Fcgr1 Fc receptor, IgG, high affinity I https://www.infrafrontier.eu/search?keyword=EM:11125 + EM:07208 C57BL/6NTac-Fbxo33/WtsiCnrm EMMA sperm mutant strain MGI:4432600 Fbxo33 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917861 Fbxo33 F-box protein 33 https://www.infrafrontier.eu/search?keyword=EM:07208 - EM:10990 C57BL/6NTac-Fam71b/WtsiPh EMMA sperm C57BL/6NTac-Garin3/WtsiPh mutant strain MGI:4364165 Garin3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3650836 Garin3 golgi associated RAB2 interactor 3 https://www.infrafrontier.eu/search?keyword=EM:10990 - EM:04359 C57BL/6NTac-Fam234b/Cnrm EMMA embryo mutant strain MGI:4432729 Fam234b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921775 Fam234b family with sequence similarity 234, member B https://www.infrafrontier.eu/search?keyword=EM:04359 - EM:04359 C57BL/6NTac-Fam234b/Cnrm EMMA sperm mutant strain MGI:4432729 Fam234b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1921775 Fam234b family with sequence similarity 234, member B https://www.infrafrontier.eu/search?keyword=EM:04359 - EM:04544 C57BL/6NTac-Fam110b/Cnrm EMMA embryo mutant strain MGI:4432846 Fam110b targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1916593 Fam110b family with sequence similarity 110, member B https://www.infrafrontier.eu/search?keyword=EM:04544 - EM:04544 C57BL/6NTac-Fam110b/Cnrm EMMA sperm mutant strain MGI:4432846 Fam110b targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1916593 Fam110b family with sequence similarity 110, member B https://www.infrafrontier.eu/search?keyword=EM:04544 + EM:06090 C57BL/6NTac-Fahd2a/WtsiCnbc EMMA sperm mutant strain MGI:4431777 Fahd2a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915376 Fahd2a fumarylacetoacetate hydrolase domain containing 2A https://www.infrafrontier.eu/search?keyword=EM:06090 + EM:12360 C57BL/6NTac-Fabp7/H EMMA sperm mutant strain MGI:6153790 Fabp7 endonuclease-mediated mutation 1, Harwell MGI:101916 Fabp7 fatty acid binding protein 7, brain https://www.infrafrontier.eu/search?keyword=EM:12360 + EM:07665 C57BL/6NTac-Fabp3/IcsOrl EMMA sperm mutant strain MGI:4431873 Fabp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95476 Fabp3 fatty acid binding protein 3, muscle and heart https://www.infrafrontier.eu/search?keyword=EM:07665 + EM:09830 C57BL/6NTac-Fabp1/Cnrm EMMA sperm C57BL/6NTac-Fabp1/Cnrm mutant strain MGI:5660005 Fabp1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:95479 Fabp1 fatty acid binding protein 1, liver https://www.infrafrontier.eu/search?keyword=EM:09830 + EM:07648 C57BL/6NTac-Fabp12/IcsOrl EMMA archived mutant strain MGI:4433784 Fabp12 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922747 Fabp12 fatty acid binding protein 12 https://www.infrafrontier.eu/search?keyword=EM:07648 + EM:05974 C57BL/6NTac-Ezr/WtsiBiat EMMA sperm mutant strain MGI:4431855 Ezr targeted mutation 2a, Wellcome Trust Sanger Institute MGI:98931 Ezr ezrin https://www.infrafrontier.eu/search?keyword=EM:05974 + EM:05698 C57BL/6NTac-Ezh2/WtsiIeg EMMA sperm mutant strain MGI:4432638 Ezh2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107940 Ezh2 enhancer of zeste 2 polycomb repressive complex 2 subunit https://www.infrafrontier.eu/search?keyword=EM:05698 + EM:08714 C57BL/6NTac-Ethe1/H EMMA sperm mutant strain MGI:4432299 Ethe1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913321 Ethe1 ethylmalonic encephalopathy 1 https://www.infrafrontier.eu/search?keyword=EM:08714 + EM:12259 C57BL/6NTac-Ermn/H EMMA sperm mutant strain MGI:6153851 Ermn endonuclease-mediated mutation 1, Harwell MGI:1925017 Ermn ermin, ERM-like protein https://www.infrafrontier.eu/search?keyword=EM:12259 + EM:09757 C57BL/6NTac-Epx/WtsiH EMMA sperm C57BL/6NTac-Epx/WtsiH mutant strain MGI:5660003 Epx targeted mutation 1, Wellcome Trust Sanger Institute MGI:107569 Epx eosinophil peroxidase https://www.infrafrontier.eu/search?keyword=EM:09757 + EM:07716 C57BL/6NTac-Ephx1/IcsOrl EMMA sperm mutant strain MGI:4434687 Ephx1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:95405 Ephx1 epoxide hydrolase 1, microsomal https://www.infrafrontier.eu/search?keyword=EM:07716 - EM:05198 C57BL/6NTac-Epc2/Ieg EMMA embryo mutant strain MGI:4431957 Epc2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1278321 Epc2 enhancer of polycomb homolog 2 https://www.infrafrontier.eu/search?keyword=EM:05198 - EM:08971 C57BL/6NTac-Eomes/Cnrm EMMA sperm mutant strain MGI:5632488 Eomes targeted mutation 1, Wellcome Trust Sanger Institute MGI:1201683 Eomes eomesodermin https://www.infrafrontier.eu/search?keyword=EM:08971 ? EM:14016 C57BL/6NTac-Entpd6/WtsiOulu EMMA embryo mutant strain MGI:4363445 Entpd6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202295 Entpd6 ectonucleoside triphosphate diphosphohydrolase 6 https://www.infrafrontier.eu/search?keyword=EM:14016 ? EM:14016 C57BL/6NTac-Entpd6/WtsiOulu EMMA sperm mutant strain MGI:4363445 Entpd6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202295 Entpd6 ectonucleoside triphosphate diphosphohydrolase 6 https://www.infrafrontier.eu/search?keyword=EM:14016 - EM:08963 C57BL/6NTac-Entpd5/Cnrm EMMA sperm mutant strain MGI:5632487 Entpd5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1321385 Entpd5 ectonucleoside triphosphate diphosphohydrolase 5 https://www.infrafrontier.eu/search?keyword=EM:08963 + EM:08727 C57BL/6NTac-Enpep/Ieg EMMA sperm mutant strain MGI:4363369 Enpep targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106645 Enpep glutamyl aminopeptidase https://www.infrafrontier.eu/search?keyword=EM:08727 - EM:04384 C57BL/6NTac-Emid1/Cnrm EMMA embryo mutant strain MGI:4433762 Emid1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2155091 Emid1 EMI domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:04384 - EM:04384 C57BL/6NTac-Emid1/Cnrm EMMA sperm mutant strain MGI:4433762 Emid1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2155091 Emid1 EMI domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:04384 ? EM:13687 C57BL/6NTac-Elovl4/H EMMA live mutant strain MGI:5497308 Elovl4 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1933331 Elovl4 elongation of very long chain fatty acids (FEN1/Elo2, SUR4/Elo3, yeast)-like 4 https://www.infrafrontier.eu/search?keyword=EM:13687 + EM:09951 C57BL/6NTac-Elapor1/IcsOrl EMMA archived C57BL/6NTac-5330417C22Rik/IcsOrl mutant strain MGI:4436415 Elapor1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923930 Elapor1 endosome-lysosome associated apoptosis and autophagy regulator 1 https://www.infrafrontier.eu/search?keyword=EM:09951 + EM:05966 C57BL/6NTac-Elac2/WtsiBiat EMMA sperm mutant strain MGI:4456058 Elac2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1890496 Elac2 elaC ribonuclease Z 2 https://www.infrafrontier.eu/search?keyword=EM:05966 + EM:07702 C57BL/6NTac-Eif2b5/IcsOrl EMMA archived mutant strain MGI:4432328 Eif2b5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446176 Eif2b5 eukaryotic translation initiation factor 2B, subunit 5 epsilon https://www.infrafrontier.eu/search?keyword=EM:07702 + EM:05712 C57BL/6NTac-Ehd1/WtsiBiat EMMA embryo mutant strain MGI:4432418 Ehd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1341878 Ehd1 EH-domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:05712 + EM:05927 C57BL/6NTac-Efcab11/Cnrm EMMA sperm mutant strain MGI:4434986 Efcab11 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1926017 Efcab11 EF-hand calcium binding domain 11 https://www.infrafrontier.eu/search?keyword=EM:05927 - EM:04570 C57BL/6NTac-Eef2kmt/Cnrm EMMA embryo mutant strain MGI:4433018 Eef2kmt targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1917761 Eef2kmt eukaryotic elongation factor 2 lysine methyltransferase https://www.infrafrontier.eu/search?keyword=EM:04570 - EM:04570 C57BL/6NTac-Eef2kmt/Cnrm EMMA sperm mutant strain MGI:4433018 Eef2kmt targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1917761 Eef2kmt eukaryotic elongation factor 2 lysine methyltransferase https://www.infrafrontier.eu/search?keyword=EM:04570 + EM:07851 C57BL/6NTac-Eef1akmt1/WtsiOrl EMMA sperm C57BL/6NTac-N6amt2/WtsiOrl mutant strain MGI:4431797 Eef1akmt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915293 Eef1akmt1 EEF1A alpha lysine methyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:07851 + EM:09964 C57BL/6NTac-Ect2/IcsOrl EMMA sperm mutant strain MGI:4433090 Ect2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95281 Ect2 ect2 oncogene https://www.infrafrontier.eu/search?keyword=EM:09964 + EM:05789 C57BL/6NTac-Ears2/WtsiOrl EMMA sperm mutant strain MGI:4432622 Ears2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914667 Ears2 glutamyl-tRNA synthetase 2, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:05789 + EM:05795 C57BL/6NTac-Dusp4/WtsiOrl EMMA sperm mutant strain MGI:4431999 Dusp4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442191 Dusp4 dual specificity phosphatase 4 https://www.infrafrontier.eu/search?keyword=EM:05795 + EM:10346 C57BL/6NTac-Dusp3/WtsiBiat EMMA sperm mutant strain MGI:4820135 Dusp3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919599 Dusp3 dual specificity phosphatase 3 (vaccinia virus phosphatase VH1-related) https://www.infrafrontier.eu/search?keyword=EM:10346 + EM:12450 C57BL/6NTac-Dtx1/H EMMA sperm mutant strain MGI:6153785 Dtx1 endonuclease-mediated mutation 1, Harwell MGI:1352744 Dtx1 deltex 1, E3 ubiquitin ligase https://www.infrafrontier.eu/search?keyword=EM:12450 ? EM:14375 C57BL/6NTac-Dsg1b/WtsiOulu EMMA embryo mutant strain MGI:4364614 Dsg1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2664357 Dsg1b desmoglein 1 beta https://www.infrafrontier.eu/search?keyword=EM:14375 ? EM:14375 C57BL/6NTac-Dsg1b/WtsiOulu EMMA sperm mutant strain MGI:4364614 Dsg1b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2664357 Dsg1b desmoglein 1 beta https://www.infrafrontier.eu/search?keyword=EM:14375 + EM:07821 C57BL/6NTac-Drg2/IcsOrl EMMA archived mutant strain MGI:4432942 Drg2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1342307 Drg2 developmentally regulated GTP binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:07821 + EM:12310 C57BL/6NTac-Drd1/Ics EMMA sperm mutant strain Drd1 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:99578 Drd1 dopamine receptor D1 https://www.infrafrontier.eu/search?keyword=EM:12310 + EM:07639 C57BL/6NTac-Dpy19l3/IcsOrl EMMA archived mutant strain MGI:4433660 Dpy19l3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443952 Dpy19l3 dpy-19-like 3 (C. elegans) https://www.infrafrontier.eu/search?keyword=EM:07639 + EM:09968 C57BL/6NTac-Dpp4/IcsOrl EMMA sperm mutant strain MGI:4433896 Dpp4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:94919 Dpp4 dipeptidylpeptidase 4 https://www.infrafrontier.eu/search?keyword=EM:09968 + EM:04393 C57BL/6NTac-Dpm2/H EMMA sperm HEPD0510_6_G06 mutant strain MGI:4435371 Dpm2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1330238 Dpm2 dolichol-phosphate (beta-D) mannosyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:04393 + EM:05670 C57BL/6NTac-Donson/WtsiH EMMA sperm MAVY, EPD0243_2_A05 mutant strain MGI:4433969 Donson targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1890621 Donson downstream neighbor of SON https://www.infrafrontier.eu/search?keyword=EM:05670 + EM:08389 C57BL/6NTac-Dner/Ieg EMMA archived mutant strain MGI:4435871 Dner targeted mutation 3a, Helmholtz Zentrum Muenchen GmbH MGI:2152889 Dner delta/notch-like EGF repeat containing https://www.infrafrontier.eu/search?keyword=EM:08389 + EM:09690 C57BL/6NTac-Dnase1l2/WtsiH EMMA sperm mutant strain MGI:4362265 Dnase1l2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1913955 Dnase1l2 deoxyribonuclease 1-like 2 https://www.infrafrontier.eu/search?keyword=EM:09690 + EM:06204 C57BL/6NTac-Dnal4/Ics EMMA embryo mutant strain MGI:4441730 Dnal4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859217 Dnal4 dynein, axonemal, light chain 4 https://www.infrafrontier.eu/search?keyword=EM:06204 + EM:04949 C57BL/6NTac-Dnajc17/Ieg EMMA embryo mutant strain MGI:4434811 Dnajc17 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916658 Dnajc17 DnaJ heat shock protein family (Hsp40) member C17 https://www.infrafrontier.eu/search?keyword=EM:04949 + EM:04535 C57BL/6NTac-Dnajc10/H EMMA sperm HEPD0507_5_B06 mutant strain MGI:4436651 Dnajc10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914111 Dnajc10 DnaJ heat shock protein family (Hsp40) member C10 https://www.infrafrontier.eu/search?keyword=EM:04535 + EM:12330 C57BL/6NTac-Dmrtc2/Ics EMMA sperm mutant strain Dmrtc2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1918491 Dmrtc2 doublesex and mab-3 related transcription factor like family C2 https://www.infrafrontier.eu/search?keyword=EM:12330 - EM:09553 C57BL/6NTac-Dmbx1/WtsiIeg EMMA sperm mutant strain MGI:5632486 Dmbx1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2153518 Dmbx1 diencephalon/mesencephalon homeobox 1 https://www.infrafrontier.eu/search?keyword=EM:09553 + EM:04133 C57BL/6NTac-Dlec1/Ieg EMMA embryo EPD0183_3_F08 mutant strain MGI:4432388 Dlec1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443671 Dlec1 deleted in lung and esophageal cancer 1 https://www.infrafrontier.eu/search?keyword=EM:04133 - EM:09543 C57BL/6NTac-Dkk3/WtsiIeg EMMA sperm mutant strain MGI:5632485 Dkk3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1354952 Dkk3 dickkopf WNT signaling pathway inhibitor 3 https://www.infrafrontier.eu/search?keyword=EM:09543 + EM:09710 C57BL/6NTac-Dipk1a/WtsiPh EMMA sperm C57BL/6NTac-Fam69a/WtsiPh mutant strain MGI:5548321 Dipk1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914516 Dipk1a divergent protein kinase domain 1A https://www.infrafrontier.eu/search?keyword=EM:09710 + EM:08729 C57BL/6NTac-Dhdds/Ieg EMMA sperm mutant strain MGI:4362250 Dhdds targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914672 Dhdds dehydrodolichyl diphosphate synthase https://www.infrafrontier.eu/search?keyword=EM:08729 - EM:08171 C57BL/6NTac-Denr/WtsiOrl EMMA sperm mutant strain MGI:4451332 Denr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915434 Denr density-regulated protein https://www.infrafrontier.eu/search?keyword=EM:08171 + EM:07728 C57BL/6NTac-Ddx52/IcsOrl EMMA archived mutant strain MGI:4434081 Ddx52 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1925644 Ddx52 DExD box helicase 52 https://www.infrafrontier.eu/search?keyword=EM:07728 - EM:05109 C57BL/6NTac-Ddx43/Cnrm EMMA sperm mutant strain MGI:4433882 Ddx43 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3642857 Ddx43 DEAD box helicase 43 https://www.infrafrontier.eu/search?keyword=EM:05109 ? EM:13943 C57BL/6NTac-Ddhd1/WtsiOrl EMMA sperm mutant strain MGI:4362938 Ddhd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2150302 Ddhd1 DDHD domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:13943 + EM:05962 C57BL/6NTac-Dcx/WtsiBiat EMMA sperm mutant strain MGI:4441970 Dcx targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1277171 Dcx doublecortin https://www.infrafrontier.eu/search?keyword=EM:05962 + EM:09711 C57BL/6NTac-Dclk1/WtsiOrl EMMA sperm mutant strain MGI:5543459 Dclk1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1330861 Dclk1 doublecortin-like kinase 1 https://www.infrafrontier.eu/search?keyword=EM:09711 + EM:08380 C57BL/6NTac-Dcbld2/WtsiPh EMMA sperm mutant strain MGI:4363322 Dcbld2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920629 Dcbld2 discoidin, CUB and LCCL domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:08380 - EM:09560 C57BL/6NTac-Dbx1/WtsiIeg EMMA sperm mutant strain MGI:5632484 Dbx1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:94867 Dbx1 developing brain homeobox 1 https://www.infrafrontier.eu/search?keyword=EM:09560 ? EM:13175 C57BL/6NTac-Dbn1/WtsiFlmg EMMA sperm mutant strain MGI:4363390 Dbn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1931838 Dbn1 drebrin 1 https://www.infrafrontier.eu/search?keyword=EM:13175 + EM:12309 C57BL/6NTac-Dbi/Ics EMMA sperm mutant strain Dbi EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:94865 Dbi diazepam binding inhibitor https://www.infrafrontier.eu/search?keyword=EM:12309 ? EM:14032 C57BL/6NTac-Dars2/WtsiOrl EMMA sperm mutant strain MGI:4362200 Dars2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442510 Dars2 aspartyl-tRNA synthetase 2 (mitochondrial) https://www.infrafrontier.eu/search?keyword=EM:14032 + EM:06844 C57BL/6NTac-Dapk2/WtsiCnrm EMMA sperm mutant strain MGI:4434345 Dapk2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1341297 Dapk2 death-associated protein kinase 2 https://www.infrafrontier.eu/search?keyword=EM:06844 + EM:06356 C57BL/6NTac-Dapk1/H EMMA sperm mutant strain MGI:4435674 Dapk1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916885 Dapk1 death associated protein kinase 1 https://www.infrafrontier.eu/search?keyword=EM:06356 + EM:10084 C57BL/6NTac-Dagla/WtsiIeg EMMA sperm mutant strain MGI:5632483 Dagla targeted mutation 1, Wellcome Trust Sanger Institute MGI:2677061 Dagla diacylglycerol lipase, alpha https://www.infrafrontier.eu/search?keyword=EM:10084 + EM:12323 C57BL/6NTac-D130043K22Rik/Ics EMMA sperm mutant strain D130043K22Rik EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:3036268 D130043K22Rik RIKEN cDNA D130043K22 gene https://www.infrafrontier.eu/search?keyword=EM:12323 + EM:08705 C57BL/6NTac-Cyp4f16/H EMMA sperm mutant strain MGI:4364137 Cyp4f16 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917351 Cyp4f16 cytochrome P450, family 4, subfamily f, polypeptide 16 https://www.infrafrontier.eu/search?keyword=EM:08705 + EM:08718 C57BL/6NTac-Cyp4b1/Ieg EMMA embryo C57BL/6NTac-Cyp4b1tm1a(KOMP)Wtsi/Ieg mutant strain MGI:4364022 Cyp4b1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:103225 Cyp4b1 cytochrome P450, family 4, subfamily b, polypeptide 1 https://www.infrafrontier.eu/search?keyword=EM:08718 - EM:09537 C57BL/6NTac-Cyp1a1/Cnrm EMMA sperm mutant strain MGI:5632482 Cyp1a1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:88588 Cyp1a1 cytochrome P450, family 1, subfamily a, polypeptide 1 https://www.infrafrontier.eu/search?keyword=EM:09537 ? EM:13974 C57BL/6NTac-Cybc1/WtsiOulu EMMA embryo mutant strain MGI:4363837 Cybc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384959 Cybc1 cytochrome b 245 chaperone 1 https://www.infrafrontier.eu/search?keyword=EM:13974 ? EM:13974 C57BL/6NTac-Cybc1/WtsiOulu EMMA sperm mutant strain MGI:4363837 Cybc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384959 Cybc1 cytochrome b 245 chaperone 1 https://www.infrafrontier.eu/search?keyword=EM:13974 + EM:09709 C57BL/6NTac-Cxcr1/WtsiPh EMMA sperm mutant strain MGI:5497392 Cxcr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2448715 Cxcr1 chemokine (C-X-C motif) receptor 1 https://www.infrafrontier.eu/search?keyword=EM:09709 + EM:12524 C57BL/6NTac-Cx3cl1/H EMMA sperm C57BL/6NTac-Cx3cl/H unclassified MGI:6451422 Cx3cl1 endonuclease-mediated mutation 1, Harwell MGI:1097153 Cx3cl1 chemokine (C-X3-C motif) ligand 1 https://www.infrafrontier.eu/search?keyword=EM:12524 - EM:09771 C57BL/6NTac-Ctsq/WtsiH EMMA sperm mutant strain MGI:5632481 Ctsq targeted mutation 1, Wellcome Trust Sanger Institute MGI:2137385 Ctsq cathepsin Q https://www.infrafrontier.eu/search?keyword=EM:09771 + EM:10223 C57BL/6NTac-Ctsq/Cnrm EMMA embryo mutant strain MGI:5632481 Ctsq targeted mutation 1, Wellcome Trust Sanger Institute MGI:2137385 Ctsq cathepsin Q https://www.infrafrontier.eu/search?keyword=EM:10223 + EM:10223 C57BL/6NTac-Ctsq/Cnrm EMMA sperm mutant strain MGI:5632481 Ctsq targeted mutation 1, Wellcome Trust Sanger Institute MGI:2137385 Ctsq cathepsin Q https://www.infrafrontier.eu/search?keyword=EM:10223 + EM:06216 C57BL/6NTac-Ctsd/Ics EMMA embryo mutant strain MGI:4433100 Ctsd targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88562 Ctsd cathepsin D https://www.infrafrontier.eu/search?keyword=EM:06216 + EM:12640 C57BL/6NTac-Ctsa/H EMMA live mutant strain MGI:4435627 Ctsa targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:97748 Ctsa cathepsin A https://www.infrafrontier.eu/search?keyword=EM:12640 + EM:07024 C57BL/6NTac-Ctr9/WtsiOulu EMMA embryo mutant strain MGI:4433989 Ctr9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109345 Ctr9 CTR9 homolog, Paf1/RNA polymerase II complex component https://www.infrafrontier.eu/search?keyword=EM:07024 + EM:07024 C57BL/6NTac-Ctr9/WtsiOulu EMMA sperm mutant strain MGI:4433989 Ctr9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109345 Ctr9 CTR9 homolog, Paf1/RNA polymerase II complex component https://www.infrafrontier.eu/search?keyword=EM:07024 + EM:08586 C57BL/6NTac-Cth/Ieg EMMA sperm mutant strain MGI:5435787 Cth targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1339968 Cth cystathionase (cystathionine gamma-lyase) https://www.infrafrontier.eu/search?keyword=EM:08586 - EM:09739 C57BL/6NTac-Csn1s2a/WtsiH EMMA sperm mutant strain MGI:5632480 Csn1s2a targeted mutation 1, Wellcome Trust Sanger Institute MGI:88542 Csn1s2a casein alpha s2-like A https://www.infrafrontier.eu/search?keyword=EM:09739 - EM:09554 C57BL/6NTac-Csk/WtsiIeg EMMA sperm mutant strain MGI:5632479 Csk targeted mutation 1, Wellcome Trust Sanger Institute MGI:88537 Csk c-src tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:09554 - EM:09766 C57BL/6NTac-Crym/WtsiH EMMA sperm mutant strain MGI:5632478 Crym targeted mutation 1, Wellcome Trust Sanger Institute MGI:102675 Crym crystallin, mu https://www.infrafrontier.eu/search?keyword=EM:09766 - EM:09736 C57BL/6NTac-Crygd/WtsiH EMMA sperm mutant strain MGI:5632477 Crygd targeted mutation 2, Wellcome Trust Sanger Institute MGI:88524 Crygd crystallin, gamma D https://www.infrafrontier.eu/search?keyword=EM:09736 + EM:10051 C57BL/6NTac-Crygb/WtsiIeg EMMA sperm mutant strain MGI:5632476 Crygb targeted mutation 2, Wellcome Trust Sanger Institute MGI:88522 Crygb crystallin, gamma B https://www.infrafrontier.eu/search?keyword=EM:10051 + EM:10704 C57BL/6NTac-Cryga/WtsiIeg EMMA sperm mutant strain MGI:5632475 Cryga targeted mutation 2, Wellcome Trust Sanger Institute MGI:88521 Cryga crystallin, gamma A https://www.infrafrontier.eu/search?keyword=EM:10704 + EM:10763 C57BL/6NTac-Cry1/H EMMA live mutant strain MGI:5755154 Cry1 endonuclease-mediated mutation 1, Harwell MGI:1270841 Cry1 cryptochrome 1 (photolyase-like) https://www.infrafrontier.eu/search?keyword=EM:10763 + EM:10014 C57BL/6NTac-Crlf3/WtsiFlmg EMMA sperm mutant strain MGI:4363171 Crlf3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1860086 Crlf3 cytokine receptor-like factor 3 https://www.infrafrontier.eu/search?keyword=EM:10014 + EM:10713 C57BL/6NTac-Crisp3/WtsiIeg EMMA sperm mutant strain MGI:5632474 Crisp3 targeted mutation 2, Wellcome Trust Sanger Institute MGI:102552 Crisp3 cysteine-rich secretory protein 3 https://www.infrafrontier.eu/search?keyword=EM:10713 - EM:08170 C57BL/6NTac-Cracdl/WtsiOrl EMMA sperm mutant strain MGI:4364312 Cracdl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919347 Cracdl capping protein inhibiting regulator of actin like https://www.infrafrontier.eu/search?keyword=EM:08170 + EM:08052 C57BL/6NTac-Cpt2/WtsiBiat EMMA sperm mutant strain MGI:4362863 Cpt2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109176 Cpt2 carnitine palmitoyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:08052 + EM:10778 C57BL/6NTac-Cps1/H EMMA sperm C57BL/6N-Cps1/H mutant strain MGI:6144263 Cps1 endonuclease mediated mutation 1, Harwell MGI:891996 Cps1 carbamoyl-phosphate synthetase 1 https://www.infrafrontier.eu/search?keyword=EM:10778 - EM:08849 C57BL/6NTac-Cpne6/WtsiH EMMA sperm mutant strain MGI:5632472 Cpne6 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1334445 Cpne6 copine VI https://www.infrafrontier.eu/search?keyword=EM:08849 - EM:08861 C57BL/6NTac-Cpne6/WtsiH EMMA sperm mutant strain MGI:5632473 Cpne6 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1334445 Cpne6 copine VI https://www.infrafrontier.eu/search?keyword=EM:08861 - EM:04002 C57BL/6NTac-Cpeb4/Cnrm EMMA sperm mutant strain MGI:4434181 Cpeb4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914829 Cpeb4 cytoplasmic polyadenylation element binding protein 4 https://www.infrafrontier.eu/search?keyword=EM:04002 + EM:05349 C57BL/6NTac-Cpa2/Ieg EMMA embryo mutant strain MGI:4436075 Cpa2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3617840 Cpa2 carboxypeptidase A2, pancreatic https://www.infrafrontier.eu/search?keyword=EM:05349 + EM:12312 C57BL/6NTac-Corin/Ics EMMA sperm mutant strain Corin EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1349451 Corin corin, serine peptidase https://www.infrafrontier.eu/search?keyword=EM:12312 + EM:09952 C57BL/6NTac-Coq6/IcsOrl EMMA sperm mutant strain MGI:4435820 Coq6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924408 Coq6 coenzyme Q6 monooxygenase https://www.infrafrontier.eu/search?keyword=EM:09952 + EM:07680 C57BL/6NTac-Cops4/IcsOrl EMMA sperm mutant strain MGI:4435445 Cops4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1349414 Cops4 COP9 signalosome subunit 4 https://www.infrafrontier.eu/search?keyword=EM:07680 + EM:06775 C57BL/6NTac-Copg1/WtsiH EMMA sperm EPD0102_1_D08, MCGY mutant strain MGI:4432009 Copg1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858696 Copg1 coatomer protein complex, subunit gamma 1 https://www.infrafrontier.eu/search?keyword=EM:06775 + EM:09482 C57BL/6NTac-Commd9/H EMMA sperm mutant strain MGI:4365175 Commd9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923751 Commd9 COMM domain containing 9 https://www.infrafrontier.eu/search?keyword=EM:09482 + EM:07703 C57BL/6NTac-Col5a1/IcsOrl EMMA archived mutant strain MGI:4435753 Col5a1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88457 Col5a1 collagen, type V, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:07703 - EM:04732 C57BL/6NTac-Col4a5/Cnrm EMMA embryo mutant strain MGI:4432414 Col4a5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88456 Col4a5 collagen, type IV, alpha 5 https://www.infrafrontier.eu/search?keyword=EM:04732 - EM:04732 C57BL/6NTac-Col4a5/Cnrm EMMA sperm mutant strain MGI:4432414 Col4a5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88456 Col4a5 collagen, type IV, alpha 5 https://www.infrafrontier.eu/search?keyword=EM:04732 + EM:12376 C57BL/6NTac-Col4a4/H EMMA sperm mutant strain MGI:6153784 Col4a4 endonuclease-mediated mutation 1, Harwell MGI:104687 Col4a4 collagen, type IV, alpha 4 https://www.infrafrontier.eu/search?keyword=EM:12376 + EM:08609 C57BL/6NTac-Col24a1/WtsiH EMMA sperm mutant strain MGI:4433574 Col24a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1918605 Col24a1 collagen, type XXIV, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:08609 + EM:11402 C57BL/6NTac-Cntnap2/H EMMA live mutant strain MGI:6149219 Cntnap2 endonuclease mediated mutation 2, Harwell MGI:1914047 Cntnap2 contactin associated protein-like 2 https://www.infrafrontier.eu/search?keyword=EM:11402 + EM:11408 C57BL/6NTac-Cntnap2/H EMMA sperm mutant strain MGI:6153781 Cntnap2 endonuclease-mediated mutation 1, Harwell MGI:1914047 Cntnap2 contactin associated protein-like 2 https://www.infrafrontier.eu/search?keyword=EM:11408 + EM:09950 C57BL/6NTac-Cntnap1/IcsOrl EMMA sperm mutant strain MGI:4431603 Cntnap1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858201 Cntnap1 contactin associated protein-like 1 https://www.infrafrontier.eu/search?keyword=EM:09950 + EM:10965 C57BL/6NTac-Cnp/H EMMA sperm C57BL/6NTac-Cnptm1a(EUCOMM)Wtsi/H mutant strain MGI:4433004 Cnp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88437 Cnp 2',3'-cyclic nucleotide 3' phosphodiesterase https://www.infrafrontier.eu/search?keyword=EM:10965 - EM:09548 C57BL/6NTac-Cnp/WtsiIeg EMMA sperm mutant strain MGI:5632471 Cnp targeted mutation 1, Wellcome Trust Sanger Institute MGI:88437 Cnp 2',3'-cyclic nucleotide 3' phosphodiesterase https://www.infrafrontier.eu/search?keyword=EM:09548 + EM:05872 C57BL/6NTac-Cnot9/WtsiH EMMA sperm EPD0156_3_A07, MCWG, C57BL/6NTac-Rqcd1/WtsiH mutant strain MGI:4431867 Cnot9 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928902 Cnot9 CCR4-NOT transcription complex, subunit 9 https://www.infrafrontier.eu/search?keyword=EM:05872 ? EM:14024 C57BL/6NTac-Cnot6/WtsiPh EMMA sperm mutant strain MGI:4451305 Cnot6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144529 Cnot6 CCR4-NOT transcription complex, subunit 6 https://www.infrafrontier.eu/search?keyword=EM:14024 - EM:09762 C57BL/6NTac-Cmtm5/WtsiH EMMA sperm mutant strain MGI:5632412 Cmtm5 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2447164 Cmtm5 CKLF-like MARVEL transmembrane domain containing 5 https://www.infrafrontier.eu/search?keyword=EM:09762 + EM:07704 C57BL/6NTac-Clk1/IcsOrl EMMA archived mutant strain MGI:4432186 Clk1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107403 Clk1 CDC-like kinase 1 https://www.infrafrontier.eu/search?keyword=EM:07704 - EM:08965 C57BL/6NTac-Cldn7/Cnrm EMMA sperm mutant strain MGI:5632404 Cldn7 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1859285 Cldn7 claudin 7 https://www.infrafrontier.eu/search?keyword=EM:08965 + EM:12433 C57BL/6NTac-Cldn3/H EMMA sperm mutant strain MGI:6153848 Cldn3 endonuclease-mediated mutation 1, Harwell MGI:1329044 Cldn3 claudin 3 https://www.infrafrontier.eu/search?keyword=EM:12433 + EM:04395 C57BL/6NTac-Cisd2/H EMMA sperm mutant strain MGI:4434148 Cisd2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914256 Cisd2 CDGSH iron sulfur domain 2 https://www.infrafrontier.eu/search?keyword=EM:04395 + EM:04395 C57BL/6NTac-Cisd2/H EMMA live mutant strain MGI:4434148 Cisd2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914256 Cisd2 CDGSH iron sulfur domain 2 https://www.infrafrontier.eu/search?keyword=EM:04395 ? EM:11497 C57BL/6NTac-Cir1/WtsiIeg EMMA sperm mutant strain MGI:5577261 Cir1 targeted mutation 3a, Wellcome Trust Sanger Institute MGI:1914185 Cir1 corepressor interacting with RBPJ, 1 https://www.infrafrontier.eu/search?keyword=EM:11497 - EM:04019 C57BL/6NTac-Cidec/Cnrm EMMA sperm mutant strain MGI:4433521 Cidec targeted mutation 1a, Wellcome Trust Sanger Institute MGI:95585 Cidec cell death-inducing DFFA-like effector c https://www.infrafrontier.eu/search?keyword=EM:04019 + EM:12307 C57BL/6NTac-Cidec/Ics EMMA sperm mutant strain Cidec EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:95585 Cidec cell death-inducing DFFA-like effector c https://www.infrafrontier.eu/search?keyword=EM:12307 + EM:12362 C57BL/6NTac-Cib3/H EMMA sperm mutant strain MGI:6153778 Cib3 endonuclease-mediated mutation 1, Harwell MGI:2685953 Cib3 calcium and integrin binding family member 3 https://www.infrafrontier.eu/search?keyword=EM:12362 ? EM:13187 C57BL/6NTac-Churc1/WtsiFlmg EMMA sperm mutant strain MGI:4441753 Churc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923684 Churc1 churchill domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:13187 + EM:12471 C57BL/6NTac-Chrna5/H EMMA sperm mutant strain MGI:6153777 Chrna5 endonuclease-mediated mutation 1, Harwell MGI:87889 Chrna5 cholinergic receptor, nicotinic, alpha polypeptide 5 https://www.infrafrontier.eu/search?keyword=EM:12471 + EM:07658 C57BL/6NTac-Chrna1/IcsOrl EMMA sperm mutant strain MGI:4435231 Chrna1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:87885 Chrna1 cholinergic receptor, nicotinic, alpha polypeptide 1 (muscle) https://www.infrafrontier.eu/search?keyword=EM:07658 + EM:11314 C57BL/6NTac-Chrdl1/H EMMA live mutant strain MGI:5749866 Chrdl1 endonuclease-mediated mutation 2, Harwell MGI:1933172 Chrdl1 chordin-like 1 https://www.infrafrontier.eu/search?keyword=EM:11314 + EM:10757 C57BL/6NTac-Chrdl1/H EMMA sperm Chrdl1-DEL694-EM1-B6N mutant strain MGI:5749864 Chrdl1 endonuclease-mediated mutation 1, Harwell MGI:1933172 Chrdl1 chordin-like 1 https://www.infrafrontier.eu/search?keyword=EM:10757 + EM:10200 C57BL/6NTac-Chpf/Ieg EMMA sperm mutant strain MGI:4460343 Chpf targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:106576 Chpf chondroitin polymerizing factor https://www.infrafrontier.eu/search?keyword=EM:10200 + EM:10840 C57BL/6NTac-Chodl/H EMMA sperm mutant strain MGI:6149218 Chodl endonuclease mediated mutation 2, Harwell MGI:2179069 Chodl chondrolectin https://www.infrafrontier.eu/search?keyword=EM:10840 + EM:10769 C57BL/6NTac-Chodl/H EMMA sperm H-CHODL-DEL576-EM1-B6N (IMPC), CHODL-DEL576-EM1-B6N, C57BL/6N-Chodl/H mutant strain MGI:5755153 Chodl endonuclease-mediated mutation 1, Harwell MGI:2179069 Chodl chondrolectin https://www.infrafrontier.eu/search?keyword=EM:10769 + EM:07874 C57BL/6NTac-Chmp4c/H EMMA sperm EPD0113_1_B10 mutant strain MGI:4431890 Chmp4c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913621 Chmp4c charged multivesicular body protein 4C https://www.infrafrontier.eu/search?keyword=EM:07874 + EM:10088 C57BL/6NTac-Chgb/WtsiIeg EMMA sperm mutant strain MGI:5632403 Chgb targeted mutation 1, Wellcome Trust Sanger Institute MGI:88395 Chgb chromogranin B https://www.infrafrontier.eu/search?keyword=EM:10088 - EM:09574 C57BL/6NTac-Chga/Cnrm EMMA sperm mutant strain MGI:5632402 Chga targeted mutation 1, Wellcome Trust Sanger Institute MGI:88394 Chga chromogranin A https://www.infrafrontier.eu/search?keyword=EM:09574 + EM:07632 C57BL/6NTac-Cgas/IcsOrl EMMA sperm C57BL/6NTac-Mb21d1/IcsOrl mutant strain MGI:4435548 Cgas targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2442261 Cgas cyclic GMP-AMP synthase https://www.infrafrontier.eu/search?keyword=EM:07632 + EM:10082 C57BL/6NTac-Cga/WtsiIeg EMMA sperm mutant strain MGI:5632399 Cga targeted mutation 1, Wellcome Trust Sanger Institute MGI:88390 Cga glycoprotein hormones, alpha subunit https://www.infrafrontier.eu/search?keyword=EM:10082 + EM:11291 C57BL/6NTac-Cfap410/WtsiOrl EMMA sperm C57BL/6NTac-1810043G02Rik/WtsiOrl mutant strain MGI:4432613 Cfap410 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915134 Cfap410 cilia and flagella associated protein 410 https://www.infrafrontier.eu/search?keyword=EM:11291 + EM:05669 C57BL/6NTac-Cfap36/WtsiH EMMA sperm EPD0059_1_A09, MBUU, C57BL/6NTac-Ccdc104/WtsiH mutant strain MGI:4433419 Cfap36 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913994 Cfap36 cilia and flagella associated protein 36 https://www.infrafrontier.eu/search?keyword=EM:05669 - EM:09562 C57BL/6NTac-Cfap126/WtsiIeg EMMA sperm mutant strain MGI:5632398 Cfap126 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1922722 Cfap126 cilia and flagella associated protein 126 https://www.infrafrontier.eu/search?keyword=EM:09562 + EM:05888 C57BL/6NTac-Cep41/WtsiIeg EMMA sperm mutant strain MGI:4432442 Cep41 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891414 Cep41 centrosomal protein 41 https://www.infrafrontier.eu/search?keyword=EM:05888 + EM:12526 C57BL/6NTac-Cep290/H EMMA sperm unclassified MGI:6450518 Cep290 endonuclease-mediated mutation 1, Harwell MGI:2384917 Cep290 centrosomal protein 290 https://www.infrafrontier.eu/search?keyword=EM:12526 + EM:08128 C57BL/6NTac-Cenph/Ieg EMMA embryo mutant strain MGI:4436053 Cenph targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1349448 Cenph centromere protein H https://www.infrafrontier.eu/search?keyword=EM:08128 - EM:09456 C57BL/6NTac-Ceacam1/Cnrm EMMA sperm mutant strain MGI:5632397 Ceacam1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1347245 Ceacam1 CEA cell adhesion molecule 1 https://www.infrafrontier.eu/search?keyword=EM:09456 - EM:08846 C57BL/6NTac-Cdx2/WtsiH EMMA sperm mutant strain MGI:5632396 Cdx2 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:88361 Cdx2 caudal type homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:08846 + EM:09369 C57BL/6NTac-Cdsn/Ieg EMMA embryo mutant strain MGI:4436163 Cdsn targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3505689 Cdsn corneodesmosin https://www.infrafrontier.eu/search?keyword=EM:09369 ? EM:14114 C57BL/6NTac-Cdkn2aipnl/WtsiOrl EMMA sperm mutant strain MGI:4362329 Cdkn2aipnl targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1261797 Cdkn2aipnl CDKN2A interacting protein N-terminal like https://www.infrafrontier.eu/search?keyword=EM:14114 + EM:08637 C57BL/6NTac-Cdk5rap3/Ieg EMMA sperm mutant strain MGI:4435510 Cdk5rap3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1933126 Cdk5rap3 CDK5 regulatory subunit associated protein 3 https://www.infrafrontier.eu/search?keyword=EM:08637 - EM:09322 C57BL/6NTac-Cdh2/Cnrm EMMA sperm mutant strain MGI:5632395 Cdh2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:88355 Cdh2 cadherin 2 https://www.infrafrontier.eu/search?keyword=EM:09322 + EM:10890 C57BL/6NTac-Cdh23/H EMMA sperm mutant strain MGI:5749861 Cdh23 endonuclease-mediated revertant 3, Harwell MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/search?keyword=EM:10890 + EM:14636 C57BL/6NTac-Cdh23 Nefh/H EMMA sperm unclassified MGI:5749861 Cdh23 endonuclease-mediated revertant 3, Harwell MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/search?keyword=EM:14636 + EM:14636 C57BL/6NTac-Cdh23 Nefh/H EMMA sperm unclassified MGI:6717160 Nefh endonuclease-mediated mutation 3, Harwell MGI:97309 Nefh neurofilament, heavy polypeptide https://www.infrafrontier.eu/search?keyword=EM:14636 + EM:14635 C57BL/6NTac-Cdh23 Nefh/H EMMA sperm unclassified MGI:5749861 Cdh23 endonuclease-mediated revertant 3, Harwell MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/search?keyword=EM:14635 + EM:14635 C57BL/6NTac-Cdh23 Nefh/H EMMA sperm unclassified MGI:6717159 Nefh endonuclease-mediated mutation 2, Harwell MGI:97309 Nefh neurofilament, heavy polypeptide https://www.infrafrontier.eu/search?keyword=EM:14635 + EM:14634 C57BL/6NTac-Cdh23 Nefh/H EMMA sperm unclassified MGI:5749861 Cdh23 endonuclease-mediated revertant 3, Harwell MGI:1890219 Cdh23 cadherin 23 (otocadherin) https://www.infrafrontier.eu/search?keyword=EM:14634 + EM:14634 C57BL/6NTac-Cdh23 Nefh/H EMMA sperm unclassified MGI:6717158 Nefh endonuclease-mediated mutation 1, Harwell MGI:97309 Nefh neurofilament, heavy polypeptide https://www.infrafrontier.eu/search?keyword=EM:14634 - EM:09758 C57BL/6NTac-Cdh16/WtsiH EMMA sperm mutant strain MGI:5632394 Cdh16 targeted mutation 1, Wellcome Trust Sanger Institute MGI:106671 Cdh16 cadherin 16 https://www.infrafrontier.eu/search?keyword=EM:09758 + EM:10529 C57BL/6NTac-Cdh13/Ics EMMA live mutant strain MGI:4436162 Cdh13 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99551 Cdh13 cadherin 13 https://www.infrafrontier.eu/search?keyword=EM:10529 + EM:12055 C57BL/6NTac-Cdca8/Wtsi EMMA embryo mutant strain MGI:4362476 Cdca8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1196274 Cdca8 cell division cycle associated 8 https://www.infrafrontier.eu/search?keyword=EM:12055 + EM:06210 C57BL/6NTac-Cdc26/Ics EMMA embryo mutant strain MGI:4436708 Cdc26 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913690 Cdc26 cell division cycle 26 https://www.infrafrontier.eu/search?keyword=EM:06210 - EM:08851 C57BL/6NTac-Cd63/WtsiH EMMA sperm mutant strain MGI:5632393 Cd63 targeted mutation 1, Wellcome Trust Sanger Institute MGI:99529 Cd63 CD63 antigen https://www.infrafrontier.eu/search?keyword=EM:08851 - EM:09153 C57BL/6NTac-Cd4/Cnrm EMMA sperm mutant strain MGI:5632392 Cd4 targeted mutation 2, Wellcome Trust Sanger Institute MGI:88335 Cd4 CD4 antigen https://www.infrafrontier.eu/search?keyword=EM:09153 + EM:12295 C57BL/6NTac-Cd3e/Ics EMMA sperm mutant strain Cd3e EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:88332 Cd3e CD3 antigen, epsilon polypeptide https://www.infrafrontier.eu/search?keyword=EM:12295 + EM:12314 C57BL/6NTac-Cd34/Ics EMMA sperm mutant strain Cd34 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:88329 Cd34 CD34 antigen https://www.infrafrontier.eu/search?keyword=EM:12314 + EM:04396 C57BL/6NTac-Ccnyl1/H EMMA sperm EPD0177_5_F06 mutant strain MGI:4432945 Ccnyl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2138614 Ccnyl1 cyclin Y-like 1 https://www.infrafrontier.eu/search?keyword=EM:04396 - EM:08961 C57BL/6NTac-Ccl25/Cnrm EMMA sperm mutant strain MGI:5632391 Ccl25 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1099448 Ccl25 chemokine (C-C motif) ligand 25 https://www.infrafrontier.eu/search?keyword=EM:08961 + EM:12437 C57BL/6NTac-Cckbr/H EMMA sperm mutant strain MGI:6157678 Cckbr endonuclease-mediated mutation 1, Harwell MGI:99479 Cckbr cholecystokinin B receptor https://www.infrafrontier.eu/search?keyword=EM:12437 + EM:05967 C57BL/6NTac-Ccdc77/WtsiBiat EMMA sperm mutant strain MGI:4432801 Ccdc77 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914450 Ccdc77 coiled-coil domain containing 77 https://www.infrafrontier.eu/search?keyword=EM:05967 + EM:09578 C57BL/6NTac-Ccdc69/WtsiPh EMMA sperm mutant strain MGI:4364083 Ccdc69 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1196234 Ccdc69 coiled-coil domain containing 69 https://www.infrafrontier.eu/search?keyword=EM:09578 + EM:05869 C57BL/6NTac-Ccdc106/WtsiH EMMA sperm MDDT, EPD0177_4_C08 mutant strain MGI:4433912 Ccdc106 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2385900 Ccdc106 coiled-coil domain containing 106 https://www.infrafrontier.eu/search?keyword=EM:05869 - EM:08047 C57BL/6NTac-Catip/WtsiBiat EMMA sperm mutant strain MGI:4362227 Catip targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2685062 Catip ciliogenesis associated TTC17 interacting protein https://www.infrafrontier.eu/search?keyword=EM:08047 + EM:09985 C57BL/6NTac-Casq1/IcsOrl EMMA sperm mutant strain MGI:4431740 Casq1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1309468 Casq1 calsequestrin 1 https://www.infrafrontier.eu/search?keyword=EM:09985 + EM:05347 C57BL/6NTac-Car4/Ieg EMMA embryo mutant strain MGI:4433993 Car4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1096574 Car4 carbonic anhydrase 4 https://www.infrafrontier.eu/search?keyword=EM:05347 + EM:05381 C57BL/6NTac-Caprin2/WtsiCnbc EMMA embryo mutant strain MGI:4434168 Caprin2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2448541 Caprin2 caprin family member 2 https://www.infrafrontier.eu/search?keyword=EM:05381 + EM:05381 C57BL/6NTac-Caprin2/WtsiCnbc EMMA sperm mutant strain MGI:4434168 Caprin2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:2448541 Caprin2 caprin family member 2 https://www.infrafrontier.eu/search?keyword=EM:05381 ? EM:13987 C57BL/6NTac-Capn8/WtsiIeg EMMA sperm mutant strain MGI:5632390 Capn8 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2181366 Capn8 calpain 8 https://www.infrafrontier.eu/search?keyword=EM:13987 + EM:04707 C57BL/6NTac-Capn5/H EMMA sperm HEPD0525_1_C12 mutant strain MGI:4436604 Capn5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1100859 Capn5 calpain 5 https://www.infrafrontier.eu/search?keyword=EM:04707 + EM:05552 C57BL/6NTac-Cap2/Ieg EMMA embryo mutant strain MGI:4431970 Cap2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914502 Cap2 CAP, adenylate cyclase-associated protein, 2 (yeast) https://www.infrafrontier.eu/search?keyword=EM:05552 + EM:06091 C57BL/6NTac-Cand2/WtsiCnbc EMMA sperm mutant strain MGI:4432020 Cand2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914338 Cand2 cullin-associated and neddylation-dissociated 2 (putative) https://www.infrafrontier.eu/search?keyword=EM:06091 + EM:07656 C57BL/6NTac-Cacnb4/IcsOrl EMMA sperm mutant strain MGI:4435787 Cacnb4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103301 Cacnb4 calcium channel, voltage-dependent, beta 4 subunit https://www.infrafrontier.eu/search?keyword=EM:07656 + EM:10874 C57BL/6NTac-C4b/H EMMA sperm mutant strain MGI:6144264 C4b endonuclease mediated mutation 1, Harwell MGI:88228 C4b complement component 4B (Chido blood group) https://www.infrafrontier.eu/search?keyword=EM:10874 + EM:11313 C57BL/6NTac-C2cd4a/H EMMA sperm mutant strain MGI:6144266 C2cd4a endonuclease mediated mutation 2, Harwell MGI:3645763 C2cd4a C2 calcium-dependent domain containing 4A https://www.infrafrontier.eu/search?keyword=EM:11313 + EM:10777 C57BL/6NTac-C2cd4a/H EMMA sperm C57BL/6N-C2cd4a/H mutant strain MGI:6144265 C2cd4a endonuclease mediated mutation 1, Harwell MGI:3645763 C2cd4a C2 calcium-dependent domain containing 4A https://www.infrafrontier.eu/search?keyword=EM:10777 + EM:06295 C57BL/6NTac-C1rl/H EMMA sperm mutant strain MGI:4435790 C1rl targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2660692 C1rl complement component 1, r subcomponent-like https://www.infrafrontier.eu/search?keyword=EM:06295 + EM:07819 C57BL/6NTac-C1qbp/IcsOrl EMMA sperm mutant strain MGI:4432129 C1qbp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1194505 C1qbp complement component 1, q subcomponent binding protein https://www.infrafrontier.eu/search?keyword=EM:07819 + EM:12364 C57BL/6NTac-Bud23/H EMMA sperm mutant strain MGI:6153866 Bud23 endonuclease-mediated mutation 2, Harwell MGI:1913388 Bud23 BUD23, rRNA methyltransferase and ribosome maturation factor https://www.infrafrontier.eu/search?keyword=EM:12364 + EM:11730 C57BL/6NTac-Bud23/H EMMA live mutant strain MGI:6149189 Bud23 endonuclease mediated mutation 1, Harwell MGI:1913388 Bud23 BUD23, rRNA methyltransferase and ribosome maturation factor https://www.infrafrontier.eu/search?keyword=EM:11730 ? EM:13217 C57BL/6NTac-Btk/IcsOrl EMMA sperm mutant strain MGI:6155006 Btk targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:88216 Btk Bruton agammaglobulinemia tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:13217 + EM:07682 C57BL/6NTac-Btk/IcsOrl EMMA sperm mutant strain MGI:4434935 Btk targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88216 Btk Bruton agammaglobulinemia tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:07682 + EM:07629 C57BL/6NTac-Bspry/IcsOrl EMMA archived mutant strain MGI:4432968 Bspry targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2177191 Bspry B-box and SPRY domain containing https://www.infrafrontier.eu/search?keyword=EM:07629 + EM:11506 C57BL/6NTac-Bscl2/H EMMA sperm mutant strain MGI:6153776 Bscl2 endonuclease-mediated mutation 1, Harwell MGI:1298392 Bscl2 Berardinelli-Seip congenital lipodystrophy 2 (seipin) https://www.infrafrontier.eu/search?keyword=EM:11506 + EM:11506 C57BL/6NTac-Bscl2/H EMMA live mutant strain MGI:6153776 Bscl2 endonuclease-mediated mutation 1, Harwell MGI:1298392 Bscl2 Berardinelli-Seip congenital lipodystrophy 2 (seipin) https://www.infrafrontier.eu/search?keyword=EM:11506 + EM:10179 C57BL/6NTac-Bphl/IcsOrl EMMA sperm mutant strain MGI:4436026 Bphl targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915271 Bphl biphenyl hydrolase-like (serine hydrolase, breast epithelial mucin-associated antigen) https://www.infrafrontier.eu/search?keyword=EM:10179 + EM:10701 C57BL/6NTac-Bpgm/WtsiIeg EMMA sperm mutant strain MGI:4363424 Bpgm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098242 Bpgm 2,3-bisphosphoglycerate mutase https://www.infrafrontier.eu/search?keyword=EM:10701 + EM:06075 C57BL/6NTac-Boc/H EMMA sperm mutant strain MGI:4364249 Boc targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2151153 Boc biregional cell adhesion molecule-related/down-regulated by oncogenes (Cdon) binding protein https://www.infrafrontier.eu/search?keyword=EM:06075 + EM:07672 C57BL/6NTac-Bmx/IcsOrl EMMA sperm mutant strain MGI:4433142 Bmx targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1101778 Bmx BMX non-receptor tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:07672 + EM:04863 C57BL/6NTac-Bmp7/H EMMA sperm mutant strain MGI:4436150 Bmp7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103302 Bmp7 bone morphogenetic protein 7 https://www.infrafrontier.eu/search?keyword=EM:04863 + EM:08484 C57BL/6NTac-Bivm/WtsiFlmg EMMA sperm mutant strain MGI:5296109 Bivm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2179809 Bivm basic, immunoglobulin-like variable motif containing https://www.infrafrontier.eu/search?keyword=EM:08484 + EM:09819 C57BL/6NTac-Bhlhe40/WtsiPh EMMA sperm mutant strain MGI:4362482 Bhlhe40 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1097714 Bhlhe40 basic helix-loop-helix family, member e40 https://www.infrafrontier.eu/search?keyword=EM:09819 + EM:05360 C57BL/6NTac-Becn1/Cnrm EMMA embryo mutant strain MGI:4362198 Becn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891828 Becn1 beclin 1, autophagy related https://www.infrafrontier.eu/search?keyword=EM:05360 - EM:10772 C57BL/6NTac-Bdkrb1/H EMMA sperm B6N;B6NTac-Bdkrb1/H, C57BL/6N;C57BL/6NTac-Bdkrb1/H mutant strain MGI:6140144 Bdkrb1 endonuclease mediated mutation 1, Harwell MGI:88144 Bdkrb1 bradykinin receptor, beta 1 https://www.infrafrontier.eu/search?keyword=EM:10772 + EM:05866 C57BL/6NTac-Bdh2/WtsiH EMMA sperm EPD0143_2_E05 mutant strain MGI:4433163 Bdh2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917022 Bdh2 3-hydroxybutyrate dehydrogenase, type 2 https://www.infrafrontier.eu/search?keyword=EM:05866 ? EM:09272 C57BL/6NTac-Bccip/Ieg EMMA embryo mutant strain MGI:4435867 Bccip targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913415 Bccip BRCA2 and CDKN1A interacting protein https://www.infrafrontier.eu/search?keyword=EM:09272 ? EM:09272 C57BL/6NTac-Bccip/Ieg EMMA sperm mutant strain MGI:4435867 Bccip targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913415 Bccip BRCA2 and CDKN1A interacting protein https://www.infrafrontier.eu/search?keyword=EM:09272 + EM:14614 C57BL/6NTac-Bcap31/H EMMA sperm unclassified MGI:6717133 Bcap31 endonuclease-mediated mutation 2, Harwell MGI:1350933 Bcap31 B cell receptor associated protein 31 https://www.infrafrontier.eu/search?keyword=EM:14614 + EM:14613 C57BL/6NTac-Bcap31/H EMMA sperm unclassified MGI:6717131 Bcap31 endonuclease-mediated mutation 1, Harwell MGI:1350933 Bcap31 B cell receptor associated protein 31 https://www.infrafrontier.eu/search?keyword=EM:14613 + EM:06028 C57BL/6NTac-Bbs5/H EMMA sperm EPD0227_3_C06 mutant strain MGI:4433255 Bbs5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919819 Bbs5 Bardet-Biedl syndrome 5 (human) https://www.infrafrontier.eu/search?keyword=EM:06028 ? EM:11884 C57BL/6NTac-Batf3/WtsiH EMMA sperm mutant strain Batf3 KOMP targeted mutation 1, Wellcome Trust Sanger Institute MGI:1925491 Batf3 basic leucine zipper transcription factor, ATF-like 3 https://www.infrafrontier.eu/search?keyword=EM:11884 - EM:08856 C57BL/6NTac-Barhl1/WtsiH EMMA sperm mutant strain MGI:5632389 Barhl1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1859288 Barhl1 BarH like homeobox 1 https://www.infrafrontier.eu/search?keyword=EM:08856 + EM:08891 C57BL/6NTac-Bap1/WtsiIeg EMMA sperm mutant strain MGI:4436674 Bap1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1206586 Bap1 Brca1 associated protein 1 https://www.infrafrontier.eu/search?keyword=EM:08891 + EM:07678 C57BL/6NTac-Baiap2l2/IcsOrl EMMA archived mutant strain MGI:4435406 Baiap2l2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2652819 Baiap2l2 BAI1-associated protein 2-like 2 https://www.infrafrontier.eu/search?keyword=EM:07678 + EM:07720 C57BL/6NTac-B9d1/IcsOrl EMMA archived mutant strain MGI:4432284 B9d1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1351471 B9d1 B9 protein domain 1 https://www.infrafrontier.eu/search?keyword=EM:07720 + EM:07727 C57BL/6NTac-B4galnt3/IcsOrl EMMA sperm mutant strain MGI:4434237 B4galnt3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3041155 B4galnt3 beta-1,4-N-acetyl-galactosaminyl transferase 3 https://www.infrafrontier.eu/search?keyword=EM:07727 + EM:08898 C57BL/6NTac-Atxn3/WtsiPh EMMA sperm mutant strain MGI:4363482 Atxn3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1099442 Atxn3 ataxin 3 https://www.infrafrontier.eu/search?keyword=EM:08898 + EM:05233 C57BL/6NTac-Atpif1/WtsiCnbc EMMA embryo mutant strain MGI:4433166 Atpif1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1196457 Atpif1 ATPase inhibitory factor 1 https://www.infrafrontier.eu/search?keyword=EM:05233 + EM:10675 C57BL/6NTac-Atp9a/Ieg EMMA sperm mutant strain MGI:4460384 Atp9a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1330826 Atp9a ATPase, class II, type 9A https://www.infrafrontier.eu/search?keyword=EM:10675 + EM:12296 C57BL/6NTac-Atp6v1g2/Ics EMMA sperm mutant strain Atp6v1g2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:1913487 Atp6v1g2 ATPase, H+ transporting, lysosomal V1 subunit G2 https://www.infrafrontier.eu/search?keyword=EM:12296 + EM:07641 C57BL/6NTac-Atp6v1d/IcsOrl EMMA archived mutant strain MGI:4434885 Atp6v1d targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921084 Atp6v1d ATPase, H+ transporting, lysosomal V1 subunit D https://www.infrafrontier.eu/search?keyword=EM:07641 + EM:10054 C57BL/6NTac-Atp4b/WtsiIeg EMMA sperm mutant strain MGI:5632388 Atp4b targeted mutation 2, Wellcome Trust Sanger Institute MGI:88114 Atp4b ATPase, H+/K+ exchanging, beta polypeptide https://www.infrafrontier.eu/search?keyword=EM:10054 + EM:09026 C57BL/6NTac-Atp1a3/H EMMA sperm mutant strain MGI:5438364 Atp1a3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:88107 Atp1a3 ATPase, Na+/K+ transporting, alpha 3 polypeptide https://www.infrafrontier.eu/search?keyword=EM:09026 + EM:13034 C57BL/6NTac-Atp1a3/H EMMA sperm unclassified MGI:6450024 Atp1a3 endonuclease-mediated mutation 3, Harwell MGI:88107 Atp1a3 ATPase, Na+/K+ transporting, alpha 3 polypeptide https://www.infrafrontier.eu/search?keyword=EM:13034 + EM:13025 C57BL/6NTac-Atp1a3/H EMMA sperm unclassified MGI:6450018 Atp1a3 endonuclease-mediated mutation 1, Harwell MGI:88107 Atp1a3 ATPase, Na+/K+ transporting, alpha 3 polypeptide https://www.infrafrontier.eu/search?keyword=EM:13025 - EM:09703 C57BL/6NTac-Atp11a/WtsiIeg EMMA sperm mutant strain MGI:4363953 Atp11a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354735 Atp11a ATPase, class VI, type 11A https://www.infrafrontier.eu/search?keyword=EM:09703 - EM:04961 C57BL/6NTac-Atg3/Cnrm EMMA sperm mutant strain MGI:4436012 Atg3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915091 Atg3 autophagy related 3 https://www.infrafrontier.eu/search?keyword=EM:04961 + EM:05376 C57BL/6NTac-Atg16l1/WtsiCnbc EMMA embryo mutant strain MGI:4432181 Atg16l1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924290 Atg16l1 autophagy related 16-like 1 (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:05376 + EM:05376 C57BL/6NTac-Atg16l1/WtsiCnbc EMMA sperm mutant strain MGI:4432181 Atg16l1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924290 Atg16l1 autophagy related 16-like 1 (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:05376 + EM:10711 C57BL/6NTac-Atf4/WtsiIeg EMMA sperm mutant strain MGI:5659996 Atf4 targeted mutation 1, Wellcome Trust Sanger Institute MGI:88096 Atf4 activating transcription factor 4 https://www.infrafrontier.eu/search?keyword=EM:10711 + EM:09817 C57BL/6NTac-Atad3a/WtsiPh EMMA sperm mutant strain MGI:4364878 Atad3a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919214 Atad3a ATPase family, AAA domain containing 3A https://www.infrafrontier.eu/search?keyword=EM:09817 - EM:03996 C57BL/6NTac-Asxl1/Cnrm EMMA embryo mutant strain MGI:6272013 Asxl1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2684063 Asxl1 ASXL transcriptional regulator 1 https://www.infrafrontier.eu/search?keyword=EM:03996 - EM:03996 C57BL/6NTac-Asxl1/Cnrm EMMA sperm mutant strain MGI:6272013 Asxl1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2684063 Asxl1 ASXL transcriptional regulator 1 https://www.infrafrontier.eu/search?keyword=EM:03996 ? EM:09271 C57BL/6NTac-Aspa/Ieg EMMA sperm mutant strain MGI:4434258 Aspa targeted mutation 1a, Wellcome Trust Sanger Institute MGI:87914 Aspa aspartoacylase https://www.infrafrontier.eu/search?keyword=EM:09271 + EM:07647 C57BL/6NTac-Ascc3/IcsOrl EMMA archived mutant strain MGI:4436301 Ascc3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1925237 Ascc3 activating signal cointegrator 1 complex subunit 3 https://www.infrafrontier.eu/search?keyword=EM:07647 - EM:04548 C57BL/6NTac-Arvcf/Ieg EMMA sperm mutant strain MGI:4432634 Arvcf targeted mutation 1e, Wellcome Trust Sanger Institute MGI:109620 Arvcf armadillo repeat gene deleted in velocardiofacial syndrome https://www.infrafrontier.eu/search?keyword=EM:04548 + EM:09472 C57BL/6NTac-Art4/WtsiH EMMA sperm mutant strain MGI:4363180 Art4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202710 Art4 ADP-ribosyltransferase 4 https://www.infrafrontier.eu/search?keyword=EM:09472 + EM:07635 C57BL/6NTac-Armt1/IcsOrl EMMA archived C57BL/6NTac-1700052N19Rik/IcsOrl mutant strain MGI:4433265 Armt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920669 Armt1 acidic residue methyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:07635 + EM:10792 C57BL/6NTac-Armh4/H EMMA archived 3632451O06RIK-DEL1869-EM2-B6N, C57BL/6NTac-3632451O06Rik/H, C57BL/6NTac-3632451O06Rik/H mutant strain MGI:5749843 Armh4 endonuclease-mediated mutation 2, Harwell MGI:1914669 Armh4 armadillo-like helical domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:10792 + EM:10762 C57BL/6NTac-Armh4/H EMMA archived C57BL/6NTac-3632451O06Rik/H, 3632451O06RIK-DEL1851-EM1-B6N, C57BL/6N-3632451O06Rik/H mutant strain MGI:5749842 Armh4 endonuclease-mediated mutation 1, Harwell MGI:1914669 Armh4 armadillo-like helical domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:10762 + EM:10785 C57BL/6NTac-Arl15/H EMMA live C57BL/6N-Arl15/H mutant strain MGI:6149188 Arl15 endonuclease mediated mutation 1, Harwell MGI:2442308 Arl15 ADP-ribosylation factor-like 15 https://www.infrafrontier.eu/search?keyword=EM:10785 + EM:11521 C57BL/6NTac-Arhgef9/H EMMA sperm C57BL/6NTac-Arhgef/H mutant strain MGI:6153845 Arhgef9 endonuclease mediated mutation 1, Harwell MGI:2442233 Arhgef9 CDC42 guanine nucleotide exchange factor (GEF) 9 https://www.infrafrontier.eu/search?keyword=EM:11521 + EM:11521 C57BL/6NTac-Arhgef9/H EMMA live C57BL/6NTac-Arhgef/H mutant strain MGI:6153845 Arhgef9 endonuclease mediated mutation 1, Harwell MGI:2442233 Arhgef9 CDC42 guanine nucleotide exchange factor (GEF) 9 https://www.infrafrontier.eu/search?keyword=EM:11521 + EM:12046 C57BL/6NTac-Arhgef4/Wtsi EMMA embryo mutant strain MGI:4364388 Arhgef4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442507 Arhgef4 Rho guanine nucleotide exchange factor (GEF) 4 https://www.infrafrontier.eu/search?keyword=EM:12046 + EM:09891 C57BL/6NTac-Arhgef1/WtsiPh EMMA sperm mutant strain MGI:4434048 Arhgef1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353510 Arhgef1 Rho guanine nucleotide exchange factor (GEF) 1 https://www.infrafrontier.eu/search?keyword=EM:09891 ? EM:13671 C57BL/6NTac-Arhgap25/WtsiOrl EMMA sperm mutant strain MGI:4362243 Arhgap25 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443687 Arhgap25 Rho GTPase activating protein 25 https://www.infrafrontier.eu/search?keyword=EM:13671 + EM:07808 C57BL/6NTac-Arhgap22/WtsiOrl EMMA sperm mutant strain MGI:4363166 Arhgap22 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2443418 Arhgap22 Rho GTPase activating protein 22 https://www.infrafrontier.eu/search?keyword=EM:07808 + EM:07675 C57BL/6NTac-Arcn1/IcsOrl EMMA archived mutant strain MGI:4435514 Arcn1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2387591 Arcn1 archain 1 https://www.infrafrontier.eu/search?keyword=EM:07675 - EM:08972 C57BL/6NTac-Aqp3/Cnrm EMMA sperm mutant strain MGI:5632387 Aqp3 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1333777 Aqp3 aquaporin 3 https://www.infrafrontier.eu/search?keyword=EM:08972 + EM:09371 C57BL/6NTac-Aqp1/H EMMA sperm mutant strain MGI:4441703 Aqp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:103201 Aqp1 aquaporin 1 https://www.infrafrontier.eu/search?keyword=EM:09371 ? EM:14115 C57BL/6NTac-Apool/WtsiOulu EMMA embryo mutant strain MGI:4364721 Apool targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915367 Apool apolipoprotein O-like https://www.infrafrontier.eu/search?keyword=EM:14115 ? EM:14115 C57BL/6NTac-Apool/WtsiOulu EMMA sperm mutant strain MGI:4364721 Apool targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915367 Apool apolipoprotein O-like https://www.infrafrontier.eu/search?keyword=EM:14115 + EM:07378 C57BL/6NTac-Apip/WtsiH EMMA sperm mutant strain MGI:4441695 Apip targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926788 Apip APAF1 interacting protein https://www.infrafrontier.eu/search?keyword=EM:07378 + EM:10756 C57BL/6NTac-Ap3m2/H EMMA live mutant strain MGI:6149217 Ap3m2 endonuclease mediated mutation 2, Harwell MGI:1929214 Ap3m2 adaptor-related protein complex 3, mu 2 subunit https://www.infrafrontier.eu/search?keyword=EM:10756 - EM:04711 C57BL/6NTac-Ap3m1/Cnrm EMMA embryo mutant strain MGI:4436527 Ap3m1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1929212 Ap3m1 adaptor-related protein complex 3, mu 1 subunit https://www.infrafrontier.eu/search?keyword=EM:04711 - EM:04711 C57BL/6NTac-Ap3m1/Cnrm EMMA sperm mutant strain MGI:4436527 Ap3m1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1929212 Ap3m1 adaptor-related protein complex 3, mu 1 subunit https://www.infrafrontier.eu/search?keyword=EM:04711 + EM:12105 C57BL/6NTac-Anp32e/Wtsi EMMA embryo mutant strain MGI:4451429 Anp32e targeted mutation 1e, Wellcome Trust Sanger Institute MGI:1913721 Anp32e acidic (leucine-rich) nuclear phosphoprotein 32 family, member E https://www.infrafrontier.eu/search?keyword=EM:12105 + EM:08234 C57BL/6NTac-Anks6/WtsiPh EMMA sperm mutant strain MGI:4363754 Anks6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922941 Anks6 ankyrin repeat and sterile alpha motif domain containing 6 https://www.infrafrontier.eu/search?keyword=EM:08234 + EM:06843 C57BL/6NTac-Anapc4/WtsiCnrm EMMA sperm mutant strain MGI:4434153 Anapc4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098673 Anapc4 anaphase promoting complex subunit 4 https://www.infrafrontier.eu/search?keyword=EM:06843 + EM:05895 C57BL/6NTac-Amotl1/WtsiIeg EMMA sperm mutant strain MGI:4433551 Amotl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922973 Amotl1 angiomotin-like 1 https://www.infrafrontier.eu/search?keyword=EM:05895 + EM:12322 C57BL/6NTac-Amhr2/Ics EMMA sperm mutant strain Amhr2 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:105062 Amhr2 anti-Mullerian hormone type 2 receptor https://www.infrafrontier.eu/search?keyword=EM:12322 + EM:07351 C57BL/6NTac-Alms1/H EMMA sperm mutant strain MGI:6324160 Alms1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1934606 Alms1 ALMS1, centrosome and basal body associated https://www.infrafrontier.eu/search?keyword=EM:07351 + EM:09931 C57BL/6NTac-Alms1/H EMMA sperm mutant strain MGI:4434567 Alms1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1934606 Alms1 ALMS1, centrosome and basal body associated https://www.infrafrontier.eu/search?keyword=EM:09931 + EM:12327 C57BL/6NTac-Aldoc/Ics EMMA sperm mutant strain Aldoc EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:101863 Aldoc aldolase C, fructose-bisphosphate https://www.infrafrontier.eu/search?keyword=EM:12327 - EM:09506 C57BL/6NTac-Aldh8a1/Cnrm EMMA sperm mutant strain MGI:5632386 Aldh8a1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:2653900 Aldh8a1 aldehyde dehydrogenase 8 family, member A1 https://www.infrafrontier.eu/search?keyword=EM:09506 - EM:09117 C57BL/6NTac-Aldh3a2/Cnrm EMMA sperm mutant strain MGI:5632385 Aldh3a2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1353452 Aldh3a2 aldehyde dehydrogenase family 3, subfamily A2 https://www.infrafrontier.eu/search?keyword=EM:09117 + EM:07734 C57BL/6NTac-Aldh3a2/IcsOrl EMMA sperm mutant strain MGI:4432633 Aldh3a2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353452 Aldh3a2 aldehyde dehydrogenase family 3, subfamily A2 https://www.infrafrontier.eu/search?keyword=EM:07734 + EM:08719 C57BL/6NTac-Aldh1l1/Ieg EMMA sperm mutant strain MGI:4364886 Aldh1l1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1340024 Aldh1l1 aldehyde dehydrogenase 1 family, member L1 https://www.infrafrontier.eu/search?keyword=EM:08719 + EM:12025 C57BL/6NTac-Aldh18a1/Wtsi EMMA embryo mutant strain MGI:4363671 Aldh18a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1888908 Aldh18a1 aldehyde dehydrogenase 18 family, member A1 https://www.infrafrontier.eu/search?keyword=EM:12025 + EM:05864 C57BL/6NTac-Aldh16a1/WtsiH EMMA sperm EPD0091_2_D04, MBWA mutant strain MGI:4432547 Aldh16a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916998 Aldh16a1 aldehyde dehydrogenase 16 family, member A1 https://www.infrafrontier.eu/search?keyword=EM:05864 + EM:09874 C57BL/6NTac-Alb/Cnrm EMMA sperm mutant strain MGI:5811675 Alb targeted mutation 2, Wellcome Trust Sanger Institute MGI:87991 Alb albumin https://www.infrafrontier.eu/search?keyword=EM:09874 + EM:07186 C57BL/6NTac-Akt1s1/WtsiH EMMA sperm MEVA, EPD0156_2_A06 mutant strain MGI:4431959 Akt1s1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914855 Akt1s1 AKT1 substrate 1 (proline-rich) https://www.infrafrontier.eu/search?keyword=EM:07186 + EM:12324 C57BL/6NTac-Akr1b7/Ics EMMA sperm mutant strain Akr1b7 EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:101918 Akr1b7 aldo-keto reductase family 1, member B7 https://www.infrafrontier.eu/search?keyword=EM:12324 - EM:09556 C57BL/6NTac-Aif1/WtsiIeg EMMA sperm mutant strain MGI:5632384 Aif1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1343098 Aif1 allograft inflammatory factor 1 https://www.infrafrontier.eu/search?keyword=EM:09556 - EM:09775 C57BL/6NTac-Afp/WtsiH EMMA sperm mutant strain MGI:5632383 Afp targeted mutation 1, Wellcome Trust Sanger Institute MGI:87951 Afp alpha fetoprotein https://www.infrafrontier.eu/search?keyword=EM:09775 + EM:05099 C57BL/6NTac-Afmid/H EMMA sperm EPD0155_6_A07 mutant strain MGI:4432070 Afmid targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2448704 Afmid arylformamidase https://www.infrafrontier.eu/search?keyword=EM:05099 - EM:07631 C57BL/6NTac-Afm/IcsOrl EMMA sperm mutant strain MGI:4455621 Afm targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2429409 Afm afamin https://www.infrafrontier.eu/search?keyword=EM:07631 + EM:05880 C57BL/6NTac-Aff3/WtsiIeg EMMA sperm mutant strain MGI:4434291 Aff3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106927 Aff3 AF4/FMR2 family, member 3 https://www.infrafrontier.eu/search?keyword=EM:05880 + EM:11312 C57BL/6NTac-Adprhl1/H EMMA archived mutant strain MGI:6140150 Adprhl1 endonuclease mediated mutation 2, Harwell MGI:2442168 Adprhl1 ADP-ribosylhydrolase like 1 https://www.infrafrontier.eu/search?keyword=EM:11312 + EM:10875 C57BL/6NTac-Adprhl1/H EMMA live mutant strain MGI:6140149 Adprhl1 endonuclease mediated mutation 1, Harwell MGI:2442168 Adprhl1 ADP-ribosylhydrolase like 1 https://www.infrafrontier.eu/search?keyword=EM:10875 - EM:09507 C57BL/6NTac-Adora2a/Cnrm EMMA sperm mutant strain MGI:5632382 Adora2a targeted mutation 1, Wellcome Trust Sanger Institute MGI:99402 Adora2a adenosine A2a receptor https://www.infrafrontier.eu/search?keyword=EM:09507 + EM:12303 C57BL/6NTac-Adipoq/Ics EMMA sperm mutant strain Adipoq EUCOMM targeted mutation , Wellcome Trust Sanger Institute MGI:106675 Adipoq adiponectin, C1Q and collagen domain containing https://www.infrafrontier.eu/search?keyword=EM:12303 + EM:07190 C57BL/6NTac-Adgrd1/WtsiCnrm EMMA sperm C57BL/6NTac-Gpr133/WtsiCnrm mutant strain MGI:4432831 Adgrd1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3041203 Adgrd1 adhesion G protein-coupled receptor D1 https://www.infrafrontier.eu/search?keyword=EM:07190 + EM:09384 C57BL/6NTac-Adamtsl5/H EMMA sperm mutant strain MGI:5430118 Adamtsl5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913798 Adamtsl5 ADAMTS-like 5 https://www.infrafrontier.eu/search?keyword=EM:09384 + EM:10803 C57BL/6NTac-Adamts16/H EMMA sperm mutant strain MGI:6140145 Adamts16 endonuclease mediated mutation 2, Harwell MGI:2429637 Adamts16 a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 16 https://www.infrafrontier.eu/search?keyword=EM:10803 + EM:10776 C57BL/6NTac-Adamts16/H EMMA sperm C57BL/6N-Adamts16/H mutant strain MGI:6140148 Adamts16 endonuclease mediated mutation 1, Harwell MGI:2429637 Adamts16 a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 16 https://www.infrafrontier.eu/search?keyword=EM:10776 + EM:12297 C57BL/6NTac-Acsm4/Ics EMMA sperm mutant strain Acsm4 EUCOMM targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2681844 Acsm4 acyl-CoA synthetase medium-chain family member 4 https://www.infrafrontier.eu/search?keyword=EM:12297 + EM:09875 C57BL/6NTac-Acox2/Cnrm EMMA sperm mutant strain MGI:5811647 Acox2 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1934852 Acox2 acyl-Coenzyme A oxidase 2, branched chain https://www.infrafrontier.eu/search?keyword=EM:09875 + EM:08149 C57BL/6NTac-Acot5/WtsiCnrm EMMA sperm mutant strain MGI:4364061 Acot5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2384969 Acot5 acyl-CoA thioesterase 5 https://www.infrafrontier.eu/search?keyword=EM:08149 + EM:07627 C57BL/6NTac-Acap3/IcsOrl EMMA archived mutant strain MGI:4436565 Acap3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2153589 Acap3 ArfGAP with coiled-coil, ankyrin repeat and PH domains 3 https://www.infrafrontier.eu/search?keyword=EM:07627 - EM:08959 C57BL/6NTac-Acan/Cnrm EMMA sperm mutant strain MGI:5632381 Acan targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:99602 Acan aggrecan https://www.infrafrontier.eu/search?keyword=EM:08959 + EM:11311 C57BL/6NTac-Abcc5/H EMMA archived mutant strain MGI:5749846 Abcc5 endonuclease-mediated mutation 2, Harwell MGI:1351644 Abcc5 ATP-binding cassette, sub-family C (CFTR/MRP), member 5 https://www.infrafrontier.eu/search?keyword=EM:11311 + EM:10761 C57BL/6NTac-Abcc5/H EMMA sperm mutant strain MGI:5749845 Abcc5 endonuclease-mediated mutation 1, Harwell MGI:1351644 Abcc5 ATP-binding cassette, sub-family C (CFTR/MRP), member 5 https://www.infrafrontier.eu/search?keyword=EM:10761 + EM:05200 C57BL/6NTac-Abcb11/Ieg EMMA embryo mutant strain MGI:4434682 Abcb11 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1351619 Abcb11 ATP-binding cassette, sub-family B (MDR/TAP), member 11 https://www.infrafrontier.eu/search?keyword=EM:05200 - EM:09555 C57BL/6NTac-A4galt/WtsiIeg EMMA sperm mutant strain MGI:5632380 A4galt targeted mutation 1, Wellcome Trust Sanger Institute MGI:3512453 A4galt alpha 1,4-galactosyltransferase https://www.infrafrontier.eu/search?keyword=EM:09555 + EM:07653 C57BL/6NTac-4933430I17Rik/IcsOrl EMMA sperm mutant strain MGI:4432117 4933430I17Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3045314 4933430I17Rik RIKEN cDNA 4933430I17 gene https://www.infrafrontier.eu/search?keyword=EM:07653 + EM:06470 C57BL/6NTac-4921536K21Rik/Wtsi EMMA embryo mutant strain MGI:4363036 4921536K21Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914680 4921536K21Rik RIKEN cDNA 4921536K21 gene https://www.infrafrontier.eu/search?keyword=EM:06470 + EM:06470 C57BL/6NTac-4921536K21Rik/Wtsi EMMA sperm mutant strain MGI:4363036 4921536K21Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914680 4921536K21Rik RIKEN cDNA 4921536K21 gene https://www.infrafrontier.eu/search?keyword=EM:06470 + EM:05713 C57BL/6NTac-3110001I22Rik/WtsiBiat EMMA embryo mutant strain MGI:4434304 Bfar targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913848 Pphln1-ps1 periphilin 1, pseudogene 1 https://www.infrafrontier.eu/search?keyword=EM:05713 + EM:07724 C57BL/6NTac-2900026A02Rik/IcsOrl EMMA archived mutant strain MGI:4435426 2900026A02Rik targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920194 2900026A02Rik RIKEN cDNA 2900026A02 gene https://www.infrafrontier.eu/search?keyword=EM:07724 + EM:04559 C57BL/6NTac-2810408A11Rik/H EMMA sperm EPD0175_1_E10 mutant strain MGI:4431683 2810408A11Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1917669 2810408A11Rik RIKEN cDNA 2810408A11 gene https://www.infrafrontier.eu/search?keyword=EM:04559 + EM:12136 C57BL/6NTac-2310057J18Rik/Wtsi EMMA embryo mutant strain MGI:4364593 2310057J18Rik targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914969 2310057J18Rik RIKEN cDNA 2310057J18 gene https://www.infrafrontier.eu/search?keyword=EM:12136 + EM:08745 C57BL/6NTac-1700067K01Rik/WtsiOrl EMMA sperm mutant strain MGI:5289829 1700067K01Rik targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1920703 1700067K01Rik RIKEN cDNA 1700067K01 gene https://www.infrafrontier.eu/search?keyword=EM:08745 - EM:08478 C57BL/6NTac-1700001C02Rik/WtsiFlmg EMMA sperm C57BL/6NTac-Fam166c/WtsiFlmg mutant strain MGI:4432273 Fam166c targeted mutation 1a, Wellcome Trust Sanger Institute 1700001C02 1700001C02Rik https://www.infrafrontier.eu/search?keyword=EM:08478 + EM:10873 C57BL/6NTac-1110017D15Rik/H EMMA sperm mutant strain MGI:5749859 1110017D15Rik endonuclease-mediated mutation 2, Harwell MGI:1920971 1110017D15Rik RIKEN cDNA 1110017D15 gene https://www.infrafrontier.eu/search?keyword=EM:10873 + EM:10768 C57BL/6NTac-1110017D15Rik/H EMMA live mutant strain MGI:5749856 1110017D15Rik endonuclease-mediated mutation 1, Harwell MGI:1920971 1110017D15Rik RIKEN cDNA 1110017D15 gene https://www.infrafrontier.eu/search?keyword=EM:10768 ? EM:13653 C57BL/6NJ-Acot12/Ieg EMMA sperm mutant strain MGI:6403702 Acot12 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1921406 Acot12 acyl-CoA thioesterase 12 https://www.infrafrontier.eu/search?keyword=EM:13653 ? EM:13696 C57BL/6NCrl-Zpbp2/Ieg EMMA sperm mutant strain Zpbp2 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1916626 Zpbp2 zona pellucida binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:13696 ? EM:13451 C57BL/6NCrl-Zmym6/Ieg EMMA sperm mutant strain MGI:6157344 Zmym6 endonuclease mediated mutation 2, Helmholtz Zentrum Muenchen GmbH MGI:106505 Zmym6 zinc finger, MYM-type 6 https://www.infrafrontier.eu/search?keyword=EM:13451 ? EM:13509 C57BL/6NCrl-Zmat5/Ieg EMMA sperm mutant strain Zmat5 CRISPR/CAS9 targeted mutation , undef MGI:1914428 Zmat5 zinc finger, matrin type 5 https://www.infrafrontier.eu/search?keyword=EM:13509 + EM:12239 C57BL/6NCrl-Zfp644/Ph EMMA sperm mutant strain MGI:6341848 Zfp644 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1277212 Zfp644 zinc finger protein 644 https://www.infrafrontier.eu/search?keyword=EM:12239 + EM:11532 C57BL/6NCrl-Zfp61/Ieg EMMA sperm mutant strain MGI:6120826 Zfp61 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:99663 Zfp61 zinc finger protein 61 https://www.infrafrontier.eu/search?keyword=EM:11532 ? EM:13577 C57BL/6NCrl-Zfp280d/Ieg EMMA sperm mutant strain MGI:6382407 Zfp280d endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2384583 Zfp280d zinc finger protein 280D https://www.infrafrontier.eu/search?keyword=EM:13577 + EM:11531 C57BL/6NCrl-Zdhhc5/Ieg EMMA sperm C57BL/6N-Zdhhc5/Ieg mutant strain MGI:6317366 Zdhhc5 targeted mutation 1e.1, Helmholtz Zentrum Muenchen GmbH MGI:1923573 Zdhhc5 zinc finger, DHHC domain containing 5 https://www.infrafrontier.eu/search?keyword=EM:11531 ? EM:13496 C57BL/6NCrl-Zdhhc20/Ieg EMMA sperm mutant strain MGI:6277052 Zdhhc20 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1923215 Zdhhc20 zinc finger, DHHC domain containing 20 https://www.infrafrontier.eu/search?keyword=EM:13496 ? EM:13631 C57BL/6NCrl-Zcchc17/Ieg EMMA sperm mutant strain MGI:6435661 Zcchc17 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1919955 Zcchc17 zinc finger, CCHC domain containing 17 https://www.infrafrontier.eu/search?keyword=EM:13631 + EM:12543 C57BL/6NCrl-Zc3h12a/Ieg EMMA sperm mutant strain MGI:6220866 Zc3h12a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2385891 Zc3h12a zinc finger CCCH type containing 12A https://www.infrafrontier.eu/search?keyword=EM:12543 + EM:11787 C57BL/6NCrl-Wiz/Ph EMMA sperm mutant strain MGI:6316145 Wiz endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1332638 Wiz widely-interspaced zinc finger motifs https://www.infrafrontier.eu/search?keyword=EM:11787 + EM:09053 C57BL/6NCrl-Wdsub1/Ph EMMA archived mutant strain MGI:5588281 Wdsub1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919387 Wdsub1 WD repeat, SAM and U-box domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:09053 ? EM:12414 C57BL/6NCrl-Wdr63/Ph EMMA live mutant strain Wdr63 CRISPR/CAS9 targeted mutation , undef MGI:3045269 Dnai3 dynein axonemal intermediate chain 3 https://www.infrafrontier.eu/search?keyword=EM:12414 + EM:11684 C57BL/6NCrl-Vgll4/Ieg EMMA sperm mutant strain MGI:6120802 Vgll4 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2652840 Vgll4 vestigial like family member 4 https://www.infrafrontier.eu/search?keyword=EM:11684 ? EM:13479 C57BL/6NCrl-Vdac3/Ieg EMMA sperm mutant strain MGI:6273947 Vdac3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:106922 Vdac3 voltage-dependent anion channel 3 https://www.infrafrontier.eu/search?keyword=EM:13479 ? EM:13400 C57BL/6NCrl-Uggt2/Ieg EMMA sperm mutant strain MGI:6472606 Uggt2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913685 Uggt2 UDP-glucose glycoprotein glucosyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:13400 + EM:11770 C57BL/6NCrl-Uchl4/Ph EMMA sperm C57BL/6NCrl-Uchl4/Ph mutant strain MGI:6152712 Uchl4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1890440 Uchl4 ubiquitin carboxyl-terminal esterase L4 https://www.infrafrontier.eu/search?keyword=EM:11770 + EM:12280 C57BL/6NCrl-Ubl4b/Ph EMMA sperm mutant strain MGI:6341871 Ubl4b endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1914841 Ubl4b ubiquitin-like 4B https://www.infrafrontier.eu/search?keyword=EM:12280 ? EM:13473 C57BL/6NCrl-Ube3a/Ieg EMMA sperm mutant strain MGI:6273955 Ube3a endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:105098 Ube3a ubiquitin protein ligase E3A https://www.infrafrontier.eu/search?keyword=EM:13473 + EM:12283 C57BL/6NCrl-Ube2n/Ph EMMA live mutant strain MGI:6341889 Ube2n endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1934835 Ube2n ubiquitin-conjugating enzyme E2N https://www.infrafrontier.eu/search?keyword=EM:12283 + EM:11332 C57BL/6NCrl-Ubd/Ph EMMA sperm mutant strain MGI:6120710 Ubd targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1344410 Ubd ubiquitin D https://www.infrafrontier.eu/search?keyword=EM:11332 + EM:11614 C57BL/6NCrl-Ubd/Ph EMMA sperm mutant strain MGI:5810734 Ubd targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1344410 Ubd ubiquitin D https://www.infrafrontier.eu/search?keyword=EM:11614 + EM:12290 C57BL/6NCrl-Ubac2/Ieg EMMA sperm mutant strain Ubac2 EUCOMM targeted mutation 1e.1, Helmholtz Zentrum Muenchen GmbH MGI:1916139 Ubac2 ubiquitin associated domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:12290 + EM:11687 C57BL/6NCrl-Tyk2/Ieg EMMA sperm mutant strain MGI:6120762 Tyk2 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1929470 Tyk2 tyrosine kinase 2 https://www.infrafrontier.eu/search?keyword=EM:11687 ? EM:13724 C57BL/6NCrl-Ttll8/Ieg EMMA sperm mutant strain MGI:6441116 Ttll8 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1922902 Ttll8 tubulin tyrosine ligase-like family, member 8 https://www.infrafrontier.eu/search?keyword=EM:13724 + EM:11666 C57BL/6NCrl-Ttll12/Ieg EMMA sperm C57BL/6N-Ttll12/Ieg mutant strain MGI:6317367 Ttll12 targeted mutation 1e.1, Wellcome Trust Sanger Institute MGI:3039573 Ttll12 tubulin tyrosine ligase-like family, member 12 https://www.infrafrontier.eu/search?keyword=EM:11666 ? EM:13557 C57BL/6NCrl-Tspan8/Ieg EMMA sperm mutant strain MGI:6277054 Tspan8 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2384918 Tspan8 tetraspanin 8 https://www.infrafrontier.eu/search?keyword=EM:13557 ? EM:13635 C57BL/6NCrl-Tspan15/Ieg EMMA sperm mutant strain Tspan15 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1917673 Tspan15 tetraspanin 15 https://www.infrafrontier.eu/search?keyword=EM:13635 + EM:11303 C57BL/6NCrl-Trim9/Ph EMMA sperm mutant strain MGI:6147539 Trim9 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2137354 Trim9 tripartite motif-containing 9 https://www.infrafrontier.eu/search?keyword=EM:11303 + EM:09055 C57BL/6NCrl-Trim15/Ph EMMA archived mutant strain MGI:5588277 Trim15 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1916347 Trim15 tripartite motif-containing 15 https://www.infrafrontier.eu/search?keyword=EM:09055 + EM:11338 C57BL/6NCrl-Trabd2b/Ph EMMA sperm C57BL/6NCrl-Trabd2b/Ph mutant strain MGI:6152711 Trabd2b endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:3650152 Trabd2b TraB domain containing 2B https://www.infrafrontier.eu/search?keyword=EM:11338 ? EM:13515 C57BL/6NCrl-Tnks/Ieg EMMA sperm mutant strain MGI:6273966 Tnks endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1341087 Tnks tankyrase, TRF1-interacting ankyrin-related ADP-ribose polymerase https://www.infrafrontier.eu/search?keyword=EM:13515 + EM:11913 C57BL/6NCrl-Tmem62/Ph EMMA sperm mutant strain MGI:6341890 Tmem62 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2139461 Tmem62 transmembrane protein 62 https://www.infrafrontier.eu/search?keyword=EM:11913 + EM:11682 C57BL/6NCrl-Tmem60/Ph EMMA live C57BL/6NCrl-Tmem60/Ph mutant strain MGI:6152710 Tmem60 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2673965 Tmem60 transmembrane protein 60 https://www.infrafrontier.eu/search?keyword=EM:11682 + EM:11874 C57BL/6NCrl-Tmem47/Ph EMMA sperm mutant strain MGI:6341870 Tmem47 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2177570 Tmem47 transmembrane protein 47 https://www.infrafrontier.eu/search?keyword=EM:11874 + EM:11876 C57BL/6NCrl-Tmem273/Ph EMMA sperm mutant strain MGI:6341882 Tmem273 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1916319 Tmem273 transmembrane protein 273 https://www.infrafrontier.eu/search?keyword=EM:11876 + EM:12176 C57BL/6NCrl-Tmem240/Ph EMMA sperm mutant strain MGI:6341826 Tmem240 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3648074 Tmem240 transmembrane protein 240 https://www.infrafrontier.eu/search?keyword=EM:12176 + EM:11771 C57BL/6NCrl-Tmem150b/Ph EMMA sperm C57BL/6NCrl-Tmem150b/Ph mutant strain MGI:6152708 Tmem150b endonuclease mediated mutation 1, Institute of Molecular Genetics MGI:2679718 Tmem150b transmembrane protein 150B https://www.infrafrontier.eu/search?keyword=EM:11771 + EM:11772 C57BL/6NCrl-Tmem132b/Ph EMMA sperm C57BL/6NCrl-Tmem132b/Ph mutant strain MGI:6152707 Tmem132b endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3609245 Tmem132b transmembrane protein 132B https://www.infrafrontier.eu/search?keyword=EM:11772 ? EM:13467 C57BL/6NCrl-Tle1/Ieg EMMA sperm mutant strain MGI:6384610 Tle1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:104636 Tle1 transducin-like enhancer of split 1 https://www.infrafrontier.eu/search?keyword=EM:13467 ? EM:13488 C57BL/6NCrl-Timp2/Ieg EMMA sperm mutant strain MGI:6276911 Timp2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:98753 Timp2 tissue inhibitor of metalloproteinase 2 https://www.infrafrontier.eu/search?keyword=EM:13488 + EM:11538 C57BL/6NCrl-Thg1l/Ieg EMMA sperm mutant strain MGI:6120731 Thg1l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913878 Thg1l tRNA-histidine guanylyltransferase 1-like (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:11538 + EM:12476 C57BL/6NCrl-Tg(Vav1-STAT5B)731Biat/Biat EMMA sperm B6N-Tg(STAT5B)731Biat mutant strain MGI:6164041 Tg(Vav1-STAT5B)731Biat transgene insertion 731, Biomodels Austria MGI:6164040 Tg(Vav1-STAT5B)731Biat transgene insertion 731, Biomodels Austria https://www.infrafrontier.eu/search?keyword=EM:12476 + EM:02120 C57BL/6NCrl-Tg(Bglap-Omd)1Kieg/Kieg EMMA embryo OSAD, C57BL/6NCrlOSAD mutant strain MGI:5516352 Tg(Bglap-Omd)1Kieg transgene insertion 1, Karolinska Institute Unit for Embryology and Genetics MGI:5516351 Tg(Bglap-Omd)1Kieg transgene insertion 1, Karolinska Institute Unit for Embryology and Genetics https://www.infrafrontier.eu/search?keyword=EM:02120 + EM:11774 C57BL/6NCrl-Tent5a/Ph EMMA sperm C57BL/6NCrl-Fam46a/Ph mutant strain MGI:6152705 Tent5a endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2670964 Tent5a terminal nucleotidyltransferase 5A https://www.infrafrontier.eu/search?keyword=EM:11774 + EM:11700 C57BL/6NCrl-Tent4a/Ph EMMA sperm C57BL/6NCrl-Papd7/Ph mutant strain MGI:6120803 Tent4a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2682295 Tent4a terminal nucleotidyltransferase 4A https://www.infrafrontier.eu/search?keyword=EM:11700 ? EM:14738 C57BL/6NCrl-Ten1/Ieg EMMA sperm mutant strain MGI:6449028 Ten1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1916785 Ten1 TEN1 telomerase capping complex subunit https://www.infrafrontier.eu/search?keyword=EM:14738 ? EM:13619 C57BL/6NCrl-Tcp11x2/Ieg EMMA sperm mutant strain MGI:6449038 Tcp11x2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1919091 Tcp11x2 t-complex 11 family, X-linked 2 https://www.infrafrontier.eu/search?keyword=EM:13619 + EM:12192 C57BL/6NCrl-Tbl1xr1/Ieg EMMA sperm mutant strain MGI:6199116 Tbl1xr1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2441730 Tbl1xr1 transducin (beta)-like 1X-linked receptor 1 https://www.infrafrontier.eu/search?keyword=EM:12192 + EM:11962 C57BL/6NCrl-Tasor/Ph EMMA sperm mutant strain MGI:6341945 Tasor endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1921694 Tasor transcription activation suppressor https://www.infrafrontier.eu/search?keyword=EM:11962 ? EM:13497 C57BL/6NCrl-Tanc2/Ieg EMMA sperm mutant strain MGI:6384591 Tanc2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2444121 Tanc2 tetratricopeptide repeat, ankyrin repeat and coiled-coil containing 2 https://www.infrafrontier.eu/search?keyword=EM:13497 ? EM:13581 C57BL/6NCrl-Sytl4/Ieg EMMA sperm mutant strain MGI:6451108 Sytl4 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1351606 Sytl4 synaptotagmin-like 4 https://www.infrafrontier.eu/search?keyword=EM:13581 + EM:11534 C57BL/6NCrl-Syncrip/Ieg EMMA sperm mutant strain MGI:6120727 Syncrip targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1891690 Syncrip synaptotagmin binding, cytoplasmic RNA interacting protein https://www.infrafrontier.eu/search?keyword=EM:11534 - EM:10366 C57BL/6NCrl-Syde1/Ieg EMMA sperm mutant strain MGI:5704518 Syde1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1918959 Syde1 synapse defective 1, Rho GTPase, homolog 1 (C. elegans) https://www.infrafrontier.eu/search?keyword=EM:10366 ? EM:13409 C57BL/6NCrl-Sycp2/Ieg EMMA sperm mutant strain MGI:6507385 Sycp2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1933281 Sycp2 synaptonemal complex protein 2 https://www.infrafrontier.eu/search?keyword=EM:13409 ? EM:13506 C57BL/6NCrl-Sult2a8/Ieg EMMA sperm mutant strain MGI:6314734 Sult2a8 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1924221 Sult2a8 sulfotransferase family 2A, dehydroepiandrosterone (DHEA)-preferring, member 8 https://www.infrafrontier.eu/search?keyword=EM:13506 + EM:11908 C57BL/6NCrl-Sulf1/Ieg EMMA sperm mutant strain MGI:6160170 Sulf1 targeted mutation 1b, Mouse Biology Program, UCDavis MGI:2138563 Sulf1 sulfatase 1 https://www.infrafrontier.eu/search?keyword=EM:11908 ? EM:13494 C57BL/6NCrl-Stxbp5/Ieg EMMA sperm mutant strain MGI:6277010 Stxbp5 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1926058 Stxbp5 syntaxin binding protein 5 (tomosyn) https://www.infrafrontier.eu/search?keyword=EM:13494 + EM:10138 C57BL/6NCrl-Stx5a/Ieg EMMA sperm mutant strain MGI:5692753 Stx5a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1928483 Stx5a syntaxin 5A https://www.infrafrontier.eu/search?keyword=EM:10138 + EM:11702 C57BL/6NCrl-Strn4/Ph EMMA sperm C57BL/6N-Strn4/Ph mutant strain MGI:6317368 Strn4 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2142346 Strn4 striatin, calmodulin binding protein 4 https://www.infrafrontier.eu/search?keyword=EM:11702 + EM:12184 C57BL/6NCrl-Strip2/Ph EMMA sperm mutant strain MGI:6341827 Strip2 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2444363 Strip2 striatin interacting protein 2 https://www.infrafrontier.eu/search?keyword=EM:12184 ? EM:13603 C57BL/6NCrl-Strbp/Ieg EMMA sperm mutant strain MGI:6302759 Strbp endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:104626 Strbp spermatid perinuclear RNA binding protein https://www.infrafrontier.eu/search?keyword=EM:13603 + EM:12248 C57BL/6NCrl-Stk26/Ph EMMA sperm mutant strain MGI:6159329 Stk26 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1917665 Stk26 serine/threonine kinase 26 https://www.infrafrontier.eu/search?keyword=EM:12248 ? EM:13733 C57BL/6NCrl-Sptlc3/Ieg EMMA sperm mutant strain MGI:6441120 Sptlc3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2444678 Sptlc3 serine palmitoyltransferase, long chain base subunit 3 https://www.infrafrontier.eu/search?keyword=EM:13733 + EM:11985 C57BL/6NCrl-Spryd4/Ph EMMA sperm mutant strain MGI:6341853 Spryd4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1913951 Spryd4 SPRY domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:11985 + EM:11773 C57BL/6NCrl-Spink6/Ph EMMA sperm C57BL/6NCrl-Spink6/Ph mutant strain MGI:6152706 Spink6 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3648654 Spink6 serine peptidase inhibitor, Kazal type 6 https://www.infrafrontier.eu/search?keyword=EM:11773 ? EM:12420 C57BL/6NCrl-Spink13/Ph EMMA sperm mutant strain MGI:6341936 Spink13 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3642511 Spink13 serine peptidase inhibitor, Kazal type 13 https://www.infrafrontier.eu/search?keyword=EM:12420 ? EM:12279 C57BL/6NCrl-Sox14/Ph EMMA sperm mutant strain MGI:6341893 Sox14 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:98362 Sox14 SRY (sex determining region Y)-box 14 https://www.infrafrontier.eu/search?keyword=EM:12279 ? EM:13418 C57BL/6NCrl-Snx13/Ieg EMMA sperm mutant strain MGI:6472608 Snx13 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2661416 Snx13 sorting nexin 13 https://www.infrafrontier.eu/search?keyword=EM:13418 ? EM:13582 C57BL/6NCrl-Snrpb2/Ieg EMMA sperm mutant strain MGI:6414501 Snrpb2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:104805 Snrpb2 U2 small nuclear ribonucleoprotein B https://www.infrafrontier.eu/search?keyword=EM:13582 + EM:10113 C57BL/6NCrl-Smim6/Ieg EMMA sperm mutant strain MGI:5692688 Smim6 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915778 Smim6 small integral membrane protein 6 https://www.infrafrontier.eu/search?keyword=EM:10113 ? EM:13595 C57BL/6NCrl-Slc6a15/Ieg EMMA sperm mutant strain MGI:6361241 Slc6a15 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2143484 Slc6a15 solute carrier family 6 (neurotransmitter transporter), member 15 https://www.infrafrontier.eu/search?keyword=EM:13595 ? EM:13573 C57BL/6NCrl-Slc5a9/Ieg EMMA sperm mutant strain MGI:6423835 Slc5a9 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2140201 Slc5a9 solute carrier family 5 (sodium/glucose cotransporter), member 9 https://www.infrafrontier.eu/search?keyword=EM:13573 ? EM:13654 C57BL/6NCrl-Slc5a4a/Ieg EMMA sperm mutant strain MGI:6414481 Slc5a4a endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1927848 Slc5a4a solute carrier family 5, member 4a https://www.infrafrontier.eu/search?keyword=EM:13654 ? EM:13626 C57BL/6NCrl-Slc35f5/Ieg EMMA sperm mutant strain MGI:6414495 Slc35f5 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1921400 Slc35f5 solute carrier family 35, member F5 https://www.infrafrontier.eu/search?keyword=EM:13626 - EM:11872 C57BL/6NCrl-Slc25a32/Orl EMMA archived mutant strain MGI:6406920 Slc25a32 endonuclease-mediated mutation 1, Orleans MGI:1917156 Slc25a32 solute carrier family 25, member 32 https://www.infrafrontier.eu/search?keyword=EM:11872 ? EM:13558 C57BL/6NCrl-Slc25a13/Ieg EMMA sperm mutant strain MGI:6388371 Slc25a13 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1354721 Slc25a13 solute carrier family 25 (mitochondrial carrier, adenine nucleotide translocator), member 13 https://www.infrafrontier.eu/search?keyword=EM:13558 ? EM:13561 C57BL/6NCrl-Slc25a12/Ieg EMMA sperm mutant strain MGI:6305719 Slc25a12 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1926080 Slc25a12 solute carrier family 25 (mitochondrial carrier, Aralar), member 12 https://www.infrafrontier.eu/search?keyword=EM:13561 + EM:12252 C57BL/6NCrl-Slc25a10/Ieg EMMA sperm mutant strain MGI:6120716 Slc25a10 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1353497 Slc25a10 solute carrier family 25 (mitochondrial carrier, dicarboxylate transporter), member 10 https://www.infrafrontier.eu/search?keyword=EM:12252 ? EM:13640 C57BL/6NCrl-Slc13a4/Ieg EMMA sperm mutant strain MGI:6414526 Slc13a4 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2442367 Slc13a4 solute carrier family 13 (sodium/sulfate symporters), member 4 https://www.infrafrontier.eu/search?keyword=EM:13640 + EM:11535 C57BL/6NCrl-Slc12a9/Ieg EMMA sperm mutant strain MGI:6120766 Slc12a9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1933532 Slc12a9 solute carrier family 12 (potassium/chloride transporters), member 9 https://www.infrafrontier.eu/search?keyword=EM:11535 ? EM:12418 C57BL/6NCrl-Sla2/Ph EMMA sperm mutant strain MGI:6341873 Sla2 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1925049 Sla2 Src-like-adaptor 2 https://www.infrafrontier.eu/search?keyword=EM:12418 + EM:12170 C57BL/6NCrl-Sinhcaf/Ph EMMA sperm mutant strain MGI:6341898 Sinhcaf endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1929091 Sinhcaf SIN3-HDAC complex associated factor https://www.infrafrontier.eu/search?keyword=EM:12170 + EM:12835 C57BL/6NCrl-Shisal2a/Ieg EMMA sperm mutant strain MGI:6279892 Shisal2a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3651644 Shisal2a shisa like 2A https://www.infrafrontier.eu/search?keyword=EM:12835 + EM:12276 C57BL/6NCrl-Shisal1/Ph EMMA sperm mutant strain MGI:6341918 Shisal1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1919551 Shisal1 shisa like 1 https://www.infrafrontier.eu/search?keyword=EM:12276 ? EM:13493 C57BL/6NCrl-Sec13/Ieg EMMA sperm mutant strain MGI:6279926 Sec13 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:99832 Sec13 SEC13 homolog, nuclear pore and COPII coat complex component https://www.infrafrontier.eu/search?keyword=EM:13493 + EM:10169 C57BL/6NCrl-Sec11c/Ieg EMMA sperm mutant strain MGI:5696903 Sec11c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913536 Sec11c SEC11 homolog C, signal peptidase complex subunit https://www.infrafrontier.eu/search?keyword=EM:10169 + EM:11909 C57BL/6NCrl-Scmh1/Ieg EMMA sperm mutant strain MGI:6324158 Scmh1 targeted mutation 1e.1, Helmholtz Zentrum Muenchen GmbH MGI:1352762 Scmh1 sex comb on midleg homolog 1 https://www.infrafrontier.eu/search?keyword=EM:11909 ? EM:13734 C57BL/6NCrl-Scara3/Ieg EMMA sperm mutant strain Scara3 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:2444418 Scara3 scavenger receptor class A, member 3 https://www.infrafrontier.eu/search?keyword=EM:13734 + EM:11304 C57BL/6NCrl-Sbspon/Ph EMMA sperm mutant strain MGI:6147538 Sbspon endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2684952 Sbspon somatomedin B and thrombospondin, type 1 domain containing https://www.infrafrontier.eu/search?keyword=EM:11304 + EM:12286 C57BL/6NCrl-Sbsn/Ph EMMA sperm mutant strain MGI:6341905 Sbsn endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2446326 Sbsn suprabasin https://www.infrafrontier.eu/search?keyword=EM:12286 ? EM:13645 C57BL/6NCrl-Samm50/Ieg EMMA sperm mutant strain MGI:6414489 Samm50 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1915903 Samm50 SAMM50 sorting and assembly machinery component https://www.infrafrontier.eu/search?keyword=EM:13645 ? EM:13627 C57BL/6NCrl-Rtn4/Ieg EMMA sperm mutant strain MGI:6279927 Rtn4 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1915835 Rtn4 reticulon 4 https://www.infrafrontier.eu/search?keyword=EM:13627 + EM:11366 C57BL/6NCrl-Rnls/Ieg EMMA sperm mutant strain MGI:6120734 Rnls targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915045 Rnls renalase, FAD-dependent amine oxidase https://www.infrafrontier.eu/search?keyword=EM:11366 + EM:12752 C57BL/6NCrl-Rnf5/Ph EMMA sperm mutant strain MGI:6361211 Rnf5 targeted mutation 1.1, Velocigene MGI:1860076 Rnf5 ring finger protein 5 https://www.infrafrontier.eu/search?keyword=EM:12752 + EM:12180 C57BL/6NCrl-Rnf4/Ph EMMA sperm mutant strain MGI:6341902 Rnf4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1201691 Rnf4 ring finger protein 4 https://www.infrafrontier.eu/search?keyword=EM:12180 ? EM:12277 C57BL/6NCrl-Rnf223/Ph EMMA sperm mutant strain MGI:6341957 Rnf223 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3588193 Rnf223 ring finger 223 https://www.infrafrontier.eu/search?keyword=EM:12277 + EM:12413 C57BL/6NCrl-Rnf19b/Ph EMMA live mutant strain MGI:6341934 Rnf19b endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1922484 Rnf19b ring finger protein 19B https://www.infrafrontier.eu/search?keyword=EM:12413 + EM:10161 C57BL/6NCrl-Rnf186/Ph EMMA sperm mutant strain MGI:5695912 Rnf186 targeted mutation 1.1, Velocigene MGI:1914075 Rnf186 ring finger protein 186 https://www.infrafrontier.eu/search?keyword=EM:10161 ? EM:13197 C57BL/6NCrl-Rnf168/Ph EMMA live mutant strain MGI:6433991 Rnf168 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1917488 Rnf168 ring finger protein 168 https://www.infrafrontier.eu/search?keyword=EM:13197 ? EM:12419 C57BL/6NCrl-Rnf14/Ph EMMA sperm mutant strain MGI:6341897 Rnf14 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1929668 Rnf14 ring finger protein 14 https://www.infrafrontier.eu/search?keyword=EM:12419 + EM:12656 C57BL/6NCrl-Rnf121/Ph EMMA sperm mutant strain MGI:5609353 Rnf121 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1922462 Rnf121 ring finger protein 121 https://www.infrafrontier.eu/search?keyword=EM:12656 + EM:11339 C57BL/6NCrl-Rhobtb1/Ph EMMA sperm mutant strain MGI:6147537 Rhobtb1 endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:1916538 Rhobtb1 Rho-related BTB domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:11339 ? EM:13484 C57BL/6NCrl-Rhbg/Ieg EMMA sperm mutant strain MGI:6273949 Rhbg endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1927379 Rhbg Rhesus blood group-associated B glycoprotein https://www.infrafrontier.eu/search?keyword=EM:13484 ? EM:12589 C57BL/6NCrl-Rffl/Ph EMMA live mutant strain MGI:6341904 Rffl endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1914588 Rffl ring finger and FYVE like domain containing protein https://www.infrafrontier.eu/search?keyword=EM:12589 + EM:11464 C57BL/6NCrl-Retreg2/Ph EMMA sperm mutant strain MGI:6147536 Retreg2 endonucleas-mediated mutation 2, Institute of Molecular Genetics MGI:2388278 Retreg2 reticulophagy regulator family member 2 https://www.infrafrontier.eu/search?keyword=EM:11464 ? EM:13643 C57BL/6NCrl-Rbm39/Ieg EMMA sperm mutant strain MGI:6403708 Rbm39 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2157953 Rbm39 RNA binding motif protein 39 https://www.infrafrontier.eu/search?keyword=EM:13643 ? EM:13618 C57BL/6NCrl-Raver1/Ieg EMMA sperm mutant strain MGI:6414545 Raver1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1919016 Raver1 ribonucleoprotein, PTB-binding 1 https://www.infrafrontier.eu/search?keyword=EM:13618 ? EM:13637 C57BL/6NCrl-Ptbp2/Ieg EMMA sperm mutant strain MGI:6388381 Ptbp2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1860489 Ptbp2 polypyrimidine tract binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:13637 + EM:12284 C57BL/6NCrl-Pstpip1/Ph EMMA sperm mutant strain MGI:6341846 Pstpip1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1321396 Pstpip1 proline-serine-threonine phosphatase-interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:12284 ? EM:14563 C57BL/6NCrl-Psors1c2/Ieg EMMA sperm mutant strain Psors1c2 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1930025 Psors1c2 psoriasis susceptibility 1 candidate 2 (human) https://www.infrafrontier.eu/search?keyword=EM:14563 + EM:10140 C57BL/6NCrl-Psmc2/Ieg EMMA sperm mutant strain MGI:5692582 Psmc2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:109555 Psmc2 proteasome (prosome, macropain) 26S subunit, ATPase 2 https://www.infrafrontier.eu/search?keyword=EM:10140 ? EM:12682 C57BL/6NCrl-Prss57/Ph EMMA sperm mutant strain MGI:6341906 Prss57 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1920356 Prss57 protease, serine 57 https://www.infrafrontier.eu/search?keyword=EM:12682 ? EM:12594 C57BL/6NCrl-Prss47/Ph EMMA sperm mutant strain MGI:6341895 Prss47 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2685120 Prss47 protease, serine 47 https://www.infrafrontier.eu/search?keyword=EM:12594 ? EM:12602 C57BL/6NCrl-Prss21/Ph EMMA sperm mutant strain MGI:6341900 Prss21 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1916698 Prss21 protease, serine 21 https://www.infrafrontier.eu/search?keyword=EM:12602 ? EM:13439 C57BL/6NCrl-Prox2/Ieg EMMA sperm mutant strain MGI:6257723 Prox2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1920672 Prox2 prospero homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:13439 ? EM:13414 C57BL/6NCrl-Prkd3/Ieg EMMA sperm mutant strain MGI:6472607 Prkd3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922542 Prkd3 protein kinase D3 https://www.infrafrontier.eu/search?keyword=EM:13414 ? EM:13445 C57BL/6NCrl-Prkd2/Ieg EMMA sperm mutant strain MGI:6257638 Prkd2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2141917 Prkd2 protein kinase D2 https://www.infrafrontier.eu/search?keyword=EM:13445 + EM:11370 C57BL/6NCrl-Ppp4r3b/Ieg EMMA sperm mutant strain MGI:6120774 Ppp4r3b targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2144474 Ppp4r3b protein phosphatase 4 regulatory subunit 3B https://www.infrafrontier.eu/search?keyword=EM:11370 ? EM:15005 C57BL/6NCrl-Pomk/Ieg EMMA sperm mutant strain Pomk CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1921903 Pomk protein-O-mannose kinase https://www.infrafrontier.eu/search?keyword=EM:15005 ? EM:14678 C57BL/6NCrl-Plppr5/Ph EMMA sperm mutant strain Plppr5 CRISPR/CAS9 targeted mutation , undef MGI:1923019 Plppr5 phospholipid phosphatase related 5 https://www.infrafrontier.eu/search?keyword=EM:14678 ? EM:14579 C57BL/6NCrl-Plpp4/Ieg EMMA sperm mutant strain Plpp4 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:2685936 Plpp4 phospholipid phosphatase 4 https://www.infrafrontier.eu/search?keyword=EM:14579 + EM:12539 C57BL/6NCrl-Plekha1/Ieg EMMA sperm mutant strain MGI:6256795 Plekha1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2442213 Plekha1 pleckstrin homology domain containing, family A (phosphoinositide binding specific) member 1 https://www.infrafrontier.eu/search?keyword=EM:12539 ? EM:13491 C57BL/6NCrl-Plag1/Ieg EMMA sperm mutant strain MGI:6273963 Plag1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1891916 Plag1 pleiomorphic adenoma gene 1 https://www.infrafrontier.eu/search?keyword=EM:13491 + EM:11866 C57BL/6NCrl-Pknox2/Ph EMMA sperm mutant strain MGI:6341886 Pknox2 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2445415 Pknox2 Pbx/knotted 1 homeobox 2 https://www.infrafrontier.eu/search?keyword=EM:11866 + EM:11740 C57BL/6NCrl-Pip4p1/Ph EMMA sperm C57BL/6NCrl-Tmem55b/Ph, C57BL/6NCrl-Tmem55b/Ph mutant strain MGI:6152709 Pip4p1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2448501 Pip4p1 phosphatidylinositol-4,5-bisphosphate 4-phosphatase 1 https://www.infrafrontier.eu/search?keyword=EM:11740 ? EM:13563 C57BL/6NCrl-Phf14/Ieg EMMA sperm mutant strain MGI:6277016 Phf14 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1923539 Phf14 PHD finger protein 14 https://www.infrafrontier.eu/search?keyword=EM:13563 + EM:12435 C57BL/6NCrl-Phf10/Ieg EMMA sperm mutant strain MGI:6276833 Phf10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919307 Phf10 PHD finger protein 10 https://www.infrafrontier.eu/search?keyword=EM:12435 ? EM:13430 C57BL/6NCrl-Phactr4/Ieg EMMA sperm mutant strain MGI:6324157 Phactr4 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2140327 Phactr4 phosphatase and actin regulator 4 https://www.infrafrontier.eu/search?keyword=EM:13430 ? EM:13501 C57BL/6NCrl-Phactr3/Ieg EMMA sperm mutant strain MGI:6273948 Phactr3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1921439 Phactr3 phosphatase and actin regulator 3 https://www.infrafrontier.eu/search?keyword=EM:13501 ? EM:13455 C57BL/6NCrl-Phactr2/Ieg EMMA sperm mutant strain MGI:6257524 Phactr2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2446138 Phactr2 phosphatase and actin regulator 2 https://www.infrafrontier.eu/search?keyword=EM:13455 ? EM:13727 C57BL/6NCrl-Pgm3/Ieg EMMA sperm mutant strain MGI:6388357 Pgm3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:97566 Pgm3 phosphoglucomutase 3 https://www.infrafrontier.eu/search?keyword=EM:13727 ? EM:11529 C57BL/6NCrl-Pex1/Ieg EMMA sperm mutant strain Pex1 EUCOMM targeted mutation 1e.1, Helmholtz Zentrum Muenchen GmbH MGI:1918632 Pex1 peroxisomal biogenesis factor 1 https://www.infrafrontier.eu/search?keyword=EM:11529 ? EM:13617 C57BL/6NCrl-Pdia3/Ieg EMMA sperm mutant strain MGI:6399889 Pdia3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:95834 Pdia3 protein disulfide isomerase associated 3 https://www.infrafrontier.eu/search?keyword=EM:13617 + EM:11911 C57BL/6NCrl-Pdgfc/Ieg EMMA sperm mutant strain MGI:6160167 Pdgfc targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1859631 Pdgfc platelet-derived growth factor, C polypeptide https://www.infrafrontier.eu/search?keyword=EM:11911 ? EM:13434 C57BL/6NCrl-Pdcd6ip/Ieg EMMA live mutant strain MGI:6257536 Pdcd6ip endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1333753 Pdcd6ip programmed cell death 6 interacting protein https://www.infrafrontier.eu/search?keyword=EM:13434 + EM:12341 C57BL/6NCrl-Pcp4l1/Ph EMMA sperm mutant strain MGI:6120730 Pcp4l1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913675 Pcp4l1 Purkinje cell protein 4-like 1 https://www.infrafrontier.eu/search?keyword=EM:12341 ? EM:13602 C57BL/6NCrl-Pcdhgc3/Ieg EMMA sperm mutant strain MGI:6336215 Pcdhgc3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1935201 Pcdhgc3 protocadherin gamma subfamily C, 3 https://www.infrafrontier.eu/search?keyword=EM:13602 ? EM:13560 C57BL/6NCrl-Pcdhgb2/Ieg EMMA sperm mutant strain MGI:6336214 Pcdhgb2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1935170 Pcdhgb2 protocadherin gamma subfamily B, 2 https://www.infrafrontier.eu/search?keyword=EM:13560 ? EM:13517 C57BL/6NCrl-Pcdhga1/Ieg EMMA sperm mutant strain MGI:6273954 Pcdhga1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1935212 Pcdhga1 protocadherin gamma subfamily A, 1 https://www.infrafrontier.eu/search?keyword=EM:13517 ? EM:13725 C57BL/6NCrl-Pcca/Ieg EMMA sperm mutant strain Pcca CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:97499 Pcca propionyl-Coenzyme A carboxylase, alpha polypeptide https://www.infrafrontier.eu/search?keyword=EM:13725 ? EM:13441 C57BL/6NCrl-Pacs1/Ieg EMMA sperm mutant strain MGI:6257514 Pacs1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1277113 Pacs1 phosphofurin acidic cluster sorting protein 1 https://www.infrafrontier.eu/search?keyword=EM:13441 + EM:12831 C57BL/6NCrl-P2rx2/Ieg EMMA sperm mutant strain MGI:6279891 P2rx2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2665170 P2rx2 purinergic receptor P2X, ligand-gated ion channel, 2 https://www.infrafrontier.eu/search?keyword=EM:12831 ? EM:14898 C57BL/6NCrl-Omd/Ieg EMMA sperm mutant strain Omd CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1350918 Omd osteomodulin https://www.infrafrontier.eu/search?keyword=EM:14898 ? EM:13507 C57BL/6NCrl-Oma1/Ieg EMMA sperm mutant strain MGI:6314739 Oma1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1914263 Oma1 OMA1 zinc metallopeptidase https://www.infrafrontier.eu/search?keyword=EM:13507 ? EM:13513 C57BL/6NCrl-Olfr1466/Ieg EMMA sperm mutant strain Olfr1466 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:3031300 Or5b112 olfactory receptor family 5 subfamily B member 112 https://www.infrafrontier.eu/search?keyword=EM:13513 ? EM:13063 C57BL/6NCrl-Nxnl2/Ph EMMA sperm mutant strain Nxnl2 CRISPR/CAS9 targeted mutation , undef MGI:1922374 Nxnl2 nucleoredoxin-like 2 https://www.infrafrontier.eu/search?keyword=EM:13063 + EM:12182 C57BL/6NCrl-Nwd2/Ph EMMA sperm mutant strain MGI:6341878 Nwd2 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1920464 Nwd2 NACHT and WD repeat domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:12182 + EM:11907 C57BL/6NCrl-Nup35/Ieg EMMA sperm mutant strain MGI:6160168 Nup35 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916732 Nup35 nucleoporin 35 https://www.infrafrontier.eu/search?keyword=EM:11907 + EM:11365 C57BL/6NCrl-Nucks1/Ieg EMMA sperm mutant strain MGI:6120767 Nucks1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1934811 Nucks1 nuclear casein kinase and cyclin-dependent kinase substrate 1 https://www.infrafrontier.eu/search?keyword=EM:11365 + EM:11613 C57BL/6NCrl-Nub1/Ph EMMA sperm mutant strain MGI:5766751 Nub1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1889001 Nub1 negative regulator of ubiquitin-like proteins 1 https://www.infrafrontier.eu/search?keyword=EM:11613 ? EM:13511 C57BL/6NCrl-Nt5c2/Ieg EMMA sperm mutant strain MGI:6273967 Nt5c2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2178563 Nt5c2 5'-nucleotidase, cytosolic II https://www.infrafrontier.eu/search?keyword=EM:13511 ? EM:13495 C57BL/6NCrl-Npepps/Ieg EMMA sperm mutant strain MGI:6276869 Npepps endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1101358 Npepps aminopeptidase puromycin sensitive https://www.infrafrontier.eu/search?keyword=EM:13495 ? EM:13481 C57BL/6NCrl-Neurod2/Ieg EMMA sperm mutant strain MGI:6273956 Neurod2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:107755 Neurod2 neurogenic differentiation 2 https://www.infrafrontier.eu/search?keyword=EM:13481 ? EM:13499 C57BL/6NCrl-Neto2/Ieg EMMA sperm mutant strain MGI:6384608 Neto2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1921763 Neto2 neuropilin (NRP) and tolloid (TLL)-like 2 https://www.infrafrontier.eu/search?keyword=EM:13499 + EM:11528 C57BL/6NCrl-Napb/Ieg EMMA sperm mutant strain MGI:6120686 Napb targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:104562 Napb N-ethylmaleimide sensitive fusion protein attachment protein beta https://www.infrafrontier.eu/search?keyword=EM:11528 ? EM:13447 C57BL/6NCrl-Nacc1/Ieg EMMA sperm mutant strain MGI:6324156 Nacc1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1914080 Nacc1 nucleus accumbens associated 1, BEN and BTB (POZ) domain containing https://www.infrafrontier.eu/search?keyword=EM:13447 + EM:12175 C57BL/6NCrl-Naa38/Ph EMMA sperm mutant strain MGI:6341883 Naa38 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1925554 Naa38 N(alpha)-acetyltransferase 38, NatC auxiliary subunit https://www.infrafrontier.eu/search?keyword=EM:12175 + EM:11306 C57BL/6NCrl-Mzb1/Ph EMMA sperm mutant strain MGI:6147535 Mzb1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1917066 Mzb1 marginal zone B and B1 cell-specific protein 1 https://www.infrafrontier.eu/search?keyword=EM:11306 + EM:09512 C57BL/6NCrl-Myl2/Ieg EMMA sperm mutant strain MGI:5629324 Myl2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:97272 Myl2 myosin, light polypeptide 2, regulatory, cardiac, slow https://www.infrafrontier.eu/search?keyword=EM:09512 ? EM:13516 C57BL/6NCrl-Mydgf/Ieg EMMA sperm mutant strain MGI:6273959 Mydgf endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2156020 Mydgf myeloid derived growth factor https://www.infrafrontier.eu/search?keyword=EM:13516 ? EM:13604 C57BL/6NCrl-Mtmr2/Ieg EMMA sperm mutant strain MGI:6386315 Mtmr2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1924366 Mtmr2 myotubularin related protein 2 https://www.infrafrontier.eu/search?keyword=EM:13604 ? EM:13584 C57BL/6NCrl-Mtcp1/Ieg EMMA sperm mutant strain Mtcp1 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:102699 Mtcp1 mature T cell proliferation 1 https://www.infrafrontier.eu/search?keyword=EM:13584 ? EM:13624 C57BL/6NCrl-Mogat1/Ieg EMMA sperm mutant strain MGI:6399911 Mogat1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1915643 Mogat1 monoacylglycerol O-acyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:13624 ? EM:13510 C57BL/6NCrl-Mmd/Ieg EMMA sperm mutant strain MGI:6384588 Mmd endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1914718 Mmd monocyte to macrophage differentiation-associated https://www.infrafrontier.eu/search?keyword=EM:13510 ? EM:13646 C57BL/6NCrl-Mmab/Ieg EMMA sperm mutant strain MGI:6435666 Mmab endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1924947 Mmab methylmalonic aciduria (cobalamin deficiency) cblB type homolog (human) https://www.infrafrontier.eu/search?keyword=EM:13646 ? EM:13480 C57BL/6NCrl-Mgll/Ieg EMMA live mutant strain MGI:6273958 Mgll endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1346042 Mgll monoglyceride lipase https://www.infrafrontier.eu/search?keyword=EM:13480 ? EM:13384 C57BL/6NCrl-Mfn1/Ieg EMMA sperm mutant strain MGI:6414496 Mfn1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1914664 Mfn1 mitofusin 1 https://www.infrafrontier.eu/search?keyword=EM:13384 + EM:11612 C57BL/6NCrl-Mex3b/Ph EMMA sperm mutant strain MGI:5766754 Mex3b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1918252 Mex3b mex3 RNA binding family member B https://www.infrafrontier.eu/search?keyword=EM:11612 + EM:11612 C57BL/6NCrl-Mex3b/Ph EMMA live mutant strain MGI:5766754 Mex3b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1918252 Mex3b mex3 RNA binding family member B https://www.infrafrontier.eu/search?keyword=EM:11612 ? EM:13474 C57BL/6NCrl-Mettl5/Ieg EMMA sperm mutant strain MGI:6273953 Mettl5 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1922672 Mettl5 methyltransferase like 5 https://www.infrafrontier.eu/search?keyword=EM:13474 ? EM:13716 C57BL/6NCrl-Mettl23Hmgu/Ieg EMMA sperm mutant strain Mettl23Hmgu CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1921569 Mettl23 methyltransferase like 23 https://www.infrafrontier.eu/search?keyword=EM:13716 + EM:11867 C57BL/6NCrl-Mest/Ph EMMA sperm mutant strain MGI:6341841 Mest endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:96968 Mest mesoderm specific transcript https://www.infrafrontier.eu/search?keyword=EM:11867 + EM:11334 C57BL/6NCrl-Marchf8/Ph EMMA sperm C57BL/6NCrl-March8/Ph mutant strain MGI:6147531 Marchf8 endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:1919029 Marchf8 membrane associated ring-CH-type finger 8 https://www.infrafrontier.eu/search?keyword=EM:11334 + EM:12830 C57BL/6NCrl-Marchf3/Ph EMMA sperm mutant strain MGI:6358620 Marchf3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2443667 Marchf3 membrane associated ring-CH-type finger 3 https://www.infrafrontier.eu/search?keyword=EM:12830 ? EM:13452 C57BL/6NCrl-Mapk13/Ieg EMMA sperm mutant strain MGI:6257497 Mapk13 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1346864 Mapk13 mitogen-activated protein kinase 13 https://www.infrafrontier.eu/search?keyword=EM:13452 ? EM:13477 C57BL/6NCrl-Man2a1/Ieg EMMA sperm mutant strain MGI:6273945 Man2a1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:104669 Man2a1 mannosidase 2, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:13477 ? EM:14745 C57BL/6NCrl-Magix/Ieg EMMA sperm mutant strain MGI:6403694 Magix endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1859644 Magix MAGI family member, X-linked https://www.infrafrontier.eu/search?keyword=EM:14745 ? EM:13630 C57BL/6NCrl-Macroh2a2/Ieg EMMA sperm mutant strain MGI:6441118 Macroh2a2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:3037658 Macroh2a2 macroH2A.2 histone https://www.infrafrontier.eu/search?keyword=EM:13630 ? EM:13571 C57BL/6NCrl-Ly6g6f/Ieg EMMA sperm mutant strain Ly6g6f CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:3616082 Ly6g6f lymphocyte antigen 6 complex, locus G6F https://www.infrafrontier.eu/search?keyword=EM:13571 + EM:11539 C57BL/6NCrl-Ly6g6d/Ieg EMMA sperm mutant strain MGI:6120778 Ly6g6d targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2148931 Ly6g6d lymphocyte antigen 6 complex, locus G6D https://www.infrafrontier.eu/search?keyword=EM:11539 + EM:12617 C57BL/6NCrl-Ltn1/Ph EMMA sperm mutant strain MGI:6304241 Ltn1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1926163 Ltn1 listerin E3 ubiquitin protein ligase 1 https://www.infrafrontier.eu/search?keyword=EM:12617 ? EM:13468 C57BL/6NCrl-Lrp1b/Ieg EMMA sperm mutant strain MGI:6273952 Lrp1b endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2151136 Lrp1b low density lipoprotein-related protein 1B https://www.infrafrontier.eu/search?keyword=EM:13468 + EM:11786 C57BL/6NCrl-Lratd2/Ph EMMA sperm mutant strain MGI:6316150 Lratd2 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3026924 Lratd2 LRAT domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:11786 + EM:12477 C57BL/6NCrl-Lpp/Ph EMMA sperm mutant strain MGI:6120784 Lpp targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2441849 Lpp LIM domain containing preferred translocation partner in lipoma https://www.infrafrontier.eu/search?keyword=EM:12477 + EM:12815 C57BL/6NCrl-Lmo1/Ieg EMMA sperm mutant strain MGI:6382778 Lmo1 targeted mutation 1b, Mouse Biology Program, UCDavis MGI:102812 Lmo1 LIM domain only 1 https://www.infrafrontier.eu/search?keyword=EM:12815 + EM:10118 C57BL/6NCrl-Ldlr/Ieg EMMA sperm mutant strain MGI:5695977 Ldlr targeted mutation 1b, Wellcome Trust Sanger Institute MGI:96765 Ldlr low density lipoprotein receptor https://www.infrafrontier.eu/search?keyword=EM:10118 + EM:10369 C57BL/6NCrl-Lct/Ieg EMMA sperm mutant strain MGI:5704514 Lct targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104576 Lct lactase https://www.infrafrontier.eu/search?keyword=EM:10369 ? EM:14521 C57BL/6NCrl-Lars/WtsiIeg EMMA sperm mutant strain MGI:5637014 Lars targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913808 Lars leucyl-tRNA synthetase https://www.infrafrontier.eu/search?keyword=EM:14521 + EM:11869 C57BL/6NCrl-Lamtor4/Ph EMMA sperm mutant strain MGI:6341931 Lamtor4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1913346 Lamtor4 late endosomal/lysosomal adaptor, MAPK and MTOR activator 4 https://www.infrafrontier.eu/search?keyword=EM:11869 ? EM:13621 C57BL/6NCrl-Lamtor3/Ieg EMMA sperm mutant strain MGI:6441124 Lamtor3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1929467 Lamtor3 late endosomal/lysosomal adaptor, MAPK and MTOR activator 3 https://www.infrafrontier.eu/search?keyword=EM:13621 ? EM:12486 C57BL/6NCrl-Krtap9-5/Ph EMMA sperm mutant strain MGI:6341857 Krtap9-5 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3650333 Krtap9-5 keratin associated protein 9-5 https://www.infrafrontier.eu/search?keyword=EM:12486 ? EM:12497 C57BL/6NCrl-Krt33b/Ph EMMA sperm mutant strain MGI:6341937 Krt33b endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1309991 Krt33b keratin 33B https://www.infrafrontier.eu/search?keyword=EM:12497 ? EM:12491 C57BL/6NCrl-Krt28/Ph EMMA sperm mutant strain MGI:6341928 Krt28 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1918093 Krt28 keratin 28 https://www.infrafrontier.eu/search?keyword=EM:12491 ? EM:12483 C57BL/6NCrl-Krt27/Ph EMMA sperm mutant strain MGI:6341921 Krt27 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1339999 Krt27 keratin 27 https://www.infrafrontier.eu/search?keyword=EM:12483 + EM:12177 C57BL/6NCrl-Klk8/Ph EMMA sperm mutant strain MGI:6341912 Klk8 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1343327 Klk8 kallikrein related-peptidase 8 https://www.infrafrontier.eu/search?keyword=EM:12177 + EM:09056 C57BL/6NCrl-Klk5/Ph EMMA archived mutant strain MGI:5604101 Klk5 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1915918 Klk5 kallikrein related-peptidase 5 https://www.infrafrontier.eu/search?keyword=EM:09056 ? EM:12484 C57BL/6NCrl-Klk15/Ph EMMA sperm mutant strain MGI:6341840 Klk15 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2447533 Klk15 kallikrein related-peptidase 15 https://www.infrafrontier.eu/search?keyword=EM:12484 - EM:12654 C57BL/6NCrl-Klk14/Ph EMMA sperm mutant strain MGI:5571350 Klk14 targeted mutation 1.1, Velocigene MGI:2447564 Klk14 kallikrein related-peptidase 14 https://www.infrafrontier.eu/search?keyword=EM:12654 + EM:11910 C57BL/6NCrl-Klk13/Ph EMMA sperm mutant strain MGI:6341887 Klk13 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3615275 Klk13 kallikrein related-peptidase 13 https://www.infrafrontier.eu/search?keyword=EM:11910 + EM:11989 C57BL/6NCrl-Klk12/Ph EMMA sperm mutant strain MGI:6341825 Klk12 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1916761 Klk12 kallikrein related-peptidase 12 https://www.infrafrontier.eu/search?keyword=EM:11989 + EM:11611 C57BL/6NCrl-Klhl5/Ph EMMA sperm mutant strain MGI:5692709 Klhl5 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919028 Klhl5 kelch-like 5 https://www.infrafrontier.eu/search?keyword=EM:11611 ? EM:13570 C57BL/6NCrl-Kl/Ieg EMMA sperm mutant strain MGI:6276985 Kl endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1101771 Kl klotho https://www.infrafrontier.eu/search?keyword=EM:13570 ? EM:13476 C57BL/6NCrl-Kif28/Ieg EMMA sperm mutant strain Kif28 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:2686151 Kif28 kinesin family member 28 https://www.infrafrontier.eu/search?keyword=EM:13476 ? EM:13720 C57BL/6NCrl-Kctd2/Ieg EMMA sperm mutant strain MGI:6414510 Kctd2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1917632 Kctd2 potassium channel tetramerisation domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:13720 ? EM:13498 C57BL/6NCrl-Kcnh7/Ieg EMMA sperm mutant strain MGI:6273965 Kcnh7 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2159566 Kcnh7 potassium voltage-gated channel, subfamily H (eag-related), member 7 https://www.infrafrontier.eu/search?keyword=EM:13498 + EM:12810 C57BL/6NCrl-Kansl1l/Ieg EMMA sperm mutant strain MGI:6379553 Kansl1l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915941 Kansl1l KAT8 regulatory NSL complex subunit 1-like https://www.infrafrontier.eu/search?keyword=EM:12810 ? EM:13633 C57BL/6NCrl-Islr/Ieg EMMA sperm mutant strain Islr CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1349645 Islr immunoglobulin superfamily containing leucine-rich repeat https://www.infrafrontier.eu/search?keyword=EM:13633 ? EM:13505 C57BL/6NCrl-Insig2/Ieg EMMA sperm mutant strain MGI:6276878 Insig2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1920249 Insig2 insulin induced gene 2 https://www.infrafrontier.eu/search?keyword=EM:13505 + EM:11914 C57BL/6NCrl-Insig1/Ph EMMA sperm mutant strain MGI:6341860 Insig1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1916289 Insig1 insulin induced gene 1 https://www.infrafrontier.eu/search?keyword=EM:11914 + EM:11533 C57BL/6NCrl-Il4i1/Ieg EMMA sperm mutant strain MGI:6120692 Il4i1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:109552 Il4i1 interleukin 4 induced 1 https://www.infrafrontier.eu/search?keyword=EM:11533 + EM:11527 C57BL/6NCrl-Il31/Ieg EMMA sperm mutant strain MGI:6120755 Il31 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923649 Il31 interleukin 31 https://www.infrafrontier.eu/search?keyword=EM:11527 + EM:11369 C57BL/6NCrl-Il13ra2/Ieg EMMA sperm mutant strain MGI:6120701 Il13ra2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1277954 Il13ra2 interleukin 13 receptor, alpha 2 https://www.infrafrontier.eu/search?keyword=EM:11369 + EM:10170 C57BL/6NCrl-Idi1/Ieg EMMA sperm mutant strain MGI:5696924 Idi1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2442264 Idi1 isopentenyl-diphosphate delta isomerase https://www.infrafrontier.eu/search?keyword=EM:10170 + EM:11540 C57BL/6NCrl-Ica1l/Ieg EMMA sperm mutant strain MGI:6120743 Ica1l targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1917625 Ica1l islet cell autoantigen 1-like https://www.infrafrontier.eu/search?keyword=EM:11540 ? EM:13586 C57BL/6NCrl-Ibtk/Ieg EMMA sperm mutant strain MGI:6358629 Ibtk endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1918677 Ibtk inhibitor of Bruton agammaglobulinemia tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:13586 ? EM:13600 C57BL/6NCrl-Hip1/Ieg EMMA sperm mutant strain MGI:6305724 Hip1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1099804 Hip1 huntingtin interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:13600 - EM:11940 C57BL/6NCrl-Hgs/Ieg EMMA sperm C57BL/6NCrl-Hgs/2Ieg mutant strain MGI:6163774 Hgs targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104681 Hgs HGF-regulated tyrosine kinase substrate https://www.infrafrontier.eu/search?keyword=EM:11940 + EM:10591 C57BL/6NCrl-Hepacam2/Ph EMMA sperm mutant strain MGI:5766759 Hepacam2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2141520 Hepacam2 HEPACAM family member 2 https://www.infrafrontier.eu/search?keyword=EM:10591 + EM:10591 C57BL/6NCrl-Hepacam2/Ph EMMA live mutant strain MGI:5766759 Hepacam2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2141520 Hepacam2 HEPACAM family member 2 https://www.infrafrontier.eu/search?keyword=EM:10591 ? EM:13649 C57BL/6NCrl-Hebp1/Ieg EMMA sperm mutant strain MGI:6433993 Hebp1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1333880 Hebp1 heme binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:13649 + EM:12179 C57BL/6NCrl-Hdac4/Ph EMMA sperm mutant strain MGI:6341845 Hdac4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3036234 Hdac4 histone deacetylase 4 https://www.infrafrontier.eu/search?keyword=EM:12179 + EM:11536 C57BL/6NCrl-Gstt1/Ieg EMMA sperm mutant strain MGI:5695115 Gstt1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:107379 Gstt1 glutathione S-transferase, theta 1 https://www.infrafrontier.eu/search?keyword=EM:11536 ? EM:13652 C57BL/6NCrl-Gstp2/Ieg EMMA sperm mutant strain MGI:6414521 Gstp2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:95864 Gstp2 glutathione S-transferase, pi 2 https://www.infrafrontier.eu/search?keyword=EM:13652 ? EM:13593 C57BL/6NCrl-Gstp1/Ieg EMMA sperm mutant strain MGI:6330715 Gstp1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:95865 Gstp1 glutathione S-transferase, pi 1 https://www.infrafrontier.eu/search?keyword=EM:13593 ? EM:13651 C57BL/6NCrl-Gstm3/Ieg EMMA sperm mutant strain MGI:6414476 Gstm3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:106026 Gstm3 glutathione S-transferase, mu 3 https://www.infrafrontier.eu/search?keyword=EM:13651 ? EM:13594 C57BL/6NCrl-Gstm1/Ieg EMMA sperm mutant strain MGI:6367950 Gstm1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:95860 Gstm1 glutathione S-transferase, mu 1 https://www.infrafrontier.eu/search?keyword=EM:13594 ? EM:13442 C57BL/6NCrl-Gria1/Ieg EMMA sperm mutant strain MGI:6257717 Gria1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:95808 Gria1 glutamate receptor, ionotropic, AMPA1 (alpha 1) https://www.infrafrontier.eu/search?keyword=EM:13442 ? EM:13449 C57BL/6NCrl-Gper1/Ieg EMMA sperm mutant strain Gper1 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1924104 Gper1 G protein-coupled estrogen receptor 1 https://www.infrafrontier.eu/search?keyword=EM:13449 ? EM:13622 C57BL/6NCrl-Gpd1/Ieg EMMA sperm mutant strain MGI:6441117 Gpd1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:95679 Gpd1 glycerol-3-phosphate dehydrogenase 1 (soluble) https://www.infrafrontier.eu/search?keyword=EM:13622 ? EM:13698 C57BL/6NCrl-Gpalpp1/Ieg EMMA sperm mutant strain MGI:6433996 Gpalpp1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1914717 Gpalpp1 GPALPP motifs containing 1 https://www.infrafrontier.eu/search?keyword=EM:13698 ? EM:13437 C57BL/6NCrl-Gm4951/Ieg EMMA sperm mutant strain MGI:6158427 Gm4951 endonuclease mediated mutation 2, Helmholtz Zentrum Muenchen GmbH MGI:3644953 Gm4951 predicted gene 4951 https://www.infrafrontier.eu/search?keyword=EM:13437 ? EM:13612 C57BL/6NCrl-Glipr1/Ieg EMMA sperm mutant strain Glipr1 CRISPR/CAS9 targeted mutation , undef MGI:1920940 Glipr1 GLI pathogenesis-related 1 (glioma) https://www.infrafrontier.eu/search?keyword=EM:13612 ? EM:13416 C57BL/6NCrl-Gins2/Ieg EMMA sperm mutant strain MGI:6470391 Gins2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921019 Gins2 GINS complex subunit 2 (Psf2 homolog) https://www.infrafrontier.eu/search?keyword=EM:13416 ? EM:13574 C57BL/6NCrl-Gatb/Ieg EMMA sperm mutant strain MGI:6358623 Gatb endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2442496 Gatb glutamyl-tRNA(Gln) amidotransferase, subunit B https://www.infrafrontier.eu/search?keyword=EM:13574 + EM:11685 C57BL/6NCrl-Fut1/Ieg EMMA sperm mutant strain MGI:6120691 Fut1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:109375 Fut1 fucosyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:11685 ? EM:13500 C57BL/6NCrl-Foxd2/Ieg EMMA sperm mutant strain MGI:6273962 Foxd2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1347471 Foxd2 forkhead box D2 https://www.infrafrontier.eu/search?keyword=EM:13500 + EM:12410 C57BL/6NCrl-Fgf14/Ph EMMA live mutant strain MGI:6341935 Fgf14 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:109189 Fgf14 fibroblast growth factor 14 https://www.infrafrontier.eu/search?keyword=EM:12410 ? EM:13489 C57BL/6NCrl-Fezf2/Ieg EMMA sperm mutant strain MGI:6273951 Fezf2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1859823 Fezf2 Fez family zinc finger 2 https://www.infrafrontier.eu/search?keyword=EM:13489 ? EM:12590 C57BL/6NCrl-Fbxw18/Ph EMMA live mutant strain MGI:6341894 Fbxw18 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3505704 Fbxw18 F-box and WD-40 domain protein 18 https://www.infrafrontier.eu/search?keyword=EM:12590 ? EM:12490 C57BL/6NCrl-Fbxw15/Ph EMMA live mutant strain MGI:6341864 Fbxw15 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3505701 Fbxw15 F-box and WD-40 domain protein 15 https://www.infrafrontier.eu/search?keyword=EM:12490 + EM:12285 C57BL/6NCrl-Fbxo25/Ph EMMA live mutant strain MGI:6341913 Fbxo25 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1914072 Fbxo25 F-box protein 25 https://www.infrafrontier.eu/search?keyword=EM:12285 ? EM:13625 C57BL/6NCrl-Fancd2/Ieg EMMA sperm mutant strain MGI:6302758 Fancd2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2448480 Fancd2 Fanconi anemia, complementation group D2 https://www.infrafrontier.eu/search?keyword=EM:13625 + EM:12171 C57BL/6NCrl-Fam83h/Ph EMMA sperm mutant strain MGI:6341855 Fam83h endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2145900 Fam83h family with sequence similarity 83, member H https://www.infrafrontier.eu/search?keyword=EM:12171 - EM:12282 C57BL/6NCrl-Fam71f1/Ph EMMA sperm C57BL/6NCrl-Garin1b/Ph mutant strain Fam71f1 CRISPR/CAS9 targeted mutation , undef MGI:3032524 Garin1b golgi associated RAB2 interactor 1B https://www.infrafrontier.eu/search?keyword=EM:12282 + EM:11336 C57BL/6NCrl-Fam172a/Ph EMMA sperm mutant strain MGI:6147534 Fam172a endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:1915925 Fam172a family with sequence similarity 172, member A https://www.infrafrontier.eu/search?keyword=EM:11336 ? EM:12601 C57BL/6NCrl-Fam161b/Ph EMMA sperm mutant strain MGI:6341852 Fam161b endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2443027 Fam161b family with sequence similarity 161, member B https://www.infrafrontier.eu/search?keyword=EM:12601 + EM:11877 C57BL/6NCrl-Fam126a/Ph EMMA sperm mutant strain MGI:6341927 Fam126a endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2149839 Fam126a family with sequence similarity 126, member A https://www.infrafrontier.eu/search?keyword=EM:11877 ? EM:13518 C57BL/6NCrl-Fam107a/Ieg EMMA sperm mutant strain MGI:6314737 Fam107a endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:3041256 Fam107a family with sequence similarity 107, member A https://www.infrafrontier.eu/search?keyword=EM:13518 + EM:12200 C57BL/6NCrl-Fads6/Ieg EMMA sperm mutant strain MGI:6194112 Fads6 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3039592 Fads6 fatty acid desaturase domain family, member 6 https://www.infrafrontier.eu/search?keyword=EM:12200 ? EM:13556 C57BL/6NCrl-Fabp2/Ieg EMMA sperm mutant strain Fabp2 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:95478 Fabp2 fatty acid binding protein 2, intestinal https://www.infrafrontier.eu/search?keyword=EM:13556 + EM:11537 C57BL/6NCrl-Exph5/Ieg EMMA sperm mutant strain MGI:6120790 Exph5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443248 Exph5 exophilin 5 https://www.infrafrontier.eu/search?keyword=EM:11537 ? EM:13638 C57BL/6NCrl-Exoc6b/Ieg EMMA sperm mutant strain MGI:6414561 Exoc6b endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1923164 Exoc6b exocyst complex component 6B https://www.infrafrontier.eu/search?keyword=EM:13638 ? EM:13714 C57BL/6NCrl-Etfb/Ieg EMMA sperm mutant strain Etfb CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:106098 Etfb electron transferring flavoprotein, beta polypeptide https://www.infrafrontier.eu/search?keyword=EM:13714 ? EM:14739 C57BL/6NCrl-Esyt1/Ieg EMMA sperm mutant strain Esyt1 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1344426 Esyt1 extended synaptotagmin-like protein 1 https://www.infrafrontier.eu/search?keyword=EM:14739 ? EM:13514 C57BL/6NCrl-Ergic2/Ieg EMMA sperm mutant strain MGI:6314735 Ergic2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1914706 Ergic2 ERGIC and golgi 2 https://www.infrafrontier.eu/search?keyword=EM:13514 ? EM:13614 C57BL/6NCrl-Ercc6l2/Ieg EMMA sperm mutant strain MGI:6399886 Ercc6l2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1923501 Ercc6l2 excision repair cross-complementing rodent repair deficiency, complementation group 6 like 2 https://www.infrafrontier.eu/search?keyword=EM:13614 + EM:12826 C57BL/6NCrl-Erbb2/Ieg EMMA sperm mutant strain MGI:6279893 Erbb2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:95410 Erbb2 erb-b2 receptor tyrosine kinase 2 https://www.infrafrontier.eu/search?keyword=EM:12826 + EM:12452 C57BL/6NCrl-Emsy/Ph EMMA sperm mutant strain MGI:6341933 Emsy endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1924203 Emsy EMSY, BRCA2-interacting transcriptional repressor https://www.infrafrontier.eu/search?keyword=EM:12452 ? EM:13721 C57BL/6NCrl-Eif4g1/Ieg EMMA sperm mutant strain MGI:6414502 Eif4g1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2384784 Eif4g1 eukaryotic translation initiation factor 4, gamma 1 https://www.infrafrontier.eu/search?keyword=EM:13721 ? EM:13616 C57BL/6NCrl-Eif3k/Ieg EMMA sperm mutant strain MGI:6399916 Eif3k endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1921080 Eif3k eukaryotic translation initiation factor 3, subunit K https://www.infrafrontier.eu/search?keyword=EM:13616 ? EM:13470 C57BL/6NCrl-Eif3f/Ieg EMMA sperm mutant strain MGI:6384603 Eif3f endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1913335 Eif3f eukaryotic translation initiation factor 3, subunit F https://www.infrafrontier.eu/search?keyword=EM:13470 ? EM:13475 C57BL/6NCrl-Eef1a2/Ieg EMMA sperm mutant strain MGI:6157345 Eef1a2 endonuclease mediated mutation 2, Helmholtz Zentrum Muenchen GmbH MGI:1096317 Eef1a2 eukaryotic translation elongation factor 1 alpha 2 https://www.infrafrontier.eu/search?keyword=EM:13475 + EM:11371 C57BL/6NCrl-Eea1/Ieg EMMA sperm mutant strain MGI:6120786 Eea1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2442192 Eea1 early endosome antigen 1 https://www.infrafrontier.eu/search?keyword=EM:11371 ? EM:13579 C57BL/6NCrl-Echs1/Ieg EMMA sperm mutant strain MGI:6361232 Echs1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2136460 Echs1 enoyl Coenzyme A hydratase, short chain, 1, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:13579 ? EM:13629 C57BL/6NCrl-Duox1/Ieg EMMA sperm mutant strain MGI:6441115 Duox1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2139422 Duox1 dual oxidase 1 https://www.infrafrontier.eu/search?keyword=EM:13629 + EM:12415 C57BL/6NCrl-Dtx4/Ph EMMA sperm mutant strain MGI:6341925 Dtx4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2672905 Dtx4 deltex 4, E3 ubiquitin ligase https://www.infrafrontier.eu/search?keyword=EM:12415 ? EM:13406 C57BL/6NCrl-Dpp3/Ieg EMMA sperm mutant strain MGI:6470392 Dpp3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1922471 Dpp3 dipeptidylpeptidase 3 https://www.infrafrontier.eu/search?keyword=EM:13406 ? EM:13634 C57BL/6NCrl-Dock4/Ieg EMMA sperm mutant strain MGI:6449030 Dock4 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1918006 Dock4 dedicator of cytokinesis 4 https://www.infrafrontier.eu/search?keyword=EM:13634 + EM:11541 C57BL/6NCrl-Dnmt3l/Ieg EMMA sperm mutant strain MGI:6120722 Dnmt3l targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1859287 Dnmt3l DNA (cytosine-5-)-methyltransferase 3-like https://www.infrafrontier.eu/search?keyword=EM:11541 ? EM:13564 C57BL/6NCrl-Dnajb14/Ieg EMMA sperm mutant strain MGI:6388373 Dnajb14 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1917854 Dnajb14 DnaJ heat shock protein family (Hsp40) member B14 https://www.infrafrontier.eu/search?keyword=EM:13564 ? EM:13583 C57BL/6NCrl-Dmd/Ieg EMMA sperm mutant strain MGI:6277059 Dmd endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:94909 Dmd dystrophin, muscular dystrophy https://www.infrafrontier.eu/search?keyword=EM:13583 ? EM:13492 C57BL/6NCrl-Dlst/Ieg EMMA sperm mutant strain MGI:6277023 Dlst endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1926170 Dlst dihydrolipoamide S-succinyltransferase (E2 component of 2-oxo-glutarate complex) https://www.infrafrontier.eu/search?keyword=EM:13492 ? EM:13512 C57BL/6NCrl-Dio1/Ieg EMMA sperm mutant strain MGI:6276908 Dio1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:94896 Dio1 deiodinase, iodothyronine, type I https://www.infrafrontier.eu/search?keyword=EM:13512 + EM:07575 C57BL/6NCrl-Dicer1/Ph EMMA sperm C57BL/6-Dicer1/Ph, DcrMTdel mutant strain MGI:5566698 Dicer1 endonuclease-mediated mutation 3, Petr Svoboda MGI:2177178 Dicer1 dicer 1, ribonuclease type III https://www.infrafrontier.eu/search?keyword=EM:07575 ? EM:13392 C57BL/6NCrl-Dhx9/Ieg EMMA sperm mutant strain MGI:6472605 Dhx9 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:108177 Dhx9 DEAH (Asp-Glu-Ala-His) box polypeptide 9 https://www.infrafrontier.eu/search?keyword=EM:13392 ? EM:13628 C57BL/6NCrl-Dhrs4/Ieg EMMA sperm mutant strain MGI:6378426 Dhrs4 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:90169 Dhrs4 dehydrogenase/reductase (SDR family) member 4 https://www.infrafrontier.eu/search?keyword=EM:13628 ? EM:13623 C57BL/6NCrl-Dennd6b/Ieg EMMA sperm mutant strain MGI:6449025 Dennd6b endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1916690 Dennd6b DENN/MADD domain containing 6B https://www.infrafrontier.eu/search?keyword=EM:13623 ? EM:13285 C57BL/6NCrl-Dele1/Ph EMMA live mutant strain MGI:6316147 Dele1 endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:1914089 Dele1 DAP3 binding cell death enhancer 1 https://www.infrafrontier.eu/search?keyword=EM:13285 + EM:11704 C57BL/6NCrl-Ddi2/Ph EMMA sperm mutant strain MGI:6117798 Ddi2 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1917244 Ddi2 DNA-damage inducible protein 2 https://www.infrafrontier.eu/search?keyword=EM:11704 + EM:12340 C57BL/6NCrl-Ddi2/Ph EMMA sperm mutant strain MGI:5810736 Ddi2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1917244 Ddi2 DNA-damage inducible protein 2 https://www.infrafrontier.eu/search?keyword=EM:12340 ? EM:13482 C57BL/6NCrl-Ddc/Ieg EMMA sperm mutant strain MGI:6273964 Ddc endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:94876 Ddc dopa decarboxylase https://www.infrafrontier.eu/search?keyword=EM:13482 + EM:12183 C57BL/6NCrl-Dcaf8/Ph EMMA sperm mutant strain MGI:6341909 Dcaf8 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:91860 Dcaf8 DDB1 and CUL4 associated factor 8 https://www.infrafrontier.eu/search?keyword=EM:12183 + EM:11994 C57BL/6NCrl-Dcaf12/Ph EMMA sperm mutant strain MGI:6341838 Dcaf12 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1916220 Dcaf12 DDB1 and CUL4 associated factor 12 https://www.infrafrontier.eu/search?keyword=EM:11994 ? EM:13706 C57BL/6NCrl-Cyria/Ieg EMMA sperm mutant strain MGI:6414515 Cyria endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1261783 Cyria CYFIP related Rac1 interactor A https://www.infrafrontier.eu/search?keyword=EM:13706 + EM:12181 C57BL/6NCrl-Cyp39a1/Ph EMMA sperm mutant strain MGI:6341926 Cyp39a1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1927096 Cyp39a1 cytochrome P450, family 39, subfamily a, polypeptide 1 https://www.infrafrontier.eu/search?keyword=EM:12181 ? EM:13596 C57BL/6NCrl-Cyp2b9/Ieg EMMA sperm mutant strain MGI:6304243 Cyp2b9 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:88600 Cyp2b9 cytochrome P450, family 2, subfamily b, polypeptide 9 https://www.infrafrontier.eu/search?keyword=EM:13596 + EM:11686 C57BL/6NCrl-Ctrc/Ieg EMMA sperm mutant strain MGI:6120756 Ctrc targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1923951 Ctrc chymotrypsin C (caldecrin) https://www.infrafrontier.eu/search?keyword=EM:11686 ? EM:13597 C57BL/6NCrl-Crygn/Ieg EMMA sperm mutant strain MGI:6330718 Crygn endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2449167 Crygn crystallin, gamma N https://www.infrafrontier.eu/search?keyword=EM:13597 ? EM:12278 C57BL/6NCrl-Crx/Ph EMMA sperm mutant strain MGI:6341903 Crx endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1194883 Crx cone-rod homeobox https://www.infrafrontier.eu/search?keyword=EM:12278 ? EM:13254 C57BL/6NCrl-Cox7a2/Ieg EMMA sperm mutant strain MGI:6385264 Cox7a2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1316715 Cox7a2 cytochrome c oxidase subunit 7A2 https://www.infrafrontier.eu/search?keyword=EM:13254 ? EM:13503 C57BL/6NCrl-Coq7/Ieg EMMA sperm mutant strain MGI:6273957 Coq7 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:107207 Coq7 demethyl-Q 7 https://www.infrafrontier.eu/search?keyword=EM:13503 + EM:12173 C57BL/6NCrl-Coa6/Ph EMMA sperm mutant strain MGI:6341938 Coa6 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1915142 Coa6 cytochrome c oxidase assembly factor 6 https://www.infrafrontier.eu/search?keyword=EM:12173 ? EM:13397 C57BL/6NCrl-Cnot6l/Ieg EMMA sperm mutant strain MGI:6514804 Cnot6l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443154 Cnot6l CCR4-NOT transcription complex, subunit 6-like https://www.infrafrontier.eu/search?keyword=EM:13397 + EM:10142 C57BL/6NCrl-Cmpk1/Ieg EMMA sperm mutant strain MGI:5692662 Cmpk1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913838 Cmpk1 cytidine monophosphate (UMP-CMP) kinase 1 https://www.infrafrontier.eu/search?keyword=EM:10142 ? EM:13567 C57BL/6NCrl-Cmas/Ieg EMMA sperm mutant strain MGI:6361234 Cmas endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1337124 Cmas cytidine monophospho-N-acetylneuraminic acid synthetase https://www.infrafrontier.eu/search?keyword=EM:13567 + EM:11305 C57BL/6NCrl-Cluh/Ph EMMA sperm mutant strain MGI:6147533 Cluh endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1921398 Cluh clustered mitochondria (cluA/CLU1) homolog https://www.infrafrontier.eu/search?keyword=EM:11305 ? EM:13562 C57BL/6NCrl-Cisd1/Ieg EMMA sperm mutant strain MGI:6276862 Cisd1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1261855 Cisd1 CDGSH iron sulfur domain 1 https://www.infrafrontier.eu/search?keyword=EM:13562 ? EM:12243 C57BL/6NCrl-Ciao2b/Ph EMMA sperm mutant strain MGI:6341859 Ciao2b endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1915773 Ciao2b cytosolic iron-sulfur assembly component 2B https://www.infrafrontier.eu/search?keyword=EM:12243 ? EM:14534 C57BL/6NCrl-Churc1/WtsiPh EMMA live mutant strain MGI:6477909 Churc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923684 Churc1 churchill domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:14534 ? EM:13636 C57BL/6NCrl-Chst10/Ieg EMMA sperm mutant strain MGI:6441122 Chst10 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2138283 Chst10 carbohydrate sulfotransferase 10 https://www.infrafrontier.eu/search?keyword=EM:13636 + EM:10452 C57BL/6NCrl-Chpf/Ieg EMMA sperm mutant strain MGI:5751153 Chpf targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:106576 Chpf chondroitin polymerizing factor https://www.infrafrontier.eu/search?keyword=EM:10452 + EM:12828 C57BL/6NCrl-Chaf1b/Ieg EMMA sperm mutant strain MGI:6279889 Chaf1b targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1314881 Chaf1b chromatin assembly factor 1, subunit B (p60) https://www.infrafrontier.eu/search?keyword=EM:12828 + EM:11768 C57BL/6NCrl-Cfap161/Ph EMMA sperm C57BL/6NCrl-Cfap161/Ph mutant strain MGI:6152704 Cfap161 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1922806 Cfap161 cilia and flagella associated protein 161 https://www.infrafrontier.eu/search?keyword=EM:11768 ? EM:13401 C57BL/6NCrl-Cerkl/Ieg EMMA sperm mutant strain MGI:6472609 Cerkl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3037816 Cerkl ceramide kinase-like https://www.infrafrontier.eu/search?keyword=EM:13401 ? EM:12863 C57BL/6NCrl-Cer1/Ph EMMA sperm mutant strain Cer1 CRISPR/CAS9 targeted mutation , undef MGI:1201414 Cer1 cerberus 1, DAN family BMP antagonist https://www.infrafrontier.eu/search?keyword=EM:12863 ? EM:13718 C57BL/6NCrl-Cep170b/Ieg EMMA sperm mutant strain MGI:6403701 Cep170b endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2145043 Cep170b centrosomal protein 170B https://www.infrafrontier.eu/search?keyword=EM:13718 ? EM:13588 C57BL/6NCrl-Cenpv/Ieg EMMA sperm mutant strain Cenpv CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1920389 Cenpv centromere protein V https://www.infrafrontier.eu/search?keyword=EM:13588 + EM:11688 C57BL/6NCrl-Cckar/Ieg EMMA sperm mutant strain MGI:6120823 Cckar targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:99478 Cckar cholecystokinin A receptor https://www.infrafrontier.eu/search?keyword=EM:11688 ? EM:14808 C57BL/6NCrl-Ccdc183/Ieg EMMA sperm mutant strain Ccdc183 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1924308 Ccdc183 coiled-coil domain containing 183 https://www.infrafrontier.eu/search?keyword=EM:14808 ? EM:14895 C57BL/6NCrl-Car3/Ieg EMMA sperm mutant strain Car3 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:88270 Car3 carbonic anhydrase 3 https://www.infrafrontier.eu/search?keyword=EM:14895 + EM:11368 C57BL/6NCrl-Car14/Ieg EMMA sperm mutant strain MGI:6120708 Car14 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1344341 Car14 carbonic anhydrase 14 https://www.infrafrontier.eu/search?keyword=EM:11368 + EM:11526 C57BL/6NCrl-Camk2b/Ieg EMMA sperm mutant strain MGI:6120813 Camk2b targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:88257 Camk2b calcium/calmodulin-dependent protein kinase II, beta https://www.infrafrontier.eu/search?keyword=EM:11526 ? EM:13428 C57BL/6NCrl-C1galt1/Ieg EMMA sperm mutant strain MGI:6273946 C1galt1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2151071 C1galt1 core 1 synthase, glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase, 1 https://www.infrafrontier.eu/search?keyword=EM:13428 + EM:12458 C57BL/6NCrl-Bysl/Ph EMMA sperm mutant strain MGI:6341843 Bysl endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1858419 Bysl bystin-like https://www.infrafrontier.eu/search?keyword=EM:12458 + EM:12174 C57BL/6NCrl-Btbd8/Ph EMMA sperm mutant strain MGI:6341849 Btbd8 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3646208 Btbd8 BTB (POZ) domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:12174 + EM:12342 C57BL/6NCrl-Btbd3/Ph EMMA sperm mutant strain MGI:5588286 Btbd3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2385155 Btbd3 BTB (POZ) domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:12342 ? EM:12681 C57BL/6NCrl-Btbd18/Ph EMMA sperm mutant strain MGI:6341842 Btbd18 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:3650217 Btbd18 BTB (POZ) domain containing 18 https://www.infrafrontier.eu/search?keyword=EM:12681 ? EM:13647 C57BL/6NCrl-Btbd10/Ieg EMMA sperm mutant strain MGI:6399906 Btbd10 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1916065 Btbd10 BTB (POZ) domain containing 10 https://www.infrafrontier.eu/search?keyword=EM:13647 ? EM:13580 C57BL/6NCrl-Bsph2/Ieg EMMA sperm mutant strain MGI:6384596 Bsph2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1924934 Bsph2 binder of sperm protein homolog 2 https://www.infrafrontier.eu/search?keyword=EM:13580 + EM:11769 C57BL/6NCrl-Bmerb1/Ph EMMA sperm C57BL/6NCrl-2900011O08Rik/Ph mutant strain MGI:6152702 Bmerb1 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1914504 Bmerb1 bMERB domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:11769 ? EM:12236 C57BL/6NCrl-Birc6/Ph EMMA sperm mutant strain MGI:6341866 Birc6 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1276108 Birc6 baculoviral IAP repeat-containing 6 https://www.infrafrontier.eu/search?keyword=EM:12236 ? EM:13576 C57BL/6NCrl-Bcdin3d/Ieg EMMA sperm mutant strain Bcdin3d CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1922534 Bcdin3d BCDIN3 domain containing https://www.infrafrontier.eu/search?keyword=EM:13576 ? EM:13615 C57BL/6NCrl-Aven/Ieg EMMA sperm mutant strain MGI:6403699 Aven endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1921518 Aven apoptosis, caspase activation inhibitor https://www.infrafrontier.eu/search?keyword=EM:13615 ? EM:14842 C57BL/6NCrl-Atrnl1/Ieg EMMA sperm mutant strain Atrnl1 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:2147749 Atrnl1 attractin like 1 https://www.infrafrontier.eu/search?keyword=EM:14842 + EM:10365 C57BL/6NCrl-Atp9a/Ieg EMMA sperm mutant strain MGI:5704515 Atp9a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1330826 Atp9a ATPase, class II, type 9A https://www.infrafrontier.eu/search?keyword=EM:10365 ? EM:14830 C57BL/6NCrl-Atp8b3/Ieg EMMA sperm mutant strain Atp8b3 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1914581 Atp8b3 ATPase, class I, type 8B, member 3 https://www.infrafrontier.eu/search?keyword=EM:14830 + EM:11458 C57BL/6NCrl-Atp6v0c/Ph EMMA sperm mutant strain MGI:6147532 Atp6v0c endonuclease mediated-mutation 2, Institute of Molecular Genetics MGI:88116 Atp6v0c ATPase, H+ transporting, lysosomal V0 subunit C https://www.infrafrontier.eu/search?keyword=EM:11458 ? EM:12172 C57BL/6NCrl-Atg7/Ph EMMA sperm mutant strain MGI:6341910 Atg7 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1921494 Atg7 autophagy related 7 https://www.infrafrontier.eu/search?keyword=EM:12172 + EM:12241 C57BL/6NCrl-Asb7/Ph EMMA sperm mutant strain MGI:6341901 Asb7 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2152835 Asb7 ankyrin repeat and SOCS box-containing 7 https://www.infrafrontier.eu/search?keyword=EM:12241 ? EM:12237 C57BL/6NCrl-Asb5/Ph EMMA sperm mutant strain MGI:6341940 Asb5 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1923544 Asb5 ankyrin repeat and SOCs box-containing 5 https://www.infrafrontier.eu/search?keyword=EM:12237 + EM:11871 C57BL/6NCrl-Asb4/Ph EMMA live mutant strain MGI:6341911 Asb4 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1929751 Asb4 ankyrin repeat and SOCS box-containing 4 https://www.infrafrontier.eu/search?keyword=EM:11871 ? EM:12487 C57BL/6NCrl-Asb16/Ph EMMA sperm mutant strain MGI:6341953 Asb16 endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:2654437 Asb16 ankyrin repeat and SOCS box-containing 16 https://www.infrafrontier.eu/search?keyword=EM:12487 + EM:12193 C57BL/6NCrl-Arhgap26/Ieg EMMA sperm mutant strain MGI:6199115 Arhgap26 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1918552 Arhgap26 Rho GTPase activating protein 26 https://www.infrafrontier.eu/search?keyword=EM:12193 ? EM:13605 C57BL/6NCrl-Arhgap15/Ieg EMMA sperm mutant strain MGI:6277012 Arhgap15 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1923367 Arhgap15 Rho GTPase activating protein 15 https://www.infrafrontier.eu/search?keyword=EM:13605 ? EM:13632 C57BL/6NCrl-Arfgef1/Ieg EMMA sperm mutant strain MGI:6423073 Arfgef1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2442988 Arfgef1 ADP-ribosylation factor guanine nucleotide-exchange factor 1(brefeldin A-inhibited) https://www.infrafrontier.eu/search?keyword=EM:13632 ? EM:13601 C57BL/6NCrl-Apoa4/Ieg EMMA sperm mutant strain MGI:6386312 Apoa4 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:88051 Apoa4 apolipoprotein A-IV https://www.infrafrontier.eu/search?keyword=EM:13601 + EM:12256 C57BL/6NCrl-Aopep/Ph EMMA sperm mutant strain MGI:6209550 Aopep targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919311 Aopep aminopeptidase O https://www.infrafrontier.eu/search?keyword=EM:12256 ? EM:13592 C57BL/6NCrl-Anpep/Ieg EMMA sperm mutant strain MGI:6367953 Anpep endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:5000466 Anpep alanyl (membrane) aminopeptidase https://www.infrafrontier.eu/search?keyword=EM:13592 ? EM:13565 C57BL/6NCrl-Ankzf1/Ieg EMMA sperm mutant strain MGI:6382399 Ankzf1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1098746 Ankzf1 ankyrin repeat and zinc finger domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:13565 + EM:11367 C57BL/6NCrl-Alkbh6/Ieg EMMA sperm mutant strain MGI:6120771 Alkbh6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2142037 Alkbh6 alkB homolog 6 https://www.infrafrontier.eu/search?keyword=EM:11367 ? EM:13487 C57BL/6NCrl-Ahctf1/Ieg EMMA sperm mutant strain MGI:6384598 Ahctf1 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1915033 Ahctf1 AT hook containing transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:13487 ? EM:14730 C57BL/6NCrl-Agxt2/Ieg EMMA sperm mutant strain MGI:6450144 Agxt2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2146052 Agxt2 alanine-glyoxylate aminotransferase 2 https://www.infrafrontier.eu/search?keyword=EM:14730 ? EM:13613 C57BL/6NCrl-Adam30/Ieg EMMA sperm mutant strain Adam30 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1918328 Adam30 a disintegrin and metallopeptidase domain 30 https://www.infrafrontier.eu/search?keyword=EM:13613 ? EM:13572 C57BL/6NCrl-Acsf3/Ieg EMMA sperm mutant strain Acsf3 CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:2182591 Acsf3 acyl-CoA synthetase family member 3 https://www.infrafrontier.eu/search?keyword=EM:13572 ? EM:13708 C57BL/6NCrl-Acp6/Ieg EMMA sperm mutant strain MGI:6449047 Acp6 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1931010 Acp6 acid phosphatase 6, lysophosphatidic https://www.infrafrontier.eu/search?keyword=EM:13708 ? EM:13568 C57BL/6NCrl-Acnat2/Ieg EMMA sperm mutant strain MGI:6361231 Acnat2 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:2444345 Acnat2 acyl-coenzyme A amino acid N-acyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:13568 + EM:12339 C57BL/6NCrl-Abcg8/Ph EMMA sperm mutant strain MGI:5810735 Abcg8 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914720 Abcg8 ATP binding cassette subfamily G member 8 https://www.infrafrontier.eu/search?keyword=EM:12339 ? EM:13587 C57BL/6NCrl-Abcg3/Ieg EMMA sperm mutant strain MGI:6399880 Abcg3 endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1351624 Abcg3 ATP binding cassette subfamily G member 3 https://www.infrafrontier.eu/search?keyword=EM:13587 + EM:11335 C57BL/6NCrl-3425401B19Rik/Ph EMMA sperm mutant strain MGI:6147530 3425401B19Rik endonuclease-mediated mutation 2, Institute of Molecular Genetics MGI:3588196 3425401B19Rik RIKEN cDNA 3425401B19 gene https://www.infrafrontier.eu/search?keyword=EM:11335 + EM:11302 C57BL/6NCrl-2510009E07Rik/Ph EMMA sperm C57BL/6NCrl-2510009E07Rik/Ph mutant strain MGI:6147529 2510009E07Rik endonuclease-mediated mutation 1, Institute of Molecular Genetics MGI:1919440 2510009E07Rik RIKEN cDNA 2510009E07 gene https://www.infrafrontier.eu/search?keyword=EM:11302 ? EM:13650 C57BL/6NCrl-1810055G02Rik/Ieg EMMA sperm mutant strain MGI:6388367 1810055G02Rik endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1919306 1810055G02Rik RIKEN cDNA 1810055G02 gene https://www.infrafrontier.eu/search?keyword=EM:13650 ? EM:13569 C57BL/6NCrl-1700021F07Rik/Ieg EMMA sperm mutant strain MGI:6386309 1700021F07Rik endonuclease-mediated mutation 1, Helmholtz Zentrum Muenchen GmbH MGI:1919471 1700021F07Rik RIKEN cDNA 1700021F07 gene https://www.infrafrontier.eu/search?keyword=EM:13569 ? EM:13648 C57BL/6NCrl-1300017J02Rik/Ieg EMMA sperm mutant strain 1300017J02Rik CRISPR/CAS9 targeted mutation , Helmholtz Zentrum Muenchen GmbH MGI:1919025 Inhca inhibitor of carbonic anhydrase https://www.infrafrontier.eu/search?keyword=EM:13648 ? EM:14267 C57BL/6N;C57BL/6NTac-Zfp239/WtsiIeg EMMA sperm mutant strain MGI:5636945 Zfp239 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1306812 Zfp239 zinc finger protein 239 https://www.infrafrontier.eu/search?keyword=EM:14267 ? EM:14147 C57BL/6N;C57BL/6NTac-Vwa3a/WtsiIeg EMMA sperm mutant strain MGI:5637178 Vwa3a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3041229 Vwa3a von Willebrand factor A domain containing 3A https://www.infrafrontier.eu/search?keyword=EM:14147 ? EM:14321 C57BL/6N;C57BL/6NTac-Ssr2/WtsiCnbc EMMA archived mutant strain MGI:5637009 Ssr2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913506 Ssr2 signal sequence receptor, beta https://www.infrafrontier.eu/search?keyword=EM:14321 ? EM:14142 C57BL/6N;C57BL/6NTac-Kif13b/WtsiOulu EMMA embryo mutant strain MGI:5636925 Kif13b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1098265 Kif13b kinesin family member 13B https://www.infrafrontier.eu/search?keyword=EM:14142 ? EM:14142 C57BL/6N;C57BL/6NTac-Kif13b/WtsiOulu EMMA sperm mutant strain MGI:5636925 Kif13b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1098265 Kif13b kinesin family member 13B https://www.infrafrontier.eu/search?keyword=EM:14142 ? EM:14424 C57BL/6N;C57BL/6NTac-Galntl5/WtsiCnbc EMMA archived mutant strain MGI:5577268 Galntl5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915159 Galntl5 UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase-like 5 https://www.infrafrontier.eu/search?keyword=EM:14424 ? EM:14190 C57BL/6N;C57BL/6NTac-Exosc9/WtsiOulu EMMA embryo mutant strain MGI:5636988 Exosc9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1355319 Exosc9 exosome component 9 https://www.infrafrontier.eu/search?keyword=EM:14190 ? EM:14190 C57BL/6N;C57BL/6NTac-Exosc9/WtsiOulu EMMA sperm mutant strain MGI:5636988 Exosc9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1355319 Exosc9 exosome component 9 https://www.infrafrontier.eu/search?keyword=EM:14190 ? EM:14426 C57BL/6N;C57BL/6NTac-D6Wsu163e/WtsiIeg EMMA sperm mutant strain MGI:5636910 D6Wsu163e targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107893 D6Wsu163e DNA segment, Chr 6, Wayne State University 163, expressed https://www.infrafrontier.eu/search?keyword=EM:14426 ? EM:14134 C57BL/6N;C57BL/6NTac-Cgrrf1/WtsiIeg EMMA sperm mutant strain MGI:5637038 Cgrrf1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916368 Cgrrf1 cell growth regulator with ring finger domain 1 https://www.infrafrontier.eu/search?keyword=EM:14134 ? EM:14335 C57BL/6N;C57BL/6NTac-Bivm/WtsiIeg EMMA sperm mutant strain MGI:5637122 Bivm targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2179809 Bivm basic, immunoglobulin-like variable motif containing https://www.infrafrontier.eu/search?keyword=EM:14335 ? EM:14675 C57BL/6N.B6J-Atp8/IbraH EMMA embryo unclassified MGI:4355536 mt-Atp8 mutation 1 MGI:99926 mt-Atp8 mitochondrially encoded ATP synthase 8 https://www.infrafrontier.eu/search?keyword=EM:14675 ? EM:13822 C57BL/6N-Zup1/WtsiOulu EMMA embryo mutant strain MGI:6153719 Zup1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919830 Zup1 zinc finger containing ubiquitin peptidase 1 https://www.infrafrontier.eu/search?keyword=EM:13822 ? EM:13822 C57BL/6N-Zup1/WtsiOulu EMMA sperm mutant strain MGI:6153719 Zup1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919830 Zup1 zinc finger containing ubiquitin peptidase 1 https://www.infrafrontier.eu/search?keyword=EM:13822 ? EM:14597 C57BL/6N-Zswim3/WtsiOulu EMMA embryo mutant strain MGI:6336067 Zswim3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914788 Zswim3 zinc finger SWIM-type containing 3 https://www.infrafrontier.eu/search?keyword=EM:14597 ? EM:14597 C57BL/6N-Zswim3/WtsiOulu EMMA sperm mutant strain MGI:6336067 Zswim3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914788 Zswim3 zinc finger SWIM-type containing 3 https://www.infrafrontier.eu/search?keyword=EM:14597 + EM:12657 C57BL/6N-Zscan29/Orl EMMA sperm mutant strain MGI:6406851 Zscan29 endonuclease-mediated mutation 1, Centre d'ImmunoPhenomique MGI:2139317 Zscan29 zinc finger SCAN domains 29 https://www.infrafrontier.eu/search?keyword=EM:12657 + EM:11582 C57BL/6N-Zmynd11/WtsiIeg EMMA sperm mutant strain MGI:6119402 Zmynd11 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1913755 Zmynd11 zinc finger, MYND domain containing 11 https://www.infrafrontier.eu/search?keyword=EM:11582 ? EM:14449 C57BL/6N-Zmym4/WtsiPh EMMA sperm mutant strain MGI:6153718 Zmym4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1915035 Zmym4 zinc finger, MYM-type 4 https://www.infrafrontier.eu/search?keyword=EM:14449 + EM:12827 C57BL/6N-Zmiz1/H EMMA live mutant strain MGI:6314264 Zmiz1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3040693 Zmiz1 zinc finger, MIZ-type containing 1 https://www.infrafrontier.eu/search?keyword=EM:12827 + EM:11504 C57BL/6N-Zmiz1/H EMMA sperm mutant strain MGI:4451804 Zmiz1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3040693 Zmiz1 zinc finger, MIZ-type containing 1 https://www.infrafrontier.eu/search?keyword=EM:11504 + EM:11504 C57BL/6N-Zmiz1/H EMMA live mutant strain MGI:4451804 Zmiz1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3040693 Zmiz1 zinc finger, MIZ-type containing 1 https://www.infrafrontier.eu/search?keyword=EM:11504 + EM:10354 C57BL/6N-Zkscan17/WtsiBiat EMMA sperm mutant strain MGI:5548856 Zkscan17 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2679270 Zkscan17 zinc finger with KRAB and SCAN domains 17 https://www.infrafrontier.eu/search?keyword=EM:10354 ? EM:14319 C57BL/6N-Zfyve28/WtsiH EMMA live mutant strain MGI:5637169 Zfyve28 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2684992 Zfyve28 zinc finger, FYVE domain containing 28 https://www.infrafrontier.eu/search?keyword=EM:14319 ? EM:14239 C57BL/6N-Zfp879/WtsiOrl EMMA sperm mutant strain MGI:5637179 Zfp879 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:3053099 Zfp879 zinc finger protein 879 https://www.infrafrontier.eu/search?keyword=EM:14239 ? EM:14258 C57BL/6N-Zfp84/WtsiOrl EMMA sperm mutant strain MGI:5636909 Zfp84 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107780 Zfp84 zinc finger protein 84 https://www.infrafrontier.eu/search?keyword=EM:14258 + EM:11161 C57BL/6N-Zfp763/WtsiH EMMA sperm mutant strain MGI:6153715 Zfp763 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1920701 Zfp763 zinc finger protein 763 https://www.infrafrontier.eu/search?keyword=EM:11161 + EM:04803 C57BL/6N-Zfp760/Ieg EMMA embryo B6NTac;B6N-Zfp760/Ieg mutant strain MGI:4436640 Zfp760 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2679257 Zfp760 zinc finger protein 760 https://www.infrafrontier.eu/search?keyword=EM:04803 + EM:08895 C57BL/6N-Zfp719/WtsiIeg EMMA sperm mutant strain MGI:5548829 Zfp719 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2444708 Zfp719 zinc finger protein 719 https://www.infrafrontier.eu/search?keyword=EM:08895 + EM:09715 C57BL/6N-Zfp69/Ieg EMMA sperm mutant strain MGI:5692574 Zfp69 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:107794 Zfp69 zinc finger protein 69 https://www.infrafrontier.eu/search?keyword=EM:09715 + EM:08587 C57BL/6N-Zfp69/Ieg EMMA embryo mutant strain MGI:5286360 Zfp69 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107794 Zfp69 zinc finger protein 69 https://www.infrafrontier.eu/search?keyword=EM:08587 ? EM:14241 C57BL/6N-Zfp664/WtsiH EMMA live mutant strain MGI:5708248 Zfp664 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442505 Zfp664 zinc finger protein 664 https://www.infrafrontier.eu/search?keyword=EM:14241 ? EM:14238 C57BL/6N-Zfp658/WtsiCnbc EMMA archived mutant strain MGI:5637160 Zfp658 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2652821 Zfp658 zinc finger protein 658 https://www.infrafrontier.eu/search?keyword=EM:14238 - EM:05805 C57BL/6N-Zfp61/Cnrm EMMA sperm mutant strain MGI:4436153 Zfp61 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99663 Zfp61 zinc finger protein 61 https://www.infrafrontier.eu/search?keyword=EM:05805 + EM:08570 C57BL/6N-Zfp616/WtsiH EMMA sperm mutant strain MGI:5548908 Zfp616 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3650906 Zfp616 zinc finger protein 616 https://www.infrafrontier.eu/search?keyword=EM:08570 ? EM:14549 C57BL/6N-Zfp54/WtsiPh EMMA sperm mutant strain MGI:6153708 Zfp54 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:99201 Zfp54 zinc finger protein 54 https://www.infrafrontier.eu/search?keyword=EM:14549 + EM:09252 C57BL/6N-Zfp445/Ieg EMMA sperm mutant strain MGI:5613658 Zfp445 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2143340 Zfp445 zinc finger protein 445 https://www.infrafrontier.eu/search?keyword=EM:09252 + EM:08509 C57BL/6N-Zfp445/Ieg EMMA sperm mutant strain MGI:4849402 Zfp445 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2143340 Zfp445 zinc finger protein 445 https://www.infrafrontier.eu/search?keyword=EM:08509 ? EM:14310 C57BL/6N-Zfp408/WtsiH EMMA live mutant strain MGI:5637174 Zfp408 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2685857 Zfp408 zinc finger protein 408 https://www.infrafrontier.eu/search?keyword=EM:14310 ? EM:14155 C57BL/6N-Zfp292/WtsiOulu EMMA embryo mutant strain MGI:6120714 Zfp292 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1353423 Zfp292 zinc finger protein 292 https://www.infrafrontier.eu/search?keyword=EM:14155 ? EM:14155 C57BL/6N-Zfp292/WtsiOulu EMMA sperm mutant strain MGI:6120714 Zfp292 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1353423 Zfp292 zinc finger protein 292 https://www.infrafrontier.eu/search?keyword=EM:14155 ? EM:14344 C57BL/6N-Zfp287/WtsiIeg EMMA sperm mutant strain MGI:5548771 Zfp287 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2176561 Zfp287 zinc finger protein 287 https://www.infrafrontier.eu/search?keyword=EM:14344 ? EM:14296 C57BL/6N-Zfp266/WtsiIeg EMMA sperm mutant strain MGI:5637091 Zfp266 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924769 Zfp266 zinc finger protein 266 https://www.infrafrontier.eu/search?keyword=EM:14296 ? EM:14510 C57BL/6N-Zfp219/WtsiH EMMA live mutant strain MGI:5796933 Zfp219 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1917140 Zfp219 zinc finger protein 219 https://www.infrafrontier.eu/search?keyword=EM:14510 + EM:06803 C57BL/6N-Zfp207/H EMMA sperm B6NTac;B6N-Zfp207/H mutant strain MGI:4847731 Zfp207 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1340045 Zfp207 zinc finger protein 207 https://www.infrafrontier.eu/search?keyword=EM:06803 + EM:08250 C57BL/6N-Zfp182/WtsiPh EMMA sperm mutant strain MGI:5552020 Zfp182 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442220 Zfp182 zinc finger protein 182 https://www.infrafrontier.eu/search?keyword=EM:08250 + EM:08472 C57BL/6N-Zfp119a/Ieg EMMA sperm mutant strain MGI:5548456 Zfp119a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1345189 Zfp119a zinc finger protein 119a https://www.infrafrontier.eu/search?keyword=EM:08472 + EM:08462 C57BL/6N-Zfp119a/Ieg EMMA embryo mutant strain MGI:4458716 Zfp119a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1345189 Zfp119a zinc finger protein 119a https://www.infrafrontier.eu/search?keyword=EM:08462 - EM:05839 C57BL/6N-Zdhhc5/Cnrm EMMA sperm mutant strain MGI:4841863 Zdhhc5 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1923573 Zdhhc5 zinc finger, DHHC domain containing 5 https://www.infrafrontier.eu/search?keyword=EM:05839 + EM:05657 C57BL/6N-Zdhhc24/H EMMA sperm B6NTac;B6N-Zdhhc24/H mutant strain MGI:4435901 Zdhhc24 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917855 Zdhhc24 zinc finger, DHHC domain containing 24 https://www.infrafrontier.eu/search?keyword=EM:05657 + EM:08113 C57BL/6N-Zbtb24/Ieg EMMA sperm mutant strain MGI:5548888 Zbtb24 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3039618 Zbtb24 zinc finger and BTB domain containing 24 https://www.infrafrontier.eu/search?keyword=EM:08113 + EM:06925 C57BL/6N-Zbtb24/Ieg EMMA sperm mutant strain MGI:4458660 Zbtb24 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3039618 Zbtb24 zinc finger and BTB domain containing 24 https://www.infrafrontier.eu/search?keyword=EM:06925 - EM:06000 C57BL/6N-Zbtb1/Cnrm EMMA sperm mutant strain MGI:4441870 Zbtb1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2442326 Zbtb1 zinc finger and BTB domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:06000 ? EM:14194 C57BL/6N-Zbed5/WtsiIeg EMMA sperm mutant strain MGI:5637059 Chchd2l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919220 Chchd2l coiled-coil-helix-coiled-coil-helix domain containing 2-like https://www.infrafrontier.eu/search?keyword=EM:14194 + EM:08661 C57BL/6N-Yae1d1/Ieg EMMA sperm mutant strain MGI:5548529 Yae1d1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914258 Yae1d1 Yae1 domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:08661 + EM:08638 C57BL/6N-Yae1d1/Ieg EMMA embryo mutant strain MGI:4888902 Yae1d1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914258 Yae1d1 Yae1 domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:08638 + EM:10578 C57BL/6N-Xpr1/Ph EMMA archived mutant strain MGI:4362650 Xpr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97932 Xpr1 xenotropic and polytropic retrovirus receptor 1 https://www.infrafrontier.eu/search?keyword=EM:10578 ? EM:14523 C57BL/6N-Xkrx/WtsiIeg EMMA sperm mutant strain MGI:5637183 Xkrx targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3584011 Xkrx X-linked Kx blood group related, X-linked https://www.infrafrontier.eu/search?keyword=EM:14523 + EM:09251 C57BL/6N-Xkr5/Ieg EMMA sperm mutant strain MGI:5613662 Xkr5 targeted mutation 1b, Mouse Biology Program, UCDavis MGI:2442327 Xkr5 X-linked Kx blood group related 5 https://www.infrafrontier.eu/search?keyword=EM:09251 + EM:08726 C57BL/6N-Xkr5/Ieg EMMA embryo mutant strain MGI:4840884 Xkr5 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:2442327 Xkr5 X-linked Kx blood group related 5 https://www.infrafrontier.eu/search?keyword=EM:08726 + EM:04978 C57BL/6N-Wtap/H EMMA sperm B6NTac;B6N-Wtap/H mutant strain MGI:4434984 Wtap targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1926395 Wtap WT1 associating protein https://www.infrafrontier.eu/search?keyword=EM:04978 + EM:08073 C57BL/6N-Wsb2/Ieg EMMA embryo mutant strain MGI:5548747 Wsb2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2144041 Wsb2 WD repeat and SOCS box-containing 2 https://www.infrafrontier.eu/search?keyword=EM:08073 ? EM:14329 C57BL/6N-Wrap53/WtsiCnbc EMMA archived mutant strain MGI:5637129 Wrap53 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2384933 Wrap53 WD repeat containing, antisense to Trp53 https://www.infrafrontier.eu/search?keyword=EM:14329 + EM:10353 C57BL/6N-Wnt16/WtsiBiat EMMA sperm mutant strain MGI:5548733 Wnt16 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2136018 Wnt16 wingless-type MMTV integration site family, member 16 https://www.infrafrontier.eu/search?keyword=EM:10353 - EM:05953 C57BL/6N-Wls/Cnrm EMMA sperm mutant strain MGI:4455675 Wls targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915401 Wls wntless WNT ligand secretion mediator https://www.infrafrontier.eu/search?keyword=EM:05953 ? EM:14343 C57BL/6N-Wfikkn2/WtsiIeg EMMA sperm mutant strain MGI:5637164 Wfikkn2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2669209 Wfikkn2 WAP, follistatin/kazal, immunoglobulin, kunitz and netrin domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:14343 + EM:04722 C57BL/6N-Washc5/Ieg EMMA embryo B6NTac;B6N-E430025E21Rik/Ieg, C57BL/6N-E430025E21Rik/Ieg mutant strain MGI:4435153 Washc5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2146110 Washc5 WASH complex subunit 5 https://www.infrafrontier.eu/search?keyword=EM:04722 ? EM:14186 C57BL/6N-Washc2/WtsiOulu EMMA embryo mutant strain MGI:5692563 Washc2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:106463 Washc2 WASH complex subunit 2 https://www.infrafrontier.eu/search?keyword=EM:14186 ? EM:14186 C57BL/6N-Washc2/WtsiOulu EMMA sperm mutant strain MGI:5692563 Washc2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:106463 Washc2 WASH complex subunit 2 https://www.infrafrontier.eu/search?keyword=EM:14186 + EM:08360 C57BL/6N-Wars/Ieg EMMA sperm mutant strain MGI:5548346 Wars1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:104630 Wars1 tryptophanyl-tRNA synthetase1 https://www.infrafrontier.eu/search?keyword=EM:08360 + EM:08109 C57BL/6N-Wars/Ieg EMMA embryo B6NTac;B6N-Wars/Ieg mutant strain MGI:4435065 Wars1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104630 Wars1 tryptophanyl-tRNA synthetase1 https://www.infrafrontier.eu/search?keyword=EM:08109 + EM:12198 C57BL/6N-Wac/Wtsi EMMA embryo mutant strain MGI:5925355 Wac targeted mutation 2c, Wellcome Trust Sanger Institute MGI:2387357 Wac WW domain containing adaptor with coiled-coil https://www.infrafrontier.eu/search?keyword=EM:12198 + EM:12198 C57BL/6N-Wac/Wtsi EMMA sperm mutant strain MGI:5925355 Wac targeted mutation 2c, Wellcome Trust Sanger Institute MGI:2387357 Wac WW domain containing adaptor with coiled-coil https://www.infrafrontier.eu/search?keyword=EM:12198 ? EM:14212 C57BL/6N-Wac/WtsiCnbc EMMA archived mutant strain MGI:5637134 Wac targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2387357 Wac WW domain containing adaptor with coiled-coil https://www.infrafrontier.eu/search?keyword=EM:14212 + EM:07936 C57BL/6N-Vxn/WtsiCnrm EMMA sperm C57BL/6N-3110035E14Rik/WtsiCnrm mutant strain MGI:5548679 Vxn targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924232 Vxn vexin https://www.infrafrontier.eu/search?keyword=EM:07936 + EM:09346 C57BL/6N-Vwa8/Ieg EMMA sperm mutant strain MGI:5614704 Vwa8 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919008 Vwa8 von Willebrand factor A domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:09346 + EM:08643 C57BL/6N-Vwa8/Ieg EMMA sperm mutant strain MGI:4441772 Vwa8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919008 Vwa8 von Willebrand factor A domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:08643 ? EM:13938 C57BL/6N-Vsig10/WtsiCnbc EMMA sperm mutant strain MGI:6153703 Vsig10 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2448533 Vsig10 V-set and immunoglobulin domain containing 10 https://www.infrafrontier.eu/search?keyword=EM:13938 ? EM:13922 C57BL/6N-Vrk1/WtsiCnbc EMMA sperm mutant strain MGI:6153762 Vrk1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1261847 Vrk1 vaccinia related kinase 1 https://www.infrafrontier.eu/search?keyword=EM:13922 + EM:08097 C57BL/6N-Vps13c/Ieg EMMA sperm mutant strain MGI:5548822 Vps13c targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2444207 Vps13c vacuolar protein sorting 13C https://www.infrafrontier.eu/search?keyword=EM:08097 + EM:09150 C57BL/6N-Vps13c/Ieg EMMA sperm mutant strain MGI:4460376 Vps13c targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2444207 Vps13c vacuolar protein sorting 13C https://www.infrafrontier.eu/search?keyword=EM:09150 ? EM:14508 C57BL/6N-Vps13a/WtsiIeg EMMA sperm mutant strain MGI:5637150 Vps13a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2444304 Vps13a vacuolar protein sorting 13A https://www.infrafrontier.eu/search?keyword=EM:14508 ? EM:13917 C57BL/6N-Vpreb3/WtsiCnbc EMMA sperm mutant strain MGI:6153702 Vpreb3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:98938 Vpreb3 pre-B lymphocyte gene 3 https://www.infrafrontier.eu/search?keyword=EM:13917 ? EM:14458 C57BL/6N-Vmn2r27/WtsiCnbc EMMA sperm mutant strain MGI:6153701 Vmn2r27 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3761517 Vmn2r27 vomeronasal 2, receptor27 https://www.infrafrontier.eu/search?keyword=EM:14458 ? EM:14581 C57BL/6N-Vil1/WtsiOulu EMMA embryo mutant strain MGI:6153700 Vil1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:98930 Vil1 villin 1 https://www.infrafrontier.eu/search?keyword=EM:14581 ? EM:14581 C57BL/6N-Vil1/WtsiOulu EMMA sperm mutant strain MGI:6153700 Vil1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:98930 Vil1 villin 1 https://www.infrafrontier.eu/search?keyword=EM:14581 + EM:11130 C57BL/6N-Vgll4/Ieg EMMA sperm mutant strain MGI:4841645 Vgll4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2652840 Vgll4 vestigial like family member 4 https://www.infrafrontier.eu/search?keyword=EM:11130 ? EM:13862 C57BL/6N-Vgf/WtsiCnbc EMMA sperm mutant strain MGI:6153761 Vgf endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1343180 Vgf VGF nerve growth factor inducible https://www.infrafrontier.eu/search?keyword=EM:13862 + EM:10235 C57BL/6N-Vdac1/Ieg EMMA sperm mutant strain MGI:5701719 Vdac1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106919 Vdac1 voltage-dependent anion channel 1 https://www.infrafrontier.eu/search?keyword=EM:10235 + EM:08577 C57BL/6N-Vdac1/Ieg EMMA sperm mutant strain MGI:4432270 Vdac1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106919 Vdac1 voltage-dependent anion channel 1 https://www.infrafrontier.eu/search?keyword=EM:08577 ? EM:14242 C57BL/6N-Vamp3/WtsiOrl EMMA sperm mutant strain MGI:5692605 Vamp3 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1321389 Vamp3 vesicle-associated membrane protein 3 https://www.infrafrontier.eu/search?keyword=EM:14242 + EM:08285 C57BL/6N-Usp54/H EMMA sperm mutant strain MGI:5286230 Usp54 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1926037 Usp54 ubiquitin specific peptidase 54 https://www.infrafrontier.eu/search?keyword=EM:08285 ? EM:13819 C57BL/6N-Usp51/WtsiOulu EMMA embryo mutant strain MGI:6153699 Usp51 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3588217 Usp51 ubiquitin specific protease 51 https://www.infrafrontier.eu/search?keyword=EM:13819 ? EM:13819 C57BL/6N-Usp51/WtsiOulu EMMA sperm mutant strain MGI:6153699 Usp51 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3588217 Usp51 ubiquitin specific protease 51 https://www.infrafrontier.eu/search?keyword=EM:13819 ? EM:14219 C57BL/6N-Usp44/WtsiPh EMMA live mutant strain MGI:5708261 Usp44 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3045318 Usp44 ubiquitin specific peptidase 44 https://www.infrafrontier.eu/search?keyword=EM:14219 - EM:05481 C57BL/6N-Usp38/H EMMA sperm B6NTac;B6N-Usp38/H mutant strain MGI:4455680 Usp38 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922091 Usp38 ubiquitin specific peptidase 38 https://www.infrafrontier.eu/search?keyword=EM:05481 + EM:11162 C57BL/6N-Usp37/WtsiH EMMA sperm mutant strain MGI:6153697 Usp37 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2442483 Usp37 ubiquitin specific peptidase 37 https://www.infrafrontier.eu/search?keyword=EM:11162 + EM:10743 C57BL/6N-Usp30/H EMMA sperm C57BL/6N-Usp30/WtsiH mutant strain MGI:5790643 Usp30 targeted mutation 2c, Helmholtz Zentrum Muenchen GmbH MGI:2140991 Usp30 ubiquitin specific peptidase 30 https://www.infrafrontier.eu/search?keyword=EM:10743 - EM:14214 C57BL/6N-Usp30/WtsiH EMMA live C57BL/6N-Usp30/Wtsi mutant strain MGI:5692776 Usp30 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2140991 Usp30 ubiquitin specific peptidase 30 https://www.infrafrontier.eu/search?keyword=EM:14214 + EM:08280 C57BL/6N-Usp2/H EMMA sperm mutant strain MGI:5286393 Usp2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858178 Usp2 ubiquitin specific peptidase 2 https://www.infrafrontier.eu/search?keyword=EM:08280 ? EM:14403 C57BL/6N-Usp19/WtsiOulu EMMA embryo mutant strain MGI:5796934 Usp19 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1918722 Usp19 ubiquitin specific peptidase 19 https://www.infrafrontier.eu/search?keyword=EM:14403 ? EM:14403 C57BL/6N-Usp19/WtsiOulu EMMA sperm mutant strain MGI:5796934 Usp19 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1918722 Usp19 ubiquitin specific peptidase 19 https://www.infrafrontier.eu/search?keyword=EM:14403 ? EM:13193 C57BL/6N-Usp15/WtsiH EMMA sperm mutant strain MGI:5708164 Usp15 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:101857 Usp15 ubiquitin specific peptidase 15 https://www.infrafrontier.eu/search?keyword=EM:13193 + EM:07787 C57BL/6N-Usp14/H EMMA sperm B6NTac;B6N-Usp14/H mutant strain MGI:4460420 Usp14 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1928898 Usp14 ubiquitin specific peptidase 14 https://www.infrafrontier.eu/search?keyword=EM:07787 + EM:12707 C57BL/6N-Usp13/WtsiH EMMA live mutant strain MGI:5701723 Usp13 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919857 Usp13 ubiquitin specific peptidase 13 (isopeptidase T-3) https://www.infrafrontier.eu/search?keyword=EM:12707 + EM:08062 C57BL/6N-Usp12/Ieg EMMA embryo mutant strain MGI:5548414 Usp12 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1270128 Usp12 ubiquitin specific peptidase 12 https://www.infrafrontier.eu/search?keyword=EM:08062 ? EM:14195 C57BL/6N-Usf1/WtsiIeg EMMA sperm mutant strain MGI:6120824 Usf1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:99542 Usf1 upstream transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:14195 + EM:10141 C57BL/6N-Uqcrh/Ieg EMMA sperm mutant strain MGI:5692661 Uqcrh targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913826 Uqcrh ubiquinol-cytochrome c reductase hinge protein https://www.infrafrontier.eu/search?keyword=EM:10141 + EM:10079 C57BL/6N-Uqcrh/Ieg EMMA sperm mutant strain MGI:4431969 Uqcrh targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913826 Uqcrh ubiquinol-cytochrome c reductase hinge protein https://www.infrafrontier.eu/search?keyword=EM:10079 + EM:08081 C57BL/6N-Uqcrb/Ieg EMMA sperm mutant strain MGI:5548543 Uqcrb targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914780 Uqcrb ubiquinol-cytochrome c reductase binding protein https://www.infrafrontier.eu/search?keyword=EM:08081 + EM:06277 C57BL/6N-Uqcrb/Ieg EMMA embryo B6NTac;B6N-Uqcrb/Ieg mutant strain MGI:5006762 Uqcrb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914780 Uqcrb ubiquinol-cytochrome c reductase binding protein https://www.infrafrontier.eu/search?keyword=EM:06277 + EM:06277 C57BL/6N-Uqcrb/Ieg EMMA sperm B6NTac;B6N-Uqcrb/Ieg mutant strain MGI:5006762 Uqcrb targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914780 Uqcrb ubiquinol-cytochrome c reductase binding protein https://www.infrafrontier.eu/search?keyword=EM:06277 + EM:08419 C57BL/6N-Unc45a/Ieg EMMA sperm mutant strain MGI:5759982 Unc45a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2142246 Unc45a unc-45 myosin chaperone A https://www.infrafrontier.eu/search?keyword=EM:08419 + EM:12755 C57BL/6N-Uggt2/Ieg EMMA sperm mutant strain MGI:4451533 Uggt2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913685 Uggt2 UDP-glucose glycoprotein glucosyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:12755 + EM:08087 C57BL/6N-Ucp1/Ieg EMMA sperm mutant strain MGI:5692920 Ucp1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:98894 Ucp1 uncoupling protein 1 (mitochondrial, proton carrier) https://www.infrafrontier.eu/search?keyword=EM:08087 + EM:05767 C57BL/6N-Ucp1/Ieg EMMA sperm mutant strain MGI:4841543 Ucp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98894 Ucp1 uncoupling protein 1 (mitochondrial, proton carrier) https://www.infrafrontier.eu/search?keyword=EM:05767 + EM:09187 C57BL/6N-Uchl1/H EMMA sperm mutant strain MGI:4451787 Uchl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103149 Uchl1 ubiquitin carboxy-terminal hydrolase L1 https://www.infrafrontier.eu/search?keyword=EM:09187 ? EM:14427 C57BL/6N-Ubxn10/WtsiCnbc EMMA archived mutant strain MGI:5637146 Ubxn10 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443123 Ubxn10 UBX domain protein 10 https://www.infrafrontier.eu/search?keyword=EM:14427 ? EM:14137 C57BL/6N-Ube2t/WtsiH EMMA live mutant strain MGI:5692669 Ube2t targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914446 Ube2t ubiquitin-conjugating enzyme E2T https://www.infrafrontier.eu/search?keyword=EM:14137 + EM:09106 C57BL/6N-Ubash3a/Ieg EMMA sperm mutant strain MGI:5605803 Ubash3a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1926074 Ubash3a ubiquitin associated and SH3 domain containing, A https://www.infrafrontier.eu/search?keyword=EM:09106 + EM:11090 C57BL/6N-Ubac2/Ieg EMMA sperm mutant strain MGI:4453674 Ubac2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916139 Ubac2 ubiquitin associated domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:11090 ? EM:12719 C57BL/6N-Tyr Styk1/Biat EMMA sperm mutant strain MGI:5428590 Styk1 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2141396 Styk1 serine/threonine/tyrosine kinase 1 https://www.infrafrontier.eu/search?keyword=EM:12719 + EM:11178 C57BL/6N-Tyk2/Ieg EMMA sperm mutant strain MGI:5511690 Tyk2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1929470 Tyk2 tyrosine kinase 2 https://www.infrafrontier.eu/search?keyword=EM:11178 + EM:07875 C57BL/6N-Txnip/H EMMA sperm C57BL/6NTac-Txnip/H, B6NTac;B6N-Txnip/H mutant strain MGI:5008885 Txnip targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1889549 Txnip thioredoxin interacting protein https://www.infrafrontier.eu/search?keyword=EM:07875 + EM:10165 C57BL/6N-Txlna/H EMMA sperm mutant strain MGI:4436006 Txlna targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:105968 Txlna taxilin alpha https://www.infrafrontier.eu/search?keyword=EM:10165 ? EM:14786 C57BL/6N-Tut7/WtsiCnbc EMMA sperm mutant strain MGI:6257698 Tut7 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2387179 Tut7 terminal uridylyl transferase 7 https://www.infrafrontier.eu/search?keyword=EM:14786 + EM:10971 C57BL/6N-Tulp4/Biat EMMA sperm mutant strain MGI:4365109 Tulp4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916092 Tulp4 tubby like protein 4 https://www.infrafrontier.eu/search?keyword=EM:10971 + EM:10464 C57BL/6N-Tulp3/H EMMA sperm C57BL/6NTac-Tulp3/H mutant strain MGI:5752546 Tulp3 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1329045 Tulp3 tubby-like protein 3 https://www.infrafrontier.eu/search?keyword=EM:10464 ? EM:14572 C57BL/6N-Tuba4a/WtsiCnbc EMMA sperm mutant strain MGI:6153696 Tuba4a endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1095410 Tuba4a tubulin, alpha 4A https://www.infrafrontier.eu/search?keyword=EM:14572 ? EM:14305 C57BL/6N-Tuba3a/WtsiCnbc EMMA archived mutant strain MGI:5636920 Tuba3a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1095406 Tuba3a tubulin, alpha 3A https://www.infrafrontier.eu/search?keyword=EM:14305 ? EM:14429 C57BL/6N-Ttll10/WtsiPh EMMA live mutant strain MGI:5775002 Ttll10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1921855 Ttll10 tubulin tyrosine ligase-like family, member 10 https://www.infrafrontier.eu/search?keyword=EM:14429 + EM:09345 C57BL/6N-Tspo/Ieg EMMA sperm mutant strain MGI:5614711 Tspo targeted mutation 1b, Wellcome Trust Sanger Institute MGI:88222 Tspo translocator protein https://www.infrafrontier.eu/search?keyword=EM:09345 + EM:08606 C57BL/6N-Tspo/Ieg EMMA embryo mutant strain MGI:5009653 Tspo targeted mutation 1a, Wellcome Trust Sanger Institute MGI:88222 Tspo translocator protein https://www.infrafrontier.eu/search?keyword=EM:08606 ? EM:14464 C57BL/6N-Tspan33/WtsiCnbc EMMA sperm mutant strain MGI:6153695 Tspan33 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919012 Tspan33 tetraspanin 33 https://www.infrafrontier.eu/search?keyword=EM:14464 + EM:11760 C57BL/6N-Tsks/WtsiCnrm EMMA sperm mutant strain MGI:6152743 Tsks endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1347560 Tsks testis-specific serine kinase substrate https://www.infrafrontier.eu/search?keyword=EM:11760 + EM:11113 C57BL/6N-Trpm7/H EMMA live mutant strain MGI:4841295 Trpm7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929996 Trpm7 transient receptor potential cation channel, subfamily M, member 7 https://www.infrafrontier.eu/search?keyword=EM:11113 + EM:10641 C57BL/6N-Trp53bp2/H EMMA sperm mutant strain MGI:4881993 Trp53bp2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2138319 Trp53bp2 transformation related protein 53 binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:10641 + EM:11741 C57BL/6N-Trp53/H EMMA live mutant strain MGI:4451930 Trp53 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98834 Trp53 transformation related protein 53 https://www.infrafrontier.eu/search?keyword=EM:11741 ? EM:13813 C57BL/6N-Troap/WtsiOulu EMMA embryo mutant strain MGI:6153693 Troap endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1925983 Troap trophinin associated protein https://www.infrafrontier.eu/search?keyword=EM:13813 ? EM:13813 C57BL/6N-Troap/WtsiOulu EMMA sperm mutant strain MGI:6153693 Troap endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1925983 Troap trophinin associated protein https://www.infrafrontier.eu/search?keyword=EM:13813 ? EM:14420 C57BL/6N-Trmt2a/WtsiIeg EMMA sperm mutant strain MGI:5548943 Trmt2a targeted mutation 2b, Wellcome Trust Sanger Institute MGI:96270 Trmt2a TRM2 tRNA methyltransferase 2A https://www.infrafrontier.eu/search?keyword=EM:14420 + EM:11038 C57BL/6N-Trmt2a/Ieg EMMA sperm mutant strain MGI:5811627 Trmt2a targeted mutation 1.1, Velocigene MGI:96270 Trmt2a TRM2 tRNA methyltransferase 2A https://www.infrafrontier.eu/search?keyword=EM:11038 ? EM:13719 C57BL/6N-Triqk/WtsiOrl EMMA sperm mutant strain MGI:6257646 Triqk endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:3650048 Triqk triple QxxK/R motif containing https://www.infrafrontier.eu/search?keyword=EM:13719 ? EM:13867 C57BL/6N-Trim6/WtsiCnbc EMMA sperm mutant strain MGI:6153691 Trim6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2137352 Trim6 tripartite motif-containing 6 https://www.infrafrontier.eu/search?keyword=EM:13867 ? EM:14151 C57BL/6N-Trim65/WtsiIeg EMMA sperm mutant strain MGI:5637142 Trim65 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442815 Trim65 tripartite motif-containing 65 https://www.infrafrontier.eu/search?keyword=EM:14151 + EM:09687 C57BL/6N-Trim39/H EMMA sperm mutant strain MGI:4434684 Trim39 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1890659 Trim39 tripartite motif-containing 39 https://www.infrafrontier.eu/search?keyword=EM:09687 + EM:07620 C57BL/6N-Trim29/WtsiCnrm EMMA sperm mutant strain MGI:5548617 Trim29 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919419 Trim29 tripartite motif-containing 29 https://www.infrafrontier.eu/search?keyword=EM:07620 ? EM:14422 C57BL/6N-Trim25/WtsiOulu EMMA embryo mutant strain MGI:5692539 Trim25 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:102749 Trim25 tripartite motif-containing 25 https://www.infrafrontier.eu/search?keyword=EM:14422 ? EM:14422 C57BL/6N-Trim25/WtsiOulu EMMA sperm mutant strain MGI:5692539 Trim25 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:102749 Trim25 tripartite motif-containing 25 https://www.infrafrontier.eu/search?keyword=EM:14422 + EM:11571 C57BL/6N-Trim21/WtsiIeg EMMA sperm mutant strain MGI:6140225 Trim21 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:106657 Trim21 tripartite motif-containing 21 https://www.infrafrontier.eu/search?keyword=EM:11571 ? EM:13827 C57BL/6N-Trerf1/WtsiOulu EMMA embryo mutant strain MGI:6153688 Trerf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2442086 Trerf1 transcriptional regulating factor 1 https://www.infrafrontier.eu/search?keyword=EM:13827 ? EM:13827 C57BL/6N-Trerf1/WtsiOulu EMMA sperm mutant strain MGI:6153688 Trerf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2442086 Trerf1 transcriptional regulating factor 1 https://www.infrafrontier.eu/search?keyword=EM:13827 + EM:08667 C57BL/6N-Treml1/H EMMA sperm mutant strain MGI:4436002 Treml1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918576 Treml1 triggering receptor expressed on myeloid cells-like 1 https://www.infrafrontier.eu/search?keyword=EM:08667 + EM:11363 C57BL/6N-Trdmt1/H EMMA archived mutant strain MGI:5286348 Trdmt1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1274787 Trdmt1 tRNA aspartic acid methyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:11363 ? EM:13923 C57BL/6N-Trbv19/WtsiPh EMMA sperm mutant strain MGI:6153687 Trbv19 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:98604 Trbv19 T cell receptor beta, variable 19 https://www.infrafrontier.eu/search?keyword=EM:13923 + EM:11001 C57BL/6N-Trappc9/WtsiPh EMMA sperm mutant strain MGI:5692743 Trappc9 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1923760 Trappc9 trafficking protein particle complex 9 https://www.infrafrontier.eu/search?keyword=EM:11001 + EM:10214 C57BL/6N-Trappc14/H EMMA sperm C57BL/6N-BC037034/H, C57BL/6N-Map11/H mutant strain MGI:5511727 Trappc14 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2385896 Trappc14 trafficking protein particle complex 14 https://www.infrafrontier.eu/search?keyword=EM:10214 ? EM:14299 C57BL/6N-Trappc10/WtsiOrl EMMA sperm mutant strain MGI:5636961 Trappc10 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336209 Trappc10 trafficking protein particle complex 10 https://www.infrafrontier.eu/search?keyword=EM:14299 + EM:09049 C57BL/6N-Tpcn2/H EMMA sperm mutant strain MGI:5692810 Tpcn2 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:2385297 Tpcn2 two pore segment channel 2 https://www.infrafrontier.eu/search?keyword=EM:09049 + EM:05903 C57BL/6N-Tpcn2/H EMMA sperm HEPD0665_2_C10, B6NTac;B6N-Tpcn2/H mutant strain MGI:4842149 Tpcn2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385297 Tpcn2 two pore segment channel 2 https://www.infrafrontier.eu/search?keyword=EM:05903 + EM:08142 C57BL/6N-Tomm20l/WtsiCnrm EMMA sperm mutant strain MGI:5548653 Tomm20l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922516 Tomm20l translocase of outer mitochondrial membrane 20-like https://www.infrafrontier.eu/search?keyword=EM:08142 + EM:09414 C57BL/6N-Tnxb/H EMMA sperm mutant strain MGI:4451866 Tnxb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1932137 Tnxb tenascin XB https://www.infrafrontier.eu/search?keyword=EM:09414 ? EM:14489 C57BL/6N-Tnpo1/WtsiIeg EMMA sperm mutant strain Tnpo1 KOMP targeted mutation 2e, Wellcome Trust Sanger Institute MGI:2681523 Tnpo1 transportin 1 https://www.infrafrontier.eu/search?keyword=EM:14489 ? EM:13731 C57BL/6N-Tnpo1/WtsiOrl EMMA sperm mutant strain MGI:6336064 Tnpo1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2681523 Tnpo1 transportin 1 https://www.infrafrontier.eu/search?keyword=EM:13731 ? EM:14217 C57BL/6N-Tnfsf18/WtsiH EMMA live mutant strain MGI:5796938 Tnfsf18 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2673064 Tnfsf18 tumor necrosis factor (ligand) superfamily, member 18 https://www.infrafrontier.eu/search?keyword=EM:14217 + EM:09866 C57BL/6N-Tnfrsf1a/H EMMA sperm mutant strain MGI:5473067 Tnfrsf1a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1314884 Tnfrsf1a tumor necrosis factor receptor superfamily, member 1a https://www.infrafrontier.eu/search?keyword=EM:09866 ? EM:14300 C57BL/6N-Tmprss11c/WtsiIeg EMMA sperm mutant strain MGI:5708263 Tmprss11c targeted mutation 2b, Wellcome Trust Sanger Institute MGI:3521861 Tmprss11c transmembrane protease, serine 11c https://www.infrafrontier.eu/search?keyword=EM:14300 + EM:09685 C57BL/6N-Tmem51/H EMMA sperm mutant strain MGI:4951020 Tmem51 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384874 Tmem51 transmembrane protein 51 https://www.infrafrontier.eu/search?keyword=EM:09685 ? EM:14169 C57BL/6N-Tmem241/WtsiPh EMMA live mutant strain MGI:5637138 Tmem241 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442435 Tmem241 transmembrane protein 241 https://www.infrafrontier.eu/search?keyword=EM:14169 ? EM:13712 C57BL/6N-Tmem235/WtsiOrl EMMA sperm mutant strain MGI:6257731 Tmem235 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:3651706 Tmem235 transmembrane protein 235 https://www.infrafrontier.eu/search?keyword=EM:13712 ? EM:14281 C57BL/6N-Tmem211/WtsiOulu EMMA embryo mutant strain MGI:5812930 Tmem211 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2685700 Tmem211 transmembrane protein 211 https://www.infrafrontier.eu/search?keyword=EM:14281 ? EM:14281 C57BL/6N-Tmem211/WtsiOulu EMMA sperm mutant strain MGI:5812930 Tmem211 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2685700 Tmem211 transmembrane protein 211 https://www.infrafrontier.eu/search?keyword=EM:14281 ? EM:14132 C57BL/6N-Tmem18/WtsiPh EMMA live mutant strain MGI:5637133 Tmem18 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2387176 Tmem18 transmembrane protein 18 https://www.infrafrontier.eu/search?keyword=EM:14132 + EM:10830 C57BL/6N-Tmem167/H EMMA sperm mutant strain MGI:4435969 Tmem167 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913324 Tmem167 transmembrane protein 167 https://www.infrafrontier.eu/search?keyword=EM:10830 ? EM:14448 C57BL/6N-Tmem14c/WtsiPh EMMA sperm mutant strain MGI:6153686 Tmem14c endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1913404 Tmem14c transmembrane protein 14C https://www.infrafrontier.eu/search?keyword=EM:14448 ? EM:13713 C57BL/6N-Tmem131/WtsiOrl EMMA sperm mutant strain MGI:6257725 Tmem131 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1927110 Tmem131 transmembrane protein 131 https://www.infrafrontier.eu/search?keyword=EM:13713 + EM:10130 C57BL/6N-Tmem116/Ieg EMMA sperm mutant strain MGI:5695121 Tmem116 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1924712 Tmem116 transmembrane protein 116 https://www.infrafrontier.eu/search?keyword=EM:10130 + EM:09480 C57BL/6N-Tmem116/Ieg EMMA embryo mutant strain MGI:5085387 Tmem116 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924712 Tmem116 transmembrane protein 116 https://www.infrafrontier.eu/search?keyword=EM:09480 + EM:08567 C57BL/6N-Tmc3/WtsiH EMMA sperm mutant strain MGI:5548850 Tmc3 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2669033 Tmc3 transmembrane channel-like gene family 3 https://www.infrafrontier.eu/search?keyword=EM:08567 + EM:10052 C57BL/6N-Tlr13/Ieg EMMA sperm mutant strain MGI:5692860 Tlr13 targeted mutation 1.1, Velocigene MGI:3045213 Tlr13 toll-like receptor 13 https://www.infrafrontier.eu/search?keyword=EM:10052 + EM:11759 C57BL/6N-Tlr12/WtsiCnrm EMMA sperm mutant strain MGI:6152742 Tlr12 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3045221 Tlr12 toll-like receptor 12 https://www.infrafrontier.eu/search?keyword=EM:11759 + EM:11889 C57BL/6N-Tlr11/WtsiH EMMA sperm mutant strain MGI:6153685 Tlr11 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3045226 Tlr11 toll-like receptor 11 https://www.infrafrontier.eu/search?keyword=EM:11889 ? EM:14462 C57BL/6N-Tle5/WtsiOulu EMMA embryo mutant strain MGI:6153271 Tle5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95806 Tle5 TLE family member 5, transcriptional modulator https://www.infrafrontier.eu/search?keyword=EM:14462 ? EM:14462 C57BL/6N-Tle5/WtsiOulu EMMA sperm mutant strain MGI:6153271 Tle5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95806 Tle5 TLE family member 5, transcriptional modulator https://www.infrafrontier.eu/search?keyword=EM:14462 - EM:08490 C57BL/6N-Timp1/H EMMA sperm B6NTac;B6N-A Timp1/H mutant strain MGI:4841598 Timp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98752 Timp1 tissue inhibitor of metalloproteinase 1 https://www.infrafrontier.eu/search?keyword=EM:08490 ? EM:14262 C57BL/6N-Timmdc1/WtsiOulu EMMA embryo mutant strain MGI:5637083 Timmdc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922139 Timmdc1 translocase of inner mitochondrial membrane domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:14262 ? EM:14262 C57BL/6N-Timmdc1/WtsiOulu EMMA sperm mutant strain MGI:5637083 Timmdc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922139 Timmdc1 translocase of inner mitochondrial membrane domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:14262 ? EM:14265 C57BL/6N-Timeless/WtsiOulu EMMA embryo mutant strain MGI:5692606 Timeless targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1321393 Timeless timeless circadian clock 1 https://www.infrafrontier.eu/search?keyword=EM:14265 ? EM:14265 C57BL/6N-Timeless/WtsiOulu EMMA sperm mutant strain MGI:5692606 Timeless targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1321393 Timeless timeless circadian clock 1 https://www.infrafrontier.eu/search?keyword=EM:14265 ? EM:14486 C57BL/6N-Tigit/WtsiPh EMMA sperm mutant strain MGI:6406775 Tigit targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:3642260 Tigit T cell immunoreceptor with Ig and ITIM domains https://www.infrafrontier.eu/search?keyword=EM:14486 ? EM:14408 C57BL/6N-Tigar/WtsiH EMMA live mutant strain MGI:5692824 Tigar targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442752 Tigar Trp53 induced glycolysis regulatory phosphatase https://www.infrafrontier.eu/search?keyword=EM:14408 ? EM:14170 C57BL/6N-Tial1/WtsiH EMMA live mutant strain MGI:5708174 Tial1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107913 Tial1 Tia1 cytotoxic granule-associated RNA binding protein-like 1 https://www.infrafrontier.eu/search?keyword=EM:14170 ? EM:14255 C57BL/6N-Tia1/WtsiOrl EMMA sperm mutant strain Tia1 KOMP targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107914 Tia1 cytotoxic granule-associated RNA binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:14255 + EM:11068 C57BL/6N-Thg1l/Ieg EMMA sperm mutant strain MGI:4431657 Thg1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913878 Thg1l tRNA-histidine guanylyltransferase 1-like (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:11068 ? EM:14180 C57BL/6N-Thada/WtsiOulu EMMA embryo mutant strain MGI:5548889 Thada targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3039623 Thada thyroid adenoma associated https://www.infrafrontier.eu/search?keyword=EM:14180 ? EM:14180 C57BL/6N-Thada/WtsiOulu EMMA sperm mutant strain MGI:5548889 Thada targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3039623 Thada thyroid adenoma associated https://www.infrafrontier.eu/search?keyword=EM:14180 + EM:11896 C57BL/6N-Tgm3/WtsiH EMMA sperm mutant strain MGI:6153772 Tgm3 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:98732 Tgm3 transglutaminase 3, E polypeptide https://www.infrafrontier.eu/search?keyword=EM:11896 + EM:12636 C57BL/6N-Tgm1/H EMMA live mutant strain MGI:4458787 Tgm1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98730 Tgm1 transglutaminase 1, K polypeptide https://www.infrafrontier.eu/search?keyword=EM:12636 ? EM:14256 C57BL/6N-Tgfb1i1/WtsiOrl EMMA sperm mutant strain MGI:5636887 Tgfb1i1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:102784 Tgfb1i1 transforming growth factor beta 1 induced transcript 1 https://www.infrafrontier.eu/search?keyword=EM:14256 - EM:12475 C57BL/6N-Tg(Vav1-STAT5B*N642H)726Biat/Biat EMMA archived mutant strain MGI:6164037 Tg(Vav1-STAT5B*N642H)726Biat transgene insertion 726, Biomodels Austria MGI:6164036 Tg(Vav1-STAT5B*N642H)726Biat transgene insertion 726, Biomodels Austria https://www.infrafrontier.eu/search?keyword=EM:12475 ? EM:11779 C57BL/6N-Tg(Vav-BFL1)686Biat/Biat EMMA sperm mutant strain Tg(Vav-BFL1)686Biat Tg(Vav-BFL1)686Biat Tg(Vav-BFL1)686Biat Tg(Vav-BFL1)686Biat https://www.infrafrontier.eu/search?keyword=EM:11779 ? EM:11778 C57BL/6N-Tg(Vav-BCLX)670Biat/Biat EMMA sperm mutant strain Tg(Vav-BCLX)670Biat Tg(Vav-BCLX)670Biat Tg(Vav-BCLX)670Biat Tg(Vav-BCLX)670Biat https://www.infrafrontier.eu/search?keyword=EM:11778 + EM:07327 C57BL/6N-Tg(Tnfrsf19-cre/ERT2)1Kori/Ph EMMA sperm TROY-CreERT2, C57BL/6-Tg(Tnfrsf19-cre/ERT2)1Kori/Ph mutant strain MGI:5575757 Tg(Tnfrsf19-cre/ERT2)1Kori transgene insertion 1, Vladimir Korinek MGI:5575756 Tg(Tnfrsf19-cre/ERT2)1Kori transgene insertion 1, Vladimir Korinek https://www.infrafrontier.eu/search?keyword=EM:07327 ? EM:14608 C57BL/6N-Tg(Th-SNCA*)15Ccs/Ieg EMMA sperm mutant strain MGI:3764815 Tg(Th-SNCA*)1.2Ccs transgene insertion 1.2, Christine C Stichel MGI:3764733 Tg(Th-SNCA*)1.2Ccs transgene insertion 1.2, Christine C Stichel https://www.infrafrontier.eu/search?keyword=EM:14608 ? EM:14609 C57BL/6N-Tg(Prnp-SNCA*)11Ccs/Ieg EMMA sperm mutant strain Tg(Prnp-SNCA*)11Ccs Tg(Prnp-SNCA*)11Ccs Tg(Prnp-SNCA*)11Ccs Tg(Prnp-SNCA*)11Ccs https://www.infrafrontier.eu/search?keyword=EM:14609 + EM:11673 C57BL/6N-Tg(Pdpn-icre)14Biat/Biat EMMA sperm Pdpn-Cre, C57BL/6N-Tg(Pdpn-Cre)408Biat mutant strain MGI:5526988 Tg(Pdpn-icre)14Biat transgene insertion 14, Biomodels Austria MGI:5526987 Tg(Pdpn-icre)14Biat transgene insertion 14, Biomodels Austria https://www.infrafrontier.eu/search?keyword=EM:11673 + EM:04887 C57BL/6N-Tg(NES/TK-PDGFB,-lacZ)312Kfn/Kctt EMMA embryo UB6n-Nestin-PDGF B-LacZ, nes/tk-Pdgfb-lacZ mutant strain MGI:5648209 Tg(NES/TK-PDGFB,-lacZ)312Kfn transgene insertion 312, Karin Forsberg-Nilsson MGI:5648207 Tg(NES/TK-PDGFB,-lacZ)312Kfn transgene insertion 312, Karin Forsberg-Nilsson https://www.infrafrontier.eu/search?keyword=EM:04887 ? EM:13610 C57BL/6N-Tg(Cxcl13-cre,-tdTomato)723Biat/Biat EMMA sperm mutant strain Tg(Cxcl13-cre,-tdTomato)723Biat Tg(Cxcl13-cre,-tdTomato)723Biat Tg(Cxcl13-cre,-tdTomato)723Biat Tg(Cxcl13-cre,-tdTomato)723Biat https://www.infrafrontier.eu/search?keyword=EM:13610 + EM:05917 C57BL/6N-Tg(CRP-Cast)1Lbau/Orl EMMA embryo mutant strain MGI:5789386 Tg(CRP-Cast)1Lbau transgene insertion 1, Laurent Baud MGI:5789383 Tg(CRP-Cast)1Lbau transgene insertion 1, Laurent Baud https://www.infrafrontier.eu/search?keyword=EM:05917 + EM:09381 C57BL/6N-Tg(Ccl19-cre)489Biat/Biat EMMA sperm mutant strain MGI:5526991 Tg(Ccl19-cre)489Biat transgene insertion 489, Biomodels Austria MGI:5526990 Tg(Ccl19-cre)489Biat transgene insertion 489, Biomodels Austria https://www.infrafrontier.eu/search?keyword=EM:09381 ? EM:14607 C57BL/6N-Tg(CAG-SNCA*)17Ccs/Ieg EMMA sperm mutant strain MGI:3764813 Tg(CAG-SNCA*)1.1Ccs transgene insertion 1.1, Christine C Stichel MGI:3764732 Tg(CAG-SNCA*)1.1Ccs transgene insertion 1.1, Christine C Stichel https://www.infrafrontier.eu/search?keyword=EM:14607 ? EM:09498 C57BL/6N-Tg(CAG-mCherry)690Biat/Biat EMMA sperm mutant strain Tg(CAG-mCherry)690Biat Tg(CAG-mCherry)690Biat Tg(CAG-mCherry)690Biat Tg(CAG-mCherry)690Biat https://www.infrafrontier.eu/search?keyword=EM:09498 + EM:09626 C57BL/6N-Tfap2b/Ieg EMMA sperm mutant strain MGI:5635165 Tfap2b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104672 Tfap2b transcription factor AP-2 beta https://www.infrafrontier.eu/search?keyword=EM:09626 + EM:08633 C57BL/6N-Tfap2b/Ieg EMMA embryo mutant strain MGI:4948640 Tfap2b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104672 Tfap2b transcription factor AP-2 beta https://www.infrafrontier.eu/search?keyword=EM:08633 ? EM:14145 C57BL/6N-Tex261/WtsiIeg EMMA sperm mutant strain MGI:5812916 Tex261 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1096575 Tex261 testis expressed gene 261 https://www.infrafrontier.eu/search?keyword=EM:14145 ? EM:14339 C57BL/6N-Tepsin/WtsiCnbc EMMA archived mutant strain MGI:5637095 Tepsin targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1926027 Tepsin TEPSIN, adaptor related protein complex 4 accessory protein https://www.infrafrontier.eu/search?keyword=EM:14339 ? EM:14166 C57BL/6N-Tent5c/WtsiCnbc EMMA archived mutant strain MGI:5637082 Tent5c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921895 Tent5c terminal nucleotidyltransferase 5C https://www.infrafrontier.eu/search?keyword=EM:14166 ? EM:14138 C57BL/6N-Tcf4/WtsiH EMMA sperm mutant strain MGI:6283398 Tcf4 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:98506 Tcf4 transcription factor 4 https://www.infrafrontier.eu/search?keyword=EM:14138 ? EM:13550 C57BL/6N-Tcf20/WtsiKieg EMMA live mutant strain MGI:6257777 Tcf20 endonuclease-mediated mutation 2, Wellcome Trust Sanger Institute MGI:108399 Tcf20 transcription factor 20 https://www.infrafrontier.eu/search?keyword=EM:13550 + EM:11890 C57BL/6N-Tcf20/WtsiH EMMA sperm mutant strain MGI:6153684 Tcf20 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:108399 Tcf20 transcription factor 20 https://www.infrafrontier.eu/search?keyword=EM:11890 + EM:07951 C57BL/6N-Tceal5/WtsiOulu EMMA embryo mutant strain MGI:5548883 Tceal5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3036236 Tceal5 transcription elongation factor A (SII)-like 5 https://www.infrafrontier.eu/search?keyword=EM:07951 + EM:07951 C57BL/6N-Tceal5/WtsiOulu EMMA sperm mutant strain MGI:5548883 Tceal5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3036236 Tceal5 transcription elongation factor A (SII)-like 5 https://www.infrafrontier.eu/search?keyword=EM:07951 + EM:08701 C57BL/6N-Tcaim/H EMMA sperm EPD0327_1_B11, B6NTac;B6N-Tcaim/H mutant strain MGI:4433698 Tcaim targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1196217 Tcaim T cell activation inhibitor, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:08701 + EM:11330 C57BL/6N-Tbl1xr1/Ieg EMMA sperm mutant strain MGI:5085358 Tbl1xr1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2441730 Tbl1xr1 transducin (beta)-like 1X-linked receptor 1 https://www.infrafrontier.eu/search?keyword=EM:11330 - EM:07141 C57BL/6N-Tbkbp1/H EMMA sperm B6NTac;B6N-Tbkbp1/H, B6NTac;B6N-A Tbkbp1/H mutant strain MGI:4842322 Tbkbp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1920424 Tbkbp1 TBK1 binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:07141 + EM:09308 C57BL/6N-Tbce/Ieg EMMA sperm mutant strain MGI:5588279 Tbce targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1917680 Tbce tubulin-specific chaperone E https://www.infrafrontier.eu/search?keyword=EM:09308 + EM:08306 C57BL/6N-Tbce/Ieg EMMA sperm mutant strain MGI:5297130 Tbce targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1917680 Tbce tubulin-specific chaperone E https://www.infrafrontier.eu/search?keyword=EM:08306 ? EM:14236 C57BL/6N-Tbc1d22a/WtsiCnbc EMMA archived mutant strain MGI:5636942 Tbc1d22a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1289265 Tbc1d22a TBC1 domain family, member 22a https://www.infrafrontier.eu/search?keyword=EM:14236 ? EM:13461 C57BL/6N-Tax1bp3/IegBiat EMMA sperm unclassified MGI:6508042 Tax1bp3 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1923531 Tax1bp3 Tax1 (human T cell leukemia virus type I) binding protein 3 https://www.infrafrontier.eu/search?keyword=EM:13461 + EM:10137 C57BL/6N-Tax1bp3/Ieg EMMA sperm mutant strain MGI:5692738 Tax1bp3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1923531 Tax1bp3 Tax1 (human T cell leukemia virus type I) binding protein 3 https://www.infrafrontier.eu/search?keyword=EM:10137 + EM:09585 C57BL/6N-Tax1bp3/Ieg EMMA sperm mutant strain MGI:4436221 Tax1bp3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923531 Tax1bp3 Tax1 (human T cell leukemia virus type I) binding protein 3 https://www.infrafrontier.eu/search?keyword=EM:09585 + EM:07861 C57BL/6N-Tatdn3/WtsiOulu EMMA embryo mutant strain MGI:5548575 Tatdn3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916222 Tatdn3 TatD DNase domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:07861 + EM:07861 C57BL/6N-Tatdn3/WtsiOulu EMMA sperm mutant strain MGI:5548575 Tatdn3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916222 Tatdn3 TatD DNase domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:07861 + EM:08625 C57BL/6N-Tardbp/H EMMA sperm mutant strain MGI:5140493 Tardbp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2387629 Tardbp TAR DNA binding protein https://www.infrafrontier.eu/search?keyword=EM:08625 + EM:10124 C57BL/6N-Tap1/Ieg EMMA sperm mutant strain MGI:5692917 Tap1 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:98483 Tap1 transporter 1, ATP-binding cassette, sub-family B (MDR/TAP) https://www.infrafrontier.eu/search?keyword=EM:10124 + EM:09400 C57BL/6N-Tap1/Ieg EMMA sperm mutant strain MGI:4868062 Tap1 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:98483 Tap1 transporter 1, ATP-binding cassette, sub-family B (MDR/TAP) https://www.infrafrontier.eu/search?keyword=EM:09400 + EM:05344 C57BL/6N-Tango6/Cnrm EMMA sperm C57BL/6N-Tmco7/Cnrm mutant strain MGI:4455865 Tango6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2142786 Tango6 transport and golgi organization 6 https://www.infrafrontier.eu/search?keyword=EM:05344 ? EM:13747 C57BL/6N-Tafa2/WtsiOrl EMMA sperm mutant strain MGI:6257537 Tafa2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2143691 Tafa2 TAFA chemokine like family member 2 https://www.infrafrontier.eu/search?keyword=EM:13747 ? EM:13756 C57BL/6N-Taf4b/WtsiOrl EMMA sperm mutant strain MGI:6153682 Taf4b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2152345 Taf4b TATA-box binding protein associated factor 4b https://www.infrafrontier.eu/search?keyword=EM:13756 ? EM:13887 C57BL/6N-Tada2a/WtsiPh EMMA sperm mutant strain MGI:6153681 Tada2a endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2144471 Tada2a transcriptional adaptor 2A https://www.infrafrontier.eu/search?keyword=EM:13887 + EM:08402 C57BL/6N-Tacr1/Cnrm EMMA sperm mutant strain MGI:5569967 Tacr1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:98475 Tacr1 tachykinin receptor 1 https://www.infrafrontier.eu/search?keyword=EM:08402 + EM:08399 C57BL/6N-Tacr1/Cnrm EMMA embryo mutant strain MGI:5008936 Tacr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98475 Tacr1 tachykinin receptor 1 https://www.infrafrontier.eu/search?keyword=EM:08399 + EM:08399 C57BL/6N-Tacr1/Cnrm EMMA sperm mutant strain MGI:5008936 Tacr1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98475 Tacr1 tachykinin receptor 1 https://www.infrafrontier.eu/search?keyword=EM:08399 ? EM:14465 C57BL/6N-Sytl3/WtsiOulu EMMA embryo mutant strain MGI:6153629 Sytl3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1933367 Sytl3 synaptotagmin-like 3 https://www.infrafrontier.eu/search?keyword=EM:14465 ? EM:14465 C57BL/6N-Sytl3/WtsiOulu EMMA sperm mutant strain MGI:6153629 Sytl3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1933367 Sytl3 synaptotagmin-like 3 https://www.infrafrontier.eu/search?keyword=EM:14465 + EM:08690 C57BL/6N-Synj1/H EMMA sperm mutant strain MGI:4432121 Synj1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354961 Synj1 synaptojanin 1 https://www.infrafrontier.eu/search?keyword=EM:08690 + EM:10362 C57BL/6N-Syncrip/Ieg EMMA sperm mutant strain MGI:4950166 Syncrip targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1891690 Syncrip synaptotagmin binding, cytoplasmic RNA interacting protein https://www.infrafrontier.eu/search?keyword=EM:10362 + EM:09307 C57BL/6N-Syk/Ieg EMMA sperm mutant strain MGI:5588292 Syk targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:99515 Syk spleen tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:09307 + EM:08239 C57BL/6N-Syk/Ieg EMMA embryo mutant strain MGI:4950230 Syk targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99515 Syk spleen tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:08239 + EM:10421 C57BL/6N-Syde1/Ieg EMMA sperm mutant strain MGI:4841821 Syde1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918959 Syde1 synapse defective 1, Rho GTPase, homolog 1 (C. elegans) https://www.infrafrontier.eu/search?keyword=EM:10421 + EM:12756 C57BL/6N-Sycp2/Ieg EMMA sperm mutant strain MGI:5516625 Sycp2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1933281 Sycp2 synaptonemal complex protein 2 https://www.infrafrontier.eu/search?keyword=EM:12756 ? EM:14538 C57BL/6N-Sv2c/WtsiH EMMA live mutant strain MGI:6120752 Sv2c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922459 Sv2c synaptic vesicle glycoprotein 2c https://www.infrafrontier.eu/search?keyword=EM:14538 ? EM:13393 C57BL/6N-Sult1c1/WtsiCnrm EMMA live mutant strain MGI:5636889 Sult1c1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:102928 Sult1c1 sulfotransferase family, cytosolic, 1C, member 1 https://www.infrafrontier.eu/search?keyword=EM:13393 + EM:11392 C57BL/6N-Sulf1/Ieg EMMA sperm mutant strain MGI:5141826 Sulf1 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:2138563 Sulf1 sulfatase 1 https://www.infrafrontier.eu/search?keyword=EM:11392 + EM:09698 C57BL/6N-Stx5a/Ieg EMMA sperm mutant strain MGI:5284918 Stx5a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1928483 Stx5a syntaxin 5A https://www.infrafrontier.eu/search?keyword=EM:09698 ? EM:14454 C57BL/6N-Stom/WtsiCnbc EMMA sperm mutant strain MGI:6153628 Stom endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95403 Stom stomatin https://www.infrafrontier.eu/search?keyword=EM:14454 ? EM:14280 C57BL/6N-Stimate/WtsiIeg EMMA sperm mutant strain MGI:5637076 Stimate targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1921500 Stimate STIM activating enhancer https://www.infrafrontier.eu/search?keyword=EM:14280 ? EM:13695 C57BL/6N-Stat2/WtsiOrl EMMA sperm mutant strain MGI:6153759 Stat2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:103039 Stat2 signal transducer and activator of transcription 2 https://www.infrafrontier.eu/search?keyword=EM:13695 ? EM:14312 C57BL/6N-Stard8/WtsiH EMMA live mutant strain MGI:5548840 Stard8 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2448556 Stard8 START domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:14312 ? EM:14243 C57BL/6N-Stard7/WtsiOulu EMMA embryo mutant strain MGI:6120770 Stard7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2139090 Stard7 START domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:14243 ? EM:14243 C57BL/6N-Stard7/WtsiOulu EMMA sperm mutant strain MGI:6120770 Stard7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2139090 Stard7 START domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:14243 + EM:09048 C57BL/6N-Stard10/H EMMA sperm mutant strain MGI:5692642 Stard10 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1860093 Stard10 START domain containing 10 https://www.infrafrontier.eu/search?keyword=EM:09048 + EM:06202 C57BL/6N-Stard10/H EMMA sperm B6NTac;B6N-Stard10/H mutant strain MGI:4419294 Stard10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1860093 Stard10 START domain containing 10 https://www.infrafrontier.eu/search?keyword=EM:06202 + EM:10123 C57BL/6N-Stac2/Ieg EMMA sperm mutant strain MGI:5692781 Stac2 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2144518 Stac2 SH3 and cysteine rich domain 2 https://www.infrafrontier.eu/search?keyword=EM:10123 + EM:10071 C57BL/6N-Stac2/Ieg EMMA sperm mutant strain MGI:4942095 Stac2 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2144518 Stac2 SH3 and cysteine rich domain 2 https://www.infrafrontier.eu/search?keyword=EM:10071 + EM:09250 C57BL/6N-Sspn/Ieg EMMA sperm mutant strain MGI:5613642 Sspn targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1353511 Sspn sarcospan https://www.infrafrontier.eu/search?keyword=EM:09250 + EM:08732 C57BL/6N-Sspn/Ieg EMMA sperm mutant strain MGI:4436581 Sspn targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1353511 Sspn sarcospan https://www.infrafrontier.eu/search?keyword=EM:08732 ? EM:13845 C57BL/6N-Ssc5d/WtsiCnbc EMMA sperm mutant strain MGI:6153627 Ssc5d endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3606211 Ssc5d scavenger receptor cysteine rich family, 5 domains https://www.infrafrontier.eu/search?keyword=EM:13845 ? EM:14130 C57BL/6N-Srebf2/WtsiCnbc EMMA sperm mutant strain Srebf2 KOMP targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107585 Srebf2 sterol regulatory element binding factor 2 https://www.infrafrontier.eu/search?keyword=EM:14130 ? EM:13821 C57BL/6N-Srcap/WtsiOulu EMMA embryo mutant strain MGI:6153626 Srcap endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2444036 Srcap Snf2-related CREBBP activator protein https://www.infrafrontier.eu/search?keyword=EM:13821 ? EM:13821 C57BL/6N-Srcap/WtsiOulu EMMA sperm mutant strain MGI:6153626 Srcap endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2444036 Srcap Snf2-related CREBBP activator protein https://www.infrafrontier.eu/search?keyword=EM:13821 - EM:07140 C57BL/6N-Sptbn2/H EMMA sperm B6NTac;B6N-Sptbn2/H mutant strain MGI:4841660 Sptbn2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1313261 Sptbn2 spectrin beta, non-erythrocytic 2 https://www.infrafrontier.eu/search?keyword=EM:07140 + EM:10031 C57BL/6N-Spryd3/Ieg EMMA sperm mutant strain MGI:5695128 Spryd3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2446175 Spryd3 SPRY domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:10031 + EM:04724 C57BL/6N-Spryd3/Ieg EMMA sperm B6NTac;B6N-Spryd3/Ieg mutant strain MGI:4434532 Spryd3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2446175 Spryd3 SPRY domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:04724 ? EM:13803 C57BL/6N-Spring1/WtsiIeg EMMA sperm mutant strain MGI:6281933 Spring1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1924042 Spring1 SREBF pathway regulator in golgi 1 https://www.infrafrontier.eu/search?keyword=EM:13803 + EM:09683 C57BL/6N-Spice1/H EMMA sperm mutant strain MGI:5286323 Spice1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1196252 Spice1 spindle and centriole associated protein 1 https://www.infrafrontier.eu/search?keyword=EM:09683 ? EM:13749 C57BL/6N-Spi1/WtsiIeg EMMA sperm mutant strain MGI:6281103 Spi1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:98282 Spi1 spleen focus forming virus (SFFV) proviral integration oncogene https://www.infrafrontier.eu/search?keyword=EM:13749 ? EM:13755 C57BL/6N-Spg21/WtsiIeg EMMA sperm mutant strain MGI:6153624 Spg21 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:106403 Spg21 SPG21, maspardin https://www.infrafrontier.eu/search?keyword=EM:13755 + EM:08074 C57BL/6N-Spg20/Ieg EMMA sperm mutant strain MGI:5548741 Spg20 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2139806 Spg20 spastic paraplegia 20, spartin (Troyer syndrome) homolog (human) https://www.infrafrontier.eu/search?keyword=EM:08074 ? EM:13769 C57BL/6N-Spats2l/WtsiOrl EMMA sperm mutant strain MGI:6281943 Spats2l endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914448 Spats2l spermatogenesis associated, serine-rich 2-like https://www.infrafrontier.eu/search?keyword=EM:13769 + EM:11570 C57BL/6N-Spaca9/WtsiIeg EMMA sperm mutant strain MGI:6140224 Spaca9 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1917237 Spaca9 sperm acrosome associated 9 https://www.infrafrontier.eu/search?keyword=EM:11570 ? EM:13814 C57BL/6N-Spaca7/WtsiIeg EMMA sperm mutant strain MGI:6257711 Spaca7 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1925884 Spaca7 sperm acrosome associated 7 https://www.infrafrontier.eu/search?keyword=EM:13814 - EM:07872 C57BL/6N-Sort1/H EMMA sperm B6NTac;B6N-Sort1/H mutant strain MGI:4842306 Sort1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1338015 Sort1 sortilin 1 https://www.infrafrontier.eu/search?keyword=EM:07872 + EM:08449 C57BL/6N-Sorl1/Cnrm EMMA embryo mutant strain MGI:5569945 Sorl1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1202296 Sorl1 sortilin-related receptor, LDLR class A repeats-containing https://www.infrafrontier.eu/search?keyword=EM:08449 + EM:08449 C57BL/6N-Sorl1/Cnrm EMMA sperm mutant strain MGI:5569945 Sorl1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1202296 Sorl1 sortilin-related receptor, LDLR class A repeats-containing https://www.infrafrontier.eu/search?keyword=EM:08449 + EM:08401 C57BL/6N-Sorl1/Cnrm EMMA sperm mutant strain MGI:4451976 Sorl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1202296 Sorl1 sortilin-related receptor, LDLR class A repeats-containing https://www.infrafrontier.eu/search?keyword=EM:08401 ? EM:13928 C57BL/6N-Son/WtsiOulu EMMA embryo mutant strain MGI:6153757 Son endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:98353 Son Son DNA binding protein https://www.infrafrontier.eu/search?keyword=EM:13928 ? EM:13928 C57BL/6N-Son/WtsiOulu EMMA sperm mutant strain MGI:6153757 Son endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:98353 Son Son DNA binding protein https://www.infrafrontier.eu/search?keyword=EM:13928 + EM:12759 C57BL/6N-Snx13/Ieg EMMA sperm mutant strain MGI:5295603 Snx13 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2661416 Snx13 sorting nexin 13 https://www.infrafrontier.eu/search?keyword=EM:12759 + EM:07007 C57BL/6N-Snrnp200/H EMMA sperm B6NTac;B6N-Snrnp200/H mutant strain MGI:4840806 Snrnp200 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:2444401 Snrnp200 small nuclear ribonucleoprotein 200 (U5) https://www.infrafrontier.eu/search?keyword=EM:07007 + EM:09934 C57BL/6N-Snorc/Oulu EMMA embryo C57BL/6N-3110079O15Rik/Oulu mutant strain MGI:5637067 Snorc targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1920484 Snorc secondary ossification center associated regulator of chondrocyte maturation https://www.infrafrontier.eu/search?keyword=EM:09934 + EM:09934 C57BL/6N-Snorc/Oulu EMMA sperm C57BL/6N-3110079O15Rik/Oulu mutant strain MGI:5637067 Snorc targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1920484 Snorc secondary ossification center associated regulator of chondrocyte maturation https://www.infrafrontier.eu/search?keyword=EM:09934 + EM:09933 C57BL/6N-Snorc/Oulu EMMA embryo C57BL/6N-3110079O15Rik/Oulu mutant strain MGI:4436063 Snorc targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920484 Snorc secondary ossification center associated regulator of chondrocyte maturation https://www.infrafrontier.eu/search?keyword=EM:09933 + EM:09933 C57BL/6N-Snorc/Oulu EMMA sperm C57BL/6N-3110079O15Rik/Oulu mutant strain MGI:4436063 Snorc targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920484 Snorc secondary ossification center associated regulator of chondrocyte maturation https://www.infrafrontier.eu/search?keyword=EM:09933 + EM:08988 C57BL/6N-Sncb/H EMMA sperm mutant strain MGI:4455731 Sncb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1889011 Sncb synuclein, beta https://www.infrafrontier.eu/search?keyword=EM:08988 + EM:08403 C57BL/6N-Sncaip/Cnrm EMMA sperm mutant strain MGI:5569950 Sncaip targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915097 Sncaip synuclein, alpha interacting protein (synphilin) https://www.infrafrontier.eu/search?keyword=EM:08403 + EM:08400 C57BL/6N-Sncaip/Cnrm EMMA sperm mutant strain MGI:4938575 Sncaip targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915097 Sncaip synuclein, alpha interacting protein (synphilin) https://www.infrafrontier.eu/search?keyword=EM:08400 + EM:09661 C57BL/6N-Snapc1/H EMMA sperm mutant strain MGI:4867920 Snapc1 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:1922877 Snapc1 small nuclear RNA activating complex, polypeptide 1 https://www.infrafrontier.eu/search?keyword=EM:09661 + EM:09868 C57BL/6N-Snap23/H EMMA sperm mutant strain MGI:4460454 Snap23 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109356 Snap23 synaptosomal-associated protein 23 https://www.infrafrontier.eu/search?keyword=EM:09868 + EM:07130 C57BL/6N-Smurf2/H EMMA sperm EPD0424_6_H08, B6NTac;B6N-Smurf2/H mutant strain MGI:4431726 Smurf2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913563 Smurf2 SMAD specific E3 ubiquitin protein ligase 2 https://www.infrafrontier.eu/search?keyword=EM:07130 + EM:07888 C57BL/6N-Smpd4/WtsiCnrm EMMA sperm mutant strain MGI:5548688 Smpd4 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1924876 Smpd4 sphingomyelin phosphodiesterase 4 https://www.infrafrontier.eu/search?keyword=EM:07888 + EM:04902 C57BL/6N-Smoc1/H EMMA sperm B6NTac;B6N-Smoc1/H mutant strain MGI:4431709 Smoc1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1929878 Smoc1 SPARC related modular calcium binding 1 https://www.infrafrontier.eu/search?keyword=EM:04902 ? EM:13742 C57BL/6N-Smim1/WtsiOrl EMMA sperm mutant strain MGI:6153773 Smim1 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:1916109 Smim1 small integral membrane protein 1 https://www.infrafrontier.eu/search?keyword=EM:13742 + EM:11219 C57BL/6N-Smim1/WtsiIeg EMMA sperm mutant strain MGI:6140223 Smim1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1916109 Smim1 small integral membrane protein 1 https://www.infrafrontier.eu/search?keyword=EM:11219 ? EM:14340 C57BL/6N-Smg9/WtsiH EMMA live mutant strain MGI:5692712 Smg9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919247 Smg9 SMG9 nonsense mediated mRNA decay factor https://www.infrafrontier.eu/search?keyword=EM:14340 ? EM:14316 C57BL/6N-Smg1/WtsiH EMMA live mutant strain MGI:5692718 Smg1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919742 Smg1 SMG1 nonsense mediated mRNA decay associated PI3K related kinase https://www.infrafrontier.eu/search?keyword=EM:14316 + EM:10413 C57BL/6N-Smcr8/Cnbc EMMA sperm mutant strain MGI:4452950 Smcr8 targeted mutation 1, Velocigene MGI:2444720 Smcr8 Smith-Magenis syndrome chromosome region, candidate 8 homolog (human) https://www.infrafrontier.eu/search?keyword=EM:10413 + EM:09249 C57BL/6N-Smc6/Ieg EMMA sperm mutant strain MGI:5613644 Smc6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914491 Smc6 structural maintenance of chromosomes 6 https://www.infrafrontier.eu/search?keyword=EM:09249 + EM:08174 C57BL/6N-Slitrk4/WtsiOulu EMMA embryo mutant strain MGI:5548808 Slitrk4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442509 Slitrk4 SLIT and NTRK-like family, member 4 https://www.infrafrontier.eu/search?keyword=EM:08174 + EM:08174 C57BL/6N-Slitrk4/WtsiOulu EMMA sperm mutant strain MGI:5548808 Slitrk4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442509 Slitrk4 SLIT and NTRK-like family, member 4 https://www.infrafrontier.eu/search?keyword=EM:08174 ? EM:13405 C57BL/6N-Slfnl1/WtsiCnrm EMMA live mutant strain MGI:6149901 Slfnl1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3045330 Slfnl1 schlafen like 1 https://www.infrafrontier.eu/search?keyword=EM:13405 - EM:07438 C57BL/6N-Slfn4/H EMMA sperm B6NTac;B6N-Slfn4/H mutant strain MGI:4944570 Slfn4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1329010 Slfn4 schlafen 4 https://www.infrafrontier.eu/search?keyword=EM:07438 ? EM:13446 C57BL/6N-Slco1a6/WtsiCnrm EMMA live mutant strain MGI:6281935 Slco1a6 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1351906 Slco1a6 solute carrier organic anion transporter family, member 1a6 https://www.infrafrontier.eu/search?keyword=EM:13446 + EM:07780 C57BL/6N-Slc9a4/H EMMA sperm B6NTac;B6N-Slc9a4/H mutant strain MGI:4842748 Slc9a4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:105074 Slc9a4 solute carrier family 9 (sodium/hydrogen exchanger), member 4 https://www.infrafrontier.eu/search?keyword=EM:07780 + EM:09028 C57BL/6N-Slc6a2/Cnrm EMMA sperm mutant strain MGI:5588269 Slc6a2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1270850 Slc6a2 solute carrier family 6 (neurotransmitter transporter, noradrenalin), member 2 https://www.infrafrontier.eu/search?keyword=EM:09028 + EM:08398 C57BL/6N-Slc6a2/Cnrm EMMA sperm mutant strain MGI:4461511 Slc6a2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1270850 Slc6a2 solute carrier family 6 (neurotransmitter transporter, noradrenalin), member 2 https://www.infrafrontier.eu/search?keyword=EM:08398 + EM:09248 C57BL/6N-Slc6a20a/Ieg EMMA sperm mutant strain MGI:5613657 Slc6a20a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2143217 Slc6a20a solute carrier family 6 (neurotransmitter transporter), member 20A https://www.infrafrontier.eu/search?keyword=EM:09248 ? EM:13453 C57BL/6N-Slc5a12/WtsiCnrm EMMA live mutant strain MGI:6257445 Slc5a12 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2138890 Slc5a12 solute carrier family 5 (sodium/glucose cotransporter), member 12 https://www.infrafrontier.eu/search?keyword=EM:13453 - EM:07866 C57BL/6N-Slc4a10/H EMMA sperm mutant strain MGI:4451535 Slc4a10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2150150 Slc4a10 solute carrier family 4, sodium bicarbonate cotransporter-like, member 10 https://www.infrafrontier.eu/search?keyword=EM:07866 + EM:08091 C57BL/6N-Slc47a1/Ieg EMMA embryo mutant strain MGI:5548541 Slc47a1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914723 Slc47a1 solute carrier family 47, member 1 https://www.infrafrontier.eu/search?keyword=EM:08091 + EM:05536 C57BL/6N-Slc47a1/Ieg EMMA embryo B6NTac;B6N-Slc47a1/Ieg mutant strain MGI:4432174 Slc47a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1914723 Slc47a1 solute carrier family 47, member 1 https://www.infrafrontier.eu/search?keyword=EM:05536 + EM:10112 C57BL/6N-Slc44a4/Ieg EMMA sperm mutant strain MGI:5692698 Slc44a4 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1917379 Slc44a4 solute carrier family 44, member 4 https://www.infrafrontier.eu/search?keyword=EM:10112 + EM:09107 C57BL/6N-Slc44a4/Ieg EMMA sperm mutant strain MGI:4841742 Slc44a4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917379 Slc44a4 solute carrier family 44, member 4 https://www.infrafrontier.eu/search?keyword=EM:09107 + EM:09247 C57BL/6N-Slc44a3/Ieg EMMA sperm mutant strain MGI:5613661 Slc44a3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2384860 Slc44a3 solute carrier family 44, member 3 https://www.infrafrontier.eu/search?keyword=EM:09247 - EM:04833 C57BL/6N-Slc40a1/H EMMA sperm B6NTac;B6N-Slc40a1/H mutant strain MGI:4435780 Slc40a1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1315204 Slc40a1 solute carrier family 40 (iron-regulated transporter), member 1 https://www.infrafrontier.eu/search?keyword=EM:04833 ? EM:13367 C57BL/6N-Slc37a3/WtsiCnrm EMMA live mutant strain MGI:6153622 Slc37a3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919394 Slc37a3 solute carrier family 37 (glycerol-3-phosphate transporter), member 3 https://www.infrafrontier.eu/search?keyword=EM:13367 + EM:09223 C57BL/6N-Slc2a5/Ieg EMMA sperm mutant strain MGI:5613655 Slc2a5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1928369 Slc2a5 solute carrier family 2 (facilitated glucose transporter), member 5 https://www.infrafrontier.eu/search?keyword=EM:09223 + EM:07602 C57BL/6N-Slc2a5/Ieg EMMA sperm B6NTac;B6N-Slc2a5/Ieg mutant strain MGI:4842480 Slc2a5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1928369 Slc2a5 solute carrier family 2 (facilitated glucose transporter), member 5 https://www.infrafrontier.eu/search?keyword=EM:07602 ? EM:13448 C57BL/6N-Slc29a3/WtsiCnrm EMMA live mutant strain MGI:6257459 Slc29a3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1918529 Slc29a3 solute carrier family 29 (nucleoside transporters), member 3 https://www.infrafrontier.eu/search?keyword=EM:13448 ? EM:13429 C57BL/6N-Slc25a37/WtsiCnrm EMMA live mutant strain MGI:6153621 Slc25a37 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914962 Slc25a37 solute carrier family 25, member 37 https://www.infrafrontier.eu/search?keyword=EM:13429 ? EM:13396 C57BL/6N-Slc25a28/WtsiCnrm EMMA live mutant strain MGI:5637123 Slc25a28 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2180509 Slc25a28 solute carrier family 25, member 28 https://www.infrafrontier.eu/search?keyword=EM:13396 + EM:08415 C57BL/6N-Slc25a15/Ieg EMMA sperm mutant strain MGI:5636973 Slc25a15 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1342274 Slc25a15 solute carrier family 25 (mitochondrial carrier ornithine transporter), member 15 https://www.infrafrontier.eu/search?keyword=EM:08415 + EM:08408 C57BL/6N-Slc25a15/Ieg EMMA embryo mutant strain MGI:5085374 Slc25a15 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1342274 Slc25a15 solute carrier family 25 (mitochondrial carrier ornithine transporter), member 15 https://www.infrafrontier.eu/search?keyword=EM:08408 + EM:11107 C57BL/6N-Slc25a10/Ieg EMMA sperm mutant strain MGI:4460471 Slc25a10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1353497 Slc25a10 solute carrier family 25 (mitochondrial carrier, dicarboxylate transporter), member 10 https://www.infrafrontier.eu/search?keyword=EM:11107 - EM:07801 C57BL/6N-Slc24a4/H EMMA sperm B6NTac;B6N-Slc24a4/H mutant strain MGI:4944392 Slc24a4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2447362 Slc24a4 solute carrier family 24 (sodium/potassium/calcium exchanger), member 4 https://www.infrafrontier.eu/search?keyword=EM:07801 + EM:07868 C57BL/6N-Slc22a8/H EMMA sperm B6NTac;B6N-Slc22a8/H mutant strain MGI:4419220 Slc22a8 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1336187 Slc22a8 solute carrier family 22 (organic anion transporter), member 8 https://www.infrafrontier.eu/search?keyword=EM:07868 + EM:08067 C57BL/6N-Slc20a2/Ieg EMMA sperm mutant strain MGI:5548966 Slc20a2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:97851 Slc20a2 solute carrier family 20, member 2 https://www.infrafrontier.eu/search?keyword=EM:08067 + EM:05733 C57BL/6N-Slc17a8/Ics EMMA sperm VGluT3cKO mutant strain MGI:5645786 Slc17a8 targeted mutation 2, Salah El Mestikawy MGI:3039629 Slc17a8 solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 8 https://www.infrafrontier.eu/search?keyword=EM:05733 + EM:09570 C57BL/6N-Slc17a6/H EMMA sperm mutant strain MGI:4455898 Slc17a6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2156052 Slc17a6 solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 6 https://www.infrafrontier.eu/search?keyword=EM:09570 + EM:09352 C57BL/6N-Slc13a5/Ieg EMMA sperm mutant strain MGI:5614709 Slc13a5 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3037150 Slc13a5 solute carrier family 13 (sodium-dependent citrate transporter), member 5 https://www.infrafrontier.eu/search?keyword=EM:09352 + EM:08618 C57BL/6N-Slc13a5/Ieg EMMA sperm mutant strain MGI:4841523 Slc13a5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3037150 Slc13a5 solute carrier family 13 (sodium-dependent citrate transporter), member 5 https://www.infrafrontier.eu/search?keyword=EM:08618 ? EM:14417 C57BL/6N-Slamf9/WtsiOulu EMMA embryo mutant strain MGI:5692740 Slamf9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923692 Slamf9 SLAM family member 9 https://www.infrafrontier.eu/search?keyword=EM:14417 ? EM:14417 C57BL/6N-Slamf9/WtsiOulu EMMA sperm mutant strain MGI:5692740 Slamf9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923692 Slamf9 SLAM family member 9 https://www.infrafrontier.eu/search?keyword=EM:14417 ? EM:13905 C57BL/6N-Skint7/WtsiCnbc EMMA sperm mutant strain MGI:6153620 Skint7 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3041190 Skint7 selection and upkeep of intraepithelial T cells 7 https://www.infrafrontier.eu/search?keyword=EM:13905 + EM:09090 C57BL/6N-Siva1/Ieg EMMA sperm mutant strain MGI:5605765 Siva1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1353606 Siva1 SIVA1, apoptosis-inducing factor https://www.infrafrontier.eu/search?keyword=EM:09090 + EM:08127 C57BL/6N-Siva1/Ieg EMMA embryo B6NTac;B6N-Siva1/Ieg mutant strain MGI:4455701 Siva1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1353606 Siva1 SIVA1, apoptosis-inducing factor https://www.infrafrontier.eu/search?keyword=EM:08127 - EM:10067 C57BL/6N-Sirt6/H EMMA sperm B6NTac;B6N-Sirt6/H mutant strain MGI:5692638 Sirt6 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1354161 Sirt6 sirtuin 6 https://www.infrafrontier.eu/search?keyword=EM:10067 + EM:05219 C57BL/6N-Sirt6/H EMMA sperm Sirt6(F08), B6NTac;B6N-Sirt6/H mutant strain MGI:4432093 Sirt6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354161 Sirt6 sirtuin 6 https://www.infrafrontier.eu/search?keyword=EM:05219 + EM:10236 C57BL/6N-Sirt5/Ieg EMMA sperm mutant strain MGI:5701722 Sirt5 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1915596 Sirt5 sirtuin 5 https://www.infrafrontier.eu/search?keyword=EM:10236 + EM:08621 C57BL/6N-Sirt5/Ieg EMMA embryo mutant strain MGI:5511642 Sirt5 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1915596 Sirt5 sirtuin 5 https://www.infrafrontier.eu/search?keyword=EM:08621 + EM:06825 C57BL/6N-Sirt4/H EMMA sperm B6NTac;B6N-Sirt4/H mutant strain MGI:4457551 Sirt4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922637 Sirt4 sirtuin 4 https://www.infrafrontier.eu/search?keyword=EM:06825 + EM:10146 C57BL/6N-Sirt1/H EMMA sperm mutant strain MGI:5692765 Sirt1 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:2135607 Sirt1 sirtuin 1 https://www.infrafrontier.eu/search?keyword=EM:10146 - EM:05484 C57BL/6N-Sirt1/H EMMA sperm B6NTac;B6N-Sirt1/H, EPD0428_2_B04 mutant strain MGI:4432175 Sirt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2135607 Sirt1 sirtuin 1 https://www.infrafrontier.eu/search?keyword=EM:05484 ? EM:14587 C57BL/6N-Sirpb1c/WtsiPh EMMA sperm mutant strain MGI:6153619 Sirpb1c endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3807521 Sirpb1c signal-regulatory protein beta 1C https://www.infrafrontier.eu/search?keyword=EM:14587 ? EM:13876 C57BL/6N-Sirpb1b/WtsiPh EMMA sperm mutant strain MGI:6153618 Sirpb1b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3779828 Sirpb1b signal-regulatory protein beta 1B https://www.infrafrontier.eu/search?keyword=EM:13876 + EM:09622 C57BL/6N-Sipa1/H EMMA sperm mutant strain MGI:4847818 Sipa1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:107576 Sipa1 signal-induced proliferation associated gene 1 https://www.infrafrontier.eu/search?keyword=EM:09622 + EM:08697 C57BL/6N-Shmt1/H EMMA sperm mutant strain MGI:4454114 Shmt1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98299 Shmt1 serine hydroxymethyltransferase 1 (soluble) https://www.infrafrontier.eu/search?keyword=EM:08697 ? EM:14592 C57BL/6N-Shld1/WtsiOulu EMMA embryo mutant strain MGI:6257464 Shld1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1920997 Shld1 shieldin complex subunit 1 https://www.infrafrontier.eu/search?keyword=EM:14592 ? EM:14592 C57BL/6N-Shld1/WtsiOulu EMMA sperm mutant strain MGI:6257464 Shld1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1920997 Shld1 shieldin complex subunit 1 https://www.infrafrontier.eu/search?keyword=EM:14592 - EM:07782 C57BL/6N-Shh/H EMMA sperm B6NTac;B6N-Shh/H, EPD0339_3_A12 mutant strain MGI:4433366 Shh targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98297 Shh sonic hedgehog https://www.infrafrontier.eu/search?keyword=EM:07782 ? EM:14517 C57BL/6N-Sh3pxd2a/WtsiCnbc EMMA archived mutant strain MGI:5636944 Sh3pxd2a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1298393 Sh3pxd2a SH3 and PX domains 2A https://www.infrafrontier.eu/search?keyword=EM:14517 ? EM:14228 C57BL/6N-Sh3bgrl3/WtsiCnbc EMMA archived mutant strain MGI:5637071 Sh3bgrl3 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1920973 Sh3bgrl3 SH3 domain binding glutamic acid-rich protein-like 3 https://www.infrafrontier.eu/search?keyword=EM:14228 + EM:07621 C57BL/6N-Sgsm1/Wtsi EMMA archived mutant strain MGI:5636905 Sgsm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107320 Sgsm1 small G protein signaling modulator 1 https://www.infrafrontier.eu/search?keyword=EM:07621 + EM:08418 C57BL/6N-Sgip1/Ieg EMMA sperm C57BL/6N-Sgip1/Hmgu mutant strain MGI:5548629 Sgip1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1920344 Sgip1 SH3-domain GRB2-like (endophilin) interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:08418 + EM:08411 C57BL/6N-Sgip1/Ieg EMMA sperm mutant strain MGI:4841887 Sgip1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920344 Sgip1 SH3-domain GRB2-like (endophilin) interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:08411 + EM:07902 C57BL/6N-Sfxn3/WtsiCnrm EMMA sperm mutant strain MGI:5548735 Sfxn3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2137679 Sfxn3 sideroflexin 3 https://www.infrafrontier.eu/search?keyword=EM:07902 + EM:08318 C57BL/6N-Sez6l/H EMMA sperm mutant strain MGI:4942074 Sez6l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1935121 Sez6l seizure related 6 homolog like https://www.infrafrontier.eu/search?keyword=EM:08318 ? EM:14244 C57BL/6N-Setd1a/WtsiCnbc EMMA archived mutant strain MGI:6162235 Setd1a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2446244 Setd1a SET domain containing 1A https://www.infrafrontier.eu/search?keyword=EM:14244 ? EM:14215 C57BL/6N-Setd1a/WtsiIeg EMMA sperm mutant strain Setd1a undef targeted mutation , Wellcome Trust Sanger Institute MGI:2446244 Setd1a SET domain containing 1A https://www.infrafrontier.eu/search?keyword=EM:14215 ? EM:14555 C57BL/6N-Serpinb9b/WtsiPh EMMA sperm mutant strain MGI:6153613 Serpinb9b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:894668 Serpinb9b serine (or cysteine) peptidase inhibitor, clade B, member 9b https://www.infrafrontier.eu/search?keyword=EM:14555 + EM:10739 C57BL/6N-Serf2/H EMMA live Serf2 mutant strain MGI:6317359 Serf2 targeted mutation 1d, Helmholtz Zentrum Muenchen GmbH MGI:1337041 Serf2 small EDRK-rich factor 2 https://www.infrafrontier.eu/search?keyword=EM:10739 + EM:10831 C57BL/6N-Serf1/H EMMA sperm mutant strain MGI:4436313 Serf1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1337114 Serf1 small EDRK-rich factor 1 https://www.infrafrontier.eu/search?keyword=EM:10831 ? EM:14401 C57BL/6N-Senp6/WtsiOulu EMMA embryo mutant strain MGI:6120751 Senp6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1922075 Senp6 SUMO/sentrin specific peptidase 6 https://www.infrafrontier.eu/search?keyword=EM:14401 ? EM:14401 C57BL/6N-Senp6/WtsiOulu EMMA sperm mutant strain MGI:6120751 Senp6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1922075 Senp6 SUMO/sentrin specific peptidase 6 https://www.infrafrontier.eu/search?keyword=EM:14401 - EM:09031 C57BL/6N-Sema3f/H EMMA sperm B6NTac;B6N-A Sema3f/H mutant strain MGI:5692585 Sema3f targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1096347 Sema3f sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3F https://www.infrafrontier.eu/search?keyword=EM:09031 + EM:06945 C57BL/6N-Sema3f/H EMMA sperm B6NTac;B6N-Sema3f/H mutant strain MGI:4435144 Sema3f targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1096347 Sema3f sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3F https://www.infrafrontier.eu/search?keyword=EM:06945 + EM:08544 C57BL/6N-Sell/H EMMA sperm mutant strain MGI:4434581 Sell targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98279 Sell selectin, lymphocyte https://www.infrafrontier.eu/search?keyword=EM:08544 + EM:07981 C57BL/6N-Selk/WtsiH EMMA sperm C57BL/6N-Selenok/WtsiH mutant strain MGI:5548722 Selenok targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1931466 Selenok selenoprotein K https://www.infrafrontier.eu/search?keyword=EM:07981 ? EM:14512 C57BL/6N-Selenow/WtsiOrl EMMA sperm mutant strain MGI:5636930 Selenow targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1100878 Selenow selenoprotein W https://www.infrafrontier.eu/search?keyword=EM:14512 + EM:09170 C57BL/6N-Selenok/WtsiH EMMA sperm C57BL/6N-Selk/WtsiH mutant strain MGI:5548722 Selenok targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1931466 Selenok selenoprotein K https://www.infrafrontier.eu/search?keyword=EM:09170 ? EM:13911 C57BL/6N-Selenoi/WtsiOulu EMMA embryo mutant strain MGI:6153612 Selenoi endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107898 Selenoi selenoprotein I https://www.infrafrontier.eu/search?keyword=EM:13911 ? EM:13911 C57BL/6N-Selenoi/WtsiOulu EMMA sperm mutant strain MGI:6153612 Selenoi endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107898 Selenoi selenoprotein I https://www.infrafrontier.eu/search?keyword=EM:13911 + EM:09227 C57BL/6N-Sec14l4/Ieg EMMA sperm mutant strain MGI:5613659 Sec14l4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2144095 Sec14l4 SEC14-like lipid binding 4 https://www.infrafrontier.eu/search?keyword=EM:09227 + EM:07612 C57BL/6N-Sec14l4/Ieg EMMA embryo B6NTac;B6N-Sec14l4/Ieg mutant strain MGI:4433028 Sec14l4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2144095 Sec14l4 SEC14-like lipid binding 4 https://www.infrafrontier.eu/search?keyword=EM:07612 + EM:09697 C57BL/6N-Sec11c/Ieg EMMA sperm mutant strain MGI:4456039 Sec11c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1913536 Sec11c SEC11 homolog C, signal peptidase complex subunit https://www.infrafrontier.eu/search?keyword=EM:09697 + EM:08116 C57BL/6N-Sdhb/Ieg EMMA sperm C57BL/6N-Sdhb/Hmgu mutant strain MGI:5548548 Sdhb targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914930 Sdhb succinate dehydrogenase complex, subunit B, iron sulfur (Ip) https://www.infrafrontier.eu/search?keyword=EM:08116 + EM:07615 C57BL/6N-Sdhb/Ieg EMMA embryo B6NTac;B6N-Sdhb/Ieg mutant strain MGI:5085385 Sdhb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914930 Sdhb succinate dehydrogenase complex, subunit B, iron sulfur (Ip) https://www.infrafrontier.eu/search?keyword=EM:07615 + EM:09383 C57BL/6N-Sdc4/H EMMA sperm mutant strain MGI:4451381 Sdc4 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1349164 Sdc4 syndecan 4 https://www.infrafrontier.eu/search?keyword=EM:09383 ? EM:13866 C57BL/6N-Sdc3/WtsiOulu EMMA embryo mutant strain MGI:6153756 Sdc3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1349163 Sdc3 syndecan 3 https://www.infrafrontier.eu/search?keyword=EM:13866 ? EM:13866 C57BL/6N-Sdc3/WtsiOulu EMMA sperm mutant strain MGI:6153756 Sdc3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1349163 Sdc3 syndecan 3 https://www.infrafrontier.eu/search?keyword=EM:13866 + EM:08059 C57BL/6N-Sdc2/Ieg EMMA sperm mutant strain MGI:5548470 Sdc2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1349165 Sdc2 syndecan 2 https://www.infrafrontier.eu/search?keyword=EM:08059 + EM:07574 C57BL/6N-Scnn1g/H EMMA sperm EPD0795_5_H04, B6NTac;B6N-Scnn1g/H mutant strain MGI:5299883 Scnn1g targeted mutation 1e, Wellcome Trust Sanger Institute MGI:104695 Scnn1g sodium channel, nonvoltage-gated 1 gamma https://www.infrafrontier.eu/search?keyword=EM:07574 - EM:04742 C57BL/6N-Scnn1b/Cnrm EMMA embryo mutant strain MGI:4435286 Scnn1b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104696 Scnn1b sodium channel, nonvoltage-gated 1 beta https://www.infrafrontier.eu/search?keyword=EM:04742 - EM:04742 C57BL/6N-Scnn1b/Cnrm EMMA sperm mutant strain MGI:4435286 Scnn1b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104696 Scnn1b sodium channel, nonvoltage-gated 1 beta https://www.infrafrontier.eu/search?keyword=EM:04742 ? EM:13715 C57BL/6N-Scn4b/WtsiOrl EMMA sperm mutant strain MGI:6153611 Scn4b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2687406 Scn4b sodium channel, type IV, beta https://www.infrafrontier.eu/search?keyword=EM:13715 - EM:06051 C57BL/6N-Scn4a/H EMMA sperm B6NTac;B6N-Scn4a/H mutant strain MGI:5284906 Scn4a targeted mutation 2a, Wellcome Trust Sanger Institute MGI:98250 Scn4a sodium channel, voltage-gated, type IV, alpha https://www.infrafrontier.eu/search?keyword=EM:06051 + EM:11595 C57BL/6N-Scmh1/Ieg EMMA sperm mutant strain MGI:4458794 Scmh1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1352762 Scmh1 sex comb on midleg homolog 1 https://www.infrafrontier.eu/search?keyword=EM:11595 - EM:08968 C57BL/6N-Scgb3a1/Cnrm EMMA sperm mutant strain MGI:5633832 Scgb3a1 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1915912 Scgb3a1 secretoglobin, family 3A, member 1 https://www.infrafrontier.eu/search?keyword=EM:08968 ? EM:14441 C57BL/6N-Scaf1/WtsiCnbc EMMA sperm mutant strain MGI:6153610 Scaf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2141980 Scaf1 SR-related CTD-associated factor 1 https://www.infrafrontier.eu/search?keyword=EM:14441 + EM:11758 C57BL/6N-Scaf11/WtsiCnrm EMMA sperm mutant strain MGI:6152741 Scaf11 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1919443 Scaf11 SR-related CTD-associated factor 11 https://www.infrafrontier.eu/search?keyword=EM:11758 + EM:09856 C57BL/6N-Sbno1/H EMMA sperm mutant strain MGI:5294216 Sbno1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384298 Sbno1 strawberry notch 1 https://www.infrafrontier.eu/search?keyword=EM:09856 + EM:09462 C57BL/6N-Sarnp/Ieg EMMA sperm mutant strain MGI:5548511 Sarnp targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1913368 Sarnp SAP domain containing ribonucleoprotein https://www.infrafrontier.eu/search?keyword=EM:09462 + EM:11377 C57BL/6N-Samd7/H EMMA sperm mutant strain MGI:4455714 Samd7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923203 Samd7 sterile alpha motif domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:11377 + EM:10854 C57BL/6N-S1pr2/WtsiOulu EMMA embryo mutant strain MGI:5423977 S1pr2 stonedeaf MGI:99569 S1pr2 sphingosine-1-phosphate receptor 2 https://www.infrafrontier.eu/search?keyword=EM:10854 ? EM:13768 C57BL/6N-S100a4/WtsiOrl EMMA sperm mutant strain MGI:6336062 S100a4 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1330282 S100a4 S100 calcium binding protein A4 https://www.infrafrontier.eu/search?keyword=EM:13768 + EM:07322 C57BL/6N-Ryr2/H EMMA sperm mutant strain MGI:4458493 Ryr2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99685 Ryr2 ryanodine receptor 2, cardiac https://www.infrafrontier.eu/search?keyword=EM:07322 + EM:09656 C57BL/6N-Ryr1/H EMMA sperm mutant strain MGI:4951021 Ryr1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99659 Ryr1 ryanodine receptor 1, skeletal muscle https://www.infrafrontier.eu/search?keyword=EM:09656 + EM:07947 C57BL/6N-Rxfp2/Ieg EMMA embryo C57BL/6N-Rxfp2/Hmgu mutant strain MGI:5548762 Rxfp2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2153463 Rxfp2 relaxin/insulin-like family peptide receptor 2 https://www.infrafrontier.eu/search?keyword=EM:07947 ? EM:14306 C57BL/6N-Rwdd1/WtsiOrl EMMA sperm mutant strain MGI:5637013 Rwdd1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913771 Rwdd1 RWD domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:14306 + EM:11396 C57BL/6N-Runx1t1/H EMMA sperm mutant strain MGI:4881046 Runx1t1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104793 Runx1t1 RUNX1 translocation partner 1 https://www.infrafrontier.eu/search?keyword=EM:11396 + EM:08942 C57BL/6N-Rundc1/WtsiOulu EMMA embryo mutant strain MGI:5548750 Rundc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2144506 Rundc1 RUN domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:08942 + EM:08942 C57BL/6N-Rundc1/WtsiOulu EMMA sperm mutant strain MGI:5548750 Rundc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2144506 Rundc1 RUN domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:08942 + EM:09027 C57BL/6N-Rtraf/Cnrm EMMA sperm mutant strain MGI:5585725 Rtraf targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1915295 Rtraf RNA transcription, translation and transport factor https://www.infrafrontier.eu/search?keyword=EM:09027 + EM:08397 C57BL/6N-Rtraf/Cnrm EMMA sperm mutant strain MGI:4455868 Rtraf targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915295 Rtraf RNA transcription, translation and transport factor https://www.infrafrontier.eu/search?keyword=EM:08397 - EM:06920 C57BL/6N-Rtn1/H EMMA sperm B6NTac;B6N-Rtn1/H mutant strain MGI:4880888 Rtn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933947 Rtn1 reticulon 1 https://www.infrafrontier.eu/search?keyword=EM:06920 ? EM:13818 C57BL/6N-Rsrc1/WtsiOulu EMMA embryo mutant strain MGI:6153607 Rsrc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914130 Rsrc1 arginine/serine-rich coiled-coil 1 https://www.infrafrontier.eu/search?keyword=EM:13818 ? EM:13818 C57BL/6N-Rsrc1/WtsiOulu EMMA sperm mutant strain MGI:6153607 Rsrc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914130 Rsrc1 arginine/serine-rich coiled-coil 1 https://www.infrafrontier.eu/search?keyword=EM:13818 - EM:05125 C57BL/6N-Rsbn1/H EMMA sperm mutant strain MGI:4433850 Rsbn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2444993 Rsbn1 rosbin, round spermatid basic protein 1 https://www.infrafrontier.eu/search?keyword=EM:05125 ? EM:14150 C57BL/6N-Rreb1/WtsiH EMMA live mutant strain MGI:5816878 Rreb1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443664 Rreb1 ras responsive element binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:14150 + EM:06932 C57BL/6N-Rptor/H EMMA sperm B6NTac;B6N-Rptor/H mutant strain MGI:4441657 Rptor targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1921620 Rptor regulatory associated protein of MTOR, complex 1 https://www.infrafrontier.eu/search?keyword=EM:06932 ? EM:13884 C57BL/6N-Rptn/WtsiOulu EMMA embryo mutant strain MGI:6336061 Rptn endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1099055 Rptn repetin https://www.infrafrontier.eu/search?keyword=EM:13884 ? EM:13884 C57BL/6N-Rptn/WtsiOulu EMMA sperm mutant strain MGI:6336061 Rptn endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1099055 Rptn repetin https://www.infrafrontier.eu/search?keyword=EM:13884 + EM:10136 C57BL/6N-Rps26/Ieg EMMA sperm mutant strain MGI:5692633 Rps26 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1351628 Rps26 ribosomal protein S26 https://www.infrafrontier.eu/search?keyword=EM:10136 + EM:10073 C57BL/6N-Rps26/Ieg EMMA sperm mutant strain MGI:5511742 Rps26 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:1351628 Rps26 ribosomal protein S26 https://www.infrafrontier.eu/search?keyword=EM:10073 + EM:10062 C57BL/6N-Rps19/Ph EMMA sperm mutant strain Rps19 Rps19 MGI:1333780 Rps19 ribosomal protein S19 https://www.infrafrontier.eu/search?keyword=EM:10062 + EM:10062 C57BL/6N-Rps19/Ph EMMA live mutant strain Rps19 Rps19 MGI:1333780 Rps19 ribosomal protein S19 https://www.infrafrontier.eu/search?keyword=EM:10062 - EM:04953 C57BL/6N-Rprd1b/H EMMA sperm mutant strain MGI:4435125 Rprd1b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917720 Rprd1b regulation of nuclear pre-mRNA domain containing 1B https://www.infrafrontier.eu/search?keyword=EM:04953 + EM:10139 C57BL/6N-Rpl32/Ieg EMMA sperm mutant strain MGI:5692914 Rpl32 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:98038 Rpl32 ribosomal protein L32 https://www.infrafrontier.eu/search?keyword=EM:10139 + EM:10078 C57BL/6N-Rpl32/Ieg EMMA sperm mutant strain MGI:4842059 Rpl32 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98038 Rpl32 ribosomal protein L32 https://www.infrafrontier.eu/search?keyword=EM:10078 + EM:09509 C57BL/6N-Rph3a/Ieg EMMA sperm mutant strain MGI:5588265 Rph3a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:102788 Rph3a rabphilin 3A https://www.infrafrontier.eu/search?keyword=EM:09509 + EM:08307 C57BL/6N-Rph3a/Ieg EMMA embryo mutant strain MGI:4946758 Rph3a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:102788 Rph3a rabphilin 3A https://www.infrafrontier.eu/search?keyword=EM:08307 - EM:04900 C57BL/6N-Rpe65/H EMMA sperm mutant strain MGI:4436481 Rpe65 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:98001 Rpe65 retinal pigment epithelium 65 https://www.infrafrontier.eu/search?keyword=EM:04900 + EM:08085 C57BL/6N-Rora/Ieg EMMA sperm mutant strain MGI:5548347 Rora targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104661 Rora RAR-related orphan receptor alpha https://www.infrafrontier.eu/search?keyword=EM:08085 + EM:07617 C57BL/6N-Ropn1l/WtsiCnrm EMMA sperm mutant strain MGI:5548780 Ropn1l targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2182357 Ropn1l ropporin 1-like https://www.infrafrontier.eu/search?keyword=EM:07617 + EM:08622 C57BL/6N-Rnls/Ieg EMMA sperm mutant strain MGI:4847877 Rnls targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915045 Rnls renalase, FAD-dependent amine oxidase https://www.infrafrontier.eu/search?keyword=EM:08622 - EM:06917 C57BL/6N-Rnf183/H EMMA sperm B6NTac;B6N-Rnf183/H mutant strain MGI:4419200 Rnf183 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923322 Rnf183 ring finger protein 183 https://www.infrafrontier.eu/search?keyword=EM:06917 - EM:05310 C57BL/6N-Rnf169/H EMMA sperm B6NTac;B6N-Rnf169/H mutant strain MGI:4452734 Rnf169 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920257 Rnf169 ring finger protein 169 https://www.infrafrontier.eu/search?keyword=EM:05310 ? EM:14174 C57BL/6N-Rnf157/WtsiH EMMA live mutant strain MGI:5637139 Rnf157 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442484 Rnf157 ring finger protein 157 https://www.infrafrontier.eu/search?keyword=EM:14174 ? EM:14580 C57BL/6N-Rnf145/WtsiPh EMMA sperm mutant strain MGI:6153606 Rnf145 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921565 Rnf145 ring finger protein 145 https://www.infrafrontier.eu/search?keyword=EM:14580 ? EM:14347 C57BL/6N-Rnf138/WtsiOrl EMMA sperm mutant strain MGI:5692757 Rnf138 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1929211 Rnf138 ring finger protein 138 https://www.infrafrontier.eu/search?keyword=EM:14347 ? EM:13858 C57BL/6N-Rnf114/WtsiPh EMMA sperm mutant strain MGI:6153605 Rnf114 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1933159 Rnf114 ring finger protein 114 https://www.infrafrontier.eu/search?keyword=EM:13858 ? EM:14160 C57BL/6N-Rnasek/WtsiIeg EMMA sperm mutant strain MGI:5636901 Rnasek targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106369 Rnasek ribonuclease, RNase K https://www.infrafrontier.eu/search?keyword=EM:14160 + EM:09880 C57BL/6N-Rnase10/Cnrm EMMA sperm mutant strain MGI:5812264 Rnase10 targeted mutation 1, Wellcome Trust Sanger Institute MGI:1922269 Rnase10 ribonuclease, RNase A family, 10 (non-active) https://www.infrafrontier.eu/search?keyword=EM:09880 + EM:06799 C57BL/6N-Rlbp1/H EMMA sperm B6NTac;B6N-Rlbp1/H mutant strain MGI:4462637 Rlbp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97930 Rlbp1 retinaldehyde binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:06799 + EM:11153 C57BL/6N-Rimbp2/WtsiH EMMA sperm mutant strain MGI:6153603 Rimbp2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2443235 Rimbp2 RIMS binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:11153 + EM:08417 C57BL/6N-Rilpl1/Ieg EMMA sperm mutant strain MGI:5548660 Rilpl1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1922945 Rilpl1 Rab interacting lysosomal protein-like 1 https://www.infrafrontier.eu/search?keyword=EM:08417 + EM:08410 C57BL/6N-Rilpl1/Ieg EMMA embryo mutant strain MGI:4946743 Rilpl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1922945 Rilpl1 Rab interacting lysosomal protein-like 1 https://www.infrafrontier.eu/search?keyword=EM:08410 - EM:05280 C57BL/6N-Ric8b/Cnrm EMMA embryo mutant strain MGI:4434606 Ric8b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2682307 Ric8b RIC8 guanine nucleotide exchange factor B https://www.infrafrontier.eu/search?keyword=EM:05280 - EM:05280 C57BL/6N-Ric8b/Cnrm EMMA sperm mutant strain MGI:4434606 Ric8b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2682307 Ric8b RIC8 guanine nucleotide exchange factor B https://www.infrafrontier.eu/search?keyword=EM:05280 + EM:04954 C57BL/6N-Ric1/H EMMA sperm B6NTac;B6N-Rica/H, B6NTac;B6N-Ric1/H, B6NTac;B6N-C030046E11Rik/H mutant strain MGI:4435468 Ric1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924893 Ric1 RAB6A GEF complex partner 1 https://www.infrafrontier.eu/search?keyword=EM:04954 + EM:07952 C57BL/6N-Rhox13/WtsiCnrm EMMA sperm mutant strain MGI:5548634 Rhox13 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1920864 Rhox13 reproductive homeobox 13 https://www.infrafrontier.eu/search?keyword=EM:07952 - EM:05008 C57BL/6N-Rhbdl3/H EMMA sperm mutant strain MGI:4433810 Rhbdl3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2179276 Rhbdl3 rhomboid like 3 https://www.infrafrontier.eu/search?keyword=EM:05008 ? EM:13925 C57BL/6N-Rhbdf2/WtsiCnbc EMMA sperm mutant strain MGI:6153755 Rhbdf2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2442473 Rhbdf2 rhomboid 5 homolog 2 https://www.infrafrontier.eu/search?keyword=EM:13925 + EM:06944 C57BL/6N-Rgs5/H EMMA sperm B6NTac;B6N-Rgs5/H mutant strain MGI:4432511 Rgs5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098434 Rgs5 regulator of G-protein signaling 5 https://www.infrafrontier.eu/search?keyword=EM:06944 ? EM:13216 C57BL/6N-Rgs1/WtsiH EMMA live mutant strain Rgs1 EUCOMM targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1354694 Rgs1 regulator of G-protein signaling 1 https://www.infrafrontier.eu/search?keyword=EM:13216 + EM:10740 C57BL/6N-Rgs16/H EMMA archived mutant strain MGI:5790638 Rgs16 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:108407 Rgs16 regulator of G-protein signaling 16 https://www.infrafrontier.eu/search?keyword=EM:10740 + EM:09347 C57BL/6N-Rfxank/Ieg EMMA sperm mutant strain MGI:5614696 Rfxank targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1333865 Rfxank regulatory factor X-associated ankyrin-containing protein https://www.infrafrontier.eu/search?keyword=EM:09347 + EM:08465 C57BL/6N-Rfxank/Ieg EMMA embryo mutant strain MGI:5008000 Rfxank targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1333865 Rfxank regulatory factor X-associated ankyrin-containing protein https://www.infrafrontier.eu/search?keyword=EM:08465 + EM:09831 C57BL/6N-Rfx7/H EMMA sperm mutant strain MGI:5692823 Rfx7 targeted mutation 2c, Helmholtz Zentrum Muenchen GmbH MGI:2442675 Rfx7 regulatory factor X, 7 https://www.infrafrontier.eu/search?keyword=EM:09831 - EM:07804 C57BL/6N-Rfx7/H EMMA sperm mutant strain MGI:5511570 Rfx7 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2442675 Rfx7 regulatory factor X, 7 https://www.infrafrontier.eu/search?keyword=EM:07804 ? EM:13707 C57BL/6N-Rexo5/WtsiOrl EMMA sperm mutant strain MGI:6153602 Rexo5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919402 Rexo5 RNA exonuclease 5 https://www.infrafrontier.eu/search?keyword=EM:13707 - EM:07596 C57BL/6N-Rexo2/H EMMA sperm mutant strain MGI:4433994 Rexo2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1888981 Rexo2 RNA exonuclease 2 https://www.infrafrontier.eu/search?keyword=EM:07596 + EM:08072 C57BL/6N-Rest/Ieg EMMA sperm mutant strain MGI:5692555 Rest targeted mutation 2b, Wellcome Trust Sanger Institute MGI:104897 Rest RE1-silencing transcription factor https://www.infrafrontier.eu/search?keyword=EM:08072 + EM:07990 C57BL/6N-Rel/H EMMA sperm B6NTac;B6N-Rel/H mutant strain MGI:4441649 Rel targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97897 Rel reticuloendotheliosis oncogene https://www.infrafrontier.eu/search?keyword=EM:07990 + EM:13681 C57BL/6N-Reg4/H EMMA live mutant strain MGI:4887647 Reg4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914959 Reg4 regenerating islet-derived family, member 4 https://www.infrafrontier.eu/search?keyword=EM:13681 ? EM:14522 C57BL/6N-Reg3d/WtsiH EMMA live mutant strain MGI:5636985 Reg3d targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1353426 Reg3d regenerating islet-derived 3 delta https://www.infrafrontier.eu/search?keyword=EM:14522 + EM:09246 C57BL/6N-Rcn1/Ieg EMMA sperm mutant strain MGI:5613634 Rcn1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:104559 Rcn1 reticulocalbin 1 https://www.infrafrontier.eu/search?keyword=EM:09246 + EM:08247 C57BL/6N-Rcn1/Ieg EMMA sperm mutant strain MGI:4841832 Rcn1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:104559 Rcn1 reticulocalbin 1 https://www.infrafrontier.eu/search?keyword=EM:08247 - EM:07113 C57BL/6N-Rcc2/H EMMA sperm mutant strain MGI:4453694 Rcc2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919784 Rcc2 regulator of chromosome condensation 2 https://www.infrafrontier.eu/search?keyword=EM:07113 ? EM:14460 C57BL/6N-Rbms3/WtsiOulu EMMA embryo mutant strain MGI:6281925 Rbms3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2444477 Rbms3 RNA binding motif, single stranded interacting protein https://www.infrafrontier.eu/search?keyword=EM:14460 ? EM:14460 C57BL/6N-Rbms3/WtsiOulu EMMA sperm mutant strain MGI:6281925 Rbms3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2444477 Rbms3 RNA binding motif, single stranded interacting protein https://www.infrafrontier.eu/search?keyword=EM:14460 - EM:07797 C57BL/6N-Rbms1/H EMMA sperm mutant strain MGI:4433622 Rbms1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1861774 Rbms1 RNA binding motif, single stranded interacting protein 1 https://www.infrafrontier.eu/search?keyword=EM:07797 ? EM:13440 C57BL/6N-Rbm7/WtsiCnrm EMMA live mutant strain MGI:6257449 Rbm7 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914260 Rbm7 RNA binding motif protein 7 https://www.infrafrontier.eu/search?keyword=EM:13440 ? EM:14289 C57BL/6N-Rbm33/WtsiCnbc EMMA archived mutant strain MGI:5637065 Rbm33 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919670 Rbm33 RNA binding motif protein 33 https://www.infrafrontier.eu/search?keyword=EM:14289 ? EM:14552 C57BL/6N-Rbm24/WtsiCnbc EMMA embryo mutant strain MGI:6153601 Rbm24 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3610364 Rbm24 RNA binding motif protein 24 https://www.infrafrontier.eu/search?keyword=EM:14552 ? EM:14552 C57BL/6N-Rbm24/WtsiCnbc EMMA sperm mutant strain MGI:6153601 Rbm24 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3610364 Rbm24 RNA binding motif protein 24 https://www.infrafrontier.eu/search?keyword=EM:14552 ? EM:14445 C57BL/6N-Rbm17/WtsiCnbc EMMA sperm mutant strain MGI:6257515 Rbm17 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1924188 Rbm17 RNA binding motif protein 17 https://www.infrafrontier.eu/search?keyword=EM:14445 + EM:10108 C57BL/6N-Rbl1/Ieg EMMA sperm mutant strain MGI:5692547 Rbl1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:103300 Rbl1 RB transcriptional corepressor like 1 https://www.infrafrontier.eu/search?keyword=EM:10108 ? EM:14224 C57BL/6N-Rbak/WtsiIeg EMMA sperm mutant strain MGI:5637097 Rbak targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1927369 Rbak RB-associated KRAB zinc finger https://www.infrafrontier.eu/search?keyword=EM:14224 ? EM:13752 C57BL/6N-Rasgrp3/WtsiIeg EMMA sperm mutant strain MGI:6153600 Rasgrp3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3028579 Rasgrp3 RAS, guanyl releasing protein 3 https://www.infrafrontier.eu/search?keyword=EM:13752 ? EM:14431 C57BL/6N-Rarres1/WtsiOulu EMMA embryo mutant strain MGI:6281923 Rarres1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1924461 Rarres1 retinoic acid receptor responder (tazarotene induced) 1 https://www.infrafrontier.eu/search?keyword=EM:14431 ? EM:14431 C57BL/6N-Rarres1/WtsiOulu EMMA sperm mutant strain MGI:6281923 Rarres1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1924461 Rarres1 retinoic acid receptor responder (tazarotene induced) 1 https://www.infrafrontier.eu/search?keyword=EM:14431 + EM:07839 C57BL/6N-Rapsn/H EMMA sperm B6NTac;B6N-Rapsn/H mutant strain MGI:4433819 Rapsn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99422 Rapsn receptor-associated protein of the synapse https://www.infrafrontier.eu/search?keyword=EM:07839 ? EM:14282 C57BL/6N-Raph1/WtsiIeg EMMA sperm mutant strain MGI:5637089 Raph1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924550 Raph1 Ras association (RalGDS/AF-6) and pleckstrin homology domains 1 https://www.infrafrontier.eu/search?keyword=EM:14282 - EM:07401 C57BL/6N-Ramp1/H EMMA sperm B6NTac;B6N-Ramp1/H, EPD0843_4_B11 mutant strain MGI:5286381 Ramp1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858418 Ramp1 receptor (calcitonin) activity modifying protein 1 https://www.infrafrontier.eu/search?keyword=EM:07401 + EM:09301 C57BL/6N-Raet1c/Ieg EMMA sperm mutant strain MGI:5548391 Raet1c targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:109431 Raet1c retinoic acid early transcript gamma https://www.infrafrontier.eu/search?keyword=EM:09301 + EM:08108 C57BL/6N-Raet1c/Ieg EMMA sperm B6NTac;B6N-Raet1c/Ieg mutant strain MGI:5008842 Raet1c targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109431 Raet1c retinoic acid early transcript gamma https://www.infrafrontier.eu/search?keyword=EM:08108 - EM:04743 C57BL/6N-Rabgap1/Cnrm EMMA embryo mutant strain MGI:4434702 Rabgap1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385139 Rabgap1 RAB GTPase activating protein 1 https://www.infrafrontier.eu/search?keyword=EM:04743 - EM:04743 C57BL/6N-Rabgap1/Cnrm EMMA sperm mutant strain MGI:4434702 Rabgap1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2385139 Rabgap1 RAB GTPase activating protein 1 https://www.infrafrontier.eu/search?keyword=EM:04743 + EM:08094 C57BL/6N-Rab35/Ieg EMMA embryo mutant strain MGI:5548685 Rab35 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1924657 Rab35 RAB35, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:08094 ? EM:14561 C57BL/6N-Rab30/WtsiCnbc EMMA embryo mutant strain MGI:6153599 Rab30 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1923235 Rab30 RAB30, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:14561 ? EM:14561 C57BL/6N-Rab30/WtsiCnbc EMMA sperm mutant strain MGI:6153599 Rab30 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1923235 Rab30 RAB30, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:14561 ? EM:13797 C57BL/6N-Rab28/WtsiOrl EMMA sperm mutant strain MGI:6315511 Rab28 endonuclease-mediated mutation 2, Wellcome Trust Sanger Institute MGI:1917285 Rab28 RAB28, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:13797 + EM:08807 C57BL/6N-Rab23/H EMMA sperm mutant strain MGI:4460477 Rab23 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99833 Rab23 RAB23, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:08807 ? EM:14502 C57BL/6N-Rab21/WtsiOulu EMMA embryo mutant strain MGI:5638577 Rab21 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:894308 Rab21 RAB21, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:14502 ? EM:14502 C57BL/6N-Rab21/WtsiOulu EMMA sperm mutant strain MGI:5638577 Rab21 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:894308 Rab21 RAB21, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:14502 + EM:11258 C57BL/6N-Rab1a/H EMMA sperm mutant strain MGI:4363435 Rab1a targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97842 Rab1a RAB1A, member RAS oncogene family https://www.infrafrontier.eu/search?keyword=EM:11258 ? EM:13753 C57BL/6N-Rab11fip2/WtsiIeg EMMA sperm mutant strain MGI:6281928 Rab11fip2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1922248 Rab11fip2 RAB11 family interacting protein 2 (class I) https://www.infrafrontier.eu/search?keyword=EM:13753 ? EM:14585 C57BL/6N-Pvr/WtsiCnbc EMMA sperm mutant strain MGI:6153598 Pvr endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107741 Pvr poliovirus receptor https://www.infrafrontier.eu/search?keyword=EM:14585 ? EM:14430 C57BL/6N-Pus10/WtsiOulu EMMA embryo mutant strain MGI:5701724 Pus10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1921717 Pus10 pseudouridylate synthase 10 https://www.infrafrontier.eu/search?keyword=EM:14430 ? EM:14430 C57BL/6N-Pus10/WtsiOulu EMMA sperm mutant strain MGI:5701724 Pus10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1921717 Pus10 pseudouridylate synthase 10 https://www.infrafrontier.eu/search?keyword=EM:14430 + EM:10888 C57BL/6N-Pts/H EMMA sperm mutant strain MGI:4944538 Pts targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1338783 Pts 6-pyruvoyl-tetrahydropterin synthase https://www.infrafrontier.eu/search?keyword=EM:10888 + EM:08359 C57BL/6N-Ptpn23/Ieg EMMA sperm mutant strain MGI:5567111 Ptpn23 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2144837 Ptpn23 protein tyrosine phosphatase, non-receptor type 23 https://www.infrafrontier.eu/search?keyword=EM:08359 + EM:08101 C57BL/6N-Ptpn23/Ieg EMMA sperm B6NTac;B6N-Ptpn23/Ieg mutant strain MGI:4434698 Ptpn23 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2144837 Ptpn23 protein tyrosine phosphatase, non-receptor type 23 https://www.infrafrontier.eu/search?keyword=EM:08101 + EM:10694 C57BL/6N-Ptk7/H EMMA sperm mutant strain MGI:5319349 Ptk7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918711 Ptk7 PTK7 protein tyrosine kinase 7 https://www.infrafrontier.eu/search?keyword=EM:10694 ? EM:13766 C57BL/6N-Ptk2b/WtsiIeg EMMA sperm mutant strain MGI:6153597 Ptk2b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:104908 Ptk2b PTK2 protein tyrosine kinase 2 beta https://www.infrafrontier.eu/search?keyword=EM:13766 + EM:09696 C57BL/6N-Psmc2/Ieg EMMA sperm mutant strain MGI:4841895 Psmc2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109555 Psmc2 proteasome (prosome, macropain) 26S subunit, ATPase 2 https://www.infrafrontier.eu/search?keyword=EM:09696 ? EM:13383 C57BL/6N-Psg29/WtsiCnrm EMMA live mutant strain MGI:6153596 Psg29 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891361 Psg29 pregnancy-specific beta-1-glycoprotein 29 https://www.infrafrontier.eu/search?keyword=EM:13383 ? EM:13921 C57BL/6N-Psg26/WtsiPh EMMA sperm mutant strain MGI:6153594 Psg26 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891358 Psg26 pregnancy-specific beta-1-glycoprotein 26 https://www.infrafrontier.eu/search?keyword=EM:13921 ? EM:13730 C57BL/6N-Psg25/WtsiOrl EMMA sperm mutant strain MGI:6153593 Psg25 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891357 Psg25 pregnancy-specific beta-1-glycoprotein 25 https://www.infrafrontier.eu/search?keyword=EM:13730 ? EM:13837 C57BL/6N-Psg22/WtsiPh EMMA sperm mutant strain MGI:6153592 Psg22 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891354 Psg22 pregnancy-specific beta-1-glycoprotein 22 https://www.infrafrontier.eu/search?keyword=EM:13837 ? EM:13870 C57BL/6N-Psg21/WtsiPh EMMA sperm mutant strain MGI:6153591 Psg21 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891353 Psg21 pregnancy-specific beta-1-glycoprotein 21 https://www.infrafrontier.eu/search?keyword=EM:13870 ? EM:13850 C57BL/6N-Psg20/WtsiPh EMMA sperm mutant strain MGI:6153590 Psg20 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891352 Psg20 pregnancy-specific beta-1-glycoprotein 20 https://www.infrafrontier.eu/search?keyword=EM:13850 ? EM:13871 C57BL/6N-Psg19/WtsiPh EMMA sperm mutant strain MGI:6153589 Psg19 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1347252 Psg19 pregnancy specific beta-1-glycoprotein 19 https://www.infrafrontier.eu/search?keyword=EM:13871 ? EM:13851 C57BL/6N-Psg18/WtsiPh EMMA sperm mutant strain MGI:6153588 Psg18 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1347251 Psg18 pregnancy specific beta-1-glycoprotein 18 https://www.infrafrontier.eu/search?keyword=EM:13851 + EM:11587 C57BL/6N-Psg17/WtsiIeg EMMA sperm mutant strain MGI:6140222 Psg17 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1347250 Psg17 pregnancy specific beta-1-glycoprotein 17 https://www.infrafrontier.eu/search?keyword=EM:11587 ? EM:14418 C57BL/6N-Prxl2b/WtsiH EMMA live mutant strain MGI:5779678 Prxl2b targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1913719 Prxl2b peroxiredoxin like 2B https://www.infrafrontier.eu/search?keyword=EM:14418 ? EM:14559 C57BL/6N-Prss53/WtsiCnbc EMMA sperm mutant strain MGI:6153264 Prss53 endonuclease mediated mutation 2, Wellcome Trust Sanger Institute MGI:2652890 Prss53 protease, serine 53 https://www.infrafrontier.eu/search?keyword=EM:14559 + EM:11580 C57BL/6N-Prss53/WtsiIeg EMMA sperm mutant strain MGI:6147557 Prss53 endonuclease mediated mutation 2, Wellcome Trust Sanger Institute MGI:2652890 Prss53 protease, serine 53 https://www.infrafrontier.eu/search?keyword=EM:11580 + EM:11762 C57BL/6N-Prss53/WtsiCnrm EMMA sperm mutant strain MGI:6140219 Prss53 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2652890 Prss53 protease, serine 53 https://www.infrafrontier.eu/search?keyword=EM:11762 - EM:05604 C57BL/6N-Prss50/H EMMA sperm mutant strain MGI:4455807 Prss50 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2447303 Prss50 protease, serine 50 https://www.infrafrontier.eu/search?keyword=EM:05604 ? EM:13532 C57BL/6N-Prrg2/WtsiKieg EMMA embryo mutant strain MGI:5548709 Prrg2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1929596 Prrg2 proline-rich Gla (G-carboxyglutamic acid) polypeptide 2 https://www.infrafrontier.eu/search?keyword=EM:13532 ? EM:13532 C57BL/6N-Prrg2/WtsiKieg EMMA sperm mutant strain MGI:5548709 Prrg2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1929596 Prrg2 proline-rich Gla (G-carboxyglutamic acid) polypeptide 2 https://www.infrafrontier.eu/search?keyword=EM:13532 ? EM:13873 C57BL/6N-Prr5l/WtsiCnbc EMMA sperm mutant strain MGI:6153587 Prr5l endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919696 Prr5l proline rich 5 like https://www.infrafrontier.eu/search?keyword=EM:13873 ? EM:13838 C57BL/6N-Prr14l/WtsiPh EMMA sperm mutant strain MGI:6153586 Prr14l endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2443658 Prr14l proline rich 14-like https://www.infrafrontier.eu/search?keyword=EM:13838 - EM:04943 C57BL/6N-Prph2/H EMMA sperm mutant strain MGI:4435174 Prph2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:102791 Prph2 peripherin 2 https://www.infrafrontier.eu/search?keyword=EM:04943 ? EM:13841 C57BL/6N-Prorp/WtsiOulu EMMA embryo mutant strain MGI:6281941 Prorp endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1913382 Prorp protein only RNase P catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:13841 ? EM:13841 C57BL/6N-Prorp/WtsiOulu EMMA sperm mutant strain MGI:6281941 Prorp endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1913382 Prorp protein only RNase P catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:13841 + EM:10735 C57BL/6N-Prmt1/H EMMA archived C57BL/6NTac-Prmt1/H mutant strain MGI:5587827 Prmt1 targeted mutation 1c, Welcome Trust Sanger Institute MGI:107846 Prmt1 protein arginine N-methyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:10735 - EM:09536 C57BL/6N-Prl4a1/Cnrm EMMA sperm mutant strain MGI:5633827 Prl4a1 targeted mutation 2, Wellcome Trust Sanger Institute MGI:1206587 Prl4a1 prolactin family 4, subfamily a, member 1 https://www.infrafrontier.eu/search?keyword=EM:09536 + EM:08524 C57BL/6N-Prkg1/H EMMA sperm mutant strain MGI:4454120 Prkg1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108174 Prkg1 protein kinase, cGMP-dependent, type I https://www.infrafrontier.eu/search?keyword=EM:08524 + EM:11965 C57BL/6N-Prkd3/Ieg EMMA sperm mutant strain MGI:4432250 Prkd3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1922542 Prkd3 protein kinase D3 https://www.infrafrontier.eu/search?keyword=EM:11965 ? EM:13709 C57BL/6N-Prkd1/WtsiOrl EMMA sperm mutant strain MGI:6153770 Prkd1 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:99879 Prkd1 protein kinase D1 https://www.infrafrontier.eu/search?keyword=EM:13709 ? EM:13690 C57BL/6N-Prkd1/WtsiOrl EMMA sperm mutant strain MGI:6153585 Prkd1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:99879 Prkd1 protein kinase D1 https://www.infrafrontier.eu/search?keyword=EM:13690 + EM:08365 C57BL/6N-Prkab2/H EMMA sperm mutant strain MGI:4946773 Prkab2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1336185 Prkab2 protein kinase, AMP-activated, beta 2 non-catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:08365 ? EM:14536 C57BL/6N-Prkab1/WtsiPh EMMA sperm mutant strain MGI:5501071 Prkab1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336167 Prkab1 protein kinase, AMP-activated, beta 1 non-catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:14536 + EM:09105 C57BL/6N-Prkab1/Ieg EMMA sperm mutant strain MGI:5501071 Prkab1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336167 Prkab1 protein kinase, AMP-activated, beta 1 non-catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:09105 + EM:08673 C57BL/6N-Prkaa2/H EMMA sperm mutant strain MGI:5318770 Prkaa2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1336173 Prkaa2 protein kinase, AMP-activated, alpha 2 catalytic subunit https://www.infrafrontier.eu/search?keyword=EM:08673 - EM:05832 C57BL/6N-Primpol/H EMMA sperm mutant strain MGI:4432243 Primpol targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3603756 Primpol primase and polymerase (DNA-directed) https://www.infrafrontier.eu/search?keyword=EM:05832 - EM:07869 C57BL/6N-Prelid2/H EMMA sperm EPD0656_6_A01, B6NTac;B6N-Prelid2/H mutant strain MGI:4842294 Prelid2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924869 Prelid2 PRELI domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:07869 ? EM:13886 C57BL/6N-Prdm8/WtsiCnbc EMMA sperm mutant strain MGI:6153584 Prdm8 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1924880 Prdm8 PR domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:13886 + EM:10148 C57BL/6N-Prdm4/H EMMA sperm mutant strain MGI:5692724 Prdm4 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1920093 Prdm4 PR domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:10148 + EM:06967 C57BL/6N-Prdm4/H EMMA sperm B6NTac;B6N-Prdm4/2H mutant strain MGI:4435837 Prdm4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920093 Prdm4 PR domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:06967 + EM:11242 C57BL/6N-Prdm16/WtsiH EMMA sperm mutant strain MGI:5633825 Prdm16 targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1917923 Prdm16 PR domain containing 16 https://www.infrafrontier.eu/search?keyword=EM:11242 + EM:09245 C57BL/6N-Prc1/Ieg EMMA sperm mutant strain MGI:5613643 Prc1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1858961 Prc1 protein regulator of cytokinesis 1 https://www.infrafrontier.eu/search?keyword=EM:09245 + EM:08513 C57BL/6N-Prc1/Ieg EMMA sperm mutant strain MGI:5294171 Prc1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1858961 Prc1 protein regulator of cytokinesis 1 https://www.infrafrontier.eu/search?keyword=EM:08513 ? EM:14210 C57BL/6N-Pramel15/WtsiIeg EMMA sperm mutant strain MGI:5637193 Pramel15 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3712553 Pramel15 PRAME like 15 https://www.infrafrontier.eu/search?keyword=EM:14210 + EM:07316 C57BL/6N-Pram1/H EMMA sperm B6NTac;B6N-Pram1/H mutant strain MGI:4461665 Pram1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3576625 Pram1 PML-RAR alpha-regulated adaptor molecule 1 https://www.infrafrontier.eu/search?keyword=EM:07316 + EM:10167 C57BL/6N-Ppy/Ieg EMMA sperm mutant strain MGI:5695979 Ppy targeted mutation 1b, Wellcome Trust Sanger Institute MGI:97753 Ppy pancreatic polypeptide https://www.infrafrontier.eu/search?keyword=EM:10167 - EM:07784 C57BL/6N-Ppt2/H EMMA sperm B6NTac;B6N-Ppt2/H mutant strain MGI:4841007 Ppt2 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1860075 Ppt2 palmitoyl-protein thioesterase 2 https://www.infrafrontier.eu/search?keyword=EM:07784 + EM:11031 C57BL/6N-Ppp4r3b/Ieg EMMA sperm mutant strain MGI:4847838 Ppp4r3b targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2144474 Ppp4r3b protein phosphatase 4 regulatory subunit 3B https://www.infrafrontier.eu/search?keyword=EM:11031 + EM:11577 C57BL/6N-Ppp1cc/WtsiOulu EMMA embryo mutant strain MGI:6140218 Ppp1cc endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:104872 Ppp1cc protein phosphatase 1 catalytic subunit gamma https://www.infrafrontier.eu/search?keyword=EM:11577 + EM:11577 C57BL/6N-Ppp1cc/WtsiOulu EMMA sperm mutant strain MGI:6140218 Ppp1cc endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:104872 Ppp1cc protein phosphatase 1 catalytic subunit gamma https://www.infrafrontier.eu/search?keyword=EM:11577 ? EM:13940 C57BL/6N-Ppm1d/WtsiCnbc EMMA sperm mutant strain MGI:6153754 Ppm1d endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1858214 Ppm1d protein phosphatase 1D magnesium-dependent, delta isoform https://www.infrafrontier.eu/search?keyword=EM:13940 - EM:06976 C57BL/6N-Ppm1a/H EMMA sperm B6NTac;B6N-Ppm1a/H mutant strain MGI:4458753 Ppm1a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:99878 Ppm1a protein phosphatase 1A, magnesium dependent, alpha isoform https://www.infrafrontier.eu/search?keyword=EM:06976 ? EM:14297 C57BL/6N-Ppil3/WtsiH EMMA live mutant strain MGI:5637044 Ppil3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1917475 Ppil3 peptidylprolyl isomerase (cyclophilin)-like 3 https://www.infrafrontier.eu/search?keyword=EM:14297 + EM:09631 C57BL/6N-Ppfia2/H EMMA sperm mutant strain MGI:4458715 Ppfia2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443834 Ppfia2 protein tyrosine phosphatase, receptor type, f polypeptide (PTPRF), interacting protein (liprin), alpha 2 https://www.infrafrontier.eu/search?keyword=EM:09631 + EM:10145 C57BL/6N-Pparg/H EMMA sperm mutant strain MGI:5692913 Pparg targeted mutation 1c, Wellcome Trust Sanger Institute MGI:97747 Pparg peroxisome proliferator activated receptor gamma https://www.infrafrontier.eu/search?keyword=EM:10145 - EM:07489 C57BL/6N-Pparg/H EMMA sperm B6NTac;B6N-Pparg/H mutant strain MGI:4419888 Pparg targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97747 Pparg peroxisome proliferator activated receptor gamma https://www.infrafrontier.eu/search?keyword=EM:07489 ? EM:14787 C57BL/6N-Pou6f1/WtsiCnbc EMMA sperm mutant strain MGI:6153583 Pou6f1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:102935 Pou6f1 POU domain, class 6, transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:14787 + EM:09662 C57BL/6N-Pon2/H EMMA sperm mutant strain MGI:4847743 Pon2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:106687 Pon2 paraoxonase 2 https://www.infrafrontier.eu/search?keyword=EM:09662 ? EM:13758 C57BL/6N-Polr2m/WtsiCnrm EMMA live mutant strain MGI:6336060 Polr2m endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107282 Polr2m polymerase (RNA) II (DNA directed) polypeptide M https://www.infrafrontier.eu/search?keyword=EM:13758 - EM:05202 C57BL/6N-Poln/Cnrm EMMA sperm mutant strain MGI:4435830 Poln targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2675617 Poln DNA polymerase N https://www.infrafrontier.eu/search?keyword=EM:05202 ? EM:14161 C57BL/6N-Pold3/WtsiIeg EMMA sperm mutant strain MGI:5637026 Pold3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915217 Pold3 polymerase (DNA-directed), delta 3, accessory subunit https://www.infrafrontier.eu/search?keyword=EM:14161 ? EM:13847 C57BL/6N-Pogk/WtsiCnbc EMMA sperm mutant strain MGI:6153582 Pogk endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1918842 Pogk pogo transposable element with KRAB domain https://www.infrafrontier.eu/search?keyword=EM:13847 + EM:09640 C57BL/6N-Pmel/Ieg EMMA sperm mutant strain MGI:5637220 Pmel targeted mutation 1b, Wellcome Trust Sanger Institute MGI:98301 Pmel premelanosome protein https://www.infrafrontier.eu/search?keyword=EM:09640 + EM:09637 C57BL/6N-Pmel/Ieg EMMA sperm mutant strain MGI:4441778 Pmel targeted mutation 1a, Wellcome Trust Sanger Institute MGI:98301 Pmel premelanosome protein https://www.infrafrontier.eu/search?keyword=EM:09637 ? EM:13689 C57BL/6N-Plxdc1/WtsiOrl EMMA sperm mutant strain MGI:6153581 Plxdc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919574 Plxdc1 plexin domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:13689 + EM:05336 C57BL/6N-Plpp3/Cnrm EMMA sperm STOCK Plpp3/Cnrm, STOCK Ppap2b/Cnrm mutant strain MGI:4451775 Plpp3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915166 Plpp3 phospholipid phosphatase 3 https://www.infrafrontier.eu/search?keyword=EM:05336 + EM:11214 C57BL/6N-Plet1/WtsiIeg EMMA sperm mutant strain MGI:6147556 Plet1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1923759 Plet1 placenta expressed transcript 1 https://www.infrafrontier.eu/search?keyword=EM:11214 ? EM:13759 C57BL/6N-Plekhf2/WtsiIeg EMMA sperm mutant strain MGI:6336059 Plekhf2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919051 Plekhf2 pleckstrin homology domain containing, family F (with FYVE domain) member 2 https://www.infrafrontier.eu/search?keyword=EM:13759 ? EM:13370 C57BL/6N-Plekhf1/WtsiCnrm EMMA live mutant strain MGI:6153580 Plekhf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919537 Plekhf1 pleckstrin homology domain containing, family F (with FYVE domain) member 1 https://www.infrafrontier.eu/search?keyword=EM:13370 + EM:11755 C57BL/6N-Plekha1/Ieg EMMA sperm mutant strain MGI:5501548 Plekha1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2442213 Plekha1 pleckstrin homology domain containing, family A (phosphoinositide binding specific) member 1 https://www.infrafrontier.eu/search?keyword=EM:11755 ? EM:14055 C57BL/6N-Plek/WtsiPh EMMA sperm mutant strain Plek EUCOMM targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1860485 Plek pleckstrin https://www.infrafrontier.eu/search?keyword=EM:14055 ? EM:13892 C57BL/6N-Plcg2/WtsiCnbc EMMA sperm mutant strain MGI:6153579 Plcg2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:97616 Plcg2 phospholipase C, gamma 2 https://www.infrafrontier.eu/search?keyword=EM:13892 - EM:07095 C57BL/6N-Plac9a/H EMMA sperm B6NTac;B6N-Plac9a/H, B6NTac;B6N-Plac9/H mutant strain MGI:4946775 Plac9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2663998 Plac9 placenta specific 9 https://www.infrafrontier.eu/search?keyword=EM:07095 + EM:09378 C57BL/6N-Plac8/Ieg EMMA sperm mutant strain MGI:5637155 Plac8 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2445289 Plac8 placenta-specific 8 https://www.infrafrontier.eu/search?keyword=EM:09378 + EM:09368 C57BL/6N-Plac8/Ieg EMMA sperm mutant strain MGI:4841670 Plac8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2445289 Plac8 placenta-specific 8 https://www.infrafrontier.eu/search?keyword=EM:09368 + EM:09779 C57BL/6N-Pla2g6/WtsiH EMMA sperm STOCK Pla2g6/WtsiH, Pla2g6-G04, MFZL mutant strain MGI:6209669 Pla2g6 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1859152 Pla2g6 phospholipase A2, group VI https://www.infrafrontier.eu/search?keyword=EM:09779 + EM:08473 C57BL/6N-Pla2g2e/Ieg EMMA sperm mutant strain MGI:5636980 Pla2g2e targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1349660 Pla2g2e phospholipase A2, group IIE https://www.infrafrontier.eu/search?keyword=EM:08473 + EM:08464 C57BL/6N-Pla2g2e/Ieg EMMA embryo mutant strain MGI:4432002 Pla2g2e targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1349660 Pla2g2e phospholipase A2, group IIE https://www.infrafrontier.eu/search?keyword=EM:08464 ? EM:14409 C57BL/6N-Pla2g2c/WtsiOulu EMMA embryo mutant strain MGI:5816875 Pla2g2c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106638 Pla2g2c phospholipase A2, group IIC https://www.infrafrontier.eu/search?keyword=EM:14409 ? EM:14409 C57BL/6N-Pla2g2c/WtsiOulu EMMA sperm mutant strain MGI:5816875 Pla2g2c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106638 Pla2g2c phospholipase A2, group IIC https://www.infrafrontier.eu/search?keyword=EM:14409 + EM:08414 C57BL/6N-Pla2g10/Ieg EMMA embryo mutant strain MGI:5548469 Pla2g10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1347522 Pla2g10 phospholipase A2, group X https://www.infrafrontier.eu/search?keyword=EM:08414 + EM:04720 C57BL/6N-Pla2g10/Ieg EMMA embryo B6NTac;B6N-Pla2g10/Ieg mutant strain MGI:4435080 Pla2g10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1347522 Pla2g10 phospholipase A2, group X https://www.infrafrontier.eu/search?keyword=EM:04720 + EM:09244 C57BL/6N-Pkn2/Ieg EMMA sperm mutant strain MGI:5613636 Pkn2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:109211 Pkn2 protein kinase N2 https://www.infrafrontier.eu/search?keyword=EM:09244 + EM:09415 C57BL/6N-Pkn2/Ieg EMMA sperm mutant strain MGI:4363870 Pkn2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109211 Pkn2 protein kinase N2 https://www.infrafrontier.eu/search?keyword=EM:09415 + EM:08420 C57BL/6N-Pkig/Ieg EMMA sperm mutant strain MGI:5636975 Pkig targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1343086 Pkig protein kinase inhibitor, gamma https://www.infrafrontier.eu/search?keyword=EM:08420 + EM:08457 C57BL/6N-Pkig/Ieg EMMA embryo mutant strain MGI:5014672 Pkig targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1343086 Pkig protein kinase inhibitor, gamma https://www.infrafrontier.eu/search?keyword=EM:08457 - EM:07006 C57BL/6N-Pkd2l2/H EMMA sperm B6NTac;B6N-Pkd2l2/H, C57BL/6N-Pkd2l2tm1a(EUCOMM)Wtsi/H, EPD0354_1_A07 mutant strain MGI:4432894 Pkd2l2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1858231 Pkd2l2 polycystic kidney disease 2-like 2 https://www.infrafrontier.eu/search?keyword=EM:07006 + EM:11574 C57BL/6N-Pitx1/WtsiIeg EMMA sperm mutant strain MGI:6140217 Pitx1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:107374 Pitx1 paired-like homeodomain transcription factor 1 https://www.infrafrontier.eu/search?keyword=EM:11574 + EM:10737 C57BL/6N-Pink1/H EMMA sperm mutant strain MGI:5637036 Pink1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916193 Pink1 PTEN induced putative kinase 1 https://www.infrafrontier.eu/search?keyword=EM:10737 - EM:07320 C57BL/6N-Pink1/H EMMA sperm mutant strain MGI:5008020 Pink1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916193 Pink1 PTEN induced putative kinase 1 https://www.infrafrontier.eu/search?keyword=EM:07320 ? EM:13872 C57BL/6N-Pilrb2/WtsiCnbc EMMA sperm mutant strain MGI:6153578 Pilrb2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2450535 Pilrb2 paired immunoglobin-like type 2 receptor beta 2 https://www.infrafrontier.eu/search?keyword=EM:13872 ? EM:13541 C57BL/6N-Pik3cg/WtsiKieg EMMA embryo mutant strain MGI:6149897 Pik3cg targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1353576 Pik3cg phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit gamma https://www.infrafrontier.eu/search?keyword=EM:13541 ? EM:13541 C57BL/6N-Pik3cg/WtsiKieg EMMA sperm mutant strain MGI:6149897 Pik3cg targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1353576 Pik3cg phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit gamma https://www.infrafrontier.eu/search?keyword=EM:13541 ? EM:14419 C57BL/6N-Pigl/WtsiIeg EMMA sperm mutant strain MGI:5637168 Pigl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2681271 Pigl phosphatidylinositol glycan anchor biosynthesis, class L https://www.infrafrontier.eu/search?keyword=EM:14419 ? EM:13932 C57BL/6N-Phip/WtsiCnbc EMMA sperm mutant strain MGI:6153577 Phip endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1932404 Phip pleckstrin homology domain interacting protein https://www.infrafrontier.eu/search?keyword=EM:13932 ? EM:13924 C57BL/6N-Phgdh/WtsiCnbc EMMA sperm mutant strain MGI:6153576 Phgdh endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1355330 Phgdh 3-phosphoglycerate dehydrogenase https://www.infrafrontier.eu/search?keyword=EM:13924 ? EM:14446 C57BL/6N-Phf8/WtsiCnbc EMMA sperm mutant strain MGI:6153728 Phf8 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:2444341 Phf8 PHD finger protein 8 https://www.infrafrontier.eu/search?keyword=EM:14446 ? EM:13378 C57BL/6N-Phf7/WtsiCnrm EMMA live mutant strain MGI:6153574 Phf7 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919088 Phf7 PHD finger protein 7 https://www.infrafrontier.eu/search?keyword=EM:13378 + EM:08412 C57BL/6N-Pgs1/Ieg EMMA sperm mutant strain MGI:5637078 Pgs1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1921701 Pgs1 phosphatidylglycerophosphate synthase 1 https://www.infrafrontier.eu/search?keyword=EM:08412 + EM:08407 C57BL/6N-Pgs1/Ieg EMMA embryo mutant strain MGI:4451871 Pgs1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921701 Pgs1 phosphatidylglycerophosphate synthase 1 https://www.infrafrontier.eu/search?keyword=EM:08407 ? EM:14253 C57BL/6N-Pgap2/WtsiH EMMA live mutant strain MGI:5637131 Pgap2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2385286 Pgap2 post-GPI attachment to proteins 2 https://www.infrafrontier.eu/search?keyword=EM:14253 + EM:10135 C57BL/6N-Pfkfb3/Ieg EMMA sperm mutant strain MGI:5692802 Pfkfb3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2181202 Pfkfb3 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 3 https://www.infrafrontier.eu/search?keyword=EM:10135 + EM:09829 C57BL/6N-Pfkfb3/Ieg EMMA sperm mutant strain MGI:4441922 Pfkfb3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2181202 Pfkfb3 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 3 https://www.infrafrontier.eu/search?keyword=EM:09829 - EM:05837 C57BL/6N-Pex1/Cnrm EMMA sperm mutant strain MGI:4458786 Pex1 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:1918632 Pex1 peroxisomal biogenesis factor 1 https://www.infrafrontier.eu/search?keyword=EM:05837 + EM:10465 C57BL/6N-Per2/H EMMA sperm mutant strain MGI:5752545 Per2 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1195265 Per2 period circadian clock 2 https://www.infrafrontier.eu/search?keyword=EM:10465 + EM:04827 C57BL/6N-Per2/H EMMA sperm B6NTac;B6N-Per2/H mutant strain MGI:4436072 Per2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1195265 Per2 period circadian clock 2 https://www.infrafrontier.eu/search?keyword=EM:04827 + EM:08468 C57BL/6N-Pef1/Ieg EMMA sperm mutant strain MGI:5614701 Pef1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1915148 Pef1 penta-EF hand domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:08468 ? EM:13746 C57BL/6N-Pdzrn4/WtsiOrl EMMA live mutant strain MGI:6257816 Pdzrn4 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:3056996 Pdzrn4 PDZ domain containing RING finger 4 https://www.infrafrontier.eu/search?keyword=EM:13746 ? EM:14527 C57BL/6N-Pdzk1/WtsiOulu EMMA embryo mutant strain MGI:5692756 Pdzk1 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1928901 Pdzk1 PDZ domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:14527 ? EM:14527 C57BL/6N-Pdzk1/WtsiOulu EMMA sperm mutant strain MGI:5692756 Pdzk1 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1928901 Pdzk1 PDZ domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:14527 ? EM:14234 C57BL/6N-Pdzd8/WtsiH EMMA live mutant strain MGI:5708255 Pdzd8 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2677270 Pdzd8 PDZ domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:14234 + EM:09324 C57BL/6N-Pdss2/H EMMA sperm mutant strain MGI:4946711 Pdss2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918615 Pdss2 prenyl (solanesyl) diphosphate synthase, subunit 2 https://www.infrafrontier.eu/search?keyword=EM:09324 + EM:09046 C57BL/6N-Pdpn/H EMMA sperm mutant strain MGI:5692543 Pdpn targeted mutation 1c, Wellcome Trust Sanger Institute MGI:103098 Pdpn podoplanin https://www.infrafrontier.eu/search?keyword=EM:09046 + EM:06983 C57BL/6N-Pdpn/H EMMA sperm B6NTac;B6N-Pdpn/H mutant strain MGI:4842558 Pdpn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:103098 Pdpn podoplanin https://www.infrafrontier.eu/search?keyword=EM:06983 + EM:11894 C57BL/6N-Pdlim1/WtsiH EMMA sperm mutant strain MGI:6153573 Pdlim1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1860611 Pdlim1 PDZ and LIM domain 1 (elfin) https://www.infrafrontier.eu/search?keyword=EM:11894 + EM:09298 C57BL/6N-Pdia6/Ieg EMMA sperm mutant strain MGI:5605786 Pdia6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1919103 Pdia6 protein disulfide isomerase associated 6 https://www.infrafrontier.eu/search?keyword=EM:09298 ? EM:13656 C57BL/6N-Pdia4/WtsiH EMMA live mutant strain MGI:5636896 Pdia4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104864 Pdia4 protein disulfide isomerase associated 4 https://www.infrafrontier.eu/search?keyword=EM:13656 + EM:09243 C57BL/6N-Pdhx/Ieg EMMA sperm mutant strain MGI:5613640 Pdhx targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1351627 Pdhx pyruvate dehydrogenase complex, component X https://www.infrafrontier.eu/search?keyword=EM:09243 + EM:08382 C57BL/6N-Pdgfrb/H EMMA sperm mutant strain MGI:4841570 Pdgfrb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97531 Pdgfrb platelet derived growth factor receptor, beta polypeptide https://www.infrafrontier.eu/search?keyword=EM:08382 + EM:11374 C57BL/6N-Pdgfc/Ieg EMMA sperm mutant strain MGI:4435567 Pdgfc targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1859631 Pdgfc platelet-derived growth factor, C polypeptide https://www.infrafrontier.eu/search?keyword=EM:11374 + EM:10833 C57BL/6N-Pde8a/H EMMA sperm mutant strain MGI:4941557 Pde8a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1277116 Pde8a phosphodiesterase 8A https://www.infrafrontier.eu/search?keyword=EM:10833 + EM:08956 C57BL/6N-Pdcd5/Biat EMMA sperm mutant strain MGI:4951313 Pdcd5 targeted mutation 1, Velocigene MGI:1913538 Pdcd5 programmed cell death 5 https://www.infrafrontier.eu/search?keyword=EM:08956 ? EM:14165 C57BL/6N-Pdcd2/WtsiIeg EMMA sperm mutant strain MGI:5636894 Pdcd2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:104643 Pdcd2 programmed cell death 2 https://www.infrafrontier.eu/search?keyword=EM:14165 + EM:08090 C57BL/6N-Pcx/Ieg EMMA embryo C57BL/6N-Pcx/Hmgu mutant strain MGI:5548959 Pcx targeted mutation 1b, Wellcome Trust Sanger Institute MGI:97520 Pcx pyruvate carboxylase https://www.infrafrontier.eu/search?keyword=EM:08090 + EM:09641 C57BL/6N-Pcsk9/Ieg EMMA sperm mutant strain MGI:5637110 Pcsk9 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2140260 Pcsk9 proprotein convertase subtilisin/kexin type 9 https://www.infrafrontier.eu/search?keyword=EM:09641 + EM:09064 C57BL/6N-Pcsk9/Ieg EMMA sperm mutant strain MGI:5511776 Pcsk9 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2140260 Pcsk9 proprotein convertase subtilisin/kexin type 9 https://www.infrafrontier.eu/search?keyword=EM:09064 + EM:04708 C57BL/6N-Pcnx3/Cnrm EMMA embryo B6NDen;B6N-Pcnxl3/Cnrm, C57BL/6N-Pcnxl3/Cnrm, HEPD0534_9_H10, B6Dnk;B6N-Pcnxl3/Cnrm mutant strain MGI:4434701 Pcnx3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1861733 Pcnx3 pecanex homolog 3 https://www.infrafrontier.eu/search?keyword=EM:04708 + EM:04708 C57BL/6N-Pcnx3/Cnrm EMMA sperm B6NDen;B6N-Pcnxl3/Cnrm, C57BL/6N-Pcnxl3/Cnrm, HEPD0534_9_H10, B6Dnk;B6N-Pcnxl3/Cnrm mutant strain MGI:4434701 Pcnx3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1861733 Pcnx3 pecanex homolog 3 https://www.infrafrontier.eu/search?keyword=EM:04708 + EM:09398 C57BL/6N-Pced1a/WtsiOrl EMMA sperm mutant strain MGI:5548804 Pced1a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442177 Pced1a PC-esterase domain containing 1A https://www.infrafrontier.eu/search?keyword=EM:09398 ? EM:14550 C57BL/6N-Pcdh7/WtsiOulu EMMA embryo mutant strain MGI:6281098 Pcdh7 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1860487 Pcdh7 protocadherin 7 https://www.infrafrontier.eu/search?keyword=EM:14550 ? EM:14550 C57BL/6N-Pcdh7/WtsiOulu EMMA sperm mutant strain MGI:6281098 Pcdh7 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1860487 Pcdh7 protocadherin 7 https://www.infrafrontier.eu/search?keyword=EM:14550 ? EM:13926 C57BL/6N-Pcdh1/WtsiCnbc EMMA sperm mutant strain MGI:6153572 Pcdh1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:104692 Pcdh1 protocadherin 1 https://www.infrafrontier.eu/search?keyword=EM:13926 ? EM:13880 C57BL/6N-Pcdh15/WtsiCnbc EMMA sperm mutant strain MGI:6153753 Pcdh15 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891428 Pcdh15 protocadherin 15 https://www.infrafrontier.eu/search?keyword=EM:13880 - EM:08416 C57BL/6N-Pbrm1/Ieg EMMA sperm mutant strain MGI:5548674 Pbrm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923998 Pbrm1 polybromo 1 https://www.infrafrontier.eu/search?keyword=EM:08416 + EM:10134 C57BL/6N-Pax5/Ieg EMMA sperm mutant strain MGI:5692910 Pax5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:97489 Pax5 paired box 5 https://www.infrafrontier.eu/search?keyword=EM:10134 - EM:07871 C57BL/6N-Pawr/H EMMA sperm B6NTac;B6N-Pawr/H mutant strain MGI:4888921 Pawr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2149961 Pawr PRKC, apoptosis, WT1, regulator https://www.infrafrontier.eu/search?keyword=EM:07871 ? EM:13864 C57BL/6N-Parn/WtsiCnbc EMMA sperm mutant strain MGI:6153570 Parn endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921358 Parn poly(A)-specific ribonuclease (deadenylation nuclease) https://www.infrafrontier.eu/search?keyword=EM:13864 + EM:09120 C57BL/6N-Pard3b/Ieg EMMA sperm mutant strain MGI:5588280 Pard3b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1919301 Pard3b par-3 family cell polarity regulator beta https://www.infrafrontier.eu/search?keyword=EM:09120 + EM:08123 C57BL/6N-Pard3b/Ieg EMMA embryo B6NTac;B6N-Pard3b/Ieg mutant strain MGI:4441664 Pard3b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919301 Pard3b par-3 family cell polarity regulator beta https://www.infrafrontier.eu/search?keyword=EM:08123 - EM:07836 C57BL/6N-Pard3/H EMMA sperm B6NTac;B6N-Pard3/H mutant strain MGI:4364353 Pard3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2135608 Pard3 par-3 family cell polarity regulator https://www.infrafrontier.eu/search?keyword=EM:07836 + EM:08752 C57BL/6N-Paox/Ieg EMMA sperm mutant strain MGI:5548591 Paox targeted mutation 1.1, Wellcome Trust Sanger Institute MGI:1916983 Paox polyamine oxidase (exo-N4-amino) https://www.infrafrontier.eu/search?keyword=EM:08752 + EM:07443 C57BL/6N-Paox/Ieg EMMA embryo mutant strain MGI:4363510 Paox targeted mutation 1, Wellcome Trust Sanger Institute MGI:1916983 Paox polyamine oxidase (exo-N4-amino) https://www.infrafrontier.eu/search?keyword=EM:07443 ? EM:14140 C57BL/6N-Pam16/WtsiCnbc EMMA archived mutant strain MGI:5637011 Pam16 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913699 Pam16 presequence translocase-asssociated motor 16 https://www.infrafrontier.eu/search?keyword=EM:14140 ? EM:13380 C57BL/6N-Palm/WtsiCnrm EMMA live mutant strain MGI:6153569 Palm endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1261814 Palm paralemmin https://www.infrafrontier.eu/search?keyword=EM:13380 + EM:10463 C57BL/6N-Pak1/H EMMA sperm mutant strain MGI:5752547 Pak1 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1339975 Pak1 p21 (RAC1) activated kinase 1 https://www.infrafrontier.eu/search?keyword=EM:10463 - EM:07474 C57BL/6N-Pak1/H EMMA sperm B6NTac;B6N-Pak1/H mutant strain MGI:4842016 Pak1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1339975 Pak1 p21 (RAC1) activated kinase 1 https://www.infrafrontier.eu/search?keyword=EM:07474 + EM:07909 C57BL/6N-P2rx7/Ieg EMMA embryo C57BL/6N-P2rx7/Hmgu mutant strain MGI:5548444 P2rx7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1339957 P2rx7 purinergic receptor P2X, ligand-gated ion channel, 7 https://www.infrafrontier.eu/search?keyword=EM:07909 + EM:05116 C57BL/6N-P2rx7/Ieg EMMA sperm B6NTac;B6N-P2rx7/Ieg mutant strain MGI:4432150 P2rx7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1339957 P2rx7 purinergic receptor P2X, ligand-gated ion channel, 7 https://www.infrafrontier.eu/search?keyword=EM:05116 - EM:07066 C57BL/6N-P2rx6/H EMMA sperm B6NTac;B6N-P2rx6/H mutant strain MGI:5050912 P2rx6 targeted mutation 2a, Wellcome Trust Sanger Institute MGI:1337113 P2rx6 purinergic receptor P2X, ligand-gated ion channel, 6 https://www.infrafrontier.eu/search?keyword=EM:07066 + EM:10131 C57BL/6N-P2rx5/Ieg EMMA sperm mutant strain MGI:5692770 P2rx5 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2137026 P2rx5 purinergic receptor P2X, ligand-gated ion channel, 5 https://www.infrafrontier.eu/search?keyword=EM:10131 + EM:09185 C57BL/6N-P2rx5/Ieg EMMA embryo mutant strain MGI:4841555 P2rx5 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2137026 P2rx5 purinergic receptor P2X, ligand-gated ion channel, 5 https://www.infrafrontier.eu/search?keyword=EM:09185 + EM:09045 C57BL/6N-P2rx4/H EMMA sperm mutant strain MGI:5708187 P2rx4 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1338859 P2rx4 purinergic receptor P2X, ligand-gated ion channel 4 https://www.infrafrontier.eu/search?keyword=EM:09045 + EM:07910 C57BL/6N-P2rx4/H EMMA live mutant strain MGI:5548440 P2rx4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1338859 P2rx4 purinergic receptor P2X, ligand-gated ion channel 4 https://www.infrafrontier.eu/search?keyword=EM:07910 - EM:06002 C57BL/6N-P2rx4/H EMMA sperm B6NTac;B6N-P2rx4/H mutant strain MGI:4944573 P2rx4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1338859 P2rx4 purinergic receptor P2X, ligand-gated ion channel 4 https://www.infrafrontier.eu/search?keyword=EM:06002 ? EM:14286 C57BL/6N-Otud7b/WtsiH EMMA live mutant strain MGI:5637162 Otud7b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2654703 Otud7b OTU domain containing 7B https://www.infrafrontier.eu/search?keyword=EM:14286 + EM:11053 C57BL/6N-Otud4/H EMMA sperm mutant strain MGI:5319342 Otud4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1098801 Otud4 OTU domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:11053 + EM:12646 C57BL/6N-Otp/H EMMA sperm mutant strain MGI:5008941 Otp targeted mutation 1a, Wellcome Trust Sanger Institute MGI:99835 Otp orthopedia homeobox https://www.infrafrontier.eu/search?keyword=EM:12646 ? EM:14440 C57BL/6N-Otof/WtsiCnbc EMMA sperm mutant strain MGI:6257766 Otof endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1891247 Otof otoferlin https://www.infrafrontier.eu/search?keyword=EM:14440 ? EM:13937 C57BL/6N-Ostn/WtsiCnbc EMMA sperm mutant strain MGI:6153568 Ostn endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2677164 Ostn osteocrin https://www.infrafrontier.eu/search?keyword=EM:13937 + EM:11035 C57BL/6N-Ostf1/Ieg EMMA sperm mutant strain MGI:5811626 Ostf1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:700012 Ostf1 osteoclast stimulating factor 1 https://www.infrafrontier.eu/search?keyword=EM:11035 + EM:09636 C57BL/6N-Ostf1/Ieg EMMA sperm mutant strain MGI:5052480 Ostf1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:700012 Ostf1 osteoclast stimulating factor 1 https://www.infrafrontier.eu/search?keyword=EM:09636 + EM:10122 C57BL/6N-Oscp1/Ieg EMMA sperm mutant strain MGI:5692692 Oscp1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1916308 Oscp1 organic solute carrier partner 1 https://www.infrafrontier.eu/search?keyword=EM:10122 + EM:09399 C57BL/6N-Oscp1/Ieg EMMA sperm mutant strain MGI:4881057 Oscp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1916308 Oscp1 organic solute carrier partner 1 https://www.infrafrontier.eu/search?keyword=EM:09399 + EM:10133 C57BL/6N-Osbpl11/Ieg EMMA sperm mutant strain MGI:5692785 Osbpl11 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2146553 Osbpl11 oxysterol binding protein-like 11 https://www.infrafrontier.eu/search?keyword=EM:10133 + EM:10074 C57BL/6N-Osbpl11/Ieg EMMA sperm mutant strain MGI:4847796 Osbpl11 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2146553 Osbpl11 oxysterol binding protein-like 11 https://www.infrafrontier.eu/search?keyword=EM:10074 + EM:08075 C57BL/6N-Oplah/Ieg EMMA sperm C57BL/6N-Oplah/Hmgu mutant strain MGI:5548658 Oplah targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1922725 Oplah 5-oxoprolinase (ATP-hydrolysing) https://www.infrafrontier.eu/search?keyword=EM:08075 + EM:08077 C57BL/6N-Odad3/Ieg EMMA sperm C57BL/6N-Ccdc151/Ieg mutant strain MGI:5548687 Odad3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1924859 Odad3 outer dynein arm docking complex subunit 3 https://www.infrafrontier.eu/search?keyword=EM:08077 + EM:12746 C57BL/6N-Odad3/Cnrm EMMA live C57BL/6N-Ccdc151/Cnrm mutant strain MGI:5548687 Odad3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1924859 Odad3 outer dynein arm docking complex subunit 3 https://www.infrafrontier.eu/search?keyword=EM:12746 + EM:05473 C57BL/6N-Odad3/Cnrm EMMA sperm C57BL/6N-Ccdc151/Cnrm mutant strain MGI:4455711 Odad3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1924859 Odad3 outer dynein arm docking complex subunit 3 https://www.infrafrontier.eu/search?keyword=EM:05473 + EM:11765 C57BL/6N-Oard1/WtsiCnrm EMMA sperm mutant strain MGI:6152739 Oard1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2146818 Oard1 O-acyl-ADP-ribose deacylase 1 https://www.infrafrontier.eu/search?keyword=EM:11765 + EM:05127 C57BL/6N-Nxpe5/H EMMA sperm mutant strain MGI:4433447 Nxpe5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3584036 Nxpe5 neurexophilin and PC-esterase domain family, member 5 https://www.infrafrontier.eu/search?keyword=EM:05127 + EM:08100 C57BL/6N-Nxn/Ieg EMMA sperm C57BL/6N-Nxn/Hmgu mutant strain MGI:5548389 Nxn targeted mutation 1b, Wellcome Trust Sanger Institute MGI:109331 Nxn nucleoredoxin https://www.infrafrontier.eu/search?keyword=EM:08100 ? EM:14308 C57BL/6N-Nutm2/WtsiIeg EMMA sperm mutant strain MGI:5637173 Nutm2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2685652 Nutm2 NUT family member 2 https://www.infrafrontier.eu/search?keyword=EM:14308 ? EM:14528 C57BL/6N-Nutm1/WtsiOulu EMMA embryo mutant strain MGI:5812926 Nutm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2661384 Nutm1 NUT midline carcinoma, family member 1 https://www.infrafrontier.eu/search?keyword=EM:14528 ? EM:14528 C57BL/6N-Nutm1/WtsiOulu EMMA sperm mutant strain MGI:5812926 Nutm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2661384 Nutm1 NUT midline carcinoma, family member 1 https://www.infrafrontier.eu/search?keyword=EM:14528 + EM:11375 C57BL/6N-Nup35/Ieg EMMA sperm mutant strain MGI:5008019 Nup35 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916732 Nup35 nucleoporin 35 https://www.infrafrontier.eu/search?keyword=EM:11375 ? EM:13836 C57BL/6N-Nudcd3/WtsiCnbc EMMA sperm mutant strain MGI:6153752 Nudcd3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2144158 Nudcd3 NudC domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:13836 ? EM:09632 C57BL/6N-Nucks1/Ieg EMMA embryo mutant strain MGI:4841942 Nucks1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1934811 Nucks1 nuclear casein kinase and cyclin-dependent kinase substrate 1 https://www.infrafrontier.eu/search?keyword=EM:09632 + EM:11226 C57BL/6N-Nubpl/WtsiIeg EMMA sperm mutant strain MGI:5775003 Nubpl targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1924076 Nubpl nucleotide binding protein-like https://www.infrafrontier.eu/search?keyword=EM:11226 ? EM:14541 C57BL/6N-Nubpl/WtsiOulu EMMA embryo mutant strain MGI:5548675 Nubpl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924076 Nubpl nucleotide binding protein-like https://www.infrafrontier.eu/search?keyword=EM:14541 ? EM:14541 C57BL/6N-Nubpl/WtsiOulu EMMA sperm mutant strain MGI:5548675 Nubpl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924076 Nubpl nucleotide binding protein-like https://www.infrafrontier.eu/search?keyword=EM:14541 + EM:09242 C57BL/6N-Nubp2/Ieg EMMA sperm mutant strain MGI:5613638 Nubp2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1347072 Nubp2 nucleotide binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:09242 + EM:08954 C57BL/6N-Nubp2/Ieg EMMA sperm mutant strain MGI:4460379 Nubp2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1347072 Nubp2 nucleotide binding protein 2 https://www.infrafrontier.eu/search?keyword=EM:08954 - EM:07446 C57BL/6N-Ntrk2/H EMMA sperm mutant strain MGI:4460486 Ntrk2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97384 Ntrk2 neurotrophic tyrosine kinase, receptor, type 2 https://www.infrafrontier.eu/search?keyword=EM:07446 + EM:10147 C57BL/6N-Ntrk1/H EMMA sperm mutant strain MGI:5692907 Ntrk1 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:97383 Ntrk1 neurotrophic tyrosine kinase, receptor, type 1 https://www.infrafrontier.eu/search?keyword=EM:10147 - EM:07342 C57BL/6N-Ntrk1/H EMMA sperm B6NTac;B6N-Ntrk1/H mutant strain MGI:4887687 Ntrk1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97383 Ntrk1 neurotrophic tyrosine kinase, receptor, type 1 https://www.infrafrontier.eu/search?keyword=EM:07342 + EM:11650 C57BL/6N-Nsun2/WtsiOulu EMMA embryo mutant strain MGI:5310947 Nsun2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:107252 Nsun2 NOL1/NOP2/Sun domain family member 2 https://www.infrafrontier.eu/search?keyword=EM:11650 + EM:11650 C57BL/6N-Nsun2/WtsiOulu EMMA sperm mutant strain MGI:5310947 Nsun2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:107252 Nsun2 NOL1/NOP2/Sun domain family member 2 https://www.infrafrontier.eu/search?keyword=EM:11650 ? EM:13751 C57BL/6N-Nsmce1/WtsiIeg EMMA sperm mutant strain MGI:6153567 Nsmce1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1914961 Nsmce1 NSE1 homolog, SMC5-SMC6 complex component https://www.infrafrontier.eu/search?keyword=EM:13751 + EM:09010 C57BL/6N-Nsd3/H EMMA sperm C57BL/6N-Whsc1l1/H mutant strain MGI:4434820 Nsd3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2142581 Nsd3 nuclear receptor binding SET domain protein 3 https://www.infrafrontier.eu/search?keyword=EM:09010 + EM:09544 C57BL/6N-Nrxn1/H EMMA sperm mutant strain MGI:5008771 Nrxn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1096391 Nrxn1 neurexin I https://www.infrafrontier.eu/search?keyword=EM:09544 ? EM:14784 C57BL/6N-Nrg4/WtsiCnbc EMMA sperm mutant strain MGI:6153566 Nrg4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1933833 Nrg4 neuregulin 4 https://www.infrafrontier.eu/search?keyword=EM:14784 ? EM:14213 C57BL/6N-Nrbp1/WtsiOulu EMMA embryo mutant strain MGI:5637124 Nrbp1 targeted mutation 3b, Wellcome Trust Sanger Institute MGI:2183436 Nrbp1 nuclear receptor binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:14213 ? EM:14213 C57BL/6N-Nrbp1/WtsiOulu EMMA sperm mutant strain MGI:5637124 Nrbp1 targeted mutation 3b, Wellcome Trust Sanger Institute MGI:2183436 Nrbp1 nuclear receptor binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:14213 + EM:10426 C57BL/6N-Nras/H EMMA sperm mutant strain MGI:5002952 Nras targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97376 Nras neuroblastoma ras oncogene https://www.infrafrontier.eu/search?keyword=EM:10426 + EM:09780 C57BL/6N-Nr4a1/Biat EMMA sperm mutant strain MGI:4432935 Nr4a1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1352454 Nr4a1 nuclear receptor subfamily 4, group A, member 1 https://www.infrafrontier.eu/search?keyword=EM:09780 ? EM:13691 C57BL/6N-Nr0b1/WtsiOrl EMMA embryo mutant strain MGI:6153726 Nr0b1 endonuclease mediated mutation 2, Wellcome Trust Sanger Insititute MGI:1352460 Nr0b1 nuclear receptor subfamily 0, group B, member 1 https://www.infrafrontier.eu/search?keyword=EM:13691 + EM:06125 C57BL/6N-Nptn/H EMMA sperm B6NTac;B6N-Nptn/H mutant strain MGI:4455733 Nptn targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108077 Nptn neuroplastin https://www.infrafrontier.eu/search?keyword=EM:06125 - EM:04739 C57BL/6N-Npc1/H EMMA sperm B6NTac;B6N-Npc1/H mutant strain MGI:4436617 Npc1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1097712 Npc1 NPC intracellular cholesterol transporter 1 https://www.infrafrontier.eu/search?keyword=EM:04739 ? EM:14323 C57BL/6N-Npat/WtsiIeg EMMA sperm mutant strain MGI:5636907 Npat targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107605 Npat nuclear protein in the AT region https://www.infrafrontier.eu/search?keyword=EM:14323 + EM:09421 C57BL/6N-Notch1/H EMMA sperm mutant strain MGI:4455755 Notch1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97363 Notch1 notch 1 https://www.infrafrontier.eu/search?keyword=EM:09421 + EM:10111 C57BL/6N-Nolc1/Ieg EMMA sperm mutant strain MGI:5692702 Nolc1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1918019 Nolc1 nucleolar and coiled-body phosphoprotein 1 https://www.infrafrontier.eu/search?keyword=EM:10111 + EM:10121 C57BL/6N-Nmt2/Ieg EMMA sperm mutant strain MGI:5692594 Nmt2 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1202298 Nmt2 N-myristoyltransferase 2 https://www.infrafrontier.eu/search?keyword=EM:10121 - EM:07781 C57BL/6N-Nlrp9b/H EMMA sperm B6NTac;B6N-Nlrp9b/H mutant strain MGI:4841142 Nlrp9b targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2675377 Nlrp9b NLR family, pyrin domain containing 9B https://www.infrafrontier.eu/search?keyword=EM:07781 + EM:08369 C57BL/6N-Nlrc4/H EMMA sperm mutant strain MGI:4841652 Nlrc4 targeted mutation 1e, Helmholtz Zentrum Muenchen GmbH MGI:3036243 Nlrc4 NLR family, CARD domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:08369 ? EM:14588 C57BL/6N-Nkain3/WtsiPh EMMA sperm mutant strain MGI:6153564 Nkain3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2444830 Nkain3 Na+/K+ transporting ATPase interacting 3 https://www.infrafrontier.eu/search?keyword=EM:14588 + EM:08808 C57BL/6N-Nisch/H EMMA sperm mutant strain MGI:5319353 Nisch targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1928323 Nisch nischarin https://www.infrafrontier.eu/search?keyword=EM:08808 ? EM:14162 C57BL/6N-Nipsnap3a/WtsiIeg EMMA sperm mutant strain MGI:5637068 Nipsnap3a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1920648 Nipsnap3a nipsnap homolog 3A https://www.infrafrontier.eu/search?keyword=EM:14162 + EM:10598 C57BL/6N-Ngfr/H EMMA archived mutant strain MGI:5637211 Ngfr targeted mutation 1b, Wellcome Trust Sanger Institute MGI:97323 Ngfr nerve growth factor receptor (TNFR superfamily, member 16) https://www.infrafrontier.eu/search?keyword=EM:10598 + EM:10120 C57BL/6N-Ngdn/Ieg EMMA sperm mutant strain MGI:5692691 Ngdn targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916216 Ngdn neuroguidin, EIF4E binding protein https://www.infrafrontier.eu/search?keyword=EM:10120 + EM:10064 C57BL/6N-Ngdn/Ieg EMMA sperm mutant strain MGI:5052489 Ngdn targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916216 Ngdn neuroguidin, EIF4E binding protein https://www.infrafrontier.eu/search?keyword=EM:10064 ? EM:13885 C57BL/6N-Nfkbiz/WtsiOulu EMMA embryo mutant strain MGI:6153562 Nfkbiz endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1931595 Nfkbiz nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, zeta https://www.infrafrontier.eu/search?keyword=EM:13885 ? EM:13885 C57BL/6N-Nfkbiz/WtsiOulu EMMA sperm mutant strain MGI:6153562 Nfkbiz endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1931595 Nfkbiz nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, zeta https://www.infrafrontier.eu/search?keyword=EM:13885 + EM:08106 C57BL/6N-Nfatc3/Ieg EMMA sperm C57BL/6N-Nfatc3/Hmgu mutant strain MGI:5548344 Nfatc3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:103296 Nfatc3 nuclear factor of activated T cells, cytoplasmic, calcineurin dependent 3 https://www.infrafrontier.eu/search?keyword=EM:08106 + EM:08102 C57BL/6N-Nfatc3/Ieg EMMA embryo B6NTac;B6N-Nfatc3/Ieg mutant strain MGI:5000351 Nfatc3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103296 Nfatc3 nuclear factor of activated T cells, cytoplasmic, calcineurin dependent 3 https://www.infrafrontier.eu/search?keyword=EM:08102 ? EM:14407 C57BL/6N-Nek3/WtsiIeg EMMA sperm mutant strain MGI:5636976 Nek3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1344371 Nek3 NIMA (never in mitosis gene a)-related expressed kinase 3 https://www.infrafrontier.eu/search?keyword=EM:14407 + EM:07339 C57BL/6N-Nedd4l/H EMMA sperm B6NTac;B6N-Nedd4l/H mutant strain MGI:4363447 Nedd4l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933754 Nedd4l neural precursor cell expressed, developmentally down-regulated gene 4-like https://www.infrafrontier.eu/search?keyword=EM:07339 + EM:08459 C57BL/6N-Nedd4/H EMMA sperm mutant strain MGI:5511569 Nedd4 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:97297 Nedd4 neural precursor cell expressed, developmentally down-regulated 4 https://www.infrafrontier.eu/search?keyword=EM:08459 ? EM:14271 C57BL/6N-Nebl/WtsiPh EMMA live mutant strain MGI:5692728 Nebl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921353 Nebl nebulette https://www.infrafrontier.eu/search?keyword=EM:14271 + EM:08470 C57BL/6N-Ndufs1/Ieg EMMA sperm mutant strain MGI:5548814 Ndufs1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2443241 Ndufs1 NADH:ubiquinone oxidoreductase core subunit S1 https://www.infrafrontier.eu/search?keyword=EM:08470 + EM:08460 C57BL/6N-Ndufs1/Ieg EMMA embryo mutant strain MGI:4843861 Ndufs1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2443241 Ndufs1 NADH:ubiquinone oxidoreductase core subunit S1 https://www.infrafrontier.eu/search?keyword=EM:08460 + EM:09311 C57BL/6N-Ndufb9/Ieg EMMA sperm mutant strain MGI:5637008 Ndufb9 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1913468 Ndufb9 NADH:ubiquinone oxidoreductase subunit B9 https://www.infrafrontier.eu/search?keyword=EM:09311 + EM:09291 C57BL/6N-Ndufb9/Ieg EMMA embryo mutant strain MGI:4841556 Ndufb9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913468 Ndufb9 NADH:ubiquinone oxidoreductase subunit B9 https://www.infrafrontier.eu/search?keyword=EM:09291 + EM:09291 C57BL/6N-Ndufb9/Ieg EMMA sperm mutant strain MGI:4841556 Ndufb9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1913468 Ndufb9 NADH:ubiquinone oxidoreductase subunit B9 https://www.infrafrontier.eu/search?keyword=EM:09291 ? EM:14500 C57BL/6N-Ndufb4/WtsiOulu EMMA embryo mutant strain MGI:6149899 Ndufb4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915444 Ndufb4 NADH:ubiquinone oxidoreductase subunit B4 https://www.infrafrontier.eu/search?keyword=EM:14500 ? EM:14500 C57BL/6N-Ndufb4/WtsiOulu EMMA sperm mutant strain MGI:6149899 Ndufb4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915444 Ndufb4 NADH:ubiquinone oxidoreductase subunit B4 https://www.infrafrontier.eu/search?keyword=EM:14500 + EM:08092 C57BL/6N-Ndufa8/Ieg EMMA embryo C57BL/6N-Ndufa8/Hmgu mutant strain MGI:5548563 Ndufa8 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1915625 Ndufa8 NADH:ubiquinone oxidoreductase subunit A8 https://www.infrafrontier.eu/search?keyword=EM:08092 + EM:10048 C57BL/6N-Ndufa10/Ieg EMMA sperm mutant strain MGI:6317360 Ndufa10 targeted mutation 1e.1, Helmholtz Zentrum Muenchen GmbH MGI:1914523 Ndufa10 NADH:ubiquinone oxidoreductase subunit A10 https://www.infrafrontier.eu/search?keyword=EM:10048 ? EM:13385 C57BL/6N-Ndrg2/WtsiCnrm EMMA live mutant strain MGI:6153561 Ndrg2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1352498 Ndrg2 N-myc downstream regulated gene 2 https://www.infrafrontier.eu/search?keyword=EM:13385 + EM:09864 C57BL/6N-Ndnf/Oulu EMMA embryo mutant strain MGI:4880569 Ndnf targeted mutation 1, Mammalian Functional Genomics Centre MGI:1915419 Ndnf neuron-derived neurotrophic factor https://www.infrafrontier.eu/search?keyword=EM:09864 + EM:09864 C57BL/6N-Ndnf/Oulu EMMA sperm mutant strain MGI:4880569 Ndnf targeted mutation 1, Mammalian Functional Genomics Centre MGI:1915419 Ndnf neuron-derived neurotrophic factor https://www.infrafrontier.eu/search?keyword=EM:09864 + EM:08069 C57BL/6N-Ndfip2/Ieg EMMA embryo C57BL/6N-Ndfip2/Hmgu mutant strain MGI:5548666 Ndfip2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1923523 Ndfip2 Nedd4 family interacting protein 2 https://www.infrafrontier.eu/search?keyword=EM:08069 + EM:05045 C57BL/6N-Ndfip2/Ieg EMMA embryo B6NTac;B6N-Ndfip2/Ieg mutant strain MGI:4436082 Ndfip2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923523 Ndfip2 Nedd4 family interacting protein 2 https://www.infrafrontier.eu/search?keyword=EM:05045 ? EM:14406 C57BL/6N-Nctc1/WtsiOrl EMMA sperm mutant strain Nctc1 Sanger Institute targeted mutation 1.1, William C. Skarnes MGI:1306816 Nctc1 non-coding transcript 1 https://www.infrafrontier.eu/search?keyword=EM:14406 + EM:09372 C57BL/6N-Ncoa3/H EMMA sperm mutant strain MGI:5008021 Ncoa3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1276535 Ncoa3 nuclear receptor coactivator 3 https://www.infrafrontier.eu/search?keyword=EM:09372 - EM:08188 C57BL/6N-Ncf4/H EMMA sperm B6NTac;B6N-Ncf4/H mutant strain MGI:4841143 Ncf4 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109186 Ncf4 neutrophil cytosolic factor 4 https://www.infrafrontier.eu/search?keyword=EM:08188 ? EM:14211 C57BL/6N-Ncf2/WtsiH EMMA live mutant strain MGI:6149902 Ncf2 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:97284 Ncf2 neutrophil cytosolic factor 2 https://www.infrafrontier.eu/search?keyword=EM:14211 ? EM:13843 C57BL/6N-Ncapd3/WtsiCnbc EMMA sperm mutant strain MGI:6153560 Ncapd3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2142989 Ncapd3 non-SMC condensin II complex, subunit D3 https://www.infrafrontier.eu/search?keyword=EM:13843 ? EM:14451 C57BL/6N-Ncapd2/WtsiCnbc EMMA sperm mutant strain MGI:6153559 Ncapd2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1915548 Ncapd2 non-SMC condensin I complex, subunit D2 https://www.infrafrontier.eu/search?keyword=EM:14451 ? EM:14279 C57BL/6N-Nbeal1/WtsiH EMMA live mutant strain MGI:5785044 Nbeal1 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:2444343 Nbeal1 neurobeachin like 1 https://www.infrafrontier.eu/search?keyword=EM:14279 + EM:08754 C57BL/6N-Nbas/Ieg EMMA sperm mutant strain MGI:5548607 Nbas targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1918419 Nbas neuroblastoma amplified sequence https://www.infrafrontier.eu/search?keyword=EM:08754 + EM:07435 C57BL/6N-Nbas/Ieg EMMA embryo B6NTac;B6N-Nbas/Ieg mutant strain MGI:4946709 Nbas targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918419 Nbas neuroblastoma amplified sequence https://www.infrafrontier.eu/search?keyword=EM:07435 + EM:07859 C57BL/6N-Natd1/WtsiOulu EMMA embryo C57BL/6N-Gm16515/WtsiOulu mutant strain MGI:5548455 Natd1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1344388 Natd1 N-acetyltransferase domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:07859 + EM:07859 C57BL/6N-Natd1/WtsiOulu EMMA sperm C57BL/6N-Gm16515/WtsiOulu mutant strain MGI:5548455 Natd1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1344388 Natd1 N-acetyltransferase domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:07859 + EM:08809 C57BL/6N-Nat8f5/H EMMA sperm mutant strain MGI:5141838 Nat8f5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916299 Nat8f5 N-acetyltransferase 8 (GCN5-related) family member 5 https://www.infrafrontier.eu/search?keyword=EM:08809 - EM:12338 C57BL/6N-Nap1l4/Orl EMMA sperm mutant strain MGI:6357884 Nap1l4 endonuclease-mediated mutation 1, Centre d'ImmunoPhenomique MGI:1316687 Nap1l4 nucleosome assembly protein 1-like 4 https://www.infrafrontier.eu/search?keyword=EM:12338 - EM:05309 C57BL/6N-Nagk/H EMMA sperm mutant strain MGI:4455634 Nagk targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1860418 Nagk N-acetylglucosamine kinase https://www.infrafrontier.eu/search?keyword=EM:05309 ? EM:14402 C57BL/6N-Nadk2/WtsiH EMMA live mutant strain MGI:5637034 Nadk2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915896 Nadk2 NAD kinase 2, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:14402 ? EM:14539 C57BL/6N-Nacc2/WtsiH EMMA live mutant strain MGI:5637027 Nacc2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1915241 Nacc2 nucleus accumbens associated 2, BEN and BTB (POZ) domain containing https://www.infrafrontier.eu/search?keyword=EM:14539 + EM:09096 C57BL/6N-Myoz1/Ieg EMMA embryo mutant strain MGI:5548708 Myoz1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1929471 Myoz1 myozenin 1 https://www.infrafrontier.eu/search?keyword=EM:09096 ? EM:14487 C57BL/6N-Myo9a/WtsiCnbc EMMA archived mutant strain MGI:5636908 Myo9a targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107735 Myo9a myosin IXa https://www.infrafrontier.eu/search?keyword=EM:14487 ? EM:13364 C57BL/6N-Myo5b/WtsiCnrm EMMA live mutant strain MGI:6153496 Myo5b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:106598 Myo5b myosin VB https://www.infrafrontier.eu/search?keyword=EM:13364 ? EM:13855 C57BL/6N-Myl3/WtsiCnbc EMMA sperm mutant strain MGI:6153495 Myl3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:97268 Myl3 myosin, light polypeptide 3 https://www.infrafrontier.eu/search?keyword=EM:13855 + EM:09487 C57BL/6N-Myl2/Ieg EMMA sperm mutant strain MGI:5425876 Myl2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97272 Myl2 myosin, light polypeptide 2, regulatory, cardiac, slow https://www.infrafrontier.eu/search?keyword=EM:09487 + EM:11897 C57BL/6N-Myl10/WtsiH EMMA sperm mutant strain MGI:6153494 Myl10 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891705 Myl10 myosin, light chain 10, regulatory https://www.infrafrontier.eu/search?keyword=EM:11897 ? EM:14254 C57BL/6N-Myh3/WtsiH EMMA live mutant strain MGI:6120706 Myh3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1339709 Myh3 myosin, heavy polypeptide 3, skeletal muscle, embryonic https://www.infrafrontier.eu/search?keyword=EM:14254 + EM:08157 C57BL/6N-Mybphl/WtsiBiat EMMA sperm mutant strain MGI:5548569 Mybphl targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916003 Mybphl myosin binding protein H-like https://www.infrafrontier.eu/search?keyword=EM:08157 + EM:09100 C57BL/6N-Mybbp1a/Ieg EMMA sperm mutant strain MGI:5548364 Mybbp1a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:106181 Mybbp1a MYB binding protein (P160) 1a https://www.infrafrontier.eu/search?keyword=EM:09100 + EM:06278 C57BL/6N-Mybbp1a/Ieg EMMA embryo B6NTac;B6N-Mybbp1a/Ieg mutant strain MGI:4435114 Mybbp1a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:106181 Mybbp1a MYB binding protein (P160) 1a https://www.infrafrontier.eu/search?keyword=EM:06278 ? EM:14275 C57BL/6N-Mtmr1/WtsiIeg EMMA sperm mutant strain MGI:5708190 Mtmr1 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1858271 Mtmr1 myotubularin related protein 1 https://www.infrafrontier.eu/search?keyword=EM:14275 ? EM:13458 C57BL/6N-Mtif3/IegBiat EMMA sperm unclassified Mtif3 Mtif3 MGI:1923616 Mtif3 mitochondrial translational initiation factor 3 https://www.infrafrontier.eu/search?keyword=EM:13458 + EM:09253 C57BL/6N-Mtif3/Ieg EMMA sperm mutant strain MGI:5613653 Mtif3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923616 Mtif3 mitochondrial translational initiation factor 3 https://www.infrafrontier.eu/search?keyword=EM:09253 + EM:08245 C57BL/6N-Mtif3/Ieg EMMA embryo mutant strain MGI:4457571 Mtif3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923616 Mtif3 mitochondrial translational initiation factor 3 https://www.infrafrontier.eu/search?keyword=EM:08245 + EM:08654 C57BL/6N-Mthfsl/Ieg EMMA sperm mutant strain MGI:5548911 Mthfsl targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:3780550 Mthfsl 5, 10-methenyltetrahydrofolate synthetase-like https://www.infrafrontier.eu/search?keyword=EM:08654 + EM:08626 C57BL/6N-Mthfsl/Ieg EMMA sperm mutant strain MGI:4434563 Mthfsl targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3780550 Mthfsl 5, 10-methenyltetrahydrofolate synthetase-like https://www.infrafrontier.eu/search?keyword=EM:08626 + EM:12648 C57BL/6N-Mthfr/H EMMA live mutant strain MGI:5521869 Mthfr targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:106639 Mthfr methylenetetrahydrofolate reductase https://www.infrafrontier.eu/search?keyword=EM:12648 + EM:09183 C57BL/6N-Mthfd2l/H EMMA sperm mutant strain MGI:5692689 Mthfd2l targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1915871 Mthfd2l methylenetetrahydrofolate dehydrogenase (NADP+ dependent) 2-like https://www.infrafrontier.eu/search?keyword=EM:09183 - EM:06362 C57BL/6N-Mthfd2l/H EMMA sperm mutant strain MGI:4431820 Mthfd2l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915871 Mthfd2l methylenetetrahydrofolate dehydrogenase (NADP+ dependent) 2-like https://www.infrafrontier.eu/search?keyword=EM:06362 ? EM:14590 C57BL/6N-Msrb2/WtsiOulu EMMA embryo mutant strain MGI:6281101 Msrb2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1923717 Msrb2 methionine sulfoxide reductase B2 https://www.infrafrontier.eu/search?keyword=EM:14590 ? EM:14590 C57BL/6N-Msrb2/WtsiOulu EMMA sperm mutant strain MGI:6281101 Msrb2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1923717 Msrb2 methionine sulfoxide reductase B2 https://www.infrafrontier.eu/search?keyword=EM:14590 ? EM:13726 C57BL/6N-Msl1/WtsiOrl EMMA sperm mutant strain MGI:6153493 Msl1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921276 Msl1 male specific lethal 1 https://www.infrafrontier.eu/search?keyword=EM:13726 + EM:09511 C57BL/6N-Msh5/Ieg EMMA sperm mutant strain MGI:5629311 Msh5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1329021 Msh5 mutS homolog 5 https://www.infrafrontier.eu/search?keyword=EM:09511 + EM:08955 C57BL/6N-Msh5/Ieg EMMA sperm mutant strain MGI:4842260 Msh5 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1329021 Msh5 mutS homolog 5 https://www.infrafrontier.eu/search?keyword=EM:08955 ? EM:14302 C57BL/6N-Mrps5/WtsiIeg EMMA sperm mutant strain MGI:5548689 Mrps5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924971 Mrps5 mitochondrial ribosomal protein S5 https://www.infrafrontier.eu/search?keyword=EM:14302 ? EM:14233 C57BL/6N-Mrpl23/WtsiOulu EMMA embryo mutant strain MGI:5694166 Mrpl23 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1196612 Mrpl23 mitochondrial ribosomal protein L23 https://www.infrafrontier.eu/search?keyword=EM:14233 ? EM:14233 C57BL/6N-Mrpl23/WtsiOulu EMMA sperm mutant strain MGI:5694166 Mrpl23 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1196612 Mrpl23 mitochondrial ribosomal protein L23 https://www.infrafrontier.eu/search?keyword=EM:14233 ? EM:13369 C57BL/6N-Mrpl20/WtsiCnrm EMMA live mutant strain MGI:6153492 Mrpl20 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2137221 Mrpl20 mitochondrial ribosomal protein L20 https://www.infrafrontier.eu/search?keyword=EM:13369 ? EM:14514 C57BL/6N-Mroh4/WtsiIeg EMMA sperm mutant strain MGI:5637041 Mroh4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916689 Mroh4 maestro heat-like repeat family member 4 https://www.infrafrontier.eu/search?keyword=EM:14514 + EM:10039 C57BL/6N-Mpst/Ieg EMMA sperm mutant strain MGI:5692799 Mpst targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2179733 Mpst mercaptopyruvate sulfurtransferase https://www.infrafrontier.eu/search?keyword=EM:10039 + EM:08601 C57BL/6N-Mpst/Ieg EMMA sperm mutant strain MGI:4841819 Mpst targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2179733 Mpst mercaptopyruvate sulfurtransferase https://www.infrafrontier.eu/search?keyword=EM:08601 - EM:06387 C57BL/6N-Mpo/H EMMA sperm B6NTac;B6N-Mpo/H mutant strain MGI:4362976 Mpo targeted mutation 1a, Wellcome Trust Sanger Institute MGI:97137 Mpo myeloperoxidase https://www.infrafrontier.eu/search?keyword=EM:06387 + EM:11581 C57BL/6N-Morc2a/WtsiOulu EMMA embryo mutant strain MGI:6140214 Morc2a endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1921772 Morc2a microrchidia 2A https://www.infrafrontier.eu/search?keyword=EM:11581 + EM:11581 C57BL/6N-Morc2a/WtsiOulu EMMA sperm mutant strain MGI:6140214 Morc2a endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1921772 Morc2a microrchidia 2A https://www.infrafrontier.eu/search?keyword=EM:11581 + EM:09099 C57BL/6N-Mocs2/Ieg EMMA embryo mutant strain MGI:5548433 Mocs2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336894 Mocs2 molybdenum cofactor synthesis 2 https://www.infrafrontier.eu/search?keyword=EM:09099 + EM:09099 C57BL/6N-Mocs2/Ieg EMMA sperm mutant strain MGI:5548433 Mocs2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336894 Mocs2 molybdenum cofactor synthesis 2 https://www.infrafrontier.eu/search?keyword=EM:09099 + EM:06280 C57BL/6N-Mocs2/Ieg EMMA embryo B6NTac;B6N-Mocs2/Ieg mutant strain MGI:4456059 Mocs2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1336894 Mocs2 molybdenum cofactor synthesis 2 https://www.infrafrontier.eu/search?keyword=EM:06280 + EM:07319 C57BL/6N-Mob2/H EMMA sperm B6NTac;B6N-Mob2/H mutant strain MGI:5286243 Mob2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919891 Mob2 MOB kinase activator 2 https://www.infrafrontier.eu/search?keyword=EM:07319 ? EM:13771 C57BL/6N-Mndal/WtsiIeg EMMA sperm mutant strain MGI:6302755 Mndal endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:3780953 Mndal myeloid nuclear differentiation antigen like https://www.infrafrontier.eu/search?keyword=EM:13771 - EM:05337 C57BL/6N-Mmrn1/Cnrm EMMA sperm mutant strain MGI:4451813 Mmrn1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1918195 Mmrn1 multimerin 1 https://www.infrafrontier.eu/search?keyword=EM:05337 - EM:06744 C57BL/6N-Mmp16/H EMMA sperm B6NTac;B6N-Mmp16/H mutant strain MGI:5014693 Mmp16 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1276107 Mmp16 matrix metallopeptidase 16 https://www.infrafrontier.eu/search?keyword=EM:06744 - EM:05321 C57BL/6N-Mmp12/H EMMA sperm mutant strain MGI:4455797 Mmp12 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:97005 Mmp12 matrix metallopeptidase 12 https://www.infrafrontier.eu/search?keyword=EM:05321 ? EM:14788 C57BL/6N-Mmadhc/WtsiCnbc EMMA sperm mutant strain MGI:6281099 Mmadhc endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1923786 Mmadhc methylmalonic aciduria (cobalamin deficiency) cblD type, with homocystinuria https://www.infrafrontier.eu/search?keyword=EM:14788 - EM:05287 C57BL/6N-Mllt3/Cnrm EMMA sperm mutant strain MGI:4434535 Mllt3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917372 Mllt3 myeloid/lymphoid or mixed-lineage leukemia; translocated to, 3 https://www.infrafrontier.eu/search?keyword=EM:05287 + EM:10680 C57BL/6N-Mkrn2/WtsiPh EMMA sperm mutant strain MGI:5548531 Mkrn2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1914277 Mkrn2 makorin, ring finger protein, 2 https://www.infrafrontier.eu/search?keyword=EM:10680 + EM:11573 C57BL/6N-Mkrn2/WtsiOulu EMMA embryo mutant strain MGI:6140212 Mkrn2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914277 Mkrn2 makorin, ring finger protein, 2 https://www.infrafrontier.eu/search?keyword=EM:11573 + EM:11573 C57BL/6N-Mkrn2/WtsiOulu EMMA sperm mutant strain MGI:6140212 Mkrn2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914277 Mkrn2 makorin, ring finger protein, 2 https://www.infrafrontier.eu/search?keyword=EM:11573 + EM:11885 C57BL/6N-Mir96/WtsiH EMMA sperm mutant strain Mir96 undef targeted mutation , Wellcome Trust Sanger Institute MGI:3619440 Mir96 microRNA 96 https://www.infrafrontier.eu/search?keyword=EM:11885 ? EM:12223 C57BL/6N-Mir182/WtsiH EMMA sperm mutant strain Mir182 Mir182 MGI:2676846 Mir182 microRNA 182 https://www.infrafrontier.eu/search?keyword=EM:12223 + EM:09088 C57BL/6N-Mipol1/Ieg EMMA sperm mutant strain MGI:5605791 Mipol1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1920740 Mipol1 mirror-image polydactyly 1 https://www.infrafrontier.eu/search?keyword=EM:09088 + EM:08619 C57BL/6N-Mipol1/Ieg EMMA embryo mutant strain MGI:4843891 Mipol1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1920740 Mipol1 mirror-image polydactyly 1 https://www.infrafrontier.eu/search?keyword=EM:08619 ? EM:13536 C57BL/6N-Minar2/WtsiKieg EMMA embryo mutant strain MGI:5637144 Minar2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442934 Minar2 membrane integral NOTCH2 associated receptor 2 https://www.infrafrontier.eu/search?keyword=EM:13536 ? EM:13536 C57BL/6N-Minar2/WtsiKieg EMMA sperm mutant strain MGI:5637144 Minar2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442934 Minar2 membrane integral NOTCH2 associated receptor 2 https://www.infrafrontier.eu/search?keyword=EM:13536 + EM:08650 C57BL/6N-Miga1/Ieg EMMA sperm C57BL/6N-Fam73a/Ieg, C57BL/6N-Mita1/Ieg mutant strain MGI:5567110 Miga1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1924567 Miga1 mitoguardin 1 https://www.infrafrontier.eu/search?keyword=EM:08650 - EM:08607 C57BL/6N-Miga1/Ieg EMMA sperm mutant strain MGI:4461706 Miga1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1924567 Miga1 mitoguardin 1 https://www.infrafrontier.eu/search?keyword=EM:08607 + EM:09241 C57BL/6N-Mgat1/Ieg EMMA sperm mutant strain MGI:5613671 Mgat1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:96973 Mgat1 mannoside acetylglucosaminyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:09241 + EM:08518 C57BL/6N-Mgat1/Ieg EMMA sperm mutant strain MGI:4842039 Mgat1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96973 Mgat1 mannoside acetylglucosaminyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:08518 ? EM:13931 C57BL/6N-Mga/WtsiCnbc EMMA sperm mutant strain MGI:6153491 Mga endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1352483 Mga MAX gene associated https://www.infrafrontier.eu/search?keyword=EM:13931 - EM:05994 C57BL/6N-Mfsd8/Cnrm EMMA sperm mutant strain MGI:4456699 Mfsd8 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1919425 Mfsd8 major facilitator superfamily domain containing 8 https://www.infrafrontier.eu/search?keyword=EM:05994 + EM:10115 C57BL/6N-Mfn2/Ieg EMMA sperm mutant strain MGI:5692821 Mfn2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2442230 Mfn2 mitofusin 2 https://www.infrafrontier.eu/search?keyword=EM:10115 + EM:09811 C57BL/6N-Mfn2/Ieg EMMA embryo mutant strain MGI:4434285 Mfn2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442230 Mfn2 mitofusin 2 https://www.infrafrontier.eu/search?keyword=EM:09811 + EM:09811 C57BL/6N-Mfn2/Ieg EMMA sperm mutant strain MGI:4434285 Mfn2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2442230 Mfn2 mitofusin 2 https://www.infrafrontier.eu/search?keyword=EM:09811 + EM:10410 C57BL/6N-Mex3a/Cnbc EMMA sperm mutant strain MGI:5085513 Mex3a targeted mutation 1, Velocigene MGI:1919890 Mex3a mex3 RNA binding family member A https://www.infrafrontier.eu/search?keyword=EM:10410 ? EM:13663 C57BL/6N-Met/Cnrm EMMA embryo mutant strain Met Met MGI:96969 Met met proto-oncogene https://www.infrafrontier.eu/search?keyword=EM:13663 ? EM:13663 C57BL/6N-Met/Cnrm EMMA sperm mutant strain Met Met MGI:96969 Met met proto-oncogene https://www.infrafrontier.eu/search?keyword=EM:13663 ? EM:13662 C57BL/6N-Met/Cnrm EMMA embryo mutant strain Met Met MGI:96969 Met met proto-oncogene https://www.infrafrontier.eu/search?keyword=EM:13662 ? EM:13662 C57BL/6N-Met/Cnrm EMMA sperm mutant strain Met Met MGI:96969 Met met proto-oncogene https://www.infrafrontier.eu/search?keyword=EM:13662 ? EM:14513 C57BL/6N-Medag/WtsiOrl EMMA sperm mutant strain MGI:5548602 Medag targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1917967 Medag mesenteric estrogen dependent adipogenesis https://www.infrafrontier.eu/search?keyword=EM:14513 + EM:11164 C57BL/6N-Med23/WtsiH EMMA sperm mutant strain MGI:6153490 Med23 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1917458 Med23 mediator complex subunit 23 https://www.infrafrontier.eu/search?keyword=EM:11164 + EM:09514 C57BL/6N-Me3/Ieg EMMA sperm mutant strain MGI:5629317 Me3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916679 Me3 malic enzyme 3, NADP(+)-dependent, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:09514 + EM:10107 C57BL/6N-Me2/Ieg EMMA sperm mutant strain MGI:5692786 Me2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2147351 Me2 malic enzyme 2, NAD(+)-dependent, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:10107 ? EM:13817 C57BL/6N-Mdfic/WtsiOulu EMMA embryo mutant strain MGI:6153489 Mdfic endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:104611 Mdfic MyoD family inhibitor domain containing https://www.infrafrontier.eu/search?keyword=EM:13817 ? EM:13817 C57BL/6N-Mdfic/WtsiOulu EMMA sperm mutant strain MGI:6153489 Mdfic endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:104611 Mdfic MyoD family inhibitor domain containing https://www.infrafrontier.eu/search?keyword=EM:13817 + EM:10143 C57BL/6N-Mcub/H EMMA sperm C57BL/6N-Ccdc109b/H mutant strain MGI:5692665 Mcub targeted mutation 1c, Mouse Biology Program, UCDavis MGI:1914065 Mcub mitochondrial calcium uniporter dominant negative beta subunit https://www.infrafrontier.eu/search?keyword=EM:10143 + EM:07308 C57BL/6N-Mcub/H EMMA sperm C57BL/6N-Ccdc109b/H, B6NTac;B6N-Ccdc109b/H mutant strain MGI:4840771 Mcub targeted mutation 1a, Mouse Biology Program, UCDavis MGI:1914065 Mcub mitochondrial calcium uniporter dominant negative beta subunit https://www.infrafrontier.eu/search?keyword=EM:07308 - EM:10448 C57BL/6N-Mcu/H EMMA sperm B6NTac;B6N-A Mcu/H mutant strain MGI:5692853 Mcu targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:3026965 Mcu mitochondrial calcium uniporter https://www.infrafrontier.eu/search?keyword=EM:10448 - EM:07445 C57BL/6N-Mcu/H EMMA sperm B6NTac;B6N-Mcu/H mutant strain MGI:5294185 Mcu targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:3026965 Mcu mitochondrial calcium uniporter https://www.infrafrontier.eu/search?keyword=EM:07445 + EM:10462 C57BL/6N-Mboat7/H EMMA sperm C57BL/6NTac-Mboat7/H mutant strain MGI:5752550 Mboat7 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1924832 Mboat7 membrane bound O-acyltransferase domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:10462 + EM:11160 C57BL/6N-Mbl2/WtsiOulu EMMA embryo mutant strain MGI:6140211 Mbl2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:96924 Mbl2 mannose-binding lectin (protein C) 2 https://www.infrafrontier.eu/search?keyword=EM:11160 + EM:11160 C57BL/6N-Mbl2/WtsiOulu EMMA sperm mutant strain MGI:6140211 Mbl2 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:96924 Mbl2 mannose-binding lectin (protein C) 2 https://www.infrafrontier.eu/search?keyword=EM:11160 + EM:11157 C57BL/6N-Mbd1/WtsiH EMMA sperm mutant strain MGI:6153488 Mbd1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1333811 Mbd1 methyl-CpG binding domain protein 1 https://www.infrafrontier.eu/search?keyword=EM:11157 ? EM:13381 C57BL/6N-Matn4/WtsiCnrm EMMA live mutant strain MGI:6153487 Matn4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1328314 Matn4 matrilin 4 https://www.infrafrontier.eu/search?keyword=EM:13381 - EM:07498 C57BL/6N-Marveld2/H EMMA sperm mutant strain MGI:4461651 Marveld2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446166 Marveld2 MARVEL (membrane-associating) domain containing 2 https://www.infrafrontier.eu/search?keyword=EM:07498 + EM:10237 C57BL/6N-Marco/Ieg EMMA sperm mutant strain MGI:5701720 Marco targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:1309998 Marco macrophage receptor with collagenous structure https://www.infrafrontier.eu/search?keyword=EM:10237 + EM:09486 C57BL/6N-Marco/Ieg EMMA sperm mutant strain Marco EUCOMM targeted mutation 2, Helmholtz Zentrum Muenchen GmbH MGI:1309998 Marco macrophage receptor with collagenous structure https://www.infrafrontier.eu/search?keyword=EM:09486 + EM:09039 C57BL/6N-Mapkbp1/H EMMA sperm mutant strain MGI:5692629 Mapkbp1 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:1347004 Mapkbp1 mitogen-activated protein kinase binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:09039 + EM:10132 C57BL/6N-Mapkapk5/Ieg EMMA sperm mutant strain MGI:5692611 Mapkapk5 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1333110 Mapkapk5 MAP kinase-activated protein kinase 5 https://www.infrafrontier.eu/search?keyword=EM:10132 - EM:05658 C57BL/6N-Mapkapk2/H EMMA sperm B6NTac;B6N-Mapkapk2/H mutant strain MGI:4842229 Mapkapk2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109298 Mapkapk2 MAP kinase-activated protein kinase 2 https://www.infrafrontier.eu/search?keyword=EM:05658 - EM:08187 C57BL/6N-Mapk11/H EMMA sperm B6NTac;B6N-Mapk11/H mutant strain MGI:4435746 Mapk11 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1338024 Mapk11 mitogen-activated protein kinase 11 https://www.infrafrontier.eu/search?keyword=EM:08187 + EM:06159 C57BL/6N-Map3k7/H EMMA sperm B6NTac;B6N-Map3k7/H mutant strain MGI:4947820 Map3k7 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1346877 Map3k7 mitogen-activated protein kinase kinase kinase 7 https://www.infrafrontier.eu/search?keyword=EM:06159 + EM:08070 C57BL/6N-Map3k10/Ieg EMMA sperm mutant strain MGI:5548463 Map3k10 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1346879 Map3k10 mitogen-activated protein kinase kinase kinase 10 https://www.infrafrontier.eu/search?keyword=EM:08070 - EM:05474 C57BL/6N-Map3k10/Cnrm EMMA sperm mutant strain MGI:4435860 Map3k10 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1346879 Map3k10 mitogen-activated protein kinase kinase kinase 10 https://www.infrafrontier.eu/search?keyword=EM:05474 ? EM:14226 C57BL/6N-Mansc4/WtsiOulu EMMA embryo mutant strain MGI:6120810 Mansc4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3645619 Mansc4 MANSC domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:14226 ? EM:14226 C57BL/6N-Mansc4/WtsiOulu EMMA sperm mutant strain MGI:6120810 Mansc4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3645619 Mansc4 MANSC domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:14226 + EM:07943 C57BL/6N-Man2b2/WtsiCnrm EMMA sperm mutant strain MGI:5513801 Man2b2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1195262 Man2b2 mannosidase 2, alpha B2 https://www.infrafrontier.eu/search?keyword=EM:07943 ? EM:14164 C57BL/6N-Mamstr/WtsiIeg EMMA sperm mutant strain MGI:5637079 Mamstr targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921740 Mamstr MEF2 activating motif and SAP domain containing transcriptional regulator https://www.infrafrontier.eu/search?keyword=EM:14164 ? EM:13644 C57BL/6N-Malt1/H EMMA live mutant strain MGI:4455782 Malt1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2445027 Malt1 MALT1 paracaspase https://www.infrafrontier.eu/search?keyword=EM:13644 ? EM:13824 C57BL/6N-Magee2/WtsiOulu EMMA embryo mutant strain MGI:6153485 Magee2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2148316 Magee2 MAGE family member E2 https://www.infrafrontier.eu/search?keyword=EM:13824 ? EM:13824 C57BL/6N-Magee2/WtsiOulu EMMA sperm mutant strain MGI:6153485 Magee2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2148316 Magee2 MAGE family member E2 https://www.infrafrontier.eu/search?keyword=EM:13824 + EM:09306 C57BL/6N-Maea/Ieg EMMA sperm mutant strain MGI:5588275 Maea targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1891748 Maea macrophage erythroblast attacher https://www.infrafrontier.eu/search?keyword=EM:09306 + EM:09288 C57BL/6N-Maea/Ieg EMMA sperm mutant strain MGI:4842478 Maea targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1891748 Maea macrophage erythroblast attacher https://www.infrafrontier.eu/search?keyword=EM:09288 + EM:11156 C57BL/6N-Macrod1/WtsiPh EMMA sperm mutant strain MGI:6140210 Macrod1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2147583 Macrod1 mono-ADP ribosylhydrolase 1 https://www.infrafrontier.eu/search?keyword=EM:11156 + EM:11764 C57BL/6N-Lzts1/WtsiCnrm EMMA sperm mutant strain MGI:6152738 Lzts1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2684762 Lzts1 leucine zipper, putative tumor suppressor 1 https://www.infrafrontier.eu/search?keyword=EM:11764 + EM:08396 C57BL/6N-Lyn/H EMMA sperm mutant strain MGI:4888900 Lyn targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96892 Lyn LYN proto-oncogene, Src family tyrosine kinase https://www.infrafrontier.eu/search?keyword=EM:08396 ? EM:13732 C57BL/6N-Ly6g/WtsiOrl EMMA sperm mutant strain MGI:6257598 Ly6g endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:109440 Ly6g lymphocyte antigen 6 complex, locus G https://www.infrafrontier.eu/search?keyword=EM:13732 + EM:11048 C57BL/6N-Ly6g6d/Ieg EMMA sperm mutant strain MGI:4436130 Ly6g6d targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2148931 Ly6g6d lymphocyte antigen 6 complex, locus G6D https://www.infrafrontier.eu/search?keyword=EM:11048 ? EM:14416 C57BL/6N-Luc7l2/WtsiOrl EMMA sperm mutant strain MGI:5816877 Luc7l2 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2183260 Luc7l2 LUC7-like 2 (S. cerevisiae) https://www.infrafrontier.eu/search?keyword=EM:14416 + EM:09416 C57BL/6N-Lta4h/H EMMA sperm mutant strain MGI:5692898 Lta4h targeted mutation 1c, Wellcome Trust Sanger Institute MGI:96836 Lta4h leukotriene A4 hydrolase https://www.infrafrontier.eu/search?keyword=EM:09416 + EM:08282 C57BL/6N-Lta4h/H EMMA sperm mutant strain MGI:4820073 Lta4h targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96836 Lta4h leukotriene A4 hydrolase https://www.infrafrontier.eu/search?keyword=EM:08282 + EM:09269 C57BL/6N-Lss/Ieg EMMA sperm mutant strain MGI:5561557 Lss targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1336155 Lss lanosterol synthase https://www.infrafrontier.eu/search?keyword=EM:09269 + EM:08057 C57BL/6N-Lsm1/Ieg EMMA sperm C57BL/6N-Lsm1/Hmgu mutant strain MGI:5548536 Lsm1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1914457 Lsm1 LSM1 homolog, mRNA degradation associated https://www.infrafrontier.eu/search?keyword=EM:08057 + EM:06274 C57BL/6N-Lsm1/Ieg EMMA embryo B6NTac;B6N-Lsm1/Ieg mutant strain MGI:4887646 Lsm1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1914457 Lsm1 LSM1 homolog, mRNA degradation associated https://www.infrafrontier.eu/search?keyword=EM:06274 ? EM:13893 C57BL/6N-Lrrn4cl/WtsiCnbc EMMA sperm mutant strain Lrrn4cl CRISPR/CAS9 targeted mutation , Wellcome Trust Sanger Institute MGI:1916102 Lrrn4cl LRRN4 C-terminal like https://www.infrafrontier.eu/search?keyword=EM:13893 ? EM:13433 C57BL/6N-Lrrc3c/WtsiCnrm EMMA live mutant strain MGI:6336056 Lrrc3c endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2684858 Lrrc3c leucine rich repeat containing 3C https://www.infrafrontier.eu/search?keyword=EM:13433 ? EM:13728 C57BL/6N-Lrrc36/WtsiOrl EMMA sperm mutant strain MGI:6153483 Lrrc36 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2448585 Lrrc36 leucine rich repeat containing 36 https://www.infrafrontier.eu/search?keyword=EM:13728 ? EM:14199 C57BL/6N-Lrmp/WtsiOulu EMMA embryo mutant strain Lrmp EUCOMM targeted mutation 1b, Wellcome Trust Sanger Institute MGI:108424 Irag2 inositol 1,4,5-triphosphate receptor associated 2 https://www.infrafrontier.eu/search?keyword=EM:14199 ? EM:14199 C57BL/6N-Lrmp/WtsiOulu EMMA sperm mutant strain Lrmp EUCOMM targeted mutation 1b, Wellcome Trust Sanger Institute MGI:108424 Irag2 inositol 1,4,5-triphosphate receptor associated 2 https://www.infrafrontier.eu/search?keyword=EM:14199 ? EM:14568 C57BL/6N-Lrguk/WtsiCnbc EMMA sperm mutant strain MGI:6153746 Lrguk endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1921604 Lrguk leucine-rich repeats and guanylate kinase domain containing https://www.infrafrontier.eu/search?keyword=EM:14568 ? EM:13918 C57BL/6N-Lrba/WtsiOulu EMMA embryo mutant strain MGI:6153482 Lrba endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1933162 Lrba LPS-responsive beige-like anchor https://www.infrafrontier.eu/search?keyword=EM:13918 ? EM:13918 C57BL/6N-Lrba/WtsiOulu EMMA sperm mutant strain MGI:6153482 Lrba endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1933162 Lrba LPS-responsive beige-like anchor https://www.infrafrontier.eu/search?keyword=EM:13918 ? EM:14248 C57BL/6N-Lpxn/WtsiOulu EMMA embryo mutant strain MGI:5692788 Lpxn targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2147677 Lpxn leupaxin https://www.infrafrontier.eu/search?keyword=EM:14248 ? EM:14248 C57BL/6N-Lpxn/WtsiOulu EMMA sperm mutant strain MGI:5692788 Lpxn targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2147677 Lpxn leupaxin https://www.infrafrontier.eu/search?keyword=EM:14248 + EM:08071 C57BL/6N-Lpo/Ieg EMMA embryo mutant strain MGI:5548663 Lpo targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1923363 Lpo lactoperoxidase https://www.infrafrontier.eu/search?keyword=EM:08071 ? EM:14467 C57BL/6N-Lpcat3/WtsiCnbc EMMA sperm mutant strain MGI:6153481 Lpcat3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1315211 Lpcat3 lysophosphatidylcholine acyltransferase 3 https://www.infrafrontier.eu/search?keyword=EM:14467 + EM:10447 C57BL/6N-Lpcat1/H EMMA sperm mutant strain MGI:4458720 Lpcat1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2384812 Lpcat1 lysophosphatidylcholine acyltransferase 1 https://www.infrafrontier.eu/search?keyword=EM:10447 ? EM:14495 C57BL/6N-Lonrf3/WtsiOulu EMMA embryo mutant strain MGI:5548642 Lonrf3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921615 Lonrf3 LON peptidase N-terminal domain and ring finger 3 https://www.infrafrontier.eu/search?keyword=EM:14495 ? EM:14495 C57BL/6N-Lonrf3/WtsiOulu EMMA sperm mutant strain MGI:5548642 Lonrf3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1921615 Lonrf3 LON peptidase N-terminal domain and ring finger 3 https://www.infrafrontier.eu/search?keyword=EM:14495 + EM:09070 C57BL/6N-Lonp1/Ieg EMMA sperm mutant strain MGI:5521859 Lonp1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921392 Lonp1 lon peptidase 1, mitochondrial https://www.infrafrontier.eu/search?keyword=EM:09070 + EM:11329 C57BL/6N-Lmo1/Ieg EMMA sperm mutant strain MGI:4843686 Lmo1 targeted mutation 1a, Mouse Biology Program, UCDavis MGI:102812 Lmo1 LIM domain only 1 https://www.infrafrontier.eu/search?keyword=EM:11329 + EM:10615 C57BL/6N-Lmnb1/WtsiH EMMA sperm mutant strain MGI:5767330 Lmnb1 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:96795 Lmnb1 lamin B1 https://www.infrafrontier.eu/search?keyword=EM:10615 ? EM:13754 C57BL/6N-Lman2/WtsiIeg EMMA sperm mutant strain MGI:6286369 Lman2 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1914140 Lman2 lectin, mannose-binding 2 https://www.infrafrontier.eu/search?keyword=EM:13754 ? EM:13760 C57BL/6N-Lingo3/WtsiIeg EMMA sperm mutant strain MGI:6287372 Lingo3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:3609246 Lingo3 leucine rich repeat and Ig domain containing 3 https://www.infrafrontier.eu/search?keyword=EM:13760 - EM:09032 C57BL/6N-Lifr/H EMMA sperm B6NTac;B6N-Lifr/H mutant strain MGI:5692896 Lifr targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:96788 Lifr LIF receptor alpha https://www.infrafrontier.eu/search?keyword=EM:09032 - EM:06941 C57BL/6N-Lifr/H EMMA sperm B6NTac;B6N-Lifr/H mutant strain MGI:4841519 Lifr targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96788 Lifr LIF receptor alpha https://www.infrafrontier.eu/search?keyword=EM:06941 + EM:09084 C57BL/6N-Lhfpl2/H EMMA sperm mutant strain MGI:4462597 Lhfpl2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2145236 Lhfpl2 lipoma HMGIC fusion partner-like 2 https://www.infrafrontier.eu/search?keyword=EM:09084 + EM:08894 C57BL/6N-Lgals7/WtsiIeg EMMA sperm mutant strain MGI:5548425 Lgals7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1316742 Lgals7 lectin, galactose binding, soluble 7 https://www.infrafrontier.eu/search?keyword=EM:08894 + EM:09044 C57BL/6N-Lgals3/H EMMA sperm mutant strain MGI:5692895 Lgals3 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:96778 Lgals3 lectin, galactose binding, soluble 3 https://www.infrafrontier.eu/search?keyword=EM:09044 - EM:06800 C57BL/6N-Lgals3/H EMMA sperm mutant strain MGI:4432481 Lgals3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96778 Lgals3 lectin, galactose binding, soluble 3 https://www.infrafrontier.eu/search?keyword=EM:06800 ? EM:14574 C57BL/6N-Lfng/WtsiCnbc EMMA sperm mutant strain MGI:6153723 Lfng endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1095413 Lfng LFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase https://www.infrafrontier.eu/search?keyword=EM:14574 - EM:07837 C57BL/6N-Leprotl1/H EMMA sperm HEPD0576_6_H12, B6NTac;B6N-Leprotl1/H mutant strain MGI:4434583 Leprotl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1915442 Leprotl1 leptin receptor overlapping transcript-like 1 https://www.infrafrontier.eu/search?keyword=EM:07837 + EM:08158 C57BL/6N-Leprot/WtsiBiat EMMA sperm mutant strain MGI:5548880 Leprot targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2687005 Leprot leptin receptor overlapping transcript https://www.infrafrontier.eu/search?keyword=EM:08158 + EM:07367 C57BL/6N-Lepr/H EMMA sperm B6NTac;B6N-Lepr/H mutant strain MGI:4453725 Lepr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104993 Lepr leptin receptor https://www.infrafrontier.eu/search?keyword=EM:07367 ? EM:14149 C57BL/6N-Ldlrad4/WtsiCnbc EMMA archived mutant strain MGI:5636938 Ldlrad4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1277150 Ldlrad4 low density lipoprotein receptor class A domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:14149 + EM:10076 C57BL/6N-Ldlr/Ieg EMMA sperm mutant strain MGI:4433768 Ldlr targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96765 Ldlr low density lipoprotein receptor https://www.infrafrontier.eu/search?keyword=EM:10076 ? EM:14278 C57BL/6N-Ldhb/WtsiPh EMMA sperm mutant strain MGI:5637210 Ldhb targeted mutation 1b, Wellcome Trust Sanger Institute MGI:96763 Ldhb lactate dehydrogenase B https://www.infrafrontier.eu/search?keyword=EM:14278 + EM:08651 C57BL/6N-Ldah/Ieg EMMA sperm mutant strain MGI:5637035 Ldah targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916082 Ldah lipid droplet associated hydrolase https://www.infrafrontier.eu/search?keyword=EM:08651 + EM:07442 C57BL/6N-Ldah/Ieg EMMA embryo B6NTac;B6N-Ldah/Ieg, B6NTac;B6N-1110057K04Rik/Ieg mutant strain MGI:4456805 Ldah targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1916082 Ldah lipid droplet associated hydrolase https://www.infrafrontier.eu/search?keyword=EM:07442 + EM:08731 C57BL/6N-Lct/Ieg EMMA sperm mutant strain MGI:4841441 Lct targeted mutation 1a, Wellcome Trust Sanger Institute MGI:104576 Lct lactase https://www.infrafrontier.eu/search?keyword=EM:08731 ? EM:13436 C57BL/6N-Lce3e/WtsiCnrm EMMA live mutant strain MGI:6153480 Lce3e endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1916764 Lce3e late cornified envelope 3E https://www.infrafrontier.eu/search?keyword=EM:13436 ? EM:14171 C57BL/6N-Lce1m/WtsiCnbc EMMA archived mutant strain MGI:5637007 Lce1m targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1913453 Lce1m late cornified envelope 1M https://www.infrafrontier.eu/search?keyword=EM:14171 + EM:07311 C57BL/6N-Lce1f/H EMMA sperm B6NTac;B6N-Lce1f/H mutant strain MGI:4841178 Lce1f targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915078 Lce1f late cornified envelope 1F https://www.infrafrontier.eu/search?keyword=EM:07311 ? EM:14556 C57BL/6N-Larp4b/WtsiPh EMMA sperm mutant strain MGI:6153479 Larp4b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:106330 Larp4b La ribonucleoprotein 4B https://www.infrafrontier.eu/search?keyword=EM:14556 + EM:10467 C57BL/6N-Lamb3/H EMMA sperm mutant strain MGI:5752556 Lamb3 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:99915 Lamb3 laminin, beta 3 https://www.infrafrontier.eu/search?keyword=EM:10467 + EM:10466 C57BL/6N-Lama5/H EMMA sperm C57BL/6NTac-Lama5/H mutant strain MGI:5752544 Lama5 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:105382 Lama5 laminin, alpha 5 https://www.infrafrontier.eu/search?keyword=EM:10466 + EM:09240 C57BL/6N-Lama1/Ieg EMMA sperm mutant strain MGI:5613672 Lama1 targeted mutation 2b, Helmholtz Zentrum Muenchen GmbH MGI:99892 Lama1 laminin, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:09240 + EM:08512 C57BL/6N-Lama1/Ieg EMMA sperm mutant strain MGI:4436547 Lama1 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:99892 Lama1 laminin, alpha 1 https://www.infrafrontier.eu/search?keyword=EM:08512 + EM:09239 C57BL/6N-Lactb/Ieg EMMA sperm mutant strain MGI:5613656 Lactb targeted mutation 1.1, Mouse Biology Program, UCDavis MGI:1933395 Lactb lactamase, beta https://www.infrafrontier.eu/search?keyword=EM:09239 + EM:08725 C57BL/6N-Lactb/Ieg EMMA sperm mutant strain MGI:4819984 Lactb targeted mutation 1, Mouse Biology Program, UCDavis MGI:1933395 Lactb lactamase, beta https://www.infrafrontier.eu/search?keyword=EM:08725 ? EM:13750 C57BL/6N-Krt87/WtsiIeg EMMA sperm mutant strain MGI:6286373 Krt87 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:3665486 Krt87 keratin 87 https://www.infrafrontier.eu/search?keyword=EM:13750 ? EM:14496 C57BL/6N-Krt83/WtsiIeg EMMA sperm mutant strain MGI:5637191 Krt83 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:3690448 Krt83 keratin 83 https://www.infrafrontier.eu/search?keyword=EM:14496 + EM:08573 C57BL/6N-Krt7/WtsiH EMMA sperm mutant strain MGI:5548947 Krt7 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:96704 Krt7 keratin 7 https://www.infrafrontier.eu/search?keyword=EM:08573 ? EM:14152 C57BL/6N-Krt79/WtsiIeg EMMA sperm mutant strain MGI:5708243 Krt79 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:2385030 Krt79 keratin 79 https://www.infrafrontier.eu/search?keyword=EM:14152 - EM:07497 C57BL/6N-Krt74/H EMMA sperm B6NTac;B6N-Krt74/H mutant strain MGI:4461649 Krt74 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:3629975 Krt74 keratin 74 https://www.infrafrontier.eu/search?keyword=EM:07497 ? EM:13823 C57BL/6N-Krt5/WtsiOulu EMMA embryo mutant strain MGI:6153745 Krt5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:96702 Krt5 keratin 5 https://www.infrafrontier.eu/search?keyword=EM:13823 ? EM:13823 C57BL/6N-Krt5/WtsiOulu EMMA sperm mutant strain MGI:6153745 Krt5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:96702 Krt5 keratin 5 https://www.infrafrontier.eu/search?keyword=EM:13823 - EM:09535 C57BL/6N-Krt12/Cnrm EMMA sperm mutant strain MGI:5633776 Krt12 targeted mutation 2, Wellcome Trust Sanger Institute MGI:96687 Krt12 keratin 12 https://www.infrafrontier.eu/search?keyword=EM:09535 + EM:10106 C57BL/6N-Knl1/Ieg EMMA sperm mutant strain MGI:5692741 Knl1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1923714 Knl1 kinetochore scaffold 1 https://www.infrafrontier.eu/search?keyword=EM:10106 + EM:08578 C57BL/6N-Knl1/Ieg EMMA sperm mutant strain MGI:4841642 Knl1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1923714 Knl1 kinetochore scaffold 1 https://www.infrafrontier.eu/search?keyword=EM:08578 ? EM:14411 C57BL/6N-Kmt2e/WtsiOrl EMMA sperm mutant strain Kmt2e undef targeted mutation , Wellcome Trust Sanger Institute MGI:1924825 Kmt2e lysine (K)-specific methyltransferase 2E https://www.infrafrontier.eu/search?keyword=EM:14411 ? EM:14428 C57BL/6N-Kmt2d/WtsiCnbc EMMA archived mutant strain Kmt2d undef targeted mutation , Wellcome Trust Sanger Institute MGI:2682319 Kmt2d lysine (K)-specific methyltransferase 2D https://www.infrafrontier.eu/search?keyword=EM:14428 ? EM:13902 C57BL/6N-Klrc3/WtsiPh EMMA sperm mutant strain MGI:6153384 Klrc3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1929720 Klrc3 killer cell lectin-like receptor subfamily C, member 3 https://www.infrafrontier.eu/search?keyword=EM:13902 ? EM:13908 C57BL/6N-Klrc2/WtsiPh EMMA sperm mutant strain MGI:6153383 Klrc2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1336162 Klrc2 killer cell lectin-like receptor subfamily C, member 2 https://www.infrafrontier.eu/search?keyword=EM:13908 ? EM:13882 C57BL/6N-Klrc1/WtsiPh EMMA sperm mutant strain MGI:6153382 Klrc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1336161 Klrc1 killer cell lectin-like receptor subfamily C, member 1 https://www.infrafrontier.eu/search?keyword=EM:13882 + EM:09638 C57BL/6N-Klrb1/Ieg EMMA sperm mutant strain MGI:4453704 Klrb1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96877 Klrb1 killer cell lectin-like receptor subfamily B member 1 https://www.infrafrontier.eu/search?keyword=EM:09638 ? EM:13741 C57BL/6N-Klra6/WtsiOrl EMMA sperm mutant strain MGI:6153381 Klra6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:101902 Klra6 killer cell lectin-like receptor, subfamily A, member 6 https://www.infrafrontier.eu/search?keyword=EM:13741 + EM:07921 C57BL/6N-Klkb1/Ieg EMMA embryo mutant strain MGI:5548334 Klkb1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:102849 Klkb1 kallikrein B, plasma 1 https://www.infrafrontier.eu/search?keyword=EM:07921 + EM:05553 C57BL/6N-Klkb1/Ieg EMMA embryo B6NTac;B6N-Klkb1/Ieg mutant strain MGI:4456034 Klkb1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:102849 Klkb1 kallikrein B, plasma 1 https://www.infrafrontier.eu/search?keyword=EM:05553 + EM:11152 C57BL/6N-Klk6/WtsiH EMMA sperm mutant strain MGI:6153380 Klk6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1343166 Klk6 kallikrein related-peptidase 6 https://www.infrafrontier.eu/search?keyword=EM:11152 ? EM:14423 C57BL/6N-Klhl42/WtsiH EMMA live mutant strain MGI:6120798 Klhl42 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2444786 Klhl42 kelch-like 42 https://www.infrafrontier.eu/search?keyword=EM:14423 - EM:07572 C57BL/6N-Klhl3/H EMMA sperm B6NTac;B6N-Klhl3/H mutant strain MGI:4946685 Klhl3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2445185 Klhl3 kelch-like 3 https://www.infrafrontier.eu/search?keyword=EM:07572 ? EM:14488 C57BL/6N-Klhl26/WtsiOulu EMMA embryo mutant strain MGI:5796937 Klhl26 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443079 Klhl26 kelch-like 26 https://www.infrafrontier.eu/search?keyword=EM:14488 ? EM:14488 C57BL/6N-Klhl26/WtsiOulu EMMA sperm mutant strain MGI:5796937 Klhl26 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2443079 Klhl26 kelch-like 26 https://www.infrafrontier.eu/search?keyword=EM:14488 - EM:05848 C57BL/6N-Klf7/H EMMA sperm B6NTac;B6N-Klf7/H mutant strain MGI:4434914 Klf7 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1935151 Klf7 Kruppel-like factor 7 (ubiquitous) https://www.infrafrontier.eu/search?keyword=EM:05848 ? EM:13779 C57BL/6N-Klf1/WtsiIeg EMMA sperm mutant strain MGI:6153379 Klf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1342771 Klf1 Kruppel-like factor 1 (erythroid) https://www.infrafrontier.eu/search?keyword=EM:13779 + EM:09397 C57BL/6N-Klf17/WtsiOrl EMMA sperm mutant strain MGI:5548777 Klf17 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2181068 Klf17 Kruppel-like factor 17 https://www.infrafrontier.eu/search?keyword=EM:09397 ? EM:14245 C57BL/6N-Kif3b/WtsiH EMMA live mutant strain MGI:5548376 Kif3b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:107688 Kif3b kinesin family member 3B https://www.infrafrontier.eu/search?keyword=EM:14245 ? EM:14188 C57BL/6N-Kif24/WtsiIeg EMMA sperm mutant strain MGI:5637052 Kif24 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1918345 Kif24 kinesin family member 24 https://www.infrafrontier.eu/search?keyword=EM:14188 + EM:08656 C57BL/6N-Kif20a/Ieg EMMA sperm mutant strain MGI:5636934 Kif20a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1201682 Kif20a kinesin family member 20A https://www.infrafrontier.eu/search?keyword=EM:08656 + EM:08632 C57BL/6N-Kif20a/Ieg EMMA embryo mutant strain MGI:4436572 Kif20a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1201682 Kif20a kinesin family member 20A https://www.infrafrontier.eu/search?keyword=EM:08632 ? EM:13460 C57BL/6N-Khdrbs3/IegBiat EMMA sperm unclassified Khdrbs3 Khdrbs3 MGI:1313312 Khdrbs3 KH domain containing, RNA binding, signal transduction associated 3 https://www.infrafrontier.eu/search?keyword=EM:13460 + EM:08658 C57BL/6N-Khdrbs3/Ieg EMMA sperm mutant strain MGI:5636948 Khdrbs3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1313312 Khdrbs3 KH domain containing, RNA binding, signal transduction associated 3 https://www.infrafrontier.eu/search?keyword=EM:08658 + EM:08634 C57BL/6N-Khdrbs3/Ieg EMMA sperm mutant strain MGI:4847821 Khdrbs3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1313312 Khdrbs3 KH domain containing, RNA binding, signal transduction associated 3 https://www.infrafrontier.eu/search?keyword=EM:08634 + EM:11155 C57BL/6N-Kera/WtsiPh EMMA sperm mutant strain MGI:6140208 Kera endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1202398 Kera keratocan https://www.infrafrontier.eu/search?keyword=EM:11155 ? EM:14205 C57BL/6N-Kdm6b/WtsiOulu EMMA embryo mutant strain MGI:6324163 Kdm6b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2448492 Kdm6b KDM1 lysine (K)-specific demethylase 6B https://www.infrafrontier.eu/search?keyword=EM:14205 ? EM:14205 C57BL/6N-Kdm6b/WtsiOulu EMMA sperm mutant strain MGI:6324163 Kdm6b targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2448492 Kdm6b KDM1 lysine (K)-specific demethylase 6B https://www.infrafrontier.eu/search?keyword=EM:14205 ? EM:13705 C57BL/6N-Kdm5b/WtsiOrl EMMA sperm mutant strain MGI:6153378 Kdm5b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1922855 Kdm5b lysine (K)-specific demethylase 5B https://www.infrafrontier.eu/search?keyword=EM:13705 + EM:09483 C57BL/6N-Kcnn1/H EMMA sperm mutant strain MGI:4419229 Kcnn1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1933993 Kcnn1 potassium intermediate/small conductance calcium-activated channel, subfamily N, member 1 https://www.infrafrontier.eu/search?keyword=EM:09483 - EM:05957 C57BL/6N-Kcnj9/H EMMA sperm B6NTac;B6N-Kcnj9/H mutant strain MGI:4436261 Kcnj9 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108007 Kcnj9 potassium inwardly-rectifying channel, subfamily J, member 9 https://www.infrafrontier.eu/search?keyword=EM:05957 + EM:08990 C57BL/6N-Kcnj14/H EMMA sperm mutant strain MGI:5511630 Kcnj14 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2384820 Kcnj14 potassium inwardly-rectifying channel, subfamily J, member 14 https://www.infrafrontier.eu/search?keyword=EM:08990 + EM:10832 C57BL/6N-Kcnj12/H EMMA sperm mutant strain MGI:4432694 Kcnj12 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:108495 Kcnj12 potassium inwardly-rectifying channel, subfamily J, member 12 https://www.infrafrontier.eu/search?keyword=EM:10832 - EM:10056 C57BL/6N-Kcnj11/H EMMA sperm B6NTac;B6N-A Kcnj11/H mutant strain MGI:5692571 Kcnj11 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:107501 Kcnj11 potassium inwardly rectifying channel, subfamily J, member 11 https://www.infrafrontier.eu/search?keyword=EM:10056 - EM:08845 C57BL/6N-Kcnj11/H EMMA sperm B6NTac;B6N-A Kcnj11/H mutant strain MGI:5473147 Kcnj11 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:107501 Kcnj11 potassium inwardly rectifying channel, subfamily J, member 11 https://www.infrafrontier.eu/search?keyword=EM:08845 + EM:09266 C57BL/6N-Kcnj10/H EMMA sperm mutant strain MGI:4451428 Kcnj10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1194504 Kcnj10 potassium inwardly-rectifying channel, subfamily J, member 10 https://www.infrafrontier.eu/search?keyword=EM:09266 ? EM:14163 C57BL/6N-Kcnh4/WtsiIeg EMMA sperm mutant strain MGI:5637120 Kcnh4 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2156184 Kcnh4 potassium voltage-gated channel, subfamily H (eag-related), member 4 https://www.infrafrontier.eu/search?keyword=EM:14163 + EM:08338 C57BL/6N-Kcnb1/H EMMA sperm mutant strain MGI:5002949 Kcnb1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96666 Kcnb1 potassium voltage gated channel, Shab-related subfamily, member 1 https://www.infrafrontier.eu/search?keyword=EM:08338 ? EM:13778 C57BL/6N-Kbtbd11/WtsiIeg EMMA sperm mutant strain MGI:6153377 Kbtbd11 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1922151 Kbtbd11 kelch repeat and BTB (POZ) domain containing 11 https://www.infrafrontier.eu/search?keyword=EM:13778 - EM:06113 C57BL/6N-Katnb1/Cnrm EMMA sperm mutant strain MGI:4436305 Katnb1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1921437 Katnb1 katanin p80 (WD40-containing) subunit B 1 https://www.infrafrontier.eu/search?keyword=EM:06113 + EM:11211 C57BL/6N-Kat2b/WtsiIeg EMMA sperm mutant strain MGI:6140207 Kat2b endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1343094 Kat2b K(lysine) acetyltransferase 2B https://www.infrafrontier.eu/search?keyword=EM:11211 + EM:12754 C57BL/6N-Kansl1l/Ieg EMMA sperm mutant strain MGI:4432674 Kansl1l targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915941 Kansl1l KAT8 regulatory NSL complex subunit 1-like https://www.infrafrontier.eu/search?keyword=EM:12754 + EM:11210 C57BL/6N-Josd1/WtsiIeg EMMA sperm mutant strain MGI:6140206 Josd1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1921408 Josd1 Josephin domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:11210 ? EM:13701 C57BL/6N-Jmjd7/WtsiOrl EMMA sperm mutant strain MGI:6153376 Jmjd7 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3845785 Jmjd7 jumonji domain containing 7 https://www.infrafrontier.eu/search?keyword=EM:13701 ? EM:13459 C57BL/6N-Jmjd6/IegBiat EMMA sperm unclassified MGI:6756397 Jmjd6 targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1858910 Jmjd6 jumonji domain containing 6 https://www.infrafrontier.eu/search?keyword=EM:13459 + EM:08088 C57BL/6N-Jmjd6/Ieg EMMA sperm mutant strain MGI:5548491 Jmjd6 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1858910 Jmjd6 jumonji domain containing 6 https://www.infrafrontier.eu/search?keyword=EM:08088 ? EM:14443 C57BL/6N-Jmjd4/WtsiCnbc EMMA sperm mutant strain MGI:6153375 Jmjd4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2144404 Jmjd4 jumonji domain containing 4 https://www.infrafrontier.eu/search?keyword=EM:14443 + EM:10018 C57BL/6N-Jarid2/Cnrm EMMA embryo mutant strain MGI:5811911 Jarid2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:104813 Jarid2 jumonji, AT rich interactive domain 2 https://www.infrafrontier.eu/search?keyword=EM:10018 + EM:10018 C57BL/6N-Jarid2/Cnrm EMMA sperm mutant strain MGI:5811911 Jarid2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:104813 Jarid2 jumonji, AT rich interactive domain 2 https://www.infrafrontier.eu/search?keyword=EM:10018 + EM:07862 C57BL/6N-Jag2/H EMMA sperm B6NTac;B6N-Jag2/H mutant strain MGI:4880880 Jag2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098270 Jag2 jagged 2 https://www.infrafrontier.eu/search?keyword=EM:07862 + EM:08753 C57BL/6N-Ivd/Ieg EMMA sperm mutant strain MGI:5548705 Ivd targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1929242 Ivd isovaleryl coenzyme A dehydrogenase https://www.infrafrontier.eu/search?keyword=EM:08753 + EM:08117 C57BL/6N-Itm2c/Ieg EMMA sperm mutant strain MGI:5548700 Itm2c targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1927594 Itm2c integral membrane protein 2C https://www.infrafrontier.eu/search?keyword=EM:08117 + EM:08103 C57BL/6N-Itm2c/Ieg EMMA sperm B6NTac;B6N-Itm2c/Ieg mutant strain MGI:4431661 Itm2c targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1927594 Itm2c integral membrane protein 2C https://www.infrafrontier.eu/search?keyword=EM:08103 ? EM:13450 C57BL/6N-Itm2a/WtsiCnrm EMMA live mutant strain MGI:6153374 Itm2a endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107706 Itm2a integral membrane protein 2A https://www.infrafrontier.eu/search?keyword=EM:13450 + EM:11578 C57BL/6N-Itln1/WtsiIeg EMMA sperm mutant strain MGI:6140205 Itln1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1333831 Itln1 intelectin 1 (galactofuranose binding) https://www.infrafrontier.eu/search?keyword=EM:11578 ? EM:14583 C57BL/6N-Itgam/WtsiCnbc EMMA sperm mutant strain MGI:6153373 Itgam endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:96607 Itgam integrin alpha M https://www.infrafrontier.eu/search?keyword=EM:14583 - EM:07783 C57BL/6N-Itgae/H EMMA sperm mutant strain MGI:4433992 Itgae targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1298377 Itgae integrin alpha E, epithelial-associated https://www.infrafrontier.eu/search?keyword=EM:07783 - EM:09538 C57BL/6N-Itga2/Cnrm EMMA sperm mutant strain MGI:5633770 Itga2 targeted mutation 2, Wellcome Trust Sanger Institute MGI:96600 Itga2 integrin alpha 2 https://www.infrafrontier.eu/search?keyword=EM:09538 + EM:05766 C57BL/6N-Itga2/H EMMA sperm B6NTac;B6N-Itga2/H mutant strain MGI:4455765 Itga2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96600 Itga2 integrin alpha 2 https://www.infrafrontier.eu/search?keyword=EM:05766 + EM:09007 C57BL/6N-Itch/H EMMA sperm mutant strain MGI:4888905 Itch targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1202301 Itch itchy, E3 ubiquitin protein ligase https://www.infrafrontier.eu/search?keyword=EM:09007 ? EM:14780 C57BL/6N-Irgm1/WtsiCnbc EMMA sperm mutant strain MGI:6153372 Irgm1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:107567 Irgm1 immunity-related GTPase family M member 1 https://www.infrafrontier.eu/search?keyword=EM:14780 ? EM:14435 C57BL/6N-Irf6/WtsiCnbc EMMA sperm mutant strain MGI:6153743 Irf6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1859211 Irf6 interferon regulatory factor 6 https://www.infrafrontier.eu/search?keyword=EM:14435 + EM:07483 C57BL/6N-Irak2/H EMMA sperm B6NTac;B6N-Irak2/H mutant strain MGI:4431835 Irak2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2429603 Irak2 interleukin-1 receptor-associated kinase 2 https://www.infrafrontier.eu/search?keyword=EM:07483 ? EM:14504 C57BL/6N-Irak1/WtsiOrl EMMA sperm mutant strain MGI:5636906 Irak1 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:107420 Irak1 interleukin-1 receptor-associated kinase 1 https://www.infrafrontier.eu/search?keyword=EM:14504 ? EM:14497 C57BL/6N-Ints9/WtsiOulu EMMA embryo mutant strain MGI:5796932 Ints9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1098533 Ints9 integrator complex subunit 9 https://www.infrafrontier.eu/search?keyword=EM:14497 ? EM:14497 C57BL/6N-Ints9/WtsiOulu EMMA sperm mutant strain MGI:5796932 Ints9 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1098533 Ints9 integrator complex subunit 9 https://www.infrafrontier.eu/search?keyword=EM:14497 ? EM:14156 C57BL/6N-Ints11/WtsiIeg EMMA sperm mutant strain MGI:5708213 Ints11 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:1919207 Ints11 integrator complex subunit 11 https://www.infrafrontier.eu/search?keyword=EM:14156 ? EM:14434 C57BL/6N-Insyn2b/WtsiCnbc EMMA sperm mutant strain MGI:6153338 Insyn2b endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3643491 Insyn2b inhibitory synaptic factor family member 2B https://www.infrafrontier.eu/search?keyword=EM:14434 + EM:10949 C57BL/6N-Ing3/Biat EMMA sperm mutant strain MGI:4432585 Ing3 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919027 Ing3 inhibitor of growth family, member 3 https://www.infrafrontier.eu/search?keyword=EM:10949 ? EM:14551 C57BL/6N-Il6ra/WtsiOulu EMMA embryo mutant strain Il6ra CRISPR/CAS9 targeted mutation , Wellcome Trust Sanger Institute MGI:105304 Il6ra interleukin 6 receptor, alpha https://www.infrafrontier.eu/search?keyword=EM:14551 ? EM:14551 C57BL/6N-Il6ra/WtsiOulu EMMA sperm mutant strain Il6ra CRISPR/CAS9 targeted mutation , Wellcome Trust Sanger Institute MGI:105304 Il6ra interleukin 6 receptor, alpha https://www.infrafrontier.eu/search?keyword=EM:14551 ? EM:13825 C57BL/6N-Il6ra/WtsiOulu EMMA embryo mutant strain MGI:6153742 Il6ra endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:105304 Il6ra interleukin 6 receptor, alpha https://www.infrafrontier.eu/search?keyword=EM:13825 ? EM:13825 C57BL/6N-Il6ra/WtsiOulu EMMA sperm mutant strain MGI:6153742 Il6ra endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:105304 Il6ra interleukin 6 receptor, alpha https://www.infrafrontier.eu/search?keyword=EM:13825 ? EM:13775 C57BL/6N-Il4ra/WtsiIeg EMMA sperm mutant strain MGI:6153371 Il4ra endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:105367 Il4ra interleukin 4 receptor, alpha https://www.infrafrontier.eu/search?keyword=EM:13775 + EM:09387 C57BL/6N-Il4i1/Ieg EMMA sperm mutant strain MGI:4432453 Il4i1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:109552 Il4i1 interleukin 4 induced 1 https://www.infrafrontier.eu/search?keyword=EM:09387 - EM:05779 C57BL/6N-Il31/Cnrm EMMA sperm mutant strain MGI:4842595 Il31 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1923649 Il31 interleukin 31 https://www.infrafrontier.eu/search?keyword=EM:05779 ? EM:14345 C57BL/6N-Il27/WtsiH EMMA live mutant strain MGI:5694183 Il27 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2384409 Il27 interleukin 27 https://www.infrafrontier.eu/search?keyword=EM:14345 + EM:08953 C57BL/6N-Il19/H EMMA sperm mutant strain MGI:5511440 Il19 targeted mutation 2e, Helmholtz Zentrum Muenchen GmbH MGI:1890472 Il19 interleukin 19 https://www.infrafrontier.eu/search?keyword=EM:08953 + EM:11763 C57BL/6N-Il18rap/WtsiCnrm EMMA sperm mutant strain MGI:6152737 Il18rap endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1338888 Il18rap interleukin 18 receptor accessory protein https://www.infrafrontier.eu/search?keyword=EM:11763 ? EM:14222 C57BL/6N-Il17re/WtsiH EMMA live mutant strain Il17re EUCOMM targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1889371 Il17re interleukin 17 receptor E https://www.infrafrontier.eu/search?keyword=EM:14222 ? EM:13992 C57BL/6N-Il17re/WtsiCnrm EMMA live mutant strain MGI:6157265 Il17re targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1889371 Il17re interleukin 17 receptor E https://www.infrafrontier.eu/search?keyword=EM:13992 + EM:10738 C57BL/6N-Il15/H EMMA archived mutant strain MGI:5790636 Il15 targeted mutation 1c, Helmholtz Zentrum Muenchen GmbH MGI:103014 Il15 interleukin 15 https://www.infrafrontier.eu/search?keyword=EM:10738 - EM:07964 C57BL/6N-Il15/H EMMA sperm B6NTac;B6N-Il15/H, HEPD0629_7_C06 mutant strain MGI:4455931 Il15 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:103014 Il15 interleukin 15 https://www.infrafrontier.eu/search?keyword=EM:07964 + EM:09087 C57BL/6N-Il13ra2/Ieg EMMA sperm mutant strain MGI:4452745 Il13ra2 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1277954 Il13ra2 interleukin 13 receptor, alpha 2 https://www.infrafrontier.eu/search?keyword=EM:09087 + EM:09493 C57BL/6N-Il12a/H EMMA sperm mutant strain MGI:4455775 Il12a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96539 Il12a interleukin 12a https://www.infrafrontier.eu/search?keyword=EM:09493 + EM:08503 C57BL/6N-Il10/Cnbc EMMA sperm mutant strain MGI:4432290 Il10 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96537 Il10 interleukin 10 https://www.infrafrontier.eu/search?keyword=EM:08503 ? EM:14542 C57BL/6N-Ikbke/WtsiH EMMA live mutant strain Ikbke EUCOMM targeted mutation 1c, Wellcome Trust Sanger Institute MGI:1929612 Ikbke inhibitor of kappaB kinase epsilon https://www.infrafrontier.eu/search?keyword=EM:14542 ? EM:14184 C57BL/6N-Ikbke/WtsiCnbc EMMA archived mutant strain Ikbke EUCOMM targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1929612 Ikbke inhibitor of kappaB kinase epsilon https://www.infrafrontier.eu/search?keyword=EM:14184 + EM:11218 C57BL/6N-Igsf8/WtsiIeg EMMA sperm mutant strain MGI:6140202 Igsf8 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2154090 Igsf8 immunoglobulin superfamily, member 8 https://www.infrafrontier.eu/search?keyword=EM:11218 + EM:11891 C57BL/6N-Igsf6/WtsiH EMMA sperm mutant strain MGI:6153370 Igsf6 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1891393 Igsf6 immunoglobulin superfamily, member 6 https://www.infrafrontier.eu/search?keyword=EM:11891 ? EM:13904 C57BL/6N-Igsf3/WtsiCnbc EMMA sperm mutant strain MGI:6257569 Igsf3 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:1926158 Igsf3 immunoglobulin superfamily, member 3 https://www.infrafrontier.eu/search?keyword=EM:13904 + EM:08183 C57BL/6N-Igfbp3/H EMMA sperm mutant strain MGI:5548945 Igfbp3 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:96438 Igfbp3 insulin-like growth factor binding protein 3 https://www.infrafrontier.eu/search?keyword=EM:08183 + EM:08649 C57BL/6N-Ift81/Ieg EMMA sperm mutant strain MGI:5636927 Ift81 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1098597 Ift81 intraflagellar transport 81 https://www.infrafrontier.eu/search?keyword=EM:08649 + EM:08602 C57BL/6N-Ift81/Ieg EMMA embryo mutant strain MGI:4433881 Ift81 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098597 Ift81 intraflagellar transport 81 https://www.infrafrontier.eu/search?keyword=EM:08602 ? EM:14260 C57BL/6N-Ifitm6/WtsiH EMMA live mutant strain MGI:5638572 Ifitm6 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:2686976 Ifitm6 interferon induced transmembrane protein 6 https://www.infrafrontier.eu/search?keyword=EM:14260 ? EM:14207 C57BL/6N-Ifitm1/WtsiH EMMA live mutant strain MGI:5775001 Ifitm1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1915963 Ifitm1 interferon induced transmembrane protein 1 https://www.infrafrontier.eu/search?keyword=EM:14207 + EM:10668 C57BL/6N-Ifitm1/H EMMA sperm mutant strain MGI:4432260 Ifitm1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915963 Ifitm1 interferon induced transmembrane protein 1 https://www.infrafrontier.eu/search?keyword=EM:10668 ? EM:13835 C57BL/6N-Ifih1/WtsiCnbc EMMA sperm mutant strain MGI:6153741 Ifih1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1918836 Ifih1 interferon induced with helicase C domain 1 https://www.infrafrontier.eu/search?keyword=EM:13835 ? EM:13916 C57BL/6N-Ifi44l/WtsiOulu EMMA embryo mutant strain MGI:6257644 Ifi44l endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:95975 Ifi44l interferon-induced protein 44 like https://www.infrafrontier.eu/search?keyword=EM:13916 ? EM:13916 C57BL/6N-Ifi44l/WtsiOulu EMMA sperm mutant strain MGI:6257644 Ifi44l endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:95975 Ifi44l interferon-induced protein 44 like https://www.infrafrontier.eu/search?keyword=EM:13916 + EM:10060 C57BL/6N-Ifi27l2a/Ieg EMMA sperm mutant strain MGI:5548678 Ifi27l2a targeted mutation 1.1, Velocigene MGI:1924183 Ifi27l2a interferon, alpha-inducible protein 27 like 2A https://www.infrafrontier.eu/search?keyword=EM:10060 ? EM:14311 C57BL/6N-Ifi27/WtsiCnbc EMMA archived mutant strain MGI:5636940 Ifi27 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1277180 Ifi27 interferon, alpha-inducible protein 27 https://www.infrafrontier.eu/search?keyword=EM:14311 ? EM:13781 C57BL/6N-Ifi207/WtsiIeg EMMA sperm mutant strain MGI:6153369 Ifi207 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2138302 Ifi207 interferon activated gene 207 https://www.infrafrontier.eu/search?keyword=EM:13781 + EM:09909 C57BL/6N-Idi1/Ieg EMMA sperm mutant strain MGI:4434753 Idi1 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:2442264 Idi1 isopentenyl-diphosphate delta isomerase https://www.infrafrontier.eu/search?keyword=EM:09909 ? EM:14175 C57BL/6N-Id2/WtsiOulu EMMA embryo mutant strain MGI:5796939 Id2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:96397 Id2 inhibitor of DNA binding 2 https://www.infrafrontier.eu/search?keyword=EM:14175 ? EM:14175 C57BL/6N-Id2/WtsiOulu EMMA sperm mutant strain MGI:5796939 Id2 targeted mutation 2b, Wellcome Trust Sanger Institute MGI:96397 Id2 inhibitor of DNA binding 2 https://www.infrafrontier.eu/search?keyword=EM:14175 + EM:11895 C57BL/6N-Icam5/WtsiH EMMA sperm mutant strain MGI:6153368 Icam5 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:109430 Icam5 intercellular adhesion molecule 5, telencephalin https://www.infrafrontier.eu/search?keyword=EM:11895 + EM:11344 C57BL/6N-Ica1l/Ieg EMMA sperm mutant strain MGI:5294183 Ica1l targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1917625 Ica1l islet cell autoantigen 1-like https://www.infrafrontier.eu/search?keyword=EM:11344 ? EM:13891 C57BL/6N-Iars/WtsiCnbc EMMA sperm mutant strain MGI:6153367 Iars endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2145219 Iars isoleucine-tRNA synthetase https://www.infrafrontier.eu/search?keyword=EM:13891 + EM:09238 C57BL/6N-Hunk/Ieg EMMA sperm mutant strain MGI:5613639 Hunk targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1347352 Hunk hormonally upregulated Neu-associated kinase https://www.infrafrontier.eu/search?keyword=EM:09238 + EM:08246 C57BL/6N-Hunk/Ieg EMMA embryo mutant strain MGI:5050999 Hunk targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1347352 Hunk hormonally upregulated Neu-associated kinase https://www.infrafrontier.eu/search?keyword=EM:08246 + EM:11594 C57BL/6N-Htra3/WtsiOulu EMMA embryo mutant strain MGI:6140200 Htra3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1925808 Htra3 HtrA serine peptidase 3 https://www.infrafrontier.eu/search?keyword=EM:11594 + EM:11594 C57BL/6N-Htra3/WtsiOulu EMMA sperm mutant strain MGI:6140200 Htra3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:1925808 Htra3 HtrA serine peptidase 3 https://www.infrafrontier.eu/search?keyword=EM:11594 ? EM:13744 C57BL/6N-Hspa13/WtsiOrl EMMA sperm mutant strain MGI:6153366 Hspa13 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1309463 Hspa13 heat shock protein 70 family, member 13 https://www.infrafrontier.eu/search?keyword=EM:13744 + EM:08066 C57BL/6N-Hsf2bp/Ieg EMMA sperm mutant strain MGI:5548644 Hsf2bp targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1921627 Hsf2bp heat shock transcription factor 2 binding protein https://www.infrafrontier.eu/search?keyword=EM:08066 + EM:11216 C57BL/6N-Hrnr/WtsiIeg EMMA sperm mutant strain MGI:6140199 Hrnr endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3046938 Hrnr hornerin https://www.infrafrontier.eu/search?keyword=EM:11216 + EM:04718 C57BL/6N-Hprt/Ieg EMMA embryo B6NTac;B6N-Hprt/Ieg mutant strain MGI:4435169 Hprt targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96217 Hprt hypoxanthine guanine phosphoribosyl transferase https://www.infrafrontier.eu/search?keyword=EM:04718 + EM:05414 C57BL/6N-Hprt/WtsiOulu EMMA embryo HPRT CMV Cre (CRET), C57BL/6N-Hprt/WtsiOulu mutant strain MGI:5496382 Hprt targeted mutation 1, Wellcome Trust Sanger Institute MGI:96217 Hprt hypoxanthine guanine phosphoribosyl transferase https://www.infrafrontier.eu/search?keyword=EM:05414 + EM:12647 C57BL/6N-Hpgd/H EMMA live mutant strain MGI:4946754 Hpgd targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:108085 Hpgd hydroxyprostaglandin dehydrogenase 15 (NAD) https://www.infrafrontier.eu/search?keyword=EM:12647 + EM:11150 C57BL/6N-Hpf1/WtsiH EMMA sperm mutant strain MGI:6153365 Hpf1 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1919862 Hpf1 histone PARylation factor 1 https://www.infrafrontier.eu/search?keyword=EM:11150 + EM:09237 C57BL/6N-Hoxa2/Ieg EMMA sperm mutant strain MGI:5613670 Hoxa2 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:96174 Hoxa2 homeobox A2 https://www.infrafrontier.eu/search?keyword=EM:09237 + EM:11030 C57BL/6N-Hoxa2/Ieg EMMA sperm mutant strain MGI:4455974 Hoxa2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:96174 Hoxa2 homeobox A2 https://www.infrafrontier.eu/search?keyword=EM:11030 + EM:09236 C57BL/6N-Hnf4a/Ieg EMMA sperm mutant strain MGI:5613635 Hnf4a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:109128 Hnf4a hepatic nuclear factor 4, alpha https://www.infrafrontier.eu/search?keyword=EM:09236 + EM:08243 C57BL/6N-Hnf4a/Ieg EMMA embryo mutant strain MGI:4455726 Hnf4a targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:109128 Hnf4a hepatic nuclear factor 4, alpha https://www.infrafrontier.eu/search?keyword=EM:08243 + EM:09305 C57BL/6N-Hipk3/Ieg EMMA embryo mutant strain MGI:5588270 Hipk3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1314882 Hipk3 homeodomain interacting protein kinase 3 https://www.infrafrontier.eu/search?keyword=EM:09305 + EM:09305 C57BL/6N-Hipk3/Ieg EMMA sperm mutant strain MGI:5588270 Hipk3 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1314882 Hipk3 homeodomain interacting protein kinase 3 https://www.infrafrontier.eu/search?keyword=EM:09305 + EM:09294 C57BL/6N-Hipk3/Ieg EMMA embryo mutant strain MGI:5289889 Hipk3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1314882 Hipk3 homeodomain interacting protein kinase 3 https://www.infrafrontier.eu/search?keyword=EM:09294 + EM:09294 C57BL/6N-Hipk3/Ieg EMMA sperm mutant strain MGI:5289889 Hipk3 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1314882 Hipk3 homeodomain interacting protein kinase 3 https://www.infrafrontier.eu/search?keyword=EM:09294 ? EM:14433 C57BL/6N-Hipk3/WtsiCnbc EMMA sperm mutant strain MGI:6153740 Hipk3 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1314882 Hipk3 homeodomain interacting protein kinase 3 https://www.infrafrontier.eu/search?keyword=EM:14433 - EM:05220 C57BL/6N-Hint1/H EMMA sperm mutant strain MGI:4433692 Hint1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1321133 Hint1 histidine triad nucleotide binding protein 1 https://www.infrafrontier.eu/search?keyword=EM:05220 ? EM:14503 C57BL/6N-Hibadh/WtsiH EMMA live mutant strain MGI:5637002 Hibadh targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1889802 Hibadh 3-hydroxyisobutyrate dehydrogenase https://www.infrafrontier.eu/search?keyword=EM:14503 - EM:07493 C57BL/6N-Hhipl1/H EMMA sperm B6NTac;B6N-Hhipl1/H mutant strain MGI:4451243 Hhipl1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1919265 Hhipl1 hedgehog interacting protein-like 1 https://www.infrafrontier.eu/search?keyword=EM:07493 + EM:10642 C57BL/6N-Hexb/H EMMA sperm mutant strain MGI:5050187 Hexb targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:96074 Hexb hexosaminidase B https://www.infrafrontier.eu/search?keyword=EM:10642 + EM:10257 C57BL/6N-Herc1/Wtsi EMMA archived mutant strain MGI:6153732 Herc1 endonuclease mediated mutation 3, Wellcome Trust Sanger Insititute MGI:2384589 Herc1 HECT and RLD domain containing E3 ubiquitin protein ligase family member 1 https://www.infrafrontier.eu/search?keyword=EM:10257 + EM:10246 C57BL/6N-Herc1/Wtsi EMMA archived mutant strain MGI:6102914 Herc1 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:2384589 Herc1 HECT and RLD domain containing E3 ubiquitin protein ligase family member 1 https://www.infrafrontier.eu/search?keyword=EM:10246 ? EM:14782 C57BL/6N-Hepacam/WtsiCnbc EMMA sperm mutant strain MGI:6153364 Hepacam endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:1920177 Hepacam hepatocyte cell adhesion molecule https://www.infrafrontier.eu/search?keyword=EM:14782 + EM:08093 C57BL/6N-Hells/Ieg EMMA sperm mutant strain MGI:5548365 Hells targeted mutation 1b, Wellcome Trust Sanger Institute MGI:106209 Hells helicase, lymphoid specific https://www.infrafrontier.eu/search?keyword=EM:08093 + EM:10450 C57BL/6N-Hecw1/H EMMA sperm mutant strain MGI:5511718 Hecw1 targeted mutation 2a, Helmholtz Zentrum Muenchen GmbH MGI:2444115 Hecw1 HECT, C2 and WW domain containing E3 ubiquitin protein ligase 1 https://www.infrafrontier.eu/search?keyword=EM:10450 ? EM:13842 C57BL/6N-Heatr9/WtsiCnbc EMMA sperm mutant strain MGI:6153363 Heatr9 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:3650286 Heatr9 HEAT repeat containing 9 https://www.infrafrontier.eu/search?keyword=EM:13842 + EM:10055 C57BL/6N-Hdac1/Ieg EMMA sperm mutant strain MGI:5548383 Hdac1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:108086 Hdac1 histone deacetylase 1 https://www.infrafrontier.eu/search?keyword=EM:10055 - EM:07870 C57BL/6N-Hcrtr2/H EMMA sperm mutant strain MGI:4456664 Hcrtr2 targeted mutation 1e, Wellcome Trust Sanger Institute MGI:2680765 Hcrtr2 hypocretin (orexin) receptor 2 https://www.infrafrontier.eu/search?keyword=EM:07870 ? EM:13694 C57BL/6N-Hba-x/WtsiCnrm EMMA live mutant strain MGI:6153362 Hba-x endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:96019 Hba-x hemoglobin X, alpha-like embryonic chain in Hba complex https://www.infrafrontier.eu/search?keyword=EM:13694 - EM:08190 C57BL/6N-Has1/H EMMA sperm B6NTac;B6N-Has1/H mutant strain MGI:4419868 Has1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:106590 Has1 hyaluronan synthase 1 https://www.infrafrontier.eu/search?keyword=EM:08190 ? EM:14594 C57BL/6N-Hapln4/WtsiPh EMMA sperm mutant strain MGI:6153361 Hapln4 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:2679531 Hapln4 hyaluronan and proteoglycan link protein 4 https://www.infrafrontier.eu/search?keyword=EM:14594 + EM:11163 C57BL/6N-Hao2/WtsiH EMMA sperm mutant strain MGI:6153360 Hao2 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:96012 Hao2 hydroxyacid oxidase 2 https://www.infrafrontier.eu/search?keyword=EM:11163 ? EM:14439 C57BL/6N-Hao1/WtsiCnbc EMMA sperm mutant strain MGI:6336055 Hao1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Insititute MGI:96011 Hao1 hydroxyacid oxidase 1, liver https://www.infrafrontier.eu/search?keyword=EM:14439 - EM:06138 C57BL/6N-Hace1/H EMMA sperm B6NTac;B6N-Hace1/H mutant strain MGI:4840984 Hace1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:2446110 Hace1 HECT domain and ankyrin repeat containing, E3 ubiquitin protein ligase 1 https://www.infrafrontier.eu/search?keyword=EM:06138 ? EM:14237 C57BL/6N-H2bl1/WtsiOulu EMMA embryo mutant strain MGI:5637040 H2bl1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916632 H2bl1 H2B.L histone variant 1 https://www.infrafrontier.eu/search?keyword=EM:14237 ? EM:14237 C57BL/6N-H2bl1/WtsiOulu EMMA sperm mutant strain MGI:5637040 H2bl1 targeted mutation 1b, Wellcome Trust Sanger Institute MGI:1916632 H2bl1 H2B.L histone variant 1 https://www.infrafrontier.eu/search?keyword=EM:14237 + EM:11584 C57BL/6N-H2ab3/WtsiOulu EMMA embryo C57BL/6N-H2afb3/WtsiOulu mutant strain MGI:6140198 H2ab3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3644875 H2ab3 H2A.B variant histone 3 https://www.infrafrontier.eu/search?keyword=EM:11584 + EM:11584 C57BL/6N-H2ab3/WtsiOulu EMMA sperm C57BL/6N-H2afb3/WtsiOulu mutant strain MGI:6140198 H2ab3 endonuclease mediated mutation 1, Wellcome Trust Sanger Institute MGI:3644875 H2ab3 H2A.B variant histone 3 https://www.infrafrontier.eu/search?keyword=EM:11584 ? EM:13826 C57BL/6N-H2-T24/WtsiOulu EMMA embryo mutant strain MGI:6153358 H2-T24 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95958 H2-T24 histocompatibility 2, T region locus 24 https://www.infrafrontier.eu/search?keyword=EM:13826 ? EM:13826 C57BL/6N-H2-T24/WtsiOulu EMMA sperm mutant strain MGI:6153358 H2-T24 endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:95958 H2-T24 histocompatibility 2, T region locus 24 https://www.infrafrontier.eu/search?keyword=EM:13826 ? EM:14789 C57BL/6N-Gzmf/WtsiCnbc EMMA sperm mutant strain MGI:6153357 Gzmf endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:109254 Gzmf granzyme F https://www.infrafrontier.eu/search?keyword=EM:14789 ? EM:14453 C57BL/6N-Gzme/WtsiCnbc EMMA sperm mutant strain MGI:6153356 Gzme endonuclease mediated mutation 1, Wellcome Trust Sanger Insititute MGI:109265 Gzme granzyme E https://www.infrafrontier.eu/search?keyword=EM:14453 ? EM:13387 C57BL/6N-Gzmd/WtsiCnrm EMMA live mutant strain MGI:5823220 Gzmd targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:109255 Gzmd granzyme D https://www.infrafrontier.eu/search?keyword=EM:13387 + EM:08810 C57BL/6N-Gtf2e2/H EMMA sperm mutant strain MGI:5008024 Gtf2e2 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1915403 Gtf2e2 general transcription factor II E, polypeptide 2 (beta subunit) https://www.infrafrontier.eu/search?keyword=EM:08810 ? EM:14596 C57BL/6N-Gtdc1/WtsiCnbc EMMA sperm mutant strain MGI:6281919 Gtdc1 endonuclease-mediated mutation 1, Wellcome Trust Sanger Institute MGI:2444269 Gtdc1 glycosyltransferase-like domain containing 1 https://www.infrafrontier.eu/search?keyword=EM:14596 + EM:04830 C57BL/6N-Gt(ROSA)26Sor/WtsiIeg EMMA embryo ROSA26 Fki, C57BL/6N-Gt(ROSA)26Sor/WtsiIeg mutant strain MGI:5496383 Gt(ROSA)26Sor targeted mutation 1, Wellcome Trust Sanger Institute MGI:104735 Gt(ROSA)26Sor gene trap ROSA 26, Philippe Soriano https://www.infrafrontier.eu/search?keyword=EM:04830 - EM:10234 C57BL/6N-Gstm6/Ieg EMMA sperm mutant strain MGI:6148222 Gstm6 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1309467 Gstm6 glutathione S-transferase, mu 6 https://www.infrafrontier.eu/search?keyword=EM:10234 + EM:08620 C57BL/6N-Gstm6/Ieg EMMA embryo mutant strain MGI:5287849 Gstm6 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1309467 Gstm6 glutathione S-transferase, mu 6 https://www.infrafrontier.eu/search?keyword=EM:08620 + EM:09516 C57BL/6N-Gsta4/Ieg EMMA sperm mutant strain MGI:5629310 Gsta4 targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:1309515 Gsta4 glutathione S-transferase, alpha 4 https://www.infrafrontier.eu/search?keyword=EM:09516 + EM:08599 C57BL/6N-Gsta4/Ieg EMMA embryo mutant strain MGI:5013788 Gsta4 targeted mutation 1a, Helmholtz Zentrum Muenchen GmbH MGI:1309515 Gsta4 glutathione S-transferase, alpha 4 https://www.infrafrontier.eu/search?keyword=EM:08599 - EM:11665 C57BL/6N-Gsk3a/Ieg EMMA sperm mutant strain MGI:5695125 Gsk3a targeted mutation 1b, Helmholtz Zentrum Muenchen GmbH MGI:2152453 Gsk3a glycogen synthase kinase 3 alpha https://www.infrafrontier.eu/search?keyword=EM:11665 - EM:05306 C57BL/6N-Gse1/H EMMA sperm mutant strain MGI:4455973 Gse1 targeted mutation 1a, Wellcome Trust Sanger Institute MGI:1098275 Gse1 genetic suppressor element 1, coiled-coil protein https://www.infrafrontier.eu/search?keyword=EM:05306 ? EM:14240 C57BL/6N-Grsf1/WtsiIeg EMMA sperm mutant strain MGI:5636902 Grsf1